From 79c334fd90bfed01e79850a6fa0e5555a96d9328 Mon Sep 17 00:00:00 2001 From: Hendry Sadrak Date: Wed, 11 Oct 2017 12:32:56 +0300 Subject: [PATCH 01/15] Add Awesome Hyper to readme.md (#2344) --- readme.md | 1 + 1 file changed, 1 insertion(+) diff --git a/readme.md b/readme.md index 6dcd70069df8..5c5c68a3599a 100644 --- a/readme.md +++ b/readme.md @@ -82,3 +82,4 @@ If you have issues in the `codesign` step when running `yarn run dist` on macOS, - [Website](website/) - [Sample Extension](https://github.com/zeit/hyperpower) - [Sample Theme](https://github.com/zeit/hyperyellow) +- [Awesome Hyper](https://github.com/bnb/awesome-hyper) From 28cab5e874939f81ed953d11366a46c339fe50ad Mon Sep 17 00:00:00 2001 From: Benjamin Staneck Date: Sat, 14 Oct 2017 00:08:32 +0200 Subject: [PATCH 02/15] Update electron to 1.7.9 (#2360) --- package.json | 2 +- yarn.lock | 6 +++--- 2 files changed, 4 insertions(+), 4 deletions(-) diff --git a/package.json b/package.json index 8b6a7441958f..1f3054baa5e6 100644 --- a/package.json +++ b/package.json @@ -146,7 +146,7 @@ "babel-preset-react": "6.24.1", "copy-webpack-plugin": "4.0.1", "cross-env": "5.0.5", - "electron": "1.7.8", + "electron": "1.7.9", "electron-builder": "19.27.2", "electron-builder-squirrel-windows": "19.25.0", "electron-devtools-installer": "2.2.0", diff --git a/yarn.lock b/yarn.lock index c760ee287fa9..0b123f811082 100644 --- a/yarn.lock +++ b/yarn.lock @@ -2114,9 +2114,9 @@ electron-rebuild@1.6.0: spawn-rx "^2.0.10" yargs "^7.0.2" -electron@1.7.8: - version "1.7.8" - resolved "https://registry.yarnpkg.com/electron/-/electron-1.7.8.tgz#27b791a6895171a7d52991b99442cdbd10a3539d" +electron@1.7.9: + version "1.7.9" + resolved "https://registry.yarnpkg.com/electron/-/electron-1.7.9.tgz#add54e9f8f83ed02f6519ec10135f698b19336cf" dependencies: "@types/node" "^7.0.18" electron-download "^3.0.1" From c73d7317af8c2d5fe5d0b8626f4b109489086d88 Mon Sep 17 00:00:00 2001 From: David Calhoun Date: Sun, 29 Oct 2017 19:06:17 -0500 Subject: [PATCH 03/15] Improve onUnload docs (#2409) Add missing reference to `onUnload` invocation during [plugin updates](https://github.com/zeit/hyper/blob/2.0.4/app/plugins.js#L111). --- website/index.html | 7 ++++--- 1 file changed, 4 insertions(+), 3 deletions(-) diff --git a/website/index.html b/website/index.html index 69bf969cde6e..9acefead4ef5 100644 --- a/website/index.html +++ b/website/index.html @@ -287,7 +287,7 @@ #content h3:before { content: '### '; } - + #content h4:before { content: '#### '; } @@ -925,7 +925,8 @@

Extensions API

onUnload Electron -

Invoked when a plugin is removed by the user.

+

Invoked when a plugin is removed by the user and during + plugin updates.

Parameters:

@@ -1242,7 +1243,7 @@

Module l

The user can hot-load and hot-reload plugins by pressing Command + R (refresh). Please strive to make plugins that don't require a complete restart of the application to work.

- +

Notice

Plugins affecting the `BrowserWindow` will the effect on new windows after hot-reload.

From 57166a57a2361894f8897630fff6d460e96aae3f Mon Sep 17 00:00:00 2001 From: ELLIOTTCABLE Date: Wed, 22 Nov 2017 04:19:33 -0600 Subject: [PATCH 04/15] =?UTF-8?q?Expose=20=E2=80=98true=20colour=E2=80=99?= =?UTF-8?q?=20support=20in=20$COLORTERM=20(#2478)?= MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit --- app/session.js | 1 + 1 file changed, 1 insertion(+) diff --git a/app/session.js b/app/session.js index 8ce1ba55d9b4..aaa09c07ee25 100644 --- a/app/session.js +++ b/app/session.js @@ -26,6 +26,7 @@ module.exports = class Session extends EventEmitter { const baseEnv = Object.assign({}, process.env, { LANG: app.getLocale().replace('-', '_') + '.UTF-8', TERM: 'xterm-256color', + COLORTERM: 'truecolor', TERM_PROGRAM: productName, TERM_PROGRAM_VERSION: version }, envFromConfig); From 4d7ce4375570a04f0cf15bf4e589a99940a4fcae Mon Sep 17 00:00:00 2001 From: CHaBou Date: Wed, 22 Nov 2017 14:28:40 +0100 Subject: [PATCH 05/15] =?UTF-8?q?Revert=20"Expose=20=E2=80=98true=20colour?= =?UTF-8?q?=E2=80=99=20support=20in=20$COLORTERM"=20(#2483)?= MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit This reverts commit 57166a57a2361894f8897630fff6d460e96aae3f. --- app/session.js | 1 - 1 file changed, 1 deletion(-) diff --git a/app/session.js b/app/session.js index aaa09c07ee25..8ce1ba55d9b4 100644 --- a/app/session.js +++ b/app/session.js @@ -26,7 +26,6 @@ module.exports = class Session extends EventEmitter { const baseEnv = Object.assign({}, process.env, { LANG: app.getLocale().replace('-', '_') + '.UTF-8', TERM: 'xterm-256color', - COLORTERM: 'truecolor', TERM_PROGRAM: productName, TERM_PROGRAM_VERSION: version }, envFromConfig); From 4ce99863c41054adf22f0eb89de4ed17427cbb65 Mon Sep 17 00:00:00 2001 From: Leo Lamprecht Date: Mon, 16 Apr 2018 07:17:17 -0700 Subject: [PATCH 06/15] Fixed merge conflicts --- .circleci/config.yml | 97 + .eslintignore | 10 + .github/issue_template.md | 8 +- .github/pull_request_template.md | 1 + .gitignore | 1 + .travis.yml | 4 +- .yarnrc | 2 +- PLUGINS.md | 199 + app/auto-updater-linux.js | 50 + app/auto-updater.js | 74 - app/commands.js | 118 + app/config.js | 111 +- app/config/config-default.js | 89 +- app/config/import.js | 48 +- app/config/init.js | 27 +- app/config/keymaps.js | 50 - app/config/open.js | 102 +- app/config/paths.js | 24 +- app/config/windows.js | 13 +- app/index.js | 250 +- app/keymaps/darwin.json | 80 +- app/keymaps/linux.json | 24 +- app/keymaps/win32.json | 31 +- app/menus/menu.js | 43 +- app/menus/menus/darwin.js | 7 +- app/menus/menus/edit.js | 110 +- app/menus/menus/help.js | 56 +- app/menus/menus/plugins.js | 2 +- app/menus/menus/shell.js | 46 +- app/menus/menus/view.js | 45 +- app/menus/menus/window.js | 60 +- app/notifications.js | 32 +- app/notify.js | 6 +- app/package.json | 24 +- app/plugins.js | 162 +- app/plugins/extensions.js | 48 +- app/plugins/install.js | 33 +- app/rpc.js | 2 - app/session.js | 27 +- app/system-context-menu.js | 56 +- app/ui/contextmenu.js | 27 + app/ui/window.js | 120 +- app/updater.js | 102 + app/utils/cli-install.js | 91 + {lib => app}/utils/colors.js | 17 +- app/utils/keymaps/find-command-by-keys.js | 5 - app/utils/keymaps/get-command.js | 6 - app/utils/keymaps/normalize.js | 13 - app/utils/map-keys.js | 41 + app/utils/to-electron-background-color.js | 9 +- app/utils/window-utils.js | 14 + app/yarn-error.log | 518 + app/yarn.lock | 126 +- appveyor.yml | 3 +- bin/yarn-standalone.js | 154543 ++++++++------- build/canary.icns | Bin 0 -> 160888 bytes build/canary.ico | Bin 0 -> 370070 bytes build/linux/after-install.tpl | 4 + build/linux/hyper | 34 + build/mac/hyper | 9 + build/win/hyper | 25 + build/win/hyper.cmd | 5 + circle.yml | 31 - cli/api.js | 127 + cli/index.js | 213 + jsconfig.json | 7 + lib/actions/config.js | 4 +- lib/actions/header.js | 8 +- lib/actions/notifications.js | 5 +- lib/actions/sessions.js | 8 +- lib/actions/term-groups.js | 6 +- lib/actions/ui.js | 91 +- lib/actions/updater.js | 11 +- lib/command-registry.js | 61 +- lib/component.js | 68 - lib/components/header.js | 299 +- lib/components/notification.js | 97 +- lib/components/notifications.js | 140 +- lib/components/split-pane.js | 211 +- lib/components/style-sheet.js | 144 + lib/components/tab.js | 292 +- lib/components/tabs.js | 165 +- lib/components/term-group.js | 86 +- lib/components/term.js | 612 +- lib/components/terms.js | 132 +- lib/constants/ui.js | 3 + lib/containers/header.js | 21 +- lib/containers/hyper.js | 174 +- lib/containers/notifications.js | 4 +- lib/containers/terms.js | 17 +- lib/hterm.js | 492 - lib/index.js | 71 +- lib/reducers/sessions.js | 56 +- lib/reducers/term-groups.js | 43 +- lib/reducers/ui.js | 292 +- lib/selectors.js | 5 +- lib/store/configure-store.dev.js | 20 +- lib/store/configure-store.prod.js | 11 +- lib/store/write-middleware.js | 2 +- lib/utils/file.js | 6 +- lib/utils/key-code.js | 79 - lib/utils/keymaps.js | 34 - lib/utils/notify.js | 1 + lib/utils/paste.js | 21 + lib/utils/plugins.js | 116 +- lib/utils/rpc.js | 2 - lib/utils/selection.js | 6 +- lib/utils/url-command.js | 2 +- license.md | 2 +- package.json | 214 +- readme.md | 29 +- release.js | 11 +- .../unit/keymaps-find-command-by-keys.test.js | 64 - test/unit/keymaps-normalize.test.js | 22 - .../unit/to-electron-background-color.test.js | 46 +- test/unit/window-utils.test.js | 88 + webpack.config.js | 118 +- website/favicon.png | Bin 3003 -> 0 bytes website/index.html | 1686 - website/package-lock.json | 1196 - website/package.json | 14 - website/readme.md | 10 - website/static/apple-logo.svg | 3 - website/static/arrow.svg | 10 - website/static/card.png | Bin 21326 -> 0 bytes website/static/download-icon.svg | 14 - website/static/hyper.png | Bin 33099 -> 0 bytes website/static/hyperyellow.gif | Bin 187586 -> 0 bytes website/static/linux-logo.svg | 7 - website/static/windows-logo.svg | 3 - website/updates.json | 3 - yarn-error.log | 7075 + yarn.lock | 3229 +- 133 files changed, 98733 insertions(+), 77291 deletions(-) create mode 100644 .circleci/config.yml create mode 100644 .eslintignore create mode 100644 PLUGINS.md create mode 100644 app/auto-updater-linux.js delete mode 100644 app/auto-updater.js create mode 100644 app/commands.js delete mode 100644 app/config/keymaps.js create mode 100644 app/ui/contextmenu.js create mode 100644 app/updater.js create mode 100644 app/utils/cli-install.js rename {lib => app}/utils/colors.js (55%) delete mode 100644 app/utils/keymaps/find-command-by-keys.js delete mode 100644 app/utils/keymaps/get-command.js delete mode 100644 app/utils/keymaps/normalize.js create mode 100644 app/utils/map-keys.js create mode 100644 app/utils/window-utils.js create mode 100644 app/yarn-error.log create mode 100644 build/canary.icns create mode 100644 build/canary.ico create mode 100644 build/linux/after-install.tpl create mode 100755 build/linux/hyper create mode 100755 build/mac/hyper create mode 100755 build/win/hyper create mode 100755 build/win/hyper.cmd delete mode 100644 circle.yml create mode 100644 cli/api.js create mode 100644 cli/index.js create mode 100644 jsconfig.json delete mode 100644 lib/component.js create mode 100644 lib/components/style-sheet.js delete mode 100644 lib/hterm.js delete mode 100644 lib/utils/key-code.js delete mode 100644 lib/utils/keymaps.js create mode 100644 lib/utils/paste.js delete mode 100644 test/unit/keymaps-find-command-by-keys.test.js delete mode 100644 test/unit/keymaps-normalize.test.js create mode 100644 test/unit/window-utils.test.js delete mode 100644 website/favicon.png delete mode 100644 website/index.html delete mode 100644 website/package-lock.json delete mode 100644 website/package.json delete mode 100644 website/readme.md delete mode 100644 website/static/apple-logo.svg delete mode 100644 website/static/arrow.svg delete mode 100644 website/static/card.png delete mode 100644 website/static/download-icon.svg delete mode 100644 website/static/hyper.png delete mode 100644 website/static/hyperyellow.gif delete mode 100644 website/static/linux-logo.svg delete mode 100644 website/static/windows-logo.svg delete mode 100644 website/updates.json create mode 100644 yarn-error.log diff --git a/.circleci/config.yml b/.circleci/config.yml new file mode 100644 index 000000000000..bc7e8194de04 --- /dev/null +++ b/.circleci/config.yml @@ -0,0 +1,97 @@ +version: 2 +jobs: + install: + macos: + xcode: "9.2.0" + working_directory: ~/repo + steps: + - checkout + - restore_cache: + key: cache-{{ checksum "yarn.lock" }} + - run: + name: Installing Dependencies + command: yarn --ignore-engines + - save_cache: + key: cache-{{ checksum "yarn.lock" }} + paths: + - node_modules + - run: + name: Getting build icon + command: if [[ $CIRCLE_BRANCH == canary ]]; then cp build/canary.icns build/icon.icns; fi + - persist_to_workspace: + root: . + paths: + - node_modules + + test: + macos: + xcode: "9.2.0" + steps: + - checkout + - attach_workspace: + at: . + - run: + name: Testing + command: yarn test + + build: + macos: + xcode: "9.2.0" + steps: + - checkout + - attach_workspace: + at: . + - run: + name: Building + command: yarn dist --publish 'never' + - store_artifacts: + path: dist + - persist_to_workspace: + root: . + paths: + - dist + + release: + macos: + xcode: "9.2.0" + steps: + - checkout + - attach_workspace: + at: . + - run: + name: Deploying to GitHub + command: yarn dist + + +workflows: + version: 2 + build: + jobs: + - install: + filters: + tags: + only: /.*/ + - test: + requires: + - install + filters: + tags: + only: /.*/ + - build: + requires: + - test + filters: + branches: + only: + - master + - canary + tags: + ignore: /.*/ + - release: + requires: + - test + filters: + tags: + only: /.*/ + branches: + ignore: /.*/ diff --git a/.eslintignore b/.eslintignore new file mode 100644 index 000000000000..9344d5aff15f --- /dev/null +++ b/.eslintignore @@ -0,0 +1,10 @@ +build +app/renderer +app/static +app/bin +app/dist +app/node_modules +assets +website +bin +dist \ No newline at end of file diff --git a/.github/issue_template.md b/.github/issue_template.md index dce168767821..b7bef5b2d7fb 100644 --- a/.github/issue_template.md +++ b/.github/issue_template.md @@ -1,7 +1,7 @@ @@ -10,7 +10,7 @@ - [ ] I am on the [latest](https://github.com/zeit/hyper/releases/latest) Hyper.app version - [ ] I have searched the [issues](https://github.com/zeit/hyper/issues) of this repo and believe that this is not a duplicate - @@ -18,7 +18,7 @@ - **OS version and name**: - **Hyper.app version**: - **Link of a [Gist](https://gist.github.com/) with the contents of your .hyper.js**: -- **Relevant information from devtools** _(CMD+ALT+I on Mac OS, CTRL+SHIFT+I elsewhere)_: +- **Relevant information from devtools** _(CMD+ALT+I on macOS, CTRL+SHIFT+I elsewhere)_: - **The issue is reproducible in vanilla Hyper.app**: ## Issue diff --git a/.github/pull_request_template.md b/.github/pull_request_template.md index dd4bd28fdb33..9d8542bdc9bf 100644 --- a/.github/pull_request_template.md +++ b/.github/pull_request_template.md @@ -3,5 +3,6 @@ - To help whoever reviews your PR, it'd be extremely helpful for you to list whether your PR is ready to be merged, If there's anything left to do and if there are any related PRs - It'd also be extremely helpful to enable us to update your PR incase we need to rebase or what-not by checking `Allow edits from maintainers` +- If your PR changes some API, please make a PR for hyper website too: https://github.com/zeit/hyper-site. Thanks, again! --> diff --git a/.gitignore b/.gitignore index be68f684e6e2..b2887952d29c 100644 --- a/.gitignore +++ b/.gitignore @@ -1,6 +1,7 @@ # build output dist app/renderer +bin/cli.* # dependencies node_modules diff --git a/.travis.yml b/.travis.yml index 7fa5d17c1946..de932ac0546c 100644 --- a/.travis.yml +++ b/.travis.yml @@ -6,7 +6,7 @@ language: node_js matrix: include: - os: linux - node_js: 8.4.0 + node_js: 8 env: CC=clang CXX=clang++ npm_config_clang=1 compiler: clang @@ -25,7 +25,6 @@ addons: before_install: - if [[ "$TRAVIS_OS_NAME" == "linux" ]]; then export DISPLAY=:99.0; sh -e /etc/init.d/xvfb start; sleep 3; fi - - npm install -g yarn cache: yarn @@ -33,6 +32,7 @@ install: - yarn after_success: + - (git branch --contains $TRAVIS_COMMIT | grep canary > /dev/null || [[ "$TRAVIS_BRANCH" == "canary" ]] ) && (cd build; cp canary.icns icon.icns; cp canary.ico icon.ico) - yarn run dist branches: diff --git a/.yarnrc b/.yarnrc index 95b8581eaaff..3d567722c364 100644 --- a/.yarnrc +++ b/.yarnrc @@ -1 +1 @@ -save-prefix false +save-exact true diff --git a/PLUGINS.md b/PLUGINS.md new file mode 100644 index 000000000000..645d3555951c --- /dev/null +++ b/PLUGINS.md @@ -0,0 +1,199 @@ +# Plugin development + +## Workflow + +### Run Hyper in dev mode +Hyper can be run in dev mode by cloning this repository and following the ["Contributing" section of our README](https://github.com/zeit/hyper#contribute). + +In dev mode you'll get more ouput and access to React/Redux dev-tools in Electron. + +Prerequisites and steps are described in the ["Contributing" section of our README](https://github.com/zeit/hyper#contribute). +Be sure to use the `canary` branch. + +### Create a dev config file +Copy your config file `.hyper.js` to the root of your cloned repository. Hyper, in dev mode, will use this copied config file. That means that you can continue to use your main installation of Hyper with your day-to-day configuration. +After the first run, Hyper, in dev mode, will have created a new `.hyper_plugins` directory in your repository directory. + +### Setup your plugin +Go to your recently created `/.hyper_plugins/local` directory and create/clone your plugin repo. An even better method on macOS/Linux is to add a symlink to your plugin directory. + +Edit your dev config file, and add your plugin name (directory name in your `local` directory) in the `localPlugins` array. +```js +module.exports = { + config: { + ... + }, + plugins: [], + localPlugins: ['hyper-awesome-plugin'], + ... +} +``` + +### Running your plugin +To load, your plugin should expose at least one API method. All possible methods are listed [here](https://github.com/zeit/hyper/blob/canary/app/plugins/extensions.js). + +After launching Hyper in dev mode, run `yarn run app`, it should log that your plugin has been correcty loaded: `Plugin hyper-awesome-plugin (0.1.0) loaded.`. Name and version printed are the ones in your plugins `package.json` file. + +When you put a `console.log()` in your plugin code, it will be displayed in the Electron dev-tools, but only if it is located in a renderer method, like component decorators. If it is located in the Electron main process method, like the `onApp` handler, it will be displayed in your terminal where you ran `yarn run app` or in your VSCode console. + +## Recipes +Almost all available API methods can be found on https://www.hyper.is. +If there's any missing, let us know or submit a PR to document it! + +### Components +You can decorate almost all Hyper components with a Higher-Order Component (HOC). To understand their architecture, the easiest way is to use React dev-tools to dig in to their hierachy. + +Multiple plugins can decorate the same Hyper component. Thus, `Component` passed as first argument to your decorator function could possibly not be an original Hyper component but a HOC of a previous plugin. If you need to retrieve a reference to a real Hyper component, you can pass down a `onDecorated` handler. +```js +exports.decorateTerms = (Terms, {React}) => { + return class extends React.Component { + constructor(props, context) { + super(props, context); + this.terms = null; + this.onDecorated = this.onDecorated.bind(this); + } + + onDecorated(terms) { + this.terms = terms; + // Don't forget to propagate it to HOC chain + if (this.props.onDecorated) this.props.onDecorated(terms); + } + + render() { + return React.createElement( + Terms, + Object.assign({}, this.props, { + onDecorated: this.onDecorated + }) + ); + // Or if you use JSX: + // + } + } +``` +:warning: Note that you have to execute `this.props.onDecorated` to not break the handler chain. Without this, you could break other plugins that decorate the same component. + +### Keymaps +If you want to add some keymaps, you need to do 2 things: + +#### Declare your key bindings +Use the `decorateKeymaps` API handler to modify existing keymaps and add yours with the following format `command: hotkeys`. +```js +// Adding Keymaps +exports.decorateKeymaps = keymaps => { + const newKeymaps = { + 'pane:maximize': 'ctrl+shift+m', + 'pane:invert': 'ctrl+shift+i' + } + return Object.assign({}, keymaps, newKeymaps); +} +``` +The command name can be whatever you want, but the following is better to respect the default naming convention: `:`. +Hotkeys are composed by (Mousetrap supported keys)[https://craig.is/killing/mice#keys]. + +**Bonus feature**: if your command ends with `:prefix`, it would mean that you want to use this command with an additional digit to the command. Then Hyper will create all your commands under the hood. For example, this keymap `'pane:hide:prefix': 'ctrl+shift'` will automatically generate the following: +``` +{ + 'pane:hide:1': 'ctrl+shift+1', + 'pane:hide:2': 'ctrl+shift+2', + ... + 'pane:hide:8': 'ctrl+shift+8', + 'pane:hide:last': 'ctrl+shift+9' +} +``` +Notice that `9` has been replaced by `last` because most of the time this is handy if you have more than 9 items. + + +#### Register a handler for your commands +##### Renderer/Window +Most of time, you'll want to execute some sort of handler in context of the renderer, like dispatching a Redux action. +To trigger these handlers, you'll have to register them with the `registerCommands` Terms method. +```js +this.terms.registerCommands({ + 'pane:maximize': e => { + this.props.onMaximizePane(); + // e parameter is React key event + e.preventDefault(); + } +}) +``` + +##### Main process +If there is no handler in the renderer for an existing command, an `rpc` message is emitted. +If you want to execute a handler in main process you have to subscribe to a message, for example: +```js +rpc.on('command pane:snapshot', () => { + /* Awesome snapshot feature */ +}); +``` + +### Menu +Your plugin can expose a `decorateMenu` function to modify the Hyper menu template. +Check the (Electron documentation)[https://electronjs.org/docs/api/menu-item] for more details about the different menu item types/options available. + +Be careful, a click handler will be executed on the main process. If you need to trigger a handler in the render process you need to use an `rpc` message like this: +```js +exports.decorateMenu = (menu) => { + debug('decorateMenu'); + const isMac = process.platform === 'darwin'; + // menu label is different on mac + const menuLabel = isMac ? 'Shell' : 'File'; + + return menu.map(menuCategory => { + if (menuCategory.label !== menuLabel) { + return menuItem; + } + return [ + ...menuCategory, + { + type: 'separator' + }, + { + label: 'Clear all panes in all tabs', + accelerator: 'ctrl+shift+y', + click(item, focusedWindow) { + // on macOS, menu item can clicked without or minized window + if (focusedWindow) { + focusedWindow.rpc.emit('clear allPanes'); + } + } + } + ] + }); +} +/* Plugin needs to register a rpc handler on renderer side for example in a Terms HOC*/ +exports.decorateTerms = (Terms, { React }) => { + return class extends React.Component { + componentDidMount() { + window.rpc.on('clear allPanes',() => { + /* Awesome plugin feature */ + }) + } + } +} +``` + +### Cursor +If your plugin needs to know cursor position/size, it can decorate the Term component and pass a handler. This handler will be called with each cursor move while passing back all information about the cursor. +```js +exports.decorateTerm = (Term, { React, notify }) => { + // Define and return our higher order component. + return class extends React.Component { + onCursorMove (cursorFrame) { + // Don't forget to propagate it to HOC chain + if (this.props.onCursorMove) this.props.onCursorMove(cursorFrame); + + const { x, y, width, height, col, row } = cursorFrame; + /* Awesome cursor feature */ + } + } +} +``` + +## Hyper v2 breaking changes +Hyper v2 uses `xterm.js` instead of `hterm`. It means that PTY ouput renders now in a canvas element, not with a hackable DOM structure. +For example, plugins can't use TermCSS in order to modify text or link styles anymore. It is now required to use available configuration params that are passed down to `xterm.js`. + +If your plugin was deeply linked with the `hterm` API (even public methods), it certainly doesn't work anymore. + +If your plugin needs some unavailable API to tweak `xterm.js`, please open an issue. We'll be happy to expose some existing `xterm.js` API or implement new ones. diff --git a/app/auto-updater-linux.js b/app/auto-updater-linux.js new file mode 100644 index 000000000000..80c2b057da01 --- /dev/null +++ b/app/auto-updater-linux.js @@ -0,0 +1,50 @@ +'use strict'; + +const fetch = require('node-fetch'); +const {EventEmitter} = require('events'); + +class AutoUpdater extends EventEmitter { + quitAndInstall() { + this.emitError('QuitAndInstall unimplemented'); + } + getFeedURL() { + return this.updateURL; + } + + setFeedURL(updateURL) { + this.updateURL = updateURL; + } + + checkForUpdates() { + if (!this.updateURL) { + return this.emitError('Update URL is not set'); + } + this.emit('checking-for-update'); + + fetch(this.updateURL) + .then(res => { + if (res.status === 204) { + return this.emit('update-not-available'); + } + return res.json().then(({name, notes, pub_date}) => { + // Only name is mandatory, needed to construct release URL. + if (!name) { + throw new Error('Malformed server response: release name is missing.'); + } + // If `null` is passed to Date constructor, current time will be used. This doesn't work with `undefined` + const date = new Date(pub_date || null); + this.emit('update-available', {}, notes, name, date); + }); + }) + .catch(this.emitError.bind(this)); + } + + emitError(error) { + if (typeof error === 'string') { + error = new Error(error); + } + this.emit('error', error, error.message); + } +} + +module.exports = new AutoUpdater(); diff --git a/app/auto-updater.js b/app/auto-updater.js deleted file mode 100644 index 846d1cf9c180..000000000000 --- a/app/auto-updater.js +++ /dev/null @@ -1,74 +0,0 @@ -// Packages -const {autoUpdater} = require('electron'); -const ms = require('ms'); -const retry = require('async-retry'); - -// Utilities -const notify = require('./notify'); // eslint-disable-line no-unused-vars -const {version} = require('./package'); -const {getConfig} = require('./config'); - -const {platform} = process; - -let isInit = false; - -async function init() { - autoUpdater.on('error', (err, msg) => { - console.error('Error fetching updates', msg + ' (' + err.stack + ')'); - }); - - const config = await retry(async () => { - const content = await getConfig(); - - if (!content) { - throw new Error('No config content loaded'); - } - - return content; - }); - - // Default to the "stable" update channel - let canaryUpdates = false; - - // If defined in the config, switch to the "canary" channel - if (config.updateChannel && config.updateChannel === 'canary') { - canaryUpdates = true; - } - - const updatePrefix = canaryUpdates ? 'releases-canary' : 'releases'; - const feedURL = `https://${updatePrefix}.hyper.is/update/${platform}`; - - autoUpdater.setFeedURL(`${feedURL}/${version}`); - - setTimeout(() => { - autoUpdater.checkForUpdates(); - }, ms('10s')); - - setInterval(() => { - autoUpdater.checkForUpdates(); - }, ms('30m')); - - isInit = true; -} - -module.exports = function (win) { - if (!isInit) { - init(); - } - - const {rpc} = win; - - const onupdate = (ev, releaseNotes, releaseName) => { - rpc.emit('update available', {releaseNotes, releaseName}); - }; - - autoUpdater.on('update-downloaded', onupdate); - - rpc.once('quit and install', () => { - autoUpdater.quitAndInstall(); - }); - - win.on('close', () => { - autoUpdater.removeListener('update-downloaded', onupdate); - }); -}; diff --git a/app/commands.js b/app/commands.js new file mode 100644 index 000000000000..ad848260fc4f --- /dev/null +++ b/app/commands.js @@ -0,0 +1,118 @@ +const {app} = require('electron'); +const {openConfig} = require('./config'); +const {updatePlugins} = require('./plugins'); + +const commands = { + 'window:new': () => { + // If window is created on the same tick, it will consume event too + setTimeout(app.createWindow, 0); + }, + 'tab:new': focusedWindow => { + if (focusedWindow) { + focusedWindow.rpc.emit('termgroup add req'); + } else { + setTimeout(app.createWindow, 0); + } + }, + 'pane:splitVertical': focusedWindow => { + focusedWindow && focusedWindow.rpc.emit('split request vertical'); + }, + 'pane:splitHorizontal': focusedWindow => { + focusedWindow && focusedWindow.rpc.emit('split request horizontal'); + }, + 'pane:close': focusedWindow => { + focusedWindow && focusedWindow.rpc.emit('termgroup close req'); + }, + 'window:preferences': () => { + openConfig(); + }, + 'editor:clearBuffer': focusedWindow => { + focusedWindow && focusedWindow.rpc.emit('session clear req'); + }, + 'editor:selectAll': focusedWindow => { + focusedWindow.rpc.emit('term selectAll'); + }, + 'plugins:update': () => { + updatePlugins(); + }, + 'window:reload': focusedWindow => { + focusedWindow && focusedWindow.rpc.emit('reload'); + }, + 'window:reloadFull': focusedWindow => { + focusedWindow && focusedWindow.reload(); + }, + 'window:devtools': focusedWindow => { + if (!focusedWindow) { + return; + } + const webContents = focusedWindow.webContents; + if (webContents.isDevToolsOpened()) { + webContents.closeDevTools(); + } else { + webContents.openDevTools({mode: 'detach'}); + } + }, + 'zoom:reset': focusedWindow => { + focusedWindow && focusedWindow.rpc.emit('reset fontSize req'); + }, + 'zoom:in': focusedWindow => { + focusedWindow && focusedWindow.rpc.emit('increase fontSize req'); + }, + 'zoom:out': focusedWindow => { + focusedWindow && focusedWindow.rpc.emit('decrease fontSize req'); + }, + 'tab:prev': focusedWindow => { + focusedWindow && focusedWindow.rpc.emit('move left req'); + }, + 'tab:next': focusedWindow => { + focusedWindow && focusedWindow.rpc.emit('move right req'); + }, + 'pane:prev': focusedWindow => { + focusedWindow && focusedWindow.rpc.emit('prev pane req'); + }, + 'pane:next': focusedWindow => { + focusedWindow && focusedWindow.rpc.emit('next pane req'); + }, + 'editor:movePreviousWord': focusedWindow => { + focusedWindow && focusedWindow.rpc.emit('session move word left req'); + }, + 'editor:moveNextWord': focusedWindow => { + focusedWindow && focusedWindow.rpc.emit('session move word right req'); + }, + 'editor:moveBeginningLine': focusedWindow => { + focusedWindow && focusedWindow.rpc.emit('session move line beginning req'); + }, + 'editor:moveEndLine': focusedWindow => { + focusedWindow && focusedWindow.rpc.emit('session move line end req'); + }, + 'editor:deletePreviousWord': focusedWindow => { + focusedWindow && focusedWindow.rpc.emit('session del word left req'); + }, + 'editor:deleteNextWord': focusedWindow => { + focusedWindow && focusedWindow.rpc.emit('session del word right req'); + }, + 'editor:deleteBeginningLine': focusedWindow => { + focusedWindow && focusedWindow.rpc.emit('session del line beginning req'); + }, + 'editor:deleteEndLine': focusedWindow => { + focusedWindow && focusedWindow.rpc.emit('session del line end req'); + }, + 'editor:break': focusedWindow => { + focusedWindow && focusedWindow.rpc.emit('session break req'); + } +}; + +//Special numeric command +[1, 2, 3, 4, 5, 6, 7, 8, 'last'].forEach(cmdIndex => { + const index = cmdIndex === 'last' ? cmdIndex : cmdIndex - 1; + commands[`tab:jump:${cmdIndex}`] = focusedWindow => { + focusedWindow && focusedWindow.rpc.emit('move jump req', index); + }; +}); + +exports.execCommand = (command, focusedWindow) => { + const fn = commands[command]; + if (fn) { + fn(focusedWindow); + } +}; diff --git a/app/config.js b/app/config.js index 94a5be3e0b3b..6c2a80a314a0 100644 --- a/app/config.js +++ b/app/config.js @@ -1,85 +1,154 @@ const fs = require('fs'); const notify = require('./notify'); -const _import = require('./config/import'); +const {_import, getDefaultConfig} = require('./config/import'); const _openConfig = require('./config/open'); const win = require('./config/windows'); const {cfgPath, cfgDir} = require('./config/paths'); +const {getColorMap} = require('./utils/colors'); const watchers = []; let cfg = {}; let _watcher; -const _watch = function () { +const _watch = function() { if (_watcher) { return _watcher; } const onChange = () => { - cfg = _import(); - notify('Configuration updated', 'Hyper configuration reloaded!'); - watchers.forEach(fn => fn()); + // Need to wait 100ms to ensure that write is complete + setTimeout(() => { + cfg = _import(); + notify('Configuration updated', 'Hyper configuration reloaded!'); + watchers.forEach(fn => fn()); + checkDeprecatedConfig(); + }, 100); }; + // Windows if (process.platform === 'win32') { - // watch for changes on config every 2s on windows + // watch for changes on config every 2s on Windows // https://github.com/zeit/hyper/pull/1772 _watcher = fs.watchFile(cfgPath, {interval: 2000}, (curr, prev) => { if (curr.mtime === 0) { + //eslint-disable-next-line no-console console.error('error watching config'); } else if (curr.mtime !== prev.mtime) { onChange(); } }); - } else { - _watcher = fs.watch(cfgPath); + return; + } + // macOS/Linux + setWatcher(); + function setWatcher() { + try { + _watcher = fs.watch(cfgPath, eventType => { + if (eventType === 'rename') { + _watcher.close(); + // Ensure that new file has been written + setTimeout(() => setWatcher(), 500); + } + }); + } catch (e) { + //eslint-disable-next-line no-console + console.error('Failed to watch config file:', cfgPath, e); + return; + } _watcher.on('change', onChange); _watcher.on('error', error => { + //eslint-disable-next-line no-console console.error('error watching config', error); }); } }; -exports.subscribe = function (fn) { +exports.subscribe = fn => { watchers.push(fn); return () => { watchers.splice(watchers.indexOf(fn), 1); }; }; -exports.getConfigDir = function () { +exports.getConfigDir = () => { // expose config directory to load plugin from the right place return cfgDir; }; -exports.getConfig = function () { +exports.getConfig = () => { return cfg.config; }; -exports.openConfig = function () { +exports.openConfig = () => { return _openConfig(); }; -exports.getPlugins = function () { +exports.getPlugins = () => { return { plugins: cfg.plugins, localPlugins: cfg.localPlugins }; }; -exports.getKeymaps = function () { +exports.getKeymaps = () => { return cfg.keymaps; }; -exports.extendKeymaps = function (keymaps) { - if (keymaps) { - cfg.keymaps = keymaps; - } -}; - -exports.setup = function () { +exports.setup = () => { cfg = _import(); _watch(); + checkDeprecatedConfig(); }; exports.getWin = win.get; exports.winRecord = win.recordState; +exports.windowDefaults = win.defaults; + +const getDeprecatedCSS = function(config) { + const deprecated = []; + const deprecatedCSS = ['x-screen', 'x-row', 'cursor-node', '::selection']; + deprecatedCSS.forEach(css => { + if ((config.css && config.css.indexOf(css) !== -1) || (config.termCSS && config.termCSS.indexOf(css) !== -1)) { + deprecated.push(css); + } + }); + return deprecated; +}; +exports.getDeprecatedCSS = getDeprecatedCSS; + +const checkDeprecatedConfig = function() { + if (!cfg.config) { + return; + } + const deprecated = getDeprecatedCSS(cfg.config); + if (deprecated.length === 0) { + return; + } + const deprecatedStr = deprecated.join(', '); + notify('Configuration warning', `Your configuration uses some deprecated CSS classes (${deprecatedStr})`); +}; + +exports.fixConfigDefaults = decoratedConfig => { + const defaultConfig = getDefaultConfig().config; + decoratedConfig.colors = getColorMap(decoratedConfig.colors) || {}; + // We must have default colors for xterm css. + decoratedConfig.colors = Object.assign({}, defaultConfig.colors, decoratedConfig.colors); + return decoratedConfig; +}; + +exports.htermConfigTranslate = config => { + const cssReplacements = { + 'x-screen x-row([ {.[])': '.xterm-rows > div$1', + '.cursor-node([ {.[])': '.terminal-cursor$1', + '::selection([ {.[])': '.terminal .xterm-selection div$1', + 'x-screen a([ {.[])': '.terminal a$1', + 'x-row a([ {.[])': '.terminal a$1' + }; + Object.keys(cssReplacements).forEach(pattern => { + const searchvalue = new RegExp(pattern, 'g'); + const newvalue = cssReplacements[pattern]; + config.css = config.css && config.css.replace(searchvalue, newvalue); + config.termCSS = config.termCSS && config.termCSS.replace(searchvalue, newvalue); + }); + return config; +}; diff --git a/app/config/config-default.js b/app/config/config-default.js index 1c33036cf44b..e75b7ca38dd6 100644 --- a/app/config/config-default.js +++ b/app/config/config-default.js @@ -4,8 +4,8 @@ module.exports = { config: { - // Choose either "stable" for receiving highly polished, - // or "canary" for less polished but more frequent updates + // choose either `'stable'` for receiving highly polished, + // or `'canary'` for less polished but more frequent updates updateChannel: 'stable', // default font size in pixels for all tabs @@ -14,41 +14,53 @@ module.exports = { // font family with optional fallbacks fontFamily: 'Menlo, "DejaVu Sans Mono", Consolas, "Lucida Console", monospace', + // default font weight: 'normal' or 'bold' + fontWeight: 'normal', + + // font weight for bold characters: 'normal' or 'bold' + fontWeightBold: 'bold', + // terminal cursor background color and opacity (hex, rgb, hsl, hsv, hwb or cmyk) cursorColor: 'rgba(248,28,229,0.8)', - // `BEAM` for |, `UNDERLINE` for _, `BLOCK` for █ + // terminal text color under BLOCK cursor + cursorAccentColor: '#000', + + // `'BEAM'` for |, `'UNDERLINE'` for _, `'BLOCK'` for █ cursorShape: 'BLOCK', - // set to true for blinking cursor + // set to `true` (without backticks and without quotes) for blinking cursor cursorBlink: false, // color of the text foregroundColor: '#fff', // terminal background color + // opacity is only supported on macOS backgroundColor: '#000', + // terminal selection color + selectionColor: 'rgba(248,28,229,0.3)', + // border color (window, tabs) borderColor: '#333', - // custom css to embed in the main window + // custom CSS to embed in the main window css: '', - // custom css to embed in the terminal window + // custom CSS to embed in the terminal window termCSS: '', - // set to `true` (without backticks and without quotes) if you're using a - // Linux setup that doesn't show native menus - // default: `false` on Linux, `true` on Windows (ignored on macOS) + // if you're using a Linux setup which show native menus, set to false + // default: `true` on Linux, `true` on Windows, ignored on macOS showHamburgerMenu: '', - // set to `false` if you want to hide the minimize, maximize and close buttons + // set to `false` (without backticks and without quotes) if you want to hide the minimize, maximize and close buttons // additionally, set to `'left'` if you want them on the left, like in Ubuntu - // default: `true` on windows and Linux (ignored on macOS) + // default: `true` (without backticks and without quotes) on Windows and Linux, ignored on macOS showWindowControls: '', - // custom padding (css format, i.e.: `top right bottom left`) + // custom padding (CSS format, i.e.: `top right bottom left`) padding: '12px 14px', // the full list. if you're going to provide the full color palette, @@ -56,21 +68,21 @@ module.exports = { // an array here instead of a color map object colors: { black: '#000000', - red: '#ff0000', - green: '#33ff00', - yellow: '#ffff00', - blue: '#0066ff', - magenta: '#cc00ff', - cyan: '#00ffff', - white: '#d0d0d0', - lightBlack: '#808080', - lightRed: '#ff0000', - lightGreen: '#33ff00', - lightYellow: '#ffff00', - lightBlue: '#0066ff', - lightMagenta: '#cc00ff', - lightCyan: '#00ffff', - lightWhite: '#ffffff' + red: '#C51E14', + green: '#1DC121', + yellow: '#C7C329', + blue: '#0A2FC4', + magenta: '#C839C5', + cyan: '#20C5C6', + white: '#C7C7C7', + lightBlack: '#686868', + lightRed: '#FD6F6B', + lightGreen: '#67F86F', + lightYellow: '#FFFA72', + lightBlue: '#6A76FB', + lightMagenta: '#FD7CFC', + lightCyan: '#68FDFE', + lightWhite: '#FFFFFF', }, // the shell to run when spawning a new session (i.e. /usr/local/bin/fish) @@ -83,26 +95,29 @@ module.exports = { // Bash on Windows // - Example: `C:\\Windows\\System32\\bash.exe` // - // Powershell on Windows + // PowerShell on Windows // - Example: `C:\\WINDOWS\\System32\\WindowsPowerShell\\v1.0\\powershell.exe` shell: '', - // for setting shell arguments (i.e. for using interactive shellArgs: ['-i']) - // by default ['--login'] will be used + // for setting shell arguments (i.e. for using interactive shellArgs: `['-i']`) + // by default `['--login']` will be used shellArgs: ['--login'], // for environment variables env: {}, - // set to false for no bell + // set to `false` for no bell bell: 'SOUND', - // if true, selected text will automatically be copied to the clipboard - copyOnSelect: false + // if `true` (without backticks and without quotes), selected text will automatically be copied to the clipboard + copyOnSelect: false, + + // if `true` (without backticks and without quotes), hyper will be set as the default protocol client for SSH + defaultSSHApp: true, - // if true, on right click selected text will be copied or pasted if no - // selection is present (true by default on Windows) - // quickEdit: true + // if `true` (without backticks and without quotes), on right click selected text will be copied or pasted if no + // selection is present (`true` by default on Windows and disables the context menu feature) + // quickEdit: true, // URL to custom bell // bellSoundURL: 'http://example.com/bell.mp3', @@ -126,5 +141,5 @@ module.exports = { keymaps: { // Example // 'window:devtools': 'cmd+alt+o', - } + }, }; diff --git a/app/config/import.js b/app/config/import.js index 8f6635f2f440..58394457faa5 100644 --- a/app/config/import.js +++ b/app/config/import.js @@ -1,46 +1,62 @@ const {writeFileSync, readFileSync} = require('fs'); const {sync: mkdirpSync} = require('mkdirp'); -const {defaultCfg, cfgPath, plugs} = require('./paths'); -const _init = require('./init'); -const _keymaps = require('./keymaps'); +const {defaultCfg, cfgPath, plugs, defaultPlatformKeyPath} = require('./paths'); +const {_init, _extractDefault} = require('./init'); -const _write = function (path, data) { +let defaultConfig; + +const _write = function(path, data) { // This method will take text formatted as Unix line endings and transform it // to text formatted with DOS line endings. We do this because the default // text editor on Windows (notepad) doesn't Deal with LF files. Still. In 2017. - const crlfify = function (str) { + const crlfify = function(str) { return str.replace(/\r?\n/g, '\r\n'); }; const format = process.platform === 'win32' ? crlfify(data.toString()) : data; writeFileSync(path, format, 'utf8'); }; -const _importConf = function () { +const _importConf = function() { // init plugin directories if not present mkdirpSync(plugs.base); mkdirpSync(plugs.local); try { - const _defaultCfg = readFileSync(defaultCfg, 'utf8'); + const defaultCfgRaw = readFileSync(defaultCfg, 'utf8'); + const _defaultCfg = _extractDefault(defaultCfgRaw); + // Importing platform specific keymap + try { + const content = readFileSync(defaultPlatformKeyPath(), 'utf8'); + const mapping = JSON.parse(content); + _defaultCfg.keymaps = mapping; + } catch (err) { + //eslint-disable-next-line no-console + console.error(err); + } + // Importing user config try { const _cfgPath = readFileSync(cfgPath, 'utf8'); return {userCfg: _cfgPath, defaultCfg: _defaultCfg}; } catch (err) { - _write(cfgPath, _defaultCfg); - return {userCfg: {}, defaultCfg: _defaultCfg}; + _write(cfgPath, defaultCfgRaw); + return {userCfg: defaultCfgRaw, defaultCfg: _defaultCfg}; } } catch (err) { + //eslint-disable-next-line no-console console.log(err); } }; -const _import = function () { - const cfg = _init(_importConf()); +exports._import = () => { + const imported = _importConf(); + defaultConfig = imported.defaultCfg; + const result = _init(imported); + return result; +}; - if (cfg) { - cfg.keymaps = _keymaps.import(cfg.keymaps); +exports.getDefaultConfig = () => { + if (!defaultConfig) { + defaultConfig = _extractDefault(_importConf().defaultCfg); } - return cfg; + return defaultConfig; }; - -module.exports = _import; diff --git a/app/config/init.js b/app/config/init.js index 65bbfa020352..e741f76072de 100644 --- a/app/config/init.js +++ b/app/config/init.js @@ -1,7 +1,8 @@ const vm = require('vm'); const notify = require('../notify'); +const mapKeys = require('../utils/map-keys'); -const _extract = function (script) { +const _extract = function(script) { const module = {}; script.runInNewContext({module}); if (!module.exports) { @@ -10,38 +11,40 @@ const _extract = function (script) { return module.exports; }; -const _syntaxValidation = function (cfg) { +const _syntaxValidation = function(cfg) { try { return new vm.Script(cfg, {filename: '.hyper.js', displayErrors: true}); } catch (err) { - notify(`Error loading config: ${err.name}, see DevTools for more info`); + notify('Error loading config:', `${err.name}, see DevTools for more info`); + //eslint-disable-next-line no-console console.error('Error loading config:', err); } }; -const _extractDefault = function (cfg) { +const _extractDefault = function(cfg) { return _extract(_syntaxValidation(cfg)); }; // init config -const _init = function (cfg) { +const _init = function(cfg) { const script = _syntaxValidation(cfg.userCfg); if (script) { const _cfg = _extract(script); if (!_cfg.config) { - _cfg.plugins = _cfg.plugins || []; - _cfg.localPlugins = _cfg.localPlugins || []; - _cfg.keymaps = _cfg.keymaps || {}; notify('Error reading configuration: `config` key is missing'); - return _extractDefault(cfg.defaultCfg); + return cfg.defaultCfg; } - + // Merging platform specific keymaps with user defined keymaps + _cfg.keymaps = mapKeys(Object.assign({}, cfg.defaultCfg.keymaps, _cfg.keymaps)); // Ignore undefined values in plugin and localPlugins array Issue #1862 _cfg.plugins = (_cfg.plugins && _cfg.plugins.filter(Boolean)) || []; _cfg.localPlugins = (_cfg.localPlugins && _cfg.localPlugins.filter(Boolean)) || []; return _cfg; } - return _extractDefault(cfg.defaultCfg); + return cfg.defaultCfg; }; -module.exports = _init; +module.exports = { + _init, + _extractDefault +}; diff --git a/app/config/keymaps.js b/app/config/keymaps.js deleted file mode 100644 index e88269904302..000000000000 --- a/app/config/keymaps.js +++ /dev/null @@ -1,50 +0,0 @@ -const {readFileSync} = require('fs'); -const normalize = require('../utils/keymaps/normalize'); -const {defaultPlatformKeyPath} = require('./paths'); - -const commands = {}; -const keys = {}; - -const _setKeysForCommands = function (keymap) { - for (const command in keymap) { - if (command) { - commands[command] = normalize(keymap[command]); - } - } -}; - -const _setCommandsForKeys = function (commands) { - for (const command in commands) { - if (command) { - keys[commands[command]] = command; - } - } -}; - -const _import = function (customKeys) { - try { - const mapping = JSON.parse(readFileSync(defaultPlatformKeyPath())); - _setKeysForCommands(mapping); - _setKeysForCommands(customKeys); - _setCommandsForKeys(commands); - - return {commands, keys}; - } catch (err) {} -}; - -const _extend = function (customKeys) { - if (customKeys) { - for (const command in customKeys) { - if (command) { - commands[command] = normalize(customKeys[command]); - keys[normalize(customKeys[command])] = command; - } - } - } - return {commands, keys}; -}; - -module.exports = { - import: _import, - extend: _extend -}; diff --git a/app/config/open.js b/app/config/open.js index c344390d1096..f4ddf0f45d67 100644 --- a/app/config/open.js +++ b/app/config/open.js @@ -3,75 +3,75 @@ const {cfgPath} = require('./paths'); module.exports = () => Promise.resolve(shell.openItem(cfgPath)); +// Windows opens .js files with WScript.exe by default +// If the user hasn't set up an editor for .js files, we fallback to notepad. if (process.platform === 'win32') { const Registry = require('winreg'); const {exec} = require('child_process'); - // Windows opens .js files with WScript.exe by default - // If the user hasn't set up an editor for .js files, we fallback to notepad. - const getFileExtKeys = () => new Promise((resolve, reject) => { - Registry({ - hive: Registry.HKCU, - key: '\\Software\\Microsoft\\Windows\\CurrentVersion\\Explorer\\FileExts\\.js' - }) - .keys((error, keys) => { - if (error) { - reject(error); - } else { - resolve(keys || []); - } + const getUserChoiceKey = async () => { + // Load FileExts keys for .js files + const keys = await new Promise((resolve, reject) => { + new Registry({ + hive: Registry.HKCU, + key: '\\Software\\Microsoft\\Windows\\CurrentVersion\\Explorer\\FileExts\\.js' + }).keys((error, items) => { + if (error) { + reject(error); + } else { + resolve(items || []); + } + }); }); - }); + + // Find UserChoice key + const userChoice = keys.filter(k => k.key.endsWith('UserChoice')); + return userChoice[0]; + }; const hasDefaultSet = async () => { - const keys = await getFileExtKeys(); + let userChoice = await getUserChoiceKey(); + if (!userChoice) return false; - const valueGroups = await Promise.all(keys.map(key => new Promise((resolve, reject) => { - key.values((error, items) => { + // Load key values + let values = await new Promise((resolve, reject) => { + userChoice.values((error, items) => { if (error) { reject(error); } resolve(items.map(item => item.value || '') || []); }); - }))); - - const values = valueGroups - .reduce((allValues, groupValues) => ([...allValues, ...groupValues]), []) - .filter(value => value && typeof value === 'string'); - - // No default app set - if (values.length === 0) { - return false; - } - - // WScript is in default apps list - if (values.some(value => value.includes('WScript.exe'))) { - const userDefaults = values.filter(value => value.endsWith('.exe') && !value.includes('WScript.exe')); + }); - // WScript.exe is overidden - return (userDefaults.length > 0); - } + // Look for default program + const hasDefaultProgramConfigured = values.some( + value => value && typeof value === 'string' && value.endsWith('.exe') && !value.includes('WScript.exe') + ); - return true; + return hasDefaultProgramConfigured; }; // This mimics shell.openItem, true if it worked, false if not. - const openNotepad = file => new Promise(resolve => { - exec(`start notepad.exe ${file}`, error => { - resolve(!error); + const openNotepad = file => + new Promise(resolve => { + exec(`start notepad.exe ${file}`, error => { + resolve(!error); + }); }); - }); - module.exports = () => hasDefaultSet() - .then(yes => { - if (yes) { - return shell.openItem(cfgPath); - } - console.warn('No default app set for .js files, using notepad.exe fallback'); - return openNotepad(cfgPath); - }) - .catch(err => { - console.error('Open config with default app error:', err); - return openNotepad(cfgPath); - }); + module.exports = () => + hasDefaultSet() + .then(yes => { + if (yes) { + return shell.openItem(cfgPath); + } + //eslint-disable-next-line no-console + console.warn('No default app set for .js files, using notepad.exe fallback'); + return openNotepad(cfgPath); + }) + .catch(err => { + //eslint-disable-next-line no-console + console.error('Open config with default app error:', err); + return openNotepad(cfgPath); + }); } diff --git a/app/config/paths.js b/app/config/paths.js index b29ace2eeecb..d302791aae97 100644 --- a/app/config/paths.js +++ b/app/config/paths.js @@ -21,6 +21,7 @@ if (isDev) { statSync(devCfg); cfgPath = devCfg; cfgDir = devDir; + //eslint-disable-next-line no-console console.log('using config file:', cfgPath); } catch (err) { // ignore @@ -34,6 +35,7 @@ const plugs = { cache: resolve(plugins, 'cache') }; const yarn = resolve(__dirname, '../../bin/yarn-standalone.js'); +const cliScriptPath = resolve(__dirname, '../../bin/hyper'); const icon = resolve(__dirname, '../static/icon96x96.png'); @@ -44,13 +46,25 @@ const linuxKeys = join(keymapPath, 'linux.json'); const defaultPlatformKeyPath = () => { switch (process.platform) { - case 'darwin': return darwinKeys; - case 'win32': return win32Keys; - case 'linux': return linuxKeys; - default: return darwinKeys; + case 'darwin': + return darwinKeys; + case 'win32': + return win32Keys; + case 'linux': + return linuxKeys; + default: + return darwinKeys; } }; module.exports = { - cfgDir, cfgPath, cfgFile, defaultCfg, icon, defaultPlatformKeyPath, plugs, yarn + cfgDir, + cfgPath, + cfgFile, + defaultCfg, + icon, + defaultPlatformKeyPath, + plugs, + yarn, + cliScriptPath }; diff --git a/app/config/windows.js b/app/config/windows.js index a8cef7644c93..901f47b234a6 100644 --- a/app/config/windows.js +++ b/app/config/windows.js @@ -1,14 +1,15 @@ const Config = require('electron-config'); +const defaults = { + windowPosition: [50, 50], + windowSize: [540, 380] +}; + // local storage -const cfg = new Config({ - defaults: { - windowPosition: [50, 50], - windowSize: [540, 380] - } -}); +const cfg = new Config({defaults}); module.exports = { + defaults, get() { const position = cfg.get('windowPosition'); const size = cfg.get('windowSize'); diff --git a/app/index.js b/app/index.js index 060196fee3da..477850259889 100644 --- a/app/index.js +++ b/app/index.js @@ -2,8 +2,11 @@ if (['--help', '-v', '--version'].includes(process.argv[1])) { const {version} = require('./package'); const configLocation = process.platform === 'win32' ? process.env.userprofile + '\\.hyper.js' : '~/.hyper.js'; + //eslint-disable-next-line no-console console.log(`Hyper version ${version}`); + //eslint-disable-next-line no-console console.log('Hyper does not accept any command line arguments. Please modify the config file instead.'); + //eslint-disable-next-line no-console console.log(`Hyper configuration file located at: ${configLocation}`); // eslint-disable-next-line unicorn/no-process-exit process.exit(); @@ -14,6 +17,7 @@ const checkSquirrel = () => { try { squirrel = require('electron-squirrel-startup'); + //eslint-disable-next-line no-empty } catch (err) {} if (squirrel) { @@ -52,15 +56,16 @@ const {app, BrowserWindow, Menu} = require('electron'); const {gitDescribe} = require('git-describe'); const isDev = require('electron-is-dev'); -const AppMenu = require('./menus/menu'); const config = require('./config'); // set up config config.setup(); const plugins = require('./plugins'); - +const {addSymlink, addBinToUserPath} = require('./utils/cli-install'); +const AppMenu = require('./menus/menu'); const Window = require('./ui/window'); +const windowUtils = require('./utils/window-utils'); const windowSet = new Set([]); @@ -81,6 +86,7 @@ app.getLastFocusedWindow = () => { }; if (isDev) { + //eslint-disable-next-line no-console console.log('running in dev mode'); // Overide default appVersion which is set from package.json @@ -90,123 +96,144 @@ if (isDev) { } }); } else { + //eslint-disable-next-line no-console console.log('running in prod mode'); + if (process.platform === 'win32') { + //eslint-disable-next-line no-console + addBinToUserPath().catch(err => console.error('Failed to add Hyper CLI path to user PATH', err)); + } else { + //eslint-disable-next-line no-console + addSymlink().catch(err => console.error('Failed to symlink Hyper CLI', err)); + } } -const url = 'file://' + resolve( - isDev ? __dirname : app.getAppPath(), - 'index.html' -); - +const url = 'file://' + resolve(isDev ? __dirname : app.getAppPath(), 'index.html'); +//eslint-disable-next-line no-console console.log('electron will open', url); -app.on('ready', () => installDevExtensions(isDev).then(() => { - function createWindow(fn, options = {}) { - const cfg = plugins.getDecoratedConfig(); - - const winSet = config.getWin(); - let [startX, startY] = winSet.position; +app.on('ready', () => + installDevExtensions(isDev) + .then(() => { + function createWindow(fn, options = {}) { + const cfg = plugins.getDecoratedConfig(); + + const winSet = config.getWin(); + let [startX, startY] = winSet.position; + + const [width, height] = options.size ? options.size : cfg.windowSize || winSet.size; + const {screen} = require('electron'); + + const winPos = options.position; + + // Open the new window roughly the height of the header away from the + // previous window. This also ensures in multi monitor setups that the + // new terminal is on the correct screen. + const focusedWindow = BrowserWindow.getFocusedWindow() || app.getLastFocusedWindow(); + // In case of options defaults position and size, we should ignore the focusedWindow. + if (winPos !== undefined) { + [startX, startY] = winPos; + } else if (focusedWindow) { + const points = focusedWindow.getPosition(); + const currentScreen = screen.getDisplayNearestPoint({ + x: points[0], + y: points[1] + }); + + const biggestX = points[0] + 100 + width - currentScreen.bounds.x; + const biggestY = points[1] + 100 + height - currentScreen.bounds.y; + + if (biggestX > currentScreen.size.width) { + startX = 50; + } else { + startX = points[0] + 34; + } + if (biggestY > currentScreen.size.height) { + startY = 50; + } else { + startY = points[1] + 34; + } + } - const [width, height] = options.size ? options.size : (cfg.windowSize || winSet.size); - const {screen} = require('electron'); + if (!windowUtils.positionIsValid([startX, startY])) { + [startX, startY] = config.windowDefaults.windowPosition; + } - const winPos = options.position; + const hwin = new Window({width, height, x: startX, y: startY}, cfg, fn); + windowSet.add(hwin); + hwin.loadURL(url); - // Open the new window roughly the height of the header away from the - // previous window. This also ensures in multi monitor setups that the - // new terminal is on the correct screen. - const focusedWindow = BrowserWindow.getFocusedWindow() || app.getLastFocusedWindow(); - // In case of options defaults position and size, we should ignore the focusedWindow. - if (winPos !== undefined) { - [startX, startY] = winPos; - } else if (focusedWindow) { - const points = focusedWindow.getPosition(); - const currentScreen = screen.getDisplayNearestPoint({x: points[0], y: points[1]}); + // the window can be closed by the browser process itself + hwin.on('close', () => { + hwin.clean(); + windowSet.delete(hwin); + }); - const biggestX = ((points[0] + 100 + width) - currentScreen.bounds.x); - const biggestY = ((points[1] + 100 + height) - currentScreen.bounds.y); + hwin.on('closed', () => { + if (process.platform !== 'darwin' && windowSet.size === 0) { + app.quit(); + } + }); - if (biggestX > currentScreen.size.width) { - startX = 50; - } else { - startX = points[0] + 34; + return hwin; } - if (biggestY > currentScreen.size.height) { - startY = 50; - } else { - startY = points[1] + 34; - } - } - - const hwin = new Window({width, height, x: startX, y: startY}, cfg, fn); - windowSet.add(hwin); - hwin.loadURL(url); - // the window can be closed by the browser process itself - hwin.on('close', () => { - hwin.clean(); - windowSet.delete(hwin); - }); + // when opening create a new window + createWindow(); - hwin.on('closed', () => { - if (process.platform !== 'darwin' && windowSet.size === 0) { - app.quit(); + // expose to plugins + app.createWindow = createWindow; + + if (!isDev) { + // check if should be set/removed as default ssh protocol client + if (config.getConfig().defaultSSHApp && !app.isDefaultProtocolClient('ssh')) { + //eslint-disable-next-line no-console + console.log('Setting Hyper as default client for ssh:// protocol'); + app.setAsDefaultProtocolClient('ssh'); + } else if (!config.getConfig().defaultSSHApp && app.isDefaultProtocolClient('ssh')) { + //eslint-disable-next-line no-console + console.log('Removing Hyper from default client for ssh:// protocl'); + app.removeAsDefaultProtocolClient('ssh'); + } } - }); - - return hwin; - } - - // when opening create a new window - createWindow(); - - // expose to plugins - app.createWindow = createWindow; - - // mac only. when the dock icon is clicked - // and we don't have any active windows open, - // we open one - app.on('activate', () => { - if (!windowSet.size) { - createWindow(); - } - }); - const makeMenu = () => { - const menu = plugins.decorateMenu( - AppMenu(createWindow, () => { - plugins.updatePlugins({force: true}); - }, - plugins.getLoadedPluginVersions - )); - - // If we're on Mac make a Dock Menu - if (process.platform === 'darwin') { - const dockMenu = Menu.buildFromTemplate([{ - label: 'New Window', - click() { + // mac only. when the dock icon is clicked + // and we don't have any active windows open, + // we open one + app.on('activate', () => { + if (!windowSet.size) { createWindow(); } - }]); - app.dock.setMenu(dockMenu); - } - - Menu.setApplicationMenu( - Menu.buildFromTemplate(menu) - ); - }; + }); - const load = () => { - plugins.onApp(app); - plugins.extendKeymaps(); - makeMenu(); - }; + const makeMenu = () => { + const menu = plugins.decorateMenu(AppMenu.createMenu(createWindow, plugins.getLoadedPluginVersions)); + + // If we're on Mac make a Dock Menu + if (process.platform === 'darwin') { + const dockMenu = Menu.buildFromTemplate([ + { + label: 'New Window', + click() { + createWindow(); + } + } + ]); + app.dock.setMenu(dockMenu); + } - load(); - plugins.subscribe(load); -}).catch(err => { - console.error('Error while loading devtools extensions', err); -})); + Menu.setApplicationMenu(AppMenu.buildMenu(menu)); + }; + + plugins.onApp(app); + makeMenu(); + plugins.subscribe(plugins.onApp.bind(undefined, app)); + config.subscribe(makeMenu); + }) + .catch(err => { + //eslint-disable-next-line no-console + console.error('Error while loading devtools extensions', err); + }) +); app.on('open-file', (event, path) => { const lastWindow = app.getLastFocusedWindow(); @@ -222,17 +249,28 @@ app.on('open-file', (event, path) => { } }); -function installDevExtensions(isDev) { - if (!isDev) { +app.on('open-url', (event, sshUrl) => { + const lastWindow = app.getLastFocusedWindow(); + const callback = win => win.rpc.emit('open ssh', sshUrl); + if (lastWindow) { + callback(lastWindow); + } else if (!lastWindow && {}.hasOwnProperty.call(app, 'createWindow')) { + app.createWindow(callback); + } else { + // If createWindow doesn't exist yet ('ready' event was not fired), + // sets his callback to an app.windowCallback property. + app.windowCallback = callback; + } +}); + +function installDevExtensions(isDev_) { + if (!isDev_) { return Promise.resolve(); } // eslint-disable-next-line import/no-extraneous-dependencies const installer = require('electron-devtools-installer'); - const extensions = [ - 'REACT_DEVELOPER_TOOLS', - 'REDUX_DEVTOOLS' - ]; + const extensions = ['REACT_DEVELOPER_TOOLS', 'REDUX_DEVTOOLS']; const forceDownload = Boolean(process.env.UPGRADE_EXTENSIONS); return Promise.all(extensions.map(name => installer.default(installer[name], forceDownload))); diff --git a/app/keymaps/darwin.json b/app/keymaps/darwin.json index 64c81bc90a3b..32938ba010a6 100644 --- a/app/keymaps/darwin.json +++ b/app/keymaps/darwin.json @@ -1,31 +1,51 @@ { - "window:devtools": "cmd+alt+i", - "window:reload": "cmd+r", - "window:reloadFull": "cmd+shift+r", - "window:preferences": "cmd+,", - "zoom:reset": "cmd+0", - "zoom:in": "cmd+plus", - "zoom:out": "cmd+-", - "window:new": "cmd+n", - "window:minimize": "cmd+m", - "window:zoom": "ctrl+alt+cmd+m", - "window:toggleFullScreen": "cmd+ctrl+f", - "window:close": "cmd+shift+w", - "tab:new": "cmd+t", - "tab:next": "cmd+shift+]", - "tab:prev": "cmd+shift+[", - "pane:next": "cmd+]", - "pane:prev": "cmd+[", - "pane:splitVertical": "cmd+d", - "pane:splitHorizontal": "cmd+shift+d", - "pane:close": "cmd+w", - "editor:undo": "cmd+z", - "editor:redo": "cmd+y", - "editor:cut": "cmd+x", - "editor:copy": "cmd+c", - "editor:paste": "cmd+v", - "editor:selectAll": "cmd+a", - "editor:clearBuffer": "cmd+k", - "editor:emojis": "cmd+ctrl+space", - "plugins:update": "cmd+shift+u" -} \ No newline at end of file + "window:devtools": "command+alt+i", + "window:reload": "command+r", + "window:reloadFull": "command+shift+r", + "window:preferences": "command+,", + "zoom:reset": "command+0", + "zoom:in": "command+plus", + "zoom:out": "command+-", + "window:new": "command+n", + "window:minimize": "command+m", + "window:zoom": "ctrl+alt+command+m", + "window:toggleFullScreen": "command+ctrl+f", + "window:close": "command+shift+w", + "tab:new": "command+t", + "tab:next": [ + "command+shift+]", + "command+shift+right", + "command+alt+right", + "ctrl+tab" + ], + "tab:prev": [ + "command+shift+[", + "command+shift+left", + "command+alt+left", + "ctrl+shift+tab" + ], + "tab:jump:prefix": "command", + "pane:next": "command+]", + "pane:prev": "command+[", + "pane:splitVertical": "command+d", + "pane:splitHorizontal": "command+shift+d", + "pane:close": "command+w", + "editor:undo": "command+z", + "editor:redo": "command+y", + "editor:cut": "command+x", + "editor:copy": "command+c", + "editor:paste": "command+v", + "editor:selectAll": "command+a", + "editor:movePreviousWord": "alt+left", + "editor:moveNextWord": "alt+right", + "editor:moveBeginningLine": "command+left", + "editor:moveEndLine": "command+right", + "editor:deletePreviousWord": "alt+backspace", + "editor:deleteNextWord": "alt+delete", + "editor:deleteBeginningLine": "command+backspace", + "editor:deleteEndLine": "command+delete", + "editor:clearBuffer": "command+k", + "editor:emojis": "command+ctrl+space", + "editor:break": "ctrl+c", + "plugins:update": "command+shift+u" +} diff --git a/app/keymaps/linux.json b/app/keymaps/linux.json index d66494f6b8d3..85615cc036f0 100644 --- a/app/keymaps/linux.json +++ b/app/keymaps/linux.json @@ -12,8 +12,19 @@ "window:toggleFullScreen": "f11", "window:close": "ctrl+shift+q", "tab:new": "ctrl+shift+t", - "tab:next": "ctrl+tab", - "tab:prev": "ctrl+shift+tab", + "tab:next": [ + "ctrl+shift+]", + "ctrl+shift+right", + "ctrl+alt+right", + "ctrl+tab" + ], + "tab:prev": [ + "ctrl+shift+[", + "ctrl+shift+left", + "ctrl+alt+left", + "ctrl+shift+tab" + ], + "tab:jump:prefix": "ctrl", "pane:next": "ctrl+pageup", "pane:prev": "ctrl+pagedown", "pane:splitVertical": "ctrl+shift+d", @@ -25,6 +36,15 @@ "editor:copy": "ctrl+shift+c", "editor:paste": "ctrl+shift+v", "editor:selectAll": "ctrl+shift+a", + "editor:movePreviousWord": "ctrl+left", + "editor:moveNextWord": "ctrl+right", + "editor:moveBeginningLine": "home", + "editor:moveEndLine": "end", + "editor:deletePreviousWord": "ctrl+backspace", + "editor:deleteNextWord": "ctrl+del", + "editor:deleteBeginningLine": "ctrl+home", + "editor:deleteEndLine": "ctrl+end", "editor:clearBuffer": "ctrl+shift+k", + "editor:break": "ctrl+c", "plugins:update": "ctrl+shift+u" } diff --git a/app/keymaps/win32.json b/app/keymaps/win32.json index ee94f2c58d86..94ef8643534f 100644 --- a/app/keymaps/win32.json +++ b/app/keymaps/win32.json @@ -7,13 +7,27 @@ "zoom:in": "ctrl+plus", "zoom:out": "ctrl+-", "window:new": "ctrl+shift+n", - "window:minimize": "ctrl+m", + "window:minimize": "ctrl+shift+m", "window:zoom": "ctrl+shift+alt+m", "window:toggleFullScreen": "f11", - "window:close": "ctrl+shift+q", + "window:close": [ + "ctrl+shift+q", + "alt+f4" + ], "tab:new": "ctrl+shift+t", - "tab:next": "ctrl+tab", - "tab:prev": "ctrl+shift+tab", + "tab:next": [ + "ctrl+shift+]", + "ctrl+shift+right", + "ctrl+alt+right", + "ctrl+tab" + ], + "tab:prev": [ + "ctrl+shift+[", + "ctrl+shift+left", + "ctrl+alt+left", + "ctrl+shift+tab" + ], + "tab:jump:prefix": "ctrl", "pane:next": "ctrl+pageup", "pane:prev": "ctrl+pagedown", "pane:splitVertical": "ctrl+shift+d", @@ -25,6 +39,15 @@ "editor:copy": "ctrl+shift+c", "editor:paste": "ctrl+shift+v", "editor:selectAll": "ctrl+shift+a", + "editor:movePreviousWord": "ctrl+left", + "editor:moveNextWord": "ctrl+right", + "editor:moveBeginningLine": "home", + "editor:moveEndLine": "end", + "editor:deletePreviousWord": "ctrl+backspace", + "editor:deleteNextWord": "ctrl+del", + "editor:deleteBeginningLine": "ctrl+home", + "editor:deleteEndLine": "ctrl+end", "editor:clearBuffer": "ctrl+shift+k", + "editor:break": "ctrl+c", "plugins:update": "ctrl+shift+u" } diff --git a/app/menus/menu.js b/app/menus/menu.js index fff07157f387..bc6cce38fec0 100644 --- a/app/menus/menu.js +++ b/app/menus/menu.js @@ -1,8 +1,8 @@ // Packages -const {app, dialog} = require('electron'); +const {app, dialog, Menu} = require('electron'); // Utilities -const {getKeymaps, getConfig} = require('../config'); +const {getConfig} = require('../config'); const {icon} = require('../config/paths'); const viewMenu = require('./menus/view'); const shellMenu = require('./menus/shell'); @@ -11,13 +11,22 @@ const pluginsMenu = require('./menus/plugins'); const windowMenu = require('./menus/window'); const helpMenu = require('./menus/help'); const darwinMenu = require('./menus/darwin'); +const {getDecoratedKeymaps} = require('../plugins'); +const {execCommand} = require('../commands'); const appName = app.getName(); const appVersion = app.getVersion(); -module.exports = (createWindow, updatePlugins, getLoadedPluginVersions) => { +let menu_ = []; + +exports.createMenu = (createWindow, getLoadedPluginVersions) => { const config = getConfig(); - const {commands} = getKeymaps(); + // We take only first shortcut in array for each command + const allCommandKeys = getDecoratedKeymaps(); + const commandKeys = Object.keys(allCommandKeys).reduce((result, command) => { + result[command] = allCommandKeys[command][0]; + return result; + }, {}); let updateChannel = 'stable'; @@ -27,27 +36,31 @@ module.exports = (createWindow, updatePlugins, getLoadedPluginVersions) => { const showAbout = () => { const loadedPlugins = getLoadedPluginVersions(); - const pluginList = loadedPlugins.length === 0 ? - 'none' : - loadedPlugins.map(plugin => `\n ${plugin.name} (${plugin.version})`); + const pluginList = + loadedPlugins.length === 0 ? 'none' : loadedPlugins.map(plugin => `\n ${plugin.name} (${plugin.version})`); dialog.showMessageBox({ title: `About ${appName}`, message: `${appName} ${appVersion} (${updateChannel})`, - detail: `Plugins: ${pluginList}\n\nCreated by Guillermo Rauch\nCopyright © 2017 Zeit, Inc.`, + detail: `Plugins: ${pluginList}\n\nCreated by Guillermo Rauch\nCopyright © 2018 ZEIT, Inc.`, buttons: [], icon }); }; const menu = [ - ...(process.platform === 'darwin' ? [darwinMenu(commands, showAbout)] : []), - shellMenu(commands, createWindow), - editMenu(commands), - viewMenu(commands), - pluginsMenu(commands, updatePlugins), - windowMenu(commands), - helpMenu(commands, showAbout) + ...(process.platform === 'darwin' ? [darwinMenu(commandKeys, execCommand, showAbout)] : []), + shellMenu(commandKeys, execCommand), + editMenu(commandKeys, execCommand), + viewMenu(commandKeys, execCommand), + pluginsMenu(commandKeys, execCommand), + windowMenu(commandKeys, execCommand), + helpMenu(commandKeys, showAbout) ]; return menu; }; + +exports.buildMenu = template => { + menu_ = Menu.buildFromTemplate(template); + return menu_; +}; diff --git a/app/menus/menus/darwin.js b/app/menus/menus/darwin.js index bff2bf0d9444..5badbd8a7f9d 100644 --- a/app/menus/menus/darwin.js +++ b/app/menus/menus/darwin.js @@ -1,9 +1,8 @@ // This menu label is overrided by OSX to be the appName // The label is set to appName here so it matches actual behavior const {app} = require('electron'); -const {openConfig} = require('../../config'); -module.exports = function (commands, showAbout) { +module.exports = (commandKeys, execCommand, showAbout) => { return { label: `${app.getName()}`, submenu: [ @@ -18,9 +17,9 @@ module.exports = function (commands, showAbout) { }, { label: 'Preferences...', - accelerator: commands['window:preferences'], + accelerator: commandKeys['window:preferences'], click() { - openConfig(); + execCommand('window:preferences'); } }, { diff --git a/app/menus/menus/edit.js b/app/menus/menus/edit.js index aa6f5d7d2bdf..301cf034ffb6 100644 --- a/app/menus/menus/edit.js +++ b/app/menus/menus/edit.js @@ -1,44 +1,116 @@ -const {openConfig} = require('../../config'); - -module.exports = function (commands) { +module.exports = (commandKeys, execCommand) => { const submenu = [ { - role: 'undo', - accelerator: commands['editor:undo'] + label: 'Undo', + accelerator: commandKeys['editor:undo'], + enabled: false }, { - role: 'redo', - accelerator: commands['editor:redo'] + label: 'Redo', + accelerator: commandKeys['editor:redo'], + enabled: false }, { type: 'separator' }, { - role: 'cut', - accelerator: commands['editor:cut'] + label: 'Cut', + accelerator: commandKeys['editor:cut'], + enabled: false }, { role: 'copy', - accelerator: commands['editor:copy'] + command: 'editor:copy', + accelerator: commandKeys['editor:copy'] }, { role: 'paste', - accelerator: commands['editor:paste'] + accelerator: commandKeys['editor:paste'] }, { - role: 'selectall', - accelerator: commands['editor:selectAll'] + label: 'Select All', + accelerator: commandKeys['editor:selectAll'], + click(item, focusedWindow) { + execCommand('editor:selectAll', focusedWindow); + } + }, + { + type: 'separator' + }, + { + label: 'Move to...', + submenu: [ + { + label: 'Previous word', + accelerator: commandKeys['editor:movePreviousWord'], + click(item, focusedWindow) { + execCommand('editor:movePreviousWord', focusedWindow); + } + }, + { + label: 'Next word', + accelerator: commandKeys['editor:moveNextWord'], + click(item, focusedWindow) { + execCommand('editor:moveNextWord', focusedWindow); + } + }, + { + label: 'Line beginning', + accelerator: commandKeys['editor:moveBeginningLine'], + click(item, focusedWindow) { + execCommand('editor:moveBeginningLine', focusedWindow); + } + }, + { + label: 'Line end', + accelerator: commandKeys['editor:moveEndLine'], + click(item, focusedWindow) { + execCommand('editor:moveEndLine', focusedWindow); + } + } + ] + }, + { + label: 'Delete...', + submenu: [ + { + label: 'Previous word', + accelerator: commandKeys['editor:deletePreviousWord'], + click(item, focusedWindow) { + execCommand('editor:deletePreviousWord', focusedWindow); + } + }, + { + label: 'Next word', + accelerator: commandKeys['editor:deleteNextWord'], + click(item, focusedWindow) { + execCommand('editor:deleteNextWord', focusedWindow); + } + }, + { + label: 'Line beginning', + accelerator: commandKeys['editor:deleteBeginningLine'], + click(item, focusedWindow) { + execCommand('editor:deleteBeginningLine', focusedWindow); + } + }, + { + label: 'Line end', + accelerator: commandKeys['editor:deleteEndLine'], + click(item, focusedWindow) { + execCommand('editor:deleteEndLine', focusedWindow); + } + } + ] }, { type: 'separator' }, { label: 'Clear Buffer', - accelerator: commands['editor:clearBuffer'], + accelerator: commandKeys['editor:clearBuffer'], click(item, focusedWindow) { - if (focusedWindow) { - focusedWindow.rpc.emit('session clear req'); - } + execCommand('editor:clearBuffer', focusedWindow); } } ]; @@ -48,9 +120,9 @@ module.exports = function (commands) { {type: 'separator'}, { label: 'Preferences...', - accelerator: commands['window:preferences'], + accelerator: commandKeys['window:preferences'], click() { - openConfig(); + execCommand('window:preferences'); } } ); diff --git a/app/menus/menus/help.js b/app/menus/menus/help.js index 6bdc882656c4..6f920c8cc063 100644 --- a/app/menus/menus/help.js +++ b/app/menus/menus/help.js @@ -1,7 +1,11 @@ -const os = require('os'); +const {release} = require('os'); const {app, shell} = require('electron'); -module.exports = function (commands, showAbout) { +const {getConfig, getPlugins} = require('../../config'); +const {arch, env, platform, versions} = process; +const {version} = require('../../package.json'); + +module.exports = (commands, showAbout) => { const submenu = [ { label: `${app.getName()} Website`, @@ -13,11 +17,48 @@ module.exports = function (commands, showAbout) { label: 'Report Issue', click() { const body = ` - - - - ${app.getName()} ${app.getVersion()} - Electron ${process.versions.electron} - ${process.platform} ${process.arch} ${os.release()}`; + + + - [ ] Your Hyper.app version is **${version}**. Please verify your using the [latest](https://github.com/zeit/hyper/releases/latest) Hyper.app version + - [ ] I have searched the [issues](https://github.com/zeit/hyper/issues) of this repo and believe that this is not a duplicate + + --- + - **Any relevant information from devtools?** _(CMD+ALT+I on macOS, CTRL+SHIFT+I elsewhere)_: + + + - **Is the issue reproducible in vanilla Hyper.app?** + + +## Issue + + + + + + + + + - **${app.getName()} version**: ${env.TERM_PROGRAM_VERSION} "${app.getVersion()}" + + - **OS ARCH VERSION:** ${platform} ${arch} ${release()} + - **Electron:** ${versions.electron} **LANG:** ${env.LANG} + - **SHELL:** ${env.SHELL} **TERM:** ${env.TERM} + +
+ ~/.hyper.js contents + 
+        
+          ${JSON.stringify(getConfig(), null, 2)}
+
+          ${JSON.stringify(getPlugins(), null, 2)}
+        
+
+
`; shell.openExternal(`https://github.com/zeit/hyper/issues/new?body=${encodeURIComponent(body)}`); } @@ -35,7 +76,6 @@ module.exports = function (commands, showAbout) { } ); } - return { role: 'help', submenu diff --git a/app/menus/menus/plugins.js b/app/menus/menus/plugins.js index d7dee3fe0ec0..4c08f93fbe2f 100644 --- a/app/menus/menus/plugins.js +++ b/app/menus/menus/plugins.js @@ -1,4 +1,4 @@ -module.exports = function (commands, update) { +module.exports = (commands, update) => { return { label: 'Plugins', submenu: [ diff --git a/app/menus/menus/shell.js b/app/menus/menus/shell.js index 56b0d7d02f01..ba6224aabf23 100644 --- a/app/menus/menus/shell.js +++ b/app/menus/menus/shell.js @@ -1,64 +1,54 @@ -module.exports = function (commands, createWindow) { +module.exports = (commandKeys, execCommand) => { const isMac = process.platform === 'darwin'; return { label: isMac ? 'Shell' : 'File', submenu: [ { - label: 'New Window', - accelerator: commands['window:new'], - click() { - createWindow(); + label: 'New Tab', + accelerator: commandKeys['tab:new'], + click(item, focusedWindow) { + execCommand('tab:new', focusedWindow); } }, { - label: 'New Tab', - accelerator: commands['tab:new'], + label: 'New Window', + accelerator: commandKeys['window:new'], click(item, focusedWindow) { - if (focusedWindow) { - focusedWindow.rpc.emit('termgroup add req'); - } else { - createWindow(); - } + execCommand('window:new', focusedWindow); } }, { type: 'separator' }, { - label: 'Split Vertically', - accelerator: commands['pane:splitVertical'], + label: 'Split Horizontally', + accelerator: commandKeys['pane:splitHorizontal'], click(item, focusedWindow) { - if (focusedWindow) { - focusedWindow.rpc.emit('split request vertical'); - } + execCommand('pane:splitHorizontal', focusedWindow); } }, { - label: 'Split Horizontally', - accelerator: commands['pane:splitHorizontal'], + label: 'Split Vertically', + accelerator: commandKeys['pane:splitVertical'], click(item, focusedWindow) { - if (focusedWindow) { - focusedWindow.rpc.emit('split request horizontal'); - } + execCommand('pane:splitVertical', focusedWindow); } }, { type: 'separator' }, { - label: 'Close Session', - accelerator: commands['pane:close'], + label: 'Close', + accelerator: commandKeys['pane:close'], click(item, focusedWindow) { - if (focusedWindow) { - focusedWindow.rpc.emit('termgroup close req'); - } + execCommand('pane:close', focusedWindow); } }, { label: isMac ? 'Close Window' : 'Quit', role: 'close', - accelerator: commands['window:close'] + accelerator: commandKeys['window:close'] } ] }; diff --git a/app/menus/menus/view.js b/app/menus/menus/view.js index 3c64253826d6..04d6df61faaa 100644 --- a/app/menus/menus/view.js +++ b/app/menus/menus/view.js @@ -1,37 +1,26 @@ -module.exports = function (commands) { +module.exports = (commandKeys, execCommand) => { return { label: 'View', submenu: [ { label: 'Reload', - accelerator: commands['window:reload'], + accelerator: commandKeys['window:reload'], click(item, focusedWindow) { - if (focusedWindow) { - focusedWindow.rpc.emit('reload'); - } + execCommand('window:reload', focusedWindow); } }, { label: 'Full Reload', - accelerator: commands['window:reloadFull'], + accelerator: commandKeys['window:reloadFull'], click(item, focusedWindow) { - if (focusedWindow) { - focusedWindow.reload(); - } + execCommand('window:reloadFull', focusedWindow); } }, { label: 'Developer Tools', - accelerator: commands['window:devtools'], - click(item, focusedWindow) { - if (focusedWindow) { - const webContents = focusedWindow.webContents; - if (webContents.isDevToolsOpened()) { - webContents.closeDevTools(); - } else { - webContents.openDevTools({mode: 'detach'}); - } - } + accelerator: commandKeys['window:devtools'], + click: (item, focusedWindow) => { + execCommand('window:devtools', focusedWindow); } }, { @@ -39,29 +28,23 @@ module.exports = function (commands) { }, { label: 'Reset Zoom Level', - accelerator: commands['zoom:reset'], + accelerator: commandKeys['zoom:reset'], click(item, focusedWindow) { - if (focusedWindow) { - focusedWindow.rpc.emit('reset fontSize req'); - } + execCommand('zoom:reset', focusedWindow); } }, { label: 'Zoom In', - accelerator: commands['zoom:in'], + accelerator: commandKeys['zoom:in'], click(item, focusedWindow) { - if (focusedWindow) { - focusedWindow.rpc.emit('increase fontSize req'); - } + execCommand('zoom:in', focusedWindow); } }, { label: 'Zoom Out', - accelerator: commands['zoom:out'], + accelerator: commandKeys['zoom:out'], click(item, focusedWindow) { - if (focusedWindow) { - focusedWindow.rpc.emit('decrease fontSize req'); - } + execCommand('zoom:out', focusedWindow); } } ] diff --git a/app/menus/menus/window.js b/app/menus/menus/window.js index 42eba8f2a05e..ed955e584d16 100644 --- a/app/menus/menus/window.js +++ b/app/menus/menus/window.js @@ -1,39 +1,51 @@ -module.exports = function (commands) { +module.exports = (commandKeys, execCommand) => { + // Generating tab:jump array + const tabJump = []; + for (let i = 1; i <= 9; i++) { + // 9 is a special number because it means 'last' + const label = i === 9 ? 'Last' : `${i}`; + tabJump.push({ + label: label, + accelerator: commandKeys[`tab:jump:${label.toLowerCase()}`] + }); + } + return { role: 'window', submenu: [ { role: 'minimize', - accelerator: commands['window:minimize'] + accelerator: commandKeys['window:minimize'] }, { type: 'separator' }, - { // It's the same thing as clicking the green traffc-light on macOS + { + // It's the same thing as clicking the green traffc-light on macOS role: 'zoom', - accelerator: commands['window:zoom'] + accelerator: commandKeys['window:zoom'] }, { label: 'Select Tab', submenu: [ { label: 'Previous', - accelerator: commands['tab:prev'], - click(item, focusedWindow) { - if (focusedWindow) { - focusedWindow.rpc.emit('move left req'); - } + accelerator: commandKeys['tab:prev'], + click: (item, focusedWindow) => { + execCommand('tab:prev', focusedWindow); } }, { label: 'Next', - accelerator: commands['tab:next'], - click(item, focusedWindow) { - if (focusedWindow) { - focusedWindow.rpc.emit('move right req'); - } + accelerator: commandKeys['tab:next'], + click: (item, focusedWindow) => { + execCommand('tab:next', focusedWindow); } - } + }, + { + type: 'separator' + }, + ...tabJump ] }, { @@ -44,20 +56,16 @@ module.exports = function (commands) { submenu: [ { label: 'Previous', - accelerator: commands['pane:prev'], - click(item, focusedWindow) { - if (focusedWindow) { - focusedWindow.rpc.emit('prev pane req'); - } + accelerator: commandKeys['pane:prev'], + click: (item, focusedWindow) => { + execCommand('pane:prev', focusedWindow); } }, { label: 'Next', - accelerator: commands['pane:next'], - click(item, focusedWindow) { - if (focusedWindow) { - focusedWindow.rpc.emit('next pane req'); - } + accelerator: commandKeys['pane:next'], + click: (item, focusedWindow) => { + execCommand('pane:next', focusedWindow); } } ] @@ -70,7 +78,7 @@ module.exports = function (commands) { }, { role: 'togglefullscreen', - accelerators: commands['window:toggleFullScreen'] + accelerators: commandKeys['window:toggleFullScreen'] } ] }; diff --git a/app/notifications.js b/app/notifications.js index 58a5800aea06..1c7b5b9156bd 100644 --- a/app/notifications.js +++ b/app/notifications.js @@ -10,10 +10,11 @@ module.exports = function fetchNotifications(win) { const retry = err => { setTimeout(() => fetchNotifications(win), ms('30m')); if (err) { + //eslint-disable-next-line no-console console.error('Notification messages fetch error', err.stack); } }; - + //eslint-disable-next-line no-console console.log('Checking for notification messages'); fetch(NEWS_URL, { headers: { @@ -21,19 +22,20 @@ module.exports = function fetchNotifications(win) { 'X-Hyper-Platform': process.platform } }) - .then(res => res.json()) - .then(data => { - const {message} = data || {}; - if (typeof message !== 'object' && message !== '') { - throw new Error('Bad response'); - } - if (message === '') { - console.log('No matching notification messages'); - } else { - rpc.emit('add notification', message); - } + .then(res => res.json()) + .then(data => { + const {message} = data || {}; + if (typeof message !== 'object' && message !== '') { + throw new Error('Bad response'); + } + if (message === '') { + //eslint-disable-next-line no-console + console.log('No matching notification messages'); + } else { + rpc.emit('add notification', message); + } - retry(); - }) - .catch(retry); + retry(); + }) + .catch(retry); }; diff --git a/app/notify.js b/app/notify.js index 2e342fdace2d..1d00428ed7c6 100644 --- a/app/notify.js +++ b/app/notify.js @@ -16,10 +16,7 @@ app.on('ready', () => { const win_ = new BrowserWindow({ show: false }); - const url = 'file://' + resolve( - isDev ? __dirname : app.getAppPath(), - 'notify.html' - ); + const url = 'file://' + resolve(isDev ? __dirname : app.getAppPath(), 'notify.html'); win_.loadURL(url); win_.webContents.on('dom-ready', () => { win = win_; @@ -31,6 +28,7 @@ app.on('ready', () => { }); function notify(title, body) { + //eslint-disable-next-line no-console console.log(`[Notification] ${title}: ${body}`); if (win) { win.webContents.send('notification', {title, body}); diff --git a/app/package.json b/app/package.json index c51cf69c0d19..2b493555392d 100644 --- a/app/package.json +++ b/app/package.json @@ -2,17 +2,16 @@ "name": "hyper", "productName": "Hyper", "description": "A terminal built on web technologies", - "version": "1.4.8", + "version": "2.0.0-canary.17", "license": "MIT", "author": { - "name": "Zeit, Inc.", + "name": "ZEIT, Inc.", "email": "team@zeit.co" }, "repository": "zeit/hyper", - "xo": false, "dependencies": { - "async-retry": "1.1.3", - "color": "2.0.0", + "async-retry": "1.1.4", + "color": "2.0.1", "convert-css-color-name-to-hex": "0.1.1", "default-shell": "1.0.1", "electron-config": "1.0.0", @@ -20,15 +19,16 @@ "electron-squirrel-startup": "1.0.0", "file-uri-to-path": "1.0.0", "git-describe": "4.0.2", - "lodash": "4.17.4", + "lodash": "4.17.5", "mkdirp": "0.5.1", - "ms": "2.0.0", - "node-fetch": "1.7.2", - "node-pty": "0.7.0", - "queue": "4.4.0", - "semver": "5.4.1", + "ms": "2.1.1", + "node-fetch": "1.7.3", + "node-pty": "0.7.4", + "parse-url": "3.0.2", + "queue": "4.4.2", + "semver": "5.5.0", "shell-env": "0.3.0", - "uuid": "3.1.0", + "uuid": "3.2.1", "winreg": "1.2.4" } } diff --git a/app/plugins.js b/app/plugins.js index 10d57cc51627..0be9d458ebe6 100644 --- a/app/plugins.js +++ b/app/plugins.js @@ -6,10 +6,10 @@ const ms = require('ms'); const config = require('./config'); const notify = require('./notify'); -const _keys = require('./config/keymaps'); const {availableExtensions} = require('./plugins/extensions'); const {install} = require('./plugins/install'); const {plugs} = require('./config/paths'); +const mapKeys = require('./utils/map-keys'); // local storage const cache = new Config(); @@ -19,7 +19,7 @@ const localPath = plugs.local; // caches let plugins = config.getPlugins(); -let paths = getPaths(plugins); +let paths = getPaths(); let id = getId(plugins); let modules = requirePlugins(); @@ -43,6 +43,15 @@ config.subscribe(() => { } }); +function checkDeprecatedExtendKeymaps() { + modules.forEach(plugin => { + if (plugin.extendKeymaps) { + notify('Plugin warning!', `"${plugin._name}" use deprecated "extendKeymaps" handler`); + return; + } + }); +} + let updating = false; function updatePlugins({force = false} = {}) { @@ -56,17 +65,14 @@ function updatePlugins({force = false} = {}) { updating = false; if (err) { - console.error(err.stack); - notify( - 'Error updating plugins.', - err.message - ); + //eslint-disable-next-line no-console + notify('Error updating plugins.', err); } else { // flag successful plugin update cache.set('hyper.plugins', id_); // cache paths - paths = getPaths(plugins); + paths = getPaths(); // clear require cache clearCache(); @@ -81,19 +87,15 @@ function updatePlugins({force = false} = {}) { cache.set('hyper.plugin-versions', pluginVersions); // notify watchers + watchers.forEach(fn => fn(err, {force})); + if (force || changed) { if (changed) { - notify( - 'Plugins Updated', - 'Restart the app or hot-reload with "View" > "Reload" to enjoy the updates!' - ); + notify('Plugins Updated', 'Restart the app or hot-reload with "View" > "Reload" to enjoy the updates!'); } else { - notify( - 'Plugins Updated', - 'No changes!' - ); + notify('Plugins Updated', 'No changes!'); } - watchers.forEach(fn => fn(err, {force})); + checkDeprecatedExtendKeymaps(); } } }); @@ -101,16 +103,14 @@ function updatePlugins({force = false} = {}) { function getPluginVersions() { const paths_ = paths.plugins.concat(paths.localPlugins); - return paths_.map(path => { + return paths_.map(path_ => { let version = null; try { - // eslint-disable-next-line import/no-dynamic-require - version = require(resolve(path, 'package.json')).version; - } catch (err) { } - return [ - basename(path), - version - ]; + //eslint-disable-next-line import/no-dynamic-require + version = require(resolve(path_, 'package.json')).version; + //eslint-disable-next-line no-empty + } catch (err) {} + return [basename(path_), version]; }); } @@ -132,7 +132,7 @@ function clearCache() { exports.updatePlugins = updatePlugins; -exports.getLoadedPluginVersions = function () { +exports.getLoadedPluginVersions = () => { return modules.map(mod => ({name: mod._name, version: mod._version})); }; @@ -141,10 +141,11 @@ exports.getLoadedPluginVersions = function () { // to prevent slowness if (cache.get('hyper.plugins') !== id || process.env.HYPER_FORCE_UPDATE) { // install immediately if the user changed plugins + //eslint-disable-next-line no-console console.log('plugins have changed / not init, scheduling plugins installation'); setTimeout(() => { updatePlugins(); - }, 5000); + }, 1000); } // otherwise update plugins every 5 hours @@ -178,9 +179,9 @@ function alert(message) { }); } -function toDependencies(plugins) { +function toDependencies(plugins_) { const obj = {}; - plugins.plugins.forEach(plugin => { + plugins_.plugins.forEach(plugin => { const regex = /.(@|#)/; const match = regex.exec(plugin); @@ -198,7 +199,7 @@ function toDependencies(plugins) { return obj; } -exports.subscribe = function (fn) { +exports.subscribe = fn => { watchers.push(fn); return () => { watchers.splice(watchers.indexOf(fn), 1); @@ -208,7 +209,7 @@ exports.subscribe = function (fn) { function getPaths() { return { plugins: plugins.plugins.map(name => { - return resolve(path, 'node_modules', name.split('#')[0]); + return resolve(path, 'node_modules', name.split('#')[0].split('@')[0]); }), localPlugins: plugins.localPlugins.map(name => { return resolve(localPath, name); @@ -220,59 +221,75 @@ function getPaths() { exports.getPaths = getPaths; // get paths from renderer -exports.getBasePaths = function () { +exports.getBasePaths = () => { return {path, localPath}; }; function requirePlugins() { - const {plugins, localPlugins} = paths; + const {plugins: plugins_, localPlugins} = paths; - const load = path => { + const load = path_ => { let mod; try { // eslint-disable-next-line import/no-dynamic-require - mod = require(path); + mod = require(path_); const exposed = mod && Object.keys(mod).some(key => availableExtensions.has(key)); if (!exposed) { - notify('Plugin error!', `Plugin "${basename(path)}" does not expose any ` + - 'Hyper extension API methods'); + notify('Plugin error!', `Plugin "${basename(path_)}" does not expose any ` + 'Hyper extension API methods'); return; } // populate the name for internal errors here - mod._name = basename(path); + mod._name = basename(path_); try { // eslint-disable-next-line import/no-dynamic-require - mod._version = require(resolve(path, 'package.json')).version; + mod._version = require(resolve(path_, 'package.json')).version; } catch (err) { - console.warn(`No package.json found in ${path}`); + //eslint-disable-next-line no-console + console.warn(`No package.json found in ${path_}`); } + //eslint-disable-next-line no-console console.log(`Plugin ${mod._name} (${mod._version}) loaded.`); return mod; } catch (err) { - console.error(err); - notify('Plugin error!', `Plugin "${basename(path)}" failed to load (${err.message})`); + if (err.code === 'MODULE_NOT_FOUND') { + //eslint-disable-next-line no-console + console.warn(`Plugin "${basename(path_)}" not found: ${path_}`); + } else { + //eslint-disable-next-line no-console + console.error(err); + notify('Plugin error!', `Plugin "${basename(path_)}" failed to load (${err.message})`); + } } }; - return plugins.map(load) + return plugins_ + .map(load) .concat(localPlugins.map(load)) .filter(v => Boolean(v)); } -exports.onApp = function (app) { +exports.onApp = app_ => { modules.forEach(plugin => { if (plugin.onApp) { - plugin.onApp(app); + try { + plugin.onApp(app_); + } catch (e) { + notify('Plugin error!', `"${plugin._name}" has encountered an error. Check Developer Tools for details.`); + } } }); }; -exports.onWindow = function (win) { +exports.onWindow = win => { modules.forEach(plugin => { if (plugin.onWindow) { - plugin.onWindow(win); + try { + plugin.onWindow(win); + } catch (e) { + notify('Plugin error!', `"${plugin._name}" has encountered an error. Check Developer Tools for details.`); + } } }); }; @@ -283,7 +300,13 @@ function decorateObject(base, key) { let decorated = base; modules.forEach(plugin => { if (plugin[key]) { - const res = plugin[key](decorated); + let res; + try { + res = plugin[key](decorated); + } catch (e) { + notify('Plugin error!', `"${plugin._name}" when decorating ${key}`); + return; + } if (res && typeof res === 'object') { decorated = res; } else { @@ -295,29 +318,54 @@ function decorateObject(base, key) { return decorated; } -exports.extendKeymaps = function () { +exports.getDeprecatedConfig = () => { + const deprecated = {}; + const baseConfig = config.getConfig(); modules.forEach(plugin => { - if (plugin.extendKeymaps) { - const keys = _keys.extend(plugin.extendKeymaps()); - config.extendKeymaps(keys); + if (!plugin.decorateConfig) { + return; + } + // We need to clone config in case of plugin modifies config directly. + let configTmp; + try { + configTmp = plugin.decorateConfig(JSON.parse(JSON.stringify(baseConfig))); + } catch (e) { + notify('Plugin error!', `"${plugin._name}" has encountered an error. Check Developer Tools for details.`); + return; } + const pluginCSSDeprecated = config.getDeprecatedCSS(configTmp); + if (pluginCSSDeprecated.length === 0) { + return; + } + deprecated[plugin._name] = {css: pluginCSSDeprecated}; }); + return deprecated; }; -exports.decorateMenu = function (tpl) { +exports.decorateMenu = tpl => { return decorateObject(tpl, 'decorateMenu'); }; -exports.getDecoratedEnv = function (baseEnv) { +exports.getDecoratedEnv = baseEnv => { return decorateObject(baseEnv, 'decorateEnv'); }; -exports.getDecoratedConfig = function () { +exports.getDecoratedConfig = () => { const baseConfig = config.getConfig(); - return decorateObject(baseConfig, 'decorateConfig'); + const decoratedConfig = decorateObject(baseConfig, 'decorateConfig'); + const fixedConfig = config.fixConfigDefaults(decoratedConfig); + const translatedConfig = config.htermConfigTranslate(fixedConfig); + return translatedConfig; +}; + +exports.getDecoratedKeymaps = () => { + const baseKeymaps = config.getKeymaps(); + // Ensure that all keys are in an array and don't use deprecated key combination` + const decoratedKeymaps = mapKeys(decorateObject(baseKeymaps, 'decorateKeymaps')); + return decoratedKeymaps; }; -exports.getDecoratedBrowserOptions = function (defaults) { +exports.getDecoratedBrowserOptions = defaults => { return decorateObject(defaults, 'decorateBrowserOptions'); }; diff --git a/app/plugins/extensions.js b/app/plugins/extensions.js index 7cbefb04eeb4..102bb6c59dd6 100644 --- a/app/plugins/extensions.js +++ b/app/plugins/extensions.js @@ -1,18 +1,40 @@ module.exports = { availableExtensions: new Set([ - 'onApp', 'onWindow', 'onRendererWindow', 'onUnload', 'middleware', - 'reduceUI', 'reduceSessions', 'reduceTermGroups', - 'decorateMenu', 'decorateTerm', 'decorateHyper', + 'onApp', + 'onWindow', + 'onRendererWindow', + 'onUnload', + 'middleware', + 'reduceUI', + 'reduceSessions', + 'reduceTermGroups', + 'decorateBrowserOptions', + 'decorateMenu', + 'decorateTerm', + 'decorateHyper', 'decorateHyperTerm', // for backwards compatibility with hyperterm - 'decorateHeader', 'decorateTerms', 'decorateTab', - 'decorateNotification', 'decorateNotifications', - 'decorateTabs', 'decorateConfig', 'decorateEnv', - 'decorateTermGroup', 'decorateSplitPane', 'getTermProps', - 'getTabProps', 'getTabsProps', 'getTermGroupProps', - 'mapHyperTermState', 'mapTermsState', - 'mapHeaderState', 'mapNotificationsState', - 'mapHyperTermDispatch', 'mapTermsDispatch', - 'mapHeaderDispatch', 'mapNotificationsDispatch', - 'extendKeymaps' + 'decorateHeader', + 'decorateTerms', + 'decorateTab', + 'decorateNotification', + 'decorateNotifications', + 'decorateTabs', + 'decorateConfig', + 'decorateKeymaps', + 'decorateEnv', + 'decorateTermGroup', + 'decorateSplitPane', + 'getTermProps', + 'getTabProps', + 'getTabsProps', + 'getTermGroupProps', + 'mapHyperTermState', + 'mapTermsState', + 'mapHeaderState', + 'mapNotificationsState', + 'mapHyperTermDispatch', + 'mapTermsDispatch', + 'mapHeaderDispatch', + 'mapNotificationsDispatch' ]) }; diff --git a/app/plugins/install.js b/app/plugins/install.js index a4824a527fa0..145365b90156 100644 --- a/app/plugins/install.js +++ b/app/plugins/install.js @@ -13,23 +13,28 @@ module.exports = { }; spawnQueue.push(end => { const cmd = [process.execPath, yarn].concat(args).join(' '); + //eslint-disable-next-line no-console console.log('Launching yarn:', cmd); - cp.execFile(process.execPath, [yarn].concat(args), { - cwd: plugs.base, - env, - timeout: ms('5m'), - maxBuffer: 1024 * 1024 - }, err => { - if (err) { - cb(err); - } else { - cb(null); + cp.execFile( + process.execPath, + [yarn].concat(args), + { + cwd: plugs.base, + env, + timeout: ms('5m'), + maxBuffer: 1024 * 1024 + }, + (err, stdout, stderr) => { + if (err) { + cb(stderr); + } else { + cb(null); + } + end(); + spawnQueue.start(); } - - end(); - spawnQueue.start(); - }); + ); }); spawnQueue.start(); diff --git a/app/rpc.js b/app/rpc.js index cffd5da8851a..547f9dcf6af5 100644 --- a/app/rpc.js +++ b/app/rpc.js @@ -3,7 +3,6 @@ const {ipcMain} = require('electron'); const uuid = require('uuid'); class Server extends EventEmitter { - constructor(win) { super(); this.win = win; @@ -48,7 +47,6 @@ class Server extends EventEmitter { this.destroyed = true; } } - } module.exports = win => { diff --git a/app/session.js b/app/session.js index 8ce1ba55d9b4..c9bf8cfdc28b 100644 --- a/app/session.js +++ b/app/session.js @@ -8,7 +8,10 @@ const {getDecoratedEnv} = require('./plugins'); const {productName, version} = require('./package'); const config = require('./config'); -const createNodePtyError = () => new Error('`node-pty` failed to load. Typically this means that it was built incorrectly. Please check the `readme.md` to more info.'); +const createNodePtyError = () => + new Error( + '`node-pty` failed to load. Typically this means that it was built incorrectly. Please check the `readme.md` to more info.' + ); let spawn; try { @@ -20,15 +23,20 @@ try { const envFromConfig = config.getConfig().env || {}; module.exports = class Session extends EventEmitter { - constructor({rows, cols: columns, cwd, shell, shellArgs}) { super(); - const baseEnv = Object.assign({}, process.env, { - LANG: app.getLocale().replace('-', '_') + '.UTF-8', - TERM: 'xterm-256color', - TERM_PROGRAM: productName, - TERM_PROGRAM_VERSION: version - }, envFromConfig); + const baseEnv = Object.assign( + {}, + process.env, + { + LANG: app.getLocale().replace('-', '_') + '.UTF-8', + TERM: 'xterm-256color', + COLORTERM: 'truecolor', + TERM_PROGRAM: productName, + TERM_PROGRAM_VERSION: version + }, + envFromConfig + ); // Electron has a default value for process.env.GOOGLE_API_KEY // We don't want to leak this to the shell @@ -85,6 +93,7 @@ module.exports = class Session extends EventEmitter { try { this.pty.resize(cols, rows); } catch (err) { + //eslint-disable-next-line no-console console.error(err.stack); } } @@ -93,10 +102,10 @@ module.exports = class Session extends EventEmitter { try { this.pty.kill(); } catch (err) { + //eslint-disable-next-line no-console console.error('exit error', err.stack); } this.emit('exit'); this.ended = true; } - }; diff --git a/app/system-context-menu.js b/app/system-context-menu.js index be429913632e..4d2eb08ef5d8 100644 --- a/app/system-context-menu.js +++ b/app/system-context-menu.js @@ -3,23 +3,26 @@ const Registry = require('winreg'); const appPath = `"${process.execPath}"`; const regKey = `\\Software\\Classes\\Directory\\background\\shell\\Hyper`; const regParts = [ - {key: 'command', name: '', value: `${appPath} "%V"`}, - {name: '', value: 'Open Hyper here'}, - {name: 'Icon', value: `${appPath}`} + {key: 'command', name: '', value: `${appPath} "%V"`}, + {name: '', value: 'Open Hyper here'}, + {name: 'Icon', value: `${appPath}`} ]; function addValues(hyperKey, commandKey, callback) { - hyperKey.set(regParts[1].name, Registry.REG_SZ, regParts[1].value, err => { - if (err) { - console.error(err.message); + hyperKey.set(regParts[1].name, Registry.REG_SZ, regParts[1].value, error => { + if (error) { + //eslint-disable-next-line no-console + console.error(error.message); } hyperKey.set(regParts[2].name, Registry.REG_SZ, regParts[2].value, err => { if (err) { + //eslint-disable-next-line no-console console.error(err.message); } - commandKey.set(regParts[0].name, Registry.REG_SZ, regParts[0].value, err => { - if (err) { - console.error(err.message); + commandKey.set(regParts[0].name, Registry.REG_SZ, regParts[0].value, err_ => { + if (err_) { + //eslint-disable-next-line no-console + console.error(err_.message); } callback(); }); @@ -27,24 +30,30 @@ function addValues(hyperKey, commandKey, callback) { }); } -exports.add = function (callback) { +exports.add = callback => { const hyperKey = new Registry({hive: 'HKCU', key: regKey}); - const commandKey = new Registry({hive: 'HKCU', key: `${regKey}\\${regParts[0].key}`}); + const commandKey = new Registry({ + hive: 'HKCU', + key: `${regKey}\\${regParts[0].key}` + }); - hyperKey.keyExists((err, exists) => { - if (err) { - console.error(err.message); + hyperKey.keyExists((error, exists) => { + if (error) { + //eslint-disable-next-line no-console + console.error(error.message); } if (exists) { - commandKey.keyExists((err, exists) => { - if (err) { - console.error(err.message); + commandKey.keyExists((err_, exists_) => { + if (err_) { + //eslint-disable-next-line no-console + console.error(err_.message); } - if (exists) { + if (exists_) { addValues(hyperKey, commandKey, callback); } else { commandKey.create(err => { if (err) { + //eslint-disable-next-line no-console console.error(err.message); } addValues(hyperKey, commandKey, callback); @@ -54,11 +63,13 @@ exports.add = function (callback) { } else { hyperKey.create(err => { if (err) { + //eslint-disable-next-line no-console console.error(err.message); } - commandKey.create(err => { - if (err) { - console.error(err.message); + commandKey.create(err_ => { + if (err_) { + //eslint-disable-next-line no-console + console.error(err_.message); } addValues(hyperKey, commandKey, callback); }); @@ -67,9 +78,10 @@ exports.add = function (callback) { }); }; -exports.remove = function (callback) { +exports.remove = callback => { new Registry({hive: 'HKCU', key: regKey}).destroy(err => { if (err) { + //eslint-disable-next-line no-console console.error(err.message); } callback(); diff --git a/app/ui/contextmenu.js b/app/ui/contextmenu.js new file mode 100644 index 000000000000..a854ba394441 --- /dev/null +++ b/app/ui/contextmenu.js @@ -0,0 +1,27 @@ +const editMenu = require('../menus/menus/edit'); +const shellMenu = require('../menus/menus/shell'); +const {execCommand} = require('../commands'); +const {getDecoratedKeymaps} = require('../plugins'); +const separator = {type: 'separator'}; + +const getCommandKeys = keymaps => + Object.keys(keymaps).reduce((commandKeys, command) => { + return Object.assign(commandKeys, { + [command]: keymaps[command][0] + }); + }, {}); + +// only display cut/copy when there's a cursor selection +const filterCutCopy = (selection, menuItem) => { + if (/^cut$|^copy$/.test(menuItem.role) && !selection) { + return; + } + return menuItem; +}; + +module.exports = (createWindow, selection) => { + const commandKeys = getCommandKeys(getDecoratedKeymaps()); + const _shell = shellMenu(commandKeys, execCommand).submenu; + const _edit = editMenu(commandKeys, execCommand).submenu.filter(filterCutCopy.bind(null, selection)); + return _edit.concat(separator, _shell).filter(menuItem => !menuItem.hasOwnProperty('enabled') || menuItem.enabled); +}; diff --git a/app/ui/window.js b/app/ui/window.js index 09bd48c9a625..923cfe42e9a8 100644 --- a/app/ui/window.js +++ b/app/ui/window.js @@ -4,33 +4,43 @@ const {parse: parseUrl} = require('url'); const uuid = require('uuid'); const fileUriToPath = require('file-uri-to-path'); const isDev = require('electron-is-dev'); -const AutoUpdater = require('../auto-updater'); +const updater = require('../updater'); const toElectronBackgroundColor = require('../utils/to-electron-background-color'); const {icon, cfgDir} = require('../config/paths'); const createRPC = require('../rpc'); const notify = require('../notify'); const fetchNotifications = require('../notifications'); const Session = require('../session'); +const contextMenuTemplate = require('./contextmenu'); +const {execCommand} = require('../commands'); module.exports = class Window { - constructor(options, cfg, fn) { - const opts = Object.assign({ - minWidth: 370, - minHeight: 190, - backgroundColor: toElectronBackgroundColor(cfg.backgroundColor || '#000'), - titleBarStyle: 'hidden-inset', - title: 'Hyper.app', - // we want to go frameless on windows and linux - frame: process.platform === 'darwin', - transparent: process.platform === 'darwin', - icon, - show: process.env.HYPER_DEBUG || process.env.HYPERTERM_DEBUG || isDev, - acceptFirstMouse: true - }, options); - const window = new BrowserWindow(app.plugins.getDecoratedBrowserOptions(opts)); + constructor(options_, cfg, fn) { + const winOpts = Object.assign( + { + minWidth: 370, + minHeight: 190, + backgroundColor: toElectronBackgroundColor(cfg.backgroundColor || '#000'), + titleBarStyle: 'hidden-inset', + title: 'Hyper.app', + // we want to go frameless on Windows and Linux + frame: process.platform === 'darwin', + transparent: process.platform === 'darwin', + icon, + show: process.env.HYPER_DEBUG || process.env.HYPERTERM_DEBUG || isDev, + acceptFirstMouse: true + }, + options_ + ); + const window = new BrowserWindow(app.plugins.getDecoratedBrowserOptions(winOpts)); const rpc = createRPC(window); const sessions = new Map(); + const updateBackgroundColor = () => { + const cfg_ = app.plugins.getDecoratedConfig(); + window.setBackgroundColor(toElectronBackgroundColor(cfg_.backgroundColor || '#000')); + }; + // config changes const cfgUnsubscribe = app.config.subscribe(() => { const cfg_ = app.plugins.getDecoratedConfig(); @@ -39,21 +49,19 @@ module.exports = class Window { window.webContents.send('config change'); // notify user that shell changes require new sessions - if (cfg_.shell !== cfg.shell || - JSON.stringify(cfg_.shellArgs) !== JSON.stringify(cfg.shellArgs)) { - notify( - 'Shell configuration changed!', - 'Open a new tab or window to start using the new shell' - ); + if (cfg_.shell !== cfg.shell || JSON.stringify(cfg_.shellArgs) !== JSON.stringify(cfg.shellArgs)) { + notify('Shell configuration changed!', 'Open a new tab or window to start using the new shell'); } // update background color if necessary + updateBackgroundColor(); + cfg = cfg_; }); rpc.on('init', () => { - window.setBackgroundColor(toElectronBackgroundColor(cfg.backgroundColor || '#000')); window.show(); + updateBackgroundColor(); // If no callback is passed to createWindow, // a new session will be created by default. @@ -66,37 +74,41 @@ module.exports = class Window { // and createWindow deifinition. It's executed in place of // the callback passed as parameter, and deleted right after. (app.windowCallback || fn)(window); - delete (app.windowCallback); + delete app.windowCallback; fetchNotifications(window); // auto updates - if (!isDev && process.platform !== 'linux') { - AutoUpdater(window); + if (!isDev) { + updater(window); } else { + //eslint-disable-next-line no-console console.log('ignoring auto updates during dev'); } }); rpc.on('new', options => { - const opts = Object.assign({ - rows: 40, - cols: 100, - cwd: process.argv[1] && isAbsolute(process.argv[1]) ? process.argv[1] : cfgDir, - splitDirection: undefined, - shell: cfg.shell, - shellArgs: cfg.shellArgs && Array.from(cfg.shellArgs) - }, options); - - const initSession = (opts, fn) => { - fn(uuid.v4(), new Session(opts)); + const sessionOpts = Object.assign( + { + rows: 40, + cols: 100, + cwd: process.argv[1] && isAbsolute(process.argv[1]) ? process.argv[1] : cfgDir, + splitDirection: undefined, + shell: cfg.shell, + shellArgs: cfg.shellArgs && Array.from(cfg.shellArgs) + }, + options + ); + + const initSession = (opts, fn_) => { + fn_(uuid.v4(), new Session(opts)); }; - initSession(opts, (uid, session) => { + initSession(sessionOpts, (uid, session) => { sessions.set(uid, session); rpc.emit('session add', { - rows: opts.rows, - cols: opts.cols, + rows: sessionOpts.rows, + cols: sessionOpts.cols, uid, - splitDirection: opts.splitDirection, + splitDirection: sessionOpts.splitDirection, shell: session.shell, pid: session.pty.pid }); @@ -116,6 +128,7 @@ module.exports = class Window { if (session) { session.exit(); } else { + //eslint-disable-next-line no-console console.log('session not found by', uid); } }); @@ -136,9 +149,9 @@ module.exports = class Window { const session = sessions.get(uid); if (escaped) { - const escapedData = session.shell.endsWith('cmd.exe') ? - `"${data}"` : // This is how cmd.exe does it - `'${data.replace(/'/g, `'\\''`)}'`; // Inside a single-quoted string nothing is interpreted + const escapedData = session.shell.endsWith('cmd.exe') + ? `"${data}"` // This is how cmd.exe does it + : `'${data.replace(/'/g, `'\\''`)}'`; // Inside a single-quoted string nothing is interpreted session.write(escapedData); } else { @@ -148,6 +161,11 @@ module.exports = class Window { rpc.on('open external', ({url}) => { shell.openExternal(url); }); + rpc.on('open context menu', selection => { + const {createWindow} = app; + const {buildFromTemplate} = Menu; + buildFromTemplate(contextMenuTemplate(createWindow, selection)).popup(window); + }); rpc.on('open hamburger menu', ({x, y}) => { Menu.getApplicationMenu().popup(Math.ceil(x), Math.ceil(y)); }); @@ -163,6 +181,10 @@ module.exports = class Window { rpc.on('close', () => { window.close(); }); + rpc.on('command', command => { + const focusedWindow = BrowserWindow.getFocusedWindow(); + execCommand(command, focusedWindow); + }); const deleteSessions = () => { sessions.forEach((session, key) => { session.removeAllListeners(); @@ -195,6 +217,15 @@ module.exports = class Window { } }); + // xterm makes link clickable + window.webContents.on('new-window', (event, url) => { + const protocol = typeof url === 'string' && parseUrl(url).protocol; + if (protocol === 'http:' || protocol === 'https:') { + event.preventDefault(); + shell.openExternal(url); + } + }); + // expose internals to extension authors window.rpc = rpc; window.sessions = sessions; @@ -210,6 +241,7 @@ module.exports = class Window { if (!err) { load(); window.webContents.send('plugins change'); + updateBackgroundColor(); } }); diff --git a/app/updater.js b/app/updater.js new file mode 100644 index 000000000000..461f4e7df099 --- /dev/null +++ b/app/updater.js @@ -0,0 +1,102 @@ +// Packages +const electron = require('electron'); +const {app} = electron; +const ms = require('ms'); +const retry = require('async-retry'); + +// Utilities +// eslint-disable-next-line no-unused-vars +const notify = require('./notify'); +const {version} = require('./package'); +const {getDecoratedConfig} = require('./plugins'); + +const {platform} = process; +const isLinux = platform === 'linux'; + +const autoUpdater = isLinux ? require('./auto-updater-linux') : electron.autoUpdater; + +let isInit = false; +// Default to the "stable" update channel +let canaryUpdates = false; + +const buildFeedUrl = (canary, currentVersion) => { + const updatePrefix = canary ? 'releases-canary' : 'releases'; + return `https://${updatePrefix}.hyper.is/update/${isLinux ? 'deb' : platform}/${currentVersion}`; +}; + +const isCanary = updateChannel => updateChannel === 'canary'; + +async function init() { + autoUpdater.on('error', (err, msg) => { + //eslint-disable-next-line no-console + console.error('Error fetching updates', msg + ' (' + err.stack + ')'); + }); + + const config = await retry(async () => { + const content = await getDecoratedConfig(); + + if (!content) { + throw new Error('No config content loaded'); + } + + return content; + }); + + // If defined in the config, switch to the "canary" channel + if (config.updateChannel && isCanary(config.updateChannel)) { + canaryUpdates = true; + } + + const feedURL = buildFeedUrl(canaryUpdates, version); + + autoUpdater.setFeedURL(feedURL); + + setTimeout(() => { + autoUpdater.checkForUpdates(); + }, ms('10s')); + + setInterval(() => { + autoUpdater.checkForUpdates(); + }, ms('30m')); + + isInit = true; +} + +module.exports = win => { + if (!isInit) { + init(); + } + + const {rpc} = win; + + const onupdate = (ev, releaseNotes, releaseName, date, updateUrl, onQuitAndInstall) => { + const releaseUrl = updateUrl || `https://github.com/zeit/hyper/releases/tag/${releaseName}`; + rpc.emit('update available', {releaseNotes, releaseName, releaseUrl, canInstall: !!onQuitAndInstall}); + }; + + const eventName = isLinux ? 'update-available' : 'update-downloaded'; + + autoUpdater.on(eventName, onupdate); + + rpc.once('quit and install', () => { + autoUpdater.quitAndInstall(); + }); + + app.config.subscribe(() => { + const {updateChannel} = app.plugins.getDecoratedConfig(); + const newUpdateIsCanary = isCanary(updateChannel); + + if (newUpdateIsCanary !== canaryUpdates) { + const feedURL = buildFeedUrl(newUpdateIsCanary, version); + + autoUpdater.setFeedURL(feedURL); + autoUpdater.checkForUpdates(); + + canaryUpdates = newUpdateIsCanary; + } + }); + + win.on('close', () => { + autoUpdater.removeListener(eventName, onupdate); + }); +}; diff --git a/app/utils/cli-install.js b/app/utils/cli-install.js new file mode 100644 index 000000000000..438b55881ba4 --- /dev/null +++ b/app/utils/cli-install.js @@ -0,0 +1,91 @@ +const pify = require('pify'); +const fs = require('fs'); +const path = require('path'); +const Registry = require('winreg'); + +const {cliScriptPath} = require('../config/paths'); + +const lstat = pify(fs.lstat); +const readlink = pify(fs.readlink); +const unlink = pify(fs.unlink); +const symlink = pify(fs.symlink); + +const target = '/usr/local/bin/hyper'; +const source = cliScriptPath; + +const checkInstall = () => { + return lstat(target) + .then(stat => stat.isSymbolicLink()) + .then(() => readlink(target)) + .then(link => link === source) + .catch(err => { + if (err.code === 'ENOENT') { + return false; + } + throw err; + }); +}; + +const createSymlink = () => { + return unlink(target) + .catch(err => { + if (err.code === 'ENOENT') { + return; + } + throw err; + }) + .then(() => symlink(source, target)); +}; + +exports.addSymlink = () => { + return checkInstall().then(isInstalled => { + if (isInstalled) { + return Promise.resolve(); + } + return createSymlink(); + }); +}; + +exports.addBinToUserPath = () => { + // Can't use pify because of param order of Registry.values callback + return new Promise((resolve, reject) => { + const envKey = new Registry({hive: 'HKCU', key: '\\Environment'}); + envKey.values((err, items) => { + if (err) { + reject(err); + return; + } + // C:\Users\\AppData\Local\hyper\app-\resources\bin + const binPath = path.dirname(cliScriptPath); + // C:\Users\\AppData\Local\hyper + const basePath = path.resolve(binPath, '../../..'); + + const pathItem = items.find(item => item.name.toUpperCase() === 'PATH'); + + let newPathValue = binPath; + const pathItemName = pathItem ? pathItem.name : 'PATH'; + if (pathItem) { + const pathParts = pathItem.value.split(';'); + const existingPath = pathParts.find(pathPart => pathPart === binPath); + if (existingPath) { + resolve(); + return; + } + + // Because version is in path we need to remove old path if present and add current path + newPathValue = pathParts + .filter(pathPart => !pathPart.startsWith(basePath)) + .concat([binPath]) + .join(';'); + } + + envKey.set(pathItemName, Registry.REG_SZ, newPathValue, error => { + if (error) { + reject(error); + return; + } + resolve(); + }); + }); + }); +}; diff --git a/lib/utils/colors.js b/app/utils/colors.js similarity index 55% rename from lib/utils/colors.js rename to app/utils/colors.js index f0137f4a216d..f571edd3b247 100644 --- a/lib/utils/colors.js +++ b/app/utils/colors.js @@ -19,13 +19,14 @@ const colorList = [ 'grayscale' ]; -export default function getColorList(colors) { - // For backwards compatibility, return early if it's already an array - if (Array.isArray(colors)) { +exports.getColorMap = colors => { + if (!Array.isArray(colors)) { return colors; } - - return colorList.map(colorName => { - return colors[colorName]; - }); -} + return colors.reduce((result, color, index) => { + if (index < colorList.length) { + result[colorList[index]] = color; + } + return result; + }, {}); +}; diff --git a/app/utils/keymaps/find-command-by-keys.js b/app/utils/keymaps/find-command-by-keys.js deleted file mode 100644 index 5cba0d05adc1..000000000000 --- a/app/utils/keymaps/find-command-by-keys.js +++ /dev/null @@ -1,5 +0,0 @@ -const normalize = require('./normalize'); - -module.exports = (keys, commands) => { - return commands[normalize(keys)]; -}; diff --git a/app/utils/keymaps/get-command.js b/app/utils/keymaps/get-command.js deleted file mode 100644 index a27dd3ede68f..000000000000 --- a/app/utils/keymaps/get-command.js +++ /dev/null @@ -1,6 +0,0 @@ -const {getKeymaps} = require('../../config'); -const findCommandByKeys = require('./find-command-by-keys'); - -module.exports = keys => { - return findCommandByKeys(keys, getKeymaps().keys); -}; diff --git a/app/utils/keymaps/normalize.js b/app/utils/keymaps/normalize.js deleted file mode 100644 index 934fa48cd4af..000000000000 --- a/app/utils/keymaps/normalize.js +++ /dev/null @@ -1,13 +0,0 @@ -// This function receives a keymap in any key order and returns -// the same keymap alphatetically sorted by the clients locale. -// eg.: cmd+alt+o -> alt+cmd+o -// We do this in order to normalize what the user defined to what we -// internally parse. By doing this, you can set your keymaps in any given order -// eg.: alt+cmd+o, cmd+alt+o, o+alt+cmd, etc. #2195 -module.exports = keybinding => { - function sortAlphabetically(a, b) { - return a.localeCompare(b); - } - - return keybinding.toLowerCase().split('+').sort(sortAlphabetically).join('+'); -}; diff --git a/app/utils/map-keys.js b/app/utils/map-keys.js new file mode 100644 index 000000000000..c5f99fb5d56f --- /dev/null +++ b/app/utils/map-keys.js @@ -0,0 +1,41 @@ +const generatePrefixedCommand = (command, shortcuts) => { + const result = {}; + const baseCmd = command.replace(/:prefix$/, ''); + for (let i = 1; i <= 9; i++) { + // 9 is a special number because it means 'last' + const index = i === 9 ? 'last' : i; + const prefixedShortcuts = shortcuts.map(shortcut => `${shortcut}+${i}`); + result[`${baseCmd}:${index}`] = prefixedShortcuts; + } + + return result; +}; + +module.exports = config => { + return Object.keys(config).reduce((keymap, command) => { + if (!command) { + return; + } + // We can have different keys for a same command. + const shortcuts = Array.isArray(config[command]) ? config[command] : [config[command]]; + const fixedShortcuts = []; + shortcuts.forEach(shortcut => { + let newShortcut = shortcut; + if (newShortcut.indexOf('cmd') !== -1) { + // Mousetrap use `command` and not `cmd` + //eslint-disable-next-line no-console + console.warn('Your config use deprecated `cmd` in key combination. Please use `command` instead.'); + newShortcut = newShortcut.replace('cmd', 'command'); + } + fixedShortcuts.push(newShortcut); + }); + + if (command.endsWith(':prefix')) { + return Object.assign(keymap, generatePrefixedCommand(command, fixedShortcuts)); + } + + keymap[command] = fixedShortcuts; + + return keymap; + }, {}); +}; diff --git a/app/utils/to-electron-background-color.js b/app/utils/to-electron-background-color.js index 60bc82518e40..053abbae6446 100644 --- a/app/utils/to-electron-background-color.js +++ b/app/utils/to-electron-background-color.js @@ -13,5 +13,12 @@ module.exports = bgColor => { // http://stackoverflow.com/a/11019879/1202488 const alphaHex = Math.round(color.alpha() * 255).toString(16); - return '#' + alphaHex + color.hex().toString().substr(1); + return ( + '#' + + alphaHex + + color + .hex() + .toString() + .substr(1) + ); }; diff --git a/app/utils/window-utils.js b/app/utils/window-utils.js new file mode 100644 index 000000000000..7ba4eb912e0a --- /dev/null +++ b/app/utils/window-utils.js @@ -0,0 +1,14 @@ +const electron = require('electron'); + +function positionIsValid(position) { + const displays = electron.screen.getAllDisplays(); + const [x, y] = position; + + return displays.some(({workArea}) => { + return x >= workArea.x && x <= workArea.x + workArea.width && y >= workArea.y && y <= workArea.y + workArea.height; + }); +} + +module.exports = { + positionIsValid +}; diff --git a/app/yarn-error.log b/app/yarn-error.log new file mode 100644 index 000000000000..942a595e7efa --- /dev/null +++ b/app/yarn-error.log @@ -0,0 +1,518 @@ +Arguments: + /usr/local/bin/node /usr/local/Cellar/yarn/1.5.1_1/libexec/bin/yarn.js install --production + +PATH: + /Users/leo/projects/hyper/node_modules/.bin:/Users/leo/.config/yarn/link/node_modules/.bin:/Users/leo/projects/hyper/node_modules/.bin:/Users/leo/.config/yarn/link/node_modules/.bin:/usr/local/libexec/lib/node_modules/npm/bin/node-gyp-bin:/usr/local/lib/node_modules/npm/bin/node-gyp-bin:/usr/local/bin/node_modules/npm/bin/node-gyp-bin:/usr/local/opt/openvpn/sbin:/Users/leo/google-cloud-sdk/bin:/usr/local/bin:/usr/bin:/bin:/usr/sbin:/sbin:/usr/local/go/bin:/opt/X11/bin + +Yarn version: + 1.5.1 + +Node version: + 9.10.1 + +Platform: + darwin x64 + +npm manifest: + { + "name": "hyper", + "productName": "Hyper", + "description": "A terminal built on web technologies", + "version": "2.0.0-canary.17", + "license": "MIT", + "author": { + "name": "ZEIT, Inc.", + "email": "team@zeit.co" + }, + "repository": "zeit/hyper", + "dependencies": { + "async-retry": "1.1.4", + "color": "2.0.1", + "convert-css-color-name-to-hex": "0.1.1", + "default-shell": "1.0.1", + "electron-config": "1.0.0", + "electron-is-dev": "0.3.0", + "electron-squirrel-startup": "1.0.0", + "file-uri-to-path": "1.0.0", + "git-describe": "4.0.2", + "lodash": "4.17.5", + "mkdirp": "0.5.1", + "ms": "2.1.1", + "node-fetch": "1.7.3", + "node-pty": "0.7.4", + "parse-url": "3.0.2", + "queue": "4.4.2", + "semver": "5.5.0", + "shell-env": "0.3.0", + "uuid": "3.2.1", + "winreg": "1.2.4" + } + } + +yarn manifest: + No manifest + +Lockfile: + # THIS IS AN AUTOGENERATED FILE. DO NOT EDIT THIS FILE DIRECTLY. + # yarn lockfile v1 + + + ansi-regex@^2.0.0: + version "2.1.1" + resolved "https://registry.yarnpkg.com/ansi-regex/-/ansi-regex-2.1.1.tgz#c3b33ab5ee360d86e0e628f0468ae7ef27d654df" + + async-retry@1.1.4: + version "1.1.4" + resolved "https://registry.yarnpkg.com/async-retry/-/async-retry-1.1.4.tgz#e0edb546600f19bf90f892e9494faa9e19baf190" + dependencies: + retry "0.10.1" + + color-convert@^1.9.1: + version "1.9.1" + resolved "https://registry.yarnpkg.com/color-convert/-/color-convert-1.9.1.tgz#c1261107aeb2f294ebffec9ed9ecad529a6097ed" + dependencies: + color-name "^1.1.1" + + color-name@^1.0.0, color-name@^1.1.1: + version "1.1.3" + resolved "https://registry.yarnpkg.com/color-name/-/color-name-1.1.3.tgz#a7d0558bd89c42f795dd42328f740831ca53bc25" + + color-string@^1.5.2: + version "1.5.2" + resolved "https://registry.yarnpkg.com/color-string/-/color-string-1.5.2.tgz#26e45814bc3c9a7cbd6751648a41434514a773a9" + dependencies: + color-name "^1.0.0" + simple-swizzle "^0.2.2" + + color@2.0.1: + version "2.0.1" + resolved "https://registry.yarnpkg.com/color/-/color-2.0.1.tgz#e4ed78a3c4603d0891eba5430b04b86314f4c839" + dependencies: + color-convert "^1.9.1" + color-string "^1.5.2" + + conf@^1.0.0: + version "1.2.0" + resolved "https://registry.yarnpkg.com/conf/-/conf-1.2.0.tgz#149af7408f0af6abd62c3e24cff747e41a0bc54f" + dependencies: + dot-prop "^4.1.0" + env-paths "^1.0.0" + make-dir "^1.0.0" + pkg-up "^2.0.0" + write-file-atomic "^2.3.0" + + convert-css-color-name-to-hex@0.1.1: + version "0.1.1" + resolved "https://registry.yarnpkg.com/convert-css-color-name-to-hex/-/convert-css-color-name-to-hex-0.1.1.tgz#38ac4d27ca470593fd663b18a072a308926a35a2" + dependencies: + css-color-names "0.0.3" + is-css-color-name "^0.1.1" + + cross-spawn@^4.0.0: + version "4.0.2" + resolved "https://registry.yarnpkg.com/cross-spawn/-/cross-spawn-4.0.2.tgz#7b9247621c23adfdd3856004a823cbe397424d41" + dependencies: + lru-cache "^4.0.1" + which "^1.2.9" + + css-color-names@0.0.2: + version "0.0.2" + resolved "https://registry.yarnpkg.com/css-color-names/-/css-color-names-0.0.2.tgz#fba18e8cff86579572d749c146c47ee83f0ea955" + + css-color-names@0.0.3: + version "0.0.3" + resolved "https://registry.yarnpkg.com/css-color-names/-/css-color-names-0.0.3.tgz#de0cef16f4d8aa8222a320d5b6d7e9bbada7b9f6" + + debug@^2.2.0: + version "2.6.8" + resolved "https://registry.yarnpkg.com/debug/-/debug-2.6.8.tgz#e731531ca2ede27d188222427da17821d68ff4fc" + dependencies: + ms "2.0.0" + + default-shell@1.0.1, default-shell@^1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/default-shell/-/default-shell-1.0.1.tgz#752304bddc6174f49eb29cb988feea0b8813c8bc" + + dot-prop@^4.1.0: + version "4.2.0" + resolved "https://registry.yarnpkg.com/dot-prop/-/dot-prop-4.2.0.tgz#1f19e0c2e1aa0e32797c49799f2837ac6af69c57" + dependencies: + is-obj "^1.0.0" + + electron-config@1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/electron-config/-/electron-config-1.0.0.tgz#069d044cc794f04784ae72f12916725d3c8c39af" + dependencies: + conf "^1.0.0" + + electron-is-dev@0.3.0: + version "0.3.0" + resolved "https://registry.yarnpkg.com/electron-is-dev/-/electron-is-dev-0.3.0.tgz#14e6fda5c68e9e4ecbeff9ccf037cbd7c05c5afe" + + electron-squirrel-startup@1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/electron-squirrel-startup/-/electron-squirrel-startup-1.0.0.tgz#19b4e55933fa0ef8f556784b9c660f772546a0b8" + dependencies: + debug "^2.2.0" + + encoding@^0.1.11: + version "0.1.12" + resolved "https://registry.yarnpkg.com/encoding/-/encoding-0.1.12.tgz#538b66f3ee62cd1ab51ec323829d1f9480c74beb" + dependencies: + iconv-lite "~0.4.13" + + env-paths@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/env-paths/-/env-paths-1.0.0.tgz#4168133b42bb05c38a35b1ae4397c8298ab369e0" + + execa@^0.5.0: + version "0.5.1" + resolved "https://registry.yarnpkg.com/execa/-/execa-0.5.1.tgz#de3fb85cb8d6e91c85bcbceb164581785cb57b36" + dependencies: + cross-spawn "^4.0.0" + get-stream "^2.2.0" + is-stream "^1.1.0" + npm-run-path "^2.0.0" + p-finally "^1.0.0" + signal-exit "^3.0.0" + strip-eof "^1.0.0" + + file-uri-to-path@1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/file-uri-to-path/-/file-uri-to-path-1.0.0.tgz#553a7b8446ff6f684359c445f1e37a05dacc33dd" + + find-up@^2.1.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/find-up/-/find-up-2.1.0.tgz#45d1b7e506c717ddd482775a2b77920a3c0c57a7" + dependencies: + locate-path "^2.0.0" + + get-stream@^2.2.0: + version "2.3.1" + resolved "https://registry.yarnpkg.com/get-stream/-/get-stream-2.3.1.tgz#5f38f93f346009666ee0150a054167f91bdd95de" + dependencies: + object-assign "^4.0.1" + pinkie-promise "^2.0.0" + + git-describe@4.0.2: + version "4.0.2" + resolved "https://registry.yarnpkg.com/git-describe/-/git-describe-4.0.2.tgz#9ecc5e6df4658450c89ea35d10183c9f5f40dc73" + dependencies: + lodash "^4.16.6" + optionalDependencies: + semver "^5.3.0" + + graceful-fs@^4.1.11: + version "4.1.11" + resolved "https://registry.yarnpkg.com/graceful-fs/-/graceful-fs-4.1.11.tgz#0e8bdfe4d1ddb8854d64e04ea7c00e2a026e5658" + + iconv-lite@~0.4.13: + version "0.4.19" + resolved "https://registry.yarnpkg.com/iconv-lite/-/iconv-lite-0.4.19.tgz#f7468f60135f5e5dad3399c0a81be9a1603a082b" + + imurmurhash@^0.1.4: + version "0.1.4" + resolved "https://registry.yarnpkg.com/imurmurhash/-/imurmurhash-0.1.4.tgz#9218b9b2b928a238b13dc4fb6b6d576f231453ea" + + inherits@~2.0.0: + version "2.0.3" + resolved "https://registry.yarnpkg.com/inherits/-/inherits-2.0.3.tgz#633c2c83e3da42a502f52466022480f4208261de" + + is-arrayish@^0.3.1: + version "0.3.1" + resolved "https://registry.yarnpkg.com/is-arrayish/-/is-arrayish-0.3.1.tgz#c2dfc386abaa0c3e33c48db3fe87059e69065efd" + + is-css-color-name@^0.1.1: + version "0.1.3" + resolved "https://registry.yarnpkg.com/is-css-color-name/-/is-css-color-name-0.1.3.tgz#ea3b51bc901d8a243d32c9b7873d0680dbbef7f1" + dependencies: + css-color-names "0.0.2" + + is-obj@^1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/is-obj/-/is-obj-1.0.1.tgz#3e4729ac1f5fde025cd7d83a896dab9f4f67db0f" + + is-plain-obj@^1.0.0: + version "1.1.0" + resolved "https://registry.yarnpkg.com/is-plain-obj/-/is-plain-obj-1.1.0.tgz#71a50c8429dfca773c92a390a4a03b39fcd51d3e" + + is-ssh@^1.3.0: + version "1.3.0" + resolved "https://registry.yarnpkg.com/is-ssh/-/is-ssh-1.3.0.tgz#ebea1169a2614da392a63740366c3ce049d8dff6" + dependencies: + protocols "^1.1.0" + + is-stream@^1.0.1, is-stream@^1.1.0: + version "1.1.0" + resolved "https://registry.yarnpkg.com/is-stream/-/is-stream-1.1.0.tgz#12d4a3dd4e68e0b79ceb8dbc84173ae80d91ca44" + + isexe@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/isexe/-/isexe-2.0.0.tgz#e8fbf374dc556ff8947a10dcb0572d633f2cfa10" + + locate-path@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/locate-path/-/locate-path-2.0.0.tgz#2b568b265eec944c6d9c0de9c3dbbbca0354cd8e" + dependencies: + p-locate "^2.0.0" + path-exists "^3.0.0" + + lodash@4.17.5: + version "4.17.5" + resolved "https://registry.yarnpkg.com/lodash/-/lodash-4.17.5.tgz#99a92d65c0272debe8c96b6057bc8fbfa3bed511" + + lodash@^4.16.6: + version "4.17.4" + resolved "https://registry.yarnpkg.com/lodash/-/lodash-4.17.4.tgz#78203a4d1c328ae1d86dca6460e369b57f4055ae" + + lru-cache@^4.0.1: + version "4.1.1" + resolved "https://registry.yarnpkg.com/lru-cache/-/lru-cache-4.1.1.tgz#622e32e82488b49279114a4f9ecf45e7cd6bba55" + dependencies: + pseudomap "^1.0.2" + yallist "^2.1.2" + + make-dir@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/make-dir/-/make-dir-1.0.0.tgz#97a011751e91dd87cfadef58832ebb04936de978" + dependencies: + pify "^2.3.0" + + minimist@0.0.8: + version "0.0.8" + resolved "https://registry.yarnpkg.com/minimist/-/minimist-0.0.8.tgz#857fcabfc3397d2625b8228262e86aa7a011b05d" + + mkdirp@0.5.1: + version "0.5.1" + resolved "https://registry.yarnpkg.com/mkdirp/-/mkdirp-0.5.1.tgz#30057438eac6cf7f8c4767f38648d6697d75c903" + dependencies: + minimist "0.0.8" + + ms@2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/ms/-/ms-2.0.0.tgz#5608aeadfc00be6c2901df5f9861788de0d597c8" + + ms@2.1.1: + version "2.1.1" + resolved "https://registry.yarnpkg.com/ms/-/ms-2.1.1.tgz#30a5864eb3ebb0a66f2ebe6d727af06a09d86e0a" + + nan@^2.6.2: + version "2.7.0" + resolved "https://registry.yarnpkg.com/nan/-/nan-2.7.0.tgz#d95bf721ec877e08db276ed3fc6eb78f9083ad46" + + node-fetch@1.7.3: + version "1.7.3" + resolved "https://registry.yarnpkg.com/node-fetch/-/node-fetch-1.7.3.tgz#980f6f72d85211a5347c6b2bc18c5b84c3eb47ef" + dependencies: + encoding "^0.1.11" + is-stream "^1.0.1" + + node-pty@0.7.4: + version "0.7.4" + resolved "https://registry.yarnpkg.com/node-pty/-/node-pty-0.7.4.tgz#07146b2b40b76e432e57ce6750bda40f0da5c99f" + dependencies: + nan "^2.6.2" + + normalize-url@^1.9.1: + version "1.9.1" + resolved "https://registry.yarnpkg.com/normalize-url/-/normalize-url-1.9.1.tgz#2cc0d66b31ea23036458436e3620d85954c66c3c" + dependencies: + object-assign "^4.0.1" + prepend-http "^1.0.0" + query-string "^4.1.0" + sort-keys "^1.0.0" + + npm-run-path@^2.0.0: + version "2.0.2" + resolved "https://registry.yarnpkg.com/npm-run-path/-/npm-run-path-2.0.2.tgz#35a9232dfa35d7067b4cb2ddf2357b1871536c5f" + dependencies: + path-key "^2.0.0" + + object-assign@^4.0.1, object-assign@^4.1.0: + version "4.1.1" + resolved "https://registry.yarnpkg.com/object-assign/-/object-assign-4.1.1.tgz#2109adc7965887cfc05cbbd442cac8bfbb360863" + + p-finally@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/p-finally/-/p-finally-1.0.0.tgz#3fbcfb15b899a44123b34b6dcc18b724336a2cae" + + p-limit@^1.1.0: + version "1.1.0" + resolved "https://registry.yarnpkg.com/p-limit/-/p-limit-1.1.0.tgz#b07ff2d9a5d88bec806035895a2bab66a27988bc" + + p-locate@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/p-locate/-/p-locate-2.0.0.tgz#20a0103b222a70c8fd39cc2e580680f3dde5ec43" + dependencies: + p-limit "^1.1.0" + + parse-path@^3.0.1: + version "3.0.2" + resolved "https://registry.yarnpkg.com/parse-path/-/parse-path-3.0.2.tgz#4686980f0b262ee2dbb9a64eef739c91edc85245" + dependencies: + is-ssh "^1.3.0" + protocols "^1.4.0" + + parse-url@3.0.2: + version "3.0.2" + resolved "https://registry.yarnpkg.com/parse-url/-/parse-url-3.0.2.tgz#602787a7063a795d72b8673197505e72f60610be" + dependencies: + is-ssh "^1.3.0" + normalize-url "^1.9.1" + parse-path "^3.0.1" + protocols "^1.4.0" + + path-exists@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/path-exists/-/path-exists-3.0.0.tgz#ce0ebeaa5f78cb18925ea7d810d7b59b010fd515" + + path-key@^2.0.0: + version "2.0.1" + resolved "https://registry.yarnpkg.com/path-key/-/path-key-2.0.1.tgz#411cadb574c5a140d3a4b1910d40d80cc9f40b40" + + pify@^2.3.0: + version "2.3.0" + resolved "https://registry.yarnpkg.com/pify/-/pify-2.3.0.tgz#ed141a6ac043a849ea588498e7dca8b15330e90c" + + pinkie-promise@^2.0.0: + version "2.0.1" + resolved "https://registry.yarnpkg.com/pinkie-promise/-/pinkie-promise-2.0.1.tgz#2135d6dfa7a358c069ac9b178776288228450ffa" + dependencies: + pinkie "^2.0.0" + + pinkie@^2.0.0: + version "2.0.4" + resolved "https://registry.yarnpkg.com/pinkie/-/pinkie-2.0.4.tgz#72556b80cfa0d48a974e80e77248e80ed4f7f870" + + pkg-up@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/pkg-up/-/pkg-up-2.0.0.tgz#c819ac728059a461cab1c3889a2be3c49a004d7f" + dependencies: + find-up "^2.1.0" + + prepend-http@^1.0.0: + version "1.0.4" + resolved "https://registry.yarnpkg.com/prepend-http/-/prepend-http-1.0.4.tgz#d4f4562b0ce3696e41ac52d0e002e57a635dc6dc" + + protocols@^1.1.0, protocols@^1.4.0: + version "1.4.6" + resolved "https://registry.yarnpkg.com/protocols/-/protocols-1.4.6.tgz#f8bb263ea1b5fd7a7604d26b8be39bd77678bf8a" + + pseudomap@^1.0.2: + version "1.0.2" + resolved "https://registry.yarnpkg.com/pseudomap/-/pseudomap-1.0.2.tgz#f052a28da70e618917ef0a8ac34c1ae5a68286b3" + + query-string@^4.1.0: + version "4.3.4" + resolved "https://registry.yarnpkg.com/query-string/-/query-string-4.3.4.tgz#bbb693b9ca915c232515b228b1a02b609043dbeb" + dependencies: + object-assign "^4.1.0" + strict-uri-encode "^1.0.0" + + queue@4.4.2: + version "4.4.2" + resolved "https://registry.yarnpkg.com/queue/-/queue-4.4.2.tgz#5a9733d9a8b8bd1b36e934bc9c55ab89b28e29c7" + dependencies: + inherits "~2.0.0" + + retry@0.10.1: + version "0.10.1" + resolved "https://registry.yarnpkg.com/retry/-/retry-0.10.1.tgz#e76388d217992c252750241d3d3956fed98d8ff4" + + semver@5.5.0: + version "5.5.0" + resolved "https://registry.yarnpkg.com/semver/-/semver-5.5.0.tgz#dc4bbc7a6ca9d916dee5d43516f0092b58f7b8ab" + + semver@^5.3.0: + version "5.4.1" + resolved "https://registry.yarnpkg.com/semver/-/semver-5.4.1.tgz#e059c09d8571f0540823733433505d3a2f00b18e" + + shell-env@0.3.0: + version "0.3.0" + resolved "https://registry.yarnpkg.com/shell-env/-/shell-env-0.3.0.tgz#2250339022989165bda4eb7bf383afeaaa92dc34" + dependencies: + default-shell "^1.0.0" + execa "^0.5.0" + strip-ansi "^3.0.0" + + signal-exit@^3.0.0, signal-exit@^3.0.2: + version "3.0.2" + resolved "https://registry.yarnpkg.com/signal-exit/-/signal-exit-3.0.2.tgz#b5fdc08f1287ea1178628e415e25132b73646c6d" + + simple-swizzle@^0.2.2: + version "0.2.2" + resolved "https://registry.yarnpkg.com/simple-swizzle/-/simple-swizzle-0.2.2.tgz#a4da6b635ffcccca33f70d17cb92592de95e557a" + dependencies: + is-arrayish "^0.3.1" + + sort-keys@^1.0.0: + version "1.1.2" + resolved "https://registry.yarnpkg.com/sort-keys/-/sort-keys-1.1.2.tgz#441b6d4d346798f1b4e49e8920adfba0e543f9ad" + dependencies: + is-plain-obj "^1.0.0" + + strict-uri-encode@^1.0.0: + version "1.1.0" + resolved "https://registry.yarnpkg.com/strict-uri-encode/-/strict-uri-encode-1.1.0.tgz#279b225df1d582b1f54e65addd4352e18faa0713" + + strip-ansi@^3.0.0: + version "3.0.1" + resolved "https://registry.yarnpkg.com/strip-ansi/-/strip-ansi-3.0.1.tgz#6a385fb8853d952d5ff05d0e8aaf94278dc63dcf" + dependencies: + ansi-regex "^2.0.0" + + strip-eof@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/strip-eof/-/strip-eof-1.0.0.tgz#bb43ff5598a6eb05d89b59fcd129c983313606bf" + + uuid@3.2.1: + version "3.2.1" + resolved "https://registry.yarnpkg.com/uuid/-/uuid-3.2.1.tgz#12c528bb9d58d0b9265d9a2f6f0fe8be17ff1f14" + + which@^1.2.9: + version "1.3.0" + resolved "https://registry.yarnpkg.com/which/-/which-1.3.0.tgz#ff04bdfc010ee547d780bec38e1ac1c2777d253a" + dependencies: + isexe "^2.0.0" + + winreg@1.2.4: + version "1.2.4" + resolved "https://registry.yarnpkg.com/winreg/-/winreg-1.2.4.tgz#ba065629b7a925130e15779108cf540990e98d1b" + + write-file-atomic@^2.3.0: + version "2.3.0" + resolved "https://registry.yarnpkg.com/write-file-atomic/-/write-file-atomic-2.3.0.tgz#1ff61575c2e2a4e8e510d6fa4e243cce183999ab" + dependencies: + graceful-fs "^4.1.11" + imurmurhash "^0.1.4" + signal-exit "^3.0.2" + + yallist@^2.1.2: + version "2.1.2" + resolved "https://registry.yarnpkg.com/yallist/-/yallist-2.1.2.tgz#1c11f9218f076089a47dd512f93c6699a6a81d52" + +Trace: + Error: /Users/leo/projects/hyper/app/node_modules/node-pty: Command failed. + Exit code: 1 + Command: sh + Arguments: -c node scripts/install.js + Directory: /Users/leo/projects/hyper/app/node_modules/node-pty + Output: + module.js:545 + throw err; + ^ + + Error: Cannot find module '/usr/local/lib/node_modules/npm/node_modules/node-gyp/bin/node-gyp.js' + at Function.Module._resolveFilename (module.js:543:15) + at Function.Module._load (module.js:470:25) + at Function.Module.runMain (module.js:690:10) + at startup (bootstrap_node.js:194:16) + at bootstrap_node.js:666:3 + at ProcessTermError.MessageError (/usr/local/Cellar/yarn/1.5.1_1/libexec/lib/cli.js:186:110) + at new ProcessTermError (/usr/local/Cellar/yarn/1.5.1_1/libexec/lib/cli.js:226:113) + at ChildProcess. (/usr/local/Cellar/yarn/1.5.1_1/libexec/lib/cli.js:30281:17) + at ChildProcess.emit (events.js:180:13) + at maybeClose (internal/child_process.js:936:16) + at Socket.stream.socket.on (internal/child_process.js:353:11) + at Socket.emit (events.js:180:13) + at Pipe._handle.close [as _onclose] (net.js:541:12) diff --git a/app/yarn.lock b/app/yarn.lock index 4196cc1065d6..31cf61c9c31c 100644 --- a/app/yarn.lock +++ b/app/yarn.lock @@ -6,15 +6,15 @@ ansi-regex@^2.0.0: version "2.1.1" resolved "https://registry.yarnpkg.com/ansi-regex/-/ansi-regex-2.1.1.tgz#c3b33ab5ee360d86e0e628f0468ae7ef27d654df" -async-retry@1.1.3: - version "1.1.3" - resolved "https://registry.yarnpkg.com/async-retry/-/async-retry-1.1.3.tgz#1be664783337a0614999d543009a3b6e0de3609d" +async-retry@1.1.4: + version "1.1.4" + resolved "https://registry.yarnpkg.com/async-retry/-/async-retry-1.1.4.tgz#e0edb546600f19bf90f892e9494faa9e19baf190" dependencies: retry "0.10.1" -color-convert@^1.8.2: - version "1.9.0" - resolved "https://registry.yarnpkg.com/color-convert/-/color-convert-1.9.0.tgz#1accf97dd739b983bf994d56fec8f95853641b7a" +color-convert@^1.9.1: + version "1.9.1" + resolved "https://registry.yarnpkg.com/color-convert/-/color-convert-1.9.1.tgz#c1261107aeb2f294ebffec9ed9ecad529a6097ed" dependencies: color-name "^1.1.1" @@ -22,19 +22,19 @@ color-name@^1.0.0, color-name@^1.1.1: version "1.1.3" resolved "https://registry.yarnpkg.com/color-name/-/color-name-1.1.3.tgz#a7d0558bd89c42f795dd42328f740831ca53bc25" -color-string@^1.4.0: +color-string@^1.5.2: version "1.5.2" resolved "https://registry.yarnpkg.com/color-string/-/color-string-1.5.2.tgz#26e45814bc3c9a7cbd6751648a41434514a773a9" dependencies: color-name "^1.0.0" simple-swizzle "^0.2.2" -color@2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/color/-/color-2.0.0.tgz#e0c9972d1e969857004b101eaa55ceab5961d67d" +color@2.0.1: + version "2.0.1" + resolved "https://registry.yarnpkg.com/color/-/color-2.0.1.tgz#e4ed78a3c4603d0891eba5430b04b86314f4c839" dependencies: - color-convert "^1.8.2" - color-string "^1.4.0" + color-convert "^1.9.1" + color-string "^1.5.2" conf@^1.0.0: version "1.2.0" @@ -177,6 +177,16 @@ is-obj@^1.0.0: version "1.0.1" resolved "https://registry.yarnpkg.com/is-obj/-/is-obj-1.0.1.tgz#3e4729ac1f5fde025cd7d83a896dab9f4f67db0f" +is-plain-obj@^1.0.0: + version "1.1.0" + resolved "https://registry.yarnpkg.com/is-plain-obj/-/is-plain-obj-1.1.0.tgz#71a50c8429dfca773c92a390a4a03b39fcd51d3e" + +is-ssh@^1.3.0: + version "1.3.0" + resolved "https://registry.yarnpkg.com/is-ssh/-/is-ssh-1.3.0.tgz#ebea1169a2614da392a63740366c3ce049d8dff6" + dependencies: + protocols "^1.1.0" + is-stream@^1.0.1, is-stream@^1.1.0: version "1.1.0" resolved "https://registry.yarnpkg.com/is-stream/-/is-stream-1.1.0.tgz#12d4a3dd4e68e0b79ceb8dbc84173ae80d91ca44" @@ -192,7 +202,11 @@ locate-path@^2.0.0: p-locate "^2.0.0" path-exists "^3.0.0" -lodash@4.17.4, lodash@^4.16.6: +lodash@4.17.5: + version "4.17.5" + resolved "https://registry.yarnpkg.com/lodash/-/lodash-4.17.5.tgz#99a92d65c0272debe8c96b6057bc8fbfa3bed511" + +lodash@^4.16.6: version "4.17.4" resolved "https://registry.yarnpkg.com/lodash/-/lodash-4.17.4.tgz#78203a4d1c328ae1d86dca6460e369b57f4055ae" @@ -223,30 +237,43 @@ ms@2.0.0: version "2.0.0" resolved "https://registry.yarnpkg.com/ms/-/ms-2.0.0.tgz#5608aeadfc00be6c2901df5f9861788de0d597c8" +ms@2.1.1: + version "2.1.1" + resolved "https://registry.yarnpkg.com/ms/-/ms-2.1.1.tgz#30a5864eb3ebb0a66f2ebe6d727af06a09d86e0a" + nan@^2.6.2: version "2.7.0" resolved "https://registry.yarnpkg.com/nan/-/nan-2.7.0.tgz#d95bf721ec877e08db276ed3fc6eb78f9083ad46" -node-fetch@1.7.2: - version "1.7.2" - resolved "https://registry.yarnpkg.com/node-fetch/-/node-fetch-1.7.2.tgz#c54e9aac57e432875233525f3c891c4159ffefd7" +node-fetch@1.7.3: + version "1.7.3" + resolved "https://registry.yarnpkg.com/node-fetch/-/node-fetch-1.7.3.tgz#980f6f72d85211a5347c6b2bc18c5b84c3eb47ef" dependencies: encoding "^0.1.11" is-stream "^1.0.1" -node-pty@0.7.0: - version "0.7.0" - resolved "https://registry.yarnpkg.com/node-pty/-/node-pty-0.7.0.tgz#993038692d3a2921811a152658fc7dc211323ac2" +node-pty@0.7.4: + version "0.7.4" + resolved "https://registry.yarnpkg.com/node-pty/-/node-pty-0.7.4.tgz#07146b2b40b76e432e57ce6750bda40f0da5c99f" dependencies: nan "^2.6.2" +normalize-url@^1.9.1: + version "1.9.1" + resolved "https://registry.yarnpkg.com/normalize-url/-/normalize-url-1.9.1.tgz#2cc0d66b31ea23036458436e3620d85954c66c3c" + dependencies: + object-assign "^4.0.1" + prepend-http "^1.0.0" + query-string "^4.1.0" + sort-keys "^1.0.0" + npm-run-path@^2.0.0: version "2.0.2" resolved "https://registry.yarnpkg.com/npm-run-path/-/npm-run-path-2.0.2.tgz#35a9232dfa35d7067b4cb2ddf2357b1871536c5f" dependencies: path-key "^2.0.0" -object-assign@^4.0.1: +object-assign@^4.0.1, object-assign@^4.1.0: version "4.1.1" resolved "https://registry.yarnpkg.com/object-assign/-/object-assign-4.1.1.tgz#2109adc7965887cfc05cbbd442cac8bfbb360863" @@ -264,6 +291,22 @@ p-locate@^2.0.0: dependencies: p-limit "^1.1.0" +parse-path@^3.0.1: + version "3.0.2" + resolved "https://registry.yarnpkg.com/parse-path/-/parse-path-3.0.2.tgz#4686980f0b262ee2dbb9a64eef739c91edc85245" + dependencies: + is-ssh "^1.3.0" + protocols "^1.4.0" + +parse-url@3.0.2: + version "3.0.2" + resolved "https://registry.yarnpkg.com/parse-url/-/parse-url-3.0.2.tgz#602787a7063a795d72b8673197505e72f60610be" + dependencies: + is-ssh "^1.3.0" + normalize-url "^1.9.1" + parse-path "^3.0.1" + protocols "^1.4.0" + path-exists@^3.0.0: version "3.0.0" resolved "https://registry.yarnpkg.com/path-exists/-/path-exists-3.0.0.tgz#ce0ebeaa5f78cb18925ea7d810d7b59b010fd515" @@ -292,13 +335,28 @@ pkg-up@^2.0.0: dependencies: find-up "^2.1.0" +prepend-http@^1.0.0: + version "1.0.4" + resolved "https://registry.yarnpkg.com/prepend-http/-/prepend-http-1.0.4.tgz#d4f4562b0ce3696e41ac52d0e002e57a635dc6dc" + +protocols@^1.1.0, protocols@^1.4.0: + version "1.4.6" + resolved "https://registry.yarnpkg.com/protocols/-/protocols-1.4.6.tgz#f8bb263ea1b5fd7a7604d26b8be39bd77678bf8a" + pseudomap@^1.0.2: version "1.0.2" resolved "https://registry.yarnpkg.com/pseudomap/-/pseudomap-1.0.2.tgz#f052a28da70e618917ef0a8ac34c1ae5a68286b3" -queue@4.4.0: - version "4.4.0" - resolved "https://registry.yarnpkg.com/queue/-/queue-4.4.0.tgz#bf9139e62f440a00de4a7d5e1907a91282e4560d" +query-string@^4.1.0: + version "4.3.4" + resolved "https://registry.yarnpkg.com/query-string/-/query-string-4.3.4.tgz#bbb693b9ca915c232515b228b1a02b609043dbeb" + dependencies: + object-assign "^4.1.0" + strict-uri-encode "^1.0.0" + +queue@4.4.2: + version "4.4.2" + resolved "https://registry.yarnpkg.com/queue/-/queue-4.4.2.tgz#5a9733d9a8b8bd1b36e934bc9c55ab89b28e29c7" dependencies: inherits "~2.0.0" @@ -306,7 +364,11 @@ retry@0.10.1: version "0.10.1" resolved "https://registry.yarnpkg.com/retry/-/retry-0.10.1.tgz#e76388d217992c252750241d3d3956fed98d8ff4" -semver@5.4.1, semver@^5.3.0: +semver@5.5.0: + version "5.5.0" + resolved "https://registry.yarnpkg.com/semver/-/semver-5.5.0.tgz#dc4bbc7a6ca9d916dee5d43516f0092b58f7b8ab" + +semver@^5.3.0: version "5.4.1" resolved "https://registry.yarnpkg.com/semver/-/semver-5.4.1.tgz#e059c09d8571f0540823733433505d3a2f00b18e" @@ -328,6 +390,16 @@ simple-swizzle@^0.2.2: dependencies: is-arrayish "^0.3.1" +sort-keys@^1.0.0: + version "1.1.2" + resolved "https://registry.yarnpkg.com/sort-keys/-/sort-keys-1.1.2.tgz#441b6d4d346798f1b4e49e8920adfba0e543f9ad" + dependencies: + is-plain-obj "^1.0.0" + +strict-uri-encode@^1.0.0: + version "1.1.0" + resolved "https://registry.yarnpkg.com/strict-uri-encode/-/strict-uri-encode-1.1.0.tgz#279b225df1d582b1f54e65addd4352e18faa0713" + strip-ansi@^3.0.0: version "3.0.1" resolved "https://registry.yarnpkg.com/strip-ansi/-/strip-ansi-3.0.1.tgz#6a385fb8853d952d5ff05d0e8aaf94278dc63dcf" @@ -338,9 +410,9 @@ strip-eof@^1.0.0: version "1.0.0" resolved "https://registry.yarnpkg.com/strip-eof/-/strip-eof-1.0.0.tgz#bb43ff5598a6eb05d89b59fcd129c983313606bf" -uuid@3.1.0: - version "3.1.0" - resolved "https://registry.yarnpkg.com/uuid/-/uuid-3.1.0.tgz#3dd3d3e790abc24d7b0d3a034ffababe28ebbc04" +uuid@3.2.1: + version "3.2.1" + resolved "https://registry.yarnpkg.com/uuid/-/uuid-3.2.1.tgz#12c528bb9d58d0b9265d9a2f6f0fe8be17ff1f14" which@^1.2.9: version "1.3.0" diff --git a/appveyor.yml b/appveyor.yml index 5048629c7d1f..363dcdb3c4cb 100644 --- a/appveyor.yml +++ b/appveyor.yml @@ -27,5 +27,6 @@ test_script: - yarn run test on_success: + - IF %APPVEYOR_REPO_BRANCH%==canary cp build\canary.ico build\icon.ico - yarn run dist - - ps: ls .\dist\win\*.exe | % { Push-AppveyorArtifact $_.FullName } + - ps: Get-ChildItem .\dist\squirrel-windows\*.exe | % { Push-AppveyorArtifact $_.FullName } diff --git a/bin/yarn-standalone.js b/bin/yarn-standalone.js index 367b34a42417..cc3814c11ee1 100644 --- a/bin/yarn-standalone.js +++ b/bin/yarn-standalone.js @@ -1,42 +1,43 @@ #!/usr/bin/env node +module.exports = /******/ (function(modules) { // webpackBootstrap /******/ // The module cache /******/ var installedModules = {}; - +/******/ /******/ // The require function /******/ function __webpack_require__(moduleId) { - +/******/ /******/ // Check if module is in cache -/******/ if(installedModules[moduleId]) +/******/ if(installedModules[moduleId]) { /******/ return installedModules[moduleId].exports; - +/******/ } /******/ // Create a new module (and put it into the cache) /******/ var module = installedModules[moduleId] = { /******/ i: moduleId, /******/ l: false, /******/ exports: {} /******/ }; - +/******/ /******/ // Execute the module function /******/ modules[moduleId].call(module.exports, module, module.exports, __webpack_require__); - +/******/ /******/ // Flag the module as loaded /******/ module.l = true; - +/******/ /******/ // Return the exports of the module /******/ return module.exports; /******/ } - - +/******/ +/******/ /******/ // expose the modules object (__webpack_modules__) /******/ __webpack_require__.m = modules; - +/******/ /******/ // expose the module cache /******/ __webpack_require__.c = installedModules; - +/******/ /******/ // identity function for calling harmony imports with the correct context /******/ __webpack_require__.i = function(value) { return value; }; - +/******/ /******/ // define getter function for harmony exports /******/ __webpack_require__.d = function(exports, name, getter) { /******/ if(!__webpack_require__.o(exports, name)) { @@ -47,7 +48,7 @@ /******/ }); /******/ } /******/ }; - +/******/ /******/ // getDefaultExport function for compatibility with non-harmony modules /******/ __webpack_require__.n = function(module) { /******/ var getter = module && module.__esModule ? @@ -56,19 +57,25 @@ /******/ __webpack_require__.d(getter, 'a', getter); /******/ return getter; /******/ }; - +/******/ /******/ // Object.prototype.hasOwnProperty.call /******/ __webpack_require__.o = function(object, property) { return Object.prototype.hasOwnProperty.call(object, property); }; - +/******/ /******/ // __webpack_public_path__ /******/ __webpack_require__.p = ""; - +/******/ /******/ // Load entry module and return exports -/******/ return __webpack_require__(__webpack_require__.s = 593); +/******/ return __webpack_require__(__webpack_require__.s = 414); /******/ }) /************************************************************************/ /******/ ([ /* 0 */ +/***/ (function(module, exports) { + +module.exports = require("path"); + +/***/ }), +/* 1 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -76,7 +83,7 @@ exports.__esModule = true; -var _promise = __webpack_require__(375); +var _promise = __webpack_require__(173); var _promise2 = _interopRequireDefault(_promise); @@ -111,12 +118,6 @@ exports.default = function (fn) { }; }; -/***/ }), -/* 1 */ -/***/ (function(module, exports) { - -module.exports = require("path"); - /***/ }), /* 2 */ /***/ (function(module, exports) { @@ -142,11 +143,29 @@ class MessageError extends Error { } exports.MessageError = MessageError; +class ProcessSpawnError extends MessageError { + constructor(msg, code, process) { + super(msg, code); + this.process = process; + } + +} + +exports.ProcessSpawnError = ProcessSpawnError; class SecurityError extends MessageError {} exports.SecurityError = SecurityError; -class SpawnError extends MessageError {} -exports.SpawnError = SpawnError; +class ProcessTermError extends MessageError {} + +exports.ProcessTermError = ProcessTermError; +class ResponseError extends Error { + constructor(msg, responseCode) { + super(msg); + this.responseCode = responseCode; + } + +} +exports.ResponseError = ResponseError; /***/ }), /* 4 */ @@ -158,28 +177,47 @@ exports.SpawnError = SpawnError; Object.defineProperty(exports, "__esModule", { value: true }); -exports.makeTempDir = exports.hardlinksWork = exports.writeFilePreservingEol = exports.getFileSizeOnDisk = exports.walk = exports.symlink = exports.find = exports.readJsonAndFile = exports.readJson = exports.readFileAny = exports.hardlinkBulk = exports.copyBulk = exports.fileDatesEqual = exports.link = exports.chmod = exports.lstat = exports.exists = exports.mkdirp = exports.unlink = exports.stat = exports.access = exports.rename = exports.readdir = exports.realpath = exports.readlink = exports.writeFile = exports.readFileBuffer = exports.lockQueue = undefined; +exports.getFirstSuitableFolder = exports.readFirstAvailableStream = exports.makeTempDir = exports.hardlinksWork = exports.writeFilePreservingEol = exports.getFileSizeOnDisk = exports.walk = exports.symlink = exports.find = exports.readJsonAndFile = exports.readJson = exports.readFileAny = exports.hardlinkBulk = exports.copyBulk = exports.fileDatesEqual = exports.glob = exports.link = exports.chmod = exports.lstat = exports.exists = exports.mkdirp = exports.unlink = exports.stat = exports.access = exports.rename = exports.readdir = exports.realpath = exports.readlink = exports.writeFile = exports.readFileBuffer = exports.lockQueue = exports.constants = undefined; var _asyncToGenerator2; function _load_asyncToGenerator() { - return _asyncToGenerator2 = _interopRequireDefault(__webpack_require__(0)); + return _asyncToGenerator2 = _interopRequireDefault(__webpack_require__(1)); } let buildActionsForCopy = (() => { - var _ref = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (queue, events, possibleExtraneous, reporter) { + var _ref2 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (queue, events, possibleExtraneous, reporter) { // let build = (() => { - var _ref2 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (data) { + var _ref3 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (data) { const src = data.src, - dest = data.dest; + dest = data.dest, + type = data.type; const onFresh = data.onFresh || noop; const onDone = data.onDone || noop; - files.add(dest); - if (events.ignoreBasenames.indexOf(path.basename(src)) >= 0) { + // TODO https://github.com/yarnpkg/yarn/issues/3751 + // related to bundled dependencies handling + if (files.has(dest.toLowerCase())) { + reporter.verbose(`The case-insensitive file ${dest} shouldn't be copied twice in one bulk copy`); + } else { + files.add(dest.toLowerCase()); + } + + if (type === 'symlink') { + yield mkdirp((_path || _load_path()).default.dirname(dest)); + onFresh(); + actions.symlink.push({ + dest, + linkname: src + }); + onDone(); + return; + } + + if (events.ignoreBasenames.indexOf((_path || _load_path()).default.basename(src)) >= 0) { // ignored file return; } @@ -241,12 +279,12 @@ let buildActionsForCopy = (() => { for (const file of destFiles) { if (srcFiles.indexOf(file) < 0) { - const loc = path.join(dest, file); + const loc = (_path || _load_path()).default.join(dest, file); possibleExtraneous.add(loc); if ((yield lstat(loc)).isDirectory()) { for (const file of yield readdir(loc)) { - possibleExtraneous.add(path.join(loc, file)); + possibleExtraneous.add((_path || _load_path()).default.join(loc, file)); } } } @@ -254,11 +292,15 @@ let buildActionsForCopy = (() => { } } + if (destStat && destStat.isSymbolicLink()) { + yield unlink(dest); + destStat = null; + } + if (srcStat.isSymbolicLink()) { onFresh(); const linkname = yield readlink(src); - actions.push({ - type: 'symlink', + actions.symlink.push({ dest, linkname }); @@ -269,9 +311,9 @@ let buildActionsForCopy = (() => { yield mkdirp(dest); } - const destParts = dest.split(path.sep); + const destParts = dest.split((_path || _load_path()).default.sep); while (destParts.length) { - files.add(destParts.join(path.sep)); + files.add(destParts.join((_path || _load_path()).default.sep).toLowerCase()); destParts.pop(); } @@ -283,20 +325,19 @@ let buildActionsForCopy = (() => { } for (const file of srcFiles) { queue.push({ + dest: (_path || _load_path()).default.join(dest, file), onFresh, - src: path.join(src, file), - dest: path.join(dest, file), onDone: function () { if (--remaining === 0) { onDone(); } - } + }, + src: (_path || _load_path()).default.join(src, file) }); } } else if (srcStat.isFile()) { onFresh(); - actions.push({ - type: 'file', + actions.file.push({ src, dest, atime: srcStat.atime, @@ -309,8 +350,8 @@ let buildActionsForCopy = (() => { } }); - return function build(_x5) { - return _ref2.apply(this, arguments); + return function build(_x9) { + return _ref3.apply(this, arguments); }; })(); @@ -330,7 +371,11 @@ let buildActionsForCopy = (() => { events.onStart(queue.length); // start building actions - const actions = []; + const actions = { + file: [], + symlink: [], + link: [] + }; // custom concurrency logic as we're always executing stacks of CONCURRENT_QUEUE_ITEMS queue items // at a time due to the requirement to push items onto the queue @@ -348,7 +393,7 @@ let buildActionsForCopy = (() => { } for (const loc of possibleExtraneous) { - if (files.has(loc)) { + if (files.has(loc.toLowerCase())) { possibleExtraneous.delete(loc); } } @@ -356,25 +401,34 @@ let buildActionsForCopy = (() => { return actions; }); - return function buildActionsForCopy(_x, _x2, _x3, _x4) { - return _ref.apply(this, arguments); + return function buildActionsForCopy(_x5, _x6, _x7, _x8) { + return _ref2.apply(this, arguments); }; })(); let buildActionsForHardlink = (() => { - var _ref3 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (queue, events, possibleExtraneous, reporter) { + var _ref4 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (queue, events, possibleExtraneous, reporter) { // let build = (() => { - var _ref4 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (data) { + var _ref5 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (data) { const src = data.src, dest = data.dest; const onFresh = data.onFresh || noop; const onDone = data.onDone || noop; - files.add(dest); + if (files.has(dest.toLowerCase())) { + // Fixes issue https://github.com/yarnpkg/yarn/issues/2734 + // When bulk hardlinking we have A -> B structure that we want to hardlink to A1 -> B1, + // package-linker passes that modules A1 and B1 need to be hardlinked, + // the recursive linking algorithm of A1 ends up scheduling files in B1 to be linked twice which will case + // an exception. + onDone(); + return; + } + files.add(dest.toLowerCase()); - if (events.ignoreBasenames.indexOf(path.basename(src)) >= 0) { + if (events.ignoreBasenames.indexOf((_path || _load_path()).default.basename(src)) >= 0) { // ignored file return; } @@ -428,12 +482,12 @@ let buildActionsForHardlink = (() => { for (const file of destFiles) { if (srcFiles.indexOf(file) < 0) { - const loc = path.join(dest, file); + const loc = (_path || _load_path()).default.join(dest, file); possibleExtraneous.add(loc); if ((yield lstat(loc)).isDirectory()) { for (const file of yield readdir(loc)) { - possibleExtraneous.add(path.join(loc, file)); + possibleExtraneous.add((_path || _load_path()).default.join(loc, file)); } } } @@ -444,8 +498,7 @@ let buildActionsForHardlink = (() => { if (srcStat.isSymbolicLink()) { onFresh(); const linkname = yield readlink(src); - actions.push({ - type: 'symlink', + actions.symlink.push({ dest, linkname }); @@ -454,9 +507,9 @@ let buildActionsForHardlink = (() => { reporter.verbose(reporter.lang('verboseFileFolder', dest)); yield mkdirp(dest); - const destParts = dest.split(path.sep); + const destParts = dest.split((_path || _load_path()).default.sep); while (destParts.length) { - files.add(destParts.join(path.sep)); + files.add(destParts.join((_path || _load_path()).default.sep).toLowerCase()); destParts.pop(); } @@ -469,8 +522,8 @@ let buildActionsForHardlink = (() => { for (const file of srcFiles) { queue.push({ onFresh, - src: path.join(src, file), - dest: path.join(dest, file), + src: (_path || _load_path()).default.join(src, file), + dest: (_path || _load_path()).default.join(dest, file), onDone: function () { if (--remaining === 0) { onDone(); @@ -480,8 +533,7 @@ let buildActionsForHardlink = (() => { } } else if (srcStat.isFile()) { onFresh(); - actions.push({ - type: 'link', + actions.link.push({ src, dest, removeDest: destExists @@ -492,8 +544,8 @@ let buildActionsForHardlink = (() => { } }); - return function build(_x10) { - return _ref4.apply(this, arguments); + return function build(_x14) { + return _ref5.apply(this, arguments); }; })(); @@ -502,18 +554,20 @@ let buildActionsForHardlink = (() => { // initialise events for (const item of queue) { - const onDone = item.onDone; + const onDone = item.onDone || noop; item.onDone = function () { events.onProgress(item.dest); - if (onDone) { - onDone(); - } + onDone(); }; } events.onStart(queue.length); // start building actions - const actions = []; + const actions = { + file: [], + symlink: [], + link: [] + }; // custom concurrency logic as we're always executing stacks of CONCURRENT_QUEUE_ITEMS queue items // at a time due to the requirement to push items onto the queue @@ -531,7 +585,7 @@ let buildActionsForHardlink = (() => { } for (const loc of possibleExtraneous) { - if (files.has(loc)) { + if (files.has(loc.toLowerCase())) { possibleExtraneous.delete(loc); } } @@ -539,13 +593,13 @@ let buildActionsForHardlink = (() => { return actions; }); - return function buildActionsForHardlink(_x6, _x7, _x8, _x9) { - return _ref3.apply(this, arguments); + return function buildActionsForHardlink(_x10, _x11, _x12, _x13) { + return _ref4.apply(this, arguments); }; })(); let copyBulk = exports.copyBulk = (() => { - var _ref5 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (queue, reporter, _events) { + var _ref7 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (queue, reporter, _events) { const events = { onStart: _events && _events.onStart || noop, onProgress: _events && _events.onProgress || noop, @@ -555,80 +609,49 @@ let copyBulk = exports.copyBulk = (() => { }; const actions = yield buildActionsForCopy(queue, events, events.possibleExtraneous, reporter); - events.onStart(actions.length); + events.onStart(actions.file.length + actions.symlink.length + actions.link.length); - const fileActions = actions.filter(function (action) { - return action.type === 'file'; - }); + const fileActions = actions.file; - const currentlyWriting = {}; + const currentlyWriting = new Map(); yield (_promise || _load_promise()).queue(fileActions, (() => { - var _ref6 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (data) { + var _ref8 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (data) { let writePromise; - while (writePromise = currentlyWriting[data.dest]) { + while (writePromise = currentlyWriting.get(data.dest)) { yield writePromise; } - const cleanup = function () { - return delete currentlyWriting[data.dest]; - }; - return currentlyWriting[data.dest] = new Promise(function (resolve, reject) { - const readStream = fs.createReadStream(data.src); - const writeStream = fs.createWriteStream(data.dest, { mode: data.mode }); - - reporter.verbose(reporter.lang('verboseFileCopy', data.src, data.dest)); - - readStream.on('error', reject); - writeStream.on('error', reject); - - writeStream.on('open', function () { - readStream.pipe(writeStream); - }); - - writeStream.once('close', function () { - fs.utimes(data.dest, data.atime, data.mtime, function (err) { - if (err) { - reject(err); - } else { - events.onProgress(data.dest); - cleanup(); - resolve(); - } - }); - }); - }).then(function (arg) { - cleanup(); - return arg; - }).catch(function (arg) { - cleanup(); - throw arg; + reporter.verbose(reporter.lang('verboseFileCopy', data.src, data.dest)); + const copier = safeCopyFile(data, function () { + return currentlyWriting.delete(data.dest); }); + currentlyWriting.set(data.dest, copier); + events.onProgress(data.dest); + return copier; }); - return function (_x14) { - return _ref6.apply(this, arguments); + return function (_x20) { + return _ref8.apply(this, arguments); }; })(), CONCURRENT_QUEUE_ITEMS); // we need to copy symlinks last as they could reference files we were copying - const symlinkActions = actions.filter(function (action) { - return action.type === 'symlink'; - }); + const symlinkActions = actions.symlink; yield (_promise || _load_promise()).queue(symlinkActions, function (data) { - const linkname = path.resolve(path.dirname(data.dest), data.linkname); + const linkname = (_path || _load_path()).default.resolve((_path || _load_path()).default.dirname(data.dest), data.linkname); reporter.verbose(reporter.lang('verboseFileSymlink', data.dest, linkname)); return symlink(linkname, data.dest); }); }); - return function copyBulk(_x11, _x12, _x13) { - return _ref5.apply(this, arguments); + return function copyBulk(_x17, _x18, _x19) { + return _ref7.apply(this, arguments); }; })(); let hardlinkBulk = exports.hardlinkBulk = (() => { - var _ref7 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (queue, reporter, _events) { + var _ref9 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (queue, reporter, _events) { const events = { onStart: _events && _events.onStart || noop, onProgress: _events && _events.onProgress || noop, @@ -638,14 +661,12 @@ let hardlinkBulk = exports.hardlinkBulk = (() => { }; const actions = yield buildActionsForHardlink(queue, events, events.possibleExtraneous, reporter); - events.onStart(actions.length); + events.onStart(actions.file.length + actions.symlink.length + actions.link.length); - const fileActions = actions.filter(function (action) { - return action.type === 'link'; - }); + const fileActions = actions.link; yield (_promise || _load_promise()).queue(fileActions, (() => { - var _ref8 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (data) { + var _ref10 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (data) { reporter.verbose(reporter.lang('verboseFileLink', data.src, data.dest)); if (data.removeDest) { yield unlink(data.dest); @@ -653,29 +674,27 @@ let hardlinkBulk = exports.hardlinkBulk = (() => { yield link(data.src, data.dest); }); - return function (_x18) { - return _ref8.apply(this, arguments); + return function (_x24) { + return _ref10.apply(this, arguments); }; })(), CONCURRENT_QUEUE_ITEMS); // we need to copy symlinks last as they could reference files we were copying - const symlinkActions = actions.filter(function (action) { - return action.type === 'symlink'; - }); + const symlinkActions = actions.symlink; yield (_promise || _load_promise()).queue(symlinkActions, function (data) { - const linkname = path.resolve(path.dirname(data.dest), data.linkname); + const linkname = (_path || _load_path()).default.resolve((_path || _load_path()).default.dirname(data.dest), data.linkname); reporter.verbose(reporter.lang('verboseFileSymlink', data.dest, linkname)); return symlink(linkname, data.dest); }); }); - return function hardlinkBulk(_x15, _x16, _x17) { - return _ref7.apply(this, arguments); + return function hardlinkBulk(_x21, _x22, _x23) { + return _ref9.apply(this, arguments); }; })(); let readFileAny = exports.readFileAny = (() => { - var _ref9 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (files) { + var _ref11 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (files) { for (const file of files) { if (yield exists(file)) { return readFile(file); @@ -684,23 +703,23 @@ let readFileAny = exports.readFileAny = (() => { return null; }); - return function readFileAny(_x19) { - return _ref9.apply(this, arguments); + return function readFileAny(_x25) { + return _ref11.apply(this, arguments); }; })(); let readJson = exports.readJson = (() => { - var _ref10 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (loc) { + var _ref12 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (loc) { return (yield readJsonAndFile(loc)).object; }); - return function readJson(_x20) { - return _ref10.apply(this, arguments); + return function readJson(_x26) { + return _ref12.apply(this, arguments); }; })(); let readJsonAndFile = exports.readJsonAndFile = (() => { - var _ref11 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (loc) { + var _ref13 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (loc) { const file = yield readFile(loc); try { return { @@ -713,17 +732,17 @@ let readJsonAndFile = exports.readJsonAndFile = (() => { } }); - return function readJsonAndFile(_x21) { - return _ref11.apply(this, arguments); + return function readJsonAndFile(_x27) { + return _ref13.apply(this, arguments); }; })(); let find = exports.find = (() => { - var _ref12 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (filename, dir) { - const parts = dir.split(path.sep); + var _ref14 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (filename, dir) { + const parts = dir.split((_path || _load_path()).default.sep); while (parts.length) { - const loc = parts.concat(filename).join(path.sep); + const loc = parts.concat(filename).join((_path || _load_path()).default.sep); if (yield exists(loc)) { return loc; @@ -735,13 +754,13 @@ let find = exports.find = (() => { return false; }); - return function find(_x22, _x23) { - return _ref12.apply(this, arguments); + return function find(_x28, _x29) { + return _ref14.apply(this, arguments); }; })(); let symlink = exports.symlink = (() => { - var _ref13 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (src, dest) { + var _ref15 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (src, dest) { try { const stats = yield lstat(dest); @@ -767,11 +786,13 @@ let symlink = exports.symlink = (() => { // use relative paths otherwise which will be retained if the directory is moved let relative; if (yield exists(src)) { - relative = path.relative(fs.realpathSync(path.dirname(dest)), fs.realpathSync(src)); + relative = (_path || _load_path()).default.relative((_fs || _load_fs()).default.realpathSync((_path || _load_path()).default.dirname(dest)), (_fs || _load_fs()).default.realpathSync(src)); } else { - relative = path.relative(path.dirname(dest), src); + relative = (_path || _load_path()).default.relative((_path || _load_path()).default.dirname(dest), src); } - yield fsSymlink(relative, dest); + // When path.relative returns an empty string for the current directory, we should instead use + // '.', which is a valid fs.symlink target. + yield fsSymlink(relative || '.', dest); } } catch (err) { if (err.code === 'EEXIST') { @@ -783,13 +804,13 @@ let symlink = exports.symlink = (() => { } }); - return function symlink(_x24, _x25) { - return _ref13.apply(this, arguments); + return function symlink(_x30, _x31) { + return _ref15.apply(this, arguments); }; })(); let walk = exports.walk = (() => { - var _ref14 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (dir, relativeDir) { + var _ref16 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (dir, relativeDir) { let ignoreBasenames = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : new Set(); let files = []; @@ -802,8 +823,8 @@ let walk = exports.walk = (() => { } for (const name of filenames) { - const relative = relativeDir ? path.join(relativeDir, name) : name; - const loc = path.join(dir, name); + const relative = relativeDir ? (_path || _load_path()).default.join(relativeDir, name) : name; + const loc = (_path || _load_path()).default.join(dir, name); const stat = yield lstat(loc); files.push({ @@ -821,13 +842,13 @@ let walk = exports.walk = (() => { return files; }); - return function walk(_x26, _x27) { - return _ref14.apply(this, arguments); + return function walk(_x32, _x33) { + return _ref16.apply(this, arguments); }; })(); let getFileSizeOnDisk = exports.getFileSizeOnDisk = (() => { - var _ref15 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (loc) { + var _ref17 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (loc) { const stat = yield lstat(loc); const size = stat.size, blockSize = stat.blksize; @@ -836,13 +857,13 @@ let getFileSizeOnDisk = exports.getFileSizeOnDisk = (() => { return Math.ceil(size / blockSize) * blockSize; }); - return function getFileSizeOnDisk(_x29) { - return _ref15.apply(this, arguments); + return function getFileSizeOnDisk(_x35) { + return _ref17.apply(this, arguments); }; })(); let getEolFromFile = (() => { - var _ref16 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (path) { + var _ref18 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (path) { if (!(yield exists(path))) { return undefined; } @@ -860,30 +881,30 @@ let getEolFromFile = (() => { return undefined; }); - return function getEolFromFile(_x30) { - return _ref16.apply(this, arguments); + return function getEolFromFile(_x36) { + return _ref18.apply(this, arguments); }; })(); let writeFilePreservingEol = exports.writeFilePreservingEol = (() => { - var _ref17 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (path, data) { - const eol = (yield getEolFromFile(path)) || os.EOL; + var _ref19 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (path, data) { + const eol = (yield getEolFromFile(path)) || (_os || _load_os()).default.EOL; if (eol !== '\n') { data = data.replace(/\n/g, eol); } - yield (0, (_promise2 || _load_promise2()).promisify)(fs.writeFile)(path, data); + yield writeFile(path, data); }); - return function writeFilePreservingEol(_x31, _x32) { - return _ref17.apply(this, arguments); + return function writeFilePreservingEol(_x37, _x38) { + return _ref19.apply(this, arguments); }; })(); let hardlinksWork = exports.hardlinksWork = (() => { - var _ref18 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (dir) { + var _ref20 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (dir) { const filename = 'test-file' + Math.random(); - const file = path.join(dir, filename); - const fileLink = path.join(dir, filename + '-link'); + const file = (_path || _load_path()).default.join(dir, filename); + const fileLink = (_path || _load_path()).default.join(dir, filename + '-link'); try { yield writeFile(file, 'test'); yield link(file, fileLink); @@ -896,8 +917,8 @@ let hardlinksWork = exports.hardlinksWork = (() => { return true; }); - return function hardlinksWork(_x33) { - return _ref18.apply(this, arguments); + return function hardlinksWork(_x39) { + return _ref20.apply(this, arguments); }; })(); @@ -905,15 +926,81 @@ let hardlinksWork = exports.hardlinksWork = (() => { let makeTempDir = exports.makeTempDir = (() => { - var _ref19 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (prefix) { - const dir = path.join(os.tmpdir(), `yarn-${prefix || ''}-${Date.now()}-${Math.random()}`); + var _ref21 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (prefix) { + const dir = (_path || _load_path()).default.join((_os || _load_os()).default.tmpdir(), `yarn-${prefix || ''}-${Date.now()}-${Math.random()}`); yield unlink(dir); yield mkdirp(dir); return dir; }); - return function makeTempDir(_x34) { - return _ref19.apply(this, arguments); + return function makeTempDir(_x40) { + return _ref21.apply(this, arguments); + }; +})(); + +let readFirstAvailableStream = exports.readFirstAvailableStream = (() => { + var _ref22 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (paths) { + var _this = this; + + let stream; + const triedPaths = []; + for (const tarballPath of paths) { + if (tarballPath) { + try { + // We need the weird `await new Promise()` construct for `createReadStream` because + // it always returns a ReadStream object but immediately triggers an `error` event + // on it if it fails to open the file, instead of throwing an exception. If this event + // is not handled, it crashes node. A saner way to handle this with multiple tries is + // the following construct. + stream = yield new Promise(function (resolve, reject) { + const maybeStream = (_fs || _load_fs()).default.createReadStream(tarballPath); + maybeStream.on('error', reject).on('readable', resolve.bind(_this, maybeStream)); + }); + break; + } catch (err) { + // Try the next one + triedPaths.push(tarballPath); + } + } + } + + return { stream, triedPaths }; + }); + + return function readFirstAvailableStream(_x41) { + return _ref22.apply(this, arguments); + }; +})(); + +let getFirstSuitableFolder = exports.getFirstSuitableFolder = (() => { + var _ref23 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (paths) { + let mode = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : constants.W_OK | constants.X_OK; + + const result = { + skipped: [], + folder: null + }; + + for (const folder of paths) { + try { + yield mkdirp(folder); + yield access(folder, mode); + + result.folder = folder; + + return result; + } catch (error) { + result.skipped.push({ + error, + folder + }); + } + } + return result; + }); + + return function getFirstSuitableFolder(_x42) { + return _ref23.apply(this, arguments); }; })(); @@ -922,6 +1009,30 @@ exports.readFile = readFile; exports.readFileRaw = readFileRaw; exports.normalizeOS = normalizeOS; +var _fs; + +function _load_fs() { + return _fs = _interopRequireDefault(__webpack_require__(5)); +} + +var _glob; + +function _load_glob() { + return _glob = _interopRequireDefault(__webpack_require__(71)); +} + +var _os; + +function _load_os() { + return _os = _interopRequireDefault(__webpack_require__(41)); +} + +var _path; + +function _load_path() { + return _path = _interopRequireDefault(__webpack_require__(0)); +} + var _blockingQueue; function _load_blockingQueue() { @@ -931,52 +1042,80 @@ function _load_blockingQueue() { var _promise; function _load_promise() { - return _promise = _interopRequireWildcard(__webpack_require__(61)); + return _promise = _interopRequireWildcard(__webpack_require__(53)); } var _promise2; function _load_promise2() { - return _promise2 = __webpack_require__(61); + return _promise2 = __webpack_require__(53); } var _map; function _load_map() { - return _map = _interopRequireDefault(__webpack_require__(24)); + return _map = _interopRequireDefault(__webpack_require__(18)); } function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } } function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } -const path = __webpack_require__(1); - -const fs = __webpack_require__(5); -const os = __webpack_require__(106); +const constants = exports.constants = typeof (_fs || _load_fs()).default.constants !== 'undefined' ? (_fs || _load_fs()).default.constants : { + R_OK: (_fs || _load_fs()).default.R_OK, + W_OK: (_fs || _load_fs()).default.W_OK, + X_OK: (_fs || _load_fs()).default.X_OK +}; const lockQueue = exports.lockQueue = new (_blockingQueue || _load_blockingQueue()).default('fs lock'); -const readFileBuffer = exports.readFileBuffer = (0, (_promise2 || _load_promise2()).promisify)(fs.readFile); -const writeFile = exports.writeFile = (0, (_promise2 || _load_promise2()).promisify)(fs.writeFile); -const readlink = exports.readlink = (0, (_promise2 || _load_promise2()).promisify)(fs.readlink); -const realpath = exports.realpath = (0, (_promise2 || _load_promise2()).promisify)(fs.realpath); -const readdir = exports.readdir = (0, (_promise2 || _load_promise2()).promisify)(fs.readdir); -const rename = exports.rename = (0, (_promise2 || _load_promise2()).promisify)(fs.rename); -const access = exports.access = (0, (_promise2 || _load_promise2()).promisify)(fs.access); -const stat = exports.stat = (0, (_promise2 || _load_promise2()).promisify)(fs.stat); -const unlink = exports.unlink = (0, (_promise2 || _load_promise2()).promisify)(__webpack_require__(555)); -const mkdirp = exports.mkdirp = (0, (_promise2 || _load_promise2()).promisify)(__webpack_require__(149)); -const exists = exports.exists = (0, (_promise2 || _load_promise2()).promisify)(fs.exists, true); -const lstat = exports.lstat = (0, (_promise2 || _load_promise2()).promisify)(fs.lstat); -const chmod = exports.chmod = (0, (_promise2 || _load_promise2()).promisify)(fs.chmod); -const link = exports.link = (0, (_promise2 || _load_promise2()).promisify)(fs.link); - -const CONCURRENT_QUEUE_ITEMS = 4; - -const fsSymlink = (0, (_promise2 || _load_promise2()).promisify)(fs.symlink); -const invariant = __webpack_require__(7); -const stripBOM = __webpack_require__(253); +const readFileBuffer = exports.readFileBuffer = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.readFile); +const writeFile = exports.writeFile = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.writeFile); +const readlink = exports.readlink = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.readlink); +const realpath = exports.realpath = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.realpath); +const readdir = exports.readdir = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.readdir); +const rename = exports.rename = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.rename); +const access = exports.access = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.access); +const stat = exports.stat = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.stat); +const unlink = exports.unlink = (0, (_promise2 || _load_promise2()).promisify)(__webpack_require__(227)); +const mkdirp = exports.mkdirp = (0, (_promise2 || _load_promise2()).promisify)(__webpack_require__(115)); +const exists = exports.exists = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.exists, true); +const lstat = exports.lstat = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.lstat); +const chmod = exports.chmod = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.chmod); +const link = exports.link = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.link); +const glob = exports.glob = (0, (_promise2 || _load_promise2()).promisify)((_glob || _load_glob()).default); + +// fs.copyFile uses the native file copying instructions on the system, performing much better +// than any JS-based solution and consumes fewer resources. Repeated testing to fine tune the +// concurrency level revealed 128 as the sweet spot on a quad-core, 16 CPU Intel system with SSD. +const CONCURRENT_QUEUE_ITEMS = (_fs || _load_fs()).default.copyFile ? 128 : 4; + +const open = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.open); +const close = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.close); +const write = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.write); +const futimes = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.futimes); +const copyFile = (_fs || _load_fs()).default.copyFile ? // Don't use `promisify` to avoid passing the last, argument `data`, to the native method +(src, dest, flags, data) => new Promise((resolve, reject) => (_fs || _load_fs()).default.copyFile(src, dest, flags, err => err ? reject(err) : resolve(err))) : (() => { + var _ref = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (src, dest, flags, data) { + // Use open -> write -> futimes -> close sequence to avoid opening the file twice: + // one with writeFile and one with utimes + const fd = yield open(dest, 'w', data.mode); + try { + const buffer = yield readFileBuffer(src); + yield write(fd, buffer, 0, buffer.length); + yield futimes(fd, data.atime, data.mtime); + } finally { + yield close(fd); + } + }); + + return function (_x, _x2, _x3, _x4) { + return _ref.apply(this, arguments); + }; +})(); +const fsSymlink = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.symlink); +const invariant = __webpack_require__(6); +const stripBOM = __webpack_require__(120); const noop = () => {}; @@ -1014,9 +1153,32 @@ function copy(src, dest, reporter) { return copyBulk([{ src, dest }], reporter); } +/** + * Unlinks the destination to force a recreation. This is needed on case-insensitive file systems + * to force the correct naming when the filename has changed only in charater-casing. (Jest -> jest). + * It also calls a cleanup function once it is done. + * + * `data` contains target file attributes like mode, atime and mtime. Built-in copyFile copies these + * automatically but our polyfill needs the do this manually, thus needs the info. + */ +const safeCopyFile = (() => { + var _ref6 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (data, cleanup) { + try { + yield unlink(data.dest); + yield copyFile(data.src, data.dest, 0, data); + } finally { + cleanup(); + } + }); + + return function safeCopyFile(_x15, _x16) { + return _ref6.apply(this, arguments); + }; +})(); + function _readFile(loc, encoding) { return new Promise((resolve, reject) => { - fs.readFile(loc, encoding, function (err, content) { + (_fs || _load_fs()).default.readFile(loc, encoding, function (err, content) { if (err) { reject(err); } else { @@ -1049,12 +1211,6 @@ module.exports = require("fs"); /***/ }), /* 6 */ -/***/ (function(module, exports) { - -module.exports = require("crypto"); - -/***/ }), -/* 7 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -1114,7 +1270,7 @@ module.exports = invariant; /***/ }), -/* 8 */ +/* 7 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; @@ -1124,10 +1280,16 @@ Object.defineProperty(exports, "__esModule", { value: true }); exports.getPathKey = getPathKey; -const path = __webpack_require__(1); -const userHome = __webpack_require__(121).default; +const os = __webpack_require__(41); +const path = __webpack_require__(0); +const userHome = __webpack_require__(62).default; +const isWebpackBundle = __webpack_require__(218); const DEPENDENCY_TYPES = exports.DEPENDENCY_TYPES = ['devDependencies', 'dependencies', 'optionalDependencies', 'peerDependencies']; +const RESOLUTIONS = exports.RESOLUTIONS = 'resolutions'; +const MANIFEST_FIELDS = exports.MANIFEST_FIELDS = [RESOLUTIONS, ...DEPENDENCY_TYPES]; + +const SUPPORTED_NODE_VERSIONS = exports.SUPPORTED_NODE_VERSIONS = '^4.8.0 || ^5.7.0 || ^6.2.2 || >=8.0.0'; const YARN_REGISTRY = exports.YARN_REGISTRY = 'https://registry.yarnpkg.com'; @@ -1166,25 +1328,55 @@ function getDirectory(category) { return path.join(userHome, `.${category}`, 'yarn'); } -function getCacheDirectory() { +function getPreferredCacheDirectories() { + const preferredCacheDirectories = []; + if (process.platform === 'darwin') { - return path.join(userHome, 'Library', 'Caches', 'Yarn'); + preferredCacheDirectories.push(path.join(userHome, 'Library', 'Caches', 'Yarn')); + } else { + preferredCacheDirectories.push(getDirectory('cache')); + } + + if (process.getuid) { + // $FlowFixMe: process.getuid exists, dammit + preferredCacheDirectories.push(path.join(os.tmpdir(), `.yarn-cache-${process.getuid()}`)); } - return getDirectory('cache'); + preferredCacheDirectories.push(path.join(os.tmpdir(), `.yarn-cache`)); + + return preferredCacheDirectories; } -const MODULE_CACHE_DIRECTORY = exports.MODULE_CACHE_DIRECTORY = getCacheDirectory(); +const PREFERRED_MODULE_CACHE_DIRECTORIES = exports.PREFERRED_MODULE_CACHE_DIRECTORIES = getPreferredCacheDirectories(); const CONFIG_DIRECTORY = exports.CONFIG_DIRECTORY = getDirectory('config'); const LINK_REGISTRY_DIRECTORY = exports.LINK_REGISTRY_DIRECTORY = path.join(CONFIG_DIRECTORY, 'link'); const GLOBAL_MODULE_DIRECTORY = exports.GLOBAL_MODULE_DIRECTORY = path.join(CONFIG_DIRECTORY, 'global'); +const NODE_BIN_PATH = exports.NODE_BIN_PATH = process.execPath; +const YARN_BIN_PATH = exports.YARN_BIN_PATH = getYarnBinPath(); + +// Webpack needs to be configured with node.__dirname/__filename = false +function getYarnBinPath() { + if (isWebpackBundle) { + return __filename; + } else { + return path.join(__dirname, '..', 'bin', 'yarn.js'); + } +} + +const NODE_MODULES_FOLDER = exports.NODE_MODULES_FOLDER = 'node_modules'; +const NODE_PACKAGE_JSON = exports.NODE_PACKAGE_JSON = 'package.json'; + +const POSIX_GLOBAL_PREFIX = exports.POSIX_GLOBAL_PREFIX = `${process.env.DESTDIR || ''}/usr/local`; +const FALLBACK_GLOBAL_PREFIX = exports.FALLBACK_GLOBAL_PREFIX = path.join(userHome, '.yarn'); + const META_FOLDER = exports.META_FOLDER = '.yarn-meta'; const INTEGRITY_FILENAME = exports.INTEGRITY_FILENAME = '.yarn-integrity'; const LOCKFILE_FILENAME = exports.LOCKFILE_FILENAME = 'yarn.lock'; const METADATA_FILENAME = exports.METADATA_FILENAME = '.yarn-metadata.json'; const TARBALL_FILENAME = exports.TARBALL_FILENAME = '.yarn-tarball.tgz'; const CLEAN_FILENAME = exports.CLEAN_FILENAME = '.yarnclean'; +const ACCESS_FILENAME = exports.ACCESS_FILENAME = '.yarn-access'; const DEFAULT_INDENT = exports.DEFAULT_INDENT = ' '; const SINGLE_INSTANCE_PORT = exports.SINGLE_INSTANCE_PORT = 31997; @@ -1209,15 +1401,149 @@ function getPathKey(platform, env) { return pathKey; } +const VERSION_COLOR_SCHEME = exports.VERSION_COLOR_SCHEME = { + major: 'red', + premajor: 'red', + minor: 'yellow', + preminor: 'yellow', + patch: 'green', + prepatch: 'green', + prerelease: 'red', + unchanged: 'white', + unknown: 'red' +}; + +/***/ }), +/* 8 */ +/***/ (function(module, exports) { + +module.exports = require("crypto"); + /***/ }), /* 9 */ /***/ (function(module, exports, __webpack_require__) { +var store = __webpack_require__(104)('wks') + , uid = __webpack_require__(107) + , Symbol = __webpack_require__(13).Symbol + , USE_SYMBOL = typeof Symbol == 'function'; + +var $exports = module.exports = function(name){ + return store[name] || (store[name] = + USE_SYMBOL && Symbol[name] || (USE_SYMBOL ? Symbol : uid)('Symbol.' + name)); +}; + +$exports.store = store; + +/***/ }), +/* 10 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.sortAlpha = sortAlpha; +exports.entries = entries; +exports.removePrefix = removePrefix; +exports.removeSuffix = removeSuffix; +exports.addSuffix = addSuffix; +exports.hyphenate = hyphenate; +exports.camelCase = camelCase; +exports.compareSortedArrays = compareSortedArrays; +exports.sleep = sleep; +const _camelCase = __webpack_require__(177); + +function sortAlpha(a, b) { + // sort alphabetically in a deterministic way + const shortLen = Math.min(a.length, b.length); + for (let i = 0; i < shortLen; i++) { + const aChar = a.charCodeAt(i); + const bChar = b.charCodeAt(i); + if (aChar !== bChar) { + return aChar - bChar; + } + } + return a.length - b.length; +} + +function entries(obj) { + const entries = []; + if (obj) { + for (const key in obj) { + entries.push([key, obj[key]]); + } + } + return entries; +} + +function removePrefix(pattern, prefix) { + if (pattern.startsWith(prefix)) { + pattern = pattern.slice(prefix.length); + } + + return pattern; +} + +function removeSuffix(pattern, suffix) { + if (pattern.endsWith(suffix)) { + return pattern.slice(0, -suffix.length); + } + + return pattern; +} + +function addSuffix(pattern, suffix) { + if (!pattern.endsWith(suffix)) { + return pattern + suffix; + } + + return pattern; +} + +function hyphenate(str) { + return str.replace(/[A-Z]/g, match => { + return '-' + match.charAt(0).toLowerCase(); + }); +} + +function camelCase(str) { + if (/[A-Z]/.test(str)) { + return null; + } else { + return _camelCase(str); + } +} + +function compareSortedArrays(array1, array2) { + if (array1.length !== array2.length) { + return false; + } + for (let i = 0, len = array1.length; i < len; i++) { + if (array1[i] !== array2[i]) { + return false; + } + } + return true; +} + +function sleep(ms) { + return new Promise(resolve => { + setTimeout(resolve, ms); + }); +} + +/***/ }), +/* 11 */ +/***/ (function(module, exports, __webpack_require__) { + // Copyright (c) 2012, Mark Cavage. All rights reserved. // Copyright 2015 Joyent, Inc. -var assert = __webpack_require__(22); -var Stream = __webpack_require__(14).Stream; +var assert = __webpack_require__(20); +var Stream = __webpack_require__(25).Stream; var util = __webpack_require__(2); @@ -1426,105 +1752,6 @@ function _setExports(ndebug) { module.exports = _setExports(process.env.NODE_NDEBUG); -/***/ }), -/* 10 */ -/***/ (function(module, exports, __webpack_require__) { - -"use strict"; - - -Object.defineProperty(exports, "__esModule", { - value: true -}); -exports.sortAlpha = sortAlpha; -exports.entries = entries; -exports.removePrefix = removePrefix; -exports.removeSuffix = removeSuffix; -exports.addSuffix = addSuffix; -exports.hyphenate = hyphenate; -exports.camelCase = camelCase; -exports.compareSortedArrays = compareSortedArrays; -const _camelCase = __webpack_require__(381); - -function sortAlpha(a, b) { - // sort alphabetically in a deterministic way - const shortLen = Math.min(a.length, b.length); - for (let i = 0; i < shortLen; i++) { - const aChar = a.charCodeAt(i); - const bChar = b.charCodeAt(i); - if (aChar !== bChar) { - return aChar - bChar; - } - } - return a.length - b.length; -} - -function entries(obj) { - const entries = []; - if (obj) { - for (const key in obj) { - entries.push([key, obj[key]]); - } - } - return entries; -} - -function removePrefix(pattern, prefix) { - if (pattern.startsWith(prefix)) { - pattern = pattern.slice(prefix.length); - } - - return pattern; -} - -function removeSuffix(pattern, suffix) { - if (pattern.endsWith(suffix)) { - return pattern.slice(0, -suffix.length); - } - - return pattern; -} - -function addSuffix(pattern, suffix) { - if (!pattern.endsWith(suffix)) { - return pattern + suffix; - } - - return pattern; -} - -function hyphenate(str) { - return str.replace(/[A-Z]/g, match => { - return '-' + match.charAt(0).toLowerCase(); - }); -} - -function camelCase(str) { - if (/[A-Z]/.test(str)) { - return null; - } else { - return _camelCase(str); - } -} - -function compareSortedArrays(array1, array2) { - if (array1.length !== array2.length) { - return false; - } - for (let i = 0, len = array1.length; i < len; i++) { - if (array1[i] !== array2[i]) { - return false; - } - } - return true; -} - -/***/ }), -/* 11 */ -/***/ (function(module, exports) { - -module.exports = require("url"); - /***/ }), /* 12 */ /***/ (function(module, exports, __webpack_require__) { @@ -1532,363 +1759,6 @@ module.exports = require("url"); "use strict"; -exports.__esModule = true; - -var _isIterable2 = __webpack_require__(373); - -var _isIterable3 = _interopRequireDefault(_isIterable2); - -var _getIterator2 = __webpack_require__(372); - -var _getIterator3 = _interopRequireDefault(_getIterator2); - -function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } - -exports.default = function () { - function sliceIterator(arr, i) { - var _arr = []; - var _n = true; - var _d = false; - var _e = undefined; - - try { - for (var _i = (0, _getIterator3.default)(arr), _s; !(_n = (_s = _i.next()).done); _n = true) { - _arr.push(_s.value); - - if (i && _arr.length === i) break; - } - } catch (err) { - _d = true; - _e = err; - } finally { - try { - if (!_n && _i["return"]) _i["return"](); - } finally { - if (_d) throw _e; - } - } - - return _arr; - } - - return function (arr, i) { - if (Array.isArray(arr)) { - return arr; - } else if ((0, _isIterable3.default)(Object(arr))) { - return sliceIterator(arr, i); - } else { - throw new TypeError("Invalid attempt to destructure non-iterable instance"); - } - }; -}(); - -/***/ }), -/* 13 */ -/***/ (function(module, exports, __webpack_require__) { - -// Copyright 2015 Joyent, Inc. - -module.exports = { - bufferSplit: bufferSplit, - addRSAMissing: addRSAMissing, - calculateDSAPublic: calculateDSAPublic, - mpNormalize: mpNormalize, - ecNormalize: ecNormalize, - countZeros: countZeros, - assertCompatible: assertCompatible, - isCompatible: isCompatible, - opensslKeyDeriv: opensslKeyDeriv, - opensshCipherInfo: opensshCipherInfo -}; - -var assert = __webpack_require__(9); -var PrivateKey = __webpack_require__(19); -var crypto = __webpack_require__(6); - -var MAX_CLASS_DEPTH = 3; - -function isCompatible(obj, klass, needVer) { - if (obj === null || typeof (obj) !== 'object') - return (false); - if (needVer === undefined) - needVer = klass.prototype._sshpkApiVersion; - if (obj instanceof klass && - klass.prototype._sshpkApiVersion[0] == needVer[0]) - return (true); - var proto = Object.getPrototypeOf(obj); - var depth = 0; - while (proto.constructor.name !== klass.name) { - proto = Object.getPrototypeOf(proto); - if (!proto || ++depth > MAX_CLASS_DEPTH) - return (false); - } - if (proto.constructor.name !== klass.name) - return (false); - var ver = proto._sshpkApiVersion; - if (ver === undefined) - ver = klass._oldVersionDetect(obj); - if (ver[0] != needVer[0] || ver[1] < needVer[1]) - return (false); - return (true); -} - -function assertCompatible(obj, klass, needVer, name) { - if (name === undefined) - name = 'object'; - assert.ok(obj, name + ' must not be null'); - assert.object(obj, name + ' must be an object'); - if (needVer === undefined) - needVer = klass.prototype._sshpkApiVersion; - if (obj instanceof klass && - klass.prototype._sshpkApiVersion[0] == needVer[0]) - return; - var proto = Object.getPrototypeOf(obj); - var depth = 0; - while (proto.constructor.name !== klass.name) { - proto = Object.getPrototypeOf(proto); - assert.ok(proto && ++depth <= MAX_CLASS_DEPTH, - name + ' must be a ' + klass.name + ' instance'); - } - assert.strictEqual(proto.constructor.name, klass.name, - name + ' must be a ' + klass.name + ' instance'); - var ver = proto._sshpkApiVersion; - if (ver === undefined) - ver = klass._oldVersionDetect(obj); - assert.ok(ver[0] == needVer[0] && ver[1] >= needVer[1], - name + ' must be compatible with ' + klass.name + ' klass ' + - 'version ' + needVer[0] + '.' + needVer[1]); -} - -var CIPHER_LEN = { - 'des-ede3-cbc': { key: 7, iv: 8 }, - 'aes-128-cbc': { key: 16, iv: 16 } -}; -var PKCS5_SALT_LEN = 8; - -function opensslKeyDeriv(cipher, salt, passphrase, count) { - assert.buffer(salt, 'salt'); - assert.buffer(passphrase, 'passphrase'); - assert.number(count, 'iteration count'); - - var clen = CIPHER_LEN[cipher]; - assert.object(clen, 'supported cipher'); - - salt = salt.slice(0, PKCS5_SALT_LEN); - - var D, D_prev, bufs; - var material = new Buffer(0); - while (material.length < clen.key + clen.iv) { - bufs = []; - if (D_prev) - bufs.push(D_prev); - bufs.push(passphrase); - bufs.push(salt); - D = Buffer.concat(bufs); - for (var j = 0; j < count; ++j) - D = crypto.createHash('md5').update(D).digest(); - material = Buffer.concat([material, D]); - D_prev = D; - } - - return ({ - key: material.slice(0, clen.key), - iv: material.slice(clen.key, clen.key + clen.iv) - }); -} - -/* Count leading zero bits on a buffer */ -function countZeros(buf) { - var o = 0, obit = 8; - while (o < buf.length) { - var mask = (1 << obit); - if ((buf[o] & mask) === mask) - break; - obit--; - if (obit < 0) { - o++; - obit = 8; - } - } - return (o*8 + (8 - obit) - 1); -} - -function bufferSplit(buf, chr) { - assert.buffer(buf); - assert.string(chr); - - var parts = []; - var lastPart = 0; - var matches = 0; - for (var i = 0; i < buf.length; ++i) { - if (buf[i] === chr.charCodeAt(matches)) - ++matches; - else if (buf[i] === chr.charCodeAt(0)) - matches = 1; - else - matches = 0; - - if (matches >= chr.length) { - var newPart = i + 1; - parts.push(buf.slice(lastPart, newPart - matches)); - lastPart = newPart; - matches = 0; - } - } - if (lastPart <= buf.length) - parts.push(buf.slice(lastPart, buf.length)); - - return (parts); -} - -function ecNormalize(buf, addZero) { - assert.buffer(buf); - if (buf[0] === 0x00 && buf[1] === 0x04) { - if (addZero) - return (buf); - return (buf.slice(1)); - } else if (buf[0] === 0x04) { - if (!addZero) - return (buf); - } else { - while (buf[0] === 0x00) - buf = buf.slice(1); - if (buf[0] === 0x02 || buf[0] === 0x03) - throw (new Error('Compressed elliptic curve points ' + - 'are not supported')); - if (buf[0] !== 0x04) - throw (new Error('Not a valid elliptic curve point')); - if (!addZero) - return (buf); - } - var b = new Buffer(buf.length + 1); - b[0] = 0x0; - buf.copy(b, 1); - return (b); -} - -function mpNormalize(buf) { - assert.buffer(buf); - while (buf.length > 1 && buf[0] === 0x00 && (buf[1] & 0x80) === 0x00) - buf = buf.slice(1); - if ((buf[0] & 0x80) === 0x80) { - var b = new Buffer(buf.length + 1); - b[0] = 0x00; - buf.copy(b, 1); - buf = b; - } - return (buf); -} - -function bigintToMpBuf(bigint) { - var buf = new Buffer(bigint.toByteArray()); - buf = mpNormalize(buf); - return (buf); -} - -function calculateDSAPublic(g, p, x) { - assert.buffer(g); - assert.buffer(p); - assert.buffer(x); - try { - var bigInt = __webpack_require__(45).BigInteger; - } catch (e) { - throw (new Error('To load a PKCS#8 format DSA private key, ' + - 'the node jsbn library is required.')); - } - g = new bigInt(g); - p = new bigInt(p); - x = new bigInt(x); - var y = g.modPow(x, p); - var ybuf = bigintToMpBuf(y); - return (ybuf); -} - -function addRSAMissing(key) { - assert.object(key); - assertCompatible(key, PrivateKey, [1, 1]); - try { - var bigInt = __webpack_require__(45).BigInteger; - } catch (e) { - throw (new Error('To write a PEM private key from ' + - 'this source, the node jsbn lib is required.')); - } - - var d = new bigInt(key.part.d.data); - var buf; - - if (!key.part.dmodp) { - var p = new bigInt(key.part.p.data); - var dmodp = d.mod(p.subtract(1)); - - buf = bigintToMpBuf(dmodp); - key.part.dmodp = {name: 'dmodp', data: buf}; - key.parts.push(key.part.dmodp); - } - if (!key.part.dmodq) { - var q = new bigInt(key.part.q.data); - var dmodq = d.mod(q.subtract(1)); - - buf = bigintToMpBuf(dmodq); - key.part.dmodq = {name: 'dmodq', data: buf}; - key.parts.push(key.part.dmodq); - } -} - -function opensshCipherInfo(cipher) { - var inf = {}; - switch (cipher) { - case '3des-cbc': - inf.keySize = 24; - inf.blockSize = 8; - inf.opensslName = 'des-ede3-cbc'; - break; - case 'blowfish-cbc': - inf.keySize = 16; - inf.blockSize = 8; - inf.opensslName = 'bf-cbc'; - break; - case 'aes128-cbc': - case 'aes128-ctr': - case 'aes128-gcm@openssh.com': - inf.keySize = 16; - inf.blockSize = 16; - inf.opensslName = 'aes-128-' + cipher.slice(7, 10); - break; - case 'aes192-cbc': - case 'aes192-ctr': - case 'aes192-gcm@openssh.com': - inf.keySize = 24; - inf.blockSize = 16; - inf.opensslName = 'aes-192-' + cipher.slice(7, 10); - break; - case 'aes256-cbc': - case 'aes256-ctr': - case 'aes256-gcm@openssh.com': - inf.keySize = 32; - inf.blockSize = 16; - inf.opensslName = 'aes-256-' + cipher.slice(7, 10); - break; - default: - throw (new Error( - 'Unsupported openssl cipher "' + cipher + '"')); - } - return (inf); -} - - -/***/ }), -/* 14 */ -/***/ (function(module, exports) { - -module.exports = require("stream"); - -/***/ }), -/* 15 */ -/***/ (function(module, exports, __webpack_require__) { - -"use strict"; - - Object.defineProperty(exports, "__esModule", { value: true }); @@ -1897,7 +1767,7 @@ exports.stringify = exports.parse = undefined; var _asyncToGenerator2; function _load_asyncToGenerator() { - return _asyncToGenerator2 = _interopRequireDefault(__webpack_require__(0)); + return _asyncToGenerator2 = _interopRequireDefault(__webpack_require__(1)); } var _parse; @@ -1916,7 +1786,7 @@ Object.defineProperty(exports, 'parse', { var _stringify; function _load_stringify() { - return _stringify = __webpack_require__(78); + return _stringify = __webpack_require__(154); } Object.defineProperty(exports, 'stringify', { @@ -1934,10 +1804,10 @@ function _load_misc() { return _misc = __webpack_require__(10); } -var _packageRequest; +var _normalizePattern; -function _load_packageRequest() { - return _packageRequest = _interopRequireDefault(__webpack_require__(30)); +function _load_normalizePattern() { + return _normalizePattern = __webpack_require__(31); } var _parse2; @@ -1949,7 +1819,7 @@ function _load_parse2() { var _constants; function _load_constants() { - return _constants = _interopRequireWildcard(__webpack_require__(8)); + return _constants = __webpack_require__(7); } var _fs; @@ -1962,17 +1832,22 @@ function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } -const invariant = __webpack_require__(7); -const path = __webpack_require__(1); +const invariant = __webpack_require__(6); + +const path = __webpack_require__(0); function getName(pattern) { - return (_packageRequest || _load_packageRequest()).default.normalizePattern(pattern).name; + return (0, (_normalizePattern || _load_normalizePattern()).normalizePattern)(pattern).name; } function blankObjectUndefined(obj) { return obj && Object.keys(obj).length ? obj : undefined; } +function keyForRemote(remote) { + return remote.resolved || (remote.reference && remote.hash ? `${remote.reference}#${remote.hash}` : null); +} + function implodeEntry(pattern, obj) { const inferredName = getName(pattern); return { @@ -1998,9 +1873,16 @@ function explodeEntry(pattern, obj) { } class Lockfile { - constructor(cache, source) { + constructor() { + var _ref = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {}; + + let cache = _ref.cache, + source = _ref.source, + parseResultType = _ref.parseResultType; + this.source = source || ''; this.cache = cache; + this.parseResultType = parseResultType; } // source string if the `cache` was parsed @@ -2010,19 +1892,31 @@ class Lockfile { return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { // read the manifest in this directory const lockfileLoc = path.join(dir, (_constants || _load_constants()).LOCKFILE_FILENAME); + let lockfile; let rawLockfile = ''; + let parseResult; if (yield (_fs || _load_fs()).exists(lockfileLoc)) { rawLockfile = yield (_fs || _load_fs()).readFile(lockfileLoc); - lockfile = (0, (_parse2 || _load_parse2()).default)(rawLockfile, lockfileLoc); + parseResult = (0, (_parse2 || _load_parse2()).default)(rawLockfile, lockfileLoc); + + if (reporter) { + if (parseResult.type === 'merge') { + reporter.info(reporter.lang('lockfileMerged')); + } else if (parseResult.type === 'conflict') { + reporter.warn(reporter.lang('lockfileConflict')); + } + } + + lockfile = parseResult.object; } else { if (reporter) { reporter.info(reporter.lang('noLockfileFound')); } } - return new Lockfile(lockfile, rawLockfile); + return new Lockfile({ cache: lockfile, source: rawLockfile, parseResultType: parseResult && parseResult.type }); })(); } @@ -2057,7 +1951,7 @@ class Lockfile { const seen = new Map(); // order by name so that lockfile manifest is assigned to the first dependency with this manifest - // the others that have the same remote.resolved will just refer to the first + // the others that have the same remoteKey will just refer to the first // ordering allows for consistency in lockfile when it is serialized const sortedPatternsKeys = Object.keys(patterns).sort((_misc || _load_misc()).sortAlpha); @@ -2069,7 +1963,8 @@ class Lockfile { invariant(ref, 'Package is missing a reference'); invariant(remote, 'Package is missing a remote'); - const seenPattern = remote.resolved && seen.get(remote.resolved); + const remoteKey = keyForRemote(remote); + const seenPattern = remoteKey && seen.get(remoteKey); if (seenPattern) { // no point in duplicating it lockfile[pattern] = seenPattern; @@ -2095,8 +1990,8 @@ class Lockfile { }); lockfile[pattern] = obj; - if (remote.resolved) { - seen.set(remote.resolved, obj); + if (remoteKey) { + seen.set(remoteKey, obj); } } @@ -2106,7403 +2001,5887 @@ class Lockfile { exports.default = Lockfile; /***/ }), -/* 16 */ +/* 13 */ +/***/ (function(module, exports) { + +// https://github.com/zloirock/core-js/issues/86#issuecomment-115759028 +var global = module.exports = typeof window != 'undefined' && window.Math == Math + ? window : typeof self != 'undefined' && self.Math == Math ? self : Function('return this')(); +if(typeof __g == 'number')__g = global; // eslint-disable-line no-undef + +/***/ }), +/* 14 */ +/***/ (function(module, exports) { + +module.exports = require("url"); + +/***/ }), +/* 15 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; -var escapeStringRegexp = __webpack_require__(223); -var ansiStyles = __webpack_require__(300); -var stripAnsi = __webpack_require__(157); -var hasAnsi = __webpack_require__(473); -var supportsColor = __webpack_require__(382); -var defineProps = Object.defineProperties; -var isSimpleWindowsTerm = process.platform === 'win32' && !/^xterm/i.test(process.env.TERM); -function Chalk(options) { - // detect mode if not set manually - this.enabled = !options || options.enabled === undefined ? supportsColor : options.enabled; -} +exports.__esModule = true; -// use bright blue on Windows as the normal blue color is illegible -if (isSimpleWindowsTerm) { - ansiStyles.blue.open = '\u001b[94m'; -} +var _isIterable2 = __webpack_require__(453); -var styles = (function () { - var ret = {}; +var _isIterable3 = _interopRequireDefault(_isIterable2); - Object.keys(ansiStyles).forEach(function (key) { - ansiStyles[key].closeRe = new RegExp(escapeStringRegexp(ansiStyles[key].close), 'g'); +var _getIterator2 = __webpack_require__(452); - ret[key] = { - get: function () { - return build.call(this, this._styles.concat(key)); - } - }; - }); +var _getIterator3 = _interopRequireDefault(_getIterator2); - return ret; -})(); +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } -var proto = defineProps(function chalk() {}, styles); +exports.default = function () { + function sliceIterator(arr, i) { + var _arr = []; + var _n = true; + var _d = false; + var _e = undefined; -function build(_styles) { - var builder = function () { - return applyStyle.apply(builder, arguments); - }; + try { + for (var _i = (0, _getIterator3.default)(arr), _s; !(_n = (_s = _i.next()).done); _n = true) { + _arr.push(_s.value); - builder._styles = _styles; - builder.enabled = this.enabled; - // __proto__ is used because we must return a function, but there is - // no way to create a function with a different prototype. - /* eslint-disable no-proto */ - builder.__proto__ = proto; + if (i && _arr.length === i) break; + } + } catch (err) { + _d = true; + _e = err; + } finally { + try { + if (!_n && _i["return"]) _i["return"](); + } finally { + if (_d) throw _e; + } + } - return builder; -} + return _arr; + } -function applyStyle() { - // support varags, but simply cast to string in case there's only one arg - var args = arguments; - var argsLen = args.length; - var str = argsLen !== 0 && String(arguments[0]); + return function (arr, i) { + if (Array.isArray(arr)) { + return arr; + } else if ((0, _isIterable3.default)(Object(arr))) { + return sliceIterator(arr, i); + } else { + throw new TypeError("Invalid attempt to destructure non-iterable instance"); + } + }; +}(); - if (argsLen > 1) { - // don't slice `arguments`, it prevents v8 optimizations - for (var a = 1; a < argsLen; a++) { - str += ' ' + args[a]; - } - } +/***/ }), +/* 16 */ +/***/ (function(module, exports) { - if (!this.enabled || !str) { - return str; +module.exports = function(module) { + if(!module.webpackPolyfill) { + module.deprecate = function() {}; + module.paths = []; + // module.parent = undefined by default + if(!module.children) module.children = []; + Object.defineProperty(module, "loaded", { + enumerable: true, + get: function() { + return module.l; + } + }); + Object.defineProperty(module, "id", { + enumerable: true, + get: function() { + return module.i; + } + }); + module.webpackPolyfill = 1; } + return module; +}; - var nestedStyles = this._styles; - var i = nestedStyles.length; - // Turns out that on Windows dimmed gray text becomes invisible in cmd.exe, - // see https://github.com/chalk/chalk/issues/58 - // If we're on Windows and we're dealing with a gray color, temporarily make 'dim' a noop. - var originalDim = ansiStyles.dim.open; - if (isSimpleWindowsTerm && (nestedStyles.indexOf('gray') !== -1 || nestedStyles.indexOf('grey') !== -1)) { - ansiStyles.dim.open = ''; - } +/***/ }), +/* 17 */ +/***/ (function(module, exports) { - while (i--) { - var code = ansiStyles[nestedStyles[i]]; +exports = module.exports = SemVer; - // Replace any instances already present with a re-opening code - // otherwise only the part of the string until said closing code - // will be colored, and the rest will simply be 'plain'. - str = code.open + str.replace(code.closeRe, code.open) + code.close; - } +// The debug function is excluded entirely from the minified version. +/* nomin */ var debug; +/* nomin */ if (typeof process === 'object' && + /* nomin */ process.env && + /* nomin */ process.env.NODE_DEBUG && + /* nomin */ /\bsemver\b/i.test(process.env.NODE_DEBUG)) + /* nomin */ debug = function() { + /* nomin */ var args = Array.prototype.slice.call(arguments, 0); + /* nomin */ args.unshift('SEMVER'); + /* nomin */ console.log.apply(console, args); + /* nomin */ }; +/* nomin */ else + /* nomin */ debug = function() {}; - // Reset the original 'dim' if we changed it to work around the Windows dimmed gray issue. - ansiStyles.dim.open = originalDim; +// Note: this is the semver.org version of the spec that it implements +// Not necessarily the package version of this code. +exports.SEMVER_SPEC_VERSION = '2.0.0'; - return str; -} +var MAX_LENGTH = 256; +var MAX_SAFE_INTEGER = Number.MAX_SAFE_INTEGER || 9007199254740991; -function init() { - var ret = {}; +// The actual regexps go on exports.re +var re = exports.re = []; +var src = exports.src = []; +var R = 0; - Object.keys(styles).forEach(function (name) { - ret[name] = { - get: function () { - return build.call(this, [name]); - } - }; - }); +// The following Regular Expressions can be used for tokenizing, +// validating, and parsing SemVer version strings. - return ret; -} +// ## Numeric Identifier +// A single `0`, or a non-zero digit followed by zero or more digits. -defineProps(Chalk.prototype, init()); +var NUMERICIDENTIFIER = R++; +src[NUMERICIDENTIFIER] = '0|[1-9]\\d*'; +var NUMERICIDENTIFIERLOOSE = R++; +src[NUMERICIDENTIFIERLOOSE] = '[0-9]+'; -module.exports = new Chalk(); -module.exports.styles = ansiStyles; -module.exports.hasColor = hasAnsi; -module.exports.stripColor = stripAnsi; -module.exports.supportsColor = supportsColor; +// ## Non-numeric Identifier +// Zero or more digits, followed by a letter or hyphen, and then zero or +// more letters, digits, or hyphens. -/***/ }), -/* 17 */ -/***/ (function(module, exports) { +var NONNUMERICIDENTIFIER = R++; +src[NONNUMERICIDENTIFIER] = '\\d*[a-zA-Z-][a-zA-Z0-9-]*'; -// Copyright 2015 Joyent, Inc. -var algInfo = { - 'dsa': { - parts: ['p', 'q', 'g', 'y'], - sizePart: 'p' - }, - 'rsa': { - parts: ['e', 'n'], - sizePart: 'n' - }, - 'ecdsa': { - parts: ['curve', 'Q'], - sizePart: 'Q' - }, - 'ed25519': { - parts: ['R'], - normalize: false, - sizePart: 'R' - } -}; -algInfo['curve25519'] = algInfo['ed25519']; +// ## Main Version +// Three dot-separated numeric identifiers. -var algPrivInfo = { - 'dsa': { - parts: ['p', 'q', 'g', 'y', 'x'] - }, - 'rsa': { - parts: ['n', 'e', 'd', 'iqmp', 'p', 'q'] - }, - 'ecdsa': { - parts: ['curve', 'Q', 'd'] - }, - 'ed25519': { - parts: ['R', 'r'], - normalize: false - } -}; -algPrivInfo['curve25519'] = algPrivInfo['ed25519']; +var MAINVERSION = R++; +src[MAINVERSION] = '(' + src[NUMERICIDENTIFIER] + ')\\.' + + '(' + src[NUMERICIDENTIFIER] + ')\\.' + + '(' + src[NUMERICIDENTIFIER] + ')'; -var hashAlgs = { - 'md5': true, - 'sha1': true, - 'sha256': true, - 'sha384': true, - 'sha512': true -}; +var MAINVERSIONLOOSE = R++; +src[MAINVERSIONLOOSE] = '(' + src[NUMERICIDENTIFIERLOOSE] + ')\\.' + + '(' + src[NUMERICIDENTIFIERLOOSE] + ')\\.' + + '(' + src[NUMERICIDENTIFIERLOOSE] + ')'; -/* - * Taken from - * http://csrc.nist.gov/groups/ST/toolkit/documents/dss/NISTReCur.pdf - */ -var curves = { - 'nistp256': { - size: 256, - pkcs8oid: '1.2.840.10045.3.1.7', - p: new Buffer(('00' + - 'ffffffff 00000001 00000000 00000000' + - '00000000 ffffffff ffffffff ffffffff'). - replace(/ /g, ''), 'hex'), - a: new Buffer(('00' + - 'FFFFFFFF 00000001 00000000 00000000' + - '00000000 FFFFFFFF FFFFFFFF FFFFFFFC'). - replace(/ /g, ''), 'hex'), - b: new Buffer(( - '5ac635d8 aa3a93e7 b3ebbd55 769886bc' + - '651d06b0 cc53b0f6 3bce3c3e 27d2604b'). - replace(/ /g, ''), 'hex'), - s: new Buffer(('00' + - 'c49d3608 86e70493 6a6678e1 139d26b7' + - '819f7e90'). - replace(/ /g, ''), 'hex'), - n: new Buffer(('00' + - 'ffffffff 00000000 ffffffff ffffffff' + - 'bce6faad a7179e84 f3b9cac2 fc632551'). - replace(/ /g, ''), 'hex'), - G: new Buffer(('04' + - '6b17d1f2 e12c4247 f8bce6e5 63a440f2' + - '77037d81 2deb33a0 f4a13945 d898c296' + - '4fe342e2 fe1a7f9b 8ee7eb4a 7c0f9e16' + - '2bce3357 6b315ece cbb64068 37bf51f5'). - replace(/ /g, ''), 'hex') - }, - 'nistp384': { - size: 384, - pkcs8oid: '1.3.132.0.34', - p: new Buffer(('00' + - 'ffffffff ffffffff ffffffff ffffffff' + - 'ffffffff ffffffff ffffffff fffffffe' + - 'ffffffff 00000000 00000000 ffffffff'). - replace(/ /g, ''), 'hex'), - a: new Buffer(('00' + - 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + - 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFE' + - 'FFFFFFFF 00000000 00000000 FFFFFFFC'). - replace(/ /g, ''), 'hex'), - b: new Buffer(( - 'b3312fa7 e23ee7e4 988e056b e3f82d19' + - '181d9c6e fe814112 0314088f 5013875a' + - 'c656398d 8a2ed19d 2a85c8ed d3ec2aef'). - replace(/ /g, ''), 'hex'), - s: new Buffer(('00' + - 'a335926a a319a27a 1d00896a 6773a482' + - '7acdac73'). - replace(/ /g, ''), 'hex'), - n: new Buffer(('00' + - 'ffffffff ffffffff ffffffff ffffffff' + - 'ffffffff ffffffff c7634d81 f4372ddf' + - '581a0db2 48b0a77a ecec196a ccc52973'). - replace(/ /g, ''), 'hex'), - G: new Buffer(('04' + - 'aa87ca22 be8b0537 8eb1c71e f320ad74' + - '6e1d3b62 8ba79b98 59f741e0 82542a38' + - '5502f25d bf55296c 3a545e38 72760ab7' + - '3617de4a 96262c6f 5d9e98bf 9292dc29' + - 'f8f41dbd 289a147c e9da3113 b5f0b8c0' + - '0a60b1ce 1d7e819d 7a431d7c 90ea0e5f'). - replace(/ /g, ''), 'hex') - }, - 'nistp521': { - size: 521, - pkcs8oid: '1.3.132.0.35', - p: new Buffer(( - '01ffffff ffffffff ffffffff ffffffff' + - 'ffffffff ffffffff ffffffff ffffffff' + - 'ffffffff ffffffff ffffffff ffffffff' + - 'ffffffff ffffffff ffffffff ffffffff' + - 'ffff').replace(/ /g, ''), 'hex'), - a: new Buffer(('01FF' + - 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + - 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + - 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + - 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFC'). - replace(/ /g, ''), 'hex'), - b: new Buffer(('51' + - '953eb961 8e1c9a1f 929a21a0 b68540ee' + - 'a2da725b 99b315f3 b8b48991 8ef109e1' + - '56193951 ec7e937b 1652c0bd 3bb1bf07' + - '3573df88 3d2c34f1 ef451fd4 6b503f00'). - replace(/ /g, ''), 'hex'), - s: new Buffer(('00' + - 'd09e8800 291cb853 96cc6717 393284aa' + - 'a0da64ba').replace(/ /g, ''), 'hex'), - n: new Buffer(('01ff' + - 'ffffffff ffffffff ffffffff ffffffff' + - 'ffffffff ffffffff ffffffff fffffffa' + - '51868783 bf2f966b 7fcc0148 f709a5d0' + - '3bb5c9b8 899c47ae bb6fb71e 91386409'). - replace(/ /g, ''), 'hex'), - G: new Buffer(('04' + - '00c6 858e06b7 0404e9cd 9e3ecb66 2395b442' + - '9c648139 053fb521 f828af60 6b4d3dba' + - 'a14b5e77 efe75928 fe1dc127 a2ffa8de' + - '3348b3c1 856a429b f97e7e31 c2e5bd66' + - '0118 39296a78 9a3bc004 5c8a5fb4 2c7d1bd9' + - '98f54449 579b4468 17afbd17 273e662c' + - '97ee7299 5ef42640 c550b901 3fad0761' + - '353c7086 a272c240 88be9476 9fd16650'). - replace(/ /g, ''), 'hex') - } -}; +// ## Pre-release Version Identifier +// A numeric identifier, or a non-numeric identifier. -module.exports = { - info: algInfo, - privInfo: algPrivInfo, - hashAlgs: hashAlgs, - curves: curves -}; +var PRERELEASEIDENTIFIER = R++; +src[PRERELEASEIDENTIFIER] = '(?:' + src[NUMERICIDENTIFIER] + + '|' + src[NONNUMERICIDENTIFIER] + ')'; +var PRERELEASEIDENTIFIERLOOSE = R++; +src[PRERELEASEIDENTIFIERLOOSE] = '(?:' + src[NUMERICIDENTIFIERLOOSE] + + '|' + src[NONNUMERICIDENTIFIER] + ')'; -/***/ }), -/* 18 */ -/***/ (function(module, exports, __webpack_require__) { -// Copyright 2015 Joyent, Inc. +// ## Pre-release Version +// Hyphen, followed by one or more dot-separated pre-release version +// identifiers. -module.exports = Key; +var PRERELEASE = R++; +src[PRERELEASE] = '(?:-(' + src[PRERELEASEIDENTIFIER] + + '(?:\\.' + src[PRERELEASEIDENTIFIER] + ')*))'; -var assert = __webpack_require__(9); -var algs = __webpack_require__(17); -var crypto = __webpack_require__(6); -var Fingerprint = __webpack_require__(70); -var Signature = __webpack_require__(33); -var DiffieHellman = __webpack_require__(571); -var errs = __webpack_require__(32); -var utils = __webpack_require__(13); -var PrivateKey = __webpack_require__(19); -var edCompat; +var PRERELEASELOOSE = R++; +src[PRERELEASELOOSE] = '(?:-?(' + src[PRERELEASEIDENTIFIERLOOSE] + + '(?:\\.' + src[PRERELEASEIDENTIFIERLOOSE] + ')*))'; -try { - edCompat = __webpack_require__(248); -} catch (e) { - /* Just continue through, and bail out if we try to use it. */ -} +// ## Build Metadata Identifier +// Any combination of digits, letters, or hyphens. -var InvalidAlgorithmError = errs.InvalidAlgorithmError; -var KeyParseError = errs.KeyParseError; +var BUILDIDENTIFIER = R++; +src[BUILDIDENTIFIER] = '[0-9A-Za-z-]+'; -var formats = {}; -formats['auto'] = __webpack_require__(249); -formats['pem'] = __webpack_require__(40); -formats['pkcs1'] = __webpack_require__(155); -formats['pkcs8'] = __webpack_require__(71); -formats['rfc4253'] = __webpack_require__(47); -formats['ssh'] = __webpack_require__(250); -formats['ssh-private'] = __webpack_require__(100); -formats['openssh'] = formats['ssh-private']; +// ## Build Metadata +// Plus sign, followed by one or more period-separated build metadata +// identifiers. -function Key(opts) { - assert.object(opts, 'options'); - assert.arrayOfObject(opts.parts, 'options.parts'); - assert.string(opts.type, 'options.type'); - assert.optionalString(opts.comment, 'options.comment'); +var BUILD = R++; +src[BUILD] = '(?:\\+(' + src[BUILDIDENTIFIER] + + '(?:\\.' + src[BUILDIDENTIFIER] + ')*))'; - var algInfo = algs.info[opts.type]; - if (typeof (algInfo) !== 'object') - throw (new InvalidAlgorithmError(opts.type)); - var partLookup = {}; - for (var i = 0; i < opts.parts.length; ++i) { - var part = opts.parts[i]; - partLookup[part.name] = part; - } +// ## Full Version String +// A main version, followed optionally by a pre-release version and +// build metadata. - this.type = opts.type; - this.parts = opts.parts; - this.part = partLookup; - this.comment = undefined; - this.source = opts.source; +// Note that the only major, minor, patch, and pre-release sections of +// the version string are capturing groups. The build metadata is not a +// capturing group, because it should not ever be used in version +// comparison. - /* for speeding up hashing/fingerprint operations */ - this._rfc4253Cache = opts._rfc4253Cache; - this._hashCache = {}; +var FULL = R++; +var FULLPLAIN = 'v?' + src[MAINVERSION] + + src[PRERELEASE] + '?' + + src[BUILD] + '?'; - var sz; - this.curve = undefined; - if (this.type === 'ecdsa') { - var curve = this.part.curve.data.toString(); - this.curve = curve; - sz = algs.curves[curve].size; - } else if (this.type === 'ed25519') { - sz = 256; - this.curve = 'curve25519'; - } else { - var szPart = this.part[algInfo.sizePart]; - sz = szPart.data.length; - sz = sz * 8 - utils.countZeros(szPart.data); - } - this.size = sz; -} +src[FULL] = '^' + FULLPLAIN + '$'; -Key.formats = formats; +// like full, but allows v1.2.3 and =1.2.3, which people do sometimes. +// also, 1.0.0alpha1 (prerelease without the hyphen) which is pretty +// common in the npm registry. +var LOOSEPLAIN = '[v=\\s]*' + src[MAINVERSIONLOOSE] + + src[PRERELEASELOOSE] + '?' + + src[BUILD] + '?'; -Key.prototype.toBuffer = function (format, options) { - if (format === undefined) - format = 'ssh'; - assert.string(format, 'format'); - assert.object(formats[format], 'formats[format]'); - assert.optionalObject(options, 'options'); +var LOOSE = R++; +src[LOOSE] = '^' + LOOSEPLAIN + '$'; - if (format === 'rfc4253') { - if (this._rfc4253Cache === undefined) - this._rfc4253Cache = formats['rfc4253'].write(this); - return (this._rfc4253Cache); - } +var GTLT = R++; +src[GTLT] = '((?:<|>)?=?)'; - return (formats[format].write(this, options)); -}; +// Something like "2.*" or "1.2.x". +// Note that "x.x" is a valid xRange identifer, meaning "any version" +// Only the first item is strictly required. +var XRANGEIDENTIFIERLOOSE = R++; +src[XRANGEIDENTIFIERLOOSE] = src[NUMERICIDENTIFIERLOOSE] + '|x|X|\\*'; +var XRANGEIDENTIFIER = R++; +src[XRANGEIDENTIFIER] = src[NUMERICIDENTIFIER] + '|x|X|\\*'; -Key.prototype.toString = function (format, options) { - return (this.toBuffer(format, options).toString()); -}; +var XRANGEPLAIN = R++; +src[XRANGEPLAIN] = '[v=\\s]*(' + src[XRANGEIDENTIFIER] + ')' + + '(?:\\.(' + src[XRANGEIDENTIFIER] + ')' + + '(?:\\.(' + src[XRANGEIDENTIFIER] + ')' + + '(?:' + src[PRERELEASE] + ')?' + + src[BUILD] + '?' + + ')?)?'; -Key.prototype.hash = function (algo) { - assert.string(algo, 'algorithm'); - algo = algo.toLowerCase(); - if (algs.hashAlgs[algo] === undefined) - throw (new InvalidAlgorithmError(algo)); +var XRANGEPLAINLOOSE = R++; +src[XRANGEPLAINLOOSE] = '[v=\\s]*(' + src[XRANGEIDENTIFIERLOOSE] + ')' + + '(?:\\.(' + src[XRANGEIDENTIFIERLOOSE] + ')' + + '(?:\\.(' + src[XRANGEIDENTIFIERLOOSE] + ')' + + '(?:' + src[PRERELEASELOOSE] + ')?' + + src[BUILD] + '?' + + ')?)?'; - if (this._hashCache[algo]) - return (this._hashCache[algo]); +var XRANGE = R++; +src[XRANGE] = '^' + src[GTLT] + '\\s*' + src[XRANGEPLAIN] + '$'; +var XRANGELOOSE = R++; +src[XRANGELOOSE] = '^' + src[GTLT] + '\\s*' + src[XRANGEPLAINLOOSE] + '$'; - var hash = crypto.createHash(algo). - update(this.toBuffer('rfc4253')).digest(); - this._hashCache[algo] = hash; - return (hash); -}; +// Tilde ranges. +// Meaning is "reasonably at or greater than" +var LONETILDE = R++; +src[LONETILDE] = '(?:~>?)'; -Key.prototype.fingerprint = function (algo) { - if (algo === undefined) - algo = 'sha256'; - assert.string(algo, 'algorithm'); - var opts = { - type: 'key', - hash: this.hash(algo), - algorithm: algo - }; - return (new Fingerprint(opts)); -}; +var TILDETRIM = R++; +src[TILDETRIM] = '(\\s*)' + src[LONETILDE] + '\\s+'; +re[TILDETRIM] = new RegExp(src[TILDETRIM], 'g'); +var tildeTrimReplace = '$1~'; -Key.prototype.defaultHashAlgorithm = function () { - var hashAlgo = 'sha1'; - if (this.type === 'rsa') - hashAlgo = 'sha256'; - if (this.type === 'dsa' && this.size > 1024) - hashAlgo = 'sha256'; - if (this.type === 'ed25519') - hashAlgo = 'sha512'; - if (this.type === 'ecdsa') { - if (this.size <= 256) - hashAlgo = 'sha256'; - else if (this.size <= 384) - hashAlgo = 'sha384'; - else - hashAlgo = 'sha512'; - } - return (hashAlgo); -}; - -Key.prototype.createVerify = function (hashAlgo) { - if (hashAlgo === undefined) - hashAlgo = this.defaultHashAlgorithm(); - assert.string(hashAlgo, 'hash algorithm'); - - /* ED25519 is not supported by OpenSSL, use a javascript impl. */ - if (this.type === 'ed25519' && edCompat !== undefined) - return (new edCompat.Verifier(this, hashAlgo)); - if (this.type === 'curve25519') - throw (new Error('Curve25519 keys are not suitable for ' + - 'signing or verification')); - - var v, nm, err; - try { - nm = hashAlgo.toUpperCase(); - v = crypto.createVerify(nm); - } catch (e) { - err = e; - } - if (v === undefined || (err instanceof Error && - err.message.match(/Unknown message digest/))) { - nm = 'RSA-'; - nm += hashAlgo.toUpperCase(); - v = crypto.createVerify(nm); - } - assert.ok(v, 'failed to create verifier'); - var oldVerify = v.verify.bind(v); - var key = this.toBuffer('pkcs8'); - var self = this; - v.verify = function (signature, fmt) { - if (Signature.isSignature(signature, [2, 0])) { - if (signature.type !== self.type) - return (false); - if (signature.hashAlgorithm && - signature.hashAlgorithm !== hashAlgo) - return (false); - return (oldVerify(key, signature.toBuffer('asn1'))); +var TILDE = R++; +src[TILDE] = '^' + src[LONETILDE] + src[XRANGEPLAIN] + '$'; +var TILDELOOSE = R++; +src[TILDELOOSE] = '^' + src[LONETILDE] + src[XRANGEPLAINLOOSE] + '$'; - } else if (typeof (signature) === 'string' || - Buffer.isBuffer(signature)) { - return (oldVerify(key, signature, fmt)); +// Caret ranges. +// Meaning is "at least and backwards compatible with" +var LONECARET = R++; +src[LONECARET] = '(?:\\^)'; - /* - * Avoid doing this on valid arguments, walking the prototype - * chain can be quite slow. - */ - } else if (Signature.isSignature(signature, [1, 0])) { - throw (new Error('signature was created by too old ' + - 'a version of sshpk and cannot be verified')); +var CARETTRIM = R++; +src[CARETTRIM] = '(\\s*)' + src[LONECARET] + '\\s+'; +re[CARETTRIM] = new RegExp(src[CARETTRIM], 'g'); +var caretTrimReplace = '$1^'; - } else { - throw (new TypeError('signature must be a string, ' + - 'Buffer, or Signature object')); - } - }; - return (v); -}; +var CARET = R++; +src[CARET] = '^' + src[LONECARET] + src[XRANGEPLAIN] + '$'; +var CARETLOOSE = R++; +src[CARETLOOSE] = '^' + src[LONECARET] + src[XRANGEPLAINLOOSE] + '$'; -Key.prototype.createDiffieHellman = function () { - if (this.type === 'rsa') - throw (new Error('RSA keys do not support Diffie-Hellman')); +// A simple gt/lt/eq thing, or just "" to indicate "any version" +var COMPARATORLOOSE = R++; +src[COMPARATORLOOSE] = '^' + src[GTLT] + '\\s*(' + LOOSEPLAIN + ')$|^$'; +var COMPARATOR = R++; +src[COMPARATOR] = '^' + src[GTLT] + '\\s*(' + FULLPLAIN + ')$|^$'; - return (new DiffieHellman(this)); -}; -Key.prototype.createDH = Key.prototype.createDiffieHellman; -Key.parse = function (data, format, options) { - if (typeof (data) !== 'string') - assert.buffer(data, 'data'); - if (format === undefined) - format = 'auto'; - assert.string(format, 'format'); - if (typeof (options) === 'string') - options = { filename: options }; - assert.optionalObject(options, 'options'); - if (options === undefined) - options = {}; - assert.optionalString(options.filename, 'options.filename'); - if (options.filename === undefined) - options.filename = '(unnamed)'; +// An expression to strip any whitespace between the gtlt and the thing +// it modifies, so that `> 1.2.3` ==> `>1.2.3` +var COMPARATORTRIM = R++; +src[COMPARATORTRIM] = '(\\s*)' + src[GTLT] + + '\\s*(' + LOOSEPLAIN + '|' + src[XRANGEPLAIN] + ')'; - assert.object(formats[format], 'formats[format]'); +// this one has to use the /g flag +re[COMPARATORTRIM] = new RegExp(src[COMPARATORTRIM], 'g'); +var comparatorTrimReplace = '$1$2$3'; - try { - var k = formats[format].read(data, options); - if (k instanceof PrivateKey) - k = k.toPublic(); - if (!k.comment) - k.comment = options.filename; - return (k); - } catch (e) { - if (e.name === 'KeyEncryptedError') - throw (e); - throw (new KeyParseError(options.filename, format, e)); - } -}; -Key.isKey = function (obj, ver) { - return (utils.isCompatible(obj, Key, ver)); -}; +// Something like `1.2.3 - 1.2.4` +// Note that these all use the loose form, because they'll be +// checked against either the strict or loose comparator form +// later. +var HYPHENRANGE = R++; +src[HYPHENRANGE] = '^\\s*(' + src[XRANGEPLAIN] + ')' + + '\\s+-\\s+' + + '(' + src[XRANGEPLAIN] + ')' + + '\\s*$'; -/* - * API versions for Key: - * [1,0] -- initial ver, may take Signature for createVerify or may not - * [1,1] -- added pkcs1, pkcs8 formats - * [1,2] -- added auto, ssh-private, openssh formats - * [1,3] -- added defaultHashAlgorithm - * [1,4] -- added ed support, createDH - * [1,5] -- first explicitly tagged version - */ -Key.prototype._sshpkApiVersion = [1, 5]; +var HYPHENRANGELOOSE = R++; +src[HYPHENRANGELOOSE] = '^\\s*(' + src[XRANGEPLAINLOOSE] + ')' + + '\\s+-\\s+' + + '(' + src[XRANGEPLAINLOOSE] + ')' + + '\\s*$'; -Key._oldVersionDetect = function (obj) { - assert.func(obj.toBuffer); - assert.func(obj.fingerprint); - if (obj.createDH) - return ([1, 4]); - if (obj.defaultHashAlgorithm) - return ([1, 3]); - if (obj.formats['auto']) - return ([1, 2]); - if (obj.formats['pkcs1']) - return ([1, 1]); - return ([1, 0]); -}; +// Star ranges basically just allow anything at all. +var STAR = R++; +src[STAR] = '(<|>)?=?\\s*\\*'; +// Compile to actual regexp objects. +// All are flag-free, unless they were created above with a flag. +for (var i = 0; i < R; i++) { + debug(i, src[i]); + if (!re[i]) + re[i] = new RegExp(src[i]); +} -/***/ }), -/* 19 */ -/***/ (function(module, exports, __webpack_require__) { +exports.parse = parse; +function parse(version, loose) { + if (version instanceof SemVer) + return version; -// Copyright 2015 Joyent, Inc. + if (typeof version !== 'string') + return null; -module.exports = PrivateKey; + if (version.length > MAX_LENGTH) + return null; -var assert = __webpack_require__(9); -var algs = __webpack_require__(17); -var crypto = __webpack_require__(6); -var Fingerprint = __webpack_require__(70); -var Signature = __webpack_require__(33); -var errs = __webpack_require__(32); -var util = __webpack_require__(2); -var utils = __webpack_require__(13); -var edCompat; -var ed; + var r = loose ? re[LOOSE] : re[FULL]; + if (!r.test(version)) + return null; -try { - edCompat = __webpack_require__(248); -} catch (e) { - /* Just continue through, and bail out if we try to use it. */ + try { + return new SemVer(version, loose); + } catch (er) { + return null; + } } -var Key = __webpack_require__(18); - -var InvalidAlgorithmError = errs.InvalidAlgorithmError; -var KeyParseError = errs.KeyParseError; -var KeyEncryptedError = errs.KeyEncryptedError; - -var formats = {}; -formats['auto'] = __webpack_require__(249); -formats['pem'] = __webpack_require__(40); -formats['pkcs1'] = __webpack_require__(155); -formats['pkcs8'] = __webpack_require__(71); -formats['rfc4253'] = __webpack_require__(47); -formats['ssh-private'] = __webpack_require__(100); -formats['openssh'] = formats['ssh-private']; -formats['ssh'] = formats['ssh-private']; - -function PrivateKey(opts) { - assert.object(opts, 'options'); - Key.call(this, opts); - - this._pubCache = undefined; +exports.valid = valid; +function valid(version, loose) { + var v = parse(version, loose); + return v ? v.version : null; } -util.inherits(PrivateKey, Key); -PrivateKey.formats = formats; -PrivateKey.prototype.toBuffer = function (format, options) { - if (format === undefined) - format = 'pkcs1'; - assert.string(format, 'format'); - assert.object(formats[format], 'formats[format]'); - assert.optionalObject(options, 'options'); +exports.clean = clean; +function clean(version, loose) { + var s = parse(version.trim().replace(/^[=v]+/, ''), loose); + return s ? s.version : null; +} - return (formats[format].write(this, options)); -}; +exports.SemVer = SemVer; -PrivateKey.prototype.hash = function (algo) { - return (this.toPublic().hash(algo)); -}; +function SemVer(version, loose) { + if (version instanceof SemVer) { + if (version.loose === loose) + return version; + else + version = version.version; + } else if (typeof version !== 'string') { + throw new TypeError('Invalid Version: ' + version); + } -PrivateKey.prototype.toPublic = function () { - if (this._pubCache) - return (this._pubCache); + if (version.length > MAX_LENGTH) + throw new TypeError('version is longer than ' + MAX_LENGTH + ' characters') - var algInfo = algs.info[this.type]; - var pubParts = []; - for (var i = 0; i < algInfo.parts.length; ++i) { - var p = algInfo.parts[i]; - pubParts.push(this.part[p]); - } + if (!(this instanceof SemVer)) + return new SemVer(version, loose); - this._pubCache = new Key({ - type: this.type, - source: this, - parts: pubParts - }); - if (this.comment) - this._pubCache.comment = this.comment; - return (this._pubCache); -}; + debug('SemVer', version, loose); + this.loose = loose; + var m = version.trim().match(loose ? re[LOOSE] : re[FULL]); -PrivateKey.prototype.derive = function (newType, newSize) { - assert.string(newType, 'type'); - assert.optionalNumber(newSize, 'size'); - var priv, pub; + if (!m) + throw new TypeError('Invalid Version: ' + version); - if (this.type === 'ed25519' && newType === 'curve25519') { - if (ed === undefined) - ed = __webpack_require__(146); + this.raw = version; - priv = this.part.r.data; - if (priv[0] === 0x00) - priv = priv.slice(1); - priv = priv.slice(0, 32); + // these are actually numbers + this.major = +m[1]; + this.minor = +m[2]; + this.patch = +m[3]; - pub = ed.dh.publicKey(priv); - priv = utils.mpNormalize(Buffer.concat([priv, pub])); + if (this.major > MAX_SAFE_INTEGER || this.major < 0) + throw new TypeError('Invalid major version') - return (new PrivateKey({ - type: 'curve25519', - parts: [ - { name: 'R', data: utils.mpNormalize(pub) }, - { name: 'r', data: priv } - ] - })); - } else if (this.type === 'curve25519' && newType === 'ed25519') { - if (ed === undefined) - ed = __webpack_require__(146); + if (this.minor > MAX_SAFE_INTEGER || this.minor < 0) + throw new TypeError('Invalid minor version') - priv = this.part.r.data; - if (priv[0] === 0x00) - priv = priv.slice(1); - priv = priv.slice(0, 32); + if (this.patch > MAX_SAFE_INTEGER || this.patch < 0) + throw new TypeError('Invalid patch version') - pub = ed.eddsa.publicKey(priv.toString('binary')); - pub = new Buffer(pub, 'binary'); + // numberify any prerelease numeric ids + if (!m[4]) + this.prerelease = []; + else + this.prerelease = m[4].split('.').map(function(id) { + if (/^[0-9]+$/.test(id)) { + var num = +id; + if (num >= 0 && num < MAX_SAFE_INTEGER) + return num; + } + return id; + }); - priv = utils.mpNormalize(Buffer.concat([priv, pub])); + this.build = m[5] ? m[5].split('.') : []; + this.format(); +} - return (new PrivateKey({ - type: 'ed25519', - parts: [ - { name: 'R', data: utils.mpNormalize(pub) }, - { name: 'r', data: priv } - ] - })); - } - throw (new Error('Key derivation not supported from ' + this.type + - ' to ' + newType)); +SemVer.prototype.format = function() { + this.version = this.major + '.' + this.minor + '.' + this.patch; + if (this.prerelease.length) + this.version += '-' + this.prerelease.join('.'); + return this.version; }; -PrivateKey.prototype.createVerify = function (hashAlgo) { - return (this.toPublic().createVerify(hashAlgo)); +SemVer.prototype.toString = function() { + return this.version; }; -PrivateKey.prototype.createSign = function (hashAlgo) { - if (hashAlgo === undefined) - hashAlgo = this.defaultHashAlgorithm(); - assert.string(hashAlgo, 'hash algorithm'); - - /* ED25519 is not supported by OpenSSL, use a javascript impl. */ - if (this.type === 'ed25519' && edCompat !== undefined) - return (new edCompat.Signer(this, hashAlgo)); - if (this.type === 'curve25519') - throw (new Error('Curve25519 keys are not suitable for ' + - 'signing or verification')); +SemVer.prototype.compare = function(other) { + debug('SemVer.compare', this.version, this.loose, other); + if (!(other instanceof SemVer)) + other = new SemVer(other, this.loose); - var v, nm, err; - try { - nm = hashAlgo.toUpperCase(); - v = crypto.createSign(nm); - } catch (e) { - err = e; - } - if (v === undefined || (err instanceof Error && - err.message.match(/Unknown message digest/))) { - nm = 'RSA-'; - nm += hashAlgo.toUpperCase(); - v = crypto.createSign(nm); - } - assert.ok(v, 'failed to create verifier'); - var oldSign = v.sign.bind(v); - var key = this.toBuffer('pkcs1'); - var type = this.type; - v.sign = function () { - var sig = oldSign(key); - if (typeof (sig) === 'string') - sig = new Buffer(sig, 'binary'); - sig = Signature.parse(sig, type, 'asn1'); - sig.hashAlgorithm = hashAlgo; - return (sig); - }; - return (v); + return this.compareMain(other) || this.comparePre(other); }; -PrivateKey.parse = function (data, format, options) { - if (typeof (data) !== 'string') - assert.buffer(data, 'data'); - if (format === undefined) - format = 'auto'; - assert.string(format, 'format'); - if (typeof (options) === 'string') - options = { filename: options }; - assert.optionalObject(options, 'options'); - if (options === undefined) - options = {}; - assert.optionalString(options.filename, 'options.filename'); - if (options.filename === undefined) - options.filename = '(unnamed)'; - - assert.object(formats[format], 'formats[format]'); +SemVer.prototype.compareMain = function(other) { + if (!(other instanceof SemVer)) + other = new SemVer(other, this.loose); - try { - var k = formats[format].read(data, options); - assert.ok(k instanceof PrivateKey, 'key is not a private key'); - if (!k.comment) - k.comment = options.filename; - return (k); - } catch (e) { - if (e.name === 'KeyEncryptedError') - throw (e); - throw (new KeyParseError(options.filename, format, e)); - } + return compareIdentifiers(this.major, other.major) || + compareIdentifiers(this.minor, other.minor) || + compareIdentifiers(this.patch, other.patch); }; -PrivateKey.isPrivateKey = function (obj, ver) { - return (utils.isCompatible(obj, PrivateKey, ver)); -}; +SemVer.prototype.comparePre = function(other) { + if (!(other instanceof SemVer)) + other = new SemVer(other, this.loose); -/* - * API versions for PrivateKey: - * [1,0] -- initial ver - * [1,1] -- added auto, pkcs[18], openssh/ssh-private formats - * [1,2] -- added defaultHashAlgorithm - * [1,3] -- added derive, ed, createDH - * [1,4] -- first tagged version - */ -PrivateKey.prototype._sshpkApiVersion = [1, 4]; + // NOT having a prerelease is > having one + if (this.prerelease.length && !other.prerelease.length) + return -1; + else if (!this.prerelease.length && other.prerelease.length) + return 1; + else if (!this.prerelease.length && !other.prerelease.length) + return 0; -PrivateKey._oldVersionDetect = function (obj) { - assert.func(obj.toPublic); - assert.func(obj.createSign); - if (obj.derive) - return ([1, 3]); - if (obj.defaultHashAlgorithm) - return ([1, 2]); - if (obj.formats['auto']) - return ([1, 1]); - return ([1, 0]); + var i = 0; + do { + var a = this.prerelease[i]; + var b = other.prerelease[i]; + debug('prerelease compare', i, a, b); + if (a === undefined && b === undefined) + return 0; + else if (b === undefined) + return 1; + else if (a === undefined) + return -1; + else if (a === b) + continue; + else + return compareIdentifiers(a, b); + } while (++i); }; +// preminor will bump the version up to the next minor release, and immediately +// down to pre-release. premajor and prepatch work the same way. +SemVer.prototype.inc = function(release, identifier) { + switch (release) { + case 'premajor': + this.prerelease.length = 0; + this.patch = 0; + this.minor = 0; + this.major++; + this.inc('pre', identifier); + break; + case 'preminor': + this.prerelease.length = 0; + this.patch = 0; + this.minor++; + this.inc('pre', identifier); + break; + case 'prepatch': + // If this is already a prerelease, it will bump to the next version + // drop any prereleases that might already exist, since they are not + // relevant at this point. + this.prerelease.length = 0; + this.inc('patch', identifier); + this.inc('pre', identifier); + break; + // If the input is a non-prerelease version, this acts the same as + // prepatch. + case 'prerelease': + if (this.prerelease.length === 0) + this.inc('patch', identifier); + this.inc('pre', identifier); + break; -/***/ }), -/* 20 */ -/***/ (function(module, exports) { - -module.exports = function(module) { - if(!module.webpackPolyfill) { - module.deprecate = function() {}; - module.paths = []; - // module.parent = undefined by default - if(!module.children) module.children = []; - Object.defineProperty(module, "loaded", { - enumerable: true, - get: function() { - return module.l; - } - }); - Object.defineProperty(module, "id", { - enumerable: true, - get: function() { - return module.i; - } - }); - module.webpackPolyfill = 1; - } - return module; + case 'major': + // If this is a pre-major version, bump up to the same major version. + // Otherwise increment major. + // 1.0.0-5 bumps to 1.0.0 + // 1.1.0 bumps to 2.0.0 + if (this.minor !== 0 || this.patch !== 0 || this.prerelease.length === 0) + this.major++; + this.minor = 0; + this.patch = 0; + this.prerelease = []; + break; + case 'minor': + // If this is a pre-minor version, bump up to the same minor version. + // Otherwise increment minor. + // 1.2.0-5 bumps to 1.2.0 + // 1.2.1 bumps to 1.3.0 + if (this.patch !== 0 || this.prerelease.length === 0) + this.minor++; + this.patch = 0; + this.prerelease = []; + break; + case 'patch': + // If this is not a pre-release version, it will increment the patch. + // If it is a pre-release it will bump up to the same patch version. + // 1.2.0-5 patches to 1.2.0 + // 1.2.0 patches to 1.2.1 + if (this.prerelease.length === 0) + this.patch++; + this.prerelease = []; + break; + // This probably shouldn't be used publicly. + // 1.0.0 "pre" would become 1.0.0-0 which is the wrong direction. + case 'pre': + if (this.prerelease.length === 0) + this.prerelease = [0]; + else { + var i = this.prerelease.length; + while (--i >= 0) { + if (typeof this.prerelease[i] === 'number') { + this.prerelease[i]++; + i = -2; + } + } + if (i === -1) // didn't increment anything + this.prerelease.push(0); + } + if (identifier) { + // 1.2.0-beta.1 bumps to 1.2.0-beta.2, + // 1.2.0-beta.fooblz or 1.2.0-beta bumps to 1.2.0-beta.0 + if (this.prerelease[0] === identifier) { + if (isNaN(this.prerelease[1])) + this.prerelease = [identifier, 0]; + } else + this.prerelease = [identifier, 0]; + } + break; + + default: + throw new Error('invalid increment argument: ' + release); + } + this.format(); + this.raw = this.version; + return this; }; +exports.inc = inc; +function inc(version, release, loose, identifier) { + if (typeof(loose) === 'string') { + identifier = loose; + loose = undefined; + } -/***/ }), -/* 21 */ -/***/ (function(module, exports, __webpack_require__) { + try { + return new SemVer(version, loose).inc(release, identifier).version; + } catch (er) { + return null; + } +} -/* WEBPACK VAR INJECTION */(function(module) {var __WEBPACK_AMD_DEFINE_RESULT__;/** - * @license - * Lodash - * Copyright JS Foundation and other contributors - * Released under MIT license - * Based on Underscore.js 1.8.3 - * Copyright Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors - */ -;(function() { +exports.diff = diff; +function diff(version1, version2) { + if (eq(version1, version2)) { + return null; + } else { + var v1 = parse(version1); + var v2 = parse(version2); + if (v1.prerelease.length || v2.prerelease.length) { + for (var key in v1) { + if (key === 'major' || key === 'minor' || key === 'patch') { + if (v1[key] !== v2[key]) { + return 'pre'+key; + } + } + } + return 'prerelease'; + } + for (var key in v1) { + if (key === 'major' || key === 'minor' || key === 'patch') { + if (v1[key] !== v2[key]) { + return key; + } + } + } + } +} - /** Used as a safe reference for `undefined` in pre-ES5 environments. */ - var undefined; +exports.compareIdentifiers = compareIdentifiers; - /** Used as the semantic version number. */ - var VERSION = '4.17.4'; +var numeric = /^[0-9]+$/; +function compareIdentifiers(a, b) { + var anum = numeric.test(a); + var bnum = numeric.test(b); - /** Used as the size to enable large array optimizations. */ - var LARGE_ARRAY_SIZE = 200; + if (anum && bnum) { + a = +a; + b = +b; + } - /** Error message constants. */ - var CORE_ERROR_TEXT = 'Unsupported core-js use. Try https://npms.io/search?q=ponyfill.', - FUNC_ERROR_TEXT = 'Expected a function'; + return (anum && !bnum) ? -1 : + (bnum && !anum) ? 1 : + a < b ? -1 : + a > b ? 1 : + 0; +} - /** Used to stand-in for `undefined` hash values. */ - var HASH_UNDEFINED = '__lodash_hash_undefined__'; +exports.rcompareIdentifiers = rcompareIdentifiers; +function rcompareIdentifiers(a, b) { + return compareIdentifiers(b, a); +} - /** Used as the maximum memoize cache size. */ - var MAX_MEMOIZE_SIZE = 500; +exports.major = major; +function major(a, loose) { + return new SemVer(a, loose).major; +} - /** Used as the internal argument placeholder. */ - var PLACEHOLDER = '__lodash_placeholder__'; +exports.minor = minor; +function minor(a, loose) { + return new SemVer(a, loose).minor; +} - /** Used to compose bitmasks for cloning. */ - var CLONE_DEEP_FLAG = 1, - CLONE_FLAT_FLAG = 2, - CLONE_SYMBOLS_FLAG = 4; +exports.patch = patch; +function patch(a, loose) { + return new SemVer(a, loose).patch; +} - /** Used to compose bitmasks for value comparisons. */ - var COMPARE_PARTIAL_FLAG = 1, - COMPARE_UNORDERED_FLAG = 2; +exports.compare = compare; +function compare(a, b, loose) { + return new SemVer(a, loose).compare(b); +} - /** Used to compose bitmasks for function metadata. */ - var WRAP_BIND_FLAG = 1, - WRAP_BIND_KEY_FLAG = 2, - WRAP_CURRY_BOUND_FLAG = 4, - WRAP_CURRY_FLAG = 8, - WRAP_CURRY_RIGHT_FLAG = 16, - WRAP_PARTIAL_FLAG = 32, - WRAP_PARTIAL_RIGHT_FLAG = 64, - WRAP_ARY_FLAG = 128, - WRAP_REARG_FLAG = 256, - WRAP_FLIP_FLAG = 512; +exports.compareLoose = compareLoose; +function compareLoose(a, b) { + return compare(a, b, true); +} - /** Used as default options for `_.truncate`. */ - var DEFAULT_TRUNC_LENGTH = 30, - DEFAULT_TRUNC_OMISSION = '...'; +exports.rcompare = rcompare; +function rcompare(a, b, loose) { + return compare(b, a, loose); +} - /** Used to detect hot functions by number of calls within a span of milliseconds. */ - var HOT_COUNT = 800, - HOT_SPAN = 16; +exports.sort = sort; +function sort(list, loose) { + return list.sort(function(a, b) { + return exports.compare(a, b, loose); + }); +} - /** Used to indicate the type of lazy iteratees. */ - var LAZY_FILTER_FLAG = 1, - LAZY_MAP_FLAG = 2, - LAZY_WHILE_FLAG = 3; +exports.rsort = rsort; +function rsort(list, loose) { + return list.sort(function(a, b) { + return exports.rcompare(a, b, loose); + }); +} - /** Used as references for various `Number` constants. */ - var INFINITY = 1 / 0, - MAX_SAFE_INTEGER = 9007199254740991, - MAX_INTEGER = 1.7976931348623157e+308, - NAN = 0 / 0; +exports.gt = gt; +function gt(a, b, loose) { + return compare(a, b, loose) > 0; +} - /** Used as references for the maximum length and index of an array. */ - var MAX_ARRAY_LENGTH = 4294967295, - MAX_ARRAY_INDEX = MAX_ARRAY_LENGTH - 1, - HALF_MAX_ARRAY_LENGTH = MAX_ARRAY_LENGTH >>> 1; +exports.lt = lt; +function lt(a, b, loose) { + return compare(a, b, loose) < 0; +} - /** Used to associate wrap methods with their bit flags. */ - var wrapFlags = [ - ['ary', WRAP_ARY_FLAG], - ['bind', WRAP_BIND_FLAG], - ['bindKey', WRAP_BIND_KEY_FLAG], - ['curry', WRAP_CURRY_FLAG], - ['curryRight', WRAP_CURRY_RIGHT_FLAG], - ['flip', WRAP_FLIP_FLAG], - ['partial', WRAP_PARTIAL_FLAG], - ['partialRight', WRAP_PARTIAL_RIGHT_FLAG], - ['rearg', WRAP_REARG_FLAG] - ]; +exports.eq = eq; +function eq(a, b, loose) { + return compare(a, b, loose) === 0; +} - /** `Object#toString` result references. */ - var argsTag = '[object Arguments]', - arrayTag = '[object Array]', - asyncTag = '[object AsyncFunction]', - boolTag = '[object Boolean]', - dateTag = '[object Date]', - domExcTag = '[object DOMException]', - errorTag = '[object Error]', - funcTag = '[object Function]', - genTag = '[object GeneratorFunction]', - mapTag = '[object Map]', - numberTag = '[object Number]', - nullTag = '[object Null]', - objectTag = '[object Object]', - promiseTag = '[object Promise]', - proxyTag = '[object Proxy]', - regexpTag = '[object RegExp]', - setTag = '[object Set]', - stringTag = '[object String]', - symbolTag = '[object Symbol]', - undefinedTag = '[object Undefined]', - weakMapTag = '[object WeakMap]', - weakSetTag = '[object WeakSet]'; +exports.neq = neq; +function neq(a, b, loose) { + return compare(a, b, loose) !== 0; +} - var arrayBufferTag = '[object ArrayBuffer]', - dataViewTag = '[object DataView]', - float32Tag = '[object Float32Array]', - float64Tag = '[object Float64Array]', - int8Tag = '[object Int8Array]', - int16Tag = '[object Int16Array]', - int32Tag = '[object Int32Array]', - uint8Tag = '[object Uint8Array]', - uint8ClampedTag = '[object Uint8ClampedArray]', - uint16Tag = '[object Uint16Array]', - uint32Tag = '[object Uint32Array]'; +exports.gte = gte; +function gte(a, b, loose) { + return compare(a, b, loose) >= 0; +} - /** Used to match empty string literals in compiled template source. */ - var reEmptyStringLeading = /\b__p \+= '';/g, - reEmptyStringMiddle = /\b(__p \+=) '' \+/g, - reEmptyStringTrailing = /(__e\(.*?\)|\b__t\)) \+\n'';/g; +exports.lte = lte; +function lte(a, b, loose) { + return compare(a, b, loose) <= 0; +} - /** Used to match HTML entities and HTML characters. */ - var reEscapedHtml = /&(?:amp|lt|gt|quot|#39);/g, - reUnescapedHtml = /[&<>"']/g, - reHasEscapedHtml = RegExp(reEscapedHtml.source), - reHasUnescapedHtml = RegExp(reUnescapedHtml.source); +exports.cmp = cmp; +function cmp(a, op, b, loose) { + var ret; + switch (op) { + case '===': + if (typeof a === 'object') a = a.version; + if (typeof b === 'object') b = b.version; + ret = a === b; + break; + case '!==': + if (typeof a === 'object') a = a.version; + if (typeof b === 'object') b = b.version; + ret = a !== b; + break; + case '': case '=': case '==': ret = eq(a, b, loose); break; + case '!=': ret = neq(a, b, loose); break; + case '>': ret = gt(a, b, loose); break; + case '>=': ret = gte(a, b, loose); break; + case '<': ret = lt(a, b, loose); break; + case '<=': ret = lte(a, b, loose); break; + default: throw new TypeError('Invalid operator: ' + op); + } + return ret; +} - /** Used to match template delimiters. */ - var reEscape = /<%-([\s\S]+?)%>/g, - reEvaluate = /<%([\s\S]+?)%>/g, - reInterpolate = /<%=([\s\S]+?)%>/g; +exports.Comparator = Comparator; +function Comparator(comp, loose) { + if (comp instanceof Comparator) { + if (comp.loose === loose) + return comp; + else + comp = comp.value; + } - /** Used to match property names within property paths. */ - var reIsDeepProp = /\.|\[(?:[^[\]]*|(["'])(?:(?!\1)[^\\]|\\.)*?\1)\]/, - reIsPlainProp = /^\w*$/, - reLeadingDot = /^\./, - rePropName = /[^.[\]]+|\[(?:(-?\d+(?:\.\d+)?)|(["'])((?:(?!\2)[^\\]|\\.)*?)\2)\]|(?=(?:\.|\[\])(?:\.|\[\]|$))/g; + if (!(this instanceof Comparator)) + return new Comparator(comp, loose); - /** - * Used to match `RegExp` - * [syntax characters](http://ecma-international.org/ecma-262/7.0/#sec-patterns). - */ - var reRegExpChar = /[\\^$.*+?()[\]{}|]/g, - reHasRegExpChar = RegExp(reRegExpChar.source); + debug('comparator', comp, loose); + this.loose = loose; + this.parse(comp); - /** Used to match leading and trailing whitespace. */ - var reTrim = /^\s+|\s+$/g, - reTrimStart = /^\s+/, - reTrimEnd = /\s+$/; + if (this.semver === ANY) + this.value = ''; + else + this.value = this.operator + this.semver.version; - /** Used to match wrap detail comments. */ - var reWrapComment = /\{(?:\n\/\* \[wrapped with .+\] \*\/)?\n?/, - reWrapDetails = /\{\n\/\* \[wrapped with (.+)\] \*/, - reSplitDetails = /,? & /; + debug('comp', this); +} - /** Used to match words composed of alphanumeric characters. */ - var reAsciiWord = /[^\x00-\x2f\x3a-\x40\x5b-\x60\x7b-\x7f]+/g; +var ANY = {}; +Comparator.prototype.parse = function(comp) { + var r = this.loose ? re[COMPARATORLOOSE] : re[COMPARATOR]; + var m = comp.match(r); - /** Used to match backslashes in property paths. */ - var reEscapeChar = /\\(\\)?/g; + if (!m) + throw new TypeError('Invalid comparator: ' + comp); - /** - * Used to match - * [ES template delimiters](http://ecma-international.org/ecma-262/7.0/#sec-template-literal-lexical-components). - */ - var reEsTemplate = /\$\{([^\\}]*(?:\\.[^\\}]*)*)\}/g; + this.operator = m[1]; + if (this.operator === '=') + this.operator = ''; - /** Used to match `RegExp` flags from their coerced string values. */ - var reFlags = /\w*$/; + // if it literally is just '>' or '' then allow anything. + if (!m[2]) + this.semver = ANY; + else + this.semver = new SemVer(m[2], this.loose); +}; - /** Used to detect bad signed hexadecimal string values. */ - var reIsBadHex = /^[-+]0x[0-9a-f]+$/i; +Comparator.prototype.toString = function() { + return this.value; +}; - /** Used to detect binary string values. */ - var reIsBinary = /^0b[01]+$/i; +Comparator.prototype.test = function(version) { + debug('Comparator.test', version, this.loose); - /** Used to detect host constructors (Safari). */ - var reIsHostCtor = /^\[object .+?Constructor\]$/; + if (this.semver === ANY) + return true; - /** Used to detect octal string values. */ - var reIsOctal = /^0o[0-7]+$/i; + if (typeof version === 'string') + version = new SemVer(version, this.loose); - /** Used to detect unsigned integer values. */ - var reIsUint = /^(?:0|[1-9]\d*)$/; + return cmp(version, this.operator, this.semver, this.loose); +}; - /** Used to match Latin Unicode letters (excluding mathematical operators). */ - var reLatin = /[\xc0-\xd6\xd8-\xf6\xf8-\xff\u0100-\u017f]/g; - /** Used to ensure capturing order of template delimiters. */ - var reNoMatch = /($^)/; +exports.Range = Range; +function Range(range, loose) { + if ((range instanceof Range) && range.loose === loose) + return range; - /** Used to match unescaped characters in compiled string literals. */ - var reUnescapedString = /['\n\r\u2028\u2029\\]/g; + if (!(this instanceof Range)) + return new Range(range, loose); - /** Used to compose unicode character classes. */ - var rsAstralRange = '\\ud800-\\udfff', - rsComboMarksRange = '\\u0300-\\u036f', - reComboHalfMarksRange = '\\ufe20-\\ufe2f', - rsComboSymbolsRange = '\\u20d0-\\u20ff', - rsComboRange = rsComboMarksRange + reComboHalfMarksRange + rsComboSymbolsRange, - rsDingbatRange = '\\u2700-\\u27bf', - rsLowerRange = 'a-z\\xdf-\\xf6\\xf8-\\xff', - rsMathOpRange = '\\xac\\xb1\\xd7\\xf7', - rsNonCharRange = '\\x00-\\x2f\\x3a-\\x40\\x5b-\\x60\\x7b-\\xbf', - rsPunctuationRange = '\\u2000-\\u206f', - rsSpaceRange = ' \\t\\x0b\\f\\xa0\\ufeff\\n\\r\\u2028\\u2029\\u1680\\u180e\\u2000\\u2001\\u2002\\u2003\\u2004\\u2005\\u2006\\u2007\\u2008\\u2009\\u200a\\u202f\\u205f\\u3000', - rsUpperRange = 'A-Z\\xc0-\\xd6\\xd8-\\xde', - rsVarRange = '\\ufe0e\\ufe0f', - rsBreakRange = rsMathOpRange + rsNonCharRange + rsPunctuationRange + rsSpaceRange; + this.loose = loose; - /** Used to compose unicode capture groups. */ - var rsApos = "['\u2019]", - rsAstral = '[' + rsAstralRange + ']', - rsBreak = '[' + rsBreakRange + ']', - rsCombo = '[' + rsComboRange + ']', - rsDigits = '\\d+', - rsDingbat = '[' + rsDingbatRange + ']', - rsLower = '[' + rsLowerRange + ']', - rsMisc = '[^' + rsAstralRange + rsBreakRange + rsDigits + rsDingbatRange + rsLowerRange + rsUpperRange + ']', - rsFitz = '\\ud83c[\\udffb-\\udfff]', - rsModifier = '(?:' + rsCombo + '|' + rsFitz + ')', - rsNonAstral = '[^' + rsAstralRange + ']', - rsRegional = '(?:\\ud83c[\\udde6-\\uddff]){2}', - rsSurrPair = '[\\ud800-\\udbff][\\udc00-\\udfff]', - rsUpper = '[' + rsUpperRange + ']', - rsZWJ = '\\u200d'; + // First, split based on boolean or || + this.raw = range; + this.set = range.split(/\s*\|\|\s*/).map(function(range) { + return this.parseRange(range.trim()); + }, this).filter(function(c) { + // throw out any that are not relevant for whatever reason + return c.length; + }); - /** Used to compose unicode regexes. */ - var rsMiscLower = '(?:' + rsLower + '|' + rsMisc + ')', - rsMiscUpper = '(?:' + rsUpper + '|' + rsMisc + ')', - rsOptContrLower = '(?:' + rsApos + '(?:d|ll|m|re|s|t|ve))?', - rsOptContrUpper = '(?:' + rsApos + '(?:D|LL|M|RE|S|T|VE))?', - reOptMod = rsModifier + '?', - rsOptVar = '[' + rsVarRange + ']?', - rsOptJoin = '(?:' + rsZWJ + '(?:' + [rsNonAstral, rsRegional, rsSurrPair].join('|') + ')' + rsOptVar + reOptMod + ')*', - rsOrdLower = '\\d*(?:(?:1st|2nd|3rd|(?![123])\\dth)\\b)', - rsOrdUpper = '\\d*(?:(?:1ST|2ND|3RD|(?![123])\\dTH)\\b)', - rsSeq = rsOptVar + reOptMod + rsOptJoin, - rsEmoji = '(?:' + [rsDingbat, rsRegional, rsSurrPair].join('|') + ')' + rsSeq, - rsSymbol = '(?:' + [rsNonAstral + rsCombo + '?', rsCombo, rsRegional, rsSurrPair, rsAstral].join('|') + ')'; + if (!this.set.length) { + throw new TypeError('Invalid SemVer Range: ' + range); + } - /** Used to match apostrophes. */ - var reApos = RegExp(rsApos, 'g'); + this.format(); +} - /** - * Used to match [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks) and - * [combining diacritical marks for symbols](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks_for_Symbols). - */ - var reComboMark = RegExp(rsCombo, 'g'); +Range.prototype.format = function() { + this.range = this.set.map(function(comps) { + return comps.join(' ').trim(); + }).join('||').trim(); + return this.range; +}; - /** Used to match [string symbols](https://mathiasbynens.be/notes/javascript-unicode). */ - var reUnicode = RegExp(rsFitz + '(?=' + rsFitz + ')|' + rsSymbol + rsSeq, 'g'); - - /** Used to match complex or compound words. */ - var reUnicodeWord = RegExp([ - rsUpper + '?' + rsLower + '+' + rsOptContrLower + '(?=' + [rsBreak, rsUpper, '$'].join('|') + ')', - rsMiscUpper + '+' + rsOptContrUpper + '(?=' + [rsBreak, rsUpper + rsMiscLower, '$'].join('|') + ')', - rsUpper + '?' + rsMiscLower + '+' + rsOptContrLower, - rsUpper + '+' + rsOptContrUpper, - rsOrdUpper, - rsOrdLower, - rsDigits, - rsEmoji - ].join('|'), 'g'); +Range.prototype.toString = function() { + return this.range; +}; - /** Used to detect strings with [zero-width joiners or code points from the astral planes](http://eev.ee/blog/2015/09/12/dark-corners-of-unicode/). */ - var reHasUnicode = RegExp('[' + rsZWJ + rsAstralRange + rsComboRange + rsVarRange + ']'); +Range.prototype.parseRange = function(range) { + var loose = this.loose; + range = range.trim(); + debug('range', range, loose); + // `1.2.3 - 1.2.4` => `>=1.2.3 <=1.2.4` + var hr = loose ? re[HYPHENRANGELOOSE] : re[HYPHENRANGE]; + range = range.replace(hr, hyphenReplace); + debug('hyphen replace', range); + // `> 1.2.3 < 1.2.5` => `>1.2.3 <1.2.5` + range = range.replace(re[COMPARATORTRIM], comparatorTrimReplace); + debug('comparator trim', range, re[COMPARATORTRIM]); - /** Used to detect strings that need a more robust regexp to match words. */ - var reHasUnicodeWord = /[a-z][A-Z]|[A-Z]{2,}[a-z]|[0-9][a-zA-Z]|[a-zA-Z][0-9]|[^a-zA-Z0-9 ]/; + // `~ 1.2.3` => `~1.2.3` + range = range.replace(re[TILDETRIM], tildeTrimReplace); - /** Used to assign default `context` object properties. */ - var contextProps = [ - 'Array', 'Buffer', 'DataView', 'Date', 'Error', 'Float32Array', 'Float64Array', - 'Function', 'Int8Array', 'Int16Array', 'Int32Array', 'Map', 'Math', 'Object', - 'Promise', 'RegExp', 'Set', 'String', 'Symbol', 'TypeError', 'Uint8Array', - 'Uint8ClampedArray', 'Uint16Array', 'Uint32Array', 'WeakMap', - '_', 'clearTimeout', 'isFinite', 'parseInt', 'setTimeout' - ]; + // `^ 1.2.3` => `^1.2.3` + range = range.replace(re[CARETTRIM], caretTrimReplace); - /** Used to make template sourceURLs easier to identify. */ - var templateCounter = -1; + // normalize spaces + range = range.split(/\s+/).join(' '); - /** Used to identify `toStringTag` values of typed arrays. */ - var typedArrayTags = {}; - typedArrayTags[float32Tag] = typedArrayTags[float64Tag] = - typedArrayTags[int8Tag] = typedArrayTags[int16Tag] = - typedArrayTags[int32Tag] = typedArrayTags[uint8Tag] = - typedArrayTags[uint8ClampedTag] = typedArrayTags[uint16Tag] = - typedArrayTags[uint32Tag] = true; - typedArrayTags[argsTag] = typedArrayTags[arrayTag] = - typedArrayTags[arrayBufferTag] = typedArrayTags[boolTag] = - typedArrayTags[dataViewTag] = typedArrayTags[dateTag] = - typedArrayTags[errorTag] = typedArrayTags[funcTag] = - typedArrayTags[mapTag] = typedArrayTags[numberTag] = - typedArrayTags[objectTag] = typedArrayTags[regexpTag] = - typedArrayTags[setTag] = typedArrayTags[stringTag] = - typedArrayTags[weakMapTag] = false; + // At this point, the range is completely trimmed and + // ready to be split into comparators. - /** Used to identify `toStringTag` values supported by `_.clone`. */ - var cloneableTags = {}; - cloneableTags[argsTag] = cloneableTags[arrayTag] = - cloneableTags[arrayBufferTag] = cloneableTags[dataViewTag] = - cloneableTags[boolTag] = cloneableTags[dateTag] = - cloneableTags[float32Tag] = cloneableTags[float64Tag] = - cloneableTags[int8Tag] = cloneableTags[int16Tag] = - cloneableTags[int32Tag] = cloneableTags[mapTag] = - cloneableTags[numberTag] = cloneableTags[objectTag] = - cloneableTags[regexpTag] = cloneableTags[setTag] = - cloneableTags[stringTag] = cloneableTags[symbolTag] = - cloneableTags[uint8Tag] = cloneableTags[uint8ClampedTag] = - cloneableTags[uint16Tag] = cloneableTags[uint32Tag] = true; - cloneableTags[errorTag] = cloneableTags[funcTag] = - cloneableTags[weakMapTag] = false; + var compRe = loose ? re[COMPARATORLOOSE] : re[COMPARATOR]; + var set = range.split(' ').map(function(comp) { + return parseComparator(comp, loose); + }).join(' ').split(/\s+/); + if (this.loose) { + // in loose mode, throw out any that are not valid comparators + set = set.filter(function(comp) { + return !!comp.match(compRe); + }); + } + set = set.map(function(comp) { + return new Comparator(comp, loose); + }); - /** Used to map Latin Unicode letters to basic Latin letters. */ - var deburredLetters = { - // Latin-1 Supplement block. - '\xc0': 'A', '\xc1': 'A', '\xc2': 'A', '\xc3': 'A', '\xc4': 'A', '\xc5': 'A', - '\xe0': 'a', '\xe1': 'a', '\xe2': 'a', '\xe3': 'a', '\xe4': 'a', '\xe5': 'a', - '\xc7': 'C', '\xe7': 'c', - '\xd0': 'D', '\xf0': 'd', - '\xc8': 'E', '\xc9': 'E', '\xca': 'E', '\xcb': 'E', - '\xe8': 'e', '\xe9': 'e', '\xea': 'e', '\xeb': 'e', - '\xcc': 'I', '\xcd': 'I', '\xce': 'I', '\xcf': 'I', - '\xec': 'i', '\xed': 'i', '\xee': 'i', '\xef': 'i', - '\xd1': 'N', '\xf1': 'n', - '\xd2': 'O', '\xd3': 'O', '\xd4': 'O', '\xd5': 'O', '\xd6': 'O', '\xd8': 'O', - '\xf2': 'o', '\xf3': 'o', '\xf4': 'o', '\xf5': 'o', '\xf6': 'o', '\xf8': 'o', - '\xd9': 'U', '\xda': 'U', '\xdb': 'U', '\xdc': 'U', - '\xf9': 'u', '\xfa': 'u', '\xfb': 'u', '\xfc': 'u', - '\xdd': 'Y', '\xfd': 'y', '\xff': 'y', - '\xc6': 'Ae', '\xe6': 'ae', - '\xde': 'Th', '\xfe': 'th', - '\xdf': 'ss', - // Latin Extended-A block. - '\u0100': 'A', '\u0102': 'A', '\u0104': 'A', - '\u0101': 'a', '\u0103': 'a', '\u0105': 'a', - '\u0106': 'C', '\u0108': 'C', '\u010a': 'C', '\u010c': 'C', - '\u0107': 'c', '\u0109': 'c', '\u010b': 'c', '\u010d': 'c', - '\u010e': 'D', '\u0110': 'D', '\u010f': 'd', '\u0111': 'd', - '\u0112': 'E', '\u0114': 'E', '\u0116': 'E', '\u0118': 'E', '\u011a': 'E', - '\u0113': 'e', '\u0115': 'e', '\u0117': 'e', '\u0119': 'e', '\u011b': 'e', - '\u011c': 'G', '\u011e': 'G', '\u0120': 'G', '\u0122': 'G', - '\u011d': 'g', '\u011f': 'g', '\u0121': 'g', '\u0123': 'g', - '\u0124': 'H', '\u0126': 'H', '\u0125': 'h', '\u0127': 'h', - '\u0128': 'I', '\u012a': 'I', '\u012c': 'I', '\u012e': 'I', '\u0130': 'I', - '\u0129': 'i', '\u012b': 'i', '\u012d': 'i', '\u012f': 'i', '\u0131': 'i', - '\u0134': 'J', '\u0135': 'j', - '\u0136': 'K', '\u0137': 'k', '\u0138': 'k', - '\u0139': 'L', '\u013b': 'L', '\u013d': 'L', '\u013f': 'L', '\u0141': 'L', - '\u013a': 'l', '\u013c': 'l', '\u013e': 'l', '\u0140': 'l', '\u0142': 'l', - '\u0143': 'N', '\u0145': 'N', '\u0147': 'N', '\u014a': 'N', - '\u0144': 'n', '\u0146': 'n', '\u0148': 'n', '\u014b': 'n', - '\u014c': 'O', '\u014e': 'O', '\u0150': 'O', - '\u014d': 'o', '\u014f': 'o', '\u0151': 'o', - '\u0154': 'R', '\u0156': 'R', '\u0158': 'R', - '\u0155': 'r', '\u0157': 'r', '\u0159': 'r', - '\u015a': 'S', '\u015c': 'S', '\u015e': 'S', '\u0160': 'S', - '\u015b': 's', '\u015d': 's', '\u015f': 's', '\u0161': 's', - '\u0162': 'T', '\u0164': 'T', '\u0166': 'T', - '\u0163': 't', '\u0165': 't', '\u0167': 't', - '\u0168': 'U', '\u016a': 'U', '\u016c': 'U', '\u016e': 'U', '\u0170': 'U', '\u0172': 'U', - '\u0169': 'u', '\u016b': 'u', '\u016d': 'u', '\u016f': 'u', '\u0171': 'u', '\u0173': 'u', - '\u0174': 'W', '\u0175': 'w', - '\u0176': 'Y', '\u0177': 'y', '\u0178': 'Y', - '\u0179': 'Z', '\u017b': 'Z', '\u017d': 'Z', - '\u017a': 'z', '\u017c': 'z', '\u017e': 'z', - '\u0132': 'IJ', '\u0133': 'ij', - '\u0152': 'Oe', '\u0153': 'oe', - '\u0149': "'n", '\u017f': 's' - }; + return set; +}; - /** Used to map characters to HTML entities. */ - var htmlEscapes = { - '&': '&', - '<': '<', - '>': '>', - '"': '"', - "'": ''' - }; +// Mostly just for testing and legacy API reasons +exports.toComparators = toComparators; +function toComparators(range, loose) { + return new Range(range, loose).set.map(function(comp) { + return comp.map(function(c) { + return c.value; + }).join(' ').trim().split(' '); + }); +} - /** Used to map HTML entities to characters. */ - var htmlUnescapes = { - '&': '&', - '<': '<', - '>': '>', - '"': '"', - ''': "'" - }; +// comprised of xranges, tildes, stars, and gtlt's at this point. +// already replaced the hyphen ranges +// turn into a set of JUST comparators. +function parseComparator(comp, loose) { + debug('comp', comp); + comp = replaceCarets(comp, loose); + debug('caret', comp); + comp = replaceTildes(comp, loose); + debug('tildes', comp); + comp = replaceXRanges(comp, loose); + debug('xrange', comp); + comp = replaceStars(comp, loose); + debug('stars', comp); + return comp; +} - /** Used to escape characters for inclusion in compiled string literals. */ - var stringEscapes = { - '\\': '\\', - "'": "'", - '\n': 'n', - '\r': 'r', - '\u2028': 'u2028', - '\u2029': 'u2029' - }; +function isX(id) { + return !id || id.toLowerCase() === 'x' || id === '*'; +} - /** Built-in method references without a dependency on `root`. */ - var freeParseFloat = parseFloat, - freeParseInt = parseInt; +// ~, ~> --> * (any, kinda silly) +// ~2, ~2.x, ~2.x.x, ~>2, ~>2.x ~>2.x.x --> >=2.0.0 <3.0.0 +// ~2.0, ~2.0.x, ~>2.0, ~>2.0.x --> >=2.0.0 <2.1.0 +// ~1.2, ~1.2.x, ~>1.2, ~>1.2.x --> >=1.2.0 <1.3.0 +// ~1.2.3, ~>1.2.3 --> >=1.2.3 <1.3.0 +// ~1.2.0, ~>1.2.0 --> >=1.2.0 <1.3.0 +function replaceTildes(comp, loose) { + return comp.trim().split(/\s+/).map(function(comp) { + return replaceTilde(comp, loose); + }).join(' '); +} - /** Detect free variable `global` from Node.js. */ - var freeGlobal = typeof global == 'object' && global && global.Object === Object && global; +function replaceTilde(comp, loose) { + var r = loose ? re[TILDELOOSE] : re[TILDE]; + return comp.replace(r, function(_, M, m, p, pr) { + debug('tilde', comp, _, M, m, p, pr); + var ret; - /** Detect free variable `self`. */ - var freeSelf = typeof self == 'object' && self && self.Object === Object && self; + if (isX(M)) + ret = ''; + else if (isX(m)) + ret = '>=' + M + '.0.0 <' + (+M + 1) + '.0.0'; + else if (isX(p)) + // ~1.2 == >=1.2.0 <1.3.0 + ret = '>=' + M + '.' + m + '.0 <' + M + '.' + (+m + 1) + '.0'; + else if (pr) { + debug('replaceTilde pr', pr); + if (pr.charAt(0) !== '-') + pr = '-' + pr; + ret = '>=' + M + '.' + m + '.' + p + pr + + ' <' + M + '.' + (+m + 1) + '.0'; + } else + // ~1.2.3 == >=1.2.3 <1.3.0 + ret = '>=' + M + '.' + m + '.' + p + + ' <' + M + '.' + (+m + 1) + '.0'; - /** Used as a reference to the global object. */ - var root = freeGlobal || freeSelf || Function('return this')(); + debug('tilde return', ret); + return ret; + }); +} - /** Detect free variable `exports`. */ - var freeExports = typeof exports == 'object' && exports && !exports.nodeType && exports; +// ^ --> * (any, kinda silly) +// ^2, ^2.x, ^2.x.x --> >=2.0.0 <3.0.0 +// ^2.0, ^2.0.x --> >=2.0.0 <3.0.0 +// ^1.2, ^1.2.x --> >=1.2.0 <2.0.0 +// ^1.2.3 --> >=1.2.3 <2.0.0 +// ^1.2.0 --> >=1.2.0 <2.0.0 +function replaceCarets(comp, loose) { + return comp.trim().split(/\s+/).map(function(comp) { + return replaceCaret(comp, loose); + }).join(' '); +} - /** Detect free variable `module`. */ - var freeModule = freeExports && typeof module == 'object' && module && !module.nodeType && module; +function replaceCaret(comp, loose) { + debug('caret', comp, loose); + var r = loose ? re[CARETLOOSE] : re[CARET]; + return comp.replace(r, function(_, M, m, p, pr) { + debug('caret', comp, _, M, m, p, pr); + var ret; - /** Detect the popular CommonJS extension `module.exports`. */ - var moduleExports = freeModule && freeModule.exports === freeExports; + if (isX(M)) + ret = ''; + else if (isX(m)) + ret = '>=' + M + '.0.0 <' + (+M + 1) + '.0.0'; + else if (isX(p)) { + if (M === '0') + ret = '>=' + M + '.' + m + '.0 <' + M + '.' + (+m + 1) + '.0'; + else + ret = '>=' + M + '.' + m + '.0 <' + (+M + 1) + '.0.0'; + } else if (pr) { + debug('replaceCaret pr', pr); + if (pr.charAt(0) !== '-') + pr = '-' + pr; + if (M === '0') { + if (m === '0') + ret = '>=' + M + '.' + m + '.' + p + pr + + ' <' + M + '.' + m + '.' + (+p + 1); + else + ret = '>=' + M + '.' + m + '.' + p + pr + + ' <' + M + '.' + (+m + 1) + '.0'; + } else + ret = '>=' + M + '.' + m + '.' + p + pr + + ' <' + (+M + 1) + '.0.0'; + } else { + debug('no pr'); + if (M === '0') { + if (m === '0') + ret = '>=' + M + '.' + m + '.' + p + + ' <' + M + '.' + m + '.' + (+p + 1); + else + ret = '>=' + M + '.' + m + '.' + p + + ' <' + M + '.' + (+m + 1) + '.0'; + } else + ret = '>=' + M + '.' + m + '.' + p + + ' <' + (+M + 1) + '.0.0'; + } - /** Detect free variable `process` from Node.js. */ - var freeProcess = moduleExports && freeGlobal.process; + debug('caret return', ret); + return ret; + }); +} - /** Used to access faster Node.js helpers. */ - var nodeUtil = (function() { - try { - return freeProcess && freeProcess.binding && freeProcess.binding('util'); - } catch (e) {} - }()); +function replaceXRanges(comp, loose) { + debug('replaceXRanges', comp, loose); + return comp.split(/\s+/).map(function(comp) { + return replaceXRange(comp, loose); + }).join(' '); +} - /* Node.js helper references. */ - var nodeIsArrayBuffer = nodeUtil && nodeUtil.isArrayBuffer, - nodeIsDate = nodeUtil && nodeUtil.isDate, - nodeIsMap = nodeUtil && nodeUtil.isMap, - nodeIsRegExp = nodeUtil && nodeUtil.isRegExp, - nodeIsSet = nodeUtil && nodeUtil.isSet, - nodeIsTypedArray = nodeUtil && nodeUtil.isTypedArray; +function replaceXRange(comp, loose) { + comp = comp.trim(); + var r = loose ? re[XRANGELOOSE] : re[XRANGE]; + return comp.replace(r, function(ret, gtlt, M, m, p, pr) { + debug('xRange', comp, ret, gtlt, M, m, p, pr); + var xM = isX(M); + var xm = xM || isX(m); + var xp = xm || isX(p); + var anyX = xp; - /*--------------------------------------------------------------------------*/ + if (gtlt === '=' && anyX) + gtlt = ''; - /** - * Adds the key-value `pair` to `map`. - * - * @private - * @param {Object} map The map to modify. - * @param {Array} pair The key-value pair to add. - * @returns {Object} Returns `map`. - */ - function addMapEntry(map, pair) { - // Don't return `map.set` because it's not chainable in IE 11. - map.set(pair[0], pair[1]); - return map; - } + if (xM) { + if (gtlt === '>' || gtlt === '<') { + // nothing is allowed + ret = '<0.0.0'; + } else { + // nothing is forbidden + ret = '*'; + } + } else if (gtlt && anyX) { + // replace X with 0 + if (xm) + m = 0; + if (xp) + p = 0; - /** - * Adds `value` to `set`. - * - * @private - * @param {Object} set The set to modify. - * @param {*} value The value to add. - * @returns {Object} Returns `set`. - */ - function addSetEntry(set, value) { - // Don't return `set.add` because it's not chainable in IE 11. - set.add(value); - return set; - } + if (gtlt === '>') { + // >1 => >=2.0.0 + // >1.2 => >=1.3.0 + // >1.2.3 => >= 1.2.4 + gtlt = '>='; + if (xm) { + M = +M + 1; + m = 0; + p = 0; + } else if (xp) { + m = +m + 1; + p = 0; + } + } else if (gtlt === '<=') { + // <=0.7.x is actually <0.8.0, since any 0.7.x should + // pass. Similarly, <=7.x is actually <8.0.0, etc. + gtlt = '<'; + if (xm) + M = +M + 1; + else + m = +m + 1; + } - /** - * A faster alternative to `Function#apply`, this function invokes `func` - * with the `this` binding of `thisArg` and the arguments of `args`. - * - * @private - * @param {Function} func The function to invoke. - * @param {*} thisArg The `this` binding of `func`. - * @param {Array} args The arguments to invoke `func` with. - * @returns {*} Returns the result of `func`. - */ - function apply(func, thisArg, args) { - switch (args.length) { - case 0: return func.call(thisArg); - case 1: return func.call(thisArg, args[0]); - case 2: return func.call(thisArg, args[0], args[1]); - case 3: return func.call(thisArg, args[0], args[1], args[2]); + ret = gtlt + M + '.' + m + '.' + p; + } else if (xm) { + ret = '>=' + M + '.0.0 <' + (+M + 1) + '.0.0'; + } else if (xp) { + ret = '>=' + M + '.' + m + '.0 <' + M + '.' + (+m + 1) + '.0'; } - return func.apply(thisArg, args); - } - /** - * A specialized version of `baseAggregator` for arrays. - * - * @private - * @param {Array} [array] The array to iterate over. - * @param {Function} setter The function to set `accumulator` values. - * @param {Function} iteratee The iteratee to transform keys. - * @param {Object} accumulator The initial aggregated object. - * @returns {Function} Returns `accumulator`. - */ - function arrayAggregator(array, setter, iteratee, accumulator) { - var index = -1, - length = array == null ? 0 : array.length; + debug('xRange return', ret); - while (++index < length) { - var value = array[index]; - setter(accumulator, value, iteratee(value), array); - } - return accumulator; - } + return ret; + }); +} - /** - * A specialized version of `_.forEach` for arrays without support for - * iteratee shorthands. - * - * @private - * @param {Array} [array] The array to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {Array} Returns `array`. - */ - function arrayEach(array, iteratee) { - var index = -1, - length = array == null ? 0 : array.length; +// Because * is AND-ed with everything else in the comparator, +// and '' means "any version", just remove the *s entirely. +function replaceStars(comp, loose) { + debug('replaceStars', comp, loose); + // Looseness is ignored here. star is always as loose as it gets! + return comp.trim().replace(re[STAR], ''); +} - while (++index < length) { - if (iteratee(array[index], index, array) === false) { - break; - } - } - return array; - } +// This function is passed to string.replace(re[HYPHENRANGE]) +// M, m, patch, prerelease, build +// 1.2 - 3.4.5 => >=1.2.0 <=3.4.5 +// 1.2.3 - 3.4 => >=1.2.0 <3.5.0 Any 3.4.x will do +// 1.2 - 3.4 => >=1.2.0 <3.5.0 +function hyphenReplace($0, + from, fM, fm, fp, fpr, fb, + to, tM, tm, tp, tpr, tb) { - /** - * A specialized version of `_.forEachRight` for arrays without support for - * iteratee shorthands. - * - * @private - * @param {Array} [array] The array to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {Array} Returns `array`. - */ - function arrayEachRight(array, iteratee) { - var length = array == null ? 0 : array.length; + if (isX(fM)) + from = ''; + else if (isX(fm)) + from = '>=' + fM + '.0.0'; + else if (isX(fp)) + from = '>=' + fM + '.' + fm + '.0'; + else + from = '>=' + from; - while (length--) { - if (iteratee(array[length], length, array) === false) { - break; - } - } - return array; - } + if (isX(tM)) + to = ''; + else if (isX(tm)) + to = '<' + (+tM + 1) + '.0.0'; + else if (isX(tp)) + to = '<' + tM + '.' + (+tm + 1) + '.0'; + else if (tpr) + to = '<=' + tM + '.' + tm + '.' + tp + '-' + tpr; + else + to = '<=' + to; - /** - * A specialized version of `_.every` for arrays without support for - * iteratee shorthands. - * - * @private - * @param {Array} [array] The array to iterate over. - * @param {Function} predicate The function invoked per iteration. - * @returns {boolean} Returns `true` if all elements pass the predicate check, - * else `false`. - */ - function arrayEvery(array, predicate) { - var index = -1, - length = array == null ? 0 : array.length; + return (from + ' ' + to).trim(); +} - while (++index < length) { - if (!predicate(array[index], index, array)) { - return false; - } - } - return true; - } - /** - * A specialized version of `_.filter` for arrays without support for - * iteratee shorthands. - * - * @private - * @param {Array} [array] The array to iterate over. - * @param {Function} predicate The function invoked per iteration. - * @returns {Array} Returns the new filtered array. - */ - function arrayFilter(array, predicate) { - var index = -1, - length = array == null ? 0 : array.length, - resIndex = 0, - result = []; +// if ANY of the sets match ALL of its comparators, then pass +Range.prototype.test = function(version) { + if (!version) + return false; - while (++index < length) { - var value = array[index]; - if (predicate(value, index, array)) { - result[resIndex++] = value; - } - } - return result; + if (typeof version === 'string') + version = new SemVer(version, this.loose); + + for (var i = 0; i < this.set.length; i++) { + if (testSet(this.set[i], version)) + return true; } + return false; +}; - /** - * A specialized version of `_.includes` for arrays without support for - * specifying an index to search from. - * - * @private - * @param {Array} [array] The array to inspect. - * @param {*} target The value to search for. - * @returns {boolean} Returns `true` if `target` is found, else `false`. - */ - function arrayIncludes(array, value) { - var length = array == null ? 0 : array.length; - return !!length && baseIndexOf(array, value, 0) > -1; +function testSet(set, version) { + for (var i = 0; i < set.length; i++) { + if (!set[i].test(version)) + return false; } - /** - * This function is like `arrayIncludes` except that it accepts a comparator. - * - * @private - * @param {Array} [array] The array to inspect. - * @param {*} target The value to search for. - * @param {Function} comparator The comparator invoked per element. - * @returns {boolean} Returns `true` if `target` is found, else `false`. - */ - function arrayIncludesWith(array, value, comparator) { - var index = -1, - length = array == null ? 0 : array.length; + if (version.prerelease.length) { + // Find the set of versions that are allowed to have prereleases + // For example, ^1.2.3-pr.1 desugars to >=1.2.3-pr.1 <2.0.0 + // That should allow `1.2.3-pr.2` to pass. + // However, `1.2.4-alpha.notready` should NOT be allowed, + // even though it's within the range set by the comparators. + for (var i = 0; i < set.length; i++) { + debug(set[i].semver); + if (set[i].semver === ANY) + continue; - while (++index < length) { - if (comparator(value, array[index])) { - return true; + if (set[i].semver.prerelease.length > 0) { + var allowed = set[i].semver; + if (allowed.major === version.major && + allowed.minor === version.minor && + allowed.patch === version.patch) + return true; } } + + // Version has a -pre, but it's not one of the ones we like. return false; } - /** - * A specialized version of `_.map` for arrays without support for iteratee - * shorthands. - * - * @private - * @param {Array} [array] The array to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {Array} Returns the new mapped array. - */ - function arrayMap(array, iteratee) { - var index = -1, - length = array == null ? 0 : array.length, - result = Array(length); + return true; +} - while (++index < length) { - result[index] = iteratee(array[index], index, array); - } - return result; +exports.satisfies = satisfies; +function satisfies(version, range, loose) { + try { + range = new Range(range, loose); + } catch (er) { + return false; } + return range.test(version); +} - /** - * Appends the elements of `values` to `array`. - * - * @private - * @param {Array} array The array to modify. - * @param {Array} values The values to append. - * @returns {Array} Returns `array`. - */ - function arrayPush(array, values) { - var index = -1, - length = values.length, - offset = array.length; +exports.maxSatisfying = maxSatisfying; +function maxSatisfying(versions, range, loose) { + return versions.filter(function(version) { + return satisfies(version, range, loose); + }).sort(function(a, b) { + return rcompare(a, b, loose); + })[0] || null; +} - while (++index < length) { - array[offset + index] = values[index]; - } - return array; +exports.minSatisfying = minSatisfying; +function minSatisfying(versions, range, loose) { + return versions.filter(function(version) { + return satisfies(version, range, loose); + }).sort(function(a, b) { + return compare(a, b, loose); + })[0] || null; +} + +exports.validRange = validRange; +function validRange(range, loose) { + try { + // Return '*' instead of '' so that truthiness works. + // This will throw if it's invalid anyway + return new Range(range, loose).range || '*'; + } catch (er) { + return null; } +} - /** - * A specialized version of `_.reduce` for arrays without support for - * iteratee shorthands. - * - * @private - * @param {Array} [array] The array to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @param {*} [accumulator] The initial value. - * @param {boolean} [initAccum] Specify using the first element of `array` as - * the initial value. - * @returns {*} Returns the accumulated value. - */ - function arrayReduce(array, iteratee, accumulator, initAccum) { - var index = -1, - length = array == null ? 0 : array.length; +// Determine if version is less than all the versions possible in the range +exports.ltr = ltr; +function ltr(version, range, loose) { + return outside(version, range, '<', loose); +} - if (initAccum && length) { - accumulator = array[++index]; - } - while (++index < length) { - accumulator = iteratee(accumulator, array[index], index, array); - } - return accumulator; - } +// Determine if version is greater than all the versions possible in the range. +exports.gtr = gtr; +function gtr(version, range, loose) { + return outside(version, range, '>', loose); +} - /** - * A specialized version of `_.reduceRight` for arrays without support for - * iteratee shorthands. - * - * @private - * @param {Array} [array] The array to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @param {*} [accumulator] The initial value. - * @param {boolean} [initAccum] Specify using the last element of `array` as - * the initial value. - * @returns {*} Returns the accumulated value. - */ - function arrayReduceRight(array, iteratee, accumulator, initAccum) { - var length = array == null ? 0 : array.length; - if (initAccum && length) { - accumulator = array[--length]; - } - while (length--) { - accumulator = iteratee(accumulator, array[length], length, array); - } - return accumulator; - } +exports.outside = outside; +function outside(version, range, hilo, loose) { + version = new SemVer(version, loose); + range = new Range(range, loose); - /** - * A specialized version of `_.some` for arrays without support for iteratee - * shorthands. - * - * @private - * @param {Array} [array] The array to iterate over. - * @param {Function} predicate The function invoked per iteration. - * @returns {boolean} Returns `true` if any element passes the predicate check, - * else `false`. - */ - function arraySome(array, predicate) { - var index = -1, - length = array == null ? 0 : array.length; + var gtfn, ltefn, ltfn, comp, ecomp; + switch (hilo) { + case '>': + gtfn = gt; + ltefn = lte; + ltfn = lt; + comp = '>'; + ecomp = '>='; + break; + case '<': + gtfn = lt; + ltefn = gte; + ltfn = gt; + comp = '<'; + ecomp = '<='; + break; + default: + throw new TypeError('Must provide a hilo val of "<" or ">"'); + } - while (++index < length) { - if (predicate(array[index], index, array)) { - return true; - } - } + // If it satisifes the range it is not outside + if (satisfies(version, range, loose)) { return false; } - /** - * Gets the size of an ASCII `string`. - * - * @private - * @param {string} string The string inspect. - * @returns {number} Returns the string size. - */ - var asciiSize = baseProperty('length'); + // From now on, variable terms are as if we're in "gtr" mode. + // but note that everything is flipped for the "ltr" function. - /** - * Converts an ASCII `string` to an array. - * - * @private - * @param {string} string The string to convert. - * @returns {Array} Returns the converted array. - */ - function asciiToArray(string) { - return string.split(''); - } + for (var i = 0; i < range.set.length; ++i) { + var comparators = range.set[i]; - /** - * Splits an ASCII `string` into an array of its words. - * - * @private - * @param {string} The string to inspect. - * @returns {Array} Returns the words of `string`. - */ - function asciiWords(string) { - return string.match(reAsciiWord) || []; - } + var high = null; + var low = null; - /** - * The base implementation of methods like `_.findKey` and `_.findLastKey`, - * without support for iteratee shorthands, which iterates over `collection` - * using `eachFunc`. - * - * @private - * @param {Array|Object} collection The collection to inspect. - * @param {Function} predicate The function invoked per iteration. - * @param {Function} eachFunc The function to iterate over `collection`. - * @returns {*} Returns the found element or its key, else `undefined`. - */ - function baseFindKey(collection, predicate, eachFunc) { - var result; - eachFunc(collection, function(value, key, collection) { - if (predicate(value, key, collection)) { - result = key; - return false; + comparators.forEach(function(comparator) { + if (comparator.semver === ANY) { + comparator = new Comparator('>=0.0.0') + } + high = high || comparator; + low = low || comparator; + if (gtfn(comparator.semver, high.semver, loose)) { + high = comparator; + } else if (ltfn(comparator.semver, low.semver, loose)) { + low = comparator; } }); - return result; - } - /** - * The base implementation of `_.findIndex` and `_.findLastIndex` without - * support for iteratee shorthands. - * - * @private - * @param {Array} array The array to inspect. - * @param {Function} predicate The function invoked per iteration. - * @param {number} fromIndex The index to search from. - * @param {boolean} [fromRight] Specify iterating from right to left. - * @returns {number} Returns the index of the matched value, else `-1`. - */ - function baseFindIndex(array, predicate, fromIndex, fromRight) { - var length = array.length, - index = fromIndex + (fromRight ? 1 : -1); + // If the edge version comparator has a operator then our version + // isn't outside it + if (high.operator === comp || high.operator === ecomp) { + return false; + } - while ((fromRight ? index-- : ++index < length)) { - if (predicate(array[index], index, array)) { - return index; - } + // If the lowest version comparator has an operator and our version + // is less than it then it isn't higher than the range + if ((!low.operator || low.operator === comp) && + ltefn(version, low.semver)) { + return false; + } else if (low.operator === ecomp && ltfn(version, low.semver)) { + return false; } - return -1; } + return true; +} - /** - * The base implementation of `_.indexOf` without `fromIndex` bounds checks. - * - * @private - * @param {Array} array The array to inspect. - * @param {*} value The value to search for. - * @param {number} fromIndex The index to search from. - * @returns {number} Returns the index of the matched value, else `-1`. - */ - function baseIndexOf(array, value, fromIndex) { - return value === value - ? strictIndexOf(array, value, fromIndex) - : baseFindIndex(array, baseIsNaN, fromIndex); - } +exports.prerelease = prerelease; +function prerelease(version, loose) { + var parsed = parse(version, loose); + return (parsed && parsed.prerelease.length) ? parsed.prerelease : null; +} - /** - * This function is like `baseIndexOf` except that it accepts a comparator. - * - * @private - * @param {Array} array The array to inspect. - * @param {*} value The value to search for. - * @param {number} fromIndex The index to search from. - * @param {Function} comparator The comparator invoked per element. - * @returns {number} Returns the index of the matched value, else `-1`. - */ - function baseIndexOfWith(array, value, fromIndex, comparator) { - var index = fromIndex - 1, - length = array.length; - while (++index < length) { - if (comparator(array[index], value)) { - return index; +/***/ }), +/* 18 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.default = nullify; +function nullify() { + let obj = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {}; + + if (Array.isArray(obj)) { + for (const item of obj) { + nullify(item); + } + } else if (obj !== null && typeof obj === 'object' || typeof obj === 'function') { + Object.setPrototypeOf(obj, null); + + // for..in can only be applied to 'object', not 'function' + if (typeof obj === 'object') { + for (const key in obj) { + nullify(obj[key]); } } - return -1; } - /** - * The base implementation of `_.isNaN` without support for number objects. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is `NaN`, else `false`. - */ - function baseIsNaN(value) { - return value !== value; - } + return obj; +} - /** - * The base implementation of `_.mean` and `_.meanBy` without support for - * iteratee shorthands. - * - * @private - * @param {Array} array The array to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {number} Returns the mean. - */ - function baseMean(array, iteratee) { - var length = array == null ? 0 : array.length; - return length ? (baseSum(array, iteratee) / length) : NAN; - } +/***/ }), +/* 19 */ +/***/ (function(module, exports, __webpack_require__) { - /** - * The base implementation of `_.property` without support for deep paths. - * - * @private - * @param {string} key The key of the property to get. - * @returns {Function} Returns the new accessor function. - */ - function baseProperty(key) { - return function(object) { - return object == null ? undefined : object[key]; - }; - } +// Copyright 2015 Joyent, Inc. - /** - * The base implementation of `_.propertyOf` without support for deep paths. - * - * @private - * @param {Object} object The object to query. - * @returns {Function} Returns the new accessor function. - */ - function basePropertyOf(object) { - return function(key) { - return object == null ? undefined : object[key]; - }; - } +module.exports = { + bufferSplit: bufferSplit, + addRSAMissing: addRSAMissing, + calculateDSAPublic: calculateDSAPublic, + mpNormalize: mpNormalize, + ecNormalize: ecNormalize, + countZeros: countZeros, + assertCompatible: assertCompatible, + isCompatible: isCompatible, + opensslKeyDeriv: opensslKeyDeriv, + opensshCipherInfo: opensshCipherInfo +}; - /** - * The base implementation of `_.reduce` and `_.reduceRight`, without support - * for iteratee shorthands, which iterates over `collection` using `eachFunc`. - * - * @private - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @param {*} accumulator The initial value. - * @param {boolean} initAccum Specify using the first or last element of - * `collection` as the initial value. - * @param {Function} eachFunc The function to iterate over `collection`. - * @returns {*} Returns the accumulated value. - */ - function baseReduce(collection, iteratee, accumulator, initAccum, eachFunc) { - eachFunc(collection, function(value, index, collection) { - accumulator = initAccum - ? (initAccum = false, value) - : iteratee(accumulator, value, index, collection); - }); - return accumulator; - } +var assert = __webpack_require__(11); +var PrivateKey = __webpack_require__(24); +var crypto = __webpack_require__(8); - /** - * The base implementation of `_.sortBy` which uses `comparer` to define the - * sort order of `array` and replaces criteria objects with their corresponding - * values. - * - * @private - * @param {Array} array The array to sort. - * @param {Function} comparer The function to define sort order. - * @returns {Array} Returns `array`. - */ - function baseSortBy(array, comparer) { - var length = array.length; +var MAX_CLASS_DEPTH = 3; - array.sort(comparer); - while (length--) { - array[length] = array[length].value; - } - return array; - } +function isCompatible(obj, klass, needVer) { + if (obj === null || typeof (obj) !== 'object') + return (false); + if (needVer === undefined) + needVer = klass.prototype._sshpkApiVersion; + if (obj instanceof klass && + klass.prototype._sshpkApiVersion[0] == needVer[0]) + return (true); + var proto = Object.getPrototypeOf(obj); + var depth = 0; + while (proto.constructor.name !== klass.name) { + proto = Object.getPrototypeOf(proto); + if (!proto || ++depth > MAX_CLASS_DEPTH) + return (false); + } + if (proto.constructor.name !== klass.name) + return (false); + var ver = proto._sshpkApiVersion; + if (ver === undefined) + ver = klass._oldVersionDetect(obj); + if (ver[0] != needVer[0] || ver[1] < needVer[1]) + return (false); + return (true); +} - /** - * The base implementation of `_.sum` and `_.sumBy` without support for - * iteratee shorthands. - * - * @private - * @param {Array} array The array to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {number} Returns the sum. - */ - function baseSum(array, iteratee) { - var result, - index = -1, - length = array.length; +function assertCompatible(obj, klass, needVer, name) { + if (name === undefined) + name = 'object'; + assert.ok(obj, name + ' must not be null'); + assert.object(obj, name + ' must be an object'); + if (needVer === undefined) + needVer = klass.prototype._sshpkApiVersion; + if (obj instanceof klass && + klass.prototype._sshpkApiVersion[0] == needVer[0]) + return; + var proto = Object.getPrototypeOf(obj); + var depth = 0; + while (proto.constructor.name !== klass.name) { + proto = Object.getPrototypeOf(proto); + assert.ok(proto && ++depth <= MAX_CLASS_DEPTH, + name + ' must be a ' + klass.name + ' instance'); + } + assert.strictEqual(proto.constructor.name, klass.name, + name + ' must be a ' + klass.name + ' instance'); + var ver = proto._sshpkApiVersion; + if (ver === undefined) + ver = klass._oldVersionDetect(obj); + assert.ok(ver[0] == needVer[0] && ver[1] >= needVer[1], + name + ' must be compatible with ' + klass.name + ' klass ' + + 'version ' + needVer[0] + '.' + needVer[1]); +} - while (++index < length) { - var current = iteratee(array[index]); - if (current !== undefined) { - result = result === undefined ? current : (result + current); - } - } - return result; - } +var CIPHER_LEN = { + 'des-ede3-cbc': { key: 7, iv: 8 }, + 'aes-128-cbc': { key: 16, iv: 16 } +}; +var PKCS5_SALT_LEN = 8; - /** - * The base implementation of `_.times` without support for iteratee shorthands - * or max array length checks. - * - * @private - * @param {number} n The number of times to invoke `iteratee`. - * @param {Function} iteratee The function invoked per iteration. - * @returns {Array} Returns the array of results. - */ - function baseTimes(n, iteratee) { - var index = -1, - result = Array(n); +function opensslKeyDeriv(cipher, salt, passphrase, count) { + assert.buffer(salt, 'salt'); + assert.buffer(passphrase, 'passphrase'); + assert.number(count, 'iteration count'); - while (++index < n) { - result[index] = iteratee(index); - } - return result; - } + var clen = CIPHER_LEN[cipher]; + assert.object(clen, 'supported cipher'); - /** - * The base implementation of `_.toPairs` and `_.toPairsIn` which creates an array - * of key-value pairs for `object` corresponding to the property names of `props`. - * - * @private - * @param {Object} object The object to query. - * @param {Array} props The property names to get values for. - * @returns {Object} Returns the key-value pairs. - */ - function baseToPairs(object, props) { - return arrayMap(props, function(key) { - return [key, object[key]]; - }); - } + salt = salt.slice(0, PKCS5_SALT_LEN); - /** - * The base implementation of `_.unary` without support for storing metadata. - * - * @private - * @param {Function} func The function to cap arguments for. - * @returns {Function} Returns the new capped function. - */ - function baseUnary(func) { - return function(value) { - return func(value); - }; - } + var D, D_prev, bufs; + var material = new Buffer(0); + while (material.length < clen.key + clen.iv) { + bufs = []; + if (D_prev) + bufs.push(D_prev); + bufs.push(passphrase); + bufs.push(salt); + D = Buffer.concat(bufs); + for (var j = 0; j < count; ++j) + D = crypto.createHash('md5').update(D).digest(); + material = Buffer.concat([material, D]); + D_prev = D; + } - /** - * The base implementation of `_.values` and `_.valuesIn` which creates an - * array of `object` property values corresponding to the property names - * of `props`. - * - * @private - * @param {Object} object The object to query. - * @param {Array} props The property names to get values for. - * @returns {Object} Returns the array of property values. - */ - function baseValues(object, props) { - return arrayMap(props, function(key) { - return object[key]; - }); - } + return ({ + key: material.slice(0, clen.key), + iv: material.slice(clen.key, clen.key + clen.iv) + }); +} - /** - * Checks if a `cache` value for `key` exists. - * - * @private - * @param {Object} cache The cache to query. - * @param {string} key The key of the entry to check. - * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. - */ - function cacheHas(cache, key) { - return cache.has(key); - } +/* Count leading zero bits on a buffer */ +function countZeros(buf) { + var o = 0, obit = 8; + while (o < buf.length) { + var mask = (1 << obit); + if ((buf[o] & mask) === mask) + break; + obit--; + if (obit < 0) { + o++; + obit = 8; + } + } + return (o*8 + (8 - obit) - 1); +} - /** - * Used by `_.trim` and `_.trimStart` to get the index of the first string symbol - * that is not found in the character symbols. - * - * @private - * @param {Array} strSymbols The string symbols to inspect. - * @param {Array} chrSymbols The character symbols to find. - * @returns {number} Returns the index of the first unmatched string symbol. - */ - function charsStartIndex(strSymbols, chrSymbols) { - var index = -1, - length = strSymbols.length; +function bufferSplit(buf, chr) { + assert.buffer(buf); + assert.string(chr); - while (++index < length && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {} - return index; - } + var parts = []; + var lastPart = 0; + var matches = 0; + for (var i = 0; i < buf.length; ++i) { + if (buf[i] === chr.charCodeAt(matches)) + ++matches; + else if (buf[i] === chr.charCodeAt(0)) + matches = 1; + else + matches = 0; - /** - * Used by `_.trim` and `_.trimEnd` to get the index of the last string symbol - * that is not found in the character symbols. - * - * @private - * @param {Array} strSymbols The string symbols to inspect. - * @param {Array} chrSymbols The character symbols to find. - * @returns {number} Returns the index of the last unmatched string symbol. - */ - function charsEndIndex(strSymbols, chrSymbols) { - var index = strSymbols.length; + if (matches >= chr.length) { + var newPart = i + 1; + parts.push(buf.slice(lastPart, newPart - matches)); + lastPart = newPart; + matches = 0; + } + } + if (lastPart <= buf.length) + parts.push(buf.slice(lastPart, buf.length)); - while (index-- && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {} - return index; - } + return (parts); +} - /** - * Gets the number of `placeholder` occurrences in `array`. - * - * @private - * @param {Array} array The array to inspect. - * @param {*} placeholder The placeholder to search for. - * @returns {number} Returns the placeholder count. - */ - function countHolders(array, placeholder) { - var length = array.length, - result = 0; +function ecNormalize(buf, addZero) { + assert.buffer(buf); + if (buf[0] === 0x00 && buf[1] === 0x04) { + if (addZero) + return (buf); + return (buf.slice(1)); + } else if (buf[0] === 0x04) { + if (!addZero) + return (buf); + } else { + while (buf[0] === 0x00) + buf = buf.slice(1); + if (buf[0] === 0x02 || buf[0] === 0x03) + throw (new Error('Compressed elliptic curve points ' + + 'are not supported')); + if (buf[0] !== 0x04) + throw (new Error('Not a valid elliptic curve point')); + if (!addZero) + return (buf); + } + var b = new Buffer(buf.length + 1); + b[0] = 0x0; + buf.copy(b, 1); + return (b); +} - while (length--) { - if (array[length] === placeholder) { - ++result; - } - } - return result; - } +function mpNormalize(buf) { + assert.buffer(buf); + while (buf.length > 1 && buf[0] === 0x00 && (buf[1] & 0x80) === 0x00) + buf = buf.slice(1); + if ((buf[0] & 0x80) === 0x80) { + var b = new Buffer(buf.length + 1); + b[0] = 0x00; + buf.copy(b, 1); + buf = b; + } + return (buf); +} - /** - * Used by `_.deburr` to convert Latin-1 Supplement and Latin Extended-A - * letters to basic Latin letters. - * - * @private - * @param {string} letter The matched letter to deburr. - * @returns {string} Returns the deburred letter. - */ - var deburrLetter = basePropertyOf(deburredLetters); +function bigintToMpBuf(bigint) { + var buf = new Buffer(bigint.toByteArray()); + buf = mpNormalize(buf); + return (buf); +} - /** - * Used by `_.escape` to convert characters to HTML entities. - * - * @private - * @param {string} chr The matched character to escape. - * @returns {string} Returns the escaped character. - */ - var escapeHtmlChar = basePropertyOf(htmlEscapes); +function calculateDSAPublic(g, p, x) { + assert.buffer(g); + assert.buffer(p); + assert.buffer(x); + try { + var bigInt = __webpack_require__(56).BigInteger; + } catch (e) { + throw (new Error('To load a PKCS#8 format DSA private key, ' + + 'the node jsbn library is required.')); + } + g = new bigInt(g); + p = new bigInt(p); + x = new bigInt(x); + var y = g.modPow(x, p); + var ybuf = bigintToMpBuf(y); + return (ybuf); +} - /** - * Used by `_.template` to escape characters for inclusion in compiled string literals. - * - * @private - * @param {string} chr The matched character to escape. - * @returns {string} Returns the escaped character. - */ - function escapeStringChar(chr) { - return '\\' + stringEscapes[chr]; - } +function addRSAMissing(key) { + assert.object(key); + assertCompatible(key, PrivateKey, [1, 1]); + try { + var bigInt = __webpack_require__(56).BigInteger; + } catch (e) { + throw (new Error('To write a PEM private key from ' + + 'this source, the node jsbn lib is required.')); + } - /** - * Gets the value at `key` of `object`. - * - * @private - * @param {Object} [object] The object to query. - * @param {string} key The key of the property to get. - * @returns {*} Returns the property value. - */ - function getValue(object, key) { - return object == null ? undefined : object[key]; - } + var d = new bigInt(key.part.d.data); + var buf; - /** - * Checks if `string` contains Unicode symbols. - * - * @private - * @param {string} string The string to inspect. - * @returns {boolean} Returns `true` if a symbol is found, else `false`. - */ - function hasUnicode(string) { - return reHasUnicode.test(string); - } + if (!key.part.dmodp) { + var p = new bigInt(key.part.p.data); + var dmodp = d.mod(p.subtract(1)); - /** - * Checks if `string` contains a word composed of Unicode symbols. - * - * @private - * @param {string} string The string to inspect. - * @returns {boolean} Returns `true` if a word is found, else `false`. - */ - function hasUnicodeWord(string) { - return reHasUnicodeWord.test(string); - } + buf = bigintToMpBuf(dmodp); + key.part.dmodp = {name: 'dmodp', data: buf}; + key.parts.push(key.part.dmodp); + } + if (!key.part.dmodq) { + var q = new bigInt(key.part.q.data); + var dmodq = d.mod(q.subtract(1)); - /** - * Converts `iterator` to an array. - * - * @private - * @param {Object} iterator The iterator to convert. - * @returns {Array} Returns the converted array. - */ - function iteratorToArray(iterator) { - var data, - result = []; + buf = bigintToMpBuf(dmodq); + key.part.dmodq = {name: 'dmodq', data: buf}; + key.parts.push(key.part.dmodq); + } +} - while (!(data = iterator.next()).done) { - result.push(data.value); - } - return result; - } +function opensshCipherInfo(cipher) { + var inf = {}; + switch (cipher) { + case '3des-cbc': + inf.keySize = 24; + inf.blockSize = 8; + inf.opensslName = 'des-ede3-cbc'; + break; + case 'blowfish-cbc': + inf.keySize = 16; + inf.blockSize = 8; + inf.opensslName = 'bf-cbc'; + break; + case 'aes128-cbc': + case 'aes128-ctr': + case 'aes128-gcm@openssh.com': + inf.keySize = 16; + inf.blockSize = 16; + inf.opensslName = 'aes-128-' + cipher.slice(7, 10); + break; + case 'aes192-cbc': + case 'aes192-ctr': + case 'aes192-gcm@openssh.com': + inf.keySize = 24; + inf.blockSize = 16; + inf.opensslName = 'aes-192-' + cipher.slice(7, 10); + break; + case 'aes256-cbc': + case 'aes256-ctr': + case 'aes256-gcm@openssh.com': + inf.keySize = 32; + inf.blockSize = 16; + inf.opensslName = 'aes-256-' + cipher.slice(7, 10); + break; + default: + throw (new Error( + 'Unsupported openssl cipher "' + cipher + '"')); + } + return (inf); +} - /** - * Converts `map` to its key-value pairs. - * - * @private - * @param {Object} map The map to convert. - * @returns {Array} Returns the key-value pairs. - */ - function mapToArray(map) { - var index = -1, - result = Array(map.size); - map.forEach(function(value, key) { - result[++index] = [key, value]; - }); - return result; - } +/***/ }), +/* 20 */ +/***/ (function(module, exports) { - /** - * Creates a unary function that invokes `func` with its argument transformed. - * - * @private - * @param {Function} func The function to wrap. - * @param {Function} transform The argument transform. - * @returns {Function} Returns the new function. - */ - function overArg(func, transform) { - return function(arg) { - return func(transform(arg)); - }; - } +module.exports = require("assert"); - /** - * Replaces all `placeholder` elements in `array` with an internal placeholder - * and returns an array of their indexes. - * - * @private - * @param {Array} array The array to modify. - * @param {*} placeholder The placeholder to replace. - * @returns {Array} Returns the new array of placeholder indexes. - */ - function replaceHolders(array, placeholder) { - var index = -1, - length = array.length, - resIndex = 0, - result = []; +/***/ }), +/* 21 */ +/***/ (function(module, exports) { - while (++index < length) { - var value = array[index]; - if (value === placeholder || value === PLACEHOLDER) { - array[index] = PLACEHOLDER; - result[resIndex++] = index; - } - } - return result; - } +var core = module.exports = {version: '2.4.0'}; +if(typeof __e == 'number')__e = core; // eslint-disable-line no-undef - /** - * Converts `set` to an array of its values. - * - * @private - * @param {Object} set The set to convert. - * @returns {Array} Returns the values. - */ - function setToArray(set) { - var index = -1, - result = Array(set.size); +/***/ }), +/* 22 */ +/***/ (function(module, exports) { - set.forEach(function(value) { - result[++index] = value; - }); - return result; - } +// Copyright 2015 Joyent, Inc. - /** - * Converts `set` to its value-value pairs. - * - * @private - * @param {Object} set The set to convert. - * @returns {Array} Returns the value-value pairs. - */ - function setToPairs(set) { - var index = -1, - result = Array(set.size); +var algInfo = { + 'dsa': { + parts: ['p', 'q', 'g', 'y'], + sizePart: 'p' + }, + 'rsa': { + parts: ['e', 'n'], + sizePart: 'n' + }, + 'ecdsa': { + parts: ['curve', 'Q'], + sizePart: 'Q' + }, + 'ed25519': { + parts: ['R'], + normalize: false, + sizePart: 'R' + } +}; +algInfo['curve25519'] = algInfo['ed25519']; - set.forEach(function(value) { - result[++index] = [value, value]; - }); - return result; - } +var algPrivInfo = { + 'dsa': { + parts: ['p', 'q', 'g', 'y', 'x'] + }, + 'rsa': { + parts: ['n', 'e', 'd', 'iqmp', 'p', 'q'] + }, + 'ecdsa': { + parts: ['curve', 'Q', 'd'] + }, + 'ed25519': { + parts: ['R', 'r'], + normalize: false + } +}; +algPrivInfo['curve25519'] = algPrivInfo['ed25519']; - /** - * A specialized version of `_.indexOf` which performs strict equality - * comparisons of values, i.e. `===`. - * - * @private - * @param {Array} array The array to inspect. - * @param {*} value The value to search for. - * @param {number} fromIndex The index to search from. - * @returns {number} Returns the index of the matched value, else `-1`. - */ - function strictIndexOf(array, value, fromIndex) { - var index = fromIndex - 1, - length = array.length; +var hashAlgs = { + 'md5': true, + 'sha1': true, + 'sha256': true, + 'sha384': true, + 'sha512': true +}; - while (++index < length) { - if (array[index] === value) { - return index; - } - } - return -1; - } +/* + * Taken from + * http://csrc.nist.gov/groups/ST/toolkit/documents/dss/NISTReCur.pdf + */ +var curves = { + 'nistp256': { + size: 256, + pkcs8oid: '1.2.840.10045.3.1.7', + p: new Buffer(('00' + + 'ffffffff 00000001 00000000 00000000' + + '00000000 ffffffff ffffffff ffffffff'). + replace(/ /g, ''), 'hex'), + a: new Buffer(('00' + + 'FFFFFFFF 00000001 00000000 00000000' + + '00000000 FFFFFFFF FFFFFFFF FFFFFFFC'). + replace(/ /g, ''), 'hex'), + b: new Buffer(( + '5ac635d8 aa3a93e7 b3ebbd55 769886bc' + + '651d06b0 cc53b0f6 3bce3c3e 27d2604b'). + replace(/ /g, ''), 'hex'), + s: new Buffer(('00' + + 'c49d3608 86e70493 6a6678e1 139d26b7' + + '819f7e90'). + replace(/ /g, ''), 'hex'), + n: new Buffer(('00' + + 'ffffffff 00000000 ffffffff ffffffff' + + 'bce6faad a7179e84 f3b9cac2 fc632551'). + replace(/ /g, ''), 'hex'), + G: new Buffer(('04' + + '6b17d1f2 e12c4247 f8bce6e5 63a440f2' + + '77037d81 2deb33a0 f4a13945 d898c296' + + '4fe342e2 fe1a7f9b 8ee7eb4a 7c0f9e16' + + '2bce3357 6b315ece cbb64068 37bf51f5'). + replace(/ /g, ''), 'hex') + }, + 'nistp384': { + size: 384, + pkcs8oid: '1.3.132.0.34', + p: new Buffer(('00' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff ffffffff fffffffe' + + 'ffffffff 00000000 00000000 ffffffff'). + replace(/ /g, ''), 'hex'), + a: new Buffer(('00' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFE' + + 'FFFFFFFF 00000000 00000000 FFFFFFFC'). + replace(/ /g, ''), 'hex'), + b: new Buffer(( + 'b3312fa7 e23ee7e4 988e056b e3f82d19' + + '181d9c6e fe814112 0314088f 5013875a' + + 'c656398d 8a2ed19d 2a85c8ed d3ec2aef'). + replace(/ /g, ''), 'hex'), + s: new Buffer(('00' + + 'a335926a a319a27a 1d00896a 6773a482' + + '7acdac73'). + replace(/ /g, ''), 'hex'), + n: new Buffer(('00' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff c7634d81 f4372ddf' + + '581a0db2 48b0a77a ecec196a ccc52973'). + replace(/ /g, ''), 'hex'), + G: new Buffer(('04' + + 'aa87ca22 be8b0537 8eb1c71e f320ad74' + + '6e1d3b62 8ba79b98 59f741e0 82542a38' + + '5502f25d bf55296c 3a545e38 72760ab7' + + '3617de4a 96262c6f 5d9e98bf 9292dc29' + + 'f8f41dbd 289a147c e9da3113 b5f0b8c0' + + '0a60b1ce 1d7e819d 7a431d7c 90ea0e5f'). + replace(/ /g, ''), 'hex') + }, + 'nistp521': { + size: 521, + pkcs8oid: '1.3.132.0.35', + p: new Buffer(( + '01ffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffff').replace(/ /g, ''), 'hex'), + a: new Buffer(('01FF' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFC'). + replace(/ /g, ''), 'hex'), + b: new Buffer(('51' + + '953eb961 8e1c9a1f 929a21a0 b68540ee' + + 'a2da725b 99b315f3 b8b48991 8ef109e1' + + '56193951 ec7e937b 1652c0bd 3bb1bf07' + + '3573df88 3d2c34f1 ef451fd4 6b503f00'). + replace(/ /g, ''), 'hex'), + s: new Buffer(('00' + + 'd09e8800 291cb853 96cc6717 393284aa' + + 'a0da64ba').replace(/ /g, ''), 'hex'), + n: new Buffer(('01ff' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff ffffffff fffffffa' + + '51868783 bf2f966b 7fcc0148 f709a5d0' + + '3bb5c9b8 899c47ae bb6fb71e 91386409'). + replace(/ /g, ''), 'hex'), + G: new Buffer(('04' + + '00c6 858e06b7 0404e9cd 9e3ecb66 2395b442' + + '9c648139 053fb521 f828af60 6b4d3dba' + + 'a14b5e77 efe75928 fe1dc127 a2ffa8de' + + '3348b3c1 856a429b f97e7e31 c2e5bd66' + + '0118 39296a78 9a3bc004 5c8a5fb4 2c7d1bd9' + + '98f54449 579b4468 17afbd17 273e662c' + + '97ee7299 5ef42640 c550b901 3fad0761' + + '353c7086 a272c240 88be9476 9fd16650'). + replace(/ /g, ''), 'hex') + } +}; - /** - * A specialized version of `_.lastIndexOf` which performs strict equality - * comparisons of values, i.e. `===`. - * - * @private - * @param {Array} array The array to inspect. - * @param {*} value The value to search for. - * @param {number} fromIndex The index to search from. - * @returns {number} Returns the index of the matched value, else `-1`. - */ - function strictLastIndexOf(array, value, fromIndex) { - var index = fromIndex + 1; - while (index--) { - if (array[index] === value) { - return index; - } - } - return index; - } +module.exports = { + info: algInfo, + privInfo: algPrivInfo, + hashAlgs: hashAlgs, + curves: curves +}; - /** - * Gets the number of symbols in `string`. - * - * @private - * @param {string} string The string to inspect. - * @returns {number} Returns the string size. - */ - function stringSize(string) { - return hasUnicode(string) - ? unicodeSize(string) - : asciiSize(string); - } - /** - * Converts `string` to an array. - * - * @private - * @param {string} string The string to convert. - * @returns {Array} Returns the converted array. - */ - function stringToArray(string) { - return hasUnicode(string) - ? unicodeToArray(string) - : asciiToArray(string); - } +/***/ }), +/* 23 */ +/***/ (function(module, exports, __webpack_require__) { - /** - * Used by `_.unescape` to convert HTML entities to characters. - * - * @private - * @param {string} chr The matched character to unescape. - * @returns {string} Returns the unescaped character. - */ - var unescapeHtmlChar = basePropertyOf(htmlUnescapes); +// Copyright 2017 Joyent, Inc. - /** - * Gets the size of a Unicode `string`. - * - * @private - * @param {string} string The string inspect. - * @returns {number} Returns the string size. - */ - function unicodeSize(string) { - var result = reUnicode.lastIndex = 0; - while (reUnicode.test(string)) { - ++result; - } - return result; - } +module.exports = Key; - /** - * Converts a Unicode `string` to an array. - * - * @private - * @param {string} string The string to convert. - * @returns {Array} Returns the converted array. - */ - function unicodeToArray(string) { - return string.match(reUnicode) || []; - } +var assert = __webpack_require__(11); +var algs = __webpack_require__(22); +var crypto = __webpack_require__(8); +var Fingerprint = __webpack_require__(117); +var Signature = __webpack_require__(46); +var DiffieHellman = __webpack_require__(319).DiffieHellman; +var errs = __webpack_require__(45); +var utils = __webpack_require__(19); +var PrivateKey = __webpack_require__(24); +var edCompat; - /** - * Splits a Unicode `string` into an array of its words. - * - * @private - * @param {string} The string to inspect. - * @returns {Array} Returns the words of `string`. - */ - function unicodeWords(string) { - return string.match(reUnicodeWord) || []; - } +try { + edCompat = __webpack_require__(320); +} catch (e) { + /* Just continue through, and bail out if we try to use it. */ +} - /*--------------------------------------------------------------------------*/ +var InvalidAlgorithmError = errs.InvalidAlgorithmError; +var KeyParseError = errs.KeyParseError; - /** - * Create a new pristine `lodash` function using the `context` object. - * - * @static - * @memberOf _ - * @since 1.1.0 - * @category Util - * @param {Object} [context=root] The context object. - * @returns {Function} Returns a new `lodash` function. - * @example - * - * _.mixin({ 'foo': _.constant('foo') }); - * - * var lodash = _.runInContext(); - * lodash.mixin({ 'bar': lodash.constant('bar') }); - * - * _.isFunction(_.foo); - * // => true - * _.isFunction(_.bar); - * // => false - * - * lodash.isFunction(lodash.foo); - * // => false - * lodash.isFunction(lodash.bar); - * // => true - * - * // Create a suped-up `defer` in Node.js. - * var defer = _.runInContext({ 'setTimeout': setImmediate }).defer; - */ - var runInContext = (function runInContext(context) { - context = context == null ? root : _.defaults(root.Object(), context, _.pick(root, contextProps)); +var formats = {}; +formats['auto'] = __webpack_require__(321); +formats['pem'] = __webpack_require__(58); +formats['pkcs1'] = __webpack_require__(228); +formats['pkcs8'] = __webpack_require__(118); +formats['rfc4253'] = __webpack_require__(75); +formats['ssh'] = __webpack_require__(322); +formats['ssh-private'] = __webpack_require__(145); +formats['openssh'] = formats['ssh-private']; - /** Built-in constructor references. */ - var Array = context.Array, - Date = context.Date, - Error = context.Error, - Function = context.Function, - Math = context.Math, - Object = context.Object, - RegExp = context.RegExp, - String = context.String, - TypeError = context.TypeError; +function Key(opts) { + assert.object(opts, 'options'); + assert.arrayOfObject(opts.parts, 'options.parts'); + assert.string(opts.type, 'options.type'); + assert.optionalString(opts.comment, 'options.comment'); - /** Used for built-in method references. */ - var arrayProto = Array.prototype, - funcProto = Function.prototype, - objectProto = Object.prototype; + var algInfo = algs.info[opts.type]; + if (typeof (algInfo) !== 'object') + throw (new InvalidAlgorithmError(opts.type)); - /** Used to detect overreaching core-js shims. */ - var coreJsData = context['__core-js_shared__']; + var partLookup = {}; + for (var i = 0; i < opts.parts.length; ++i) { + var part = opts.parts[i]; + partLookup[part.name] = part; + } - /** Used to resolve the decompiled source of functions. */ - var funcToString = funcProto.toString; + this.type = opts.type; + this.parts = opts.parts; + this.part = partLookup; + this.comment = undefined; + this.source = opts.source; - /** Used to check objects for own properties. */ - var hasOwnProperty = objectProto.hasOwnProperty; + /* for speeding up hashing/fingerprint operations */ + this._rfc4253Cache = opts._rfc4253Cache; + this._hashCache = {}; - /** Used to generate unique IDs. */ - var idCounter = 0; + var sz; + this.curve = undefined; + if (this.type === 'ecdsa') { + var curve = this.part.curve.data.toString(); + this.curve = curve; + sz = algs.curves[curve].size; + } else if (this.type === 'ed25519') { + sz = 256; + this.curve = 'curve25519'; + } else { + var szPart = this.part[algInfo.sizePart]; + sz = szPart.data.length; + sz = sz * 8 - utils.countZeros(szPart.data); + } + this.size = sz; +} - /** Used to detect methods masquerading as native. */ - var maskSrcKey = (function() { - var uid = /[^.]+$/.exec(coreJsData && coreJsData.keys && coreJsData.keys.IE_PROTO || ''); - return uid ? ('Symbol(src)_1.' + uid) : ''; - }()); +Key.formats = formats; - /** - * Used to resolve the - * [`toStringTag`](http://ecma-international.org/ecma-262/7.0/#sec-object.prototype.tostring) - * of values. - */ - var nativeObjectToString = objectProto.toString; +Key.prototype.toBuffer = function (format, options) { + if (format === undefined) + format = 'ssh'; + assert.string(format, 'format'); + assert.object(formats[format], 'formats[format]'); + assert.optionalObject(options, 'options'); - /** Used to infer the `Object` constructor. */ - var objectCtorString = funcToString.call(Object); + if (format === 'rfc4253') { + if (this._rfc4253Cache === undefined) + this._rfc4253Cache = formats['rfc4253'].write(this); + return (this._rfc4253Cache); + } - /** Used to restore the original `_` reference in `_.noConflict`. */ - var oldDash = root._; + return (formats[format].write(this, options)); +}; - /** Used to detect if a method is native. */ - var reIsNative = RegExp('^' + - funcToString.call(hasOwnProperty).replace(reRegExpChar, '\\$&') - .replace(/hasOwnProperty|(function).*?(?=\\\()| for .+?(?=\\\])/g, '$1.*?') + '$' - ); +Key.prototype.toString = function (format, options) { + return (this.toBuffer(format, options).toString()); +}; - /** Built-in value references. */ - var Buffer = moduleExports ? context.Buffer : undefined, - Symbol = context.Symbol, - Uint8Array = context.Uint8Array, - allocUnsafe = Buffer ? Buffer.allocUnsafe : undefined, - getPrototype = overArg(Object.getPrototypeOf, Object), - objectCreate = Object.create, - propertyIsEnumerable = objectProto.propertyIsEnumerable, - splice = arrayProto.splice, - spreadableSymbol = Symbol ? Symbol.isConcatSpreadable : undefined, - symIterator = Symbol ? Symbol.iterator : undefined, - symToStringTag = Symbol ? Symbol.toStringTag : undefined; +Key.prototype.hash = function (algo) { + assert.string(algo, 'algorithm'); + algo = algo.toLowerCase(); + if (algs.hashAlgs[algo] === undefined) + throw (new InvalidAlgorithmError(algo)); - var defineProperty = (function() { - try { - var func = getNative(Object, 'defineProperty'); - func({}, '', {}); - return func; - } catch (e) {} - }()); + if (this._hashCache[algo]) + return (this._hashCache[algo]); - /** Mocked built-ins. */ - var ctxClearTimeout = context.clearTimeout !== root.clearTimeout && context.clearTimeout, - ctxNow = Date && Date.now !== root.Date.now && Date.now, - ctxSetTimeout = context.setTimeout !== root.setTimeout && context.setTimeout; + var hash = crypto.createHash(algo). + update(this.toBuffer('rfc4253')).digest(); + this._hashCache[algo] = hash; + return (hash); +}; - /* Built-in method references for those with the same name as other `lodash` methods. */ - var nativeCeil = Math.ceil, - nativeFloor = Math.floor, - nativeGetSymbols = Object.getOwnPropertySymbols, - nativeIsBuffer = Buffer ? Buffer.isBuffer : undefined, - nativeIsFinite = context.isFinite, - nativeJoin = arrayProto.join, - nativeKeys = overArg(Object.keys, Object), - nativeMax = Math.max, - nativeMin = Math.min, - nativeNow = Date.now, - nativeParseInt = context.parseInt, - nativeRandom = Math.random, - nativeReverse = arrayProto.reverse; +Key.prototype.fingerprint = function (algo) { + if (algo === undefined) + algo = 'sha256'; + assert.string(algo, 'algorithm'); + var opts = { + type: 'key', + hash: this.hash(algo), + algorithm: algo + }; + return (new Fingerprint(opts)); +}; - /* Built-in method references that are verified to be native. */ - var DataView = getNative(context, 'DataView'), - Map = getNative(context, 'Map'), - Promise = getNative(context, 'Promise'), - Set = getNative(context, 'Set'), - WeakMap = getNative(context, 'WeakMap'), - nativeCreate = getNative(Object, 'create'); +Key.prototype.defaultHashAlgorithm = function () { + var hashAlgo = 'sha1'; + if (this.type === 'rsa') + hashAlgo = 'sha256'; + if (this.type === 'dsa' && this.size > 1024) + hashAlgo = 'sha256'; + if (this.type === 'ed25519') + hashAlgo = 'sha512'; + if (this.type === 'ecdsa') { + if (this.size <= 256) + hashAlgo = 'sha256'; + else if (this.size <= 384) + hashAlgo = 'sha384'; + else + hashAlgo = 'sha512'; + } + return (hashAlgo); +}; - /** Used to store function metadata. */ - var metaMap = WeakMap && new WeakMap; +Key.prototype.createVerify = function (hashAlgo) { + if (hashAlgo === undefined) + hashAlgo = this.defaultHashAlgorithm(); + assert.string(hashAlgo, 'hash algorithm'); - /** Used to lookup unminified function names. */ - var realNames = {}; + /* ED25519 is not supported by OpenSSL, use a javascript impl. */ + if (this.type === 'ed25519' && edCompat !== undefined) + return (new edCompat.Verifier(this, hashAlgo)); + if (this.type === 'curve25519') + throw (new Error('Curve25519 keys are not suitable for ' + + 'signing or verification')); - /** Used to detect maps, sets, and weakmaps. */ - var dataViewCtorString = toSource(DataView), - mapCtorString = toSource(Map), - promiseCtorString = toSource(Promise), - setCtorString = toSource(Set), - weakMapCtorString = toSource(WeakMap); + var v, nm, err; + try { + nm = hashAlgo.toUpperCase(); + v = crypto.createVerify(nm); + } catch (e) { + err = e; + } + if (v === undefined || (err instanceof Error && + err.message.match(/Unknown message digest/))) { + nm = 'RSA-'; + nm += hashAlgo.toUpperCase(); + v = crypto.createVerify(nm); + } + assert.ok(v, 'failed to create verifier'); + var oldVerify = v.verify.bind(v); + var key = this.toBuffer('pkcs8'); + var curve = this.curve; + var self = this; + v.verify = function (signature, fmt) { + if (Signature.isSignature(signature, [2, 0])) { + if (signature.type !== self.type) + return (false); + if (signature.hashAlgorithm && + signature.hashAlgorithm !== hashAlgo) + return (false); + if (signature.curve && self.type === 'ecdsa' && + signature.curve !== curve) + return (false); + return (oldVerify(key, signature.toBuffer('asn1'))); - /** Used to convert symbols to primitives and strings. */ - var symbolProto = Symbol ? Symbol.prototype : undefined, - symbolValueOf = symbolProto ? symbolProto.valueOf : undefined, - symbolToString = symbolProto ? symbolProto.toString : undefined; + } else if (typeof (signature) === 'string' || + Buffer.isBuffer(signature)) { + return (oldVerify(key, signature, fmt)); - /*------------------------------------------------------------------------*/ + /* + * Avoid doing this on valid arguments, walking the prototype + * chain can be quite slow. + */ + } else if (Signature.isSignature(signature, [1, 0])) { + throw (new Error('signature was created by too old ' + + 'a version of sshpk and cannot be verified')); - /** - * Creates a `lodash` object which wraps `value` to enable implicit method - * chain sequences. Methods that operate on and return arrays, collections, - * and functions can be chained together. Methods that retrieve a single value - * or may return a primitive value will automatically end the chain sequence - * and return the unwrapped value. Otherwise, the value must be unwrapped - * with `_#value`. - * - * Explicit chain sequences, which must be unwrapped with `_#value`, may be - * enabled using `_.chain`. - * - * The execution of chained methods is lazy, that is, it's deferred until - * `_#value` is implicitly or explicitly called. - * - * Lazy evaluation allows several methods to support shortcut fusion. - * Shortcut fusion is an optimization to merge iteratee calls; this avoids - * the creation of intermediate arrays and can greatly reduce the number of - * iteratee executions. Sections of a chain sequence qualify for shortcut - * fusion if the section is applied to an array and iteratees accept only - * one argument. The heuristic for whether a section qualifies for shortcut - * fusion is subject to change. - * - * Chaining is supported in custom builds as long as the `_#value` method is - * directly or indirectly included in the build. - * - * In addition to lodash methods, wrappers have `Array` and `String` methods. - * - * The wrapper `Array` methods are: - * `concat`, `join`, `pop`, `push`, `shift`, `sort`, `splice`, and `unshift` - * - * The wrapper `String` methods are: - * `replace` and `split` - * - * The wrapper methods that support shortcut fusion are: - * `at`, `compact`, `drop`, `dropRight`, `dropWhile`, `filter`, `find`, - * `findLast`, `head`, `initial`, `last`, `map`, `reject`, `reverse`, `slice`, - * `tail`, `take`, `takeRight`, `takeRightWhile`, `takeWhile`, and `toArray` - * - * The chainable wrapper methods are: - * `after`, `ary`, `assign`, `assignIn`, `assignInWith`, `assignWith`, `at`, - * `before`, `bind`, `bindAll`, `bindKey`, `castArray`, `chain`, `chunk`, - * `commit`, `compact`, `concat`, `conforms`, `constant`, `countBy`, `create`, - * `curry`, `debounce`, `defaults`, `defaultsDeep`, `defer`, `delay`, - * `difference`, `differenceBy`, `differenceWith`, `drop`, `dropRight`, - * `dropRightWhile`, `dropWhile`, `extend`, `extendWith`, `fill`, `filter`, - * `flatMap`, `flatMapDeep`, `flatMapDepth`, `flatten`, `flattenDeep`, - * `flattenDepth`, `flip`, `flow`, `flowRight`, `fromPairs`, `functions`, - * `functionsIn`, `groupBy`, `initial`, `intersection`, `intersectionBy`, - * `intersectionWith`, `invert`, `invertBy`, `invokeMap`, `iteratee`, `keyBy`, - * `keys`, `keysIn`, `map`, `mapKeys`, `mapValues`, `matches`, `matchesProperty`, - * `memoize`, `merge`, `mergeWith`, `method`, `methodOf`, `mixin`, `negate`, - * `nthArg`, `omit`, `omitBy`, `once`, `orderBy`, `over`, `overArgs`, - * `overEvery`, `overSome`, `partial`, `partialRight`, `partition`, `pick`, - * `pickBy`, `plant`, `property`, `propertyOf`, `pull`, `pullAll`, `pullAllBy`, - * `pullAllWith`, `pullAt`, `push`, `range`, `rangeRight`, `rearg`, `reject`, - * `remove`, `rest`, `reverse`, `sampleSize`, `set`, `setWith`, `shuffle`, - * `slice`, `sort`, `sortBy`, `splice`, `spread`, `tail`, `take`, `takeRight`, - * `takeRightWhile`, `takeWhile`, `tap`, `throttle`, `thru`, `toArray`, - * `toPairs`, `toPairsIn`, `toPath`, `toPlainObject`, `transform`, `unary`, - * `union`, `unionBy`, `unionWith`, `uniq`, `uniqBy`, `uniqWith`, `unset`, - * `unshift`, `unzip`, `unzipWith`, `update`, `updateWith`, `values`, - * `valuesIn`, `without`, `wrap`, `xor`, `xorBy`, `xorWith`, `zip`, - * `zipObject`, `zipObjectDeep`, and `zipWith` - * - * The wrapper methods that are **not** chainable by default are: - * `add`, `attempt`, `camelCase`, `capitalize`, `ceil`, `clamp`, `clone`, - * `cloneDeep`, `cloneDeepWith`, `cloneWith`, `conformsTo`, `deburr`, - * `defaultTo`, `divide`, `each`, `eachRight`, `endsWith`, `eq`, `escape`, - * `escapeRegExp`, `every`, `find`, `findIndex`, `findKey`, `findLast`, - * `findLastIndex`, `findLastKey`, `first`, `floor`, `forEach`, `forEachRight`, - * `forIn`, `forInRight`, `forOwn`, `forOwnRight`, `get`, `gt`, `gte`, `has`, - * `hasIn`, `head`, `identity`, `includes`, `indexOf`, `inRange`, `invoke`, - * `isArguments`, `isArray`, `isArrayBuffer`, `isArrayLike`, `isArrayLikeObject`, - * `isBoolean`, `isBuffer`, `isDate`, `isElement`, `isEmpty`, `isEqual`, - * `isEqualWith`, `isError`, `isFinite`, `isFunction`, `isInteger`, `isLength`, - * `isMap`, `isMatch`, `isMatchWith`, `isNaN`, `isNative`, `isNil`, `isNull`, - * `isNumber`, `isObject`, `isObjectLike`, `isPlainObject`, `isRegExp`, - * `isSafeInteger`, `isSet`, `isString`, `isUndefined`, `isTypedArray`, - * `isWeakMap`, `isWeakSet`, `join`, `kebabCase`, `last`, `lastIndexOf`, - * `lowerCase`, `lowerFirst`, `lt`, `lte`, `max`, `maxBy`, `mean`, `meanBy`, - * `min`, `minBy`, `multiply`, `noConflict`, `noop`, `now`, `nth`, `pad`, - * `padEnd`, `padStart`, `parseInt`, `pop`, `random`, `reduce`, `reduceRight`, - * `repeat`, `result`, `round`, `runInContext`, `sample`, `shift`, `size`, - * `snakeCase`, `some`, `sortedIndex`, `sortedIndexBy`, `sortedLastIndex`, - * `sortedLastIndexBy`, `startCase`, `startsWith`, `stubArray`, `stubFalse`, - * `stubObject`, `stubString`, `stubTrue`, `subtract`, `sum`, `sumBy`, - * `template`, `times`, `toFinite`, `toInteger`, `toJSON`, `toLength`, - * `toLower`, `toNumber`, `toSafeInteger`, `toString`, `toUpper`, `trim`, - * `trimEnd`, `trimStart`, `truncate`, `unescape`, `uniqueId`, `upperCase`, - * `upperFirst`, `value`, and `words` - * - * @name _ - * @constructor - * @category Seq - * @param {*} value The value to wrap in a `lodash` instance. - * @returns {Object} Returns the new `lodash` wrapper instance. - * @example - * - * function square(n) { - * return n * n; - * } - * - * var wrapped = _([1, 2, 3]); - * - * // Returns an unwrapped value. - * wrapped.reduce(_.add); - * // => 6 - * - * // Returns a wrapped value. - * var squares = wrapped.map(square); - * - * _.isArray(squares); - * // => false - * - * _.isArray(squares.value()); - * // => true - */ - function lodash(value) { - if (isObjectLike(value) && !isArray(value) && !(value instanceof LazyWrapper)) { - if (value instanceof LodashWrapper) { - return value; - } - if (hasOwnProperty.call(value, '__wrapped__')) { - return wrapperClone(value); - } - } - return new LodashWrapper(value); - } + } else { + throw (new TypeError('signature must be a string, ' + + 'Buffer, or Signature object')); + } + }; + return (v); +}; - /** - * The base implementation of `_.create` without support for assigning - * properties to the created object. - * - * @private - * @param {Object} proto The object to inherit from. - * @returns {Object} Returns the new object. - */ - var baseCreate = (function() { - function object() {} - return function(proto) { - if (!isObject(proto)) { - return {}; - } - if (objectCreate) { - return objectCreate(proto); - } - object.prototype = proto; - var result = new object; - object.prototype = undefined; - return result; - }; - }()); +Key.prototype.createDiffieHellman = function () { + if (this.type === 'rsa') + throw (new Error('RSA keys do not support Diffie-Hellman')); - /** - * The function whose prototype chain sequence wrappers inherit from. - * - * @private - */ - function baseLodash() { - // No operation performed. - } + return (new DiffieHellman(this)); +}; +Key.prototype.createDH = Key.prototype.createDiffieHellman; - /** - * The base constructor for creating `lodash` wrapper objects. - * - * @private - * @param {*} value The value to wrap. - * @param {boolean} [chainAll] Enable explicit method chain sequences. - */ - function LodashWrapper(value, chainAll) { - this.__wrapped__ = value; - this.__actions__ = []; - this.__chain__ = !!chainAll; - this.__index__ = 0; - this.__values__ = undefined; - } +Key.parse = function (data, format, options) { + if (typeof (data) !== 'string') + assert.buffer(data, 'data'); + if (format === undefined) + format = 'auto'; + assert.string(format, 'format'); + if (typeof (options) === 'string') + options = { filename: options }; + assert.optionalObject(options, 'options'); + if (options === undefined) + options = {}; + assert.optionalString(options.filename, 'options.filename'); + if (options.filename === undefined) + options.filename = '(unnamed)'; - /** - * By default, the template delimiters used by lodash are like those in - * embedded Ruby (ERB) as well as ES2015 template strings. Change the - * following template settings to use alternative delimiters. - * - * @static - * @memberOf _ - * @type {Object} - */ - lodash.templateSettings = { + assert.object(formats[format], 'formats[format]'); - /** - * Used to detect `data` property values to be HTML-escaped. - * - * @memberOf _.templateSettings - * @type {RegExp} - */ - 'escape': reEscape, + try { + var k = formats[format].read(data, options); + if (k instanceof PrivateKey) + k = k.toPublic(); + if (!k.comment) + k.comment = options.filename; + return (k); + } catch (e) { + if (e.name === 'KeyEncryptedError') + throw (e); + throw (new KeyParseError(options.filename, format, e)); + } +}; - /** - * Used to detect code to be evaluated. - * - * @memberOf _.templateSettings - * @type {RegExp} - */ - 'evaluate': reEvaluate, +Key.isKey = function (obj, ver) { + return (utils.isCompatible(obj, Key, ver)); +}; - /** - * Used to detect `data` property values to inject. - * - * @memberOf _.templateSettings - * @type {RegExp} - */ - 'interpolate': reInterpolate, +/* + * API versions for Key: + * [1,0] -- initial ver, may take Signature for createVerify or may not + * [1,1] -- added pkcs1, pkcs8 formats + * [1,2] -- added auto, ssh-private, openssh formats + * [1,3] -- added defaultHashAlgorithm + * [1,4] -- added ed support, createDH + * [1,5] -- first explicitly tagged version + */ +Key.prototype._sshpkApiVersion = [1, 5]; - /** - * Used to reference the data object in the template text. - * - * @memberOf _.templateSettings - * @type {string} - */ - 'variable': '', +Key._oldVersionDetect = function (obj) { + assert.func(obj.toBuffer); + assert.func(obj.fingerprint); + if (obj.createDH) + return ([1, 4]); + if (obj.defaultHashAlgorithm) + return ([1, 3]); + if (obj.formats['auto']) + return ([1, 2]); + if (obj.formats['pkcs1']) + return ([1, 1]); + return ([1, 0]); +}; - /** - * Used to import variables into the compiled template. - * - * @memberOf _.templateSettings - * @type {Object} - */ - 'imports': { - /** - * A reference to the `lodash` function. - * - * @memberOf _.templateSettings.imports - * @type {Function} - */ - '_': lodash - } - }; +/***/ }), +/* 24 */ +/***/ (function(module, exports, __webpack_require__) { - // Ensure wrappers are instances of `baseLodash`. - lodash.prototype = baseLodash.prototype; - lodash.prototype.constructor = lodash; +// Copyright 2017 Joyent, Inc. - LodashWrapper.prototype = baseCreate(baseLodash.prototype); - LodashWrapper.prototype.constructor = LodashWrapper; +module.exports = PrivateKey; - /*------------------------------------------------------------------------*/ +var assert = __webpack_require__(11); +var algs = __webpack_require__(22); +var crypto = __webpack_require__(8); +var Fingerprint = __webpack_require__(117); +var Signature = __webpack_require__(46); +var errs = __webpack_require__(45); +var util = __webpack_require__(2); +var utils = __webpack_require__(19); +var dhe = __webpack_require__(319); +var generateECDSA = dhe.generateECDSA; +var generateED25519 = dhe.generateED25519; +var edCompat; +var ed; - /** - * Creates a lazy wrapper object which wraps `value` to enable lazy evaluation. - * - * @private - * @constructor - * @param {*} value The value to wrap. - */ - function LazyWrapper(value) { - this.__wrapped__ = value; - this.__actions__ = []; - this.__dir__ = 1; - this.__filtered__ = false; - this.__iteratees__ = []; - this.__takeCount__ = MAX_ARRAY_LENGTH; - this.__views__ = []; - } +try { + edCompat = __webpack_require__(320); +} catch (e) { + /* Just continue through, and bail out if we try to use it. */ +} - /** - * Creates a clone of the lazy wrapper object. - * - * @private - * @name clone - * @memberOf LazyWrapper - * @returns {Object} Returns the cloned `LazyWrapper` object. - */ - function lazyClone() { - var result = new LazyWrapper(this.__wrapped__); - result.__actions__ = copyArray(this.__actions__); - result.__dir__ = this.__dir__; - result.__filtered__ = this.__filtered__; - result.__iteratees__ = copyArray(this.__iteratees__); - result.__takeCount__ = this.__takeCount__; - result.__views__ = copyArray(this.__views__); - return result; - } +var Key = __webpack_require__(23); - /** - * Reverses the direction of lazy iteration. - * - * @private - * @name reverse - * @memberOf LazyWrapper - * @returns {Object} Returns the new reversed `LazyWrapper` object. - */ - function lazyReverse() { - if (this.__filtered__) { - var result = new LazyWrapper(this); - result.__dir__ = -1; - result.__filtered__ = true; - } else { - result = this.clone(); - result.__dir__ *= -1; - } - return result; - } +var InvalidAlgorithmError = errs.InvalidAlgorithmError; +var KeyParseError = errs.KeyParseError; +var KeyEncryptedError = errs.KeyEncryptedError; - /** - * Extracts the unwrapped value from its lazy wrapper. - * - * @private - * @name value - * @memberOf LazyWrapper - * @returns {*} Returns the unwrapped value. - */ - function lazyValue() { - var array = this.__wrapped__.value(), - dir = this.__dir__, - isArr = isArray(array), - isRight = dir < 0, - arrLength = isArr ? array.length : 0, - view = getView(0, arrLength, this.__views__), - start = view.start, - end = view.end, - length = end - start, - index = isRight ? end : (start - 1), - iteratees = this.__iteratees__, - iterLength = iteratees.length, - resIndex = 0, - takeCount = nativeMin(length, this.__takeCount__); +var formats = {}; +formats['auto'] = __webpack_require__(321); +formats['pem'] = __webpack_require__(58); +formats['pkcs1'] = __webpack_require__(228); +formats['pkcs8'] = __webpack_require__(118); +formats['rfc4253'] = __webpack_require__(75); +formats['ssh-private'] = __webpack_require__(145); +formats['openssh'] = formats['ssh-private']; +formats['ssh'] = formats['ssh-private']; - if (!isArr || (!isRight && arrLength == length && takeCount == length)) { - return baseWrapperValue(array, this.__actions__); - } - var result = []; +function PrivateKey(opts) { + assert.object(opts, 'options'); + Key.call(this, opts); - outer: - while (length-- && resIndex < takeCount) { - index += dir; + this._pubCache = undefined; +} +util.inherits(PrivateKey, Key); - var iterIndex = -1, - value = array[index]; +PrivateKey.formats = formats; - while (++iterIndex < iterLength) { - var data = iteratees[iterIndex], - iteratee = data.iteratee, - type = data.type, - computed = iteratee(value); +PrivateKey.prototype.toBuffer = function (format, options) { + if (format === undefined) + format = 'pkcs1'; + assert.string(format, 'format'); + assert.object(formats[format], 'formats[format]'); + assert.optionalObject(options, 'options'); - if (type == LAZY_MAP_FLAG) { - value = computed; - } else if (!computed) { - if (type == LAZY_FILTER_FLAG) { - continue outer; - } else { - break outer; - } - } - } - result[resIndex++] = value; - } - return result; - } + return (formats[format].write(this, options)); +}; - // Ensure `LazyWrapper` is an instance of `baseLodash`. - LazyWrapper.prototype = baseCreate(baseLodash.prototype); - LazyWrapper.prototype.constructor = LazyWrapper; +PrivateKey.prototype.hash = function (algo) { + return (this.toPublic().hash(algo)); +}; - /*------------------------------------------------------------------------*/ +PrivateKey.prototype.toPublic = function () { + if (this._pubCache) + return (this._pubCache); - /** - * Creates a hash object. - * - * @private - * @constructor - * @param {Array} [entries] The key-value pairs to cache. - */ - function Hash(entries) { - var index = -1, - length = entries == null ? 0 : entries.length; + var algInfo = algs.info[this.type]; + var pubParts = []; + for (var i = 0; i < algInfo.parts.length; ++i) { + var p = algInfo.parts[i]; + pubParts.push(this.part[p]); + } - this.clear(); - while (++index < length) { - var entry = entries[index]; - this.set(entry[0], entry[1]); - } - } + this._pubCache = new Key({ + type: this.type, + source: this, + parts: pubParts + }); + if (this.comment) + this._pubCache.comment = this.comment; + return (this._pubCache); +}; - /** - * Removes all key-value entries from the hash. - * - * @private - * @name clear - * @memberOf Hash - */ - function hashClear() { - this.__data__ = nativeCreate ? nativeCreate(null) : {}; - this.size = 0; - } +PrivateKey.prototype.derive = function (newType, newSize) { + assert.string(newType, 'type'); + assert.optionalNumber(newSize, 'size'); + var priv, pub; - /** - * Removes `key` and its value from the hash. - * - * @private - * @name delete - * @memberOf Hash - * @param {Object} hash The hash to modify. - * @param {string} key The key of the value to remove. - * @returns {boolean} Returns `true` if the entry was removed, else `false`. - */ - function hashDelete(key) { - var result = this.has(key) && delete this.__data__[key]; - this.size -= result ? 1 : 0; - return result; - } + if (this.type === 'ed25519' && newType === 'curve25519') { + if (ed === undefined) + ed = __webpack_require__(219); - /** - * Gets the hash value for `key`. - * - * @private - * @name get - * @memberOf Hash - * @param {string} key The key of the value to get. - * @returns {*} Returns the entry value. - */ - function hashGet(key) { - var data = this.__data__; - if (nativeCreate) { - var result = data[key]; - return result === HASH_UNDEFINED ? undefined : result; - } - return hasOwnProperty.call(data, key) ? data[key] : undefined; - } + priv = this.part.r.data; + if (priv[0] === 0x00) + priv = priv.slice(1); + priv = priv.slice(0, 32); - /** - * Checks if a hash value for `key` exists. - * - * @private - * @name has - * @memberOf Hash - * @param {string} key The key of the entry to check. - * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. - */ - function hashHas(key) { - var data = this.__data__; - return nativeCreate ? (data[key] !== undefined) : hasOwnProperty.call(data, key); - } + pub = ed.dh.publicKey(priv); + priv = utils.mpNormalize(Buffer.concat([priv, pub])); - /** - * Sets the hash `key` to `value`. - * - * @private - * @name set - * @memberOf Hash - * @param {string} key The key of the value to set. - * @param {*} value The value to set. - * @returns {Object} Returns the hash instance. - */ - function hashSet(key, value) { - var data = this.__data__; - this.size += this.has(key) ? 0 : 1; - data[key] = (nativeCreate && value === undefined) ? HASH_UNDEFINED : value; - return this; - } + return (new PrivateKey({ + type: 'curve25519', + parts: [ + { name: 'R', data: utils.mpNormalize(pub) }, + { name: 'r', data: priv } + ] + })); + } else if (this.type === 'curve25519' && newType === 'ed25519') { + if (ed === undefined) + ed = __webpack_require__(219); - // Add methods to `Hash`. - Hash.prototype.clear = hashClear; - Hash.prototype['delete'] = hashDelete; - Hash.prototype.get = hashGet; - Hash.prototype.has = hashHas; - Hash.prototype.set = hashSet; + priv = this.part.r.data; + if (priv[0] === 0x00) + priv = priv.slice(1); + priv = priv.slice(0, 32); - /*------------------------------------------------------------------------*/ + pub = ed.eddsa.publicKey(priv.toString('binary')); + pub = new Buffer(pub, 'binary'); - /** - * Creates an list cache object. - * - * @private - * @constructor - * @param {Array} [entries] The key-value pairs to cache. - */ - function ListCache(entries) { - var index = -1, - length = entries == null ? 0 : entries.length; + priv = utils.mpNormalize(Buffer.concat([priv, pub])); - this.clear(); - while (++index < length) { - var entry = entries[index]; - this.set(entry[0], entry[1]); - } - } + return (new PrivateKey({ + type: 'ed25519', + parts: [ + { name: 'R', data: utils.mpNormalize(pub) }, + { name: 'r', data: priv } + ] + })); + } + throw (new Error('Key derivation not supported from ' + this.type + + ' to ' + newType)); +}; - /** - * Removes all key-value entries from the list cache. - * - * @private - * @name clear - * @memberOf ListCache - */ - function listCacheClear() { - this.__data__ = []; - this.size = 0; - } +PrivateKey.prototype.createVerify = function (hashAlgo) { + return (this.toPublic().createVerify(hashAlgo)); +}; - /** - * Removes `key` and its value from the list cache. - * - * @private - * @name delete - * @memberOf ListCache - * @param {string} key The key of the value to remove. - * @returns {boolean} Returns `true` if the entry was removed, else `false`. - */ - function listCacheDelete(key) { - var data = this.__data__, - index = assocIndexOf(data, key); +PrivateKey.prototype.createSign = function (hashAlgo) { + if (hashAlgo === undefined) + hashAlgo = this.defaultHashAlgorithm(); + assert.string(hashAlgo, 'hash algorithm'); - if (index < 0) { - return false; - } - var lastIndex = data.length - 1; - if (index == lastIndex) { - data.pop(); - } else { - splice.call(data, index, 1); - } - --this.size; - return true; - } + /* ED25519 is not supported by OpenSSL, use a javascript impl. */ + if (this.type === 'ed25519' && edCompat !== undefined) + return (new edCompat.Signer(this, hashAlgo)); + if (this.type === 'curve25519') + throw (new Error('Curve25519 keys are not suitable for ' + + 'signing or verification')); - /** - * Gets the list cache value for `key`. - * - * @private - * @name get - * @memberOf ListCache - * @param {string} key The key of the value to get. - * @returns {*} Returns the entry value. - */ - function listCacheGet(key) { - var data = this.__data__, - index = assocIndexOf(data, key); + var v, nm, err; + try { + nm = hashAlgo.toUpperCase(); + v = crypto.createSign(nm); + } catch (e) { + err = e; + } + if (v === undefined || (err instanceof Error && + err.message.match(/Unknown message digest/))) { + nm = 'RSA-'; + nm += hashAlgo.toUpperCase(); + v = crypto.createSign(nm); + } + assert.ok(v, 'failed to create verifier'); + var oldSign = v.sign.bind(v); + var key = this.toBuffer('pkcs1'); + var type = this.type; + var curve = this.curve; + v.sign = function () { + var sig = oldSign(key); + if (typeof (sig) === 'string') + sig = new Buffer(sig, 'binary'); + sig = Signature.parse(sig, type, 'asn1'); + sig.hashAlgorithm = hashAlgo; + sig.curve = curve; + return (sig); + }; + return (v); +}; - return index < 0 ? undefined : data[index][1]; - } +PrivateKey.parse = function (data, format, options) { + if (typeof (data) !== 'string') + assert.buffer(data, 'data'); + if (format === undefined) + format = 'auto'; + assert.string(format, 'format'); + if (typeof (options) === 'string') + options = { filename: options }; + assert.optionalObject(options, 'options'); + if (options === undefined) + options = {}; + assert.optionalString(options.filename, 'options.filename'); + if (options.filename === undefined) + options.filename = '(unnamed)'; - /** - * Checks if a list cache value for `key` exists. - * - * @private - * @name has - * @memberOf ListCache - * @param {string} key The key of the entry to check. - * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. - */ - function listCacheHas(key) { - return assocIndexOf(this.__data__, key) > -1; - } + assert.object(formats[format], 'formats[format]'); - /** - * Sets the list cache `key` to `value`. - * - * @private - * @name set - * @memberOf ListCache - * @param {string} key The key of the value to set. - * @param {*} value The value to set. - * @returns {Object} Returns the list cache instance. - */ - function listCacheSet(key, value) { - var data = this.__data__, - index = assocIndexOf(data, key); + try { + var k = formats[format].read(data, options); + assert.ok(k instanceof PrivateKey, 'key is not a private key'); + if (!k.comment) + k.comment = options.filename; + return (k); + } catch (e) { + if (e.name === 'KeyEncryptedError') + throw (e); + throw (new KeyParseError(options.filename, format, e)); + } +}; - if (index < 0) { - ++this.size; - data.push([key, value]); - } else { - data[index][1] = value; - } - return this; - } +PrivateKey.isPrivateKey = function (obj, ver) { + return (utils.isCompatible(obj, PrivateKey, ver)); +}; - // Add methods to `ListCache`. - ListCache.prototype.clear = listCacheClear; - ListCache.prototype['delete'] = listCacheDelete; - ListCache.prototype.get = listCacheGet; - ListCache.prototype.has = listCacheHas; - ListCache.prototype.set = listCacheSet; +PrivateKey.generate = function (type, options) { + if (options === undefined) + options = {}; + assert.object(options, 'options'); - /*------------------------------------------------------------------------*/ + switch (type) { + case 'ecdsa': + if (options.curve === undefined) + options.curve = 'nistp256'; + assert.string(options.curve, 'options.curve'); + return (generateECDSA(options.curve)); + case 'ed25519': + return (generateED25519()); + default: + throw (new Error('Key generation not supported with key ' + + 'type "' + type + '"')); + } +}; - /** - * Creates a map cache object to store key-value pairs. - * - * @private - * @constructor - * @param {Array} [entries] The key-value pairs to cache. - */ - function MapCache(entries) { - var index = -1, - length = entries == null ? 0 : entries.length; +/* + * API versions for PrivateKey: + * [1,0] -- initial ver + * [1,1] -- added auto, pkcs[18], openssh/ssh-private formats + * [1,2] -- added defaultHashAlgorithm + * [1,3] -- added derive, ed, createDH + * [1,4] -- first tagged version + */ +PrivateKey.prototype._sshpkApiVersion = [1, 4]; - this.clear(); - while (++index < length) { - var entry = entries[index]; - this.set(entry[0], entry[1]); - } - } +PrivateKey._oldVersionDetect = function (obj) { + assert.func(obj.toPublic); + assert.func(obj.createSign); + if (obj.derive) + return ([1, 3]); + if (obj.defaultHashAlgorithm) + return ([1, 2]); + if (obj.formats['auto']) + return ([1, 1]); + return ([1, 0]); +}; - /** - * Removes all key-value entries from the map. - * - * @private - * @name clear - * @memberOf MapCache - */ - function mapCacheClear() { - this.size = 0; - this.__data__ = { - 'hash': new Hash, - 'map': new (Map || ListCache), - 'string': new Hash - }; - } - /** - * Removes `key` and its value from the map. - * - * @private - * @name delete - * @memberOf MapCache - * @param {string} key The key of the value to remove. - * @returns {boolean} Returns `true` if the entry was removed, else `false`. - */ - function mapCacheDelete(key) { - var result = getMapData(this, key)['delete'](key); - this.size -= result ? 1 : 0; - return result; - } +/***/ }), +/* 25 */ +/***/ (function(module, exports) { - /** - * Gets the map value for `key`. - * - * @private - * @name get - * @memberOf MapCache - * @param {string} key The key of the value to get. - * @returns {*} Returns the entry value. - */ - function mapCacheGet(key) { - return getMapData(this, key).get(key); - } +module.exports = require("stream"); - /** - * Checks if a map value for `key` exists. - * - * @private - * @name has - * @memberOf MapCache - * @param {string} key The key of the entry to check. - * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. - */ - function mapCacheHas(key) { - return getMapData(this, key).has(key); - } +/***/ }), +/* 26 */ +/***/ (function(module, exports, __webpack_require__) { - /** - * Sets the map `key` to `value`. - * - * @private - * @name set - * @memberOf MapCache - * @param {string} key The key of the value to set. - * @param {*} value The value to set. - * @returns {Object} Returns the map cache instance. - */ - function mapCacheSet(key, value) { - var data = getMapData(this, key), - size = data.size; +var isObject = __webpack_require__(44); +module.exports = function(it){ + if(!isObject(it))throw TypeError(it + ' is not an object!'); + return it; +}; - data.set(key, value); - this.size += data.size == size ? 0 : 1; - return this; - } +/***/ }), +/* 27 */ +/***/ (function(module, exports, __webpack_require__) { - // Add methods to `MapCache`. - MapCache.prototype.clear = mapCacheClear; - MapCache.prototype['delete'] = mapCacheDelete; - MapCache.prototype.get = mapCacheGet; - MapCache.prototype.has = mapCacheHas; - MapCache.prototype.set = mapCacheSet; +/* WEBPACK VAR INJECTION */(function(module) {var __WEBPACK_AMD_DEFINE_RESULT__;/** + * @license + * Lodash + * Copyright JS Foundation and other contributors + * Released under MIT license + * Based on Underscore.js 1.8.3 + * Copyright Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors + */ +;(function() { - /*------------------------------------------------------------------------*/ + /** Used as a safe reference for `undefined` in pre-ES5 environments. */ + var undefined; - /** - * - * Creates an array cache object to store unique values. - * - * @private - * @constructor - * @param {Array} [values] The values to cache. - */ - function SetCache(values) { - var index = -1, - length = values == null ? 0 : values.length; + /** Used as the semantic version number. */ + var VERSION = '4.17.4'; - this.__data__ = new MapCache; - while (++index < length) { - this.add(values[index]); - } - } + /** Used as the size to enable large array optimizations. */ + var LARGE_ARRAY_SIZE = 200; - /** - * Adds `value` to the array cache. - * - * @private - * @name add - * @memberOf SetCache - * @alias push - * @param {*} value The value to cache. - * @returns {Object} Returns the cache instance. - */ - function setCacheAdd(value) { - this.__data__.set(value, HASH_UNDEFINED); - return this; - } + /** Error message constants. */ + var CORE_ERROR_TEXT = 'Unsupported core-js use. Try https://npms.io/search?q=ponyfill.', + FUNC_ERROR_TEXT = 'Expected a function'; - /** - * Checks if `value` is in the array cache. - * - * @private - * @name has - * @memberOf SetCache - * @param {*} value The value to search for. - * @returns {number} Returns `true` if `value` is found, else `false`. - */ - function setCacheHas(value) { - return this.__data__.has(value); - } + /** Used to stand-in for `undefined` hash values. */ + var HASH_UNDEFINED = '__lodash_hash_undefined__'; - // Add methods to `SetCache`. - SetCache.prototype.add = SetCache.prototype.push = setCacheAdd; - SetCache.prototype.has = setCacheHas; + /** Used as the maximum memoize cache size. */ + var MAX_MEMOIZE_SIZE = 500; - /*------------------------------------------------------------------------*/ + /** Used as the internal argument placeholder. */ + var PLACEHOLDER = '__lodash_placeholder__'; - /** - * Creates a stack cache object to store key-value pairs. - * - * @private - * @constructor - * @param {Array} [entries] The key-value pairs to cache. - */ - function Stack(entries) { - var data = this.__data__ = new ListCache(entries); - this.size = data.size; - } + /** Used to compose bitmasks for cloning. */ + var CLONE_DEEP_FLAG = 1, + CLONE_FLAT_FLAG = 2, + CLONE_SYMBOLS_FLAG = 4; - /** - * Removes all key-value entries from the stack. - * - * @private - * @name clear - * @memberOf Stack - */ - function stackClear() { - this.__data__ = new ListCache; - this.size = 0; - } + /** Used to compose bitmasks for value comparisons. */ + var COMPARE_PARTIAL_FLAG = 1, + COMPARE_UNORDERED_FLAG = 2; - /** - * Removes `key` and its value from the stack. - * - * @private - * @name delete - * @memberOf Stack - * @param {string} key The key of the value to remove. - * @returns {boolean} Returns `true` if the entry was removed, else `false`. - */ - function stackDelete(key) { - var data = this.__data__, - result = data['delete'](key); + /** Used to compose bitmasks for function metadata. */ + var WRAP_BIND_FLAG = 1, + WRAP_BIND_KEY_FLAG = 2, + WRAP_CURRY_BOUND_FLAG = 4, + WRAP_CURRY_FLAG = 8, + WRAP_CURRY_RIGHT_FLAG = 16, + WRAP_PARTIAL_FLAG = 32, + WRAP_PARTIAL_RIGHT_FLAG = 64, + WRAP_ARY_FLAG = 128, + WRAP_REARG_FLAG = 256, + WRAP_FLIP_FLAG = 512; - this.size = data.size; - return result; - } + /** Used as default options for `_.truncate`. */ + var DEFAULT_TRUNC_LENGTH = 30, + DEFAULT_TRUNC_OMISSION = '...'; - /** - * Gets the stack value for `key`. - * - * @private - * @name get - * @memberOf Stack - * @param {string} key The key of the value to get. - * @returns {*} Returns the entry value. - */ - function stackGet(key) { - return this.__data__.get(key); - } + /** Used to detect hot functions by number of calls within a span of milliseconds. */ + var HOT_COUNT = 800, + HOT_SPAN = 16; - /** - * Checks if a stack value for `key` exists. - * - * @private - * @name has - * @memberOf Stack - * @param {string} key The key of the entry to check. - * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. - */ - function stackHas(key) { - return this.__data__.has(key); - } + /** Used to indicate the type of lazy iteratees. */ + var LAZY_FILTER_FLAG = 1, + LAZY_MAP_FLAG = 2, + LAZY_WHILE_FLAG = 3; - /** - * Sets the stack `key` to `value`. - * - * @private - * @name set - * @memberOf Stack - * @param {string} key The key of the value to set. - * @param {*} value The value to set. - * @returns {Object} Returns the stack cache instance. - */ - function stackSet(key, value) { - var data = this.__data__; - if (data instanceof ListCache) { - var pairs = data.__data__; - if (!Map || (pairs.length < LARGE_ARRAY_SIZE - 1)) { - pairs.push([key, value]); - this.size = ++data.size; - return this; - } - data = this.__data__ = new MapCache(pairs); - } - data.set(key, value); - this.size = data.size; - return this; - } + /** Used as references for various `Number` constants. */ + var INFINITY = 1 / 0, + MAX_SAFE_INTEGER = 9007199254740991, + MAX_INTEGER = 1.7976931348623157e+308, + NAN = 0 / 0; - // Add methods to `Stack`. - Stack.prototype.clear = stackClear; - Stack.prototype['delete'] = stackDelete; - Stack.prototype.get = stackGet; - Stack.prototype.has = stackHas; - Stack.prototype.set = stackSet; + /** Used as references for the maximum length and index of an array. */ + var MAX_ARRAY_LENGTH = 4294967295, + MAX_ARRAY_INDEX = MAX_ARRAY_LENGTH - 1, + HALF_MAX_ARRAY_LENGTH = MAX_ARRAY_LENGTH >>> 1; - /*------------------------------------------------------------------------*/ + /** Used to associate wrap methods with their bit flags. */ + var wrapFlags = [ + ['ary', WRAP_ARY_FLAG], + ['bind', WRAP_BIND_FLAG], + ['bindKey', WRAP_BIND_KEY_FLAG], + ['curry', WRAP_CURRY_FLAG], + ['curryRight', WRAP_CURRY_RIGHT_FLAG], + ['flip', WRAP_FLIP_FLAG], + ['partial', WRAP_PARTIAL_FLAG], + ['partialRight', WRAP_PARTIAL_RIGHT_FLAG], + ['rearg', WRAP_REARG_FLAG] + ]; - /** - * Creates an array of the enumerable property names of the array-like `value`. - * - * @private - * @param {*} value The value to query. - * @param {boolean} inherited Specify returning inherited property names. - * @returns {Array} Returns the array of property names. - */ - function arrayLikeKeys(value, inherited) { - var isArr = isArray(value), - isArg = !isArr && isArguments(value), - isBuff = !isArr && !isArg && isBuffer(value), - isType = !isArr && !isArg && !isBuff && isTypedArray(value), - skipIndexes = isArr || isArg || isBuff || isType, - result = skipIndexes ? baseTimes(value.length, String) : [], - length = result.length; + /** `Object#toString` result references. */ + var argsTag = '[object Arguments]', + arrayTag = '[object Array]', + asyncTag = '[object AsyncFunction]', + boolTag = '[object Boolean]', + dateTag = '[object Date]', + domExcTag = '[object DOMException]', + errorTag = '[object Error]', + funcTag = '[object Function]', + genTag = '[object GeneratorFunction]', + mapTag = '[object Map]', + numberTag = '[object Number]', + nullTag = '[object Null]', + objectTag = '[object Object]', + promiseTag = '[object Promise]', + proxyTag = '[object Proxy]', + regexpTag = '[object RegExp]', + setTag = '[object Set]', + stringTag = '[object String]', + symbolTag = '[object Symbol]', + undefinedTag = '[object Undefined]', + weakMapTag = '[object WeakMap]', + weakSetTag = '[object WeakSet]'; - for (var key in value) { - if ((inherited || hasOwnProperty.call(value, key)) && - !(skipIndexes && ( - // Safari 9 has enumerable `arguments.length` in strict mode. - key == 'length' || - // Node.js 0.10 has enumerable non-index properties on buffers. - (isBuff && (key == 'offset' || key == 'parent')) || - // PhantomJS 2 has enumerable non-index properties on typed arrays. - (isType && (key == 'buffer' || key == 'byteLength' || key == 'byteOffset')) || - // Skip index properties. - isIndex(key, length) - ))) { - result.push(key); - } - } - return result; - } + var arrayBufferTag = '[object ArrayBuffer]', + dataViewTag = '[object DataView]', + float32Tag = '[object Float32Array]', + float64Tag = '[object Float64Array]', + int8Tag = '[object Int8Array]', + int16Tag = '[object Int16Array]', + int32Tag = '[object Int32Array]', + uint8Tag = '[object Uint8Array]', + uint8ClampedTag = '[object Uint8ClampedArray]', + uint16Tag = '[object Uint16Array]', + uint32Tag = '[object Uint32Array]'; - /** - * A specialized version of `_.sample` for arrays. - * - * @private - * @param {Array} array The array to sample. - * @returns {*} Returns the random element. - */ - function arraySample(array) { - var length = array.length; - return length ? array[baseRandom(0, length - 1)] : undefined; - } + /** Used to match empty string literals in compiled template source. */ + var reEmptyStringLeading = /\b__p \+= '';/g, + reEmptyStringMiddle = /\b(__p \+=) '' \+/g, + reEmptyStringTrailing = /(__e\(.*?\)|\b__t\)) \+\n'';/g; - /** - * A specialized version of `_.sampleSize` for arrays. - * - * @private - * @param {Array} array The array to sample. - * @param {number} n The number of elements to sample. - * @returns {Array} Returns the random elements. - */ - function arraySampleSize(array, n) { - return shuffleSelf(copyArray(array), baseClamp(n, 0, array.length)); - } + /** Used to match HTML entities and HTML characters. */ + var reEscapedHtml = /&(?:amp|lt|gt|quot|#39);/g, + reUnescapedHtml = /[&<>"']/g, + reHasEscapedHtml = RegExp(reEscapedHtml.source), + reHasUnescapedHtml = RegExp(reUnescapedHtml.source); - /** - * A specialized version of `_.shuffle` for arrays. - * - * @private - * @param {Array} array The array to shuffle. - * @returns {Array} Returns the new shuffled array. - */ - function arrayShuffle(array) { - return shuffleSelf(copyArray(array)); - } + /** Used to match template delimiters. */ + var reEscape = /<%-([\s\S]+?)%>/g, + reEvaluate = /<%([\s\S]+?)%>/g, + reInterpolate = /<%=([\s\S]+?)%>/g; - /** - * This function is like `assignValue` except that it doesn't assign - * `undefined` values. - * - * @private - * @param {Object} object The object to modify. - * @param {string} key The key of the property to assign. - * @param {*} value The value to assign. - */ - function assignMergeValue(object, key, value) { - if ((value !== undefined && !eq(object[key], value)) || - (value === undefined && !(key in object))) { - baseAssignValue(object, key, value); - } - } + /** Used to match property names within property paths. */ + var reIsDeepProp = /\.|\[(?:[^[\]]*|(["'])(?:(?!\1)[^\\]|\\.)*?\1)\]/, + reIsPlainProp = /^\w*$/, + reLeadingDot = /^\./, + rePropName = /[^.[\]]+|\[(?:(-?\d+(?:\.\d+)?)|(["'])((?:(?!\2)[^\\]|\\.)*?)\2)\]|(?=(?:\.|\[\])(?:\.|\[\]|$))/g; - /** - * Assigns `value` to `key` of `object` if the existing value is not equivalent - * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * for equality comparisons. - * - * @private - * @param {Object} object The object to modify. - * @param {string} key The key of the property to assign. - * @param {*} value The value to assign. - */ - function assignValue(object, key, value) { - var objValue = object[key]; - if (!(hasOwnProperty.call(object, key) && eq(objValue, value)) || - (value === undefined && !(key in object))) { - baseAssignValue(object, key, value); - } - } + /** + * Used to match `RegExp` + * [syntax characters](http://ecma-international.org/ecma-262/7.0/#sec-patterns). + */ + var reRegExpChar = /[\\^$.*+?()[\]{}|]/g, + reHasRegExpChar = RegExp(reRegExpChar.source); - /** - * Gets the index at which the `key` is found in `array` of key-value pairs. - * - * @private - * @param {Array} array The array to inspect. - * @param {*} key The key to search for. - * @returns {number} Returns the index of the matched value, else `-1`. - */ - function assocIndexOf(array, key) { - var length = array.length; - while (length--) { - if (eq(array[length][0], key)) { - return length; - } - } - return -1; - } + /** Used to match leading and trailing whitespace. */ + var reTrim = /^\s+|\s+$/g, + reTrimStart = /^\s+/, + reTrimEnd = /\s+$/; - /** - * Aggregates elements of `collection` on `accumulator` with keys transformed - * by `iteratee` and values set by `setter`. - * - * @private - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} setter The function to set `accumulator` values. - * @param {Function} iteratee The iteratee to transform keys. - * @param {Object} accumulator The initial aggregated object. - * @returns {Function} Returns `accumulator`. - */ - function baseAggregator(collection, setter, iteratee, accumulator) { - baseEach(collection, function(value, key, collection) { - setter(accumulator, value, iteratee(value), collection); - }); - return accumulator; - } + /** Used to match wrap detail comments. */ + var reWrapComment = /\{(?:\n\/\* \[wrapped with .+\] \*\/)?\n?/, + reWrapDetails = /\{\n\/\* \[wrapped with (.+)\] \*/, + reSplitDetails = /,? & /; - /** - * The base implementation of `_.assign` without support for multiple sources - * or `customizer` functions. - * - * @private - * @param {Object} object The destination object. - * @param {Object} source The source object. - * @returns {Object} Returns `object`. - */ - function baseAssign(object, source) { - return object && copyObject(source, keys(source), object); - } + /** Used to match words composed of alphanumeric characters. */ + var reAsciiWord = /[^\x00-\x2f\x3a-\x40\x5b-\x60\x7b-\x7f]+/g; - /** - * The base implementation of `_.assignIn` without support for multiple sources - * or `customizer` functions. - * - * @private - * @param {Object} object The destination object. - * @param {Object} source The source object. - * @returns {Object} Returns `object`. - */ - function baseAssignIn(object, source) { - return object && copyObject(source, keysIn(source), object); - } + /** Used to match backslashes in property paths. */ + var reEscapeChar = /\\(\\)?/g; - /** - * The base implementation of `assignValue` and `assignMergeValue` without - * value checks. - * - * @private - * @param {Object} object The object to modify. - * @param {string} key The key of the property to assign. - * @param {*} value The value to assign. - */ - function baseAssignValue(object, key, value) { - if (key == '__proto__' && defineProperty) { - defineProperty(object, key, { - 'configurable': true, - 'enumerable': true, - 'value': value, - 'writable': true - }); - } else { - object[key] = value; - } - } + /** + * Used to match + * [ES template delimiters](http://ecma-international.org/ecma-262/7.0/#sec-template-literal-lexical-components). + */ + var reEsTemplate = /\$\{([^\\}]*(?:\\.[^\\}]*)*)\}/g; - /** - * The base implementation of `_.at` without support for individual paths. - * - * @private - * @param {Object} object The object to iterate over. - * @param {string[]} paths The property paths to pick. - * @returns {Array} Returns the picked elements. - */ - function baseAt(object, paths) { - var index = -1, - length = paths.length, - result = Array(length), - skip = object == null; + /** Used to match `RegExp` flags from their coerced string values. */ + var reFlags = /\w*$/; - while (++index < length) { - result[index] = skip ? undefined : get(object, paths[index]); - } - return result; - } + /** Used to detect bad signed hexadecimal string values. */ + var reIsBadHex = /^[-+]0x[0-9a-f]+$/i; - /** - * The base implementation of `_.clamp` which doesn't coerce arguments. - * - * @private - * @param {number} number The number to clamp. - * @param {number} [lower] The lower bound. - * @param {number} upper The upper bound. - * @returns {number} Returns the clamped number. - */ - function baseClamp(number, lower, upper) { - if (number === number) { - if (upper !== undefined) { - number = number <= upper ? number : upper; - } - if (lower !== undefined) { - number = number >= lower ? number : lower; - } - } - return number; - } + /** Used to detect binary string values. */ + var reIsBinary = /^0b[01]+$/i; - /** - * The base implementation of `_.clone` and `_.cloneDeep` which tracks - * traversed objects. - * - * @private - * @param {*} value The value to clone. - * @param {boolean} bitmask The bitmask flags. - * 1 - Deep clone - * 2 - Flatten inherited properties - * 4 - Clone symbols - * @param {Function} [customizer] The function to customize cloning. - * @param {string} [key] The key of `value`. - * @param {Object} [object] The parent object of `value`. - * @param {Object} [stack] Tracks traversed objects and their clone counterparts. - * @returns {*} Returns the cloned value. - */ - function baseClone(value, bitmask, customizer, key, object, stack) { - var result, - isDeep = bitmask & CLONE_DEEP_FLAG, - isFlat = bitmask & CLONE_FLAT_FLAG, - isFull = bitmask & CLONE_SYMBOLS_FLAG; + /** Used to detect host constructors (Safari). */ + var reIsHostCtor = /^\[object .+?Constructor\]$/; - if (customizer) { - result = object ? customizer(value, key, object, stack) : customizer(value); - } - if (result !== undefined) { - return result; - } - if (!isObject(value)) { - return value; - } - var isArr = isArray(value); - if (isArr) { - result = initCloneArray(value); - if (!isDeep) { - return copyArray(value, result); - } - } else { - var tag = getTag(value), - isFunc = tag == funcTag || tag == genTag; + /** Used to detect octal string values. */ + var reIsOctal = /^0o[0-7]+$/i; - if (isBuffer(value)) { - return cloneBuffer(value, isDeep); - } - if (tag == objectTag || tag == argsTag || (isFunc && !object)) { - result = (isFlat || isFunc) ? {} : initCloneObject(value); - if (!isDeep) { - return isFlat - ? copySymbolsIn(value, baseAssignIn(result, value)) - : copySymbols(value, baseAssign(result, value)); - } - } else { - if (!cloneableTags[tag]) { - return object ? value : {}; - } - result = initCloneByTag(value, tag, baseClone, isDeep); - } - } - // Check for circular references and return its corresponding clone. - stack || (stack = new Stack); - var stacked = stack.get(value); - if (stacked) { - return stacked; - } - stack.set(value, result); + /** Used to detect unsigned integer values. */ + var reIsUint = /^(?:0|[1-9]\d*)$/; - var keysFunc = isFull - ? (isFlat ? getAllKeysIn : getAllKeys) - : (isFlat ? keysIn : keys); + /** Used to match Latin Unicode letters (excluding mathematical operators). */ + var reLatin = /[\xc0-\xd6\xd8-\xf6\xf8-\xff\u0100-\u017f]/g; - var props = isArr ? undefined : keysFunc(value); - arrayEach(props || value, function(subValue, key) { - if (props) { - key = subValue; - subValue = value[key]; - } - // Recursively populate clone (susceptible to call stack limits). - assignValue(result, key, baseClone(subValue, bitmask, customizer, key, value, stack)); - }); - return result; - } + /** Used to ensure capturing order of template delimiters. */ + var reNoMatch = /($^)/; - /** - * The base implementation of `_.conforms` which doesn't clone `source`. - * - * @private - * @param {Object} source The object of property predicates to conform to. - * @returns {Function} Returns the new spec function. - */ - function baseConforms(source) { - var props = keys(source); - return function(object) { - return baseConformsTo(object, source, props); - }; - } + /** Used to match unescaped characters in compiled string literals. */ + var reUnescapedString = /['\n\r\u2028\u2029\\]/g; - /** - * The base implementation of `_.conformsTo` which accepts `props` to check. - * - * @private - * @param {Object} object The object to inspect. - * @param {Object} source The object of property predicates to conform to. - * @returns {boolean} Returns `true` if `object` conforms, else `false`. - */ - function baseConformsTo(object, source, props) { - var length = props.length; - if (object == null) { - return !length; - } - object = Object(object); - while (length--) { - var key = props[length], - predicate = source[key], - value = object[key]; + /** Used to compose unicode character classes. */ + var rsAstralRange = '\\ud800-\\udfff', + rsComboMarksRange = '\\u0300-\\u036f', + reComboHalfMarksRange = '\\ufe20-\\ufe2f', + rsComboSymbolsRange = '\\u20d0-\\u20ff', + rsComboRange = rsComboMarksRange + reComboHalfMarksRange + rsComboSymbolsRange, + rsDingbatRange = '\\u2700-\\u27bf', + rsLowerRange = 'a-z\\xdf-\\xf6\\xf8-\\xff', + rsMathOpRange = '\\xac\\xb1\\xd7\\xf7', + rsNonCharRange = '\\x00-\\x2f\\x3a-\\x40\\x5b-\\x60\\x7b-\\xbf', + rsPunctuationRange = '\\u2000-\\u206f', + rsSpaceRange = ' \\t\\x0b\\f\\xa0\\ufeff\\n\\r\\u2028\\u2029\\u1680\\u180e\\u2000\\u2001\\u2002\\u2003\\u2004\\u2005\\u2006\\u2007\\u2008\\u2009\\u200a\\u202f\\u205f\\u3000', + rsUpperRange = 'A-Z\\xc0-\\xd6\\xd8-\\xde', + rsVarRange = '\\ufe0e\\ufe0f', + rsBreakRange = rsMathOpRange + rsNonCharRange + rsPunctuationRange + rsSpaceRange; - if ((value === undefined && !(key in object)) || !predicate(value)) { - return false; - } - } - return true; - } + /** Used to compose unicode capture groups. */ + var rsApos = "['\u2019]", + rsAstral = '[' + rsAstralRange + ']', + rsBreak = '[' + rsBreakRange + ']', + rsCombo = '[' + rsComboRange + ']', + rsDigits = '\\d+', + rsDingbat = '[' + rsDingbatRange + ']', + rsLower = '[' + rsLowerRange + ']', + rsMisc = '[^' + rsAstralRange + rsBreakRange + rsDigits + rsDingbatRange + rsLowerRange + rsUpperRange + ']', + rsFitz = '\\ud83c[\\udffb-\\udfff]', + rsModifier = '(?:' + rsCombo + '|' + rsFitz + ')', + rsNonAstral = '[^' + rsAstralRange + ']', + rsRegional = '(?:\\ud83c[\\udde6-\\uddff]){2}', + rsSurrPair = '[\\ud800-\\udbff][\\udc00-\\udfff]', + rsUpper = '[' + rsUpperRange + ']', + rsZWJ = '\\u200d'; - /** - * The base implementation of `_.delay` and `_.defer` which accepts `args` - * to provide to `func`. - * - * @private - * @param {Function} func The function to delay. - * @param {number} wait The number of milliseconds to delay invocation. - * @param {Array} args The arguments to provide to `func`. - * @returns {number|Object} Returns the timer id or timeout object. - */ - function baseDelay(func, wait, args) { - if (typeof func != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); - } - return setTimeout(function() { func.apply(undefined, args); }, wait); - } + /** Used to compose unicode regexes. */ + var rsMiscLower = '(?:' + rsLower + '|' + rsMisc + ')', + rsMiscUpper = '(?:' + rsUpper + '|' + rsMisc + ')', + rsOptContrLower = '(?:' + rsApos + '(?:d|ll|m|re|s|t|ve))?', + rsOptContrUpper = '(?:' + rsApos + '(?:D|LL|M|RE|S|T|VE))?', + reOptMod = rsModifier + '?', + rsOptVar = '[' + rsVarRange + ']?', + rsOptJoin = '(?:' + rsZWJ + '(?:' + [rsNonAstral, rsRegional, rsSurrPair].join('|') + ')' + rsOptVar + reOptMod + ')*', + rsOrdLower = '\\d*(?:(?:1st|2nd|3rd|(?![123])\\dth)\\b)', + rsOrdUpper = '\\d*(?:(?:1ST|2ND|3RD|(?![123])\\dTH)\\b)', + rsSeq = rsOptVar + reOptMod + rsOptJoin, + rsEmoji = '(?:' + [rsDingbat, rsRegional, rsSurrPair].join('|') + ')' + rsSeq, + rsSymbol = '(?:' + [rsNonAstral + rsCombo + '?', rsCombo, rsRegional, rsSurrPair, rsAstral].join('|') + ')'; - /** - * The base implementation of methods like `_.difference` without support - * for excluding multiple arrays or iteratee shorthands. - * - * @private - * @param {Array} array The array to inspect. - * @param {Array} values The values to exclude. - * @param {Function} [iteratee] The iteratee invoked per element. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns the new array of filtered values. - */ - function baseDifference(array, values, iteratee, comparator) { - var index = -1, - includes = arrayIncludes, - isCommon = true, - length = array.length, - result = [], - valuesLength = values.length; + /** Used to match apostrophes. */ + var reApos = RegExp(rsApos, 'g'); - if (!length) { - return result; - } - if (iteratee) { - values = arrayMap(values, baseUnary(iteratee)); - } - if (comparator) { - includes = arrayIncludesWith; - isCommon = false; - } - else if (values.length >= LARGE_ARRAY_SIZE) { - includes = cacheHas; - isCommon = false; - values = new SetCache(values); - } - outer: - while (++index < length) { - var value = array[index], - computed = iteratee == null ? value : iteratee(value); + /** + * Used to match [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks) and + * [combining diacritical marks for symbols](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks_for_Symbols). + */ + var reComboMark = RegExp(rsCombo, 'g'); - value = (comparator || value !== 0) ? value : 0; - if (isCommon && computed === computed) { - var valuesIndex = valuesLength; - while (valuesIndex--) { - if (values[valuesIndex] === computed) { - continue outer; - } - } - result.push(value); - } - else if (!includes(values, computed, comparator)) { - result.push(value); - } - } - return result; - } + /** Used to match [string symbols](https://mathiasbynens.be/notes/javascript-unicode). */ + var reUnicode = RegExp(rsFitz + '(?=' + rsFitz + ')|' + rsSymbol + rsSeq, 'g'); - /** - * The base implementation of `_.forEach` without support for iteratee shorthands. - * - * @private - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {Array|Object} Returns `collection`. - */ - var baseEach = createBaseEach(baseForOwn); + /** Used to match complex or compound words. */ + var reUnicodeWord = RegExp([ + rsUpper + '?' + rsLower + '+' + rsOptContrLower + '(?=' + [rsBreak, rsUpper, '$'].join('|') + ')', + rsMiscUpper + '+' + rsOptContrUpper + '(?=' + [rsBreak, rsUpper + rsMiscLower, '$'].join('|') + ')', + rsUpper + '?' + rsMiscLower + '+' + rsOptContrLower, + rsUpper + '+' + rsOptContrUpper, + rsOrdUpper, + rsOrdLower, + rsDigits, + rsEmoji + ].join('|'), 'g'); - /** - * The base implementation of `_.forEachRight` without support for iteratee shorthands. - * - * @private - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {Array|Object} Returns `collection`. - */ - var baseEachRight = createBaseEach(baseForOwnRight, true); + /** Used to detect strings with [zero-width joiners or code points from the astral planes](http://eev.ee/blog/2015/09/12/dark-corners-of-unicode/). */ + var reHasUnicode = RegExp('[' + rsZWJ + rsAstralRange + rsComboRange + rsVarRange + ']'); - /** - * The base implementation of `_.every` without support for iteratee shorthands. - * - * @private - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} predicate The function invoked per iteration. - * @returns {boolean} Returns `true` if all elements pass the predicate check, - * else `false` - */ - function baseEvery(collection, predicate) { - var result = true; - baseEach(collection, function(value, index, collection) { - result = !!predicate(value, index, collection); - return result; - }); - return result; - } + /** Used to detect strings that need a more robust regexp to match words. */ + var reHasUnicodeWord = /[a-z][A-Z]|[A-Z]{2,}[a-z]|[0-9][a-zA-Z]|[a-zA-Z][0-9]|[^a-zA-Z0-9 ]/; - /** - * The base implementation of methods like `_.max` and `_.min` which accepts a - * `comparator` to determine the extremum value. - * - * @private - * @param {Array} array The array to iterate over. - * @param {Function} iteratee The iteratee invoked per iteration. - * @param {Function} comparator The comparator used to compare values. - * @returns {*} Returns the extremum value. - */ - function baseExtremum(array, iteratee, comparator) { - var index = -1, - length = array.length; + /** Used to assign default `context` object properties. */ + var contextProps = [ + 'Array', 'Buffer', 'DataView', 'Date', 'Error', 'Float32Array', 'Float64Array', + 'Function', 'Int8Array', 'Int16Array', 'Int32Array', 'Map', 'Math', 'Object', + 'Promise', 'RegExp', 'Set', 'String', 'Symbol', 'TypeError', 'Uint8Array', + 'Uint8ClampedArray', 'Uint16Array', 'Uint32Array', 'WeakMap', + '_', 'clearTimeout', 'isFinite', 'parseInt', 'setTimeout' + ]; - while (++index < length) { - var value = array[index], - current = iteratee(value); + /** Used to make template sourceURLs easier to identify. */ + var templateCounter = -1; - if (current != null && (computed === undefined - ? (current === current && !isSymbol(current)) - : comparator(current, computed) - )) { - var computed = current, - result = value; - } - } - return result; - } + /** Used to identify `toStringTag` values of typed arrays. */ + var typedArrayTags = {}; + typedArrayTags[float32Tag] = typedArrayTags[float64Tag] = + typedArrayTags[int8Tag] = typedArrayTags[int16Tag] = + typedArrayTags[int32Tag] = typedArrayTags[uint8Tag] = + typedArrayTags[uint8ClampedTag] = typedArrayTags[uint16Tag] = + typedArrayTags[uint32Tag] = true; + typedArrayTags[argsTag] = typedArrayTags[arrayTag] = + typedArrayTags[arrayBufferTag] = typedArrayTags[boolTag] = + typedArrayTags[dataViewTag] = typedArrayTags[dateTag] = + typedArrayTags[errorTag] = typedArrayTags[funcTag] = + typedArrayTags[mapTag] = typedArrayTags[numberTag] = + typedArrayTags[objectTag] = typedArrayTags[regexpTag] = + typedArrayTags[setTag] = typedArrayTags[stringTag] = + typedArrayTags[weakMapTag] = false; - /** - * The base implementation of `_.fill` without an iteratee call guard. - * - * @private - * @param {Array} array The array to fill. - * @param {*} value The value to fill `array` with. - * @param {number} [start=0] The start position. - * @param {number} [end=array.length] The end position. - * @returns {Array} Returns `array`. - */ - function baseFill(array, value, start, end) { - var length = array.length; + /** Used to identify `toStringTag` values supported by `_.clone`. */ + var cloneableTags = {}; + cloneableTags[argsTag] = cloneableTags[arrayTag] = + cloneableTags[arrayBufferTag] = cloneableTags[dataViewTag] = + cloneableTags[boolTag] = cloneableTags[dateTag] = + cloneableTags[float32Tag] = cloneableTags[float64Tag] = + cloneableTags[int8Tag] = cloneableTags[int16Tag] = + cloneableTags[int32Tag] = cloneableTags[mapTag] = + cloneableTags[numberTag] = cloneableTags[objectTag] = + cloneableTags[regexpTag] = cloneableTags[setTag] = + cloneableTags[stringTag] = cloneableTags[symbolTag] = + cloneableTags[uint8Tag] = cloneableTags[uint8ClampedTag] = + cloneableTags[uint16Tag] = cloneableTags[uint32Tag] = true; + cloneableTags[errorTag] = cloneableTags[funcTag] = + cloneableTags[weakMapTag] = false; - start = toInteger(start); - if (start < 0) { - start = -start > length ? 0 : (length + start); - } - end = (end === undefined || end > length) ? length : toInteger(end); - if (end < 0) { - end += length; - } - end = start > end ? 0 : toLength(end); - while (start < end) { - array[start++] = value; - } - return array; - } + /** Used to map Latin Unicode letters to basic Latin letters. */ + var deburredLetters = { + // Latin-1 Supplement block. + '\xc0': 'A', '\xc1': 'A', '\xc2': 'A', '\xc3': 'A', '\xc4': 'A', '\xc5': 'A', + '\xe0': 'a', '\xe1': 'a', '\xe2': 'a', '\xe3': 'a', '\xe4': 'a', '\xe5': 'a', + '\xc7': 'C', '\xe7': 'c', + '\xd0': 'D', '\xf0': 'd', + '\xc8': 'E', '\xc9': 'E', '\xca': 'E', '\xcb': 'E', + '\xe8': 'e', '\xe9': 'e', '\xea': 'e', '\xeb': 'e', + '\xcc': 'I', '\xcd': 'I', '\xce': 'I', '\xcf': 'I', + '\xec': 'i', '\xed': 'i', '\xee': 'i', '\xef': 'i', + '\xd1': 'N', '\xf1': 'n', + '\xd2': 'O', '\xd3': 'O', '\xd4': 'O', '\xd5': 'O', '\xd6': 'O', '\xd8': 'O', + '\xf2': 'o', '\xf3': 'o', '\xf4': 'o', '\xf5': 'o', '\xf6': 'o', '\xf8': 'o', + '\xd9': 'U', '\xda': 'U', '\xdb': 'U', '\xdc': 'U', + '\xf9': 'u', '\xfa': 'u', '\xfb': 'u', '\xfc': 'u', + '\xdd': 'Y', '\xfd': 'y', '\xff': 'y', + '\xc6': 'Ae', '\xe6': 'ae', + '\xde': 'Th', '\xfe': 'th', + '\xdf': 'ss', + // Latin Extended-A block. + '\u0100': 'A', '\u0102': 'A', '\u0104': 'A', + '\u0101': 'a', '\u0103': 'a', '\u0105': 'a', + '\u0106': 'C', '\u0108': 'C', '\u010a': 'C', '\u010c': 'C', + '\u0107': 'c', '\u0109': 'c', '\u010b': 'c', '\u010d': 'c', + '\u010e': 'D', '\u0110': 'D', '\u010f': 'd', '\u0111': 'd', + '\u0112': 'E', '\u0114': 'E', '\u0116': 'E', '\u0118': 'E', '\u011a': 'E', + '\u0113': 'e', '\u0115': 'e', '\u0117': 'e', '\u0119': 'e', '\u011b': 'e', + '\u011c': 'G', '\u011e': 'G', '\u0120': 'G', '\u0122': 'G', + '\u011d': 'g', '\u011f': 'g', '\u0121': 'g', '\u0123': 'g', + '\u0124': 'H', '\u0126': 'H', '\u0125': 'h', '\u0127': 'h', + '\u0128': 'I', '\u012a': 'I', '\u012c': 'I', '\u012e': 'I', '\u0130': 'I', + '\u0129': 'i', '\u012b': 'i', '\u012d': 'i', '\u012f': 'i', '\u0131': 'i', + '\u0134': 'J', '\u0135': 'j', + '\u0136': 'K', '\u0137': 'k', '\u0138': 'k', + '\u0139': 'L', '\u013b': 'L', '\u013d': 'L', '\u013f': 'L', '\u0141': 'L', + '\u013a': 'l', '\u013c': 'l', '\u013e': 'l', '\u0140': 'l', '\u0142': 'l', + '\u0143': 'N', '\u0145': 'N', '\u0147': 'N', '\u014a': 'N', + '\u0144': 'n', '\u0146': 'n', '\u0148': 'n', '\u014b': 'n', + '\u014c': 'O', '\u014e': 'O', '\u0150': 'O', + '\u014d': 'o', '\u014f': 'o', '\u0151': 'o', + '\u0154': 'R', '\u0156': 'R', '\u0158': 'R', + '\u0155': 'r', '\u0157': 'r', '\u0159': 'r', + '\u015a': 'S', '\u015c': 'S', '\u015e': 'S', '\u0160': 'S', + '\u015b': 's', '\u015d': 's', '\u015f': 's', '\u0161': 's', + '\u0162': 'T', '\u0164': 'T', '\u0166': 'T', + '\u0163': 't', '\u0165': 't', '\u0167': 't', + '\u0168': 'U', '\u016a': 'U', '\u016c': 'U', '\u016e': 'U', '\u0170': 'U', '\u0172': 'U', + '\u0169': 'u', '\u016b': 'u', '\u016d': 'u', '\u016f': 'u', '\u0171': 'u', '\u0173': 'u', + '\u0174': 'W', '\u0175': 'w', + '\u0176': 'Y', '\u0177': 'y', '\u0178': 'Y', + '\u0179': 'Z', '\u017b': 'Z', '\u017d': 'Z', + '\u017a': 'z', '\u017c': 'z', '\u017e': 'z', + '\u0132': 'IJ', '\u0133': 'ij', + '\u0152': 'Oe', '\u0153': 'oe', + '\u0149': "'n", '\u017f': 's' + }; - /** - * The base implementation of `_.filter` without support for iteratee shorthands. - * - * @private - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} predicate The function invoked per iteration. - * @returns {Array} Returns the new filtered array. - */ - function baseFilter(collection, predicate) { - var result = []; - baseEach(collection, function(value, index, collection) { - if (predicate(value, index, collection)) { - result.push(value); - } - }); - return result; - } + /** Used to map characters to HTML entities. */ + var htmlEscapes = { + '&': '&', + '<': '<', + '>': '>', + '"': '"', + "'": ''' + }; - /** - * The base implementation of `_.flatten` with support for restricting flattening. - * - * @private - * @param {Array} array The array to flatten. - * @param {number} depth The maximum recursion depth. - * @param {boolean} [predicate=isFlattenable] The function invoked per iteration. - * @param {boolean} [isStrict] Restrict to values that pass `predicate` checks. - * @param {Array} [result=[]] The initial result value. - * @returns {Array} Returns the new flattened array. - */ - function baseFlatten(array, depth, predicate, isStrict, result) { - var index = -1, - length = array.length; + /** Used to map HTML entities to characters. */ + var htmlUnescapes = { + '&': '&', + '<': '<', + '>': '>', + '"': '"', + ''': "'" + }; - predicate || (predicate = isFlattenable); - result || (result = []); + /** Used to escape characters for inclusion in compiled string literals. */ + var stringEscapes = { + '\\': '\\', + "'": "'", + '\n': 'n', + '\r': 'r', + '\u2028': 'u2028', + '\u2029': 'u2029' + }; - while (++index < length) { - var value = array[index]; - if (depth > 0 && predicate(value)) { - if (depth > 1) { - // Recursively flatten arrays (susceptible to call stack limits). - baseFlatten(value, depth - 1, predicate, isStrict, result); - } else { - arrayPush(result, value); - } - } else if (!isStrict) { - result[result.length] = value; - } - } - return result; - } + /** Built-in method references without a dependency on `root`. */ + var freeParseFloat = parseFloat, + freeParseInt = parseInt; - /** - * The base implementation of `baseForOwn` which iterates over `object` - * properties returned by `keysFunc` and invokes `iteratee` for each property. - * Iteratee functions may exit iteration early by explicitly returning `false`. - * - * @private - * @param {Object} object The object to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @param {Function} keysFunc The function to get the keys of `object`. - * @returns {Object} Returns `object`. - */ - var baseFor = createBaseFor(); + /** Detect free variable `global` from Node.js. */ + var freeGlobal = typeof global == 'object' && global && global.Object === Object && global; - /** - * This function is like `baseFor` except that it iterates over properties - * in the opposite order. - * - * @private - * @param {Object} object The object to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @param {Function} keysFunc The function to get the keys of `object`. - * @returns {Object} Returns `object`. - */ - var baseForRight = createBaseFor(true); + /** Detect free variable `self`. */ + var freeSelf = typeof self == 'object' && self && self.Object === Object && self; - /** - * The base implementation of `_.forOwn` without support for iteratee shorthands. - * - * @private - * @param {Object} object The object to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {Object} Returns `object`. - */ - function baseForOwn(object, iteratee) { - return object && baseFor(object, iteratee, keys); - } + /** Used as a reference to the global object. */ + var root = freeGlobal || freeSelf || Function('return this')(); - /** - * The base implementation of `_.forOwnRight` without support for iteratee shorthands. - * - * @private - * @param {Object} object The object to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {Object} Returns `object`. - */ - function baseForOwnRight(object, iteratee) { - return object && baseForRight(object, iteratee, keys); - } + /** Detect free variable `exports`. */ + var freeExports = typeof exports == 'object' && exports && !exports.nodeType && exports; - /** - * The base implementation of `_.functions` which creates an array of - * `object` function property names filtered from `props`. - * - * @private - * @param {Object} object The object to inspect. - * @param {Array} props The property names to filter. - * @returns {Array} Returns the function names. - */ - function baseFunctions(object, props) { - return arrayFilter(props, function(key) { - return isFunction(object[key]); - }); - } + /** Detect free variable `module`. */ + var freeModule = freeExports && typeof module == 'object' && module && !module.nodeType && module; - /** - * The base implementation of `_.get` without support for default values. - * - * @private - * @param {Object} object The object to query. - * @param {Array|string} path The path of the property to get. - * @returns {*} Returns the resolved value. - */ - function baseGet(object, path) { - path = castPath(path, object); + /** Detect the popular CommonJS extension `module.exports`. */ + var moduleExports = freeModule && freeModule.exports === freeExports; - var index = 0, - length = path.length; + /** Detect free variable `process` from Node.js. */ + var freeProcess = moduleExports && freeGlobal.process; - while (object != null && index < length) { - object = object[toKey(path[index++])]; - } - return (index && index == length) ? object : undefined; - } + /** Used to access faster Node.js helpers. */ + var nodeUtil = (function() { + try { + return freeProcess && freeProcess.binding && freeProcess.binding('util'); + } catch (e) {} + }()); - /** - * The base implementation of `getAllKeys` and `getAllKeysIn` which uses - * `keysFunc` and `symbolsFunc` to get the enumerable property names and - * symbols of `object`. - * - * @private - * @param {Object} object The object to query. - * @param {Function} keysFunc The function to get the keys of `object`. - * @param {Function} symbolsFunc The function to get the symbols of `object`. - * @returns {Array} Returns the array of property names and symbols. - */ - function baseGetAllKeys(object, keysFunc, symbolsFunc) { - var result = keysFunc(object); - return isArray(object) ? result : arrayPush(result, symbolsFunc(object)); - } + /* Node.js helper references. */ + var nodeIsArrayBuffer = nodeUtil && nodeUtil.isArrayBuffer, + nodeIsDate = nodeUtil && nodeUtil.isDate, + nodeIsMap = nodeUtil && nodeUtil.isMap, + nodeIsRegExp = nodeUtil && nodeUtil.isRegExp, + nodeIsSet = nodeUtil && nodeUtil.isSet, + nodeIsTypedArray = nodeUtil && nodeUtil.isTypedArray; - /** - * The base implementation of `getTag` without fallbacks for buggy environments. - * - * @private - * @param {*} value The value to query. - * @returns {string} Returns the `toStringTag`. - */ - function baseGetTag(value) { - if (value == null) { - return value === undefined ? undefinedTag : nullTag; - } - return (symToStringTag && symToStringTag in Object(value)) - ? getRawTag(value) - : objectToString(value); - } + /*--------------------------------------------------------------------------*/ - /** - * The base implementation of `_.gt` which doesn't coerce arguments. - * - * @private - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @returns {boolean} Returns `true` if `value` is greater than `other`, - * else `false`. - */ - function baseGt(value, other) { - return value > other; - } + /** + * Adds the key-value `pair` to `map`. + * + * @private + * @param {Object} map The map to modify. + * @param {Array} pair The key-value pair to add. + * @returns {Object} Returns `map`. + */ + function addMapEntry(map, pair) { + // Don't return `map.set` because it's not chainable in IE 11. + map.set(pair[0], pair[1]); + return map; + } - /** - * The base implementation of `_.has` without support for deep paths. - * - * @private - * @param {Object} [object] The object to query. - * @param {Array|string} key The key to check. - * @returns {boolean} Returns `true` if `key` exists, else `false`. - */ - function baseHas(object, key) { - return object != null && hasOwnProperty.call(object, key); - } + /** + * Adds `value` to `set`. + * + * @private + * @param {Object} set The set to modify. + * @param {*} value The value to add. + * @returns {Object} Returns `set`. + */ + function addSetEntry(set, value) { + // Don't return `set.add` because it's not chainable in IE 11. + set.add(value); + return set; + } - /** - * The base implementation of `_.hasIn` without support for deep paths. - * - * @private - * @param {Object} [object] The object to query. - * @param {Array|string} key The key to check. - * @returns {boolean} Returns `true` if `key` exists, else `false`. - */ - function baseHasIn(object, key) { - return object != null && key in Object(object); + /** + * A faster alternative to `Function#apply`, this function invokes `func` + * with the `this` binding of `thisArg` and the arguments of `args`. + * + * @private + * @param {Function} func The function to invoke. + * @param {*} thisArg The `this` binding of `func`. + * @param {Array} args The arguments to invoke `func` with. + * @returns {*} Returns the result of `func`. + */ + function apply(func, thisArg, args) { + switch (args.length) { + case 0: return func.call(thisArg); + case 1: return func.call(thisArg, args[0]); + case 2: return func.call(thisArg, args[0], args[1]); + case 3: return func.call(thisArg, args[0], args[1], args[2]); } + return func.apply(thisArg, args); + } - /** - * The base implementation of `_.inRange` which doesn't coerce arguments. - * - * @private - * @param {number} number The number to check. - * @param {number} start The start of the range. - * @param {number} end The end of the range. - * @returns {boolean} Returns `true` if `number` is in the range, else `false`. - */ - function baseInRange(number, start, end) { - return number >= nativeMin(start, end) && number < nativeMax(start, end); + /** + * A specialized version of `baseAggregator` for arrays. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} setter The function to set `accumulator` values. + * @param {Function} iteratee The iteratee to transform keys. + * @param {Object} accumulator The initial aggregated object. + * @returns {Function} Returns `accumulator`. + */ + function arrayAggregator(array, setter, iteratee, accumulator) { + var index = -1, + length = array == null ? 0 : array.length; + + while (++index < length) { + var value = array[index]; + setter(accumulator, value, iteratee(value), array); } + return accumulator; + } - /** - * The base implementation of methods like `_.intersection`, without support - * for iteratee shorthands, that accepts an array of arrays to inspect. - * - * @private - * @param {Array} arrays The arrays to inspect. - * @param {Function} [iteratee] The iteratee invoked per element. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns the new array of shared values. - */ - function baseIntersection(arrays, iteratee, comparator) { - var includes = comparator ? arrayIncludesWith : arrayIncludes, - length = arrays[0].length, - othLength = arrays.length, - othIndex = othLength, - caches = Array(othLength), - maxLength = Infinity, - result = []; + /** + * A specialized version of `_.forEach` for arrays without support for + * iteratee shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array} Returns `array`. + */ + function arrayEach(array, iteratee) { + var index = -1, + length = array == null ? 0 : array.length; - while (othIndex--) { - var array = arrays[othIndex]; - if (othIndex && iteratee) { - array = arrayMap(array, baseUnary(iteratee)); - } - maxLength = nativeMin(array.length, maxLength); - caches[othIndex] = !comparator && (iteratee || (length >= 120 && array.length >= 120)) - ? new SetCache(othIndex && array) - : undefined; + while (++index < length) { + if (iteratee(array[index], index, array) === false) { + break; } - array = arrays[0]; - - var index = -1, - seen = caches[0]; + } + return array; + } - outer: - while (++index < length && result.length < maxLength) { - var value = array[index], - computed = iteratee ? iteratee(value) : value; + /** + * A specialized version of `_.forEachRight` for arrays without support for + * iteratee shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array} Returns `array`. + */ + function arrayEachRight(array, iteratee) { + var length = array == null ? 0 : array.length; - value = (comparator || value !== 0) ? value : 0; - if (!(seen - ? cacheHas(seen, computed) - : includes(result, computed, comparator) - )) { - othIndex = othLength; - while (--othIndex) { - var cache = caches[othIndex]; - if (!(cache - ? cacheHas(cache, computed) - : includes(arrays[othIndex], computed, comparator)) - ) { - continue outer; - } - } - if (seen) { - seen.push(computed); - } - result.push(value); - } + while (length--) { + if (iteratee(array[length], length, array) === false) { + break; } - return result; } + return array; + } - /** - * The base implementation of `_.invert` and `_.invertBy` which inverts - * `object` with values transformed by `iteratee` and set by `setter`. - * - * @private - * @param {Object} object The object to iterate over. - * @param {Function} setter The function to set `accumulator` values. - * @param {Function} iteratee The iteratee to transform values. - * @param {Object} accumulator The initial inverted object. - * @returns {Function} Returns `accumulator`. - */ - function baseInverter(object, setter, iteratee, accumulator) { - baseForOwn(object, function(value, key, object) { - setter(accumulator, iteratee(value), key, object); - }); - return accumulator; - } + /** + * A specialized version of `_.every` for arrays without support for + * iteratee shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} predicate The function invoked per iteration. + * @returns {boolean} Returns `true` if all elements pass the predicate check, + * else `false`. + */ + function arrayEvery(array, predicate) { + var index = -1, + length = array == null ? 0 : array.length; - /** - * The base implementation of `_.invoke` without support for individual - * method arguments. - * - * @private - * @param {Object} object The object to query. - * @param {Array|string} path The path of the method to invoke. - * @param {Array} args The arguments to invoke the method with. - * @returns {*} Returns the result of the invoked method. - */ - function baseInvoke(object, path, args) { - path = castPath(path, object); - object = parent(object, path); - var func = object == null ? object : object[toKey(last(path))]; - return func == null ? undefined : apply(func, object, args); + while (++index < length) { + if (!predicate(array[index], index, array)) { + return false; + } } + return true; + } - /** - * The base implementation of `_.isArguments`. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is an `arguments` object, - */ - function baseIsArguments(value) { - return isObjectLike(value) && baseGetTag(value) == argsTag; - } + /** + * A specialized version of `_.filter` for arrays without support for + * iteratee shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} predicate The function invoked per iteration. + * @returns {Array} Returns the new filtered array. + */ + function arrayFilter(array, predicate) { + var index = -1, + length = array == null ? 0 : array.length, + resIndex = 0, + result = []; - /** - * The base implementation of `_.isArrayBuffer` without Node.js optimizations. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is an array buffer, else `false`. - */ - function baseIsArrayBuffer(value) { - return isObjectLike(value) && baseGetTag(value) == arrayBufferTag; + while (++index < length) { + var value = array[index]; + if (predicate(value, index, array)) { + result[resIndex++] = value; + } } + return result; + } - /** - * The base implementation of `_.isDate` without Node.js optimizations. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a date object, else `false`. - */ - function baseIsDate(value) { - return isObjectLike(value) && baseGetTag(value) == dateTag; - } + /** + * A specialized version of `_.includes` for arrays without support for + * specifying an index to search from. + * + * @private + * @param {Array} [array] The array to inspect. + * @param {*} target The value to search for. + * @returns {boolean} Returns `true` if `target` is found, else `false`. + */ + function arrayIncludes(array, value) { + var length = array == null ? 0 : array.length; + return !!length && baseIndexOf(array, value, 0) > -1; + } - /** - * The base implementation of `_.isEqual` which supports partial comparisons - * and tracks traversed objects. - * - * @private - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @param {boolean} bitmask The bitmask flags. - * 1 - Unordered comparison - * 2 - Partial comparison - * @param {Function} [customizer] The function to customize comparisons. - * @param {Object} [stack] Tracks traversed `value` and `other` objects. - * @returns {boolean} Returns `true` if the values are equivalent, else `false`. - */ - function baseIsEqual(value, other, bitmask, customizer, stack) { - if (value === other) { + /** + * This function is like `arrayIncludes` except that it accepts a comparator. + * + * @private + * @param {Array} [array] The array to inspect. + * @param {*} target The value to search for. + * @param {Function} comparator The comparator invoked per element. + * @returns {boolean} Returns `true` if `target` is found, else `false`. + */ + function arrayIncludesWith(array, value, comparator) { + var index = -1, + length = array == null ? 0 : array.length; + + while (++index < length) { + if (comparator(value, array[index])) { return true; } - if (value == null || other == null || (!isObjectLike(value) && !isObjectLike(other))) { - return value !== value && other !== other; - } - return baseIsEqualDeep(value, other, bitmask, customizer, baseIsEqual, stack); } + return false; + } - /** - * A specialized version of `baseIsEqual` for arrays and objects which performs - * deep comparisons and tracks traversed objects enabling objects with circular - * references to be compared. - * - * @private - * @param {Object} object The object to compare. - * @param {Object} other The other object to compare. - * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. - * @param {Function} customizer The function to customize comparisons. - * @param {Function} equalFunc The function to determine equivalents of values. - * @param {Object} [stack] Tracks traversed `object` and `other` objects. - * @returns {boolean} Returns `true` if the objects are equivalent, else `false`. - */ - function baseIsEqualDeep(object, other, bitmask, customizer, equalFunc, stack) { - var objIsArr = isArray(object), - othIsArr = isArray(other), - objTag = objIsArr ? arrayTag : getTag(object), - othTag = othIsArr ? arrayTag : getTag(other); - - objTag = objTag == argsTag ? objectTag : objTag; - othTag = othTag == argsTag ? objectTag : othTag; + /** + * A specialized version of `_.map` for arrays without support for iteratee + * shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array} Returns the new mapped array. + */ + function arrayMap(array, iteratee) { + var index = -1, + length = array == null ? 0 : array.length, + result = Array(length); - var objIsObj = objTag == objectTag, - othIsObj = othTag == objectTag, - isSameTag = objTag == othTag; - - if (isSameTag && isBuffer(object)) { - if (!isBuffer(other)) { - return false; - } - objIsArr = true; - objIsObj = false; - } - if (isSameTag && !objIsObj) { - stack || (stack = new Stack); - return (objIsArr || isTypedArray(object)) - ? equalArrays(object, other, bitmask, customizer, equalFunc, stack) - : equalByTag(object, other, objTag, bitmask, customizer, equalFunc, stack); - } - if (!(bitmask & COMPARE_PARTIAL_FLAG)) { - var objIsWrapped = objIsObj && hasOwnProperty.call(object, '__wrapped__'), - othIsWrapped = othIsObj && hasOwnProperty.call(other, '__wrapped__'); - - if (objIsWrapped || othIsWrapped) { - var objUnwrapped = objIsWrapped ? object.value() : object, - othUnwrapped = othIsWrapped ? other.value() : other; - - stack || (stack = new Stack); - return equalFunc(objUnwrapped, othUnwrapped, bitmask, customizer, stack); - } - } - if (!isSameTag) { - return false; - } - stack || (stack = new Stack); - return equalObjects(object, other, bitmask, customizer, equalFunc, stack); - } - - /** - * The base implementation of `_.isMap` without Node.js optimizations. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a map, else `false`. - */ - function baseIsMap(value) { - return isObjectLike(value) && getTag(value) == mapTag; + while (++index < length) { + result[index] = iteratee(array[index], index, array); } + return result; + } - /** - * The base implementation of `_.isMatch` without support for iteratee shorthands. - * - * @private - * @param {Object} object The object to inspect. - * @param {Object} source The object of property values to match. - * @param {Array} matchData The property names, values, and compare flags to match. - * @param {Function} [customizer] The function to customize comparisons. - * @returns {boolean} Returns `true` if `object` is a match, else `false`. - */ - function baseIsMatch(object, source, matchData, customizer) { - var index = matchData.length, - length = index, - noCustomizer = !customizer; - - if (object == null) { - return !length; - } - object = Object(object); - while (index--) { - var data = matchData[index]; - if ((noCustomizer && data[2]) - ? data[1] !== object[data[0]] - : !(data[0] in object) - ) { - return false; - } - } - while (++index < length) { - data = matchData[index]; - var key = data[0], - objValue = object[key], - srcValue = data[1]; - - if (noCustomizer && data[2]) { - if (objValue === undefined && !(key in object)) { - return false; - } - } else { - var stack = new Stack; - if (customizer) { - var result = customizer(objValue, srcValue, key, object, source, stack); - } - if (!(result === undefined - ? baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG, customizer, stack) - : result - )) { - return false; - } - } - } - return true; - } + /** + * Appends the elements of `values` to `array`. + * + * @private + * @param {Array} array The array to modify. + * @param {Array} values The values to append. + * @returns {Array} Returns `array`. + */ + function arrayPush(array, values) { + var index = -1, + length = values.length, + offset = array.length; - /** - * The base implementation of `_.isNative` without bad shim checks. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a native function, - * else `false`. - */ - function baseIsNative(value) { - if (!isObject(value) || isMasked(value)) { - return false; - } - var pattern = isFunction(value) ? reIsNative : reIsHostCtor; - return pattern.test(toSource(value)); + while (++index < length) { + array[offset + index] = values[index]; } + return array; + } - /** - * The base implementation of `_.isRegExp` without Node.js optimizations. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a regexp, else `false`. - */ - function baseIsRegExp(value) { - return isObjectLike(value) && baseGetTag(value) == regexpTag; - } + /** + * A specialized version of `_.reduce` for arrays without support for + * iteratee shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @param {*} [accumulator] The initial value. + * @param {boolean} [initAccum] Specify using the first element of `array` as + * the initial value. + * @returns {*} Returns the accumulated value. + */ + function arrayReduce(array, iteratee, accumulator, initAccum) { + var index = -1, + length = array == null ? 0 : array.length; - /** - * The base implementation of `_.isSet` without Node.js optimizations. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a set, else `false`. - */ - function baseIsSet(value) { - return isObjectLike(value) && getTag(value) == setTag; + if (initAccum && length) { + accumulator = array[++index]; } - - /** - * The base implementation of `_.isTypedArray` without Node.js optimizations. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a typed array, else `false`. - */ - function baseIsTypedArray(value) { - return isObjectLike(value) && - isLength(value.length) && !!typedArrayTags[baseGetTag(value)]; + while (++index < length) { + accumulator = iteratee(accumulator, array[index], index, array); } + return accumulator; + } - /** - * The base implementation of `_.iteratee`. - * - * @private - * @param {*} [value=_.identity] The value to convert to an iteratee. - * @returns {Function} Returns the iteratee. - */ - function baseIteratee(value) { - // Don't store the `typeof` result in a variable to avoid a JIT bug in Safari 9. - // See https://bugs.webkit.org/show_bug.cgi?id=156034 for more details. - if (typeof value == 'function') { - return value; - } - if (value == null) { - return identity; - } - if (typeof value == 'object') { - return isArray(value) - ? baseMatchesProperty(value[0], value[1]) - : baseMatches(value); - } - return property(value); + /** + * A specialized version of `_.reduceRight` for arrays without support for + * iteratee shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @param {*} [accumulator] The initial value. + * @param {boolean} [initAccum] Specify using the last element of `array` as + * the initial value. + * @returns {*} Returns the accumulated value. + */ + function arrayReduceRight(array, iteratee, accumulator, initAccum) { + var length = array == null ? 0 : array.length; + if (initAccum && length) { + accumulator = array[--length]; } - - /** - * The base implementation of `_.keys` which doesn't treat sparse arrays as dense. - * - * @private - * @param {Object} object The object to query. - * @returns {Array} Returns the array of property names. - */ - function baseKeys(object) { - if (!isPrototype(object)) { - return nativeKeys(object); - } - var result = []; - for (var key in Object(object)) { - if (hasOwnProperty.call(object, key) && key != 'constructor') { - result.push(key); - } - } - return result; + while (length--) { + accumulator = iteratee(accumulator, array[length], length, array); } + return accumulator; + } - /** - * The base implementation of `_.keysIn` which doesn't treat sparse arrays as dense. - * - * @private - * @param {Object} object The object to query. - * @returns {Array} Returns the array of property names. - */ - function baseKeysIn(object) { - if (!isObject(object)) { - return nativeKeysIn(object); - } - var isProto = isPrototype(object), - result = []; + /** + * A specialized version of `_.some` for arrays without support for iteratee + * shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} predicate The function invoked per iteration. + * @returns {boolean} Returns `true` if any element passes the predicate check, + * else `false`. + */ + function arraySome(array, predicate) { + var index = -1, + length = array == null ? 0 : array.length; - for (var key in object) { - if (!(key == 'constructor' && (isProto || !hasOwnProperty.call(object, key)))) { - result.push(key); - } + while (++index < length) { + if (predicate(array[index], index, array)) { + return true; } - return result; } + return false; + } - /** - * The base implementation of `_.lt` which doesn't coerce arguments. - * - * @private - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @returns {boolean} Returns `true` if `value` is less than `other`, - * else `false`. - */ - function baseLt(value, other) { - return value < other; - } + /** + * Gets the size of an ASCII `string`. + * + * @private + * @param {string} string The string inspect. + * @returns {number} Returns the string size. + */ + var asciiSize = baseProperty('length'); - /** - * The base implementation of `_.map` without support for iteratee shorthands. - * - * @private - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {Array} Returns the new mapped array. - */ - function baseMap(collection, iteratee) { - var index = -1, - result = isArrayLike(collection) ? Array(collection.length) : []; + /** + * Converts an ASCII `string` to an array. + * + * @private + * @param {string} string The string to convert. + * @returns {Array} Returns the converted array. + */ + function asciiToArray(string) { + return string.split(''); + } - baseEach(collection, function(value, key, collection) { - result[++index] = iteratee(value, key, collection); - }); - return result; - } + /** + * Splits an ASCII `string` into an array of its words. + * + * @private + * @param {string} The string to inspect. + * @returns {Array} Returns the words of `string`. + */ + function asciiWords(string) { + return string.match(reAsciiWord) || []; + } - /** - * The base implementation of `_.matches` which doesn't clone `source`. - * - * @private - * @param {Object} source The object of property values to match. - * @returns {Function} Returns the new spec function. - */ - function baseMatches(source) { - var matchData = getMatchData(source); - if (matchData.length == 1 && matchData[0][2]) { - return matchesStrictComparable(matchData[0][0], matchData[0][1]); + /** + * The base implementation of methods like `_.findKey` and `_.findLastKey`, + * without support for iteratee shorthands, which iterates over `collection` + * using `eachFunc`. + * + * @private + * @param {Array|Object} collection The collection to inspect. + * @param {Function} predicate The function invoked per iteration. + * @param {Function} eachFunc The function to iterate over `collection`. + * @returns {*} Returns the found element or its key, else `undefined`. + */ + function baseFindKey(collection, predicate, eachFunc) { + var result; + eachFunc(collection, function(value, key, collection) { + if (predicate(value, key, collection)) { + result = key; + return false; } - return function(object) { - return object === source || baseIsMatch(object, source, matchData); - }; - } + }); + return result; + } - /** - * The base implementation of `_.matchesProperty` which doesn't clone `srcValue`. - * - * @private - * @param {string} path The path of the property to get. - * @param {*} srcValue The value to match. - * @returns {Function} Returns the new spec function. - */ - function baseMatchesProperty(path, srcValue) { - if (isKey(path) && isStrictComparable(srcValue)) { - return matchesStrictComparable(toKey(path), srcValue); - } - return function(object) { - var objValue = get(object, path); - return (objValue === undefined && objValue === srcValue) - ? hasIn(object, path) - : baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG); - }; - } + /** + * The base implementation of `_.findIndex` and `_.findLastIndex` without + * support for iteratee shorthands. + * + * @private + * @param {Array} array The array to inspect. + * @param {Function} predicate The function invoked per iteration. + * @param {number} fromIndex The index to search from. + * @param {boolean} [fromRight] Specify iterating from right to left. + * @returns {number} Returns the index of the matched value, else `-1`. + */ + function baseFindIndex(array, predicate, fromIndex, fromRight) { + var length = array.length, + index = fromIndex + (fromRight ? 1 : -1); - /** - * The base implementation of `_.merge` without support for multiple sources. - * - * @private - * @param {Object} object The destination object. - * @param {Object} source The source object. - * @param {number} srcIndex The index of `source`. - * @param {Function} [customizer] The function to customize merged values. - * @param {Object} [stack] Tracks traversed source values and their merged - * counterparts. - */ - function baseMerge(object, source, srcIndex, customizer, stack) { - if (object === source) { - return; + while ((fromRight ? index-- : ++index < length)) { + if (predicate(array[index], index, array)) { + return index; } - baseFor(source, function(srcValue, key) { - if (isObject(srcValue)) { - stack || (stack = new Stack); - baseMergeDeep(object, source, key, srcIndex, baseMerge, customizer, stack); - } - else { - var newValue = customizer - ? customizer(object[key], srcValue, (key + ''), object, source, stack) - : undefined; - - if (newValue === undefined) { - newValue = srcValue; - } - assignMergeValue(object, key, newValue); - } - }, keysIn); } + return -1; + } - /** - * A specialized version of `baseMerge` for arrays and objects which performs - * deep merges and tracks traversed objects enabling objects with circular - * references to be merged. - * - * @private - * @param {Object} object The destination object. - * @param {Object} source The source object. - * @param {string} key The key of the value to merge. - * @param {number} srcIndex The index of `source`. - * @param {Function} mergeFunc The function to merge values. - * @param {Function} [customizer] The function to customize assigned values. - * @param {Object} [stack] Tracks traversed source values and their merged - * counterparts. - */ - function baseMergeDeep(object, source, key, srcIndex, mergeFunc, customizer, stack) { - var objValue = object[key], - srcValue = source[key], - stacked = stack.get(srcValue); + /** + * The base implementation of `_.indexOf` without `fromIndex` bounds checks. + * + * @private + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @param {number} fromIndex The index to search from. + * @returns {number} Returns the index of the matched value, else `-1`. + */ + function baseIndexOf(array, value, fromIndex) { + return value === value + ? strictIndexOf(array, value, fromIndex) + : baseFindIndex(array, baseIsNaN, fromIndex); + } - if (stacked) { - assignMergeValue(object, key, stacked); - return; + /** + * This function is like `baseIndexOf` except that it accepts a comparator. + * + * @private + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @param {number} fromIndex The index to search from. + * @param {Function} comparator The comparator invoked per element. + * @returns {number} Returns the index of the matched value, else `-1`. + */ + function baseIndexOfWith(array, value, fromIndex, comparator) { + var index = fromIndex - 1, + length = array.length; + + while (++index < length) { + if (comparator(array[index], value)) { + return index; } - var newValue = customizer - ? customizer(objValue, srcValue, (key + ''), object, source, stack) - : undefined; + } + return -1; + } - var isCommon = newValue === undefined; + /** + * The base implementation of `_.isNaN` without support for number objects. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is `NaN`, else `false`. + */ + function baseIsNaN(value) { + return value !== value; + } - if (isCommon) { - var isArr = isArray(srcValue), - isBuff = !isArr && isBuffer(srcValue), - isTyped = !isArr && !isBuff && isTypedArray(srcValue); - - newValue = srcValue; - if (isArr || isBuff || isTyped) { - if (isArray(objValue)) { - newValue = objValue; - } - else if (isArrayLikeObject(objValue)) { - newValue = copyArray(objValue); - } - else if (isBuff) { - isCommon = false; - newValue = cloneBuffer(srcValue, true); - } - else if (isTyped) { - isCommon = false; - newValue = cloneTypedArray(srcValue, true); - } - else { - newValue = []; - } - } - else if (isPlainObject(srcValue) || isArguments(srcValue)) { - newValue = objValue; - if (isArguments(objValue)) { - newValue = toPlainObject(objValue); - } - else if (!isObject(objValue) || (srcIndex && isFunction(objValue))) { - newValue = initCloneObject(srcValue); - } - } - else { - isCommon = false; - } - } - if (isCommon) { - // Recursively merge objects and arrays (susceptible to call stack limits). - stack.set(srcValue, newValue); - mergeFunc(newValue, srcValue, srcIndex, customizer, stack); - stack['delete'](srcValue); - } - assignMergeValue(object, key, newValue); - } + /** + * The base implementation of `_.mean` and `_.meanBy` without support for + * iteratee shorthands. + * + * @private + * @param {Array} array The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {number} Returns the mean. + */ + function baseMean(array, iteratee) { + var length = array == null ? 0 : array.length; + return length ? (baseSum(array, iteratee) / length) : NAN; + } - /** - * The base implementation of `_.nth` which doesn't coerce arguments. - * - * @private - * @param {Array} array The array to query. - * @param {number} n The index of the element to return. - * @returns {*} Returns the nth element of `array`. - */ - function baseNth(array, n) { - var length = array.length; - if (!length) { - return; - } - n += n < 0 ? length : 0; - return isIndex(n, length) ? array[n] : undefined; - } + /** + * The base implementation of `_.property` without support for deep paths. + * + * @private + * @param {string} key The key of the property to get. + * @returns {Function} Returns the new accessor function. + */ + function baseProperty(key) { + return function(object) { + return object == null ? undefined : object[key]; + }; + } - /** - * The base implementation of `_.orderBy` without param guards. - * - * @private - * @param {Array|Object} collection The collection to iterate over. - * @param {Function[]|Object[]|string[]} iteratees The iteratees to sort by. - * @param {string[]} orders The sort orders of `iteratees`. - * @returns {Array} Returns the new sorted array. - */ - function baseOrderBy(collection, iteratees, orders) { - var index = -1; - iteratees = arrayMap(iteratees.length ? iteratees : [identity], baseUnary(getIteratee())); + /** + * The base implementation of `_.propertyOf` without support for deep paths. + * + * @private + * @param {Object} object The object to query. + * @returns {Function} Returns the new accessor function. + */ + function basePropertyOf(object) { + return function(key) { + return object == null ? undefined : object[key]; + }; + } - var result = baseMap(collection, function(value, key, collection) { - var criteria = arrayMap(iteratees, function(iteratee) { - return iteratee(value); - }); - return { 'criteria': criteria, 'index': ++index, 'value': value }; - }); + /** + * The base implementation of `_.reduce` and `_.reduceRight`, without support + * for iteratee shorthands, which iterates over `collection` using `eachFunc`. + * + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @param {*} accumulator The initial value. + * @param {boolean} initAccum Specify using the first or last element of + * `collection` as the initial value. + * @param {Function} eachFunc The function to iterate over `collection`. + * @returns {*} Returns the accumulated value. + */ + function baseReduce(collection, iteratee, accumulator, initAccum, eachFunc) { + eachFunc(collection, function(value, index, collection) { + accumulator = initAccum + ? (initAccum = false, value) + : iteratee(accumulator, value, index, collection); + }); + return accumulator; + } - return baseSortBy(result, function(object, other) { - return compareMultiple(object, other, orders); - }); - } + /** + * The base implementation of `_.sortBy` which uses `comparer` to define the + * sort order of `array` and replaces criteria objects with their corresponding + * values. + * + * @private + * @param {Array} array The array to sort. + * @param {Function} comparer The function to define sort order. + * @returns {Array} Returns `array`. + */ + function baseSortBy(array, comparer) { + var length = array.length; - /** - * The base implementation of `_.pick` without support for individual - * property identifiers. - * - * @private - * @param {Object} object The source object. - * @param {string[]} paths The property paths to pick. - * @returns {Object} Returns the new object. - */ - function basePick(object, paths) { - return basePickBy(object, paths, function(value, path) { - return hasIn(object, path); - }); + array.sort(comparer); + while (length--) { + array[length] = array[length].value; } + return array; + } - /** - * The base implementation of `_.pickBy` without support for iteratee shorthands. - * - * @private - * @param {Object} object The source object. - * @param {string[]} paths The property paths to pick. - * @param {Function} predicate The function invoked per property. - * @returns {Object} Returns the new object. - */ - function basePickBy(object, paths, predicate) { - var index = -1, - length = paths.length, - result = {}; - - while (++index < length) { - var path = paths[index], - value = baseGet(object, path); + /** + * The base implementation of `_.sum` and `_.sumBy` without support for + * iteratee shorthands. + * + * @private + * @param {Array} array The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {number} Returns the sum. + */ + function baseSum(array, iteratee) { + var result, + index = -1, + length = array.length; - if (predicate(value, path)) { - baseSet(result, castPath(path, object), value); - } + while (++index < length) { + var current = iteratee(array[index]); + if (current !== undefined) { + result = result === undefined ? current : (result + current); } - return result; } + return result; + } - /** - * A specialized version of `baseProperty` which supports deep paths. - * - * @private - * @param {Array|string} path The path of the property to get. - * @returns {Function} Returns the new accessor function. - */ - function basePropertyDeep(path) { - return function(object) { - return baseGet(object, path); - }; + /** + * The base implementation of `_.times` without support for iteratee shorthands + * or max array length checks. + * + * @private + * @param {number} n The number of times to invoke `iteratee`. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array} Returns the array of results. + */ + function baseTimes(n, iteratee) { + var index = -1, + result = Array(n); + + while (++index < n) { + result[index] = iteratee(index); } + return result; + } - /** - * The base implementation of `_.pullAllBy` without support for iteratee - * shorthands. - * - * @private - * @param {Array} array The array to modify. - * @param {Array} values The values to remove. - * @param {Function} [iteratee] The iteratee invoked per element. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns `array`. - */ - function basePullAll(array, values, iteratee, comparator) { - var indexOf = comparator ? baseIndexOfWith : baseIndexOf, - index = -1, - length = values.length, - seen = array; + /** + * The base implementation of `_.toPairs` and `_.toPairsIn` which creates an array + * of key-value pairs for `object` corresponding to the property names of `props`. + * + * @private + * @param {Object} object The object to query. + * @param {Array} props The property names to get values for. + * @returns {Object} Returns the key-value pairs. + */ + function baseToPairs(object, props) { + return arrayMap(props, function(key) { + return [key, object[key]]; + }); + } - if (array === values) { - values = copyArray(values); - } - if (iteratee) { - seen = arrayMap(array, baseUnary(iteratee)); - } - while (++index < length) { - var fromIndex = 0, - value = values[index], - computed = iteratee ? iteratee(value) : value; + /** + * The base implementation of `_.unary` without support for storing metadata. + * + * @private + * @param {Function} func The function to cap arguments for. + * @returns {Function} Returns the new capped function. + */ + function baseUnary(func) { + return function(value) { + return func(value); + }; + } - while ((fromIndex = indexOf(seen, computed, fromIndex, comparator)) > -1) { - if (seen !== array) { - splice.call(seen, fromIndex, 1); - } - splice.call(array, fromIndex, 1); - } - } - return array; - } + /** + * The base implementation of `_.values` and `_.valuesIn` which creates an + * array of `object` property values corresponding to the property names + * of `props`. + * + * @private + * @param {Object} object The object to query. + * @param {Array} props The property names to get values for. + * @returns {Object} Returns the array of property values. + */ + function baseValues(object, props) { + return arrayMap(props, function(key) { + return object[key]; + }); + } - /** - * The base implementation of `_.pullAt` without support for individual - * indexes or capturing the removed elements. - * - * @private - * @param {Array} array The array to modify. - * @param {number[]} indexes The indexes of elements to remove. - * @returns {Array} Returns `array`. - */ - function basePullAt(array, indexes) { - var length = array ? indexes.length : 0, - lastIndex = length - 1; + /** + * Checks if a `cache` value for `key` exists. + * + * @private + * @param {Object} cache The cache to query. + * @param {string} key The key of the entry to check. + * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. + */ + function cacheHas(cache, key) { + return cache.has(key); + } - while (length--) { - var index = indexes[length]; - if (length == lastIndex || index !== previous) { - var previous = index; - if (isIndex(index)) { - splice.call(array, index, 1); - } else { - baseUnset(array, index); - } - } - } - return array; - } + /** + * Used by `_.trim` and `_.trimStart` to get the index of the first string symbol + * that is not found in the character symbols. + * + * @private + * @param {Array} strSymbols The string symbols to inspect. + * @param {Array} chrSymbols The character symbols to find. + * @returns {number} Returns the index of the first unmatched string symbol. + */ + function charsStartIndex(strSymbols, chrSymbols) { + var index = -1, + length = strSymbols.length; - /** - * The base implementation of `_.random` without support for returning - * floating-point numbers. - * - * @private - * @param {number} lower The lower bound. - * @param {number} upper The upper bound. - * @returns {number} Returns the random number. - */ - function baseRandom(lower, upper) { - return lower + nativeFloor(nativeRandom() * (upper - lower + 1)); - } + while (++index < length && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {} + return index; + } - /** - * The base implementation of `_.range` and `_.rangeRight` which doesn't - * coerce arguments. - * - * @private - * @param {number} start The start of the range. - * @param {number} end The end of the range. - * @param {number} step The value to increment or decrement by. - * @param {boolean} [fromRight] Specify iterating from right to left. - * @returns {Array} Returns the range of numbers. - */ - function baseRange(start, end, step, fromRight) { - var index = -1, - length = nativeMax(nativeCeil((end - start) / (step || 1)), 0), - result = Array(length); + /** + * Used by `_.trim` and `_.trimEnd` to get the index of the last string symbol + * that is not found in the character symbols. + * + * @private + * @param {Array} strSymbols The string symbols to inspect. + * @param {Array} chrSymbols The character symbols to find. + * @returns {number} Returns the index of the last unmatched string symbol. + */ + function charsEndIndex(strSymbols, chrSymbols) { + var index = strSymbols.length; - while (length--) { - result[fromRight ? length : ++index] = start; - start += step; + while (index-- && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {} + return index; + } + + /** + * Gets the number of `placeholder` occurrences in `array`. + * + * @private + * @param {Array} array The array to inspect. + * @param {*} placeholder The placeholder to search for. + * @returns {number} Returns the placeholder count. + */ + function countHolders(array, placeholder) { + var length = array.length, + result = 0; + + while (length--) { + if (array[length] === placeholder) { + ++result; } - return result; } + return result; + } - /** - * The base implementation of `_.repeat` which doesn't coerce arguments. - * - * @private - * @param {string} string The string to repeat. - * @param {number} n The number of times to repeat the string. - * @returns {string} Returns the repeated string. - */ - function baseRepeat(string, n) { - var result = ''; - if (!string || n < 1 || n > MAX_SAFE_INTEGER) { - return result; - } - // Leverage the exponentiation by squaring algorithm for a faster repeat. - // See https://en.wikipedia.org/wiki/Exponentiation_by_squaring for more details. - do { - if (n % 2) { - result += string; - } - n = nativeFloor(n / 2); - if (n) { - string += string; - } - } while (n); + /** + * Used by `_.deburr` to convert Latin-1 Supplement and Latin Extended-A + * letters to basic Latin letters. + * + * @private + * @param {string} letter The matched letter to deburr. + * @returns {string} Returns the deburred letter. + */ + var deburrLetter = basePropertyOf(deburredLetters); - return result; - } + /** + * Used by `_.escape` to convert characters to HTML entities. + * + * @private + * @param {string} chr The matched character to escape. + * @returns {string} Returns the escaped character. + */ + var escapeHtmlChar = basePropertyOf(htmlEscapes); - /** - * The base implementation of `_.rest` which doesn't validate or coerce arguments. - * - * @private - * @param {Function} func The function to apply a rest parameter to. - * @param {number} [start=func.length-1] The start position of the rest parameter. - * @returns {Function} Returns the new function. - */ - function baseRest(func, start) { - return setToString(overRest(func, start, identity), func + ''); - } + /** + * Used by `_.template` to escape characters for inclusion in compiled string literals. + * + * @private + * @param {string} chr The matched character to escape. + * @returns {string} Returns the escaped character. + */ + function escapeStringChar(chr) { + return '\\' + stringEscapes[chr]; + } - /** - * The base implementation of `_.sample`. - * - * @private - * @param {Array|Object} collection The collection to sample. - * @returns {*} Returns the random element. - */ - function baseSample(collection) { - return arraySample(values(collection)); - } + /** + * Gets the value at `key` of `object`. + * + * @private + * @param {Object} [object] The object to query. + * @param {string} key The key of the property to get. + * @returns {*} Returns the property value. + */ + function getValue(object, key) { + return object == null ? undefined : object[key]; + } - /** - * The base implementation of `_.sampleSize` without param guards. - * - * @private - * @param {Array|Object} collection The collection to sample. - * @param {number} n The number of elements to sample. - * @returns {Array} Returns the random elements. - */ - function baseSampleSize(collection, n) { - var array = values(collection); - return shuffleSelf(array, baseClamp(n, 0, array.length)); + /** + * Checks if `string` contains Unicode symbols. + * + * @private + * @param {string} string The string to inspect. + * @returns {boolean} Returns `true` if a symbol is found, else `false`. + */ + function hasUnicode(string) { + return reHasUnicode.test(string); + } + + /** + * Checks if `string` contains a word composed of Unicode symbols. + * + * @private + * @param {string} string The string to inspect. + * @returns {boolean} Returns `true` if a word is found, else `false`. + */ + function hasUnicodeWord(string) { + return reHasUnicodeWord.test(string); + } + + /** + * Converts `iterator` to an array. + * + * @private + * @param {Object} iterator The iterator to convert. + * @returns {Array} Returns the converted array. + */ + function iteratorToArray(iterator) { + var data, + result = []; + + while (!(data = iterator.next()).done) { + result.push(data.value); } + return result; + } - /** - * The base implementation of `_.set`. - * - * @private - * @param {Object} object The object to modify. - * @param {Array|string} path The path of the property to set. - * @param {*} value The value to set. - * @param {Function} [customizer] The function to customize path creation. - * @returns {Object} Returns `object`. - */ - function baseSet(object, path, value, customizer) { - if (!isObject(object)) { - return object; - } - path = castPath(path, object); + /** + * Converts `map` to its key-value pairs. + * + * @private + * @param {Object} map The map to convert. + * @returns {Array} Returns the key-value pairs. + */ + function mapToArray(map) { + var index = -1, + result = Array(map.size); - var index = -1, - length = path.length, - lastIndex = length - 1, - nested = object; + map.forEach(function(value, key) { + result[++index] = [key, value]; + }); + return result; + } - while (nested != null && ++index < length) { - var key = toKey(path[index]), - newValue = value; + /** + * Creates a unary function that invokes `func` with its argument transformed. + * + * @private + * @param {Function} func The function to wrap. + * @param {Function} transform The argument transform. + * @returns {Function} Returns the new function. + */ + function overArg(func, transform) { + return function(arg) { + return func(transform(arg)); + }; + } - if (index != lastIndex) { - var objValue = nested[key]; - newValue = customizer ? customizer(objValue, key, nested) : undefined; - if (newValue === undefined) { - newValue = isObject(objValue) - ? objValue - : (isIndex(path[index + 1]) ? [] : {}); - } - } - assignValue(nested, key, newValue); - nested = nested[key]; + /** + * Replaces all `placeholder` elements in `array` with an internal placeholder + * and returns an array of their indexes. + * + * @private + * @param {Array} array The array to modify. + * @param {*} placeholder The placeholder to replace. + * @returns {Array} Returns the new array of placeholder indexes. + */ + function replaceHolders(array, placeholder) { + var index = -1, + length = array.length, + resIndex = 0, + result = []; + + while (++index < length) { + var value = array[index]; + if (value === placeholder || value === PLACEHOLDER) { + array[index] = PLACEHOLDER; + result[resIndex++] = index; } - return object; } + return result; + } - /** - * The base implementation of `setData` without support for hot loop shorting. - * - * @private - * @param {Function} func The function to associate metadata with. - * @param {*} data The metadata. - * @returns {Function} Returns `func`. - */ - var baseSetData = !metaMap ? identity : function(func, data) { - metaMap.set(func, data); - return func; - }; + /** + * Converts `set` to an array of its values. + * + * @private + * @param {Object} set The set to convert. + * @returns {Array} Returns the values. + */ + function setToArray(set) { + var index = -1, + result = Array(set.size); - /** - * The base implementation of `setToString` without support for hot loop shorting. - * - * @private - * @param {Function} func The function to modify. - * @param {Function} string The `toString` result. - * @returns {Function} Returns `func`. - */ - var baseSetToString = !defineProperty ? identity : function(func, string) { - return defineProperty(func, 'toString', { - 'configurable': true, - 'enumerable': false, - 'value': constant(string), - 'writable': true - }); - }; + set.forEach(function(value) { + result[++index] = value; + }); + return result; + } - /** - * The base implementation of `_.shuffle`. - * - * @private - * @param {Array|Object} collection The collection to shuffle. - * @returns {Array} Returns the new shuffled array. - */ - function baseShuffle(collection) { - return shuffleSelf(values(collection)); - } + /** + * Converts `set` to its value-value pairs. + * + * @private + * @param {Object} set The set to convert. + * @returns {Array} Returns the value-value pairs. + */ + function setToPairs(set) { + var index = -1, + result = Array(set.size); - /** - * The base implementation of `_.slice` without an iteratee call guard. - * - * @private - * @param {Array} array The array to slice. - * @param {number} [start=0] The start position. - * @param {number} [end=array.length] The end position. - * @returns {Array} Returns the slice of `array`. - */ - function baseSlice(array, start, end) { - var index = -1, - length = array.length; + set.forEach(function(value) { + result[++index] = [value, value]; + }); + return result; + } - if (start < 0) { - start = -start > length ? 0 : (length + start); - } - end = end > length ? length : end; - if (end < 0) { - end += length; + /** + * A specialized version of `_.indexOf` which performs strict equality + * comparisons of values, i.e. `===`. + * + * @private + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @param {number} fromIndex The index to search from. + * @returns {number} Returns the index of the matched value, else `-1`. + */ + function strictIndexOf(array, value, fromIndex) { + var index = fromIndex - 1, + length = array.length; + + while (++index < length) { + if (array[index] === value) { + return index; } - length = start > end ? 0 : ((end - start) >>> 0); - start >>>= 0; + } + return -1; + } - var result = Array(length); - while (++index < length) { - result[index] = array[index + start]; + /** + * A specialized version of `_.lastIndexOf` which performs strict equality + * comparisons of values, i.e. `===`. + * + * @private + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @param {number} fromIndex The index to search from. + * @returns {number} Returns the index of the matched value, else `-1`. + */ + function strictLastIndexOf(array, value, fromIndex) { + var index = fromIndex + 1; + while (index--) { + if (array[index] === value) { + return index; } - return result; } + return index; + } - /** - * The base implementation of `_.some` without support for iteratee shorthands. - * - * @private - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} predicate The function invoked per iteration. - * @returns {boolean} Returns `true` if any element passes the predicate check, - * else `false`. - */ - function baseSome(collection, predicate) { - var result; + /** + * Gets the number of symbols in `string`. + * + * @private + * @param {string} string The string to inspect. + * @returns {number} Returns the string size. + */ + function stringSize(string) { + return hasUnicode(string) + ? unicodeSize(string) + : asciiSize(string); + } - baseEach(collection, function(value, index, collection) { - result = predicate(value, index, collection); - return !result; - }); - return !!result; + /** + * Converts `string` to an array. + * + * @private + * @param {string} string The string to convert. + * @returns {Array} Returns the converted array. + */ + function stringToArray(string) { + return hasUnicode(string) + ? unicodeToArray(string) + : asciiToArray(string); + } + + /** + * Used by `_.unescape` to convert HTML entities to characters. + * + * @private + * @param {string} chr The matched character to unescape. + * @returns {string} Returns the unescaped character. + */ + var unescapeHtmlChar = basePropertyOf(htmlUnescapes); + + /** + * Gets the size of a Unicode `string`. + * + * @private + * @param {string} string The string inspect. + * @returns {number} Returns the string size. + */ + function unicodeSize(string) { + var result = reUnicode.lastIndex = 0; + while (reUnicode.test(string)) { + ++result; } + return result; + } - /** - * The base implementation of `_.sortedIndex` and `_.sortedLastIndex` which - * performs a binary search of `array` to determine the index at which `value` - * should be inserted into `array` in order to maintain its sort order. - * - * @private - * @param {Array} array The sorted array to inspect. - * @param {*} value The value to evaluate. - * @param {boolean} [retHighest] Specify returning the highest qualified index. - * @returns {number} Returns the index at which `value` should be inserted - * into `array`. - */ - function baseSortedIndex(array, value, retHighest) { - var low = 0, - high = array == null ? low : array.length; + /** + * Converts a Unicode `string` to an array. + * + * @private + * @param {string} string The string to convert. + * @returns {Array} Returns the converted array. + */ + function unicodeToArray(string) { + return string.match(reUnicode) || []; + } - if (typeof value == 'number' && value === value && high <= HALF_MAX_ARRAY_LENGTH) { - while (low < high) { - var mid = (low + high) >>> 1, - computed = array[mid]; + /** + * Splits a Unicode `string` into an array of its words. + * + * @private + * @param {string} The string to inspect. + * @returns {Array} Returns the words of `string`. + */ + function unicodeWords(string) { + return string.match(reUnicodeWord) || []; + } - if (computed !== null && !isSymbol(computed) && - (retHighest ? (computed <= value) : (computed < value))) { - low = mid + 1; - } else { - high = mid; - } - } - return high; - } - return baseSortedIndexBy(array, value, identity, retHighest); - } + /*--------------------------------------------------------------------------*/ - /** - * The base implementation of `_.sortedIndexBy` and `_.sortedLastIndexBy` - * which invokes `iteratee` for `value` and each element of `array` to compute - * their sort ranking. The iteratee is invoked with one argument; (value). - * - * @private - * @param {Array} array The sorted array to inspect. - * @param {*} value The value to evaluate. - * @param {Function} iteratee The iteratee invoked per element. - * @param {boolean} [retHighest] Specify returning the highest qualified index. - * @returns {number} Returns the index at which `value` should be inserted - * into `array`. - */ - function baseSortedIndexBy(array, value, iteratee, retHighest) { - value = iteratee(value); + /** + * Create a new pristine `lodash` function using the `context` object. + * + * @static + * @memberOf _ + * @since 1.1.0 + * @category Util + * @param {Object} [context=root] The context object. + * @returns {Function} Returns a new `lodash` function. + * @example + * + * _.mixin({ 'foo': _.constant('foo') }); + * + * var lodash = _.runInContext(); + * lodash.mixin({ 'bar': lodash.constant('bar') }); + * + * _.isFunction(_.foo); + * // => true + * _.isFunction(_.bar); + * // => false + * + * lodash.isFunction(lodash.foo); + * // => false + * lodash.isFunction(lodash.bar); + * // => true + * + * // Create a suped-up `defer` in Node.js. + * var defer = _.runInContext({ 'setTimeout': setImmediate }).defer; + */ + var runInContext = (function runInContext(context) { + context = context == null ? root : _.defaults(root.Object(), context, _.pick(root, contextProps)); - var low = 0, - high = array == null ? 0 : array.length, - valIsNaN = value !== value, - valIsNull = value === null, - valIsSymbol = isSymbol(value), - valIsUndefined = value === undefined; + /** Built-in constructor references. */ + var Array = context.Array, + Date = context.Date, + Error = context.Error, + Function = context.Function, + Math = context.Math, + Object = context.Object, + RegExp = context.RegExp, + String = context.String, + TypeError = context.TypeError; - while (low < high) { - var mid = nativeFloor((low + high) / 2), - computed = iteratee(array[mid]), - othIsDefined = computed !== undefined, - othIsNull = computed === null, - othIsReflexive = computed === computed, - othIsSymbol = isSymbol(computed); + /** Used for built-in method references. */ + var arrayProto = Array.prototype, + funcProto = Function.prototype, + objectProto = Object.prototype; - if (valIsNaN) { - var setLow = retHighest || othIsReflexive; - } else if (valIsUndefined) { - setLow = othIsReflexive && (retHighest || othIsDefined); - } else if (valIsNull) { - setLow = othIsReflexive && othIsDefined && (retHighest || !othIsNull); - } else if (valIsSymbol) { - setLow = othIsReflexive && othIsDefined && !othIsNull && (retHighest || !othIsSymbol); - } else if (othIsNull || othIsSymbol) { - setLow = false; - } else { - setLow = retHighest ? (computed <= value) : (computed < value); - } - if (setLow) { - low = mid + 1; - } else { - high = mid; - } - } - return nativeMin(high, MAX_ARRAY_INDEX); - } + /** Used to detect overreaching core-js shims. */ + var coreJsData = context['__core-js_shared__']; - /** - * The base implementation of `_.sortedUniq` and `_.sortedUniqBy` without - * support for iteratee shorthands. - * - * @private - * @param {Array} array The array to inspect. - * @param {Function} [iteratee] The iteratee invoked per element. - * @returns {Array} Returns the new duplicate free array. - */ - function baseSortedUniq(array, iteratee) { - var index = -1, - length = array.length, - resIndex = 0, - result = []; + /** Used to resolve the decompiled source of functions. */ + var funcToString = funcProto.toString; - while (++index < length) { - var value = array[index], - computed = iteratee ? iteratee(value) : value; + /** Used to check objects for own properties. */ + var hasOwnProperty = objectProto.hasOwnProperty; - if (!index || !eq(computed, seen)) { - var seen = computed; - result[resIndex++] = value === 0 ? 0 : value; - } - } - return result; - } + /** Used to generate unique IDs. */ + var idCounter = 0; + + /** Used to detect methods masquerading as native. */ + var maskSrcKey = (function() { + var uid = /[^.]+$/.exec(coreJsData && coreJsData.keys && coreJsData.keys.IE_PROTO || ''); + return uid ? ('Symbol(src)_1.' + uid) : ''; + }()); /** - * The base implementation of `_.toNumber` which doesn't ensure correct - * conversions of binary, hexadecimal, or octal string values. - * - * @private - * @param {*} value The value to process. - * @returns {number} Returns the number. + * Used to resolve the + * [`toStringTag`](http://ecma-international.org/ecma-262/7.0/#sec-object.prototype.tostring) + * of values. */ - function baseToNumber(value) { - if (typeof value == 'number') { - return value; - } - if (isSymbol(value)) { - return NAN; - } - return +value; - } + var nativeObjectToString = objectProto.toString; + + /** Used to infer the `Object` constructor. */ + var objectCtorString = funcToString.call(Object); + + /** Used to restore the original `_` reference in `_.noConflict`. */ + var oldDash = root._; + + /** Used to detect if a method is native. */ + var reIsNative = RegExp('^' + + funcToString.call(hasOwnProperty).replace(reRegExpChar, '\\$&') + .replace(/hasOwnProperty|(function).*?(?=\\\()| for .+?(?=\\\])/g, '$1.*?') + '$' + ); + + /** Built-in value references. */ + var Buffer = moduleExports ? context.Buffer : undefined, + Symbol = context.Symbol, + Uint8Array = context.Uint8Array, + allocUnsafe = Buffer ? Buffer.allocUnsafe : undefined, + getPrototype = overArg(Object.getPrototypeOf, Object), + objectCreate = Object.create, + propertyIsEnumerable = objectProto.propertyIsEnumerable, + splice = arrayProto.splice, + spreadableSymbol = Symbol ? Symbol.isConcatSpreadable : undefined, + symIterator = Symbol ? Symbol.iterator : undefined, + symToStringTag = Symbol ? Symbol.toStringTag : undefined; + + var defineProperty = (function() { + try { + var func = getNative(Object, 'defineProperty'); + func({}, '', {}); + return func; + } catch (e) {} + }()); + + /** Mocked built-ins. */ + var ctxClearTimeout = context.clearTimeout !== root.clearTimeout && context.clearTimeout, + ctxNow = Date && Date.now !== root.Date.now && Date.now, + ctxSetTimeout = context.setTimeout !== root.setTimeout && context.setTimeout; + + /* Built-in method references for those with the same name as other `lodash` methods. */ + var nativeCeil = Math.ceil, + nativeFloor = Math.floor, + nativeGetSymbols = Object.getOwnPropertySymbols, + nativeIsBuffer = Buffer ? Buffer.isBuffer : undefined, + nativeIsFinite = context.isFinite, + nativeJoin = arrayProto.join, + nativeKeys = overArg(Object.keys, Object), + nativeMax = Math.max, + nativeMin = Math.min, + nativeNow = Date.now, + nativeParseInt = context.parseInt, + nativeRandom = Math.random, + nativeReverse = arrayProto.reverse; + + /* Built-in method references that are verified to be native. */ + var DataView = getNative(context, 'DataView'), + Map = getNative(context, 'Map'), + Promise = getNative(context, 'Promise'), + Set = getNative(context, 'Set'), + WeakMap = getNative(context, 'WeakMap'), + nativeCreate = getNative(Object, 'create'); + + /** Used to store function metadata. */ + var metaMap = WeakMap && new WeakMap; + + /** Used to lookup unminified function names. */ + var realNames = {}; + + /** Used to detect maps, sets, and weakmaps. */ + var dataViewCtorString = toSource(DataView), + mapCtorString = toSource(Map), + promiseCtorString = toSource(Promise), + setCtorString = toSource(Set), + weakMapCtorString = toSource(WeakMap); + + /** Used to convert symbols to primitives and strings. */ + var symbolProto = Symbol ? Symbol.prototype : undefined, + symbolValueOf = symbolProto ? symbolProto.valueOf : undefined, + symbolToString = symbolProto ? symbolProto.toString : undefined; + + /*------------------------------------------------------------------------*/ /** - * The base implementation of `_.toString` which doesn't convert nullish - * values to empty strings. + * Creates a `lodash` object which wraps `value` to enable implicit method + * chain sequences. Methods that operate on and return arrays, collections, + * and functions can be chained together. Methods that retrieve a single value + * or may return a primitive value will automatically end the chain sequence + * and return the unwrapped value. Otherwise, the value must be unwrapped + * with `_#value`. * - * @private - * @param {*} value The value to process. - * @returns {string} Returns the string. + * Explicit chain sequences, which must be unwrapped with `_#value`, may be + * enabled using `_.chain`. + * + * The execution of chained methods is lazy, that is, it's deferred until + * `_#value` is implicitly or explicitly called. + * + * Lazy evaluation allows several methods to support shortcut fusion. + * Shortcut fusion is an optimization to merge iteratee calls; this avoids + * the creation of intermediate arrays and can greatly reduce the number of + * iteratee executions. Sections of a chain sequence qualify for shortcut + * fusion if the section is applied to an array and iteratees accept only + * one argument. The heuristic for whether a section qualifies for shortcut + * fusion is subject to change. + * + * Chaining is supported in custom builds as long as the `_#value` method is + * directly or indirectly included in the build. + * + * In addition to lodash methods, wrappers have `Array` and `String` methods. + * + * The wrapper `Array` methods are: + * `concat`, `join`, `pop`, `push`, `shift`, `sort`, `splice`, and `unshift` + * + * The wrapper `String` methods are: + * `replace` and `split` + * + * The wrapper methods that support shortcut fusion are: + * `at`, `compact`, `drop`, `dropRight`, `dropWhile`, `filter`, `find`, + * `findLast`, `head`, `initial`, `last`, `map`, `reject`, `reverse`, `slice`, + * `tail`, `take`, `takeRight`, `takeRightWhile`, `takeWhile`, and `toArray` + * + * The chainable wrapper methods are: + * `after`, `ary`, `assign`, `assignIn`, `assignInWith`, `assignWith`, `at`, + * `before`, `bind`, `bindAll`, `bindKey`, `castArray`, `chain`, `chunk`, + * `commit`, `compact`, `concat`, `conforms`, `constant`, `countBy`, `create`, + * `curry`, `debounce`, `defaults`, `defaultsDeep`, `defer`, `delay`, + * `difference`, `differenceBy`, `differenceWith`, `drop`, `dropRight`, + * `dropRightWhile`, `dropWhile`, `extend`, `extendWith`, `fill`, `filter`, + * `flatMap`, `flatMapDeep`, `flatMapDepth`, `flatten`, `flattenDeep`, + * `flattenDepth`, `flip`, `flow`, `flowRight`, `fromPairs`, `functions`, + * `functionsIn`, `groupBy`, `initial`, `intersection`, `intersectionBy`, + * `intersectionWith`, `invert`, `invertBy`, `invokeMap`, `iteratee`, `keyBy`, + * `keys`, `keysIn`, `map`, `mapKeys`, `mapValues`, `matches`, `matchesProperty`, + * `memoize`, `merge`, `mergeWith`, `method`, `methodOf`, `mixin`, `negate`, + * `nthArg`, `omit`, `omitBy`, `once`, `orderBy`, `over`, `overArgs`, + * `overEvery`, `overSome`, `partial`, `partialRight`, `partition`, `pick`, + * `pickBy`, `plant`, `property`, `propertyOf`, `pull`, `pullAll`, `pullAllBy`, + * `pullAllWith`, `pullAt`, `push`, `range`, `rangeRight`, `rearg`, `reject`, + * `remove`, `rest`, `reverse`, `sampleSize`, `set`, `setWith`, `shuffle`, + * `slice`, `sort`, `sortBy`, `splice`, `spread`, `tail`, `take`, `takeRight`, + * `takeRightWhile`, `takeWhile`, `tap`, `throttle`, `thru`, `toArray`, + * `toPairs`, `toPairsIn`, `toPath`, `toPlainObject`, `transform`, `unary`, + * `union`, `unionBy`, `unionWith`, `uniq`, `uniqBy`, `uniqWith`, `unset`, + * `unshift`, `unzip`, `unzipWith`, `update`, `updateWith`, `values`, + * `valuesIn`, `without`, `wrap`, `xor`, `xorBy`, `xorWith`, `zip`, + * `zipObject`, `zipObjectDeep`, and `zipWith` + * + * The wrapper methods that are **not** chainable by default are: + * `add`, `attempt`, `camelCase`, `capitalize`, `ceil`, `clamp`, `clone`, + * `cloneDeep`, `cloneDeepWith`, `cloneWith`, `conformsTo`, `deburr`, + * `defaultTo`, `divide`, `each`, `eachRight`, `endsWith`, `eq`, `escape`, + * `escapeRegExp`, `every`, `find`, `findIndex`, `findKey`, `findLast`, + * `findLastIndex`, `findLastKey`, `first`, `floor`, `forEach`, `forEachRight`, + * `forIn`, `forInRight`, `forOwn`, `forOwnRight`, `get`, `gt`, `gte`, `has`, + * `hasIn`, `head`, `identity`, `includes`, `indexOf`, `inRange`, `invoke`, + * `isArguments`, `isArray`, `isArrayBuffer`, `isArrayLike`, `isArrayLikeObject`, + * `isBoolean`, `isBuffer`, `isDate`, `isElement`, `isEmpty`, `isEqual`, + * `isEqualWith`, `isError`, `isFinite`, `isFunction`, `isInteger`, `isLength`, + * `isMap`, `isMatch`, `isMatchWith`, `isNaN`, `isNative`, `isNil`, `isNull`, + * `isNumber`, `isObject`, `isObjectLike`, `isPlainObject`, `isRegExp`, + * `isSafeInteger`, `isSet`, `isString`, `isUndefined`, `isTypedArray`, + * `isWeakMap`, `isWeakSet`, `join`, `kebabCase`, `last`, `lastIndexOf`, + * `lowerCase`, `lowerFirst`, `lt`, `lte`, `max`, `maxBy`, `mean`, `meanBy`, + * `min`, `minBy`, `multiply`, `noConflict`, `noop`, `now`, `nth`, `pad`, + * `padEnd`, `padStart`, `parseInt`, `pop`, `random`, `reduce`, `reduceRight`, + * `repeat`, `result`, `round`, `runInContext`, `sample`, `shift`, `size`, + * `snakeCase`, `some`, `sortedIndex`, `sortedIndexBy`, `sortedLastIndex`, + * `sortedLastIndexBy`, `startCase`, `startsWith`, `stubArray`, `stubFalse`, + * `stubObject`, `stubString`, `stubTrue`, `subtract`, `sum`, `sumBy`, + * `template`, `times`, `toFinite`, `toInteger`, `toJSON`, `toLength`, + * `toLower`, `toNumber`, `toSafeInteger`, `toString`, `toUpper`, `trim`, + * `trimEnd`, `trimStart`, `truncate`, `unescape`, `uniqueId`, `upperCase`, + * `upperFirst`, `value`, and `words` + * + * @name _ + * @constructor + * @category Seq + * @param {*} value The value to wrap in a `lodash` instance. + * @returns {Object} Returns the new `lodash` wrapper instance. + * @example + * + * function square(n) { + * return n * n; + * } + * + * var wrapped = _([1, 2, 3]); + * + * // Returns an unwrapped value. + * wrapped.reduce(_.add); + * // => 6 + * + * // Returns a wrapped value. + * var squares = wrapped.map(square); + * + * _.isArray(squares); + * // => false + * + * _.isArray(squares.value()); + * // => true */ - function baseToString(value) { - // Exit early for strings to avoid a performance hit in some environments. - if (typeof value == 'string') { - return value; - } - if (isArray(value)) { - // Recursively convert values (susceptible to call stack limits). - return arrayMap(value, baseToString) + ''; - } - if (isSymbol(value)) { - return symbolToString ? symbolToString.call(value) : ''; + function lodash(value) { + if (isObjectLike(value) && !isArray(value) && !(value instanceof LazyWrapper)) { + if (value instanceof LodashWrapper) { + return value; + } + if (hasOwnProperty.call(value, '__wrapped__')) { + return wrapperClone(value); + } } - var result = (value + ''); - return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result; + return new LodashWrapper(value); } /** - * The base implementation of `_.uniqBy` without support for iteratee shorthands. + * The base implementation of `_.create` without support for assigning + * properties to the created object. * * @private - * @param {Array} array The array to inspect. - * @param {Function} [iteratee] The iteratee invoked per element. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns the new duplicate free array. + * @param {Object} proto The object to inherit from. + * @returns {Object} Returns the new object. */ - function baseUniq(array, iteratee, comparator) { - var index = -1, - includes = arrayIncludes, - length = array.length, - isCommon = true, - result = [], - seen = result; - - if (comparator) { - isCommon = false; - includes = arrayIncludesWith; - } - else if (length >= LARGE_ARRAY_SIZE) { - var set = iteratee ? null : createSet(array); - if (set) { - return setToArray(set); - } - isCommon = false; - includes = cacheHas; - seen = new SetCache; - } - else { - seen = iteratee ? [] : result; - } - outer: - while (++index < length) { - var value = array[index], - computed = iteratee ? iteratee(value) : value; - - value = (comparator || value !== 0) ? value : 0; - if (isCommon && computed === computed) { - var seenIndex = seen.length; - while (seenIndex--) { - if (seen[seenIndex] === computed) { - continue outer; - } - } - if (iteratee) { - seen.push(computed); - } - result.push(value); + var baseCreate = (function() { + function object() {} + return function(proto) { + if (!isObject(proto)) { + return {}; } - else if (!includes(seen, computed, comparator)) { - if (seen !== result) { - seen.push(computed); - } - result.push(value); + if (objectCreate) { + return objectCreate(proto); } - } - return result; - } + object.prototype = proto; + var result = new object; + object.prototype = undefined; + return result; + }; + }()); /** - * The base implementation of `_.unset`. + * The function whose prototype chain sequence wrappers inherit from. * * @private - * @param {Object} object The object to modify. - * @param {Array|string} path The property path to unset. - * @returns {boolean} Returns `true` if the property is deleted, else `false`. */ - function baseUnset(object, path) { - path = castPath(path, object); - object = parent(object, path); - return object == null || delete object[toKey(last(path))]; + function baseLodash() { + // No operation performed. } /** - * The base implementation of `_.update`. + * The base constructor for creating `lodash` wrapper objects. * * @private - * @param {Object} object The object to modify. - * @param {Array|string} path The path of the property to update. - * @param {Function} updater The function to produce the updated value. - * @param {Function} [customizer] The function to customize path creation. - * @returns {Object} Returns `object`. + * @param {*} value The value to wrap. + * @param {boolean} [chainAll] Enable explicit method chain sequences. */ - function baseUpdate(object, path, updater, customizer) { - return baseSet(object, path, updater(baseGet(object, path)), customizer); + function LodashWrapper(value, chainAll) { + this.__wrapped__ = value; + this.__actions__ = []; + this.__chain__ = !!chainAll; + this.__index__ = 0; + this.__values__ = undefined; } /** - * The base implementation of methods like `_.dropWhile` and `_.takeWhile` - * without support for iteratee shorthands. + * By default, the template delimiters used by lodash are like those in + * embedded Ruby (ERB) as well as ES2015 template strings. Change the + * following template settings to use alternative delimiters. * - * @private - * @param {Array} array The array to query. - * @param {Function} predicate The function invoked per iteration. - * @param {boolean} [isDrop] Specify dropping elements instead of taking them. - * @param {boolean} [fromRight] Specify iterating from right to left. - * @returns {Array} Returns the slice of `array`. + * @static + * @memberOf _ + * @type {Object} */ - function baseWhile(array, predicate, isDrop, fromRight) { - var length = array.length, - index = fromRight ? length : -1; + lodash.templateSettings = { - while ((fromRight ? index-- : ++index < length) && - predicate(array[index], index, array)) {} + /** + * Used to detect `data` property values to be HTML-escaped. + * + * @memberOf _.templateSettings + * @type {RegExp} + */ + 'escape': reEscape, - return isDrop - ? baseSlice(array, (fromRight ? 0 : index), (fromRight ? index + 1 : length)) - : baseSlice(array, (fromRight ? index + 1 : 0), (fromRight ? length : index)); - } + /** + * Used to detect code to be evaluated. + * + * @memberOf _.templateSettings + * @type {RegExp} + */ + 'evaluate': reEvaluate, + + /** + * Used to detect `data` property values to inject. + * + * @memberOf _.templateSettings + * @type {RegExp} + */ + 'interpolate': reInterpolate, + + /** + * Used to reference the data object in the template text. + * + * @memberOf _.templateSettings + * @type {string} + */ + 'variable': '', + + /** + * Used to import variables into the compiled template. + * + * @memberOf _.templateSettings + * @type {Object} + */ + 'imports': { + + /** + * A reference to the `lodash` function. + * + * @memberOf _.templateSettings.imports + * @type {Function} + */ + '_': lodash + } + }; + + // Ensure wrappers are instances of `baseLodash`. + lodash.prototype = baseLodash.prototype; + lodash.prototype.constructor = lodash; + + LodashWrapper.prototype = baseCreate(baseLodash.prototype); + LodashWrapper.prototype.constructor = LodashWrapper; + + /*------------------------------------------------------------------------*/ /** - * The base implementation of `wrapperValue` which returns the result of - * performing a sequence of actions on the unwrapped `value`, where each - * successive action is supplied the return value of the previous. + * Creates a lazy wrapper object which wraps `value` to enable lazy evaluation. * * @private - * @param {*} value The unwrapped value. - * @param {Array} actions Actions to perform to resolve the unwrapped value. - * @returns {*} Returns the resolved value. + * @constructor + * @param {*} value The value to wrap. */ - function baseWrapperValue(value, actions) { - var result = value; - if (result instanceof LazyWrapper) { - result = result.value(); - } - return arrayReduce(actions, function(result, action) { - return action.func.apply(action.thisArg, arrayPush([result], action.args)); - }, result); + function LazyWrapper(value) { + this.__wrapped__ = value; + this.__actions__ = []; + this.__dir__ = 1; + this.__filtered__ = false; + this.__iteratees__ = []; + this.__takeCount__ = MAX_ARRAY_LENGTH; + this.__views__ = []; } /** - * The base implementation of methods like `_.xor`, without support for - * iteratee shorthands, that accepts an array of arrays to inspect. + * Creates a clone of the lazy wrapper object. * * @private - * @param {Array} arrays The arrays to inspect. - * @param {Function} [iteratee] The iteratee invoked per element. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns the new array of values. + * @name clone + * @memberOf LazyWrapper + * @returns {Object} Returns the cloned `LazyWrapper` object. */ - function baseXor(arrays, iteratee, comparator) { - var length = arrays.length; - if (length < 2) { - return length ? baseUniq(arrays[0]) : []; - } - var index = -1, - result = Array(length); - - while (++index < length) { - var array = arrays[index], - othIndex = -1; - - while (++othIndex < length) { - if (othIndex != index) { - result[index] = baseDifference(result[index] || array, arrays[othIndex], iteratee, comparator); - } - } - } - return baseUniq(baseFlatten(result, 1), iteratee, comparator); + function lazyClone() { + var result = new LazyWrapper(this.__wrapped__); + result.__actions__ = copyArray(this.__actions__); + result.__dir__ = this.__dir__; + result.__filtered__ = this.__filtered__; + result.__iteratees__ = copyArray(this.__iteratees__); + result.__takeCount__ = this.__takeCount__; + result.__views__ = copyArray(this.__views__); + return result; } /** - * This base implementation of `_.zipObject` which assigns values using `assignFunc`. + * Reverses the direction of lazy iteration. * * @private - * @param {Array} props The property identifiers. - * @param {Array} values The property values. - * @param {Function} assignFunc The function to assign values. - * @returns {Object} Returns the new object. + * @name reverse + * @memberOf LazyWrapper + * @returns {Object} Returns the new reversed `LazyWrapper` object. */ - function baseZipObject(props, values, assignFunc) { - var index = -1, - length = props.length, - valsLength = values.length, - result = {}; - - while (++index < length) { - var value = index < valsLength ? values[index] : undefined; - assignFunc(result, props[index], value); + function lazyReverse() { + if (this.__filtered__) { + var result = new LazyWrapper(this); + result.__dir__ = -1; + result.__filtered__ = true; + } else { + result = this.clone(); + result.__dir__ *= -1; } return result; } /** - * Casts `value` to an empty array if it's not an array like object. + * Extracts the unwrapped value from its lazy wrapper. * * @private - * @param {*} value The value to inspect. - * @returns {Array|Object} Returns the cast array-like object. + * @name value + * @memberOf LazyWrapper + * @returns {*} Returns the unwrapped value. */ - function castArrayLikeObject(value) { - return isArrayLikeObject(value) ? value : []; - } + function lazyValue() { + var array = this.__wrapped__.value(), + dir = this.__dir__, + isArr = isArray(array), + isRight = dir < 0, + arrLength = isArr ? array.length : 0, + view = getView(0, arrLength, this.__views__), + start = view.start, + end = view.end, + length = end - start, + index = isRight ? end : (start - 1), + iteratees = this.__iteratees__, + iterLength = iteratees.length, + resIndex = 0, + takeCount = nativeMin(length, this.__takeCount__); - /** - * Casts `value` to `identity` if it's not a function. - * - * @private - * @param {*} value The value to inspect. - * @returns {Function} Returns cast function. - */ - function castFunction(value) { - return typeof value == 'function' ? value : identity; - } + if (!isArr || (!isRight && arrLength == length && takeCount == length)) { + return baseWrapperValue(array, this.__actions__); + } + var result = []; - /** - * Casts `value` to a path array if it's not one. - * - * @private - * @param {*} value The value to inspect. - * @param {Object} [object] The object to query keys on. - * @returns {Array} Returns the cast property path array. - */ - function castPath(value, object) { - if (isArray(value)) { - return value; + outer: + while (length-- && resIndex < takeCount) { + index += dir; + + var iterIndex = -1, + value = array[index]; + + while (++iterIndex < iterLength) { + var data = iteratees[iterIndex], + iteratee = data.iteratee, + type = data.type, + computed = iteratee(value); + + if (type == LAZY_MAP_FLAG) { + value = computed; + } else if (!computed) { + if (type == LAZY_FILTER_FLAG) { + continue outer; + } else { + break outer; + } + } + } + result[resIndex++] = value; } - return isKey(value, object) ? [value] : stringToPath(toString(value)); + return result; } + // Ensure `LazyWrapper` is an instance of `baseLodash`. + LazyWrapper.prototype = baseCreate(baseLodash.prototype); + LazyWrapper.prototype.constructor = LazyWrapper; + + /*------------------------------------------------------------------------*/ + /** - * A `baseRest` alias which can be replaced with `identity` by module - * replacement plugins. + * Creates a hash object. * * @private - * @type {Function} - * @param {Function} func The function to apply a rest parameter to. - * @returns {Function} Returns the new function. + * @constructor + * @param {Array} [entries] The key-value pairs to cache. */ - var castRest = baseRest; + function Hash(entries) { + var index = -1, + length = entries == null ? 0 : entries.length; + + this.clear(); + while (++index < length) { + var entry = entries[index]; + this.set(entry[0], entry[1]); + } + } /** - * Casts `array` to a slice if it's needed. + * Removes all key-value entries from the hash. * * @private - * @param {Array} array The array to inspect. - * @param {number} start The start position. - * @param {number} [end=array.length] The end position. - * @returns {Array} Returns the cast slice. + * @name clear + * @memberOf Hash */ - function castSlice(array, start, end) { - var length = array.length; - end = end === undefined ? length : end; - return (!start && end >= length) ? array : baseSlice(array, start, end); + function hashClear() { + this.__data__ = nativeCreate ? nativeCreate(null) : {}; + this.size = 0; } /** - * A simple wrapper around the global [`clearTimeout`](https://mdn.io/clearTimeout). + * Removes `key` and its value from the hash. * * @private - * @param {number|Object} id The timer id or timeout object of the timer to clear. + * @name delete + * @memberOf Hash + * @param {Object} hash The hash to modify. + * @param {string} key The key of the value to remove. + * @returns {boolean} Returns `true` if the entry was removed, else `false`. */ - var clearTimeout = ctxClearTimeout || function(id) { - return root.clearTimeout(id); - }; + function hashDelete(key) { + var result = this.has(key) && delete this.__data__[key]; + this.size -= result ? 1 : 0; + return result; + } /** - * Creates a clone of `buffer`. + * Gets the hash value for `key`. * * @private - * @param {Buffer} buffer The buffer to clone. - * @param {boolean} [isDeep] Specify a deep clone. - * @returns {Buffer} Returns the cloned buffer. + * @name get + * @memberOf Hash + * @param {string} key The key of the value to get. + * @returns {*} Returns the entry value. */ - function cloneBuffer(buffer, isDeep) { - if (isDeep) { - return buffer.slice(); + function hashGet(key) { + var data = this.__data__; + if (nativeCreate) { + var result = data[key]; + return result === HASH_UNDEFINED ? undefined : result; } - var length = buffer.length, - result = allocUnsafe ? allocUnsafe(length) : new buffer.constructor(length); - - buffer.copy(result); - return result; + return hasOwnProperty.call(data, key) ? data[key] : undefined; } /** - * Creates a clone of `arrayBuffer`. + * Checks if a hash value for `key` exists. * * @private - * @param {ArrayBuffer} arrayBuffer The array buffer to clone. - * @returns {ArrayBuffer} Returns the cloned array buffer. + * @name has + * @memberOf Hash + * @param {string} key The key of the entry to check. + * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. */ - function cloneArrayBuffer(arrayBuffer) { - var result = new arrayBuffer.constructor(arrayBuffer.byteLength); - new Uint8Array(result).set(new Uint8Array(arrayBuffer)); - return result; + function hashHas(key) { + var data = this.__data__; + return nativeCreate ? (data[key] !== undefined) : hasOwnProperty.call(data, key); } /** - * Creates a clone of `dataView`. + * Sets the hash `key` to `value`. * * @private - * @param {Object} dataView The data view to clone. - * @param {boolean} [isDeep] Specify a deep clone. - * @returns {Object} Returns the cloned data view. + * @name set + * @memberOf Hash + * @param {string} key The key of the value to set. + * @param {*} value The value to set. + * @returns {Object} Returns the hash instance. */ - function cloneDataView(dataView, isDeep) { - var buffer = isDeep ? cloneArrayBuffer(dataView.buffer) : dataView.buffer; - return new dataView.constructor(buffer, dataView.byteOffset, dataView.byteLength); + function hashSet(key, value) { + var data = this.__data__; + this.size += this.has(key) ? 0 : 1; + data[key] = (nativeCreate && value === undefined) ? HASH_UNDEFINED : value; + return this; } + // Add methods to `Hash`. + Hash.prototype.clear = hashClear; + Hash.prototype['delete'] = hashDelete; + Hash.prototype.get = hashGet; + Hash.prototype.has = hashHas; + Hash.prototype.set = hashSet; + + /*------------------------------------------------------------------------*/ + /** - * Creates a clone of `map`. + * Creates an list cache object. * * @private - * @param {Object} map The map to clone. - * @param {Function} cloneFunc The function to clone values. - * @param {boolean} [isDeep] Specify a deep clone. - * @returns {Object} Returns the cloned map. + * @constructor + * @param {Array} [entries] The key-value pairs to cache. */ - function cloneMap(map, isDeep, cloneFunc) { - var array = isDeep ? cloneFunc(mapToArray(map), CLONE_DEEP_FLAG) : mapToArray(map); - return arrayReduce(array, addMapEntry, new map.constructor); + function ListCache(entries) { + var index = -1, + length = entries == null ? 0 : entries.length; + + this.clear(); + while (++index < length) { + var entry = entries[index]; + this.set(entry[0], entry[1]); + } } /** - * Creates a clone of `regexp`. + * Removes all key-value entries from the list cache. * * @private - * @param {Object} regexp The regexp to clone. - * @returns {Object} Returns the cloned regexp. + * @name clear + * @memberOf ListCache */ - function cloneRegExp(regexp) { - var result = new regexp.constructor(regexp.source, reFlags.exec(regexp)); - result.lastIndex = regexp.lastIndex; - return result; + function listCacheClear() { + this.__data__ = []; + this.size = 0; } /** - * Creates a clone of `set`. + * Removes `key` and its value from the list cache. * * @private - * @param {Object} set The set to clone. - * @param {Function} cloneFunc The function to clone values. - * @param {boolean} [isDeep] Specify a deep clone. - * @returns {Object} Returns the cloned set. + * @name delete + * @memberOf ListCache + * @param {string} key The key of the value to remove. + * @returns {boolean} Returns `true` if the entry was removed, else `false`. */ - function cloneSet(set, isDeep, cloneFunc) { - var array = isDeep ? cloneFunc(setToArray(set), CLONE_DEEP_FLAG) : setToArray(set); - return arrayReduce(array, addSetEntry, new set.constructor); + function listCacheDelete(key) { + var data = this.__data__, + index = assocIndexOf(data, key); + + if (index < 0) { + return false; + } + var lastIndex = data.length - 1; + if (index == lastIndex) { + data.pop(); + } else { + splice.call(data, index, 1); + } + --this.size; + return true; } /** - * Creates a clone of the `symbol` object. + * Gets the list cache value for `key`. * * @private - * @param {Object} symbol The symbol object to clone. - * @returns {Object} Returns the cloned symbol object. + * @name get + * @memberOf ListCache + * @param {string} key The key of the value to get. + * @returns {*} Returns the entry value. */ - function cloneSymbol(symbol) { - return symbolValueOf ? Object(symbolValueOf.call(symbol)) : {}; + function listCacheGet(key) { + var data = this.__data__, + index = assocIndexOf(data, key); + + return index < 0 ? undefined : data[index][1]; } /** - * Creates a clone of `typedArray`. + * Checks if a list cache value for `key` exists. * * @private - * @param {Object} typedArray The typed array to clone. - * @param {boolean} [isDeep] Specify a deep clone. - * @returns {Object} Returns the cloned typed array. + * @name has + * @memberOf ListCache + * @param {string} key The key of the entry to check. + * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. */ - function cloneTypedArray(typedArray, isDeep) { - var buffer = isDeep ? cloneArrayBuffer(typedArray.buffer) : typedArray.buffer; - return new typedArray.constructor(buffer, typedArray.byteOffset, typedArray.length); + function listCacheHas(key) { + return assocIndexOf(this.__data__, key) > -1; } /** - * Compares values to sort them in ascending order. + * Sets the list cache `key` to `value`. * * @private - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @returns {number} Returns the sort order indicator for `value`. + * @name set + * @memberOf ListCache + * @param {string} key The key of the value to set. + * @param {*} value The value to set. + * @returns {Object} Returns the list cache instance. */ - function compareAscending(value, other) { - if (value !== other) { - var valIsDefined = value !== undefined, - valIsNull = value === null, - valIsReflexive = value === value, - valIsSymbol = isSymbol(value); - - var othIsDefined = other !== undefined, - othIsNull = other === null, - othIsReflexive = other === other, - othIsSymbol = isSymbol(other); + function listCacheSet(key, value) { + var data = this.__data__, + index = assocIndexOf(data, key); - if ((!othIsNull && !othIsSymbol && !valIsSymbol && value > other) || - (valIsSymbol && othIsDefined && othIsReflexive && !othIsNull && !othIsSymbol) || - (valIsNull && othIsDefined && othIsReflexive) || - (!valIsDefined && othIsReflexive) || - !valIsReflexive) { - return 1; - } - if ((!valIsNull && !valIsSymbol && !othIsSymbol && value < other) || - (othIsSymbol && valIsDefined && valIsReflexive && !valIsNull && !valIsSymbol) || - (othIsNull && valIsDefined && valIsReflexive) || - (!othIsDefined && valIsReflexive) || - !othIsReflexive) { - return -1; - } + if (index < 0) { + ++this.size; + data.push([key, value]); + } else { + data[index][1] = value; } - return 0; + return this; } + // Add methods to `ListCache`. + ListCache.prototype.clear = listCacheClear; + ListCache.prototype['delete'] = listCacheDelete; + ListCache.prototype.get = listCacheGet; + ListCache.prototype.has = listCacheHas; + ListCache.prototype.set = listCacheSet; + + /*------------------------------------------------------------------------*/ + /** - * Used by `_.orderBy` to compare multiple properties of a value to another - * and stable sort them. - * - * If `orders` is unspecified, all values are sorted in ascending order. Otherwise, - * specify an order of "desc" for descending or "asc" for ascending sort order - * of corresponding values. + * Creates a map cache object to store key-value pairs. * * @private - * @param {Object} object The object to compare. - * @param {Object} other The other object to compare. - * @param {boolean[]|string[]} orders The order to sort by for each property. - * @returns {number} Returns the sort order indicator for `object`. + * @constructor + * @param {Array} [entries] The key-value pairs to cache. */ - function compareMultiple(object, other, orders) { + function MapCache(entries) { var index = -1, - objCriteria = object.criteria, - othCriteria = other.criteria, - length = objCriteria.length, - ordersLength = orders.length; + length = entries == null ? 0 : entries.length; + this.clear(); while (++index < length) { - var result = compareAscending(objCriteria[index], othCriteria[index]); - if (result) { - if (index >= ordersLength) { - return result; - } - var order = orders[index]; - return result * (order == 'desc' ? -1 : 1); - } + var entry = entries[index]; + this.set(entry[0], entry[1]); } - // Fixes an `Array#sort` bug in the JS engine embedded in Adobe applications - // that causes it, under certain circumstances, to provide the same value for - // `object` and `other`. See https://github.com/jashkenas/underscore/pull/1247 - // for more details. - // - // This also ensures a stable sort in V8 and other engines. - // See https://bugs.chromium.org/p/v8/issues/detail?id=90 for more details. - return object.index - other.index; } /** - * Creates an array that is the composition of partially applied arguments, - * placeholders, and provided arguments into a single array of arguments. + * Removes all key-value entries from the map. * * @private - * @param {Array} args The provided arguments. - * @param {Array} partials The arguments to prepend to those provided. - * @param {Array} holders The `partials` placeholder indexes. - * @params {boolean} [isCurried] Specify composing for a curried function. - * @returns {Array} Returns the new array of composed arguments. + * @name clear + * @memberOf MapCache */ - function composeArgs(args, partials, holders, isCurried) { - var argsIndex = -1, - argsLength = args.length, - holdersLength = holders.length, - leftIndex = -1, - leftLength = partials.length, - rangeLength = nativeMax(argsLength - holdersLength, 0), - result = Array(leftLength + rangeLength), - isUncurried = !isCurried; - - while (++leftIndex < leftLength) { - result[leftIndex] = partials[leftIndex]; - } - while (++argsIndex < holdersLength) { - if (isUncurried || argsIndex < argsLength) { - result[holders[argsIndex]] = args[argsIndex]; - } - } - while (rangeLength--) { - result[leftIndex++] = args[argsIndex++]; - } - return result; + function mapCacheClear() { + this.size = 0; + this.__data__ = { + 'hash': new Hash, + 'map': new (Map || ListCache), + 'string': new Hash + }; } /** - * This function is like `composeArgs` except that the arguments composition - * is tailored for `_.partialRight`. + * Removes `key` and its value from the map. * * @private - * @param {Array} args The provided arguments. - * @param {Array} partials The arguments to append to those provided. - * @param {Array} holders The `partials` placeholder indexes. - * @params {boolean} [isCurried] Specify composing for a curried function. - * @returns {Array} Returns the new array of composed arguments. + * @name delete + * @memberOf MapCache + * @param {string} key The key of the value to remove. + * @returns {boolean} Returns `true` if the entry was removed, else `false`. */ - function composeArgsRight(args, partials, holders, isCurried) { - var argsIndex = -1, - argsLength = args.length, - holdersIndex = -1, - holdersLength = holders.length, - rightIndex = -1, - rightLength = partials.length, - rangeLength = nativeMax(argsLength - holdersLength, 0), - result = Array(rangeLength + rightLength), - isUncurried = !isCurried; - - while (++argsIndex < rangeLength) { - result[argsIndex] = args[argsIndex]; - } - var offset = argsIndex; - while (++rightIndex < rightLength) { - result[offset + rightIndex] = partials[rightIndex]; - } - while (++holdersIndex < holdersLength) { - if (isUncurried || argsIndex < argsLength) { - result[offset + holders[holdersIndex]] = args[argsIndex++]; - } - } + function mapCacheDelete(key) { + var result = getMapData(this, key)['delete'](key); + this.size -= result ? 1 : 0; return result; } /** - * Copies the values of `source` to `array`. + * Gets the map value for `key`. * * @private - * @param {Array} source The array to copy values from. - * @param {Array} [array=[]] The array to copy values to. - * @returns {Array} Returns `array`. + * @name get + * @memberOf MapCache + * @param {string} key The key of the value to get. + * @returns {*} Returns the entry value. */ - function copyArray(source, array) { - var index = -1, - length = source.length; - - array || (array = Array(length)); - while (++index < length) { - array[index] = source[index]; - } - return array; + function mapCacheGet(key) { + return getMapData(this, key).get(key); } /** - * Copies properties of `source` to `object`. + * Checks if a map value for `key` exists. * * @private - * @param {Object} source The object to copy properties from. - * @param {Array} props The property identifiers to copy. - * @param {Object} [object={}] The object to copy properties to. - * @param {Function} [customizer] The function to customize copied values. - * @returns {Object} Returns `object`. + * @name has + * @memberOf MapCache + * @param {string} key The key of the entry to check. + * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. */ - function copyObject(source, props, object, customizer) { - var isNew = !object; - object || (object = {}); - - var index = -1, - length = props.length; - - while (++index < length) { - var key = props[index]; - - var newValue = customizer - ? customizer(object[key], source[key], key, object, source) - : undefined; - - if (newValue === undefined) { - newValue = source[key]; - } - if (isNew) { - baseAssignValue(object, key, newValue); - } else { - assignValue(object, key, newValue); - } - } - return object; + function mapCacheHas(key) { + return getMapData(this, key).has(key); } /** - * Copies own symbols of `source` to `object`. + * Sets the map `key` to `value`. * * @private - * @param {Object} source The object to copy symbols from. - * @param {Object} [object={}] The object to copy symbols to. - * @returns {Object} Returns `object`. + * @name set + * @memberOf MapCache + * @param {string} key The key of the value to set. + * @param {*} value The value to set. + * @returns {Object} Returns the map cache instance. */ - function copySymbols(source, object) { - return copyObject(source, getSymbols(source), object); + function mapCacheSet(key, value) { + var data = getMapData(this, key), + size = data.size; + + data.set(key, value); + this.size += data.size == size ? 0 : 1; + return this; } + // Add methods to `MapCache`. + MapCache.prototype.clear = mapCacheClear; + MapCache.prototype['delete'] = mapCacheDelete; + MapCache.prototype.get = mapCacheGet; + MapCache.prototype.has = mapCacheHas; + MapCache.prototype.set = mapCacheSet; + + /*------------------------------------------------------------------------*/ + /** - * Copies own and inherited symbols of `source` to `object`. + * + * Creates an array cache object to store unique values. * * @private - * @param {Object} source The object to copy symbols from. - * @param {Object} [object={}] The object to copy symbols to. - * @returns {Object} Returns `object`. + * @constructor + * @param {Array} [values] The values to cache. */ - function copySymbolsIn(source, object) { - return copyObject(source, getSymbolsIn(source), object); + function SetCache(values) { + var index = -1, + length = values == null ? 0 : values.length; + + this.__data__ = new MapCache; + while (++index < length) { + this.add(values[index]); + } } /** - * Creates a function like `_.groupBy`. + * Adds `value` to the array cache. * * @private - * @param {Function} setter The function to set accumulator values. - * @param {Function} [initializer] The accumulator object initializer. - * @returns {Function} Returns the new aggregator function. + * @name add + * @memberOf SetCache + * @alias push + * @param {*} value The value to cache. + * @returns {Object} Returns the cache instance. */ - function createAggregator(setter, initializer) { - return function(collection, iteratee) { - var func = isArray(collection) ? arrayAggregator : baseAggregator, - accumulator = initializer ? initializer() : {}; - - return func(collection, setter, getIteratee(iteratee, 2), accumulator); - }; + function setCacheAdd(value) { + this.__data__.set(value, HASH_UNDEFINED); + return this; } /** - * Creates a function like `_.assign`. + * Checks if `value` is in the array cache. * * @private - * @param {Function} assigner The function to assign values. - * @returns {Function} Returns the new assigner function. + * @name has + * @memberOf SetCache + * @param {*} value The value to search for. + * @returns {number} Returns `true` if `value` is found, else `false`. */ - function createAssigner(assigner) { - return baseRest(function(object, sources) { - var index = -1, - length = sources.length, - customizer = length > 1 ? sources[length - 1] : undefined, - guard = length > 2 ? sources[2] : undefined; + function setCacheHas(value) { + return this.__data__.has(value); + } - customizer = (assigner.length > 3 && typeof customizer == 'function') - ? (length--, customizer) - : undefined; + // Add methods to `SetCache`. + SetCache.prototype.add = SetCache.prototype.push = setCacheAdd; + SetCache.prototype.has = setCacheHas; - if (guard && isIterateeCall(sources[0], sources[1], guard)) { - customizer = length < 3 ? undefined : customizer; - length = 1; - } - object = Object(object); - while (++index < length) { - var source = sources[index]; - if (source) { - assigner(object, source, index, customizer); - } - } - return object; - }); - } + /*------------------------------------------------------------------------*/ /** - * Creates a `baseEach` or `baseEachRight` function. + * Creates a stack cache object to store key-value pairs. * * @private - * @param {Function} eachFunc The function to iterate over a collection. - * @param {boolean} [fromRight] Specify iterating from right to left. - * @returns {Function} Returns the new base function. + * @constructor + * @param {Array} [entries] The key-value pairs to cache. */ - function createBaseEach(eachFunc, fromRight) { - return function(collection, iteratee) { - if (collection == null) { - return collection; - } - if (!isArrayLike(collection)) { - return eachFunc(collection, iteratee); - } - var length = collection.length, - index = fromRight ? length : -1, - iterable = Object(collection); - - while ((fromRight ? index-- : ++index < length)) { - if (iteratee(iterable[index], index, iterable) === false) { - break; - } - } - return collection; - }; + function Stack(entries) { + var data = this.__data__ = new ListCache(entries); + this.size = data.size; } /** - * Creates a base function for methods like `_.forIn` and `_.forOwn`. + * Removes all key-value entries from the stack. * * @private - * @param {boolean} [fromRight] Specify iterating from right to left. - * @returns {Function} Returns the new base function. + * @name clear + * @memberOf Stack */ - function createBaseFor(fromRight) { - return function(object, iteratee, keysFunc) { - var index = -1, - iterable = Object(object), - props = keysFunc(object), - length = props.length; - - while (length--) { - var key = props[fromRight ? length : ++index]; - if (iteratee(iterable[key], key, iterable) === false) { - break; - } - } - return object; - }; + function stackClear() { + this.__data__ = new ListCache; + this.size = 0; } /** - * Creates a function that wraps `func` to invoke it with the optional `this` - * binding of `thisArg`. + * Removes `key` and its value from the stack. * * @private - * @param {Function} func The function to wrap. - * @param {number} bitmask The bitmask flags. See `createWrap` for more details. - * @param {*} [thisArg] The `this` binding of `func`. - * @returns {Function} Returns the new wrapped function. + * @name delete + * @memberOf Stack + * @param {string} key The key of the value to remove. + * @returns {boolean} Returns `true` if the entry was removed, else `false`. */ - function createBind(func, bitmask, thisArg) { - var isBind = bitmask & WRAP_BIND_FLAG, - Ctor = createCtor(func); + function stackDelete(key) { + var data = this.__data__, + result = data['delete'](key); - function wrapper() { - var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func; - return fn.apply(isBind ? thisArg : this, arguments); - } - return wrapper; + this.size = data.size; + return result; } /** - * Creates a function like `_.lowerFirst`. + * Gets the stack value for `key`. * * @private - * @param {string} methodName The name of the `String` case method to use. - * @returns {Function} Returns the new case function. + * @name get + * @memberOf Stack + * @param {string} key The key of the value to get. + * @returns {*} Returns the entry value. */ - function createCaseFirst(methodName) { - return function(string) { - string = toString(string); - - var strSymbols = hasUnicode(string) - ? stringToArray(string) - : undefined; - - var chr = strSymbols - ? strSymbols[0] - : string.charAt(0); - - var trailing = strSymbols - ? castSlice(strSymbols, 1).join('') - : string.slice(1); - - return chr[methodName]() + trailing; - }; + function stackGet(key) { + return this.__data__.get(key); } /** - * Creates a function like `_.camelCase`. + * Checks if a stack value for `key` exists. * * @private - * @param {Function} callback The function to combine each word. - * @returns {Function} Returns the new compounder function. + * @name has + * @memberOf Stack + * @param {string} key The key of the entry to check. + * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. */ - function createCompounder(callback) { - return function(string) { - return arrayReduce(words(deburr(string).replace(reApos, '')), callback, ''); - }; + function stackHas(key) { + return this.__data__.has(key); } /** - * Creates a function that produces an instance of `Ctor` regardless of - * whether it was invoked as part of a `new` expression or by `call` or `apply`. + * Sets the stack `key` to `value`. * * @private - * @param {Function} Ctor The constructor to wrap. - * @returns {Function} Returns the new wrapped function. + * @name set + * @memberOf Stack + * @param {string} key The key of the value to set. + * @param {*} value The value to set. + * @returns {Object} Returns the stack cache instance. */ - function createCtor(Ctor) { - return function() { - // Use a `switch` statement to work with class constructors. See - // http://ecma-international.org/ecma-262/7.0/#sec-ecmascript-function-objects-call-thisargument-argumentslist - // for more details. - var args = arguments; - switch (args.length) { - case 0: return new Ctor; - case 1: return new Ctor(args[0]); - case 2: return new Ctor(args[0], args[1]); - case 3: return new Ctor(args[0], args[1], args[2]); - case 4: return new Ctor(args[0], args[1], args[2], args[3]); - case 5: return new Ctor(args[0], args[1], args[2], args[3], args[4]); - case 6: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5]); - case 7: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5], args[6]); + function stackSet(key, value) { + var data = this.__data__; + if (data instanceof ListCache) { + var pairs = data.__data__; + if (!Map || (pairs.length < LARGE_ARRAY_SIZE - 1)) { + pairs.push([key, value]); + this.size = ++data.size; + return this; } - var thisBinding = baseCreate(Ctor.prototype), - result = Ctor.apply(thisBinding, args); - - // Mimic the constructor's `return` behavior. - // See https://es5.github.io/#x13.2.2 for more details. - return isObject(result) ? result : thisBinding; - }; + data = this.__data__ = new MapCache(pairs); + } + data.set(key, value); + this.size = data.size; + return this; } + // Add methods to `Stack`. + Stack.prototype.clear = stackClear; + Stack.prototype['delete'] = stackDelete; + Stack.prototype.get = stackGet; + Stack.prototype.has = stackHas; + Stack.prototype.set = stackSet; + + /*------------------------------------------------------------------------*/ + /** - * Creates a function that wraps `func` to enable currying. + * Creates an array of the enumerable property names of the array-like `value`. * * @private - * @param {Function} func The function to wrap. - * @param {number} bitmask The bitmask flags. See `createWrap` for more details. - * @param {number} arity The arity of `func`. - * @returns {Function} Returns the new wrapped function. + * @param {*} value The value to query. + * @param {boolean} inherited Specify returning inherited property names. + * @returns {Array} Returns the array of property names. */ - function createCurry(func, bitmask, arity) { - var Ctor = createCtor(func); - - function wrapper() { - var length = arguments.length, - args = Array(length), - index = length, - placeholder = getHolder(wrapper); - - while (index--) { - args[index] = arguments[index]; - } - var holders = (length < 3 && args[0] !== placeholder && args[length - 1] !== placeholder) - ? [] - : replaceHolders(args, placeholder); + function arrayLikeKeys(value, inherited) { + var isArr = isArray(value), + isArg = !isArr && isArguments(value), + isBuff = !isArr && !isArg && isBuffer(value), + isType = !isArr && !isArg && !isBuff && isTypedArray(value), + skipIndexes = isArr || isArg || isBuff || isType, + result = skipIndexes ? baseTimes(value.length, String) : [], + length = result.length; - length -= holders.length; - if (length < arity) { - return createRecurry( - func, bitmask, createHybrid, wrapper.placeholder, undefined, - args, holders, undefined, undefined, arity - length); + for (var key in value) { + if ((inherited || hasOwnProperty.call(value, key)) && + !(skipIndexes && ( + // Safari 9 has enumerable `arguments.length` in strict mode. + key == 'length' || + // Node.js 0.10 has enumerable non-index properties on buffers. + (isBuff && (key == 'offset' || key == 'parent')) || + // PhantomJS 2 has enumerable non-index properties on typed arrays. + (isType && (key == 'buffer' || key == 'byteLength' || key == 'byteOffset')) || + // Skip index properties. + isIndex(key, length) + ))) { + result.push(key); } - var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func; - return apply(fn, this, args); } - return wrapper; + return result; } /** - * Creates a `_.find` or `_.findLast` function. + * A specialized version of `_.sample` for arrays. * * @private - * @param {Function} findIndexFunc The function to find the collection index. - * @returns {Function} Returns the new find function. + * @param {Array} array The array to sample. + * @returns {*} Returns the random element. */ - function createFind(findIndexFunc) { - return function(collection, predicate, fromIndex) { - var iterable = Object(collection); - if (!isArrayLike(collection)) { - var iteratee = getIteratee(predicate, 3); - collection = keys(collection); - predicate = function(key) { return iteratee(iterable[key], key, iterable); }; - } - var index = findIndexFunc(collection, predicate, fromIndex); - return index > -1 ? iterable[iteratee ? collection[index] : index] : undefined; - }; + function arraySample(array) { + var length = array.length; + return length ? array[baseRandom(0, length - 1)] : undefined; } /** - * Creates a `_.flow` or `_.flowRight` function. + * A specialized version of `_.sampleSize` for arrays. * * @private - * @param {boolean} [fromRight] Specify iterating from right to left. - * @returns {Function} Returns the new flow function. + * @param {Array} array The array to sample. + * @param {number} n The number of elements to sample. + * @returns {Array} Returns the random elements. */ - function createFlow(fromRight) { - return flatRest(function(funcs) { - var length = funcs.length, - index = length, - prereq = LodashWrapper.prototype.thru; - - if (fromRight) { - funcs.reverse(); - } - while (index--) { - var func = funcs[index]; - if (typeof func != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); - } - if (prereq && !wrapper && getFuncName(func) == 'wrapper') { - var wrapper = new LodashWrapper([], true); - } - } - index = wrapper ? index : length; - while (++index < length) { - func = funcs[index]; - - var funcName = getFuncName(func), - data = funcName == 'wrapper' ? getData(func) : undefined; - - if (data && isLaziable(data[0]) && - data[1] == (WRAP_ARY_FLAG | WRAP_CURRY_FLAG | WRAP_PARTIAL_FLAG | WRAP_REARG_FLAG) && - !data[4].length && data[9] == 1 - ) { - wrapper = wrapper[getFuncName(data[0])].apply(wrapper, data[3]); - } else { - wrapper = (func.length == 1 && isLaziable(func)) - ? wrapper[funcName]() - : wrapper.thru(func); - } - } - return function() { - var args = arguments, - value = args[0]; - - if (wrapper && args.length == 1 && isArray(value)) { - return wrapper.plant(value).value(); - } - var index = 0, - result = length ? funcs[index].apply(this, args) : value; - - while (++index < length) { - result = funcs[index].call(this, result); - } - return result; - }; - }); + function arraySampleSize(array, n) { + return shuffleSelf(copyArray(array), baseClamp(n, 0, array.length)); } /** - * Creates a function that wraps `func` to invoke it with optional `this` - * binding of `thisArg`, partial application, and currying. + * A specialized version of `_.shuffle` for arrays. * * @private - * @param {Function|string} func The function or method name to wrap. - * @param {number} bitmask The bitmask flags. See `createWrap` for more details. - * @param {*} [thisArg] The `this` binding of `func`. - * @param {Array} [partials] The arguments to prepend to those provided to - * the new function. - * @param {Array} [holders] The `partials` placeholder indexes. - * @param {Array} [partialsRight] The arguments to append to those provided - * to the new function. - * @param {Array} [holdersRight] The `partialsRight` placeholder indexes. - * @param {Array} [argPos] The argument positions of the new function. - * @param {number} [ary] The arity cap of `func`. - * @param {number} [arity] The arity of `func`. - * @returns {Function} Returns the new wrapped function. + * @param {Array} array The array to shuffle. + * @returns {Array} Returns the new shuffled array. */ - function createHybrid(func, bitmask, thisArg, partials, holders, partialsRight, holdersRight, argPos, ary, arity) { - var isAry = bitmask & WRAP_ARY_FLAG, - isBind = bitmask & WRAP_BIND_FLAG, - isBindKey = bitmask & WRAP_BIND_KEY_FLAG, - isCurried = bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG), - isFlip = bitmask & WRAP_FLIP_FLAG, - Ctor = isBindKey ? undefined : createCtor(func); - - function wrapper() { - var length = arguments.length, - args = Array(length), - index = length; - - while (index--) { - args[index] = arguments[index]; - } - if (isCurried) { - var placeholder = getHolder(wrapper), - holdersCount = countHolders(args, placeholder); - } - if (partials) { - args = composeArgs(args, partials, holders, isCurried); - } - if (partialsRight) { - args = composeArgsRight(args, partialsRight, holdersRight, isCurried); - } - length -= holdersCount; - if (isCurried && length < arity) { - var newHolders = replaceHolders(args, placeholder); - return createRecurry( - func, bitmask, createHybrid, wrapper.placeholder, thisArg, - args, newHolders, argPos, ary, arity - length - ); - } - var thisBinding = isBind ? thisArg : this, - fn = isBindKey ? thisBinding[func] : func; - - length = args.length; - if (argPos) { - args = reorder(args, argPos); - } else if (isFlip && length > 1) { - args.reverse(); - } - if (isAry && ary < length) { - args.length = ary; - } - if (this && this !== root && this instanceof wrapper) { - fn = Ctor || createCtor(fn); - } - return fn.apply(thisBinding, args); - } - return wrapper; + function arrayShuffle(array) { + return shuffleSelf(copyArray(array)); } /** - * Creates a function like `_.invertBy`. + * This function is like `assignValue` except that it doesn't assign + * `undefined` values. * * @private - * @param {Function} setter The function to set accumulator values. - * @param {Function} toIteratee The function to resolve iteratees. - * @returns {Function} Returns the new inverter function. + * @param {Object} object The object to modify. + * @param {string} key The key of the property to assign. + * @param {*} value The value to assign. */ - function createInverter(setter, toIteratee) { - return function(object, iteratee) { - return baseInverter(object, setter, toIteratee(iteratee), {}); - }; + function assignMergeValue(object, key, value) { + if ((value !== undefined && !eq(object[key], value)) || + (value === undefined && !(key in object))) { + baseAssignValue(object, key, value); + } } /** - * Creates a function that performs a mathematical operation on two values. + * Assigns `value` to `key` of `object` if the existing value is not equivalent + * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons. * * @private - * @param {Function} operator The function to perform the operation. - * @param {number} [defaultValue] The value used for `undefined` arguments. - * @returns {Function} Returns the new mathematical operation function. + * @param {Object} object The object to modify. + * @param {string} key The key of the property to assign. + * @param {*} value The value to assign. */ - function createMathOperation(operator, defaultValue) { - return function(value, other) { - var result; - if (value === undefined && other === undefined) { - return defaultValue; - } - if (value !== undefined) { - result = value; - } - if (other !== undefined) { - if (result === undefined) { - return other; - } - if (typeof value == 'string' || typeof other == 'string') { - value = baseToString(value); - other = baseToString(other); - } else { - value = baseToNumber(value); - other = baseToNumber(other); - } - result = operator(value, other); - } - return result; - }; - } - - /** - * Creates a function like `_.over`. - * - * @private - * @param {Function} arrayFunc The function to iterate over iteratees. - * @returns {Function} Returns the new over function. - */ - function createOver(arrayFunc) { - return flatRest(function(iteratees) { - iteratees = arrayMap(iteratees, baseUnary(getIteratee())); - return baseRest(function(args) { - var thisArg = this; - return arrayFunc(iteratees, function(iteratee) { - return apply(iteratee, thisArg, args); - }); - }); - }); + function assignValue(object, key, value) { + var objValue = object[key]; + if (!(hasOwnProperty.call(object, key) && eq(objValue, value)) || + (value === undefined && !(key in object))) { + baseAssignValue(object, key, value); + } } /** - * Creates the padding for `string` based on `length`. The `chars` string - * is truncated if the number of characters exceeds `length`. + * Gets the index at which the `key` is found in `array` of key-value pairs. * * @private - * @param {number} length The padding length. - * @param {string} [chars=' '] The string used as padding. - * @returns {string} Returns the padding for `string`. + * @param {Array} array The array to inspect. + * @param {*} key The key to search for. + * @returns {number} Returns the index of the matched value, else `-1`. */ - function createPadding(length, chars) { - chars = chars === undefined ? ' ' : baseToString(chars); - - var charsLength = chars.length; - if (charsLength < 2) { - return charsLength ? baseRepeat(chars, length) : chars; + function assocIndexOf(array, key) { + var length = array.length; + while (length--) { + if (eq(array[length][0], key)) { + return length; + } } - var result = baseRepeat(chars, nativeCeil(length / stringSize(chars))); - return hasUnicode(chars) - ? castSlice(stringToArray(result), 0, length).join('') - : result.slice(0, length); + return -1; } /** - * Creates a function that wraps `func` to invoke it with the `this` binding - * of `thisArg` and `partials` prepended to the arguments it receives. + * Aggregates elements of `collection` on `accumulator` with keys transformed + * by `iteratee` and values set by `setter`. * * @private - * @param {Function} func The function to wrap. - * @param {number} bitmask The bitmask flags. See `createWrap` for more details. - * @param {*} thisArg The `this` binding of `func`. - * @param {Array} partials The arguments to prepend to those provided to - * the new function. - * @returns {Function} Returns the new wrapped function. + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} setter The function to set `accumulator` values. + * @param {Function} iteratee The iteratee to transform keys. + * @param {Object} accumulator The initial aggregated object. + * @returns {Function} Returns `accumulator`. */ - function createPartial(func, bitmask, thisArg, partials) { - var isBind = bitmask & WRAP_BIND_FLAG, - Ctor = createCtor(func); - - function wrapper() { - var argsIndex = -1, - argsLength = arguments.length, - leftIndex = -1, - leftLength = partials.length, - args = Array(leftLength + argsLength), - fn = (this && this !== root && this instanceof wrapper) ? Ctor : func; - - while (++leftIndex < leftLength) { - args[leftIndex] = partials[leftIndex]; - } - while (argsLength--) { - args[leftIndex++] = arguments[++argsIndex]; - } - return apply(fn, isBind ? thisArg : this, args); - } - return wrapper; + function baseAggregator(collection, setter, iteratee, accumulator) { + baseEach(collection, function(value, key, collection) { + setter(accumulator, value, iteratee(value), collection); + }); + return accumulator; } /** - * Creates a `_.range` or `_.rangeRight` function. + * The base implementation of `_.assign` without support for multiple sources + * or `customizer` functions. * * @private - * @param {boolean} [fromRight] Specify iterating from right to left. - * @returns {Function} Returns the new range function. + * @param {Object} object The destination object. + * @param {Object} source The source object. + * @returns {Object} Returns `object`. */ - function createRange(fromRight) { - return function(start, end, step) { - if (step && typeof step != 'number' && isIterateeCall(start, end, step)) { - end = step = undefined; - } - // Ensure the sign of `-0` is preserved. - start = toFinite(start); - if (end === undefined) { - end = start; - start = 0; - } else { - end = toFinite(end); - } - step = step === undefined ? (start < end ? 1 : -1) : toFinite(step); - return baseRange(start, end, step, fromRight); - }; + function baseAssign(object, source) { + return object && copyObject(source, keys(source), object); } /** - * Creates a function that performs a relational operation on two values. + * The base implementation of `_.assignIn` without support for multiple sources + * or `customizer` functions. * * @private - * @param {Function} operator The function to perform the operation. - * @returns {Function} Returns the new relational operation function. + * @param {Object} object The destination object. + * @param {Object} source The source object. + * @returns {Object} Returns `object`. */ - function createRelationalOperation(operator) { - return function(value, other) { - if (!(typeof value == 'string' && typeof other == 'string')) { - value = toNumber(value); - other = toNumber(other); - } - return operator(value, other); - }; + function baseAssignIn(object, source) { + return object && copyObject(source, keysIn(source), object); } /** - * Creates a function that wraps `func` to continue currying. + * The base implementation of `assignValue` and `assignMergeValue` without + * value checks. * * @private - * @param {Function} func The function to wrap. - * @param {number} bitmask The bitmask flags. See `createWrap` for more details. - * @param {Function} wrapFunc The function to create the `func` wrapper. - * @param {*} placeholder The placeholder value. - * @param {*} [thisArg] The `this` binding of `func`. - * @param {Array} [partials] The arguments to prepend to those provided to - * the new function. - * @param {Array} [holders] The `partials` placeholder indexes. - * @param {Array} [argPos] The argument positions of the new function. - * @param {number} [ary] The arity cap of `func`. - * @param {number} [arity] The arity of `func`. - * @returns {Function} Returns the new wrapped function. + * @param {Object} object The object to modify. + * @param {string} key The key of the property to assign. + * @param {*} value The value to assign. */ - function createRecurry(func, bitmask, wrapFunc, placeholder, thisArg, partials, holders, argPos, ary, arity) { - var isCurry = bitmask & WRAP_CURRY_FLAG, - newHolders = isCurry ? holders : undefined, - newHoldersRight = isCurry ? undefined : holders, - newPartials = isCurry ? partials : undefined, - newPartialsRight = isCurry ? undefined : partials; - - bitmask |= (isCurry ? WRAP_PARTIAL_FLAG : WRAP_PARTIAL_RIGHT_FLAG); - bitmask &= ~(isCurry ? WRAP_PARTIAL_RIGHT_FLAG : WRAP_PARTIAL_FLAG); - - if (!(bitmask & WRAP_CURRY_BOUND_FLAG)) { - bitmask &= ~(WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG); - } - var newData = [ - func, bitmask, thisArg, newPartials, newHolders, newPartialsRight, - newHoldersRight, argPos, ary, arity - ]; - - var result = wrapFunc.apply(undefined, newData); - if (isLaziable(func)) { - setData(result, newData); + function baseAssignValue(object, key, value) { + if (key == '__proto__' && defineProperty) { + defineProperty(object, key, { + 'configurable': true, + 'enumerable': true, + 'value': value, + 'writable': true + }); + } else { + object[key] = value; } - result.placeholder = placeholder; - return setWrapToString(result, func, bitmask); } /** - * Creates a function like `_.round`. + * The base implementation of `_.at` without support for individual paths. * * @private - * @param {string} methodName The name of the `Math` method to use when rounding. - * @returns {Function} Returns the new round function. + * @param {Object} object The object to iterate over. + * @param {string[]} paths The property paths to pick. + * @returns {Array} Returns the picked elements. */ - function createRound(methodName) { - var func = Math[methodName]; - return function(number, precision) { - number = toNumber(number); - precision = precision == null ? 0 : nativeMin(toInteger(precision), 292); - if (precision) { - // Shift with exponential notation to avoid floating-point issues. - // See [MDN](https://mdn.io/round#Examples) for more details. - var pair = (toString(number) + 'e').split('e'), - value = func(pair[0] + 'e' + (+pair[1] + precision)); + function baseAt(object, paths) { + var index = -1, + length = paths.length, + result = Array(length), + skip = object == null; - pair = (toString(value) + 'e').split('e'); - return +(pair[0] + 'e' + (+pair[1] - precision)); - } - return func(number); - }; + while (++index < length) { + result[index] = skip ? undefined : get(object, paths[index]); + } + return result; } /** - * Creates a set object of `values`. - * - * @private - * @param {Array} values The values to add to the set. - * @returns {Object} Returns the new set. - */ - var createSet = !(Set && (1 / setToArray(new Set([,-0]))[1]) == INFINITY) ? noop : function(values) { - return new Set(values); - }; - - /** - * Creates a `_.toPairs` or `_.toPairsIn` function. + * The base implementation of `_.clamp` which doesn't coerce arguments. * * @private - * @param {Function} keysFunc The function to get the keys of a given object. - * @returns {Function} Returns the new pairs function. + * @param {number} number The number to clamp. + * @param {number} [lower] The lower bound. + * @param {number} upper The upper bound. + * @returns {number} Returns the clamped number. */ - function createToPairs(keysFunc) { - return function(object) { - var tag = getTag(object); - if (tag == mapTag) { - return mapToArray(object); + function baseClamp(number, lower, upper) { + if (number === number) { + if (upper !== undefined) { + number = number <= upper ? number : upper; } - if (tag == setTag) { - return setToPairs(object); + if (lower !== undefined) { + number = number >= lower ? number : lower; } - return baseToPairs(object, keysFunc(object)); - }; + } + return number; } /** - * Creates a function that either curries or invokes `func` with optional - * `this` binding and partially applied arguments. + * The base implementation of `_.clone` and `_.cloneDeep` which tracks + * traversed objects. * * @private - * @param {Function|string} func The function or method name to wrap. - * @param {number} bitmask The bitmask flags. - * 1 - `_.bind` - * 2 - `_.bindKey` - * 4 - `_.curry` or `_.curryRight` of a bound function - * 8 - `_.curry` - * 16 - `_.curryRight` - * 32 - `_.partial` - * 64 - `_.partialRight` - * 128 - `_.rearg` - * 256 - `_.ary` - * 512 - `_.flip` - * @param {*} [thisArg] The `this` binding of `func`. - * @param {Array} [partials] The arguments to be partially applied. - * @param {Array} [holders] The `partials` placeholder indexes. - * @param {Array} [argPos] The argument positions of the new function. - * @param {number} [ary] The arity cap of `func`. - * @param {number} [arity] The arity of `func`. - * @returns {Function} Returns the new wrapped function. + * @param {*} value The value to clone. + * @param {boolean} bitmask The bitmask flags. + * 1 - Deep clone + * 2 - Flatten inherited properties + * 4 - Clone symbols + * @param {Function} [customizer] The function to customize cloning. + * @param {string} [key] The key of `value`. + * @param {Object} [object] The parent object of `value`. + * @param {Object} [stack] Tracks traversed objects and their clone counterparts. + * @returns {*} Returns the cloned value. */ - function createWrap(func, bitmask, thisArg, partials, holders, argPos, ary, arity) { - var isBindKey = bitmask & WRAP_BIND_KEY_FLAG; - if (!isBindKey && typeof func != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); - } - var length = partials ? partials.length : 0; - if (!length) { - bitmask &= ~(WRAP_PARTIAL_FLAG | WRAP_PARTIAL_RIGHT_FLAG); - partials = holders = undefined; - } - ary = ary === undefined ? ary : nativeMax(toInteger(ary), 0); - arity = arity === undefined ? arity : toInteger(arity); - length -= holders ? holders.length : 0; - - if (bitmask & WRAP_PARTIAL_RIGHT_FLAG) { - var partialsRight = partials, - holdersRight = holders; + function baseClone(value, bitmask, customizer, key, object, stack) { + var result, + isDeep = bitmask & CLONE_DEEP_FLAG, + isFlat = bitmask & CLONE_FLAT_FLAG, + isFull = bitmask & CLONE_SYMBOLS_FLAG; - partials = holders = undefined; + if (customizer) { + result = object ? customizer(value, key, object, stack) : customizer(value); } - var data = isBindKey ? undefined : getData(func); - - var newData = [ - func, bitmask, thisArg, partials, holders, partialsRight, holdersRight, - argPos, ary, arity - ]; - - if (data) { - mergeData(newData, data); + if (result !== undefined) { + return result; } - func = newData[0]; - bitmask = newData[1]; - thisArg = newData[2]; - partials = newData[3]; - holders = newData[4]; - arity = newData[9] = newData[9] === undefined - ? (isBindKey ? 0 : func.length) - : nativeMax(newData[9] - length, 0); - - if (!arity && bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG)) { - bitmask &= ~(WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG); + if (!isObject(value)) { + return value; } - if (!bitmask || bitmask == WRAP_BIND_FLAG) { - var result = createBind(func, bitmask, thisArg); - } else if (bitmask == WRAP_CURRY_FLAG || bitmask == WRAP_CURRY_RIGHT_FLAG) { - result = createCurry(func, bitmask, arity); - } else if ((bitmask == WRAP_PARTIAL_FLAG || bitmask == (WRAP_BIND_FLAG | WRAP_PARTIAL_FLAG)) && !holders.length) { - result = createPartial(func, bitmask, thisArg, partials); + var isArr = isArray(value); + if (isArr) { + result = initCloneArray(value); + if (!isDeep) { + return copyArray(value, result); + } } else { - result = createHybrid.apply(undefined, newData); + var tag = getTag(value), + isFunc = tag == funcTag || tag == genTag; + + if (isBuffer(value)) { + return cloneBuffer(value, isDeep); + } + if (tag == objectTag || tag == argsTag || (isFunc && !object)) { + result = (isFlat || isFunc) ? {} : initCloneObject(value); + if (!isDeep) { + return isFlat + ? copySymbolsIn(value, baseAssignIn(result, value)) + : copySymbols(value, baseAssign(result, value)); + } + } else { + if (!cloneableTags[tag]) { + return object ? value : {}; + } + result = initCloneByTag(value, tag, baseClone, isDeep); + } } - var setter = data ? baseSetData : setData; - return setWrapToString(setter(result, newData), func, bitmask); + // Check for circular references and return its corresponding clone. + stack || (stack = new Stack); + var stacked = stack.get(value); + if (stacked) { + return stacked; + } + stack.set(value, result); + + var keysFunc = isFull + ? (isFlat ? getAllKeysIn : getAllKeys) + : (isFlat ? keysIn : keys); + + var props = isArr ? undefined : keysFunc(value); + arrayEach(props || value, function(subValue, key) { + if (props) { + key = subValue; + subValue = value[key]; + } + // Recursively populate clone (susceptible to call stack limits). + assignValue(result, key, baseClone(subValue, bitmask, customizer, key, value, stack)); + }); + return result; } /** - * Used by `_.defaults` to customize its `_.assignIn` use to assign properties - * of source objects to the destination object for all destination properties - * that resolve to `undefined`. + * The base implementation of `_.conforms` which doesn't clone `source`. * * @private - * @param {*} objValue The destination value. - * @param {*} srcValue The source value. - * @param {string} key The key of the property to assign. - * @param {Object} object The parent object of `objValue`. - * @returns {*} Returns the value to assign. + * @param {Object} source The object of property predicates to conform to. + * @returns {Function} Returns the new spec function. */ - function customDefaultsAssignIn(objValue, srcValue, key, object) { - if (objValue === undefined || - (eq(objValue, objectProto[key]) && !hasOwnProperty.call(object, key))) { - return srcValue; - } - return objValue; + function baseConforms(source) { + var props = keys(source); + return function(object) { + return baseConformsTo(object, source, props); + }; } /** - * Used by `_.defaultsDeep` to customize its `_.merge` use to merge source - * objects into destination objects that are passed thru. + * The base implementation of `_.conformsTo` which accepts `props` to check. * * @private - * @param {*} objValue The destination value. - * @param {*} srcValue The source value. - * @param {string} key The key of the property to merge. - * @param {Object} object The parent object of `objValue`. - * @param {Object} source The parent object of `srcValue`. - * @param {Object} [stack] Tracks traversed source values and their merged - * counterparts. - * @returns {*} Returns the value to assign. + * @param {Object} object The object to inspect. + * @param {Object} source The object of property predicates to conform to. + * @returns {boolean} Returns `true` if `object` conforms, else `false`. */ - function customDefaultsMerge(objValue, srcValue, key, object, source, stack) { - if (isObject(objValue) && isObject(srcValue)) { - // Recursively merge objects and arrays (susceptible to call stack limits). - stack.set(srcValue, objValue); - baseMerge(objValue, srcValue, undefined, customDefaultsMerge, stack); - stack['delete'](srcValue); + function baseConformsTo(object, source, props) { + var length = props.length; + if (object == null) { + return !length; } - return objValue; + object = Object(object); + while (length--) { + var key = props[length], + predicate = source[key], + value = object[key]; + + if ((value === undefined && !(key in object)) || !predicate(value)) { + return false; + } + } + return true; } /** - * Used by `_.omit` to customize its `_.cloneDeep` use to only clone plain - * objects. + * The base implementation of `_.delay` and `_.defer` which accepts `args` + * to provide to `func`. * * @private - * @param {*} value The value to inspect. - * @param {string} key The key of the property to inspect. - * @returns {*} Returns the uncloned value or `undefined` to defer cloning to `_.cloneDeep`. + * @param {Function} func The function to delay. + * @param {number} wait The number of milliseconds to delay invocation. + * @param {Array} args The arguments to provide to `func`. + * @returns {number|Object} Returns the timer id or timeout object. */ - function customOmitClone(value) { - return isPlainObject(value) ? undefined : value; + function baseDelay(func, wait, args) { + if (typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + return setTimeout(function() { func.apply(undefined, args); }, wait); } /** - * A specialized version of `baseIsEqualDeep` for arrays with support for - * partial deep comparisons. + * The base implementation of methods like `_.difference` without support + * for excluding multiple arrays or iteratee shorthands. * * @private - * @param {Array} array The array to compare. - * @param {Array} other The other array to compare. - * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. - * @param {Function} customizer The function to customize comparisons. - * @param {Function} equalFunc The function to determine equivalents of values. - * @param {Object} stack Tracks traversed `array` and `other` objects. - * @returns {boolean} Returns `true` if the arrays are equivalent, else `false`. + * @param {Array} array The array to inspect. + * @param {Array} values The values to exclude. + * @param {Function} [iteratee] The iteratee invoked per element. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new array of filtered values. */ - function equalArrays(array, other, bitmask, customizer, equalFunc, stack) { - var isPartial = bitmask & COMPARE_PARTIAL_FLAG, - arrLength = array.length, - othLength = other.length; - - if (arrLength != othLength && !(isPartial && othLength > arrLength)) { - return false; - } - // Assume cyclic values are equal. - var stacked = stack.get(array); - if (stacked && stack.get(other)) { - return stacked == other; - } + function baseDifference(array, values, iteratee, comparator) { var index = -1, - result = true, - seen = (bitmask & COMPARE_UNORDERED_FLAG) ? new SetCache : undefined; - - stack.set(array, other); - stack.set(other, array); + includes = arrayIncludes, + isCommon = true, + length = array.length, + result = [], + valuesLength = values.length; - // Ignore non-index properties. - while (++index < arrLength) { - var arrValue = array[index], - othValue = other[index]; + if (!length) { + return result; + } + if (iteratee) { + values = arrayMap(values, baseUnary(iteratee)); + } + if (comparator) { + includes = arrayIncludesWith; + isCommon = false; + } + else if (values.length >= LARGE_ARRAY_SIZE) { + includes = cacheHas; + isCommon = false; + values = new SetCache(values); + } + outer: + while (++index < length) { + var value = array[index], + computed = iteratee == null ? value : iteratee(value); - if (customizer) { - var compared = isPartial - ? customizer(othValue, arrValue, index, other, array, stack) - : customizer(arrValue, othValue, index, array, other, stack); - } - if (compared !== undefined) { - if (compared) { - continue; + value = (comparator || value !== 0) ? value : 0; + if (isCommon && computed === computed) { + var valuesIndex = valuesLength; + while (valuesIndex--) { + if (values[valuesIndex] === computed) { + continue outer; + } } - result = false; - break; + result.push(value); } - // Recursively compare arrays (susceptible to call stack limits). - if (seen) { - if (!arraySome(other, function(othValue, othIndex) { - if (!cacheHas(seen, othIndex) && - (arrValue === othValue || equalFunc(arrValue, othValue, bitmask, customizer, stack))) { - return seen.push(othIndex); - } - })) { - result = false; - break; - } - } else if (!( - arrValue === othValue || - equalFunc(arrValue, othValue, bitmask, customizer, stack) - )) { - result = false; - break; + else if (!includes(values, computed, comparator)) { + result.push(value); } } - stack['delete'](array); - stack['delete'](other); return result; } /** - * A specialized version of `baseIsEqualDeep` for comparing objects of - * the same `toStringTag`. - * - * **Note:** This function only supports comparing values with tags of - * `Boolean`, `Date`, `Error`, `Number`, `RegExp`, or `String`. + * The base implementation of `_.forEach` without support for iteratee shorthands. * * @private - * @param {Object} object The object to compare. - * @param {Object} other The other object to compare. - * @param {string} tag The `toStringTag` of the objects to compare. - * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. - * @param {Function} customizer The function to customize comparisons. - * @param {Function} equalFunc The function to determine equivalents of values. - * @param {Object} stack Tracks traversed `object` and `other` objects. - * @returns {boolean} Returns `true` if the objects are equivalent, else `false`. + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array|Object} Returns `collection`. */ - function equalByTag(object, other, tag, bitmask, customizer, equalFunc, stack) { - switch (tag) { - case dataViewTag: - if ((object.byteLength != other.byteLength) || - (object.byteOffset != other.byteOffset)) { - return false; - } - object = object.buffer; - other = other.buffer; - - case arrayBufferTag: - if ((object.byteLength != other.byteLength) || - !equalFunc(new Uint8Array(object), new Uint8Array(other))) { - return false; - } - return true; - - case boolTag: - case dateTag: - case numberTag: - // Coerce booleans to `1` or `0` and dates to milliseconds. - // Invalid dates are coerced to `NaN`. - return eq(+object, +other); - - case errorTag: - return object.name == other.name && object.message == other.message; - - case regexpTag: - case stringTag: - // Coerce regexes to strings and treat strings, primitives and objects, - // as equal. See http://www.ecma-international.org/ecma-262/7.0/#sec-regexp.prototype.tostring - // for more details. - return object == (other + ''); - - case mapTag: - var convert = mapToArray; - - case setTag: - var isPartial = bitmask & COMPARE_PARTIAL_FLAG; - convert || (convert = setToArray); - - if (object.size != other.size && !isPartial) { - return false; - } - // Assume cyclic values are equal. - var stacked = stack.get(object); - if (stacked) { - return stacked == other; - } - bitmask |= COMPARE_UNORDERED_FLAG; + var baseEach = createBaseEach(baseForOwn); - // Recursively compare objects (susceptible to call stack limits). - stack.set(object, other); - var result = equalArrays(convert(object), convert(other), bitmask, customizer, equalFunc, stack); - stack['delete'](object); - return result; + /** + * The base implementation of `_.forEachRight` without support for iteratee shorthands. + * + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array|Object} Returns `collection`. + */ + var baseEachRight = createBaseEach(baseForOwnRight, true); - case symbolTag: - if (symbolValueOf) { - return symbolValueOf.call(object) == symbolValueOf.call(other); - } - } - return false; + /** + * The base implementation of `_.every` without support for iteratee shorthands. + * + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} predicate The function invoked per iteration. + * @returns {boolean} Returns `true` if all elements pass the predicate check, + * else `false` + */ + function baseEvery(collection, predicate) { + var result = true; + baseEach(collection, function(value, index, collection) { + result = !!predicate(value, index, collection); + return result; + }); + return result; } /** - * A specialized version of `baseIsEqualDeep` for objects with support for - * partial deep comparisons. + * The base implementation of methods like `_.max` and `_.min` which accepts a + * `comparator` to determine the extremum value. * * @private - * @param {Object} object The object to compare. - * @param {Object} other The other object to compare. - * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. - * @param {Function} customizer The function to customize comparisons. - * @param {Function} equalFunc The function to determine equivalents of values. - * @param {Object} stack Tracks traversed `object` and `other` objects. - * @returns {boolean} Returns `true` if the objects are equivalent, else `false`. + * @param {Array} array The array to iterate over. + * @param {Function} iteratee The iteratee invoked per iteration. + * @param {Function} comparator The comparator used to compare values. + * @returns {*} Returns the extremum value. */ - function equalObjects(object, other, bitmask, customizer, equalFunc, stack) { - var isPartial = bitmask & COMPARE_PARTIAL_FLAG, - objProps = getAllKeys(object), - objLength = objProps.length, - othProps = getAllKeys(other), - othLength = othProps.length; - - if (objLength != othLength && !isPartial) { - return false; - } - var index = objLength; - while (index--) { - var key = objProps[index]; - if (!(isPartial ? key in other : hasOwnProperty.call(other, key))) { - return false; - } - } - // Assume cyclic values are equal. - var stacked = stack.get(object); - if (stacked && stack.get(other)) { - return stacked == other; - } - var result = true; - stack.set(object, other); - stack.set(other, object); + function baseExtremum(array, iteratee, comparator) { + var index = -1, + length = array.length; - var skipCtor = isPartial; - while (++index < objLength) { - key = objProps[index]; - var objValue = object[key], - othValue = other[key]; + while (++index < length) { + var value = array[index], + current = iteratee(value); - if (customizer) { - var compared = isPartial - ? customizer(othValue, objValue, key, other, object, stack) - : customizer(objValue, othValue, key, object, other, stack); - } - // Recursively compare objects (susceptible to call stack limits). - if (!(compared === undefined - ? (objValue === othValue || equalFunc(objValue, othValue, bitmask, customizer, stack)) - : compared + if (current != null && (computed === undefined + ? (current === current && !isSymbol(current)) + : comparator(current, computed) )) { - result = false; - break; - } - skipCtor || (skipCtor = key == 'constructor'); - } - if (result && !skipCtor) { - var objCtor = object.constructor, - othCtor = other.constructor; - - // Non `Object` object instances with different constructors are not equal. - if (objCtor != othCtor && - ('constructor' in object && 'constructor' in other) && - !(typeof objCtor == 'function' && objCtor instanceof objCtor && - typeof othCtor == 'function' && othCtor instanceof othCtor)) { - result = false; + var computed = current, + result = value; } } - stack['delete'](object); - stack['delete'](other); return result; } /** - * A specialized version of `baseRest` which flattens the rest array. + * The base implementation of `_.fill` without an iteratee call guard. * * @private - * @param {Function} func The function to apply a rest parameter to. - * @returns {Function} Returns the new function. + * @param {Array} array The array to fill. + * @param {*} value The value to fill `array` with. + * @param {number} [start=0] The start position. + * @param {number} [end=array.length] The end position. + * @returns {Array} Returns `array`. */ - function flatRest(func) { - return setToString(overRest(func, undefined, flatten), func + ''); + function baseFill(array, value, start, end) { + var length = array.length; + + start = toInteger(start); + if (start < 0) { + start = -start > length ? 0 : (length + start); + } + end = (end === undefined || end > length) ? length : toInteger(end); + if (end < 0) { + end += length; + } + end = start > end ? 0 : toLength(end); + while (start < end) { + array[start++] = value; + } + return array; } /** - * Creates an array of own enumerable property names and symbols of `object`. + * The base implementation of `_.filter` without support for iteratee shorthands. * * @private - * @param {Object} object The object to query. - * @returns {Array} Returns the array of property names and symbols. + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} predicate The function invoked per iteration. + * @returns {Array} Returns the new filtered array. */ - function getAllKeys(object) { - return baseGetAllKeys(object, keys, getSymbols); + function baseFilter(collection, predicate) { + var result = []; + baseEach(collection, function(value, index, collection) { + if (predicate(value, index, collection)) { + result.push(value); + } + }); + return result; } /** - * Creates an array of own and inherited enumerable property names and - * symbols of `object`. + * The base implementation of `_.flatten` with support for restricting flattening. * * @private - * @param {Object} object The object to query. - * @returns {Array} Returns the array of property names and symbols. + * @param {Array} array The array to flatten. + * @param {number} depth The maximum recursion depth. + * @param {boolean} [predicate=isFlattenable] The function invoked per iteration. + * @param {boolean} [isStrict] Restrict to values that pass `predicate` checks. + * @param {Array} [result=[]] The initial result value. + * @returns {Array} Returns the new flattened array. */ - function getAllKeysIn(object) { - return baseGetAllKeys(object, keysIn, getSymbolsIn); + function baseFlatten(array, depth, predicate, isStrict, result) { + var index = -1, + length = array.length; + + predicate || (predicate = isFlattenable); + result || (result = []); + + while (++index < length) { + var value = array[index]; + if (depth > 0 && predicate(value)) { + if (depth > 1) { + // Recursively flatten arrays (susceptible to call stack limits). + baseFlatten(value, depth - 1, predicate, isStrict, result); + } else { + arrayPush(result, value); + } + } else if (!isStrict) { + result[result.length] = value; + } + } + return result; } /** - * Gets metadata for `func`. + * The base implementation of `baseForOwn` which iterates over `object` + * properties returned by `keysFunc` and invokes `iteratee` for each property. + * Iteratee functions may exit iteration early by explicitly returning `false`. * * @private - * @param {Function} func The function to query. - * @returns {*} Returns the metadata for `func`. + * @param {Object} object The object to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @param {Function} keysFunc The function to get the keys of `object`. + * @returns {Object} Returns `object`. */ - var getData = !metaMap ? noop : function(func) { - return metaMap.get(func); - }; + var baseFor = createBaseFor(); /** - * Gets the name of `func`. + * This function is like `baseFor` except that it iterates over properties + * in the opposite order. * * @private - * @param {Function} func The function to query. - * @returns {string} Returns the function name. + * @param {Object} object The object to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @param {Function} keysFunc The function to get the keys of `object`. + * @returns {Object} Returns `object`. */ - function getFuncName(func) { - var result = (func.name + ''), - array = realNames[result], - length = hasOwnProperty.call(realNames, result) ? array.length : 0; - - while (length--) { - var data = array[length], - otherFunc = data.func; - if (otherFunc == null || otherFunc == func) { - return data.name; - } - } - return result; - } + var baseForRight = createBaseFor(true); /** - * Gets the argument placeholder value for `func`. + * The base implementation of `_.forOwn` without support for iteratee shorthands. * * @private - * @param {Function} func The function to inspect. - * @returns {*} Returns the placeholder value. + * @param {Object} object The object to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Object} Returns `object`. */ - function getHolder(func) { - var object = hasOwnProperty.call(lodash, 'placeholder') ? lodash : func; - return object.placeholder; + function baseForOwn(object, iteratee) { + return object && baseFor(object, iteratee, keys); } /** - * Gets the appropriate "iteratee" function. If `_.iteratee` is customized, - * this function returns the custom method, otherwise it returns `baseIteratee`. - * If arguments are provided, the chosen function is invoked with them and - * its result is returned. + * The base implementation of `_.forOwnRight` without support for iteratee shorthands. * * @private - * @param {*} [value] The value to convert to an iteratee. - * @param {number} [arity] The arity of the created iteratee. - * @returns {Function} Returns the chosen function or its result. + * @param {Object} object The object to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Object} Returns `object`. */ - function getIteratee() { - var result = lodash.iteratee || iteratee; - result = result === iteratee ? baseIteratee : result; - return arguments.length ? result(arguments[0], arguments[1]) : result; + function baseForOwnRight(object, iteratee) { + return object && baseForRight(object, iteratee, keys); } /** - * Gets the data for `map`. + * The base implementation of `_.functions` which creates an array of + * `object` function property names filtered from `props`. * * @private - * @param {Object} map The map to query. - * @param {string} key The reference key. - * @returns {*} Returns the map data. + * @param {Object} object The object to inspect. + * @param {Array} props The property names to filter. + * @returns {Array} Returns the function names. */ - function getMapData(map, key) { - var data = map.__data__; - return isKeyable(key) - ? data[typeof key == 'string' ? 'string' : 'hash'] - : data.map; + function baseFunctions(object, props) { + return arrayFilter(props, function(key) { + return isFunction(object[key]); + }); } /** - * Gets the property names, values, and compare flags of `object`. + * The base implementation of `_.get` without support for default values. * * @private * @param {Object} object The object to query. - * @returns {Array} Returns the match data of `object`. + * @param {Array|string} path The path of the property to get. + * @returns {*} Returns the resolved value. */ - function getMatchData(object) { - var result = keys(object), - length = result.length; + function baseGet(object, path) { + path = castPath(path, object); - while (length--) { - var key = result[length], - value = object[key]; + var index = 0, + length = path.length; - result[length] = [key, value, isStrictComparable(value)]; + while (object != null && index < length) { + object = object[toKey(path[index++])]; } - return result; + return (index && index == length) ? object : undefined; } /** - * Gets the native function at `key` of `object`. + * The base implementation of `getAllKeys` and `getAllKeysIn` which uses + * `keysFunc` and `symbolsFunc` to get the enumerable property names and + * symbols of `object`. * * @private * @param {Object} object The object to query. - * @param {string} key The key of the method to get. - * @returns {*} Returns the function if it's native, else `undefined`. + * @param {Function} keysFunc The function to get the keys of `object`. + * @param {Function} symbolsFunc The function to get the symbols of `object`. + * @returns {Array} Returns the array of property names and symbols. */ - function getNative(object, key) { - var value = getValue(object, key); - return baseIsNative(value) ? value : undefined; + function baseGetAllKeys(object, keysFunc, symbolsFunc) { + var result = keysFunc(object); + return isArray(object) ? result : arrayPush(result, symbolsFunc(object)); } /** - * A specialized version of `baseGetTag` which ignores `Symbol.toStringTag` values. + * The base implementation of `getTag` without fallbacks for buggy environments. * * @private * @param {*} value The value to query. - * @returns {string} Returns the raw `toStringTag`. + * @returns {string} Returns the `toStringTag`. */ - function getRawTag(value) { - var isOwn = hasOwnProperty.call(value, symToStringTag), - tag = value[symToStringTag]; - - try { - value[symToStringTag] = undefined; - var unmasked = true; - } catch (e) {} - - var result = nativeObjectToString.call(value); - if (unmasked) { - if (isOwn) { - value[symToStringTag] = tag; - } else { - delete value[symToStringTag]; - } + function baseGetTag(value) { + if (value == null) { + return value === undefined ? undefinedTag : nullTag; } - return result; + return (symToStringTag && symToStringTag in Object(value)) + ? getRawTag(value) + : objectToString(value); } /** - * Creates an array of the own enumerable symbols of `object`. + * The base implementation of `_.gt` which doesn't coerce arguments. * * @private - * @param {Object} object The object to query. - * @returns {Array} Returns the array of symbols. + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @returns {boolean} Returns `true` if `value` is greater than `other`, + * else `false`. */ - var getSymbols = !nativeGetSymbols ? stubArray : function(object) { - if (object == null) { - return []; - } - object = Object(object); - return arrayFilter(nativeGetSymbols(object), function(symbol) { - return propertyIsEnumerable.call(object, symbol); - }); - }; + function baseGt(value, other) { + return value > other; + } /** - * Creates an array of the own and inherited enumerable symbols of `object`. + * The base implementation of `_.has` without support for deep paths. * * @private - * @param {Object} object The object to query. - * @returns {Array} Returns the array of symbols. - */ - var getSymbolsIn = !nativeGetSymbols ? stubArray : function(object) { - var result = []; - while (object) { - arrayPush(result, getSymbols(object)); - object = getPrototype(object); - } - return result; - }; - - /** - * Gets the `toStringTag` of `value`. - * - * @private - * @param {*} value The value to query. - * @returns {string} Returns the `toStringTag`. + * @param {Object} [object] The object to query. + * @param {Array|string} key The key to check. + * @returns {boolean} Returns `true` if `key` exists, else `false`. */ - var getTag = baseGetTag; - - // Fallback for data views, maps, sets, and weak maps in IE 11 and promises in Node.js < 6. - if ((DataView && getTag(new DataView(new ArrayBuffer(1))) != dataViewTag) || - (Map && getTag(new Map) != mapTag) || - (Promise && getTag(Promise.resolve()) != promiseTag) || - (Set && getTag(new Set) != setTag) || - (WeakMap && getTag(new WeakMap) != weakMapTag)) { - getTag = function(value) { - var result = baseGetTag(value), - Ctor = result == objectTag ? value.constructor : undefined, - ctorString = Ctor ? toSource(Ctor) : ''; - - if (ctorString) { - switch (ctorString) { - case dataViewCtorString: return dataViewTag; - case mapCtorString: return mapTag; - case promiseCtorString: return promiseTag; - case setCtorString: return setTag; - case weakMapCtorString: return weakMapTag; - } - } - return result; - }; + function baseHas(object, key) { + return object != null && hasOwnProperty.call(object, key); } /** - * Gets the view, applying any `transforms` to the `start` and `end` positions. + * The base implementation of `_.hasIn` without support for deep paths. * * @private - * @param {number} start The start of the view. - * @param {number} end The end of the view. - * @param {Array} transforms The transformations to apply to the view. - * @returns {Object} Returns an object containing the `start` and `end` - * positions of the view. + * @param {Object} [object] The object to query. + * @param {Array|string} key The key to check. + * @returns {boolean} Returns `true` if `key` exists, else `false`. */ - function getView(start, end, transforms) { - var index = -1, - length = transforms.length; - - while (++index < length) { - var data = transforms[index], - size = data.size; - - switch (data.type) { - case 'drop': start += size; break; - case 'dropRight': end -= size; break; - case 'take': end = nativeMin(end, start + size); break; - case 'takeRight': start = nativeMax(start, end - size); break; - } - } - return { 'start': start, 'end': end }; + function baseHasIn(object, key) { + return object != null && key in Object(object); } /** - * Extracts wrapper details from the `source` body comment. + * The base implementation of `_.inRange` which doesn't coerce arguments. * * @private - * @param {string} source The source to inspect. - * @returns {Array} Returns the wrapper details. + * @param {number} number The number to check. + * @param {number} start The start of the range. + * @param {number} end The end of the range. + * @returns {boolean} Returns `true` if `number` is in the range, else `false`. */ - function getWrapDetails(source) { - var match = source.match(reWrapDetails); - return match ? match[1].split(reSplitDetails) : []; + function baseInRange(number, start, end) { + return number >= nativeMin(start, end) && number < nativeMax(start, end); } /** - * Checks if `path` exists on `object`. + * The base implementation of methods like `_.intersection`, without support + * for iteratee shorthands, that accepts an array of arrays to inspect. * * @private - * @param {Object} object The object to query. - * @param {Array|string} path The path to check. - * @param {Function} hasFunc The function to check properties. - * @returns {boolean} Returns `true` if `path` exists, else `false`. + * @param {Array} arrays The arrays to inspect. + * @param {Function} [iteratee] The iteratee invoked per element. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new array of shared values. */ - function hasPath(object, path, hasFunc) { - path = castPath(path, object); - - var index = -1, - length = path.length, - result = false; + function baseIntersection(arrays, iteratee, comparator) { + var includes = comparator ? arrayIncludesWith : arrayIncludes, + length = arrays[0].length, + othLength = arrays.length, + othIndex = othLength, + caches = Array(othLength), + maxLength = Infinity, + result = []; - while (++index < length) { - var key = toKey(path[index]); - if (!(result = object != null && hasFunc(object, key))) { - break; + while (othIndex--) { + var array = arrays[othIndex]; + if (othIndex && iteratee) { + array = arrayMap(array, baseUnary(iteratee)); } - object = object[key]; - } - if (result || ++index != length) { - return result; + maxLength = nativeMin(array.length, maxLength); + caches[othIndex] = !comparator && (iteratee || (length >= 120 && array.length >= 120)) + ? new SetCache(othIndex && array) + : undefined; } - length = object == null ? 0 : object.length; - return !!length && isLength(length) && isIndex(key, length) && - (isArray(object) || isArguments(object)); - } + array = arrays[0]; - /** - * Initializes an array clone. - * - * @private - * @param {Array} array The array to clone. - * @returns {Array} Returns the initialized clone. - */ - function initCloneArray(array) { - var length = array.length, - result = array.constructor(length); + var index = -1, + seen = caches[0]; - // Add properties assigned by `RegExp#exec`. - if (length && typeof array[0] == 'string' && hasOwnProperty.call(array, 'index')) { - result.index = array.index; - result.input = array.input; + outer: + while (++index < length && result.length < maxLength) { + var value = array[index], + computed = iteratee ? iteratee(value) : value; + + value = (comparator || value !== 0) ? value : 0; + if (!(seen + ? cacheHas(seen, computed) + : includes(result, computed, comparator) + )) { + othIndex = othLength; + while (--othIndex) { + var cache = caches[othIndex]; + if (!(cache + ? cacheHas(cache, computed) + : includes(arrays[othIndex], computed, comparator)) + ) { + continue outer; + } + } + if (seen) { + seen.push(computed); + } + result.push(value); + } } return result; } /** - * Initializes an object clone. + * The base implementation of `_.invert` and `_.invertBy` which inverts + * `object` with values transformed by `iteratee` and set by `setter`. * * @private - * @param {Object} object The object to clone. - * @returns {Object} Returns the initialized clone. + * @param {Object} object The object to iterate over. + * @param {Function} setter The function to set `accumulator` values. + * @param {Function} iteratee The iteratee to transform values. + * @param {Object} accumulator The initial inverted object. + * @returns {Function} Returns `accumulator`. */ - function initCloneObject(object) { - return (typeof object.constructor == 'function' && !isPrototype(object)) - ? baseCreate(getPrototype(object)) - : {}; + function baseInverter(object, setter, iteratee, accumulator) { + baseForOwn(object, function(value, key, object) { + setter(accumulator, iteratee(value), key, object); + }); + return accumulator; } /** - * Initializes an object clone based on its `toStringTag`. - * - * **Note:** This function only supports cloning values with tags of - * `Boolean`, `Date`, `Error`, `Number`, `RegExp`, or `String`. + * The base implementation of `_.invoke` without support for individual + * method arguments. * * @private - * @param {Object} object The object to clone. - * @param {string} tag The `toStringTag` of the object to clone. - * @param {Function} cloneFunc The function to clone values. - * @param {boolean} [isDeep] Specify a deep clone. - * @returns {Object} Returns the initialized clone. + * @param {Object} object The object to query. + * @param {Array|string} path The path of the method to invoke. + * @param {Array} args The arguments to invoke the method with. + * @returns {*} Returns the result of the invoked method. */ - function initCloneByTag(object, tag, cloneFunc, isDeep) { - var Ctor = object.constructor; - switch (tag) { - case arrayBufferTag: - return cloneArrayBuffer(object); - - case boolTag: - case dateTag: - return new Ctor(+object); - - case dataViewTag: - return cloneDataView(object, isDeep); - - case float32Tag: case float64Tag: - case int8Tag: case int16Tag: case int32Tag: - case uint8Tag: case uint8ClampedTag: case uint16Tag: case uint32Tag: - return cloneTypedArray(object, isDeep); - - case mapTag: - return cloneMap(object, isDeep, cloneFunc); - - case numberTag: - case stringTag: - return new Ctor(object); - - case regexpTag: - return cloneRegExp(object); - - case setTag: - return cloneSet(object, isDeep, cloneFunc); - - case symbolTag: - return cloneSymbol(object); - } + function baseInvoke(object, path, args) { + path = castPath(path, object); + object = parent(object, path); + var func = object == null ? object : object[toKey(last(path))]; + return func == null ? undefined : apply(func, object, args); } /** - * Inserts wrapper `details` in a comment at the top of the `source` body. + * The base implementation of `_.isArguments`. * * @private - * @param {string} source The source to modify. - * @returns {Array} details The details to insert. - * @returns {string} Returns the modified source. + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an `arguments` object, */ - function insertWrapDetails(source, details) { - var length = details.length; - if (!length) { - return source; - } - var lastIndex = length - 1; - details[lastIndex] = (length > 1 ? '& ' : '') + details[lastIndex]; - details = details.join(length > 2 ? ', ' : ' '); - return source.replace(reWrapComment, '{\n/* [wrapped with ' + details + '] */\n'); + function baseIsArguments(value) { + return isObjectLike(value) && baseGetTag(value) == argsTag; } /** - * Checks if `value` is a flattenable `arguments` object or array. + * The base implementation of `_.isArrayBuffer` without Node.js optimizations. * * @private * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is flattenable, else `false`. + * @returns {boolean} Returns `true` if `value` is an array buffer, else `false`. */ - function isFlattenable(value) { - return isArray(value) || isArguments(value) || - !!(spreadableSymbol && value && value[spreadableSymbol]); + function baseIsArrayBuffer(value) { + return isObjectLike(value) && baseGetTag(value) == arrayBufferTag; } /** - * Checks if `value` is a valid array-like index. + * The base implementation of `_.isDate` without Node.js optimizations. * * @private * @param {*} value The value to check. - * @param {number} [length=MAX_SAFE_INTEGER] The upper bounds of a valid index. - * @returns {boolean} Returns `true` if `value` is a valid index, else `false`. + * @returns {boolean} Returns `true` if `value` is a date object, else `false`. */ - function isIndex(value, length) { - length = length == null ? MAX_SAFE_INTEGER : length; - return !!length && - (typeof value == 'number' || reIsUint.test(value)) && - (value > -1 && value % 1 == 0 && value < length); + function baseIsDate(value) { + return isObjectLike(value) && baseGetTag(value) == dateTag; } /** - * Checks if the given arguments are from an iteratee call. + * The base implementation of `_.isEqual` which supports partial comparisons + * and tracks traversed objects. * * @private - * @param {*} value The potential iteratee value argument. - * @param {*} index The potential iteratee index or key argument. - * @param {*} object The potential iteratee object argument. - * @returns {boolean} Returns `true` if the arguments are from an iteratee call, - * else `false`. + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @param {boolean} bitmask The bitmask flags. + * 1 - Unordered comparison + * 2 - Partial comparison + * @param {Function} [customizer] The function to customize comparisons. + * @param {Object} [stack] Tracks traversed `value` and `other` objects. + * @returns {boolean} Returns `true` if the values are equivalent, else `false`. */ - function isIterateeCall(value, index, object) { - if (!isObject(object)) { - return false; + function baseIsEqual(value, other, bitmask, customizer, stack) { + if (value === other) { + return true; } - var type = typeof index; - if (type == 'number' - ? (isArrayLike(object) && isIndex(index, object.length)) - : (type == 'string' && index in object) - ) { - return eq(object[index], value); + if (value == null || other == null || (!isObjectLike(value) && !isObjectLike(other))) { + return value !== value && other !== other; } - return false; + return baseIsEqualDeep(value, other, bitmask, customizer, baseIsEqual, stack); } /** - * Checks if `value` is a property name and not a property path. + * A specialized version of `baseIsEqual` for arrays and objects which performs + * deep comparisons and tracks traversed objects enabling objects with circular + * references to be compared. * * @private - * @param {*} value The value to check. - * @param {Object} [object] The object to query keys on. - * @returns {boolean} Returns `true` if `value` is a property name, else `false`. + * @param {Object} object The object to compare. + * @param {Object} other The other object to compare. + * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. + * @param {Function} customizer The function to customize comparisons. + * @param {Function} equalFunc The function to determine equivalents of values. + * @param {Object} [stack] Tracks traversed `object` and `other` objects. + * @returns {boolean} Returns `true` if the objects are equivalent, else `false`. */ - function isKey(value, object) { - if (isArray(value)) { - return false; + function baseIsEqualDeep(object, other, bitmask, customizer, equalFunc, stack) { + var objIsArr = isArray(object), + othIsArr = isArray(other), + objTag = objIsArr ? arrayTag : getTag(object), + othTag = othIsArr ? arrayTag : getTag(other); + + objTag = objTag == argsTag ? objectTag : objTag; + othTag = othTag == argsTag ? objectTag : othTag; + + var objIsObj = objTag == objectTag, + othIsObj = othTag == objectTag, + isSameTag = objTag == othTag; + + if (isSameTag && isBuffer(object)) { + if (!isBuffer(other)) { + return false; + } + objIsArr = true; + objIsObj = false; } - var type = typeof value; - if (type == 'number' || type == 'symbol' || type == 'boolean' || - value == null || isSymbol(value)) { - return true; + if (isSameTag && !objIsObj) { + stack || (stack = new Stack); + return (objIsArr || isTypedArray(object)) + ? equalArrays(object, other, bitmask, customizer, equalFunc, stack) + : equalByTag(object, other, objTag, bitmask, customizer, equalFunc, stack); } - return reIsPlainProp.test(value) || !reIsDeepProp.test(value) || - (object != null && value in Object(object)); + if (!(bitmask & COMPARE_PARTIAL_FLAG)) { + var objIsWrapped = objIsObj && hasOwnProperty.call(object, '__wrapped__'), + othIsWrapped = othIsObj && hasOwnProperty.call(other, '__wrapped__'); + + if (objIsWrapped || othIsWrapped) { + var objUnwrapped = objIsWrapped ? object.value() : object, + othUnwrapped = othIsWrapped ? other.value() : other; + + stack || (stack = new Stack); + return equalFunc(objUnwrapped, othUnwrapped, bitmask, customizer, stack); + } + } + if (!isSameTag) { + return false; + } + stack || (stack = new Stack); + return equalObjects(object, other, bitmask, customizer, equalFunc, stack); } /** - * Checks if `value` is suitable for use as unique object key. + * The base implementation of `_.isMap` without Node.js optimizations. * * @private * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is suitable, else `false`. + * @returns {boolean} Returns `true` if `value` is a map, else `false`. */ - function isKeyable(value) { - var type = typeof value; - return (type == 'string' || type == 'number' || type == 'symbol' || type == 'boolean') - ? (value !== '__proto__') - : (value === null); + function baseIsMap(value) { + return isObjectLike(value) && getTag(value) == mapTag; } /** - * Checks if `func` has a lazy counterpart. + * The base implementation of `_.isMatch` without support for iteratee shorthands. * * @private - * @param {Function} func The function to check. - * @returns {boolean} Returns `true` if `func` has a lazy counterpart, - * else `false`. + * @param {Object} object The object to inspect. + * @param {Object} source The object of property values to match. + * @param {Array} matchData The property names, values, and compare flags to match. + * @param {Function} [customizer] The function to customize comparisons. + * @returns {boolean} Returns `true` if `object` is a match, else `false`. */ - function isLaziable(func) { - var funcName = getFuncName(func), - other = lodash[funcName]; + function baseIsMatch(object, source, matchData, customizer) { + var index = matchData.length, + length = index, + noCustomizer = !customizer; - if (typeof other != 'function' || !(funcName in LazyWrapper.prototype)) { - return false; + if (object == null) { + return !length; } - if (func === other) { - return true; + object = Object(object); + while (index--) { + var data = matchData[index]; + if ((noCustomizer && data[2]) + ? data[1] !== object[data[0]] + : !(data[0] in object) + ) { + return false; + } } - var data = getData(other); - return !!data && func === data[0]; + while (++index < length) { + data = matchData[index]; + var key = data[0], + objValue = object[key], + srcValue = data[1]; + + if (noCustomizer && data[2]) { + if (objValue === undefined && !(key in object)) { + return false; + } + } else { + var stack = new Stack; + if (customizer) { + var result = customizer(objValue, srcValue, key, object, source, stack); + } + if (!(result === undefined + ? baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG, customizer, stack) + : result + )) { + return false; + } + } + } + return true; } /** - * Checks if `func` has its source masked. + * The base implementation of `_.isNative` without bad shim checks. * * @private - * @param {Function} func The function to check. - * @returns {boolean} Returns `true` if `func` is masked, else `false`. + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a native function, + * else `false`. */ - function isMasked(func) { - return !!maskSrcKey && (maskSrcKey in func); + function baseIsNative(value) { + if (!isObject(value) || isMasked(value)) { + return false; + } + var pattern = isFunction(value) ? reIsNative : reIsHostCtor; + return pattern.test(toSource(value)); } /** - * Checks if `func` is capable of being masked. + * The base implementation of `_.isRegExp` without Node.js optimizations. * * @private * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `func` is maskable, else `false`. + * @returns {boolean} Returns `true` if `value` is a regexp, else `false`. */ - var isMaskable = coreJsData ? isFunction : stubFalse; + function baseIsRegExp(value) { + return isObjectLike(value) && baseGetTag(value) == regexpTag; + } /** - * Checks if `value` is likely a prototype object. + * The base implementation of `_.isSet` without Node.js optimizations. * * @private * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a prototype, else `false`. + * @returns {boolean} Returns `true` if `value` is a set, else `false`. */ - function isPrototype(value) { - var Ctor = value && value.constructor, - proto = (typeof Ctor == 'function' && Ctor.prototype) || objectProto; - - return value === proto; + function baseIsSet(value) { + return isObjectLike(value) && getTag(value) == setTag; } /** - * Checks if `value` is suitable for strict equality comparisons, i.e. `===`. + * The base implementation of `_.isTypedArray` without Node.js optimizations. * * @private * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` if suitable for strict - * equality comparisons, else `false`. + * @returns {boolean} Returns `true` if `value` is a typed array, else `false`. */ - function isStrictComparable(value) { - return value === value && !isObject(value); + function baseIsTypedArray(value) { + return isObjectLike(value) && + isLength(value.length) && !!typedArrayTags[baseGetTag(value)]; } /** - * A specialized version of `matchesProperty` for source values suitable - * for strict equality comparisons, i.e. `===`. + * The base implementation of `_.iteratee`. * * @private - * @param {string} key The key of the property to get. - * @param {*} srcValue The value to match. - * @returns {Function} Returns the new spec function. + * @param {*} [value=_.identity] The value to convert to an iteratee. + * @returns {Function} Returns the iteratee. */ - function matchesStrictComparable(key, srcValue) { - return function(object) { - if (object == null) { - return false; - } - return object[key] === srcValue && - (srcValue !== undefined || (key in Object(object))); - }; - } - - /** - * A specialized version of `_.memoize` which clears the memoized function's - * cache when it exceeds `MAX_MEMOIZE_SIZE`. - * - * @private - * @param {Function} func The function to have its output memoized. - * @returns {Function} Returns the new memoized function. - */ - function memoizeCapped(func) { - var result = memoize(func, function(key) { - if (cache.size === MAX_MEMOIZE_SIZE) { - cache.clear(); - } - return key; - }); - - var cache = result.cache; - return result; - } - - /** - * Merges the function metadata of `source` into `data`. - * - * Merging metadata reduces the number of wrappers used to invoke a function. - * This is possible because methods like `_.bind`, `_.curry`, and `_.partial` - * may be applied regardless of execution order. Methods like `_.ary` and - * `_.rearg` modify function arguments, making the order in which they are - * executed important, preventing the merging of metadata. However, we make - * an exception for a safe combined case where curried functions have `_.ary` - * and or `_.rearg` applied. - * - * @private - * @param {Array} data The destination metadata. - * @param {Array} source The source metadata. - * @returns {Array} Returns `data`. - */ - function mergeData(data, source) { - var bitmask = data[1], - srcBitmask = source[1], - newBitmask = bitmask | srcBitmask, - isCommon = newBitmask < (WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG | WRAP_ARY_FLAG); - - var isCombo = - ((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_CURRY_FLAG)) || - ((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_REARG_FLAG) && (data[7].length <= source[8])) || - ((srcBitmask == (WRAP_ARY_FLAG | WRAP_REARG_FLAG)) && (source[7].length <= source[8]) && (bitmask == WRAP_CURRY_FLAG)); - - // Exit early if metadata can't be merged. - if (!(isCommon || isCombo)) { - return data; - } - // Use source `thisArg` if available. - if (srcBitmask & WRAP_BIND_FLAG) { - data[2] = source[2]; - // Set when currying a bound function. - newBitmask |= bitmask & WRAP_BIND_FLAG ? 0 : WRAP_CURRY_BOUND_FLAG; - } - // Compose partial arguments. - var value = source[3]; - if (value) { - var partials = data[3]; - data[3] = partials ? composeArgs(partials, value, source[4]) : value; - data[4] = partials ? replaceHolders(data[3], PLACEHOLDER) : source[4]; - } - // Compose partial right arguments. - value = source[5]; - if (value) { - partials = data[5]; - data[5] = partials ? composeArgsRight(partials, value, source[6]) : value; - data[6] = partials ? replaceHolders(data[5], PLACEHOLDER) : source[6]; - } - // Use source `argPos` if available. - value = source[7]; - if (value) { - data[7] = value; + function baseIteratee(value) { + // Don't store the `typeof` result in a variable to avoid a JIT bug in Safari 9. + // See https://bugs.webkit.org/show_bug.cgi?id=156034 for more details. + if (typeof value == 'function') { + return value; } - // Use source `ary` if it's smaller. - if (srcBitmask & WRAP_ARY_FLAG) { - data[8] = data[8] == null ? source[8] : nativeMin(data[8], source[8]); + if (value == null) { + return identity; } - // Use source `arity` if one is not provided. - if (data[9] == null) { - data[9] = source[9]; + if (typeof value == 'object') { + return isArray(value) + ? baseMatchesProperty(value[0], value[1]) + : baseMatches(value); } - // Use source `func` and merge bitmasks. - data[0] = source[0]; - data[1] = newBitmask; - - return data; + return property(value); } /** - * This function is like - * [`Object.keys`](http://ecma-international.org/ecma-262/7.0/#sec-object.keys) - * except that it includes inherited enumerable properties. + * The base implementation of `_.keys` which doesn't treat sparse arrays as dense. * * @private * @param {Object} object The object to query. * @returns {Array} Returns the array of property names. */ - function nativeKeysIn(object) { + function baseKeys(object) { + if (!isPrototype(object)) { + return nativeKeys(object); + } var result = []; - if (object != null) { - for (var key in Object(object)) { + for (var key in Object(object)) { + if (hasOwnProperty.call(object, key) && key != 'constructor') { result.push(key); } } @@ -9510,19509 +7889,21457 @@ module.exports = function(module) { } /** - * Converts `value` to a string using `Object.prototype.toString`. - * - * @private - * @param {*} value The value to convert. - * @returns {string} Returns the converted string. - */ - function objectToString(value) { - return nativeObjectToString.call(value); - } - - /** - * A specialized version of `baseRest` which transforms the rest array. + * The base implementation of `_.keysIn` which doesn't treat sparse arrays as dense. * * @private - * @param {Function} func The function to apply a rest parameter to. - * @param {number} [start=func.length-1] The start position of the rest parameter. - * @param {Function} transform The rest array transform. - * @returns {Function} Returns the new function. + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property names. */ - function overRest(func, start, transform) { - start = nativeMax(start === undefined ? (func.length - 1) : start, 0); - return function() { - var args = arguments, - index = -1, - length = nativeMax(args.length - start, 0), - array = Array(length); + function baseKeysIn(object) { + if (!isObject(object)) { + return nativeKeysIn(object); + } + var isProto = isPrototype(object), + result = []; - while (++index < length) { - array[index] = args[start + index]; - } - index = -1; - var otherArgs = Array(start + 1); - while (++index < start) { - otherArgs[index] = args[index]; + for (var key in object) { + if (!(key == 'constructor' && (isProto || !hasOwnProperty.call(object, key)))) { + result.push(key); } - otherArgs[start] = transform(array); - return apply(func, this, otherArgs); - }; + } + return result; } /** - * Gets the parent value at `path` of `object`. + * The base implementation of `_.lt` which doesn't coerce arguments. * * @private - * @param {Object} object The object to query. - * @param {Array} path The path to get the parent value of. - * @returns {*} Returns the parent value. + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @returns {boolean} Returns `true` if `value` is less than `other`, + * else `false`. */ - function parent(object, path) { - return path.length < 2 ? object : baseGet(object, baseSlice(path, 0, -1)); + function baseLt(value, other) { + return value < other; } /** - * Reorder `array` according to the specified indexes where the element at - * the first index is assigned as the first element, the element at - * the second index is assigned as the second element, and so on. + * The base implementation of `_.map` without support for iteratee shorthands. * * @private - * @param {Array} array The array to reorder. - * @param {Array} indexes The arranged array indexes. - * @returns {Array} Returns `array`. + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array} Returns the new mapped array. */ - function reorder(array, indexes) { - var arrLength = array.length, - length = nativeMin(indexes.length, arrLength), - oldArray = copyArray(array); + function baseMap(collection, iteratee) { + var index = -1, + result = isArrayLike(collection) ? Array(collection.length) : []; - while (length--) { - var index = indexes[length]; - array[length] = isIndex(index, arrLength) ? oldArray[index] : undefined; - } - return array; + baseEach(collection, function(value, key, collection) { + result[++index] = iteratee(value, key, collection); + }); + return result; } /** - * Sets metadata for `func`. - * - * **Note:** If this function becomes hot, i.e. is invoked a lot in a short - * period of time, it will trip its breaker and transition to an identity - * function to avoid garbage collection pauses in V8. See - * [V8 issue 2070](https://bugs.chromium.org/p/v8/issues/detail?id=2070) - * for more details. + * The base implementation of `_.matches` which doesn't clone `source`. * * @private - * @param {Function} func The function to associate metadata with. - * @param {*} data The metadata. - * @returns {Function} Returns `func`. + * @param {Object} source The object of property values to match. + * @returns {Function} Returns the new spec function. */ - var setData = shortOut(baseSetData); + function baseMatches(source) { + var matchData = getMatchData(source); + if (matchData.length == 1 && matchData[0][2]) { + return matchesStrictComparable(matchData[0][0], matchData[0][1]); + } + return function(object) { + return object === source || baseIsMatch(object, source, matchData); + }; + } /** - * A simple wrapper around the global [`setTimeout`](https://mdn.io/setTimeout). + * The base implementation of `_.matchesProperty` which doesn't clone `srcValue`. * * @private - * @param {Function} func The function to delay. - * @param {number} wait The number of milliseconds to delay invocation. - * @returns {number|Object} Returns the timer id or timeout object. + * @param {string} path The path of the property to get. + * @param {*} srcValue The value to match. + * @returns {Function} Returns the new spec function. */ - var setTimeout = ctxSetTimeout || function(func, wait) { - return root.setTimeout(func, wait); - }; + function baseMatchesProperty(path, srcValue) { + if (isKey(path) && isStrictComparable(srcValue)) { + return matchesStrictComparable(toKey(path), srcValue); + } + return function(object) { + var objValue = get(object, path); + return (objValue === undefined && objValue === srcValue) + ? hasIn(object, path) + : baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG); + }; + } /** - * Sets the `toString` method of `func` to return `string`. + * The base implementation of `_.merge` without support for multiple sources. * * @private - * @param {Function} func The function to modify. - * @param {Function} string The `toString` result. - * @returns {Function} Returns `func`. + * @param {Object} object The destination object. + * @param {Object} source The source object. + * @param {number} srcIndex The index of `source`. + * @param {Function} [customizer] The function to customize merged values. + * @param {Object} [stack] Tracks traversed source values and their merged + * counterparts. */ - var setToString = shortOut(baseSetToString); + function baseMerge(object, source, srcIndex, customizer, stack) { + if (object === source) { + return; + } + baseFor(source, function(srcValue, key) { + if (isObject(srcValue)) { + stack || (stack = new Stack); + baseMergeDeep(object, source, key, srcIndex, baseMerge, customizer, stack); + } + else { + var newValue = customizer + ? customizer(object[key], srcValue, (key + ''), object, source, stack) + : undefined; - /** - * Sets the `toString` method of `wrapper` to mimic the source of `reference` - * with wrapper details in a comment at the top of the source body. - * - * @private - * @param {Function} wrapper The function to modify. - * @param {Function} reference The reference function. - * @param {number} bitmask The bitmask flags. See `createWrap` for more details. - * @returns {Function} Returns `wrapper`. - */ - function setWrapToString(wrapper, reference, bitmask) { - var source = (reference + ''); - return setToString(wrapper, insertWrapDetails(source, updateWrapDetails(getWrapDetails(source), bitmask))); + if (newValue === undefined) { + newValue = srcValue; + } + assignMergeValue(object, key, newValue); + } + }, keysIn); } /** - * Creates a function that'll short out and invoke `identity` instead - * of `func` when it's called `HOT_COUNT` or more times in `HOT_SPAN` - * milliseconds. + * A specialized version of `baseMerge` for arrays and objects which performs + * deep merges and tracks traversed objects enabling objects with circular + * references to be merged. * * @private - * @param {Function} func The function to restrict. - * @returns {Function} Returns the new shortable function. + * @param {Object} object The destination object. + * @param {Object} source The source object. + * @param {string} key The key of the value to merge. + * @param {number} srcIndex The index of `source`. + * @param {Function} mergeFunc The function to merge values. + * @param {Function} [customizer] The function to customize assigned values. + * @param {Object} [stack] Tracks traversed source values and their merged + * counterparts. */ - function shortOut(func) { - var count = 0, - lastCalled = 0; + function baseMergeDeep(object, source, key, srcIndex, mergeFunc, customizer, stack) { + var objValue = object[key], + srcValue = source[key], + stacked = stack.get(srcValue); - return function() { - var stamp = nativeNow(), - remaining = HOT_SPAN - (stamp - lastCalled); + if (stacked) { + assignMergeValue(object, key, stacked); + return; + } + var newValue = customizer + ? customizer(objValue, srcValue, (key + ''), object, source, stack) + : undefined; - lastCalled = stamp; - if (remaining > 0) { - if (++count >= HOT_COUNT) { - return arguments[0]; + var isCommon = newValue === undefined; + + if (isCommon) { + var isArr = isArray(srcValue), + isBuff = !isArr && isBuffer(srcValue), + isTyped = !isArr && !isBuff && isTypedArray(srcValue); + + newValue = srcValue; + if (isArr || isBuff || isTyped) { + if (isArray(objValue)) { + newValue = objValue; + } + else if (isArrayLikeObject(objValue)) { + newValue = copyArray(objValue); + } + else if (isBuff) { + isCommon = false; + newValue = cloneBuffer(srcValue, true); + } + else if (isTyped) { + isCommon = false; + newValue = cloneTypedArray(srcValue, true); + } + else { + newValue = []; } - } else { - count = 0; } - return func.apply(undefined, arguments); - }; + else if (isPlainObject(srcValue) || isArguments(srcValue)) { + newValue = objValue; + if (isArguments(objValue)) { + newValue = toPlainObject(objValue); + } + else if (!isObject(objValue) || (srcIndex && isFunction(objValue))) { + newValue = initCloneObject(srcValue); + } + } + else { + isCommon = false; + } + } + if (isCommon) { + // Recursively merge objects and arrays (susceptible to call stack limits). + stack.set(srcValue, newValue); + mergeFunc(newValue, srcValue, srcIndex, customizer, stack); + stack['delete'](srcValue); + } + assignMergeValue(object, key, newValue); } /** - * A specialized version of `_.shuffle` which mutates and sets the size of `array`. + * The base implementation of `_.nth` which doesn't coerce arguments. * * @private - * @param {Array} array The array to shuffle. - * @param {number} [size=array.length] The size of `array`. - * @returns {Array} Returns `array`. + * @param {Array} array The array to query. + * @param {number} n The index of the element to return. + * @returns {*} Returns the nth element of `array`. */ - function shuffleSelf(array, size) { - var index = -1, - length = array.length, - lastIndex = length - 1; - - size = size === undefined ? length : size; - while (++index < size) { - var rand = baseRandom(index, lastIndex), - value = array[rand]; - - array[rand] = array[index]; - array[index] = value; + function baseNth(array, n) { + var length = array.length; + if (!length) { + return; } - array.length = size; - return array; + n += n < 0 ? length : 0; + return isIndex(n, length) ? array[n] : undefined; } /** - * Converts `string` to a property path array. + * The base implementation of `_.orderBy` without param guards. * * @private - * @param {string} string The string to convert. - * @returns {Array} Returns the property path array. + * @param {Array|Object} collection The collection to iterate over. + * @param {Function[]|Object[]|string[]} iteratees The iteratees to sort by. + * @param {string[]} orders The sort orders of `iteratees`. + * @returns {Array} Returns the new sorted array. */ - var stringToPath = memoizeCapped(function(string) { - var result = []; - if (reLeadingDot.test(string)) { - result.push(''); - } - string.replace(rePropName, function(match, number, quote, string) { - result.push(quote ? string.replace(reEscapeChar, '$1') : (number || match)); + function baseOrderBy(collection, iteratees, orders) { + var index = -1; + iteratees = arrayMap(iteratees.length ? iteratees : [identity], baseUnary(getIteratee())); + + var result = baseMap(collection, function(value, key, collection) { + var criteria = arrayMap(iteratees, function(iteratee) { + return iteratee(value); + }); + return { 'criteria': criteria, 'index': ++index, 'value': value }; }); - return result; - }); + + return baseSortBy(result, function(object, other) { + return compareMultiple(object, other, orders); + }); + } /** - * Converts `value` to a string key if it's not a string or symbol. + * The base implementation of `_.pick` without support for individual + * property identifiers. * * @private - * @param {*} value The value to inspect. - * @returns {string|symbol} Returns the key. + * @param {Object} object The source object. + * @param {string[]} paths The property paths to pick. + * @returns {Object} Returns the new object. */ - function toKey(value) { - if (typeof value == 'string' || isSymbol(value)) { - return value; - } - var result = (value + ''); - return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result; + function basePick(object, paths) { + return basePickBy(object, paths, function(value, path) { + return hasIn(object, path); + }); } /** - * Converts `func` to its source code. + * The base implementation of `_.pickBy` without support for iteratee shorthands. * * @private - * @param {Function} func The function to convert. - * @returns {string} Returns the source code. + * @param {Object} object The source object. + * @param {string[]} paths The property paths to pick. + * @param {Function} predicate The function invoked per property. + * @returns {Object} Returns the new object. */ - function toSource(func) { - if (func != null) { - try { - return funcToString.call(func); - } catch (e) {} - try { - return (func + ''); - } catch (e) {} + function basePickBy(object, paths, predicate) { + var index = -1, + length = paths.length, + result = {}; + + while (++index < length) { + var path = paths[index], + value = baseGet(object, path); + + if (predicate(value, path)) { + baseSet(result, castPath(path, object), value); + } } - return ''; + return result; } /** - * Updates wrapper `details` based on `bitmask` flags. + * A specialized version of `baseProperty` which supports deep paths. * * @private - * @returns {Array} details The details to modify. - * @param {number} bitmask The bitmask flags. See `createWrap` for more details. - * @returns {Array} Returns `details`. + * @param {Array|string} path The path of the property to get. + * @returns {Function} Returns the new accessor function. */ - function updateWrapDetails(details, bitmask) { - arrayEach(wrapFlags, function(pair) { - var value = '_.' + pair[0]; - if ((bitmask & pair[1]) && !arrayIncludes(details, value)) { - details.push(value); - } - }); - return details.sort(); + function basePropertyDeep(path) { + return function(object) { + return baseGet(object, path); + }; } /** - * Creates a clone of `wrapper`. + * The base implementation of `_.pullAllBy` without support for iteratee + * shorthands. * * @private - * @param {Object} wrapper The wrapper to clone. - * @returns {Object} Returns the cloned wrapper. + * @param {Array} array The array to modify. + * @param {Array} values The values to remove. + * @param {Function} [iteratee] The iteratee invoked per element. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns `array`. */ - function wrapperClone(wrapper) { - if (wrapper instanceof LazyWrapper) { - return wrapper.clone(); - } - var result = new LodashWrapper(wrapper.__wrapped__, wrapper.__chain__); - result.__actions__ = copyArray(wrapper.__actions__); - result.__index__ = wrapper.__index__; - result.__values__ = wrapper.__values__; - return result; - } + function basePullAll(array, values, iteratee, comparator) { + var indexOf = comparator ? baseIndexOfWith : baseIndexOf, + index = -1, + length = values.length, + seen = array; - /*------------------------------------------------------------------------*/ + if (array === values) { + values = copyArray(values); + } + if (iteratee) { + seen = arrayMap(array, baseUnary(iteratee)); + } + while (++index < length) { + var fromIndex = 0, + value = values[index], + computed = iteratee ? iteratee(value) : value; + + while ((fromIndex = indexOf(seen, computed, fromIndex, comparator)) > -1) { + if (seen !== array) { + splice.call(seen, fromIndex, 1); + } + splice.call(array, fromIndex, 1); + } + } + return array; + } /** - * Creates an array of elements split into groups the length of `size`. - * If `array` can't be split evenly, the final chunk will be the remaining - * elements. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to process. - * @param {number} [size=1] The length of each chunk - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Array} Returns the new array of chunks. - * @example - * - * _.chunk(['a', 'b', 'c', 'd'], 2); - * // => [['a', 'b'], ['c', 'd']] + * The base implementation of `_.pullAt` without support for individual + * indexes or capturing the removed elements. * - * _.chunk(['a', 'b', 'c', 'd'], 3); - * // => [['a', 'b', 'c'], ['d']] + * @private + * @param {Array} array The array to modify. + * @param {number[]} indexes The indexes of elements to remove. + * @returns {Array} Returns `array`. */ - function chunk(array, size, guard) { - if ((guard ? isIterateeCall(array, size, guard) : size === undefined)) { - size = 1; - } else { - size = nativeMax(toInteger(size), 0); - } - var length = array == null ? 0 : array.length; - if (!length || size < 1) { - return []; - } - var index = 0, - resIndex = 0, - result = Array(nativeCeil(length / size)); + function basePullAt(array, indexes) { + var length = array ? indexes.length : 0, + lastIndex = length - 1; - while (index < length) { - result[resIndex++] = baseSlice(array, index, (index += size)); + while (length--) { + var index = indexes[length]; + if (length == lastIndex || index !== previous) { + var previous = index; + if (isIndex(index)) { + splice.call(array, index, 1); + } else { + baseUnset(array, index); + } + } } - return result; + return array; } /** - * Creates an array with all falsey values removed. The values `false`, `null`, - * `0`, `""`, `undefined`, and `NaN` are falsey. + * The base implementation of `_.random` without support for returning + * floating-point numbers. * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to compact. - * @returns {Array} Returns the new array of filtered values. - * @example + * @private + * @param {number} lower The lower bound. + * @param {number} upper The upper bound. + * @returns {number} Returns the random number. + */ + function baseRandom(lower, upper) { + return lower + nativeFloor(nativeRandom() * (upper - lower + 1)); + } + + /** + * The base implementation of `_.range` and `_.rangeRight` which doesn't + * coerce arguments. * - * _.compact([0, 1, false, 2, '', 3]); - * // => [1, 2, 3] + * @private + * @param {number} start The start of the range. + * @param {number} end The end of the range. + * @param {number} step The value to increment or decrement by. + * @param {boolean} [fromRight] Specify iterating from right to left. + * @returns {Array} Returns the range of numbers. */ - function compact(array) { + function baseRange(start, end, step, fromRight) { var index = -1, - length = array == null ? 0 : array.length, - resIndex = 0, - result = []; + length = nativeMax(nativeCeil((end - start) / (step || 1)), 0), + result = Array(length); - while (++index < length) { - var value = array[index]; - if (value) { - result[resIndex++] = value; - } + while (length--) { + result[fromRight ? length : ++index] = start; + start += step; } return result; } /** - * Creates a new array concatenating `array` with any additional arrays - * and/or values. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to concatenate. - * @param {...*} [values] The values to concatenate. - * @returns {Array} Returns the new concatenated array. - * @example - * - * var array = [1]; - * var other = _.concat(array, 2, [3], [[4]]); - * - * console.log(other); - * // => [1, 2, 3, [4]] + * The base implementation of `_.repeat` which doesn't coerce arguments. * - * console.log(array); - * // => [1] + * @private + * @param {string} string The string to repeat. + * @param {number} n The number of times to repeat the string. + * @returns {string} Returns the repeated string. */ - function concat() { - var length = arguments.length; - if (!length) { - return []; + function baseRepeat(string, n) { + var result = ''; + if (!string || n < 1 || n > MAX_SAFE_INTEGER) { + return result; } - var args = Array(length - 1), - array = arguments[0], - index = length; + // Leverage the exponentiation by squaring algorithm for a faster repeat. + // See https://en.wikipedia.org/wiki/Exponentiation_by_squaring for more details. + do { + if (n % 2) { + result += string; + } + n = nativeFloor(n / 2); + if (n) { + string += string; + } + } while (n); - while (index--) { - args[index - 1] = arguments[index]; - } - return arrayPush(isArray(array) ? copyArray(array) : [array], baseFlatten(args, 1)); + return result; } /** - * Creates an array of `array` values not included in the other given arrays - * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * for equality comparisons. The order and references of result values are - * determined by the first array. - * - * **Note:** Unlike `_.pullAll`, this method returns a new array. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {...Array} [values] The values to exclude. - * @returns {Array} Returns the new array of filtered values. - * @see _.without, _.xor - * @example + * The base implementation of `_.rest` which doesn't validate or coerce arguments. * - * _.difference([2, 1], [2, 3]); - * // => [1] + * @private + * @param {Function} func The function to apply a rest parameter to. + * @param {number} [start=func.length-1] The start position of the rest parameter. + * @returns {Function} Returns the new function. */ - var difference = baseRest(function(array, values) { - return isArrayLikeObject(array) - ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true)) - : []; - }); + function baseRest(func, start) { + return setToString(overRest(func, start, identity), func + ''); + } /** - * This method is like `_.difference` except that it accepts `iteratee` which - * is invoked for each element of `array` and `values` to generate the criterion - * by which they're compared. The order and references of result values are - * determined by the first array. The iteratee is invoked with one argument: - * (value). - * - * **Note:** Unlike `_.pullAllBy`, this method returns a new array. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {...Array} [values] The values to exclude. - * @param {Function} [iteratee=_.identity] The iteratee invoked per element. - * @returns {Array} Returns the new array of filtered values. - * @example - * - * _.differenceBy([2.1, 1.2], [2.3, 3.4], Math.floor); - * // => [1.2] + * The base implementation of `_.sample`. * - * // The `_.property` iteratee shorthand. - * _.differenceBy([{ 'x': 2 }, { 'x': 1 }], [{ 'x': 1 }], 'x'); - * // => [{ 'x': 2 }] + * @private + * @param {Array|Object} collection The collection to sample. + * @returns {*} Returns the random element. */ - var differenceBy = baseRest(function(array, values) { - var iteratee = last(values); - if (isArrayLikeObject(iteratee)) { - iteratee = undefined; - } - return isArrayLikeObject(array) - ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), getIteratee(iteratee, 2)) - : []; - }); + function baseSample(collection) { + return arraySample(values(collection)); + } /** - * This method is like `_.difference` except that it accepts `comparator` - * which is invoked to compare elements of `array` to `values`. The order and - * references of result values are determined by the first array. The comparator - * is invoked with two arguments: (arrVal, othVal). - * - * **Note:** Unlike `_.pullAllWith`, this method returns a new array. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {...Array} [values] The values to exclude. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns the new array of filtered values. - * @example - * - * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; + * The base implementation of `_.sampleSize` without param guards. * - * _.differenceWith(objects, [{ 'x': 1, 'y': 2 }], _.isEqual); - * // => [{ 'x': 2, 'y': 1 }] + * @private + * @param {Array|Object} collection The collection to sample. + * @param {number} n The number of elements to sample. + * @returns {Array} Returns the random elements. */ - var differenceWith = baseRest(function(array, values) { - var comparator = last(values); - if (isArrayLikeObject(comparator)) { - comparator = undefined; - } - return isArrayLikeObject(array) - ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), undefined, comparator) - : []; - }); + function baseSampleSize(collection, n) { + var array = values(collection); + return shuffleSelf(array, baseClamp(n, 0, array.length)); + } /** - * Creates a slice of `array` with `n` elements dropped from the beginning. - * - * @static - * @memberOf _ - * @since 0.5.0 - * @category Array - * @param {Array} array The array to query. - * @param {number} [n=1] The number of elements to drop. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Array} Returns the slice of `array`. - * @example - * - * _.drop([1, 2, 3]); - * // => [2, 3] - * - * _.drop([1, 2, 3], 2); - * // => [3] - * - * _.drop([1, 2, 3], 5); - * // => [] + * The base implementation of `_.set`. * - * _.drop([1, 2, 3], 0); - * // => [1, 2, 3] + * @private + * @param {Object} object The object to modify. + * @param {Array|string} path The path of the property to set. + * @param {*} value The value to set. + * @param {Function} [customizer] The function to customize path creation. + * @returns {Object} Returns `object`. */ - function drop(array, n, guard) { - var length = array == null ? 0 : array.length; - if (!length) { - return []; + function baseSet(object, path, value, customizer) { + if (!isObject(object)) { + return object; } - n = (guard || n === undefined) ? 1 : toInteger(n); - return baseSlice(array, n < 0 ? 0 : n, length); + path = castPath(path, object); + + var index = -1, + length = path.length, + lastIndex = length - 1, + nested = object; + + while (nested != null && ++index < length) { + var key = toKey(path[index]), + newValue = value; + + if (index != lastIndex) { + var objValue = nested[key]; + newValue = customizer ? customizer(objValue, key, nested) : undefined; + if (newValue === undefined) { + newValue = isObject(objValue) + ? objValue + : (isIndex(path[index + 1]) ? [] : {}); + } + } + assignValue(nested, key, newValue); + nested = nested[key]; + } + return object; } /** - * Creates a slice of `array` with `n` elements dropped from the end. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to query. - * @param {number} [n=1] The number of elements to drop. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Array} Returns the slice of `array`. - * @example - * - * _.dropRight([1, 2, 3]); - * // => [1, 2] - * - * _.dropRight([1, 2, 3], 2); - * // => [1] - * - * _.dropRight([1, 2, 3], 5); - * // => [] + * The base implementation of `setData` without support for hot loop shorting. * - * _.dropRight([1, 2, 3], 0); - * // => [1, 2, 3] + * @private + * @param {Function} func The function to associate metadata with. + * @param {*} data The metadata. + * @returns {Function} Returns `func`. */ - function dropRight(array, n, guard) { - var length = array == null ? 0 : array.length; - if (!length) { - return []; - } - n = (guard || n === undefined) ? 1 : toInteger(n); - n = length - n; - return baseSlice(array, 0, n < 0 ? 0 : n); - } + var baseSetData = !metaMap ? identity : function(func, data) { + metaMap.set(func, data); + return func; + }; /** - * Creates a slice of `array` excluding elements dropped from the end. - * Elements are dropped until `predicate` returns falsey. The predicate is - * invoked with three arguments: (value, index, array). - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to query. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {Array} Returns the slice of `array`. - * @example - * - * var users = [ - * { 'user': 'barney', 'active': true }, - * { 'user': 'fred', 'active': false }, - * { 'user': 'pebbles', 'active': false } - * ]; - * - * _.dropRightWhile(users, function(o) { return !o.active; }); - * // => objects for ['barney'] - * - * // The `_.matches` iteratee shorthand. - * _.dropRightWhile(users, { 'user': 'pebbles', 'active': false }); - * // => objects for ['barney', 'fred'] + * The base implementation of `setToString` without support for hot loop shorting. * - * // The `_.matchesProperty` iteratee shorthand. - * _.dropRightWhile(users, ['active', false]); - * // => objects for ['barney'] + * @private + * @param {Function} func The function to modify. + * @param {Function} string The `toString` result. + * @returns {Function} Returns `func`. + */ + var baseSetToString = !defineProperty ? identity : function(func, string) { + return defineProperty(func, 'toString', { + 'configurable': true, + 'enumerable': false, + 'value': constant(string), + 'writable': true + }); + }; + + /** + * The base implementation of `_.shuffle`. * - * // The `_.property` iteratee shorthand. - * _.dropRightWhile(users, 'active'); - * // => objects for ['barney', 'fred', 'pebbles'] + * @private + * @param {Array|Object} collection The collection to shuffle. + * @returns {Array} Returns the new shuffled array. */ - function dropRightWhile(array, predicate) { - return (array && array.length) - ? baseWhile(array, getIteratee(predicate, 3), true, true) - : []; + function baseShuffle(collection) { + return shuffleSelf(values(collection)); } /** - * Creates a slice of `array` excluding elements dropped from the beginning. - * Elements are dropped until `predicate` returns falsey. The predicate is - * invoked with three arguments: (value, index, array). + * The base implementation of `_.slice` without an iteratee call guard. * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to query. - * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @private + * @param {Array} array The array to slice. + * @param {number} [start=0] The start position. + * @param {number} [end=array.length] The end position. * @returns {Array} Returns the slice of `array`. - * @example - * - * var users = [ - * { 'user': 'barney', 'active': false }, - * { 'user': 'fred', 'active': false }, - * { 'user': 'pebbles', 'active': true } - * ]; - * - * _.dropWhile(users, function(o) { return !o.active; }); - * // => objects for ['pebbles'] - * - * // The `_.matches` iteratee shorthand. - * _.dropWhile(users, { 'user': 'barney', 'active': false }); - * // => objects for ['fred', 'pebbles'] - * - * // The `_.matchesProperty` iteratee shorthand. - * _.dropWhile(users, ['active', false]); - * // => objects for ['pebbles'] - * - * // The `_.property` iteratee shorthand. - * _.dropWhile(users, 'active'); - * // => objects for ['barney', 'fred', 'pebbles'] */ - function dropWhile(array, predicate) { - return (array && array.length) - ? baseWhile(array, getIteratee(predicate, 3), true) - : []; + function baseSlice(array, start, end) { + var index = -1, + length = array.length; + + if (start < 0) { + start = -start > length ? 0 : (length + start); + } + end = end > length ? length : end; + if (end < 0) { + end += length; + } + length = start > end ? 0 : ((end - start) >>> 0); + start >>>= 0; + + var result = Array(length); + while (++index < length) { + result[index] = array[index + start]; + } + return result; } /** - * Fills elements of `array` with `value` from `start` up to, but not - * including, `end`. + * The base implementation of `_.some` without support for iteratee shorthands. * - * **Note:** This method mutates `array`. - * - * @static - * @memberOf _ - * @since 3.2.0 - * @category Array - * @param {Array} array The array to fill. - * @param {*} value The value to fill `array` with. - * @param {number} [start=0] The start position. - * @param {number} [end=array.length] The end position. - * @returns {Array} Returns `array`. - * @example - * - * var array = [1, 2, 3]; - * - * _.fill(array, 'a'); - * console.log(array); - * // => ['a', 'a', 'a'] - * - * _.fill(Array(3), 2); - * // => [2, 2, 2] - * - * _.fill([4, 6, 8, 10], '*', 1, 3); - * // => [4, '*', '*', 10] + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} predicate The function invoked per iteration. + * @returns {boolean} Returns `true` if any element passes the predicate check, + * else `false`. */ - function fill(array, value, start, end) { - var length = array == null ? 0 : array.length; - if (!length) { - return []; - } - if (start && typeof start != 'number' && isIterateeCall(array, value, start)) { - start = 0; - end = length; - } - return baseFill(array, value, start, end); + function baseSome(collection, predicate) { + var result; + + baseEach(collection, function(value, index, collection) { + result = predicate(value, index, collection); + return !result; + }); + return !!result; } /** - * This method is like `_.find` except that it returns the index of the first - * element `predicate` returns truthy for instead of the element itself. - * - * @static - * @memberOf _ - * @since 1.1.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @param {number} [fromIndex=0] The index to search from. - * @returns {number} Returns the index of the found element, else `-1`. - * @example - * - * var users = [ - * { 'user': 'barney', 'active': false }, - * { 'user': 'fred', 'active': false }, - * { 'user': 'pebbles', 'active': true } - * ]; - * - * _.findIndex(users, function(o) { return o.user == 'barney'; }); - * // => 0 - * - * // The `_.matches` iteratee shorthand. - * _.findIndex(users, { 'user': 'fred', 'active': false }); - * // => 1 - * - * // The `_.matchesProperty` iteratee shorthand. - * _.findIndex(users, ['active', false]); - * // => 0 + * The base implementation of `_.sortedIndex` and `_.sortedLastIndex` which + * performs a binary search of `array` to determine the index at which `value` + * should be inserted into `array` in order to maintain its sort order. * - * // The `_.property` iteratee shorthand. - * _.findIndex(users, 'active'); - * // => 2 + * @private + * @param {Array} array The sorted array to inspect. + * @param {*} value The value to evaluate. + * @param {boolean} [retHighest] Specify returning the highest qualified index. + * @returns {number} Returns the index at which `value` should be inserted + * into `array`. */ - function findIndex(array, predicate, fromIndex) { - var length = array == null ? 0 : array.length; - if (!length) { - return -1; - } - var index = fromIndex == null ? 0 : toInteger(fromIndex); - if (index < 0) { - index = nativeMax(length + index, 0); + function baseSortedIndex(array, value, retHighest) { + var low = 0, + high = array == null ? low : array.length; + + if (typeof value == 'number' && value === value && high <= HALF_MAX_ARRAY_LENGTH) { + while (low < high) { + var mid = (low + high) >>> 1, + computed = array[mid]; + + if (computed !== null && !isSymbol(computed) && + (retHighest ? (computed <= value) : (computed < value))) { + low = mid + 1; + } else { + high = mid; + } + } + return high; } - return baseFindIndex(array, getIteratee(predicate, 3), index); + return baseSortedIndexBy(array, value, identity, retHighest); } /** - * This method is like `_.findIndex` except that it iterates over elements - * of `collection` from right to left. - * - * @static - * @memberOf _ - * @since 2.0.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @param {number} [fromIndex=array.length-1] The index to search from. - * @returns {number} Returns the index of the found element, else `-1`. - * @example - * - * var users = [ - * { 'user': 'barney', 'active': true }, - * { 'user': 'fred', 'active': false }, - * { 'user': 'pebbles', 'active': false } - * ]; - * - * _.findLastIndex(users, function(o) { return o.user == 'pebbles'; }); - * // => 2 - * - * // The `_.matches` iteratee shorthand. - * _.findLastIndex(users, { 'user': 'barney', 'active': true }); - * // => 0 - * - * // The `_.matchesProperty` iteratee shorthand. - * _.findLastIndex(users, ['active', false]); - * // => 2 + * The base implementation of `_.sortedIndexBy` and `_.sortedLastIndexBy` + * which invokes `iteratee` for `value` and each element of `array` to compute + * their sort ranking. The iteratee is invoked with one argument; (value). * - * // The `_.property` iteratee shorthand. - * _.findLastIndex(users, 'active'); - * // => 0 + * @private + * @param {Array} array The sorted array to inspect. + * @param {*} value The value to evaluate. + * @param {Function} iteratee The iteratee invoked per element. + * @param {boolean} [retHighest] Specify returning the highest qualified index. + * @returns {number} Returns the index at which `value` should be inserted + * into `array`. */ - function findLastIndex(array, predicate, fromIndex) { - var length = array == null ? 0 : array.length; - if (!length) { - return -1; - } - var index = length - 1; - if (fromIndex !== undefined) { - index = toInteger(fromIndex); - index = fromIndex < 0 - ? nativeMax(length + index, 0) - : nativeMin(index, length - 1); + function baseSortedIndexBy(array, value, iteratee, retHighest) { + value = iteratee(value); + + var low = 0, + high = array == null ? 0 : array.length, + valIsNaN = value !== value, + valIsNull = value === null, + valIsSymbol = isSymbol(value), + valIsUndefined = value === undefined; + + while (low < high) { + var mid = nativeFloor((low + high) / 2), + computed = iteratee(array[mid]), + othIsDefined = computed !== undefined, + othIsNull = computed === null, + othIsReflexive = computed === computed, + othIsSymbol = isSymbol(computed); + + if (valIsNaN) { + var setLow = retHighest || othIsReflexive; + } else if (valIsUndefined) { + setLow = othIsReflexive && (retHighest || othIsDefined); + } else if (valIsNull) { + setLow = othIsReflexive && othIsDefined && (retHighest || !othIsNull); + } else if (valIsSymbol) { + setLow = othIsReflexive && othIsDefined && !othIsNull && (retHighest || !othIsSymbol); + } else if (othIsNull || othIsSymbol) { + setLow = false; + } else { + setLow = retHighest ? (computed <= value) : (computed < value); + } + if (setLow) { + low = mid + 1; + } else { + high = mid; + } } - return baseFindIndex(array, getIteratee(predicate, 3), index, true); + return nativeMin(high, MAX_ARRAY_INDEX); } /** - * Flattens `array` a single level deep. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to flatten. - * @returns {Array} Returns the new flattened array. - * @example + * The base implementation of `_.sortedUniq` and `_.sortedUniqBy` without + * support for iteratee shorthands. * - * _.flatten([1, [2, [3, [4]], 5]]); - * // => [1, 2, [3, [4]], 5] + * @private + * @param {Array} array The array to inspect. + * @param {Function} [iteratee] The iteratee invoked per element. + * @returns {Array} Returns the new duplicate free array. */ - function flatten(array) { - var length = array == null ? 0 : array.length; - return length ? baseFlatten(array, 1) : []; + function baseSortedUniq(array, iteratee) { + var index = -1, + length = array.length, + resIndex = 0, + result = []; + + while (++index < length) { + var value = array[index], + computed = iteratee ? iteratee(value) : value; + + if (!index || !eq(computed, seen)) { + var seen = computed; + result[resIndex++] = value === 0 ? 0 : value; + } + } + return result; } /** - * Recursively flattens `array`. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to flatten. - * @returns {Array} Returns the new flattened array. - * @example + * The base implementation of `_.toNumber` which doesn't ensure correct + * conversions of binary, hexadecimal, or octal string values. * - * _.flattenDeep([1, [2, [3, [4]], 5]]); - * // => [1, 2, 3, 4, 5] + * @private + * @param {*} value The value to process. + * @returns {number} Returns the number. */ - function flattenDeep(array) { - var length = array == null ? 0 : array.length; - return length ? baseFlatten(array, INFINITY) : []; + function baseToNumber(value) { + if (typeof value == 'number') { + return value; + } + if (isSymbol(value)) { + return NAN; + } + return +value; } /** - * Recursively flatten `array` up to `depth` times. - * - * @static - * @memberOf _ - * @since 4.4.0 - * @category Array - * @param {Array} array The array to flatten. - * @param {number} [depth=1] The maximum recursion depth. - * @returns {Array} Returns the new flattened array. - * @example - * - * var array = [1, [2, [3, [4]], 5]]; - * - * _.flattenDepth(array, 1); - * // => [1, 2, [3, [4]], 5] + * The base implementation of `_.toString` which doesn't convert nullish + * values to empty strings. * - * _.flattenDepth(array, 2); - * // => [1, 2, 3, [4], 5] + * @private + * @param {*} value The value to process. + * @returns {string} Returns the string. */ - function flattenDepth(array, depth) { - var length = array == null ? 0 : array.length; - if (!length) { - return []; + function baseToString(value) { + // Exit early for strings to avoid a performance hit in some environments. + if (typeof value == 'string') { + return value; } - depth = depth === undefined ? 1 : toInteger(depth); - return baseFlatten(array, depth); + if (isArray(value)) { + // Recursively convert values (susceptible to call stack limits). + return arrayMap(value, baseToString) + ''; + } + if (isSymbol(value)) { + return symbolToString ? symbolToString.call(value) : ''; + } + var result = (value + ''); + return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result; } /** - * The inverse of `_.toPairs`; this method returns an object composed - * from key-value `pairs`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} pairs The key-value pairs. - * @returns {Object} Returns the new object. - * @example + * The base implementation of `_.uniqBy` without support for iteratee shorthands. * - * _.fromPairs([['a', 1], ['b', 2]]); - * // => { 'a': 1, 'b': 2 } + * @private + * @param {Array} array The array to inspect. + * @param {Function} [iteratee] The iteratee invoked per element. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new duplicate free array. */ - function fromPairs(pairs) { + function baseUniq(array, iteratee, comparator) { var index = -1, - length = pairs == null ? 0 : pairs.length, - result = {}; + includes = arrayIncludes, + length = array.length, + isCommon = true, + result = [], + seen = result; + if (comparator) { + isCommon = false; + includes = arrayIncludesWith; + } + else if (length >= LARGE_ARRAY_SIZE) { + var set = iteratee ? null : createSet(array); + if (set) { + return setToArray(set); + } + isCommon = false; + includes = cacheHas; + seen = new SetCache; + } + else { + seen = iteratee ? [] : result; + } + outer: while (++index < length) { - var pair = pairs[index]; - result[pair[0]] = pair[1]; + var value = array[index], + computed = iteratee ? iteratee(value) : value; + + value = (comparator || value !== 0) ? value : 0; + if (isCommon && computed === computed) { + var seenIndex = seen.length; + while (seenIndex--) { + if (seen[seenIndex] === computed) { + continue outer; + } + } + if (iteratee) { + seen.push(computed); + } + result.push(value); + } + else if (!includes(seen, computed, comparator)) { + if (seen !== result) { + seen.push(computed); + } + result.push(value); + } } return result; } /** - * Gets the first element of `array`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @alias first - * @category Array - * @param {Array} array The array to query. - * @returns {*} Returns the first element of `array`. - * @example - * - * _.head([1, 2, 3]); - * // => 1 + * The base implementation of `_.unset`. * - * _.head([]); - * // => undefined + * @private + * @param {Object} object The object to modify. + * @param {Array|string} path The property path to unset. + * @returns {boolean} Returns `true` if the property is deleted, else `false`. */ - function head(array) { - return (array && array.length) ? array[0] : undefined; + function baseUnset(object, path) { + path = castPath(path, object); + object = parent(object, path); + return object == null || delete object[toKey(last(path))]; } /** - * Gets the index at which the first occurrence of `value` is found in `array` - * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * for equality comparisons. If `fromIndex` is negative, it's used as the - * offset from the end of `array`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {*} value The value to search for. - * @param {number} [fromIndex=0] The index to search from. - * @returns {number} Returns the index of the matched value, else `-1`. - * @example - * - * _.indexOf([1, 2, 1, 2], 2); - * // => 1 + * The base implementation of `_.update`. * - * // Search from the `fromIndex`. - * _.indexOf([1, 2, 1, 2], 2, 2); - * // => 3 + * @private + * @param {Object} object The object to modify. + * @param {Array|string} path The path of the property to update. + * @param {Function} updater The function to produce the updated value. + * @param {Function} [customizer] The function to customize path creation. + * @returns {Object} Returns `object`. */ - function indexOf(array, value, fromIndex) { - var length = array == null ? 0 : array.length; - if (!length) { - return -1; - } - var index = fromIndex == null ? 0 : toInteger(fromIndex); - if (index < 0) { - index = nativeMax(length + index, 0); - } - return baseIndexOf(array, value, index); + function baseUpdate(object, path, updater, customizer) { + return baseSet(object, path, updater(baseGet(object, path)), customizer); } /** - * Gets all but the last element of `array`. + * The base implementation of methods like `_.dropWhile` and `_.takeWhile` + * without support for iteratee shorthands. * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array + * @private * @param {Array} array The array to query. + * @param {Function} predicate The function invoked per iteration. + * @param {boolean} [isDrop] Specify dropping elements instead of taking them. + * @param {boolean} [fromRight] Specify iterating from right to left. * @returns {Array} Returns the slice of `array`. - * @example - * - * _.initial([1, 2, 3]); - * // => [1, 2] */ - function initial(array) { - var length = array == null ? 0 : array.length; - return length ? baseSlice(array, 0, -1) : []; + function baseWhile(array, predicate, isDrop, fromRight) { + var length = array.length, + index = fromRight ? length : -1; + + while ((fromRight ? index-- : ++index < length) && + predicate(array[index], index, array)) {} + + return isDrop + ? baseSlice(array, (fromRight ? 0 : index), (fromRight ? index + 1 : length)) + : baseSlice(array, (fromRight ? index + 1 : 0), (fromRight ? length : index)); } /** - * Creates an array of unique values that are included in all given arrays - * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * for equality comparisons. The order and references of result values are - * determined by the first array. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {...Array} [arrays] The arrays to inspect. - * @returns {Array} Returns the new array of intersecting values. - * @example + * The base implementation of `wrapperValue` which returns the result of + * performing a sequence of actions on the unwrapped `value`, where each + * successive action is supplied the return value of the previous. * - * _.intersection([2, 1], [2, 3]); - * // => [2] + * @private + * @param {*} value The unwrapped value. + * @param {Array} actions Actions to perform to resolve the unwrapped value. + * @returns {*} Returns the resolved value. */ - var intersection = baseRest(function(arrays) { - var mapped = arrayMap(arrays, castArrayLikeObject); - return (mapped.length && mapped[0] === arrays[0]) - ? baseIntersection(mapped) - : []; - }); + function baseWrapperValue(value, actions) { + var result = value; + if (result instanceof LazyWrapper) { + result = result.value(); + } + return arrayReduce(actions, function(result, action) { + return action.func.apply(action.thisArg, arrayPush([result], action.args)); + }, result); + } /** - * This method is like `_.intersection` except that it accepts `iteratee` - * which is invoked for each element of each `arrays` to generate the criterion - * by which they're compared. The order and references of result values are - * determined by the first array. The iteratee is invoked with one argument: - * (value). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {...Array} [arrays] The arrays to inspect. - * @param {Function} [iteratee=_.identity] The iteratee invoked per element. - * @returns {Array} Returns the new array of intersecting values. - * @example - * - * _.intersectionBy([2.1, 1.2], [2.3, 3.4], Math.floor); - * // => [2.1] + * The base implementation of methods like `_.xor`, without support for + * iteratee shorthands, that accepts an array of arrays to inspect. * - * // The `_.property` iteratee shorthand. - * _.intersectionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x'); - * // => [{ 'x': 1 }] + * @private + * @param {Array} arrays The arrays to inspect. + * @param {Function} [iteratee] The iteratee invoked per element. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new array of values. */ - var intersectionBy = baseRest(function(arrays) { - var iteratee = last(arrays), - mapped = arrayMap(arrays, castArrayLikeObject); + function baseXor(arrays, iteratee, comparator) { + var length = arrays.length; + if (length < 2) { + return length ? baseUniq(arrays[0]) : []; + } + var index = -1, + result = Array(length); - if (iteratee === last(mapped)) { - iteratee = undefined; - } else { - mapped.pop(); + while (++index < length) { + var array = arrays[index], + othIndex = -1; + + while (++othIndex < length) { + if (othIndex != index) { + result[index] = baseDifference(result[index] || array, arrays[othIndex], iteratee, comparator); + } + } } - return (mapped.length && mapped[0] === arrays[0]) - ? baseIntersection(mapped, getIteratee(iteratee, 2)) - : []; - }); + return baseUniq(baseFlatten(result, 1), iteratee, comparator); + } /** - * This method is like `_.intersection` except that it accepts `comparator` - * which is invoked to compare elements of `arrays`. The order and references - * of result values are determined by the first array. The comparator is - * invoked with two arguments: (arrVal, othVal). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {...Array} [arrays] The arrays to inspect. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns the new array of intersecting values. - * @example - * - * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; - * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }]; + * This base implementation of `_.zipObject` which assigns values using `assignFunc`. * - * _.intersectionWith(objects, others, _.isEqual); - * // => [{ 'x': 1, 'y': 2 }] + * @private + * @param {Array} props The property identifiers. + * @param {Array} values The property values. + * @param {Function} assignFunc The function to assign values. + * @returns {Object} Returns the new object. */ - var intersectionWith = baseRest(function(arrays) { - var comparator = last(arrays), - mapped = arrayMap(arrays, castArrayLikeObject); + function baseZipObject(props, values, assignFunc) { + var index = -1, + length = props.length, + valsLength = values.length, + result = {}; - comparator = typeof comparator == 'function' ? comparator : undefined; - if (comparator) { - mapped.pop(); + while (++index < length) { + var value = index < valsLength ? values[index] : undefined; + assignFunc(result, props[index], value); } - return (mapped.length && mapped[0] === arrays[0]) - ? baseIntersection(mapped, undefined, comparator) - : []; - }); + return result; + } /** - * Converts all elements in `array` into a string separated by `separator`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to convert. - * @param {string} [separator=','] The element separator. - * @returns {string} Returns the joined string. - * @example + * Casts `value` to an empty array if it's not an array like object. * - * _.join(['a', 'b', 'c'], '~'); - * // => 'a~b~c' + * @private + * @param {*} value The value to inspect. + * @returns {Array|Object} Returns the cast array-like object. */ - function join(array, separator) { - return array == null ? '' : nativeJoin.call(array, separator); + function castArrayLikeObject(value) { + return isArrayLikeObject(value) ? value : []; } /** - * Gets the last element of `array`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to query. - * @returns {*} Returns the last element of `array`. - * @example + * Casts `value` to `identity` if it's not a function. * - * _.last([1, 2, 3]); - * // => 3 + * @private + * @param {*} value The value to inspect. + * @returns {Function} Returns cast function. */ - function last(array) { - var length = array == null ? 0 : array.length; - return length ? array[length - 1] : undefined; + function castFunction(value) { + return typeof value == 'function' ? value : identity; } /** - * This method is like `_.indexOf` except that it iterates over elements of - * `array` from right to left. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {*} value The value to search for. - * @param {number} [fromIndex=array.length-1] The index to search from. - * @returns {number} Returns the index of the matched value, else `-1`. - * @example - * - * _.lastIndexOf([1, 2, 1, 2], 2); - * // => 3 + * Casts `value` to a path array if it's not one. * - * // Search from the `fromIndex`. - * _.lastIndexOf([1, 2, 1, 2], 2, 2); - * // => 1 + * @private + * @param {*} value The value to inspect. + * @param {Object} [object] The object to query keys on. + * @returns {Array} Returns the cast property path array. */ - function lastIndexOf(array, value, fromIndex) { - var length = array == null ? 0 : array.length; - if (!length) { - return -1; - } - var index = length; - if (fromIndex !== undefined) { - index = toInteger(fromIndex); - index = index < 0 ? nativeMax(length + index, 0) : nativeMin(index, length - 1); + function castPath(value, object) { + if (isArray(value)) { + return value; } - return value === value - ? strictLastIndexOf(array, value, index) - : baseFindIndex(array, baseIsNaN, index, true); + return isKey(value, object) ? [value] : stringToPath(toString(value)); } /** - * Gets the element at index `n` of `array`. If `n` is negative, the nth - * element from the end is returned. - * - * @static - * @memberOf _ - * @since 4.11.0 - * @category Array - * @param {Array} array The array to query. - * @param {number} [n=0] The index of the element to return. - * @returns {*} Returns the nth element of `array`. - * @example - * - * var array = ['a', 'b', 'c', 'd']; + * A `baseRest` alias which can be replaced with `identity` by module + * replacement plugins. * - * _.nth(array, 1); - * // => 'b' + * @private + * @type {Function} + * @param {Function} func The function to apply a rest parameter to. + * @returns {Function} Returns the new function. + */ + var castRest = baseRest; + + /** + * Casts `array` to a slice if it's needed. * - * _.nth(array, -2); - * // => 'c'; + * @private + * @param {Array} array The array to inspect. + * @param {number} start The start position. + * @param {number} [end=array.length] The end position. + * @returns {Array} Returns the cast slice. */ - function nth(array, n) { - return (array && array.length) ? baseNth(array, toInteger(n)) : undefined; + function castSlice(array, start, end) { + var length = array.length; + end = end === undefined ? length : end; + return (!start && end >= length) ? array : baseSlice(array, start, end); } /** - * Removes all given values from `array` using - * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * for equality comparisons. - * - * **Note:** Unlike `_.without`, this method mutates `array`. Use `_.remove` - * to remove elements from an array by predicate. - * - * @static - * @memberOf _ - * @since 2.0.0 - * @category Array - * @param {Array} array The array to modify. - * @param {...*} [values] The values to remove. - * @returns {Array} Returns `array`. - * @example - * - * var array = ['a', 'b', 'c', 'a', 'b', 'c']; + * A simple wrapper around the global [`clearTimeout`](https://mdn.io/clearTimeout). * - * _.pull(array, 'a', 'c'); - * console.log(array); - * // => ['b', 'b'] + * @private + * @param {number|Object} id The timer id or timeout object of the timer to clear. */ - var pull = baseRest(pullAll); + var clearTimeout = ctxClearTimeout || function(id) { + return root.clearTimeout(id); + }; /** - * This method is like `_.pull` except that it accepts an array of values to remove. - * - * **Note:** Unlike `_.difference`, this method mutates `array`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to modify. - * @param {Array} values The values to remove. - * @returns {Array} Returns `array`. - * @example - * - * var array = ['a', 'b', 'c', 'a', 'b', 'c']; + * Creates a clone of `buffer`. * - * _.pullAll(array, ['a', 'c']); - * console.log(array); - * // => ['b', 'b'] + * @private + * @param {Buffer} buffer The buffer to clone. + * @param {boolean} [isDeep] Specify a deep clone. + * @returns {Buffer} Returns the cloned buffer. */ - function pullAll(array, values) { - return (array && array.length && values && values.length) - ? basePullAll(array, values) - : array; + function cloneBuffer(buffer, isDeep) { + if (isDeep) { + return buffer.slice(); + } + var length = buffer.length, + result = allocUnsafe ? allocUnsafe(length) : new buffer.constructor(length); + + buffer.copy(result); + return result; } /** - * This method is like `_.pullAll` except that it accepts `iteratee` which is - * invoked for each element of `array` and `values` to generate the criterion - * by which they're compared. The iteratee is invoked with one argument: (value). - * - * **Note:** Unlike `_.differenceBy`, this method mutates `array`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to modify. - * @param {Array} values The values to remove. - * @param {Function} [iteratee=_.identity] The iteratee invoked per element. - * @returns {Array} Returns `array`. - * @example - * - * var array = [{ 'x': 1 }, { 'x': 2 }, { 'x': 3 }, { 'x': 1 }]; + * Creates a clone of `arrayBuffer`. * - * _.pullAllBy(array, [{ 'x': 1 }, { 'x': 3 }], 'x'); - * console.log(array); - * // => [{ 'x': 2 }] + * @private + * @param {ArrayBuffer} arrayBuffer The array buffer to clone. + * @returns {ArrayBuffer} Returns the cloned array buffer. */ - function pullAllBy(array, values, iteratee) { - return (array && array.length && values && values.length) - ? basePullAll(array, values, getIteratee(iteratee, 2)) - : array; + function cloneArrayBuffer(arrayBuffer) { + var result = new arrayBuffer.constructor(arrayBuffer.byteLength); + new Uint8Array(result).set(new Uint8Array(arrayBuffer)); + return result; } /** - * This method is like `_.pullAll` except that it accepts `comparator` which - * is invoked to compare elements of `array` to `values`. The comparator is - * invoked with two arguments: (arrVal, othVal). - * - * **Note:** Unlike `_.differenceWith`, this method mutates `array`. - * - * @static - * @memberOf _ - * @since 4.6.0 - * @category Array - * @param {Array} array The array to modify. - * @param {Array} values The values to remove. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns `array`. - * @example - * - * var array = [{ 'x': 1, 'y': 2 }, { 'x': 3, 'y': 4 }, { 'x': 5, 'y': 6 }]; + * Creates a clone of `dataView`. * - * _.pullAllWith(array, [{ 'x': 3, 'y': 4 }], _.isEqual); - * console.log(array); - * // => [{ 'x': 1, 'y': 2 }, { 'x': 5, 'y': 6 }] + * @private + * @param {Object} dataView The data view to clone. + * @param {boolean} [isDeep] Specify a deep clone. + * @returns {Object} Returns the cloned data view. */ - function pullAllWith(array, values, comparator) { - return (array && array.length && values && values.length) - ? basePullAll(array, values, undefined, comparator) - : array; + function cloneDataView(dataView, isDeep) { + var buffer = isDeep ? cloneArrayBuffer(dataView.buffer) : dataView.buffer; + return new dataView.constructor(buffer, dataView.byteOffset, dataView.byteLength); } /** - * Removes elements from `array` corresponding to `indexes` and returns an - * array of removed elements. - * - * **Note:** Unlike `_.at`, this method mutates `array`. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to modify. - * @param {...(number|number[])} [indexes] The indexes of elements to remove. - * @returns {Array} Returns the new array of removed elements. - * @example - * - * var array = ['a', 'b', 'c', 'd']; - * var pulled = _.pullAt(array, [1, 3]); - * - * console.log(array); - * // => ['a', 'c'] + * Creates a clone of `map`. * - * console.log(pulled); - * // => ['b', 'd'] + * @private + * @param {Object} map The map to clone. + * @param {Function} cloneFunc The function to clone values. + * @param {boolean} [isDeep] Specify a deep clone. + * @returns {Object} Returns the cloned map. */ - var pullAt = flatRest(function(array, indexes) { - var length = array == null ? 0 : array.length, - result = baseAt(array, indexes); - - basePullAt(array, arrayMap(indexes, function(index) { - return isIndex(index, length) ? +index : index; - }).sort(compareAscending)); - - return result; - }); + function cloneMap(map, isDeep, cloneFunc) { + var array = isDeep ? cloneFunc(mapToArray(map), CLONE_DEEP_FLAG) : mapToArray(map); + return arrayReduce(array, addMapEntry, new map.constructor); + } /** - * Removes all elements from `array` that `predicate` returns truthy for - * and returns an array of the removed elements. The predicate is invoked - * with three arguments: (value, index, array). - * - * **Note:** Unlike `_.filter`, this method mutates `array`. Use `_.pull` - * to pull elements from an array by value. - * - * @static - * @memberOf _ - * @since 2.0.0 - * @category Array - * @param {Array} array The array to modify. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {Array} Returns the new array of removed elements. - * @example - * - * var array = [1, 2, 3, 4]; - * var evens = _.remove(array, function(n) { - * return n % 2 == 0; - * }); - * - * console.log(array); - * // => [1, 3] + * Creates a clone of `regexp`. * - * console.log(evens); - * // => [2, 4] + * @private + * @param {Object} regexp The regexp to clone. + * @returns {Object} Returns the cloned regexp. */ - function remove(array, predicate) { - var result = []; - if (!(array && array.length)) { - return result; - } - var index = -1, - indexes = [], - length = array.length; - - predicate = getIteratee(predicate, 3); - while (++index < length) { - var value = array[index]; - if (predicate(value, index, array)) { - result.push(value); - indexes.push(index); - } - } - basePullAt(array, indexes); + function cloneRegExp(regexp) { + var result = new regexp.constructor(regexp.source, reFlags.exec(regexp)); + result.lastIndex = regexp.lastIndex; return result; } /** - * Reverses `array` so that the first element becomes the last, the second - * element becomes the second to last, and so on. - * - * **Note:** This method mutates `array` and is based on - * [`Array#reverse`](https://mdn.io/Array/reverse). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to modify. - * @returns {Array} Returns `array`. - * @example - * - * var array = [1, 2, 3]; - * - * _.reverse(array); - * // => [3, 2, 1] + * Creates a clone of `set`. * - * console.log(array); - * // => [3, 2, 1] + * @private + * @param {Object} set The set to clone. + * @param {Function} cloneFunc The function to clone values. + * @param {boolean} [isDeep] Specify a deep clone. + * @returns {Object} Returns the cloned set. */ - function reverse(array) { - return array == null ? array : nativeReverse.call(array); + function cloneSet(set, isDeep, cloneFunc) { + var array = isDeep ? cloneFunc(setToArray(set), CLONE_DEEP_FLAG) : setToArray(set); + return arrayReduce(array, addSetEntry, new set.constructor); } /** - * Creates a slice of `array` from `start` up to, but not including, `end`. + * Creates a clone of the `symbol` object. * - * **Note:** This method is used instead of - * [`Array#slice`](https://mdn.io/Array/slice) to ensure dense arrays are - * returned. + * @private + * @param {Object} symbol The symbol object to clone. + * @returns {Object} Returns the cloned symbol object. + */ + function cloneSymbol(symbol) { + return symbolValueOf ? Object(symbolValueOf.call(symbol)) : {}; + } + + /** + * Creates a clone of `typedArray`. * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to slice. - * @param {number} [start=0] The start position. - * @param {number} [end=array.length] The end position. - * @returns {Array} Returns the slice of `array`. + * @private + * @param {Object} typedArray The typed array to clone. + * @param {boolean} [isDeep] Specify a deep clone. + * @returns {Object} Returns the cloned typed array. */ - function slice(array, start, end) { - var length = array == null ? 0 : array.length; - if (!length) { - return []; - } - if (end && typeof end != 'number' && isIterateeCall(array, start, end)) { - start = 0; - end = length; - } - else { - start = start == null ? 0 : toInteger(start); - end = end === undefined ? length : toInteger(end); - } - return baseSlice(array, start, end); + function cloneTypedArray(typedArray, isDeep) { + var buffer = isDeep ? cloneArrayBuffer(typedArray.buffer) : typedArray.buffer; + return new typedArray.constructor(buffer, typedArray.byteOffset, typedArray.length); } /** - * Uses a binary search to determine the lowest index at which `value` - * should be inserted into `array` in order to maintain its sort order. + * Compares values to sort them in ascending order. * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The sorted array to inspect. - * @param {*} value The value to evaluate. - * @returns {number} Returns the index at which `value` should be inserted - * into `array`. - * @example - * - * _.sortedIndex([30, 50], 40); - * // => 1 + * @private + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @returns {number} Returns the sort order indicator for `value`. */ - function sortedIndex(array, value) { - return baseSortedIndex(array, value); + function compareAscending(value, other) { + if (value !== other) { + var valIsDefined = value !== undefined, + valIsNull = value === null, + valIsReflexive = value === value, + valIsSymbol = isSymbol(value); + + var othIsDefined = other !== undefined, + othIsNull = other === null, + othIsReflexive = other === other, + othIsSymbol = isSymbol(other); + + if ((!othIsNull && !othIsSymbol && !valIsSymbol && value > other) || + (valIsSymbol && othIsDefined && othIsReflexive && !othIsNull && !othIsSymbol) || + (valIsNull && othIsDefined && othIsReflexive) || + (!valIsDefined && othIsReflexive) || + !valIsReflexive) { + return 1; + } + if ((!valIsNull && !valIsSymbol && !othIsSymbol && value < other) || + (othIsSymbol && valIsDefined && valIsReflexive && !valIsNull && !valIsSymbol) || + (othIsNull && valIsDefined && valIsReflexive) || + (!othIsDefined && valIsReflexive) || + !othIsReflexive) { + return -1; + } + } + return 0; } /** - * This method is like `_.sortedIndex` except that it accepts `iteratee` - * which is invoked for `value` and each element of `array` to compute their - * sort ranking. The iteratee is invoked with one argument: (value). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The sorted array to inspect. - * @param {*} value The value to evaluate. - * @param {Function} [iteratee=_.identity] The iteratee invoked per element. - * @returns {number} Returns the index at which `value` should be inserted - * into `array`. - * @example - * - * var objects = [{ 'x': 4 }, { 'x': 5 }]; + * Used by `_.orderBy` to compare multiple properties of a value to another + * and stable sort them. * - * _.sortedIndexBy(objects, { 'x': 4 }, function(o) { return o.x; }); - * // => 0 + * If `orders` is unspecified, all values are sorted in ascending order. Otherwise, + * specify an order of "desc" for descending or "asc" for ascending sort order + * of corresponding values. * - * // The `_.property` iteratee shorthand. - * _.sortedIndexBy(objects, { 'x': 4 }, 'x'); - * // => 0 + * @private + * @param {Object} object The object to compare. + * @param {Object} other The other object to compare. + * @param {boolean[]|string[]} orders The order to sort by for each property. + * @returns {number} Returns the sort order indicator for `object`. */ - function sortedIndexBy(array, value, iteratee) { - return baseSortedIndexBy(array, value, getIteratee(iteratee, 2)); + function compareMultiple(object, other, orders) { + var index = -1, + objCriteria = object.criteria, + othCriteria = other.criteria, + length = objCriteria.length, + ordersLength = orders.length; + + while (++index < length) { + var result = compareAscending(objCriteria[index], othCriteria[index]); + if (result) { + if (index >= ordersLength) { + return result; + } + var order = orders[index]; + return result * (order == 'desc' ? -1 : 1); + } + } + // Fixes an `Array#sort` bug in the JS engine embedded in Adobe applications + // that causes it, under certain circumstances, to provide the same value for + // `object` and `other`. See https://github.com/jashkenas/underscore/pull/1247 + // for more details. + // + // This also ensures a stable sort in V8 and other engines. + // See https://bugs.chromium.org/p/v8/issues/detail?id=90 for more details. + return object.index - other.index; } /** - * This method is like `_.indexOf` except that it performs a binary - * search on a sorted `array`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {*} value The value to search for. - * @returns {number} Returns the index of the matched value, else `-1`. - * @example + * Creates an array that is the composition of partially applied arguments, + * placeholders, and provided arguments into a single array of arguments. * - * _.sortedIndexOf([4, 5, 5, 5, 6], 5); - * // => 1 + * @private + * @param {Array} args The provided arguments. + * @param {Array} partials The arguments to prepend to those provided. + * @param {Array} holders The `partials` placeholder indexes. + * @params {boolean} [isCurried] Specify composing for a curried function. + * @returns {Array} Returns the new array of composed arguments. */ - function sortedIndexOf(array, value) { - var length = array == null ? 0 : array.length; - if (length) { - var index = baseSortedIndex(array, value); - if (index < length && eq(array[index], value)) { - return index; + function composeArgs(args, partials, holders, isCurried) { + var argsIndex = -1, + argsLength = args.length, + holdersLength = holders.length, + leftIndex = -1, + leftLength = partials.length, + rangeLength = nativeMax(argsLength - holdersLength, 0), + result = Array(leftLength + rangeLength), + isUncurried = !isCurried; + + while (++leftIndex < leftLength) { + result[leftIndex] = partials[leftIndex]; + } + while (++argsIndex < holdersLength) { + if (isUncurried || argsIndex < argsLength) { + result[holders[argsIndex]] = args[argsIndex]; } } - return -1; + while (rangeLength--) { + result[leftIndex++] = args[argsIndex++]; + } + return result; } /** - * This method is like `_.sortedIndex` except that it returns the highest - * index at which `value` should be inserted into `array` in order to - * maintain its sort order. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The sorted array to inspect. - * @param {*} value The value to evaluate. - * @returns {number} Returns the index at which `value` should be inserted - * into `array`. - * @example + * This function is like `composeArgs` except that the arguments composition + * is tailored for `_.partialRight`. * - * _.sortedLastIndex([4, 5, 5, 5, 6], 5); - * // => 4 + * @private + * @param {Array} args The provided arguments. + * @param {Array} partials The arguments to append to those provided. + * @param {Array} holders The `partials` placeholder indexes. + * @params {boolean} [isCurried] Specify composing for a curried function. + * @returns {Array} Returns the new array of composed arguments. */ - function sortedLastIndex(array, value) { - return baseSortedIndex(array, value, true); + function composeArgsRight(args, partials, holders, isCurried) { + var argsIndex = -1, + argsLength = args.length, + holdersIndex = -1, + holdersLength = holders.length, + rightIndex = -1, + rightLength = partials.length, + rangeLength = nativeMax(argsLength - holdersLength, 0), + result = Array(rangeLength + rightLength), + isUncurried = !isCurried; + + while (++argsIndex < rangeLength) { + result[argsIndex] = args[argsIndex]; + } + var offset = argsIndex; + while (++rightIndex < rightLength) { + result[offset + rightIndex] = partials[rightIndex]; + } + while (++holdersIndex < holdersLength) { + if (isUncurried || argsIndex < argsLength) { + result[offset + holders[holdersIndex]] = args[argsIndex++]; + } + } + return result; } /** - * This method is like `_.sortedLastIndex` except that it accepts `iteratee` - * which is invoked for `value` and each element of `array` to compute their - * sort ranking. The iteratee is invoked with one argument: (value). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The sorted array to inspect. - * @param {*} value The value to evaluate. - * @param {Function} [iteratee=_.identity] The iteratee invoked per element. - * @returns {number} Returns the index at which `value` should be inserted - * into `array`. - * @example - * - * var objects = [{ 'x': 4 }, { 'x': 5 }]; - * - * _.sortedLastIndexBy(objects, { 'x': 4 }, function(o) { return o.x; }); - * // => 1 + * Copies the values of `source` to `array`. * - * // The `_.property` iteratee shorthand. - * _.sortedLastIndexBy(objects, { 'x': 4 }, 'x'); - * // => 1 + * @private + * @param {Array} source The array to copy values from. + * @param {Array} [array=[]] The array to copy values to. + * @returns {Array} Returns `array`. */ - function sortedLastIndexBy(array, value, iteratee) { - return baseSortedIndexBy(array, value, getIteratee(iteratee, 2), true); + function copyArray(source, array) { + var index = -1, + length = source.length; + + array || (array = Array(length)); + while (++index < length) { + array[index] = source[index]; + } + return array; } /** - * This method is like `_.lastIndexOf` except that it performs a binary - * search on a sorted `array`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {*} value The value to search for. - * @returns {number} Returns the index of the matched value, else `-1`. - * @example + * Copies properties of `source` to `object`. * - * _.sortedLastIndexOf([4, 5, 5, 5, 6], 5); - * // => 3 + * @private + * @param {Object} source The object to copy properties from. + * @param {Array} props The property identifiers to copy. + * @param {Object} [object={}] The object to copy properties to. + * @param {Function} [customizer] The function to customize copied values. + * @returns {Object} Returns `object`. */ - function sortedLastIndexOf(array, value) { - var length = array == null ? 0 : array.length; - if (length) { - var index = baseSortedIndex(array, value, true) - 1; - if (eq(array[index], value)) { - return index; + function copyObject(source, props, object, customizer) { + var isNew = !object; + object || (object = {}); + + var index = -1, + length = props.length; + + while (++index < length) { + var key = props[index]; + + var newValue = customizer + ? customizer(object[key], source[key], key, object, source) + : undefined; + + if (newValue === undefined) { + newValue = source[key]; + } + if (isNew) { + baseAssignValue(object, key, newValue); + } else { + assignValue(object, key, newValue); } } - return -1; + return object; } /** - * This method is like `_.uniq` except that it's designed and optimized - * for sorted arrays. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to inspect. - * @returns {Array} Returns the new duplicate free array. - * @example + * Copies own symbols of `source` to `object`. * - * _.sortedUniq([1, 1, 2]); - * // => [1, 2] + * @private + * @param {Object} source The object to copy symbols from. + * @param {Object} [object={}] The object to copy symbols to. + * @returns {Object} Returns `object`. */ - function sortedUniq(array) { - return (array && array.length) - ? baseSortedUniq(array) - : []; + function copySymbols(source, object) { + return copyObject(source, getSymbols(source), object); } /** - * This method is like `_.uniqBy` except that it's designed and optimized - * for sorted arrays. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {Function} [iteratee] The iteratee invoked per element. - * @returns {Array} Returns the new duplicate free array. - * @example + * Copies own and inherited symbols of `source` to `object`. * - * _.sortedUniqBy([1.1, 1.2, 2.3, 2.4], Math.floor); - * // => [1.1, 2.3] + * @private + * @param {Object} source The object to copy symbols from. + * @param {Object} [object={}] The object to copy symbols to. + * @returns {Object} Returns `object`. */ - function sortedUniqBy(array, iteratee) { - return (array && array.length) - ? baseSortedUniq(array, getIteratee(iteratee, 2)) - : []; + function copySymbolsIn(source, object) { + return copyObject(source, getSymbolsIn(source), object); } /** - * Gets all but the first element of `array`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to query. - * @returns {Array} Returns the slice of `array`. - * @example + * Creates a function like `_.groupBy`. * - * _.tail([1, 2, 3]); - * // => [2, 3] + * @private + * @param {Function} setter The function to set accumulator values. + * @param {Function} [initializer] The accumulator object initializer. + * @returns {Function} Returns the new aggregator function. */ - function tail(array) { - var length = array == null ? 0 : array.length; - return length ? baseSlice(array, 1, length) : []; + function createAggregator(setter, initializer) { + return function(collection, iteratee) { + var func = isArray(collection) ? arrayAggregator : baseAggregator, + accumulator = initializer ? initializer() : {}; + + return func(collection, setter, getIteratee(iteratee, 2), accumulator); + }; } /** - * Creates a slice of `array` with `n` elements taken from the beginning. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to query. - * @param {number} [n=1] The number of elements to take. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Array} Returns the slice of `array`. - * @example - * - * _.take([1, 2, 3]); - * // => [1] - * - * _.take([1, 2, 3], 2); - * // => [1, 2] - * - * _.take([1, 2, 3], 5); - * // => [1, 2, 3] + * Creates a function like `_.assign`. * - * _.take([1, 2, 3], 0); - * // => [] + * @private + * @param {Function} assigner The function to assign values. + * @returns {Function} Returns the new assigner function. */ - function take(array, n, guard) { - if (!(array && array.length)) { - return []; - } - n = (guard || n === undefined) ? 1 : toInteger(n); - return baseSlice(array, 0, n < 0 ? 0 : n); + function createAssigner(assigner) { + return baseRest(function(object, sources) { + var index = -1, + length = sources.length, + customizer = length > 1 ? sources[length - 1] : undefined, + guard = length > 2 ? sources[2] : undefined; + + customizer = (assigner.length > 3 && typeof customizer == 'function') + ? (length--, customizer) + : undefined; + + if (guard && isIterateeCall(sources[0], sources[1], guard)) { + customizer = length < 3 ? undefined : customizer; + length = 1; + } + object = Object(object); + while (++index < length) { + var source = sources[index]; + if (source) { + assigner(object, source, index, customizer); + } + } + return object; + }); } /** - * Creates a slice of `array` with `n` elements taken from the end. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to query. - * @param {number} [n=1] The number of elements to take. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Array} Returns the slice of `array`. - * @example - * - * _.takeRight([1, 2, 3]); - * // => [3] + * Creates a `baseEach` or `baseEachRight` function. * - * _.takeRight([1, 2, 3], 2); - * // => [2, 3] + * @private + * @param {Function} eachFunc The function to iterate over a collection. + * @param {boolean} [fromRight] Specify iterating from right to left. + * @returns {Function} Returns the new base function. + */ + function createBaseEach(eachFunc, fromRight) { + return function(collection, iteratee) { + if (collection == null) { + return collection; + } + if (!isArrayLike(collection)) { + return eachFunc(collection, iteratee); + } + var length = collection.length, + index = fromRight ? length : -1, + iterable = Object(collection); + + while ((fromRight ? index-- : ++index < length)) { + if (iteratee(iterable[index], index, iterable) === false) { + break; + } + } + return collection; + }; + } + + /** + * Creates a base function for methods like `_.forIn` and `_.forOwn`. * - * _.takeRight([1, 2, 3], 5); - * // => [1, 2, 3] + * @private + * @param {boolean} [fromRight] Specify iterating from right to left. + * @returns {Function} Returns the new base function. + */ + function createBaseFor(fromRight) { + return function(object, iteratee, keysFunc) { + var index = -1, + iterable = Object(object), + props = keysFunc(object), + length = props.length; + + while (length--) { + var key = props[fromRight ? length : ++index]; + if (iteratee(iterable[key], key, iterable) === false) { + break; + } + } + return object; + }; + } + + /** + * Creates a function that wraps `func` to invoke it with the optional `this` + * binding of `thisArg`. * - * _.takeRight([1, 2, 3], 0); - * // => [] + * @private + * @param {Function} func The function to wrap. + * @param {number} bitmask The bitmask flags. See `createWrap` for more details. + * @param {*} [thisArg] The `this` binding of `func`. + * @returns {Function} Returns the new wrapped function. */ - function takeRight(array, n, guard) { - var length = array == null ? 0 : array.length; - if (!length) { - return []; + function createBind(func, bitmask, thisArg) { + var isBind = bitmask & WRAP_BIND_FLAG, + Ctor = createCtor(func); + + function wrapper() { + var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func; + return fn.apply(isBind ? thisArg : this, arguments); } - n = (guard || n === undefined) ? 1 : toInteger(n); - n = length - n; - return baseSlice(array, n < 0 ? 0 : n, length); + return wrapper; } /** - * Creates a slice of `array` with elements taken from the end. Elements are - * taken until `predicate` returns falsey. The predicate is invoked with - * three arguments: (value, index, array). + * Creates a function like `_.lowerFirst`. * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to query. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {Array} Returns the slice of `array`. - * @example - * - * var users = [ - * { 'user': 'barney', 'active': true }, - * { 'user': 'fred', 'active': false }, - * { 'user': 'pebbles', 'active': false } - * ]; - * - * _.takeRightWhile(users, function(o) { return !o.active; }); - * // => objects for ['fred', 'pebbles'] - * - * // The `_.matches` iteratee shorthand. - * _.takeRightWhile(users, { 'user': 'pebbles', 'active': false }); - * // => objects for ['pebbles'] - * - * // The `_.matchesProperty` iteratee shorthand. - * _.takeRightWhile(users, ['active', false]); - * // => objects for ['fred', 'pebbles'] - * - * // The `_.property` iteratee shorthand. - * _.takeRightWhile(users, 'active'); - * // => [] + * @private + * @param {string} methodName The name of the `String` case method to use. + * @returns {Function} Returns the new case function. */ - function takeRightWhile(array, predicate) { - return (array && array.length) - ? baseWhile(array, getIteratee(predicate, 3), false, true) - : []; + function createCaseFirst(methodName) { + return function(string) { + string = toString(string); + + var strSymbols = hasUnicode(string) + ? stringToArray(string) + : undefined; + + var chr = strSymbols + ? strSymbols[0] + : string.charAt(0); + + var trailing = strSymbols + ? castSlice(strSymbols, 1).join('') + : string.slice(1); + + return chr[methodName]() + trailing; + }; } /** - * Creates a slice of `array` with elements taken from the beginning. Elements - * are taken until `predicate` returns falsey. The predicate is invoked with - * three arguments: (value, index, array). - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to query. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {Array} Returns the slice of `array`. - * @example - * - * var users = [ - * { 'user': 'barney', 'active': false }, - * { 'user': 'fred', 'active': false }, - * { 'user': 'pebbles', 'active': true } - * ]; - * - * _.takeWhile(users, function(o) { return !o.active; }); - * // => objects for ['barney', 'fred'] - * - * // The `_.matches` iteratee shorthand. - * _.takeWhile(users, { 'user': 'barney', 'active': false }); - * // => objects for ['barney'] - * - * // The `_.matchesProperty` iteratee shorthand. - * _.takeWhile(users, ['active', false]); - * // => objects for ['barney', 'fred'] + * Creates a function like `_.camelCase`. * - * // The `_.property` iteratee shorthand. - * _.takeWhile(users, 'active'); - * // => [] + * @private + * @param {Function} callback The function to combine each word. + * @returns {Function} Returns the new compounder function. */ - function takeWhile(array, predicate) { - return (array && array.length) - ? baseWhile(array, getIteratee(predicate, 3)) - : []; + function createCompounder(callback) { + return function(string) { + return arrayReduce(words(deburr(string).replace(reApos, '')), callback, ''); + }; } /** - * Creates an array of unique values, in order, from all given arrays using - * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * for equality comparisons. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {...Array} [arrays] The arrays to inspect. - * @returns {Array} Returns the new array of combined values. - * @example + * Creates a function that produces an instance of `Ctor` regardless of + * whether it was invoked as part of a `new` expression or by `call` or `apply`. * - * _.union([2], [1, 2]); - * // => [2, 1] + * @private + * @param {Function} Ctor The constructor to wrap. + * @returns {Function} Returns the new wrapped function. */ - var union = baseRest(function(arrays) { - return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true)); - }); + function createCtor(Ctor) { + return function() { + // Use a `switch` statement to work with class constructors. See + // http://ecma-international.org/ecma-262/7.0/#sec-ecmascript-function-objects-call-thisargument-argumentslist + // for more details. + var args = arguments; + switch (args.length) { + case 0: return new Ctor; + case 1: return new Ctor(args[0]); + case 2: return new Ctor(args[0], args[1]); + case 3: return new Ctor(args[0], args[1], args[2]); + case 4: return new Ctor(args[0], args[1], args[2], args[3]); + case 5: return new Ctor(args[0], args[1], args[2], args[3], args[4]); + case 6: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5]); + case 7: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5], args[6]); + } + var thisBinding = baseCreate(Ctor.prototype), + result = Ctor.apply(thisBinding, args); + + // Mimic the constructor's `return` behavior. + // See https://es5.github.io/#x13.2.2 for more details. + return isObject(result) ? result : thisBinding; + }; + } /** - * This method is like `_.union` except that it accepts `iteratee` which is - * invoked for each element of each `arrays` to generate the criterion by - * which uniqueness is computed. Result values are chosen from the first - * array in which the value occurs. The iteratee is invoked with one argument: - * (value). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {...Array} [arrays] The arrays to inspect. - * @param {Function} [iteratee=_.identity] The iteratee invoked per element. - * @returns {Array} Returns the new array of combined values. - * @example - * - * _.unionBy([2.1], [1.2, 2.3], Math.floor); - * // => [2.1, 1.2] + * Creates a function that wraps `func` to enable currying. * - * // The `_.property` iteratee shorthand. - * _.unionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x'); - * // => [{ 'x': 1 }, { 'x': 2 }] + * @private + * @param {Function} func The function to wrap. + * @param {number} bitmask The bitmask flags. See `createWrap` for more details. + * @param {number} arity The arity of `func`. + * @returns {Function} Returns the new wrapped function. */ - var unionBy = baseRest(function(arrays) { - var iteratee = last(arrays); - if (isArrayLikeObject(iteratee)) { - iteratee = undefined; + function createCurry(func, bitmask, arity) { + var Ctor = createCtor(func); + + function wrapper() { + var length = arguments.length, + args = Array(length), + index = length, + placeholder = getHolder(wrapper); + + while (index--) { + args[index] = arguments[index]; + } + var holders = (length < 3 && args[0] !== placeholder && args[length - 1] !== placeholder) + ? [] + : replaceHolders(args, placeholder); + + length -= holders.length; + if (length < arity) { + return createRecurry( + func, bitmask, createHybrid, wrapper.placeholder, undefined, + args, holders, undefined, undefined, arity - length); + } + var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func; + return apply(fn, this, args); } - return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), getIteratee(iteratee, 2)); - }); + return wrapper; + } /** - * This method is like `_.union` except that it accepts `comparator` which - * is invoked to compare elements of `arrays`. Result values are chosen from - * the first array in which the value occurs. The comparator is invoked - * with two arguments: (arrVal, othVal). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {...Array} [arrays] The arrays to inspect. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns the new array of combined values. - * @example - * - * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; - * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }]; + * Creates a `_.find` or `_.findLast` function. * - * _.unionWith(objects, others, _.isEqual); - * // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }] + * @private + * @param {Function} findIndexFunc The function to find the collection index. + * @returns {Function} Returns the new find function. */ - var unionWith = baseRest(function(arrays) { - var comparator = last(arrays); - comparator = typeof comparator == 'function' ? comparator : undefined; - return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), undefined, comparator); - }); + function createFind(findIndexFunc) { + return function(collection, predicate, fromIndex) { + var iterable = Object(collection); + if (!isArrayLike(collection)) { + var iteratee = getIteratee(predicate, 3); + collection = keys(collection); + predicate = function(key) { return iteratee(iterable[key], key, iterable); }; + } + var index = findIndexFunc(collection, predicate, fromIndex); + return index > -1 ? iterable[iteratee ? collection[index] : index] : undefined; + }; + } /** - * Creates a duplicate-free version of an array, using - * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * for equality comparisons, in which only the first occurrence of each element - * is kept. The order of result values is determined by the order they occur - * in the array. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to inspect. - * @returns {Array} Returns the new duplicate free array. - * @example + * Creates a `_.flow` or `_.flowRight` function. * - * _.uniq([2, 1, 2]); - * // => [2, 1] + * @private + * @param {boolean} [fromRight] Specify iterating from right to left. + * @returns {Function} Returns the new flow function. */ - function uniq(array) { - return (array && array.length) ? baseUniq(array) : []; + function createFlow(fromRight) { + return flatRest(function(funcs) { + var length = funcs.length, + index = length, + prereq = LodashWrapper.prototype.thru; + + if (fromRight) { + funcs.reverse(); + } + while (index--) { + var func = funcs[index]; + if (typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + if (prereq && !wrapper && getFuncName(func) == 'wrapper') { + var wrapper = new LodashWrapper([], true); + } + } + index = wrapper ? index : length; + while (++index < length) { + func = funcs[index]; + + var funcName = getFuncName(func), + data = funcName == 'wrapper' ? getData(func) : undefined; + + if (data && isLaziable(data[0]) && + data[1] == (WRAP_ARY_FLAG | WRAP_CURRY_FLAG | WRAP_PARTIAL_FLAG | WRAP_REARG_FLAG) && + !data[4].length && data[9] == 1 + ) { + wrapper = wrapper[getFuncName(data[0])].apply(wrapper, data[3]); + } else { + wrapper = (func.length == 1 && isLaziable(func)) + ? wrapper[funcName]() + : wrapper.thru(func); + } + } + return function() { + var args = arguments, + value = args[0]; + + if (wrapper && args.length == 1 && isArray(value)) { + return wrapper.plant(value).value(); + } + var index = 0, + result = length ? funcs[index].apply(this, args) : value; + + while (++index < length) { + result = funcs[index].call(this, result); + } + return result; + }; + }); } /** - * This method is like `_.uniq` except that it accepts `iteratee` which is - * invoked for each element in `array` to generate the criterion by which - * uniqueness is computed. The order of result values is determined by the - * order they occur in the array. The iteratee is invoked with one argument: - * (value). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {Function} [iteratee=_.identity] The iteratee invoked per element. - * @returns {Array} Returns the new duplicate free array. - * @example - * - * _.uniqBy([2.1, 1.2, 2.3], Math.floor); - * // => [2.1, 1.2] + * Creates a function that wraps `func` to invoke it with optional `this` + * binding of `thisArg`, partial application, and currying. * - * // The `_.property` iteratee shorthand. - * _.uniqBy([{ 'x': 1 }, { 'x': 2 }, { 'x': 1 }], 'x'); - * // => [{ 'x': 1 }, { 'x': 2 }] + * @private + * @param {Function|string} func The function or method name to wrap. + * @param {number} bitmask The bitmask flags. See `createWrap` for more details. + * @param {*} [thisArg] The `this` binding of `func`. + * @param {Array} [partials] The arguments to prepend to those provided to + * the new function. + * @param {Array} [holders] The `partials` placeholder indexes. + * @param {Array} [partialsRight] The arguments to append to those provided + * to the new function. + * @param {Array} [holdersRight] The `partialsRight` placeholder indexes. + * @param {Array} [argPos] The argument positions of the new function. + * @param {number} [ary] The arity cap of `func`. + * @param {number} [arity] The arity of `func`. + * @returns {Function} Returns the new wrapped function. */ - function uniqBy(array, iteratee) { - return (array && array.length) ? baseUniq(array, getIteratee(iteratee, 2)) : []; + function createHybrid(func, bitmask, thisArg, partials, holders, partialsRight, holdersRight, argPos, ary, arity) { + var isAry = bitmask & WRAP_ARY_FLAG, + isBind = bitmask & WRAP_BIND_FLAG, + isBindKey = bitmask & WRAP_BIND_KEY_FLAG, + isCurried = bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG), + isFlip = bitmask & WRAP_FLIP_FLAG, + Ctor = isBindKey ? undefined : createCtor(func); + + function wrapper() { + var length = arguments.length, + args = Array(length), + index = length; + + while (index--) { + args[index] = arguments[index]; + } + if (isCurried) { + var placeholder = getHolder(wrapper), + holdersCount = countHolders(args, placeholder); + } + if (partials) { + args = composeArgs(args, partials, holders, isCurried); + } + if (partialsRight) { + args = composeArgsRight(args, partialsRight, holdersRight, isCurried); + } + length -= holdersCount; + if (isCurried && length < arity) { + var newHolders = replaceHolders(args, placeholder); + return createRecurry( + func, bitmask, createHybrid, wrapper.placeholder, thisArg, + args, newHolders, argPos, ary, arity - length + ); + } + var thisBinding = isBind ? thisArg : this, + fn = isBindKey ? thisBinding[func] : func; + + length = args.length; + if (argPos) { + args = reorder(args, argPos); + } else if (isFlip && length > 1) { + args.reverse(); + } + if (isAry && ary < length) { + args.length = ary; + } + if (this && this !== root && this instanceof wrapper) { + fn = Ctor || createCtor(fn); + } + return fn.apply(thisBinding, args); + } + return wrapper; } /** - * This method is like `_.uniq` except that it accepts `comparator` which - * is invoked to compare elements of `array`. The order of result values is - * determined by the order they occur in the array.The comparator is invoked - * with two arguments: (arrVal, othVal). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns the new duplicate free array. - * @example - * - * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 2 }]; + * Creates a function like `_.invertBy`. * - * _.uniqWith(objects, _.isEqual); - * // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }] + * @private + * @param {Function} setter The function to set accumulator values. + * @param {Function} toIteratee The function to resolve iteratees. + * @returns {Function} Returns the new inverter function. */ - function uniqWith(array, comparator) { - comparator = typeof comparator == 'function' ? comparator : undefined; - return (array && array.length) ? baseUniq(array, undefined, comparator) : []; + function createInverter(setter, toIteratee) { + return function(object, iteratee) { + return baseInverter(object, setter, toIteratee(iteratee), {}); + }; } /** - * This method is like `_.zip` except that it accepts an array of grouped - * elements and creates an array regrouping the elements to their pre-zip - * configuration. - * - * @static - * @memberOf _ - * @since 1.2.0 - * @category Array - * @param {Array} array The array of grouped elements to process. - * @returns {Array} Returns the new array of regrouped elements. - * @example - * - * var zipped = _.zip(['a', 'b'], [1, 2], [true, false]); - * // => [['a', 1, true], ['b', 2, false]] + * Creates a function that performs a mathematical operation on two values. * - * _.unzip(zipped); - * // => [['a', 'b'], [1, 2], [true, false]] + * @private + * @param {Function} operator The function to perform the operation. + * @param {number} [defaultValue] The value used for `undefined` arguments. + * @returns {Function} Returns the new mathematical operation function. */ - function unzip(array) { - if (!(array && array.length)) { - return []; - } - var length = 0; - array = arrayFilter(array, function(group) { - if (isArrayLikeObject(group)) { - length = nativeMax(group.length, length); - return true; + function createMathOperation(operator, defaultValue) { + return function(value, other) { + var result; + if (value === undefined && other === undefined) { + return defaultValue; } - }); - return baseTimes(length, function(index) { - return arrayMap(array, baseProperty(index)); - }); + if (value !== undefined) { + result = value; + } + if (other !== undefined) { + if (result === undefined) { + return other; + } + if (typeof value == 'string' || typeof other == 'string') { + value = baseToString(value); + other = baseToString(other); + } else { + value = baseToNumber(value); + other = baseToNumber(other); + } + result = operator(value, other); + } + return result; + }; } /** - * This method is like `_.unzip` except that it accepts `iteratee` to specify - * how regrouped values should be combined. The iteratee is invoked with the - * elements of each group: (...group). - * - * @static - * @memberOf _ - * @since 3.8.0 - * @category Array - * @param {Array} array The array of grouped elements to process. - * @param {Function} [iteratee=_.identity] The function to combine - * regrouped values. - * @returns {Array} Returns the new array of regrouped elements. - * @example - * - * var zipped = _.zip([1, 2], [10, 20], [100, 200]); - * // => [[1, 10, 100], [2, 20, 200]] + * Creates a function like `_.over`. * - * _.unzipWith(zipped, _.add); - * // => [3, 30, 300] + * @private + * @param {Function} arrayFunc The function to iterate over iteratees. + * @returns {Function} Returns the new over function. */ - function unzipWith(array, iteratee) { - if (!(array && array.length)) { - return []; - } - var result = unzip(array); - if (iteratee == null) { - return result; - } - return arrayMap(result, function(group) { - return apply(iteratee, undefined, group); + function createOver(arrayFunc) { + return flatRest(function(iteratees) { + iteratees = arrayMap(iteratees, baseUnary(getIteratee())); + return baseRest(function(args) { + var thisArg = this; + return arrayFunc(iteratees, function(iteratee) { + return apply(iteratee, thisArg, args); + }); + }); }); } /** - * Creates an array excluding all given values using - * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * for equality comparisons. - * - * **Note:** Unlike `_.pull`, this method returns a new array. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {...*} [values] The values to exclude. - * @returns {Array} Returns the new array of filtered values. - * @see _.difference, _.xor - * @example + * Creates the padding for `string` based on `length`. The `chars` string + * is truncated if the number of characters exceeds `length`. * - * _.without([2, 1, 2, 3], 1, 2); - * // => [3] + * @private + * @param {number} length The padding length. + * @param {string} [chars=' '] The string used as padding. + * @returns {string} Returns the padding for `string`. */ - var without = baseRest(function(array, values) { - return isArrayLikeObject(array) - ? baseDifference(array, values) - : []; - }); + function createPadding(length, chars) { + chars = chars === undefined ? ' ' : baseToString(chars); - /** - * Creates an array of unique values that is the - * [symmetric difference](https://en.wikipedia.org/wiki/Symmetric_difference) - * of the given arrays. The order of result values is determined by the order - * they occur in the arrays. - * - * @static - * @memberOf _ - * @since 2.4.0 - * @category Array - * @param {...Array} [arrays] The arrays to inspect. - * @returns {Array} Returns the new array of filtered values. - * @see _.difference, _.without - * @example - * - * _.xor([2, 1], [2, 3]); - * // => [1, 3] - */ - var xor = baseRest(function(arrays) { - return baseXor(arrayFilter(arrays, isArrayLikeObject)); - }); + var charsLength = chars.length; + if (charsLength < 2) { + return charsLength ? baseRepeat(chars, length) : chars; + } + var result = baseRepeat(chars, nativeCeil(length / stringSize(chars))); + return hasUnicode(chars) + ? castSlice(stringToArray(result), 0, length).join('') + : result.slice(0, length); + } /** - * This method is like `_.xor` except that it accepts `iteratee` which is - * invoked for each element of each `arrays` to generate the criterion by - * which by which they're compared. The order of result values is determined - * by the order they occur in the arrays. The iteratee is invoked with one - * argument: (value). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {...Array} [arrays] The arrays to inspect. - * @param {Function} [iteratee=_.identity] The iteratee invoked per element. - * @returns {Array} Returns the new array of filtered values. - * @example - * - * _.xorBy([2.1, 1.2], [2.3, 3.4], Math.floor); - * // => [1.2, 3.4] + * Creates a function that wraps `func` to invoke it with the `this` binding + * of `thisArg` and `partials` prepended to the arguments it receives. * - * // The `_.property` iteratee shorthand. - * _.xorBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x'); - * // => [{ 'x': 2 }] + * @private + * @param {Function} func The function to wrap. + * @param {number} bitmask The bitmask flags. See `createWrap` for more details. + * @param {*} thisArg The `this` binding of `func`. + * @param {Array} partials The arguments to prepend to those provided to + * the new function. + * @returns {Function} Returns the new wrapped function. */ - var xorBy = baseRest(function(arrays) { - var iteratee = last(arrays); - if (isArrayLikeObject(iteratee)) { - iteratee = undefined; + function createPartial(func, bitmask, thisArg, partials) { + var isBind = bitmask & WRAP_BIND_FLAG, + Ctor = createCtor(func); + + function wrapper() { + var argsIndex = -1, + argsLength = arguments.length, + leftIndex = -1, + leftLength = partials.length, + args = Array(leftLength + argsLength), + fn = (this && this !== root && this instanceof wrapper) ? Ctor : func; + + while (++leftIndex < leftLength) { + args[leftIndex] = partials[leftIndex]; + } + while (argsLength--) { + args[leftIndex++] = arguments[++argsIndex]; + } + return apply(fn, isBind ? thisArg : this, args); } - return baseXor(arrayFilter(arrays, isArrayLikeObject), getIteratee(iteratee, 2)); - }); + return wrapper; + } /** - * This method is like `_.xor` except that it accepts `comparator` which is - * invoked to compare elements of `arrays`. The order of result values is - * determined by the order they occur in the arrays. The comparator is invoked - * with two arguments: (arrVal, othVal). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {...Array} [arrays] The arrays to inspect. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns the new array of filtered values. - * @example - * - * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; - * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }]; + * Creates a `_.range` or `_.rangeRight` function. * - * _.xorWith(objects, others, _.isEqual); - * // => [{ 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }] + * @private + * @param {boolean} [fromRight] Specify iterating from right to left. + * @returns {Function} Returns the new range function. */ - var xorWith = baseRest(function(arrays) { - var comparator = last(arrays); - comparator = typeof comparator == 'function' ? comparator : undefined; - return baseXor(arrayFilter(arrays, isArrayLikeObject), undefined, comparator); - }); + function createRange(fromRight) { + return function(start, end, step) { + if (step && typeof step != 'number' && isIterateeCall(start, end, step)) { + end = step = undefined; + } + // Ensure the sign of `-0` is preserved. + start = toFinite(start); + if (end === undefined) { + end = start; + start = 0; + } else { + end = toFinite(end); + } + step = step === undefined ? (start < end ? 1 : -1) : toFinite(step); + return baseRange(start, end, step, fromRight); + }; + } /** - * Creates an array of grouped elements, the first of which contains the - * first elements of the given arrays, the second of which contains the - * second elements of the given arrays, and so on. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {...Array} [arrays] The arrays to process. - * @returns {Array} Returns the new array of grouped elements. - * @example + * Creates a function that performs a relational operation on two values. * - * _.zip(['a', 'b'], [1, 2], [true, false]); - * // => [['a', 1, true], ['b', 2, false]] + * @private + * @param {Function} operator The function to perform the operation. + * @returns {Function} Returns the new relational operation function. */ - var zip = baseRest(unzip); + function createRelationalOperation(operator) { + return function(value, other) { + if (!(typeof value == 'string' && typeof other == 'string')) { + value = toNumber(value); + other = toNumber(other); + } + return operator(value, other); + }; + } /** - * This method is like `_.fromPairs` except that it accepts two arrays, - * one of property identifiers and one of corresponding values. - * - * @static - * @memberOf _ - * @since 0.4.0 - * @category Array - * @param {Array} [props=[]] The property identifiers. - * @param {Array} [values=[]] The property values. - * @returns {Object} Returns the new object. - * @example + * Creates a function that wraps `func` to continue currying. * - * _.zipObject(['a', 'b'], [1, 2]); - * // => { 'a': 1, 'b': 2 } + * @private + * @param {Function} func The function to wrap. + * @param {number} bitmask The bitmask flags. See `createWrap` for more details. + * @param {Function} wrapFunc The function to create the `func` wrapper. + * @param {*} placeholder The placeholder value. + * @param {*} [thisArg] The `this` binding of `func`. + * @param {Array} [partials] The arguments to prepend to those provided to + * the new function. + * @param {Array} [holders] The `partials` placeholder indexes. + * @param {Array} [argPos] The argument positions of the new function. + * @param {number} [ary] The arity cap of `func`. + * @param {number} [arity] The arity of `func`. + * @returns {Function} Returns the new wrapped function. */ - function zipObject(props, values) { - return baseZipObject(props || [], values || [], assignValue); + function createRecurry(func, bitmask, wrapFunc, placeholder, thisArg, partials, holders, argPos, ary, arity) { + var isCurry = bitmask & WRAP_CURRY_FLAG, + newHolders = isCurry ? holders : undefined, + newHoldersRight = isCurry ? undefined : holders, + newPartials = isCurry ? partials : undefined, + newPartialsRight = isCurry ? undefined : partials; + + bitmask |= (isCurry ? WRAP_PARTIAL_FLAG : WRAP_PARTIAL_RIGHT_FLAG); + bitmask &= ~(isCurry ? WRAP_PARTIAL_RIGHT_FLAG : WRAP_PARTIAL_FLAG); + + if (!(bitmask & WRAP_CURRY_BOUND_FLAG)) { + bitmask &= ~(WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG); + } + var newData = [ + func, bitmask, thisArg, newPartials, newHolders, newPartialsRight, + newHoldersRight, argPos, ary, arity + ]; + + var result = wrapFunc.apply(undefined, newData); + if (isLaziable(func)) { + setData(result, newData); + } + result.placeholder = placeholder; + return setWrapToString(result, func, bitmask); } /** - * This method is like `_.zipObject` except that it supports property paths. - * - * @static - * @memberOf _ - * @since 4.1.0 - * @category Array - * @param {Array} [props=[]] The property identifiers. - * @param {Array} [values=[]] The property values. - * @returns {Object} Returns the new object. - * @example + * Creates a function like `_.round`. * - * _.zipObjectDeep(['a.b[0].c', 'a.b[1].d'], [1, 2]); - * // => { 'a': { 'b': [{ 'c': 1 }, { 'd': 2 }] } } + * @private + * @param {string} methodName The name of the `Math` method to use when rounding. + * @returns {Function} Returns the new round function. */ - function zipObjectDeep(props, values) { - return baseZipObject(props || [], values || [], baseSet); + function createRound(methodName) { + var func = Math[methodName]; + return function(number, precision) { + number = toNumber(number); + precision = precision == null ? 0 : nativeMin(toInteger(precision), 292); + if (precision) { + // Shift with exponential notation to avoid floating-point issues. + // See [MDN](https://mdn.io/round#Examples) for more details. + var pair = (toString(number) + 'e').split('e'), + value = func(pair[0] + 'e' + (+pair[1] + precision)); + + pair = (toString(value) + 'e').split('e'); + return +(pair[0] + 'e' + (+pair[1] - precision)); + } + return func(number); + }; } /** - * This method is like `_.zip` except that it accepts `iteratee` to specify - * how grouped values should be combined. The iteratee is invoked with the - * elements of each group: (...group). - * - * @static - * @memberOf _ - * @since 3.8.0 - * @category Array - * @param {...Array} [arrays] The arrays to process. - * @param {Function} [iteratee=_.identity] The function to combine - * grouped values. - * @returns {Array} Returns the new array of grouped elements. - * @example + * Creates a set object of `values`. * - * _.zipWith([1, 2], [10, 20], [100, 200], function(a, b, c) { - * return a + b + c; - * }); - * // => [111, 222] + * @private + * @param {Array} values The values to add to the set. + * @returns {Object} Returns the new set. */ - var zipWith = baseRest(function(arrays) { - var length = arrays.length, - iteratee = length > 1 ? arrays[length - 1] : undefined; - - iteratee = typeof iteratee == 'function' ? (arrays.pop(), iteratee) : undefined; - return unzipWith(arrays, iteratee); - }); - - /*------------------------------------------------------------------------*/ + var createSet = !(Set && (1 / setToArray(new Set([,-0]))[1]) == INFINITY) ? noop : function(values) { + return new Set(values); + }; /** - * Creates a `lodash` wrapper instance that wraps `value` with explicit method - * chain sequences enabled. The result of such sequences must be unwrapped - * with `_#value`. - * - * @static - * @memberOf _ - * @since 1.3.0 - * @category Seq - * @param {*} value The value to wrap. - * @returns {Object} Returns the new `lodash` wrapper instance. - * @example - * - * var users = [ - * { 'user': 'barney', 'age': 36 }, - * { 'user': 'fred', 'age': 40 }, - * { 'user': 'pebbles', 'age': 1 } - * ]; + * Creates a `_.toPairs` or `_.toPairsIn` function. * - * var youngest = _ - * .chain(users) - * .sortBy('age') - * .map(function(o) { - * return o.user + ' is ' + o.age; - * }) - * .head() - * .value(); - * // => 'pebbles is 1' + * @private + * @param {Function} keysFunc The function to get the keys of a given object. + * @returns {Function} Returns the new pairs function. */ - function chain(value) { - var result = lodash(value); - result.__chain__ = true; - return result; + function createToPairs(keysFunc) { + return function(object) { + var tag = getTag(object); + if (tag == mapTag) { + return mapToArray(object); + } + if (tag == setTag) { + return setToPairs(object); + } + return baseToPairs(object, keysFunc(object)); + }; } /** - * This method invokes `interceptor` and returns `value`. The interceptor - * is invoked with one argument; (value). The purpose of this method is to - * "tap into" a method chain sequence in order to modify intermediate results. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Seq - * @param {*} value The value to provide to `interceptor`. - * @param {Function} interceptor The function to invoke. - * @returns {*} Returns `value`. - * @example + * Creates a function that either curries or invokes `func` with optional + * `this` binding and partially applied arguments. * - * _([1, 2, 3]) - * .tap(function(array) { - * // Mutate input array. - * array.pop(); - * }) - * .reverse() - * .value(); - * // => [2, 1] + * @private + * @param {Function|string} func The function or method name to wrap. + * @param {number} bitmask The bitmask flags. + * 1 - `_.bind` + * 2 - `_.bindKey` + * 4 - `_.curry` or `_.curryRight` of a bound function + * 8 - `_.curry` + * 16 - `_.curryRight` + * 32 - `_.partial` + * 64 - `_.partialRight` + * 128 - `_.rearg` + * 256 - `_.ary` + * 512 - `_.flip` + * @param {*} [thisArg] The `this` binding of `func`. + * @param {Array} [partials] The arguments to be partially applied. + * @param {Array} [holders] The `partials` placeholder indexes. + * @param {Array} [argPos] The argument positions of the new function. + * @param {number} [ary] The arity cap of `func`. + * @param {number} [arity] The arity of `func`. + * @returns {Function} Returns the new wrapped function. */ - function tap(value, interceptor) { - interceptor(value); - return value; + function createWrap(func, bitmask, thisArg, partials, holders, argPos, ary, arity) { + var isBindKey = bitmask & WRAP_BIND_KEY_FLAG; + if (!isBindKey && typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + var length = partials ? partials.length : 0; + if (!length) { + bitmask &= ~(WRAP_PARTIAL_FLAG | WRAP_PARTIAL_RIGHT_FLAG); + partials = holders = undefined; + } + ary = ary === undefined ? ary : nativeMax(toInteger(ary), 0); + arity = arity === undefined ? arity : toInteger(arity); + length -= holders ? holders.length : 0; + + if (bitmask & WRAP_PARTIAL_RIGHT_FLAG) { + var partialsRight = partials, + holdersRight = holders; + + partials = holders = undefined; + } + var data = isBindKey ? undefined : getData(func); + + var newData = [ + func, bitmask, thisArg, partials, holders, partialsRight, holdersRight, + argPos, ary, arity + ]; + + if (data) { + mergeData(newData, data); + } + func = newData[0]; + bitmask = newData[1]; + thisArg = newData[2]; + partials = newData[3]; + holders = newData[4]; + arity = newData[9] = newData[9] === undefined + ? (isBindKey ? 0 : func.length) + : nativeMax(newData[9] - length, 0); + + if (!arity && bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG)) { + bitmask &= ~(WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG); + } + if (!bitmask || bitmask == WRAP_BIND_FLAG) { + var result = createBind(func, bitmask, thisArg); + } else if (bitmask == WRAP_CURRY_FLAG || bitmask == WRAP_CURRY_RIGHT_FLAG) { + result = createCurry(func, bitmask, arity); + } else if ((bitmask == WRAP_PARTIAL_FLAG || bitmask == (WRAP_BIND_FLAG | WRAP_PARTIAL_FLAG)) && !holders.length) { + result = createPartial(func, bitmask, thisArg, partials); + } else { + result = createHybrid.apply(undefined, newData); + } + var setter = data ? baseSetData : setData; + return setWrapToString(setter(result, newData), func, bitmask); } /** - * This method is like `_.tap` except that it returns the result of `interceptor`. - * The purpose of this method is to "pass thru" values replacing intermediate - * results in a method chain sequence. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Seq - * @param {*} value The value to provide to `interceptor`. - * @param {Function} interceptor The function to invoke. - * @returns {*} Returns the result of `interceptor`. - * @example + * Used by `_.defaults` to customize its `_.assignIn` use to assign properties + * of source objects to the destination object for all destination properties + * that resolve to `undefined`. * - * _(' abc ') - * .chain() - * .trim() - * .thru(function(value) { - * return [value]; - * }) - * .value(); - * // => ['abc'] + * @private + * @param {*} objValue The destination value. + * @param {*} srcValue The source value. + * @param {string} key The key of the property to assign. + * @param {Object} object The parent object of `objValue`. + * @returns {*} Returns the value to assign. */ - function thru(value, interceptor) { - return interceptor(value); + function customDefaultsAssignIn(objValue, srcValue, key, object) { + if (objValue === undefined || + (eq(objValue, objectProto[key]) && !hasOwnProperty.call(object, key))) { + return srcValue; + } + return objValue; } /** - * This method is the wrapper version of `_.at`. + * Used by `_.defaultsDeep` to customize its `_.merge` use to merge source + * objects into destination objects that are passed thru. * - * @name at - * @memberOf _ - * @since 1.0.0 - * @category Seq - * @param {...(string|string[])} [paths] The property paths to pick. - * @returns {Object} Returns the new `lodash` wrapper instance. - * @example - * - * var object = { 'a': [{ 'b': { 'c': 3 } }, 4] }; - * - * _(object).at(['a[0].b.c', 'a[1]']).value(); - * // => [3, 4] + * @private + * @param {*} objValue The destination value. + * @param {*} srcValue The source value. + * @param {string} key The key of the property to merge. + * @param {Object} object The parent object of `objValue`. + * @param {Object} source The parent object of `srcValue`. + * @param {Object} [stack] Tracks traversed source values and their merged + * counterparts. + * @returns {*} Returns the value to assign. */ - var wrapperAt = flatRest(function(paths) { - var length = paths.length, - start = length ? paths[0] : 0, - value = this.__wrapped__, - interceptor = function(object) { return baseAt(object, paths); }; - - if (length > 1 || this.__actions__.length || - !(value instanceof LazyWrapper) || !isIndex(start)) { - return this.thru(interceptor); + function customDefaultsMerge(objValue, srcValue, key, object, source, stack) { + if (isObject(objValue) && isObject(srcValue)) { + // Recursively merge objects and arrays (susceptible to call stack limits). + stack.set(srcValue, objValue); + baseMerge(objValue, srcValue, undefined, customDefaultsMerge, stack); + stack['delete'](srcValue); } - value = value.slice(start, +start + (length ? 1 : 0)); - value.__actions__.push({ - 'func': thru, - 'args': [interceptor], - 'thisArg': undefined - }); - return new LodashWrapper(value, this.__chain__).thru(function(array) { - if (length && !array.length) { - array.push(undefined); - } - return array; - }); - }); + return objValue; + } /** - * Creates a `lodash` wrapper instance with explicit method chain sequences enabled. - * - * @name chain - * @memberOf _ - * @since 0.1.0 - * @category Seq - * @returns {Object} Returns the new `lodash` wrapper instance. - * @example - * - * var users = [ - * { 'user': 'barney', 'age': 36 }, - * { 'user': 'fred', 'age': 40 } - * ]; - * - * // A sequence without explicit chaining. - * _(users).head(); - * // => { 'user': 'barney', 'age': 36 } + * Used by `_.omit` to customize its `_.cloneDeep` use to only clone plain + * objects. * - * // A sequence with explicit chaining. - * _(users) - * .chain() - * .head() - * .pick('user') - * .value(); - * // => { 'user': 'barney' } + * @private + * @param {*} value The value to inspect. + * @param {string} key The key of the property to inspect. + * @returns {*} Returns the uncloned value or `undefined` to defer cloning to `_.cloneDeep`. */ - function wrapperChain() { - return chain(this); + function customOmitClone(value) { + return isPlainObject(value) ? undefined : value; } /** - * Executes the chain sequence and returns the wrapped result. - * - * @name commit - * @memberOf _ - * @since 3.2.0 - * @category Seq - * @returns {Object} Returns the new `lodash` wrapper instance. - * @example - * - * var array = [1, 2]; - * var wrapped = _(array).push(3); - * - * console.log(array); - * // => [1, 2] - * - * wrapped = wrapped.commit(); - * console.log(array); - * // => [1, 2, 3] - * - * wrapped.last(); - * // => 3 + * A specialized version of `baseIsEqualDeep` for arrays with support for + * partial deep comparisons. * - * console.log(array); - * // => [1, 2, 3] + * @private + * @param {Array} array The array to compare. + * @param {Array} other The other array to compare. + * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. + * @param {Function} customizer The function to customize comparisons. + * @param {Function} equalFunc The function to determine equivalents of values. + * @param {Object} stack Tracks traversed `array` and `other` objects. + * @returns {boolean} Returns `true` if the arrays are equivalent, else `false`. */ - function wrapperCommit() { - return new LodashWrapper(this.value(), this.__chain__); + function equalArrays(array, other, bitmask, customizer, equalFunc, stack) { + var isPartial = bitmask & COMPARE_PARTIAL_FLAG, + arrLength = array.length, + othLength = other.length; + + if (arrLength != othLength && !(isPartial && othLength > arrLength)) { + return false; + } + // Assume cyclic values are equal. + var stacked = stack.get(array); + if (stacked && stack.get(other)) { + return stacked == other; + } + var index = -1, + result = true, + seen = (bitmask & COMPARE_UNORDERED_FLAG) ? new SetCache : undefined; + + stack.set(array, other); + stack.set(other, array); + + // Ignore non-index properties. + while (++index < arrLength) { + var arrValue = array[index], + othValue = other[index]; + + if (customizer) { + var compared = isPartial + ? customizer(othValue, arrValue, index, other, array, stack) + : customizer(arrValue, othValue, index, array, other, stack); + } + if (compared !== undefined) { + if (compared) { + continue; + } + result = false; + break; + } + // Recursively compare arrays (susceptible to call stack limits). + if (seen) { + if (!arraySome(other, function(othValue, othIndex) { + if (!cacheHas(seen, othIndex) && + (arrValue === othValue || equalFunc(arrValue, othValue, bitmask, customizer, stack))) { + return seen.push(othIndex); + } + })) { + result = false; + break; + } + } else if (!( + arrValue === othValue || + equalFunc(arrValue, othValue, bitmask, customizer, stack) + )) { + result = false; + break; + } + } + stack['delete'](array); + stack['delete'](other); + return result; } /** - * Gets the next value on a wrapped object following the - * [iterator protocol](https://mdn.io/iteration_protocols#iterator). - * - * @name next - * @memberOf _ - * @since 4.0.0 - * @category Seq - * @returns {Object} Returns the next iterator value. - * @example - * - * var wrapped = _([1, 2]); + * A specialized version of `baseIsEqualDeep` for comparing objects of + * the same `toStringTag`. * - * wrapped.next(); - * // => { 'done': false, 'value': 1 } + * **Note:** This function only supports comparing values with tags of + * `Boolean`, `Date`, `Error`, `Number`, `RegExp`, or `String`. * - * wrapped.next(); - * // => { 'done': false, 'value': 2 } + * @private + * @param {Object} object The object to compare. + * @param {Object} other The other object to compare. + * @param {string} tag The `toStringTag` of the objects to compare. + * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. + * @param {Function} customizer The function to customize comparisons. + * @param {Function} equalFunc The function to determine equivalents of values. + * @param {Object} stack Tracks traversed `object` and `other` objects. + * @returns {boolean} Returns `true` if the objects are equivalent, else `false`. + */ + function equalByTag(object, other, tag, bitmask, customizer, equalFunc, stack) { + switch (tag) { + case dataViewTag: + if ((object.byteLength != other.byteLength) || + (object.byteOffset != other.byteOffset)) { + return false; + } + object = object.buffer; + other = other.buffer; + + case arrayBufferTag: + if ((object.byteLength != other.byteLength) || + !equalFunc(new Uint8Array(object), new Uint8Array(other))) { + return false; + } + return true; + + case boolTag: + case dateTag: + case numberTag: + // Coerce booleans to `1` or `0` and dates to milliseconds. + // Invalid dates are coerced to `NaN`. + return eq(+object, +other); + + case errorTag: + return object.name == other.name && object.message == other.message; + + case regexpTag: + case stringTag: + // Coerce regexes to strings and treat strings, primitives and objects, + // as equal. See http://www.ecma-international.org/ecma-262/7.0/#sec-regexp.prototype.tostring + // for more details. + return object == (other + ''); + + case mapTag: + var convert = mapToArray; + + case setTag: + var isPartial = bitmask & COMPARE_PARTIAL_FLAG; + convert || (convert = setToArray); + + if (object.size != other.size && !isPartial) { + return false; + } + // Assume cyclic values are equal. + var stacked = stack.get(object); + if (stacked) { + return stacked == other; + } + bitmask |= COMPARE_UNORDERED_FLAG; + + // Recursively compare objects (susceptible to call stack limits). + stack.set(object, other); + var result = equalArrays(convert(object), convert(other), bitmask, customizer, equalFunc, stack); + stack['delete'](object); + return result; + + case symbolTag: + if (symbolValueOf) { + return symbolValueOf.call(object) == symbolValueOf.call(other); + } + } + return false; + } + + /** + * A specialized version of `baseIsEqualDeep` for objects with support for + * partial deep comparisons. * - * wrapped.next(); - * // => { 'done': true, 'value': undefined } + * @private + * @param {Object} object The object to compare. + * @param {Object} other The other object to compare. + * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. + * @param {Function} customizer The function to customize comparisons. + * @param {Function} equalFunc The function to determine equivalents of values. + * @param {Object} stack Tracks traversed `object` and `other` objects. + * @returns {boolean} Returns `true` if the objects are equivalent, else `false`. */ - function wrapperNext() { - if (this.__values__ === undefined) { - this.__values__ = toArray(this.value()); + function equalObjects(object, other, bitmask, customizer, equalFunc, stack) { + var isPartial = bitmask & COMPARE_PARTIAL_FLAG, + objProps = getAllKeys(object), + objLength = objProps.length, + othProps = getAllKeys(other), + othLength = othProps.length; + + if (objLength != othLength && !isPartial) { + return false; } - var done = this.__index__ >= this.__values__.length, - value = done ? undefined : this.__values__[this.__index__++]; + var index = objLength; + while (index--) { + var key = objProps[index]; + if (!(isPartial ? key in other : hasOwnProperty.call(other, key))) { + return false; + } + } + // Assume cyclic values are equal. + var stacked = stack.get(object); + if (stacked && stack.get(other)) { + return stacked == other; + } + var result = true; + stack.set(object, other); + stack.set(other, object); - return { 'done': done, 'value': value }; + var skipCtor = isPartial; + while (++index < objLength) { + key = objProps[index]; + var objValue = object[key], + othValue = other[key]; + + if (customizer) { + var compared = isPartial + ? customizer(othValue, objValue, key, other, object, stack) + : customizer(objValue, othValue, key, object, other, stack); + } + // Recursively compare objects (susceptible to call stack limits). + if (!(compared === undefined + ? (objValue === othValue || equalFunc(objValue, othValue, bitmask, customizer, stack)) + : compared + )) { + result = false; + break; + } + skipCtor || (skipCtor = key == 'constructor'); + } + if (result && !skipCtor) { + var objCtor = object.constructor, + othCtor = other.constructor; + + // Non `Object` object instances with different constructors are not equal. + if (objCtor != othCtor && + ('constructor' in object && 'constructor' in other) && + !(typeof objCtor == 'function' && objCtor instanceof objCtor && + typeof othCtor == 'function' && othCtor instanceof othCtor)) { + result = false; + } + } + stack['delete'](object); + stack['delete'](other); + return result; } /** - * Enables the wrapper to be iterable. - * - * @name Symbol.iterator - * @memberOf _ - * @since 4.0.0 - * @category Seq - * @returns {Object} Returns the wrapper object. - * @example - * - * var wrapped = _([1, 2]); - * - * wrapped[Symbol.iterator]() === wrapped; - * // => true + * A specialized version of `baseRest` which flattens the rest array. * - * Array.from(wrapped); - * // => [1, 2] + * @private + * @param {Function} func The function to apply a rest parameter to. + * @returns {Function} Returns the new function. */ - function wrapperToIterator() { - return this; + function flatRest(func) { + return setToString(overRest(func, undefined, flatten), func + ''); } /** - * Creates a clone of the chain sequence planting `value` as the wrapped value. - * - * @name plant - * @memberOf _ - * @since 3.2.0 - * @category Seq - * @param {*} value The value to plant. - * @returns {Object} Returns the new `lodash` wrapper instance. - * @example + * Creates an array of own enumerable property names and symbols of `object`. * - * function square(n) { - * return n * n; - * } + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property names and symbols. + */ + function getAllKeys(object) { + return baseGetAllKeys(object, keys, getSymbols); + } + + /** + * Creates an array of own and inherited enumerable property names and + * symbols of `object`. * - * var wrapped = _([1, 2]).map(square); - * var other = wrapped.plant([3, 4]); + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property names and symbols. + */ + function getAllKeysIn(object) { + return baseGetAllKeys(object, keysIn, getSymbolsIn); + } + + /** + * Gets metadata for `func`. * - * other.value(); - * // => [9, 16] + * @private + * @param {Function} func The function to query. + * @returns {*} Returns the metadata for `func`. + */ + var getData = !metaMap ? noop : function(func) { + return metaMap.get(func); + }; + + /** + * Gets the name of `func`. * - * wrapped.value(); - * // => [1, 4] + * @private + * @param {Function} func The function to query. + * @returns {string} Returns the function name. */ - function wrapperPlant(value) { - var result, - parent = this; + function getFuncName(func) { + var result = (func.name + ''), + array = realNames[result], + length = hasOwnProperty.call(realNames, result) ? array.length : 0; - while (parent instanceof baseLodash) { - var clone = wrapperClone(parent); - clone.__index__ = 0; - clone.__values__ = undefined; - if (result) { - previous.__wrapped__ = clone; - } else { - result = clone; + while (length--) { + var data = array[length], + otherFunc = data.func; + if (otherFunc == null || otherFunc == func) { + return data.name; } - var previous = clone; - parent = parent.__wrapped__; } - previous.__wrapped__ = value; return result; } /** - * This method is the wrapper version of `_.reverse`. - * - * **Note:** This method mutates the wrapped array. - * - * @name reverse - * @memberOf _ - * @since 0.1.0 - * @category Seq - * @returns {Object} Returns the new `lodash` wrapper instance. - * @example - * - * var array = [1, 2, 3]; - * - * _(array).reverse().value() - * // => [3, 2, 1] + * Gets the argument placeholder value for `func`. * - * console.log(array); - * // => [3, 2, 1] + * @private + * @param {Function} func The function to inspect. + * @returns {*} Returns the placeholder value. */ - function wrapperReverse() { - var value = this.__wrapped__; - if (value instanceof LazyWrapper) { - var wrapped = value; - if (this.__actions__.length) { - wrapped = new LazyWrapper(this); - } - wrapped = wrapped.reverse(); - wrapped.__actions__.push({ - 'func': thru, - 'args': [reverse], - 'thisArg': undefined - }); - return new LodashWrapper(wrapped, this.__chain__); - } - return this.thru(reverse); + function getHolder(func) { + var object = hasOwnProperty.call(lodash, 'placeholder') ? lodash : func; + return object.placeholder; } /** - * Executes the chain sequence to resolve the unwrapped value. - * - * @name value - * @memberOf _ - * @since 0.1.0 - * @alias toJSON, valueOf - * @category Seq - * @returns {*} Returns the resolved unwrapped value. - * @example + * Gets the appropriate "iteratee" function. If `_.iteratee` is customized, + * this function returns the custom method, otherwise it returns `baseIteratee`. + * If arguments are provided, the chosen function is invoked with them and + * its result is returned. * - * _([1, 2, 3]).value(); - * // => [1, 2, 3] + * @private + * @param {*} [value] The value to convert to an iteratee. + * @param {number} [arity] The arity of the created iteratee. + * @returns {Function} Returns the chosen function or its result. */ - function wrapperValue() { - return baseWrapperValue(this.__wrapped__, this.__actions__); + function getIteratee() { + var result = lodash.iteratee || iteratee; + result = result === iteratee ? baseIteratee : result; + return arguments.length ? result(arguments[0], arguments[1]) : result; } - /*------------------------------------------------------------------------*/ - /** - * Creates an object composed of keys generated from the results of running - * each element of `collection` thru `iteratee`. The corresponding value of - * each key is the number of times the key was returned by `iteratee`. The - * iteratee is invoked with one argument: (value). - * - * @static - * @memberOf _ - * @since 0.5.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The iteratee to transform keys. - * @returns {Object} Returns the composed aggregate object. - * @example - * - * _.countBy([6.1, 4.2, 6.3], Math.floor); - * // => { '4': 1, '6': 2 } + * Gets the data for `map`. * - * // The `_.property` iteratee shorthand. - * _.countBy(['one', 'two', 'three'], 'length'); - * // => { '3': 2, '5': 1 } + * @private + * @param {Object} map The map to query. + * @param {string} key The reference key. + * @returns {*} Returns the map data. */ - var countBy = createAggregator(function(result, value, key) { - if (hasOwnProperty.call(result, key)) { - ++result[key]; - } else { - baseAssignValue(result, key, 1); - } - }); + function getMapData(map, key) { + var data = map.__data__; + return isKeyable(key) + ? data[typeof key == 'string' ? 'string' : 'hash'] + : data.map; + } /** - * Checks if `predicate` returns truthy for **all** elements of `collection`. - * Iteration is stopped once `predicate` returns falsey. The predicate is - * invoked with three arguments: (value, index|key, collection). - * - * **Note:** This method returns `true` for - * [empty collections](https://en.wikipedia.org/wiki/Empty_set) because - * [everything is true](https://en.wikipedia.org/wiki/Vacuous_truth) of - * elements of empty collections. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {boolean} Returns `true` if all elements pass the predicate check, - * else `false`. - * @example - * - * _.every([true, 1, null, 'yes'], Boolean); - * // => false - * - * var users = [ - * { 'user': 'barney', 'age': 36, 'active': false }, - * { 'user': 'fred', 'age': 40, 'active': false } - * ]; - * - * // The `_.matches` iteratee shorthand. - * _.every(users, { 'user': 'barney', 'active': false }); - * // => false - * - * // The `_.matchesProperty` iteratee shorthand. - * _.every(users, ['active', false]); - * // => true + * Gets the property names, values, and compare flags of `object`. * - * // The `_.property` iteratee shorthand. - * _.every(users, 'active'); - * // => false + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the match data of `object`. */ - function every(collection, predicate, guard) { - var func = isArray(collection) ? arrayEvery : baseEvery; - if (guard && isIterateeCall(collection, predicate, guard)) { - predicate = undefined; + function getMatchData(object) { + var result = keys(object), + length = result.length; + + while (length--) { + var key = result[length], + value = object[key]; + + result[length] = [key, value, isStrictComparable(value)]; } - return func(collection, getIteratee(predicate, 3)); + return result; } /** - * Iterates over elements of `collection`, returning an array of all elements - * `predicate` returns truthy for. The predicate is invoked with three - * arguments: (value, index|key, collection). - * - * **Note:** Unlike `_.remove`, this method returns a new array. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {Array} Returns the new filtered array. - * @see _.reject - * @example - * - * var users = [ - * { 'user': 'barney', 'age': 36, 'active': true }, - * { 'user': 'fred', 'age': 40, 'active': false } - * ]; - * - * _.filter(users, function(o) { return !o.active; }); - * // => objects for ['fred'] - * - * // The `_.matches` iteratee shorthand. - * _.filter(users, { 'age': 36, 'active': true }); - * // => objects for ['barney'] - * - * // The `_.matchesProperty` iteratee shorthand. - * _.filter(users, ['active', false]); - * // => objects for ['fred'] + * Gets the native function at `key` of `object`. * - * // The `_.property` iteratee shorthand. - * _.filter(users, 'active'); - * // => objects for ['barney'] + * @private + * @param {Object} object The object to query. + * @param {string} key The key of the method to get. + * @returns {*} Returns the function if it's native, else `undefined`. */ - function filter(collection, predicate) { - var func = isArray(collection) ? arrayFilter : baseFilter; - return func(collection, getIteratee(predicate, 3)); + function getNative(object, key) { + var value = getValue(object, key); + return baseIsNative(value) ? value : undefined; } /** - * Iterates over elements of `collection`, returning the first element - * `predicate` returns truthy for. The predicate is invoked with three - * arguments: (value, index|key, collection). - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to inspect. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @param {number} [fromIndex=0] The index to search from. - * @returns {*} Returns the matched element, else `undefined`. - * @example - * - * var users = [ - * { 'user': 'barney', 'age': 36, 'active': true }, - * { 'user': 'fred', 'age': 40, 'active': false }, - * { 'user': 'pebbles', 'age': 1, 'active': true } - * ]; - * - * _.find(users, function(o) { return o.age < 40; }); - * // => object for 'barney' - * - * // The `_.matches` iteratee shorthand. - * _.find(users, { 'age': 1, 'active': true }); - * // => object for 'pebbles' - * - * // The `_.matchesProperty` iteratee shorthand. - * _.find(users, ['active', false]); - * // => object for 'fred' + * A specialized version of `baseGetTag` which ignores `Symbol.toStringTag` values. * - * // The `_.property` iteratee shorthand. - * _.find(users, 'active'); - * // => object for 'barney' + * @private + * @param {*} value The value to query. + * @returns {string} Returns the raw `toStringTag`. */ - var find = createFind(findIndex); + function getRawTag(value) { + var isOwn = hasOwnProperty.call(value, symToStringTag), + tag = value[symToStringTag]; - /** - * This method is like `_.find` except that it iterates over elements of - * `collection` from right to left. - * - * @static - * @memberOf _ - * @since 2.0.0 - * @category Collection - * @param {Array|Object} collection The collection to inspect. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @param {number} [fromIndex=collection.length-1] The index to search from. - * @returns {*} Returns the matched element, else `undefined`. - * @example - * - * _.findLast([1, 2, 3, 4], function(n) { - * return n % 2 == 1; - * }); - * // => 3 - */ - var findLast = createFind(findLastIndex); + try { + value[symToStringTag] = undefined; + var unmasked = true; + } catch (e) {} + + var result = nativeObjectToString.call(value); + if (unmasked) { + if (isOwn) { + value[symToStringTag] = tag; + } else { + delete value[symToStringTag]; + } + } + return result; + } /** - * Creates a flattened array of values by running each element in `collection` - * thru `iteratee` and flattening the mapped results. The iteratee is invoked - * with three arguments: (value, index|key, collection). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Array} Returns the new flattened array. - * @example - * - * function duplicate(n) { - * return [n, n]; - * } + * Creates an array of the own enumerable symbols of `object`. * - * _.flatMap([1, 2], duplicate); - * // => [1, 1, 2, 2] + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the array of symbols. */ - function flatMap(collection, iteratee) { - return baseFlatten(map(collection, iteratee), 1); - } + var getSymbols = !nativeGetSymbols ? stubArray : function(object) { + if (object == null) { + return []; + } + object = Object(object); + return arrayFilter(nativeGetSymbols(object), function(symbol) { + return propertyIsEnumerable.call(object, symbol); + }); + }; /** - * This method is like `_.flatMap` except that it recursively flattens the - * mapped results. - * - * @static - * @memberOf _ - * @since 4.7.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Array} Returns the new flattened array. - * @example - * - * function duplicate(n) { - * return [[[n, n]]]; - * } + * Creates an array of the own and inherited enumerable symbols of `object`. * - * _.flatMapDeep([1, 2], duplicate); - * // => [1, 1, 2, 2] + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the array of symbols. */ - function flatMapDeep(collection, iteratee) { - return baseFlatten(map(collection, iteratee), INFINITY); - } + var getSymbolsIn = !nativeGetSymbols ? stubArray : function(object) { + var result = []; + while (object) { + arrayPush(result, getSymbols(object)); + object = getPrototype(object); + } + return result; + }; /** - * This method is like `_.flatMap` except that it recursively flattens the - * mapped results up to `depth` times. - * - * @static - * @memberOf _ - * @since 4.7.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @param {number} [depth=1] The maximum recursion depth. - * @returns {Array} Returns the new flattened array. - * @example - * - * function duplicate(n) { - * return [[[n, n]]]; - * } + * Gets the `toStringTag` of `value`. * - * _.flatMapDepth([1, 2], duplicate, 2); - * // => [[1, 1], [2, 2]] + * @private + * @param {*} value The value to query. + * @returns {string} Returns the `toStringTag`. */ - function flatMapDepth(collection, iteratee, depth) { - depth = depth === undefined ? 1 : toInteger(depth); - return baseFlatten(map(collection, iteratee), depth); + var getTag = baseGetTag; + + // Fallback for data views, maps, sets, and weak maps in IE 11 and promises in Node.js < 6. + if ((DataView && getTag(new DataView(new ArrayBuffer(1))) != dataViewTag) || + (Map && getTag(new Map) != mapTag) || + (Promise && getTag(Promise.resolve()) != promiseTag) || + (Set && getTag(new Set) != setTag) || + (WeakMap && getTag(new WeakMap) != weakMapTag)) { + getTag = function(value) { + var result = baseGetTag(value), + Ctor = result == objectTag ? value.constructor : undefined, + ctorString = Ctor ? toSource(Ctor) : ''; + + if (ctorString) { + switch (ctorString) { + case dataViewCtorString: return dataViewTag; + case mapCtorString: return mapTag; + case promiseCtorString: return promiseTag; + case setCtorString: return setTag; + case weakMapCtorString: return weakMapTag; + } + } + return result; + }; } /** - * Iterates over elements of `collection` and invokes `iteratee` for each element. - * The iteratee is invoked with three arguments: (value, index|key, collection). - * Iteratee functions may exit iteration early by explicitly returning `false`. - * - * **Note:** As with other "Collections" methods, objects with a "length" - * property are iterated like arrays. To avoid this behavior use `_.forIn` - * or `_.forOwn` for object iteration. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @alias each - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Array|Object} Returns `collection`. - * @see _.forEachRight - * @example - * - * _.forEach([1, 2], function(value) { - * console.log(value); - * }); - * // => Logs `1` then `2`. + * Gets the view, applying any `transforms` to the `start` and `end` positions. * - * _.forEach({ 'a': 1, 'b': 2 }, function(value, key) { - * console.log(key); - * }); - * // => Logs 'a' then 'b' (iteration order is not guaranteed). + * @private + * @param {number} start The start of the view. + * @param {number} end The end of the view. + * @param {Array} transforms The transformations to apply to the view. + * @returns {Object} Returns an object containing the `start` and `end` + * positions of the view. */ - function forEach(collection, iteratee) { - var func = isArray(collection) ? arrayEach : baseEach; - return func(collection, getIteratee(iteratee, 3)); + function getView(start, end, transforms) { + var index = -1, + length = transforms.length; + + while (++index < length) { + var data = transforms[index], + size = data.size; + + switch (data.type) { + case 'drop': start += size; break; + case 'dropRight': end -= size; break; + case 'take': end = nativeMin(end, start + size); break; + case 'takeRight': start = nativeMax(start, end - size); break; + } + } + return { 'start': start, 'end': end }; } /** - * This method is like `_.forEach` except that it iterates over elements of - * `collection` from right to left. - * - * @static - * @memberOf _ - * @since 2.0.0 - * @alias eachRight - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Array|Object} Returns `collection`. - * @see _.forEach - * @example + * Extracts wrapper details from the `source` body comment. * - * _.forEachRight([1, 2], function(value) { - * console.log(value); - * }); - * // => Logs `2` then `1`. + * @private + * @param {string} source The source to inspect. + * @returns {Array} Returns the wrapper details. */ - function forEachRight(collection, iteratee) { - var func = isArray(collection) ? arrayEachRight : baseEachRight; - return func(collection, getIteratee(iteratee, 3)); + function getWrapDetails(source) { + var match = source.match(reWrapDetails); + return match ? match[1].split(reSplitDetails) : []; } /** - * Creates an object composed of keys generated from the results of running - * each element of `collection` thru `iteratee`. The order of grouped values - * is determined by the order they occur in `collection`. The corresponding - * value of each key is an array of elements responsible for generating the - * key. The iteratee is invoked with one argument: (value). - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The iteratee to transform keys. - * @returns {Object} Returns the composed aggregate object. - * @example - * - * _.groupBy([6.1, 4.2, 6.3], Math.floor); - * // => { '4': [4.2], '6': [6.1, 6.3] } + * Checks if `path` exists on `object`. * - * // The `_.property` iteratee shorthand. - * _.groupBy(['one', 'two', 'three'], 'length'); - * // => { '3': ['one', 'two'], '5': ['three'] } + * @private + * @param {Object} object The object to query. + * @param {Array|string} path The path to check. + * @param {Function} hasFunc The function to check properties. + * @returns {boolean} Returns `true` if `path` exists, else `false`. */ - var groupBy = createAggregator(function(result, value, key) { - if (hasOwnProperty.call(result, key)) { - result[key].push(value); - } else { - baseAssignValue(result, key, [value]); + function hasPath(object, path, hasFunc) { + path = castPath(path, object); + + var index = -1, + length = path.length, + result = false; + + while (++index < length) { + var key = toKey(path[index]); + if (!(result = object != null && hasFunc(object, key))) { + break; + } + object = object[key]; } - }); + if (result || ++index != length) { + return result; + } + length = object == null ? 0 : object.length; + return !!length && isLength(length) && isIndex(key, length) && + (isArray(object) || isArguments(object)); + } /** - * Checks if `value` is in `collection`. If `collection` is a string, it's - * checked for a substring of `value`, otherwise - * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * is used for equality comparisons. If `fromIndex` is negative, it's used as - * the offset from the end of `collection`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object|string} collection The collection to inspect. - * @param {*} value The value to search for. - * @param {number} [fromIndex=0] The index to search from. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`. - * @returns {boolean} Returns `true` if `value` is found, else `false`. - * @example - * - * _.includes([1, 2, 3], 1); - * // => true - * - * _.includes([1, 2, 3], 1, 2); - * // => false - * - * _.includes({ 'a': 1, 'b': 2 }, 1); - * // => true + * Initializes an array clone. * - * _.includes('abcd', 'bc'); - * // => true + * @private + * @param {Array} array The array to clone. + * @returns {Array} Returns the initialized clone. */ - function includes(collection, value, fromIndex, guard) { - collection = isArrayLike(collection) ? collection : values(collection); - fromIndex = (fromIndex && !guard) ? toInteger(fromIndex) : 0; + function initCloneArray(array) { + var length = array.length, + result = array.constructor(length); - var length = collection.length; - if (fromIndex < 0) { - fromIndex = nativeMax(length + fromIndex, 0); + // Add properties assigned by `RegExp#exec`. + if (length && typeof array[0] == 'string' && hasOwnProperty.call(array, 'index')) { + result.index = array.index; + result.input = array.input; } - return isString(collection) - ? (fromIndex <= length && collection.indexOf(value, fromIndex) > -1) - : (!!length && baseIndexOf(collection, value, fromIndex) > -1); + return result; } /** - * Invokes the method at `path` of each element in `collection`, returning - * an array of the results of each invoked method. Any additional arguments - * are provided to each invoked method. If `path` is a function, it's invoked - * for, and `this` bound to, each element in `collection`. + * Initializes an object clone. * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Array|Function|string} path The path of the method to invoke or - * the function invoked per iteration. - * @param {...*} [args] The arguments to invoke each method with. - * @returns {Array} Returns the array of results. - * @example + * @private + * @param {Object} object The object to clone. + * @returns {Object} Returns the initialized clone. + */ + function initCloneObject(object) { + return (typeof object.constructor == 'function' && !isPrototype(object)) + ? baseCreate(getPrototype(object)) + : {}; + } + + /** + * Initializes an object clone based on its `toStringTag`. * - * _.invokeMap([[5, 1, 7], [3, 2, 1]], 'sort'); - * // => [[1, 5, 7], [1, 2, 3]] + * **Note:** This function only supports cloning values with tags of + * `Boolean`, `Date`, `Error`, `Number`, `RegExp`, or `String`. * - * _.invokeMap([123, 456], String.prototype.split, ''); - * // => [['1', '2', '3'], ['4', '5', '6']] + * @private + * @param {Object} object The object to clone. + * @param {string} tag The `toStringTag` of the object to clone. + * @param {Function} cloneFunc The function to clone values. + * @param {boolean} [isDeep] Specify a deep clone. + * @returns {Object} Returns the initialized clone. */ - var invokeMap = baseRest(function(collection, path, args) { - var index = -1, - isFunc = typeof path == 'function', - result = isArrayLike(collection) ? Array(collection.length) : []; + function initCloneByTag(object, tag, cloneFunc, isDeep) { + var Ctor = object.constructor; + switch (tag) { + case arrayBufferTag: + return cloneArrayBuffer(object); - baseEach(collection, function(value) { - result[++index] = isFunc ? apply(path, value, args) : baseInvoke(value, path, args); - }); - return result; - }); + case boolTag: + case dateTag: + return new Ctor(+object); + + case dataViewTag: + return cloneDataView(object, isDeep); + + case float32Tag: case float64Tag: + case int8Tag: case int16Tag: case int32Tag: + case uint8Tag: case uint8ClampedTag: case uint16Tag: case uint32Tag: + return cloneTypedArray(object, isDeep); + + case mapTag: + return cloneMap(object, isDeep, cloneFunc); + + case numberTag: + case stringTag: + return new Ctor(object); + + case regexpTag: + return cloneRegExp(object); + + case setTag: + return cloneSet(object, isDeep, cloneFunc); + + case symbolTag: + return cloneSymbol(object); + } + } /** - * Creates an object composed of keys generated from the results of running - * each element of `collection` thru `iteratee`. The corresponding value of - * each key is the last element responsible for generating the key. The - * iteratee is invoked with one argument: (value). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The iteratee to transform keys. - * @returns {Object} Returns the composed aggregate object. - * @example - * - * var array = [ - * { 'dir': 'left', 'code': 97 }, - * { 'dir': 'right', 'code': 100 } - * ]; - * - * _.keyBy(array, function(o) { - * return String.fromCharCode(o.code); - * }); - * // => { 'a': { 'dir': 'left', 'code': 97 }, 'd': { 'dir': 'right', 'code': 100 } } + * Inserts wrapper `details` in a comment at the top of the `source` body. * - * _.keyBy(array, 'dir'); - * // => { 'left': { 'dir': 'left', 'code': 97 }, 'right': { 'dir': 'right', 'code': 100 } } + * @private + * @param {string} source The source to modify. + * @returns {Array} details The details to insert. + * @returns {string} Returns the modified source. */ - var keyBy = createAggregator(function(result, value, key) { - baseAssignValue(result, key, value); - }); + function insertWrapDetails(source, details) { + var length = details.length; + if (!length) { + return source; + } + var lastIndex = length - 1; + details[lastIndex] = (length > 1 ? '& ' : '') + details[lastIndex]; + details = details.join(length > 2 ? ', ' : ' '); + return source.replace(reWrapComment, '{\n/* [wrapped with ' + details + '] */\n'); + } /** - * Creates an array of values by running each element in `collection` thru - * `iteratee`. The iteratee is invoked with three arguments: - * (value, index|key, collection). - * - * Many lodash methods are guarded to work as iteratees for methods like - * `_.every`, `_.filter`, `_.map`, `_.mapValues`, `_.reject`, and `_.some`. - * - * The guarded methods are: - * `ary`, `chunk`, `curry`, `curryRight`, `drop`, `dropRight`, `every`, - * `fill`, `invert`, `parseInt`, `random`, `range`, `rangeRight`, `repeat`, - * `sampleSize`, `slice`, `some`, `sortBy`, `split`, `take`, `takeRight`, - * `template`, `trim`, `trimEnd`, `trimStart`, and `words` - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Array} Returns the new mapped array. - * @example - * - * function square(n) { - * return n * n; - * } - * - * _.map([4, 8], square); - * // => [16, 64] - * - * _.map({ 'a': 4, 'b': 8 }, square); - * // => [16, 64] (iteration order is not guaranteed) - * - * var users = [ - * { 'user': 'barney' }, - * { 'user': 'fred' } - * ]; + * Checks if `value` is a flattenable `arguments` object or array. * - * // The `_.property` iteratee shorthand. - * _.map(users, 'user'); - * // => ['barney', 'fred'] + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is flattenable, else `false`. */ - function map(collection, iteratee) { - var func = isArray(collection) ? arrayMap : baseMap; - return func(collection, getIteratee(iteratee, 3)); + function isFlattenable(value) { + return isArray(value) || isArguments(value) || + !!(spreadableSymbol && value && value[spreadableSymbol]); } /** - * This method is like `_.sortBy` except that it allows specifying the sort - * orders of the iteratees to sort by. If `orders` is unspecified, all values - * are sorted in ascending order. Otherwise, specify an order of "desc" for - * descending or "asc" for ascending sort order of corresponding values. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Array[]|Function[]|Object[]|string[]} [iteratees=[_.identity]] - * The iteratees to sort by. - * @param {string[]} [orders] The sort orders of `iteratees`. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`. - * @returns {Array} Returns the new sorted array. - * @example + * Checks if `value` is a valid array-like index. * - * var users = [ - * { 'user': 'fred', 'age': 48 }, - * { 'user': 'barney', 'age': 34 }, - * { 'user': 'fred', 'age': 40 }, - * { 'user': 'barney', 'age': 36 } - * ]; + * @private + * @param {*} value The value to check. + * @param {number} [length=MAX_SAFE_INTEGER] The upper bounds of a valid index. + * @returns {boolean} Returns `true` if `value` is a valid index, else `false`. + */ + function isIndex(value, length) { + length = length == null ? MAX_SAFE_INTEGER : length; + return !!length && + (typeof value == 'number' || reIsUint.test(value)) && + (value > -1 && value % 1 == 0 && value < length); + } + + /** + * Checks if the given arguments are from an iteratee call. * - * // Sort by `user` in ascending order and by `age` in descending order. - * _.orderBy(users, ['user', 'age'], ['asc', 'desc']); - * // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 40]] + * @private + * @param {*} value The potential iteratee value argument. + * @param {*} index The potential iteratee index or key argument. + * @param {*} object The potential iteratee object argument. + * @returns {boolean} Returns `true` if the arguments are from an iteratee call, + * else `false`. */ - function orderBy(collection, iteratees, orders, guard) { - if (collection == null) { - return []; - } - if (!isArray(iteratees)) { - iteratees = iteratees == null ? [] : [iteratees]; + function isIterateeCall(value, index, object) { + if (!isObject(object)) { + return false; } - orders = guard ? undefined : orders; - if (!isArray(orders)) { - orders = orders == null ? [] : [orders]; + var type = typeof index; + if (type == 'number' + ? (isArrayLike(object) && isIndex(index, object.length)) + : (type == 'string' && index in object) + ) { + return eq(object[index], value); } - return baseOrderBy(collection, iteratees, orders); + return false; } /** - * Creates an array of elements split into two groups, the first of which - * contains elements `predicate` returns truthy for, the second of which - * contains elements `predicate` returns falsey for. The predicate is - * invoked with one argument: (value). - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {Array} Returns the array of grouped elements. - * @example - * - * var users = [ - * { 'user': 'barney', 'age': 36, 'active': false }, - * { 'user': 'fred', 'age': 40, 'active': true }, - * { 'user': 'pebbles', 'age': 1, 'active': false } - * ]; - * - * _.partition(users, function(o) { return o.active; }); - * // => objects for [['fred'], ['barney', 'pebbles']] - * - * // The `_.matches` iteratee shorthand. - * _.partition(users, { 'age': 1, 'active': false }); - * // => objects for [['pebbles'], ['barney', 'fred']] - * - * // The `_.matchesProperty` iteratee shorthand. - * _.partition(users, ['active', false]); - * // => objects for [['barney', 'pebbles'], ['fred']] + * Checks if `value` is a property name and not a property path. * - * // The `_.property` iteratee shorthand. - * _.partition(users, 'active'); - * // => objects for [['fred'], ['barney', 'pebbles']] + * @private + * @param {*} value The value to check. + * @param {Object} [object] The object to query keys on. + * @returns {boolean} Returns `true` if `value` is a property name, else `false`. */ - var partition = createAggregator(function(result, value, key) { - result[key ? 0 : 1].push(value); - }, function() { return [[], []]; }); + function isKey(value, object) { + if (isArray(value)) { + return false; + } + var type = typeof value; + if (type == 'number' || type == 'symbol' || type == 'boolean' || + value == null || isSymbol(value)) { + return true; + } + return reIsPlainProp.test(value) || !reIsDeepProp.test(value) || + (object != null && value in Object(object)); + } /** - * Reduces `collection` to a value which is the accumulated result of running - * each element in `collection` thru `iteratee`, where each successive - * invocation is supplied the return value of the previous. If `accumulator` - * is not given, the first element of `collection` is used as the initial - * value. The iteratee is invoked with four arguments: - * (accumulator, value, index|key, collection). - * - * Many lodash methods are guarded to work as iteratees for methods like - * `_.reduce`, `_.reduceRight`, and `_.transform`. - * - * The guarded methods are: - * `assign`, `defaults`, `defaultsDeep`, `includes`, `merge`, `orderBy`, - * and `sortBy` - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @param {*} [accumulator] The initial value. - * @returns {*} Returns the accumulated value. - * @see _.reduceRight - * @example - * - * _.reduce([1, 2], function(sum, n) { - * return sum + n; - * }, 0); - * // => 3 + * Checks if `value` is suitable for use as unique object key. * - * _.reduce({ 'a': 1, 'b': 2, 'c': 1 }, function(result, value, key) { - * (result[value] || (result[value] = [])).push(key); - * return result; - * }, {}); - * // => { '1': ['a', 'c'], '2': ['b'] } (iteration order is not guaranteed) + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is suitable, else `false`. */ - function reduce(collection, iteratee, accumulator) { - var func = isArray(collection) ? arrayReduce : baseReduce, - initAccum = arguments.length < 3; - - return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEach); + function isKeyable(value) { + var type = typeof value; + return (type == 'string' || type == 'number' || type == 'symbol' || type == 'boolean') + ? (value !== '__proto__') + : (value === null); } /** - * This method is like `_.reduce` except that it iterates over elements of - * `collection` from right to left. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @param {*} [accumulator] The initial value. - * @returns {*} Returns the accumulated value. - * @see _.reduce - * @example - * - * var array = [[0, 1], [2, 3], [4, 5]]; + * Checks if `func` has a lazy counterpart. * - * _.reduceRight(array, function(flattened, other) { - * return flattened.concat(other); - * }, []); - * // => [4, 5, 2, 3, 0, 1] + * @private + * @param {Function} func The function to check. + * @returns {boolean} Returns `true` if `func` has a lazy counterpart, + * else `false`. */ - function reduceRight(collection, iteratee, accumulator) { - var func = isArray(collection) ? arrayReduceRight : baseReduce, - initAccum = arguments.length < 3; + function isLaziable(func) { + var funcName = getFuncName(func), + other = lodash[funcName]; - return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEachRight); + if (typeof other != 'function' || !(funcName in LazyWrapper.prototype)) { + return false; + } + if (func === other) { + return true; + } + var data = getData(other); + return !!data && func === data[0]; } /** - * The opposite of `_.filter`; this method returns the elements of `collection` - * that `predicate` does **not** return truthy for. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {Array} Returns the new filtered array. - * @see _.filter - * @example - * - * var users = [ - * { 'user': 'barney', 'age': 36, 'active': false }, - * { 'user': 'fred', 'age': 40, 'active': true } - * ]; - * - * _.reject(users, function(o) { return !o.active; }); - * // => objects for ['fred'] - * - * // The `_.matches` iteratee shorthand. - * _.reject(users, { 'age': 40, 'active': true }); - * // => objects for ['barney'] - * - * // The `_.matchesProperty` iteratee shorthand. - * _.reject(users, ['active', false]); - * // => objects for ['fred'] + * Checks if `func` has its source masked. * - * // The `_.property` iteratee shorthand. - * _.reject(users, 'active'); - * // => objects for ['barney'] + * @private + * @param {Function} func The function to check. + * @returns {boolean} Returns `true` if `func` is masked, else `false`. */ - function reject(collection, predicate) { - var func = isArray(collection) ? arrayFilter : baseFilter; - return func(collection, negate(getIteratee(predicate, 3))); + function isMasked(func) { + return !!maskSrcKey && (maskSrcKey in func); } /** - * Gets a random element from `collection`. + * Checks if `func` is capable of being masked. * - * @static - * @memberOf _ - * @since 2.0.0 - * @category Collection - * @param {Array|Object} collection The collection to sample. - * @returns {*} Returns the random element. - * @example + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `func` is maskable, else `false`. + */ + var isMaskable = coreJsData ? isFunction : stubFalse; + + /** + * Checks if `value` is likely a prototype object. * - * _.sample([1, 2, 3, 4]); - * // => 2 + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a prototype, else `false`. */ - function sample(collection) { - var func = isArray(collection) ? arraySample : baseSample; - return func(collection); + function isPrototype(value) { + var Ctor = value && value.constructor, + proto = (typeof Ctor == 'function' && Ctor.prototype) || objectProto; + + return value === proto; } /** - * Gets `n` random elements at unique keys from `collection` up to the - * size of `collection`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Collection - * @param {Array|Object} collection The collection to sample. - * @param {number} [n=1] The number of elements to sample. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Array} Returns the random elements. - * @example - * - * _.sampleSize([1, 2, 3], 2); - * // => [3, 1] + * Checks if `value` is suitable for strict equality comparisons, i.e. `===`. * - * _.sampleSize([1, 2, 3], 4); - * // => [2, 3, 1] + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` if suitable for strict + * equality comparisons, else `false`. */ - function sampleSize(collection, n, guard) { - if ((guard ? isIterateeCall(collection, n, guard) : n === undefined)) { - n = 1; - } else { - n = toInteger(n); - } - var func = isArray(collection) ? arraySampleSize : baseSampleSize; - return func(collection, n); + function isStrictComparable(value) { + return value === value && !isObject(value); } /** - * Creates an array of shuffled values, using a version of the - * [Fisher-Yates shuffle](https://en.wikipedia.org/wiki/Fisher-Yates_shuffle). - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to shuffle. - * @returns {Array} Returns the new shuffled array. - * @example + * A specialized version of `matchesProperty` for source values suitable + * for strict equality comparisons, i.e. `===`. * - * _.shuffle([1, 2, 3, 4]); - * // => [4, 1, 3, 2] + * @private + * @param {string} key The key of the property to get. + * @param {*} srcValue The value to match. + * @returns {Function} Returns the new spec function. */ - function shuffle(collection) { - var func = isArray(collection) ? arrayShuffle : baseShuffle; - return func(collection); + function matchesStrictComparable(key, srcValue) { + return function(object) { + if (object == null) { + return false; + } + return object[key] === srcValue && + (srcValue !== undefined || (key in Object(object))); + }; } /** - * Gets the size of `collection` by returning its length for array-like - * values or the number of own enumerable string keyed properties for objects. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object|string} collection The collection to inspect. - * @returns {number} Returns the collection size. - * @example + * A specialized version of `_.memoize` which clears the memoized function's + * cache when it exceeds `MAX_MEMOIZE_SIZE`. * - * _.size([1, 2, 3]); - * // => 3 + * @private + * @param {Function} func The function to have its output memoized. + * @returns {Function} Returns the new memoized function. + */ + function memoizeCapped(func) { + var result = memoize(func, function(key) { + if (cache.size === MAX_MEMOIZE_SIZE) { + cache.clear(); + } + return key; + }); + + var cache = result.cache; + return result; + } + + /** + * Merges the function metadata of `source` into `data`. * - * _.size({ 'a': 1, 'b': 2 }); - * // => 2 + * Merging metadata reduces the number of wrappers used to invoke a function. + * This is possible because methods like `_.bind`, `_.curry`, and `_.partial` + * may be applied regardless of execution order. Methods like `_.ary` and + * `_.rearg` modify function arguments, making the order in which they are + * executed important, preventing the merging of metadata. However, we make + * an exception for a safe combined case where curried functions have `_.ary` + * and or `_.rearg` applied. * - * _.size('pebbles'); - * // => 7 + * @private + * @param {Array} data The destination metadata. + * @param {Array} source The source metadata. + * @returns {Array} Returns `data`. */ - function size(collection) { - if (collection == null) { - return 0; + function mergeData(data, source) { + var bitmask = data[1], + srcBitmask = source[1], + newBitmask = bitmask | srcBitmask, + isCommon = newBitmask < (WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG | WRAP_ARY_FLAG); + + var isCombo = + ((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_CURRY_FLAG)) || + ((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_REARG_FLAG) && (data[7].length <= source[8])) || + ((srcBitmask == (WRAP_ARY_FLAG | WRAP_REARG_FLAG)) && (source[7].length <= source[8]) && (bitmask == WRAP_CURRY_FLAG)); + + // Exit early if metadata can't be merged. + if (!(isCommon || isCombo)) { + return data; } - if (isArrayLike(collection)) { - return isString(collection) ? stringSize(collection) : collection.length; + // Use source `thisArg` if available. + if (srcBitmask & WRAP_BIND_FLAG) { + data[2] = source[2]; + // Set when currying a bound function. + newBitmask |= bitmask & WRAP_BIND_FLAG ? 0 : WRAP_CURRY_BOUND_FLAG; } - var tag = getTag(collection); - if (tag == mapTag || tag == setTag) { - return collection.size; + // Compose partial arguments. + var value = source[3]; + if (value) { + var partials = data[3]; + data[3] = partials ? composeArgs(partials, value, source[4]) : value; + data[4] = partials ? replaceHolders(data[3], PLACEHOLDER) : source[4]; } - return baseKeys(collection).length; + // Compose partial right arguments. + value = source[5]; + if (value) { + partials = data[5]; + data[5] = partials ? composeArgsRight(partials, value, source[6]) : value; + data[6] = partials ? replaceHolders(data[5], PLACEHOLDER) : source[6]; + } + // Use source `argPos` if available. + value = source[7]; + if (value) { + data[7] = value; + } + // Use source `ary` if it's smaller. + if (srcBitmask & WRAP_ARY_FLAG) { + data[8] = data[8] == null ? source[8] : nativeMin(data[8], source[8]); + } + // Use source `arity` if one is not provided. + if (data[9] == null) { + data[9] = source[9]; + } + // Use source `func` and merge bitmasks. + data[0] = source[0]; + data[1] = newBitmask; + + return data; } /** - * Checks if `predicate` returns truthy for **any** element of `collection`. - * Iteration is stopped once `predicate` returns truthy. The predicate is - * invoked with three arguments: (value, index|key, collection). - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {boolean} Returns `true` if any element passes the predicate check, - * else `false`. - * @example - * - * _.some([null, 0, 'yes', false], Boolean); - * // => true - * - * var users = [ - * { 'user': 'barney', 'active': true }, - * { 'user': 'fred', 'active': false } - * ]; - * - * // The `_.matches` iteratee shorthand. - * _.some(users, { 'user': 'barney', 'active': false }); - * // => false - * - * // The `_.matchesProperty` iteratee shorthand. - * _.some(users, ['active', false]); - * // => true + * This function is like + * [`Object.keys`](http://ecma-international.org/ecma-262/7.0/#sec-object.keys) + * except that it includes inherited enumerable properties. * - * // The `_.property` iteratee shorthand. - * _.some(users, 'active'); - * // => true + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property names. */ - function some(collection, predicate, guard) { - var func = isArray(collection) ? arraySome : baseSome; - if (guard && isIterateeCall(collection, predicate, guard)) { - predicate = undefined; + function nativeKeysIn(object) { + var result = []; + if (object != null) { + for (var key in Object(object)) { + result.push(key); + } } - return func(collection, getIteratee(predicate, 3)); + return result; } /** - * Creates an array of elements, sorted in ascending order by the results of - * running each element in a collection thru each iteratee. This method - * performs a stable sort, that is, it preserves the original sort order of - * equal elements. The iteratees are invoked with one argument: (value). - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {...(Function|Function[])} [iteratees=[_.identity]] - * The iteratees to sort by. - * @returns {Array} Returns the new sorted array. - * @example - * - * var users = [ - * { 'user': 'fred', 'age': 48 }, - * { 'user': 'barney', 'age': 36 }, - * { 'user': 'fred', 'age': 40 }, - * { 'user': 'barney', 'age': 34 } - * ]; + * Converts `value` to a string using `Object.prototype.toString`. * - * _.sortBy(users, [function(o) { return o.user; }]); - * // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 40]] + * @private + * @param {*} value The value to convert. + * @returns {string} Returns the converted string. + */ + function objectToString(value) { + return nativeObjectToString.call(value); + } + + /** + * A specialized version of `baseRest` which transforms the rest array. * - * _.sortBy(users, ['user', 'age']); - * // => objects for [['barney', 34], ['barney', 36], ['fred', 40], ['fred', 48]] + * @private + * @param {Function} func The function to apply a rest parameter to. + * @param {number} [start=func.length-1] The start position of the rest parameter. + * @param {Function} transform The rest array transform. + * @returns {Function} Returns the new function. */ - var sortBy = baseRest(function(collection, iteratees) { - if (collection == null) { - return []; - } - var length = iteratees.length; - if (length > 1 && isIterateeCall(collection, iteratees[0], iteratees[1])) { - iteratees = []; - } else if (length > 2 && isIterateeCall(iteratees[0], iteratees[1], iteratees[2])) { - iteratees = [iteratees[0]]; - } - return baseOrderBy(collection, baseFlatten(iteratees, 1), []); - }); + function overRest(func, start, transform) { + start = nativeMax(start === undefined ? (func.length - 1) : start, 0); + return function() { + var args = arguments, + index = -1, + length = nativeMax(args.length - start, 0), + array = Array(length); - /*------------------------------------------------------------------------*/ + while (++index < length) { + array[index] = args[start + index]; + } + index = -1; + var otherArgs = Array(start + 1); + while (++index < start) { + otherArgs[index] = args[index]; + } + otherArgs[start] = transform(array); + return apply(func, this, otherArgs); + }; + } /** - * Gets the timestamp of the number of milliseconds that have elapsed since - * the Unix epoch (1 January 1970 00:00:00 UTC). + * Gets the parent value at `path` of `object`. * - * @static - * @memberOf _ - * @since 2.4.0 - * @category Date - * @returns {number} Returns the timestamp. - * @example + * @private + * @param {Object} object The object to query. + * @param {Array} path The path to get the parent value of. + * @returns {*} Returns the parent value. + */ + function parent(object, path) { + return path.length < 2 ? object : baseGet(object, baseSlice(path, 0, -1)); + } + + /** + * Reorder `array` according to the specified indexes where the element at + * the first index is assigned as the first element, the element at + * the second index is assigned as the second element, and so on. * - * _.defer(function(stamp) { - * console.log(_.now() - stamp); - * }, _.now()); - * // => Logs the number of milliseconds it took for the deferred invocation. + * @private + * @param {Array} array The array to reorder. + * @param {Array} indexes The arranged array indexes. + * @returns {Array} Returns `array`. */ - var now = ctxNow || function() { - return root.Date.now(); - }; + function reorder(array, indexes) { + var arrLength = array.length, + length = nativeMin(indexes.length, arrLength), + oldArray = copyArray(array); - /*------------------------------------------------------------------------*/ + while (length--) { + var index = indexes[length]; + array[length] = isIndex(index, arrLength) ? oldArray[index] : undefined; + } + return array; + } /** - * The opposite of `_.before`; this method creates a function that invokes - * `func` once it's called `n` or more times. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Function - * @param {number} n The number of calls before `func` is invoked. - * @param {Function} func The function to restrict. - * @returns {Function} Returns the new restricted function. - * @example + * Sets metadata for `func`. * - * var saves = ['profile', 'settings']; + * **Note:** If this function becomes hot, i.e. is invoked a lot in a short + * period of time, it will trip its breaker and transition to an identity + * function to avoid garbage collection pauses in V8. See + * [V8 issue 2070](https://bugs.chromium.org/p/v8/issues/detail?id=2070) + * for more details. * - * var done = _.after(saves.length, function() { - * console.log('done saving!'); - * }); + * @private + * @param {Function} func The function to associate metadata with. + * @param {*} data The metadata. + * @returns {Function} Returns `func`. + */ + var setData = shortOut(baseSetData); + + /** + * A simple wrapper around the global [`setTimeout`](https://mdn.io/setTimeout). * - * _.forEach(saves, function(type) { - * asyncSave({ 'type': type, 'complete': done }); - * }); - * // => Logs 'done saving!' after the two async saves have completed. + * @private + * @param {Function} func The function to delay. + * @param {number} wait The number of milliseconds to delay invocation. + * @returns {number|Object} Returns the timer id or timeout object. */ - function after(n, func) { - if (typeof func != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); - } - n = toInteger(n); - return function() { - if (--n < 1) { - return func.apply(this, arguments); - } - }; - } + var setTimeout = ctxSetTimeout || function(func, wait) { + return root.setTimeout(func, wait); + }; /** - * Creates a function that invokes `func`, with up to `n` arguments, - * ignoring any additional arguments. + * Sets the `toString` method of `func` to return `string`. * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Function - * @param {Function} func The function to cap arguments for. - * @param {number} [n=func.length] The arity cap. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Function} Returns the new capped function. - * @example + * @private + * @param {Function} func The function to modify. + * @param {Function} string The `toString` result. + * @returns {Function} Returns `func`. + */ + var setToString = shortOut(baseSetToString); + + /** + * Sets the `toString` method of `wrapper` to mimic the source of `reference` + * with wrapper details in a comment at the top of the source body. * - * _.map(['6', '8', '10'], _.ary(parseInt, 1)); - * // => [6, 8, 10] + * @private + * @param {Function} wrapper The function to modify. + * @param {Function} reference The reference function. + * @param {number} bitmask The bitmask flags. See `createWrap` for more details. + * @returns {Function} Returns `wrapper`. */ - function ary(func, n, guard) { - n = guard ? undefined : n; - n = (func && n == null) ? func.length : n; - return createWrap(func, WRAP_ARY_FLAG, undefined, undefined, undefined, undefined, n); + function setWrapToString(wrapper, reference, bitmask) { + var source = (reference + ''); + return setToString(wrapper, insertWrapDetails(source, updateWrapDetails(getWrapDetails(source), bitmask))); } /** - * Creates a function that invokes `func`, with the `this` binding and arguments - * of the created function, while it's called less than `n` times. Subsequent - * calls to the created function return the result of the last `func` invocation. + * Creates a function that'll short out and invoke `identity` instead + * of `func` when it's called `HOT_COUNT` or more times in `HOT_SPAN` + * milliseconds. * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Function - * @param {number} n The number of calls at which `func` is no longer invoked. + * @private * @param {Function} func The function to restrict. - * @returns {Function} Returns the new restricted function. - * @example - * - * jQuery(element).on('click', _.before(5, addContactToList)); - * // => Allows adding up to 4 contacts to the list. + * @returns {Function} Returns the new shortable function. */ - function before(n, func) { - var result; - if (typeof func != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); - } - n = toInteger(n); + function shortOut(func) { + var count = 0, + lastCalled = 0; + return function() { - if (--n > 0) { - result = func.apply(this, arguments); - } - if (n <= 1) { - func = undefined; + var stamp = nativeNow(), + remaining = HOT_SPAN - (stamp - lastCalled); + + lastCalled = stamp; + if (remaining > 0) { + if (++count >= HOT_COUNT) { + return arguments[0]; + } + } else { + count = 0; } - return result; + return func.apply(undefined, arguments); }; } /** - * Creates a function that invokes `func` with the `this` binding of `thisArg` - * and `partials` prepended to the arguments it receives. - * - * The `_.bind.placeholder` value, which defaults to `_` in monolithic builds, - * may be used as a placeholder for partially applied arguments. - * - * **Note:** Unlike native `Function#bind`, this method doesn't set the "length" - * property of bound functions. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Function - * @param {Function} func The function to bind. - * @param {*} thisArg The `this` binding of `func`. - * @param {...*} [partials] The arguments to be partially applied. - * @returns {Function} Returns the new bound function. - * @example - * - * function greet(greeting, punctuation) { - * return greeting + ' ' + this.user + punctuation; - * } - * - * var object = { 'user': 'fred' }; + * A specialized version of `_.shuffle` which mutates and sets the size of `array`. * - * var bound = _.bind(greet, object, 'hi'); - * bound('!'); - * // => 'hi fred!' + * @private + * @param {Array} array The array to shuffle. + * @param {number} [size=array.length] The size of `array`. + * @returns {Array} Returns `array`. + */ + function shuffleSelf(array, size) { + var index = -1, + length = array.length, + lastIndex = length - 1; + + size = size === undefined ? length : size; + while (++index < size) { + var rand = baseRandom(index, lastIndex), + value = array[rand]; + + array[rand] = array[index]; + array[index] = value; + } + array.length = size; + return array; + } + + /** + * Converts `string` to a property path array. * - * // Bound with placeholders. - * var bound = _.bind(greet, object, _, '!'); - * bound('hi'); - * // => 'hi fred!' + * @private + * @param {string} string The string to convert. + * @returns {Array} Returns the property path array. */ - var bind = baseRest(function(func, thisArg, partials) { - var bitmask = WRAP_BIND_FLAG; - if (partials.length) { - var holders = replaceHolders(partials, getHolder(bind)); - bitmask |= WRAP_PARTIAL_FLAG; + var stringToPath = memoizeCapped(function(string) { + var result = []; + if (reLeadingDot.test(string)) { + result.push(''); } - return createWrap(func, bitmask, thisArg, partials, holders); + string.replace(rePropName, function(match, number, quote, string) { + result.push(quote ? string.replace(reEscapeChar, '$1') : (number || match)); + }); + return result; }); /** - * Creates a function that invokes the method at `object[key]` with `partials` - * prepended to the arguments it receives. - * - * This method differs from `_.bind` by allowing bound functions to reference - * methods that may be redefined or don't yet exist. See - * [Peter Michaux's article](http://peter.michaux.ca/articles/lazy-function-definition-pattern) - * for more details. - * - * The `_.bindKey.placeholder` value, which defaults to `_` in monolithic - * builds, may be used as a placeholder for partially applied arguments. + * Converts `value` to a string key if it's not a string or symbol. * - * @static - * @memberOf _ - * @since 0.10.0 - * @category Function - * @param {Object} object The object to invoke the method on. - * @param {string} key The key of the method. - * @param {...*} [partials] The arguments to be partially applied. - * @returns {Function} Returns the new bound function. - * @example + * @private + * @param {*} value The value to inspect. + * @returns {string|symbol} Returns the key. + */ + function toKey(value) { + if (typeof value == 'string' || isSymbol(value)) { + return value; + } + var result = (value + ''); + return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result; + } + + /** + * Converts `func` to its source code. * - * var object = { - * 'user': 'fred', - * 'greet': function(greeting, punctuation) { - * return greeting + ' ' + this.user + punctuation; - * } - * }; - * - * var bound = _.bindKey(object, 'greet', 'hi'); - * bound('!'); - * // => 'hi fred!' - * - * object.greet = function(greeting, punctuation) { - * return greeting + 'ya ' + this.user + punctuation; - * }; - * - * bound('!'); - * // => 'hiya fred!' - * - * // Bound with placeholders. - * var bound = _.bindKey(object, 'greet', _, '!'); - * bound('hi'); - * // => 'hiya fred!' + * @private + * @param {Function} func The function to convert. + * @returns {string} Returns the source code. */ - var bindKey = baseRest(function(object, key, partials) { - var bitmask = WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG; - if (partials.length) { - var holders = replaceHolders(partials, getHolder(bindKey)); - bitmask |= WRAP_PARTIAL_FLAG; + function toSource(func) { + if (func != null) { + try { + return funcToString.call(func); + } catch (e) {} + try { + return (func + ''); + } catch (e) {} } - return createWrap(key, bitmask, object, partials, holders); - }); + return ''; + } /** - * Creates a function that accepts arguments of `func` and either invokes - * `func` returning its result, if at least `arity` number of arguments have - * been provided, or returns a function that accepts the remaining `func` - * arguments, and so on. The arity of `func` may be specified if `func.length` - * is not sufficient. + * Updates wrapper `details` based on `bitmask` flags. * - * The `_.curry.placeholder` value, which defaults to `_` in monolithic builds, - * may be used as a placeholder for provided arguments. + * @private + * @returns {Array} details The details to modify. + * @param {number} bitmask The bitmask flags. See `createWrap` for more details. + * @returns {Array} Returns `details`. + */ + function updateWrapDetails(details, bitmask) { + arrayEach(wrapFlags, function(pair) { + var value = '_.' + pair[0]; + if ((bitmask & pair[1]) && !arrayIncludes(details, value)) { + details.push(value); + } + }); + return details.sort(); + } + + /** + * Creates a clone of `wrapper`. * - * **Note:** This method doesn't set the "length" property of curried functions. + * @private + * @param {Object} wrapper The wrapper to clone. + * @returns {Object} Returns the cloned wrapper. + */ + function wrapperClone(wrapper) { + if (wrapper instanceof LazyWrapper) { + return wrapper.clone(); + } + var result = new LodashWrapper(wrapper.__wrapped__, wrapper.__chain__); + result.__actions__ = copyArray(wrapper.__actions__); + result.__index__ = wrapper.__index__; + result.__values__ = wrapper.__values__; + return result; + } + + /*------------------------------------------------------------------------*/ + + /** + * Creates an array of elements split into groups the length of `size`. + * If `array` can't be split evenly, the final chunk will be the remaining + * elements. * * @static * @memberOf _ - * @since 2.0.0 - * @category Function - * @param {Function} func The function to curry. - * @param {number} [arity=func.length] The arity of `func`. + * @since 3.0.0 + * @category Array + * @param {Array} array The array to process. + * @param {number} [size=1] The length of each chunk * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Function} Returns the new curried function. + * @returns {Array} Returns the new array of chunks. * @example * - * var abc = function(a, b, c) { - * return [a, b, c]; - * }; - * - * var curried = _.curry(abc); - * - * curried(1)(2)(3); - * // => [1, 2, 3] - * - * curried(1, 2)(3); - * // => [1, 2, 3] - * - * curried(1, 2, 3); - * // => [1, 2, 3] + * _.chunk(['a', 'b', 'c', 'd'], 2); + * // => [['a', 'b'], ['c', 'd']] * - * // Curried with placeholders. - * curried(1)(_, 3)(2); - * // => [1, 2, 3] + * _.chunk(['a', 'b', 'c', 'd'], 3); + * // => [['a', 'b', 'c'], ['d']] */ - function curry(func, arity, guard) { - arity = guard ? undefined : arity; - var result = createWrap(func, WRAP_CURRY_FLAG, undefined, undefined, undefined, undefined, undefined, arity); - result.placeholder = curry.placeholder; + function chunk(array, size, guard) { + if ((guard ? isIterateeCall(array, size, guard) : size === undefined)) { + size = 1; + } else { + size = nativeMax(toInteger(size), 0); + } + var length = array == null ? 0 : array.length; + if (!length || size < 1) { + return []; + } + var index = 0, + resIndex = 0, + result = Array(nativeCeil(length / size)); + + while (index < length) { + result[resIndex++] = baseSlice(array, index, (index += size)); + } return result; } /** - * This method is like `_.curry` except that arguments are applied to `func` - * in the manner of `_.partialRight` instead of `_.partial`. - * - * The `_.curryRight.placeholder` value, which defaults to `_` in monolithic - * builds, may be used as a placeholder for provided arguments. - * - * **Note:** This method doesn't set the "length" property of curried functions. + * Creates an array with all falsey values removed. The values `false`, `null`, + * `0`, `""`, `undefined`, and `NaN` are falsey. * * @static * @memberOf _ - * @since 3.0.0 - * @category Function - * @param {Function} func The function to curry. - * @param {number} [arity=func.length] The arity of `func`. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Function} Returns the new curried function. + * @since 0.1.0 + * @category Array + * @param {Array} array The array to compact. + * @returns {Array} Returns the new array of filtered values. * @example * - * var abc = function(a, b, c) { - * return [a, b, c]; - * }; - * - * var curried = _.curryRight(abc); - * - * curried(3)(2)(1); - * // => [1, 2, 3] - * - * curried(2, 3)(1); - * // => [1, 2, 3] - * - * curried(1, 2, 3); - * // => [1, 2, 3] - * - * // Curried with placeholders. - * curried(3)(1, _)(2); + * _.compact([0, 1, false, 2, '', 3]); * // => [1, 2, 3] */ - function curryRight(func, arity, guard) { - arity = guard ? undefined : arity; - var result = createWrap(func, WRAP_CURRY_RIGHT_FLAG, undefined, undefined, undefined, undefined, undefined, arity); - result.placeholder = curryRight.placeholder; + function compact(array) { + var index = -1, + length = array == null ? 0 : array.length, + resIndex = 0, + result = []; + + while (++index < length) { + var value = array[index]; + if (value) { + result[resIndex++] = value; + } + } return result; } /** - * Creates a debounced function that delays invoking `func` until after `wait` - * milliseconds have elapsed since the last time the debounced function was - * invoked. The debounced function comes with a `cancel` method to cancel - * delayed `func` invocations and a `flush` method to immediately invoke them. - * Provide `options` to indicate whether `func` should be invoked on the - * leading and/or trailing edge of the `wait` timeout. The `func` is invoked - * with the last arguments provided to the debounced function. Subsequent - * calls to the debounced function return the result of the last `func` - * invocation. - * - * **Note:** If `leading` and `trailing` options are `true`, `func` is - * invoked on the trailing edge of the timeout only if the debounced function - * is invoked more than once during the `wait` timeout. - * - * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred - * until to the next tick, similar to `setTimeout` with a timeout of `0`. - * - * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/) - * for details over the differences between `_.debounce` and `_.throttle`. + * Creates a new array concatenating `array` with any additional arrays + * and/or values. * * @static * @memberOf _ - * @since 0.1.0 - * @category Function - * @param {Function} func The function to debounce. - * @param {number} [wait=0] The number of milliseconds to delay. - * @param {Object} [options={}] The options object. - * @param {boolean} [options.leading=false] - * Specify invoking on the leading edge of the timeout. - * @param {number} [options.maxWait] - * The maximum time `func` is allowed to be delayed before it's invoked. - * @param {boolean} [options.trailing=true] - * Specify invoking on the trailing edge of the timeout. - * @returns {Function} Returns the new debounced function. + * @since 4.0.0 + * @category Array + * @param {Array} array The array to concatenate. + * @param {...*} [values] The values to concatenate. + * @returns {Array} Returns the new concatenated array. * @example * - * // Avoid costly calculations while the window size is in flux. - * jQuery(window).on('resize', _.debounce(calculateLayout, 150)); - * - * // Invoke `sendMail` when clicked, debouncing subsequent calls. - * jQuery(element).on('click', _.debounce(sendMail, 300, { - * 'leading': true, - * 'trailing': false - * })); + * var array = [1]; + * var other = _.concat(array, 2, [3], [[4]]); * - * // Ensure `batchLog` is invoked once after 1 second of debounced calls. - * var debounced = _.debounce(batchLog, 250, { 'maxWait': 1000 }); - * var source = new EventSource('/stream'); - * jQuery(source).on('message', debounced); + * console.log(other); + * // => [1, 2, 3, [4]] * - * // Cancel the trailing debounced invocation. - * jQuery(window).on('popstate', debounced.cancel); + * console.log(array); + * // => [1] */ - function debounce(func, wait, options) { - var lastArgs, - lastThis, - maxWait, - result, - timerId, - lastCallTime, - lastInvokeTime = 0, - leading = false, - maxing = false, - trailing = true; - - if (typeof func != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); - } - wait = toNumber(wait) || 0; - if (isObject(options)) { - leading = !!options.leading; - maxing = 'maxWait' in options; - maxWait = maxing ? nativeMax(toNumber(options.maxWait) || 0, wait) : maxWait; - trailing = 'trailing' in options ? !!options.trailing : trailing; - } - - function invokeFunc(time) { - var args = lastArgs, - thisArg = lastThis; - - lastArgs = lastThis = undefined; - lastInvokeTime = time; - result = func.apply(thisArg, args); - return result; - } - - function leadingEdge(time) { - // Reset any `maxWait` timer. - lastInvokeTime = time; - // Start the timer for the trailing edge. - timerId = setTimeout(timerExpired, wait); - // Invoke the leading edge. - return leading ? invokeFunc(time) : result; - } - - function remainingWait(time) { - var timeSinceLastCall = time - lastCallTime, - timeSinceLastInvoke = time - lastInvokeTime, - result = wait - timeSinceLastCall; - - return maxing ? nativeMin(result, maxWait - timeSinceLastInvoke) : result; - } - - function shouldInvoke(time) { - var timeSinceLastCall = time - lastCallTime, - timeSinceLastInvoke = time - lastInvokeTime; - - // Either this is the first call, activity has stopped and we're at the - // trailing edge, the system time has gone backwards and we're treating - // it as the trailing edge, or we've hit the `maxWait` limit. - return (lastCallTime === undefined || (timeSinceLastCall >= wait) || - (timeSinceLastCall < 0) || (maxing && timeSinceLastInvoke >= maxWait)); - } - - function timerExpired() { - var time = now(); - if (shouldInvoke(time)) { - return trailingEdge(time); - } - // Restart the timer. - timerId = setTimeout(timerExpired, remainingWait(time)); - } - - function trailingEdge(time) { - timerId = undefined; - - // Only invoke if we have `lastArgs` which means `func` has been - // debounced at least once. - if (trailing && lastArgs) { - return invokeFunc(time); - } - lastArgs = lastThis = undefined; - return result; - } - - function cancel() { - if (timerId !== undefined) { - clearTimeout(timerId); - } - lastInvokeTime = 0; - lastArgs = lastCallTime = lastThis = timerId = undefined; - } - - function flush() { - return timerId === undefined ? result : trailingEdge(now()); + function concat() { + var length = arguments.length; + if (!length) { + return []; } + var args = Array(length - 1), + array = arguments[0], + index = length; - function debounced() { - var time = now(), - isInvoking = shouldInvoke(time); - - lastArgs = arguments; - lastThis = this; - lastCallTime = time; - - if (isInvoking) { - if (timerId === undefined) { - return leadingEdge(lastCallTime); - } - if (maxing) { - // Handle invocations in a tight loop. - timerId = setTimeout(timerExpired, wait); - return invokeFunc(lastCallTime); - } - } - if (timerId === undefined) { - timerId = setTimeout(timerExpired, wait); - } - return result; + while (index--) { + args[index - 1] = arguments[index]; } - debounced.cancel = cancel; - debounced.flush = flush; - return debounced; + return arrayPush(isArray(array) ? copyArray(array) : [array], baseFlatten(args, 1)); } /** - * Defers invoking the `func` until the current call stack has cleared. Any - * additional arguments are provided to `func` when it's invoked. + * Creates an array of `array` values not included in the other given arrays + * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons. The order and references of result values are + * determined by the first array. + * + * **Note:** Unlike `_.pullAll`, this method returns a new array. * * @static * @memberOf _ * @since 0.1.0 - * @category Function - * @param {Function} func The function to defer. - * @param {...*} [args] The arguments to invoke `func` with. - * @returns {number} Returns the timer id. + * @category Array + * @param {Array} array The array to inspect. + * @param {...Array} [values] The values to exclude. + * @returns {Array} Returns the new array of filtered values. + * @see _.without, _.xor * @example * - * _.defer(function(text) { - * console.log(text); - * }, 'deferred'); - * // => Logs 'deferred' after one millisecond. + * _.difference([2, 1], [2, 3]); + * // => [1] */ - var defer = baseRest(function(func, args) { - return baseDelay(func, 1, args); + var difference = baseRest(function(array, values) { + return isArrayLikeObject(array) + ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true)) + : []; }); /** - * Invokes `func` after `wait` milliseconds. Any additional arguments are - * provided to `func` when it's invoked. + * This method is like `_.difference` except that it accepts `iteratee` which + * is invoked for each element of `array` and `values` to generate the criterion + * by which they're compared. The order and references of result values are + * determined by the first array. The iteratee is invoked with one argument: + * (value). + * + * **Note:** Unlike `_.pullAllBy`, this method returns a new array. * * @static * @memberOf _ - * @since 0.1.0 - * @category Function - * @param {Function} func The function to delay. - * @param {number} wait The number of milliseconds to delay invocation. - * @param {...*} [args] The arguments to invoke `func` with. - * @returns {number} Returns the timer id. + * @since 4.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {...Array} [values] The values to exclude. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {Array} Returns the new array of filtered values. * @example * - * _.delay(function(text) { - * console.log(text); - * }, 1000, 'later'); - * // => Logs 'later' after one second. + * _.differenceBy([2.1, 1.2], [2.3, 3.4], Math.floor); + * // => [1.2] + * + * // The `_.property` iteratee shorthand. + * _.differenceBy([{ 'x': 2 }, { 'x': 1 }], [{ 'x': 1 }], 'x'); + * // => [{ 'x': 2 }] */ - var delay = baseRest(function(func, wait, args) { - return baseDelay(func, toNumber(wait) || 0, args); + var differenceBy = baseRest(function(array, values) { + var iteratee = last(values); + if (isArrayLikeObject(iteratee)) { + iteratee = undefined; + } + return isArrayLikeObject(array) + ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), getIteratee(iteratee, 2)) + : []; }); /** - * Creates a function that invokes `func` with arguments reversed. + * This method is like `_.difference` except that it accepts `comparator` + * which is invoked to compare elements of `array` to `values`. The order and + * references of result values are determined by the first array. The comparator + * is invoked with two arguments: (arrVal, othVal). + * + * **Note:** Unlike `_.pullAllWith`, this method returns a new array. * * @static * @memberOf _ * @since 4.0.0 - * @category Function - * @param {Function} func The function to flip arguments for. - * @returns {Function} Returns the new flipped function. + * @category Array + * @param {Array} array The array to inspect. + * @param {...Array} [values] The values to exclude. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new array of filtered values. * @example * - * var flipped = _.flip(function() { - * return _.toArray(arguments); - * }); + * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; * - * flipped('a', 'b', 'c', 'd'); - * // => ['d', 'c', 'b', 'a'] + * _.differenceWith(objects, [{ 'x': 1, 'y': 2 }], _.isEqual); + * // => [{ 'x': 2, 'y': 1 }] */ - function flip(func) { - return createWrap(func, WRAP_FLIP_FLAG); - } + var differenceWith = baseRest(function(array, values) { + var comparator = last(values); + if (isArrayLikeObject(comparator)) { + comparator = undefined; + } + return isArrayLikeObject(array) + ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), undefined, comparator) + : []; + }); /** - * Creates a function that memoizes the result of `func`. If `resolver` is - * provided, it determines the cache key for storing the result based on the - * arguments provided to the memoized function. By default, the first argument - * provided to the memoized function is used as the map cache key. The `func` - * is invoked with the `this` binding of the memoized function. - * - * **Note:** The cache is exposed as the `cache` property on the memoized - * function. Its creation may be customized by replacing the `_.memoize.Cache` - * constructor with one whose instances implement the - * [`Map`](http://ecma-international.org/ecma-262/7.0/#sec-properties-of-the-map-prototype-object) - * method interface of `clear`, `delete`, `get`, `has`, and `set`. + * Creates a slice of `array` with `n` elements dropped from the beginning. * * @static * @memberOf _ - * @since 0.1.0 - * @category Function - * @param {Function} func The function to have its output memoized. - * @param {Function} [resolver] The function to resolve the cache key. - * @returns {Function} Returns the new memoized function. + * @since 0.5.0 + * @category Array + * @param {Array} array The array to query. + * @param {number} [n=1] The number of elements to drop. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Array} Returns the slice of `array`. * @example * - * var object = { 'a': 1, 'b': 2 }; - * var other = { 'c': 3, 'd': 4 }; + * _.drop([1, 2, 3]); + * // => [2, 3] * - * var values = _.memoize(_.values); - * values(object); - * // => [1, 2] - * - * values(other); - * // => [3, 4] - * - * object.a = 2; - * values(object); - * // => [1, 2] + * _.drop([1, 2, 3], 2); + * // => [3] * - * // Modify the result cache. - * values.cache.set(object, ['a', 'b']); - * values(object); - * // => ['a', 'b'] + * _.drop([1, 2, 3], 5); + * // => [] * - * // Replace `_.memoize.Cache`. - * _.memoize.Cache = WeakMap; + * _.drop([1, 2, 3], 0); + * // => [1, 2, 3] */ - function memoize(func, resolver) { - if (typeof func != 'function' || (resolver != null && typeof resolver != 'function')) { - throw new TypeError(FUNC_ERROR_TEXT); + function drop(array, n, guard) { + var length = array == null ? 0 : array.length; + if (!length) { + return []; } - var memoized = function() { - var args = arguments, - key = resolver ? resolver.apply(this, args) : args[0], - cache = memoized.cache; - - if (cache.has(key)) { - return cache.get(key); - } - var result = func.apply(this, args); - memoized.cache = cache.set(key, result) || cache; - return result; - }; - memoized.cache = new (memoize.Cache || MapCache); - return memoized; + n = (guard || n === undefined) ? 1 : toInteger(n); + return baseSlice(array, n < 0 ? 0 : n, length); } - // Expose `MapCache`. - memoize.Cache = MapCache; - /** - * Creates a function that negates the result of the predicate `func`. The - * `func` predicate is invoked with the `this` binding and arguments of the - * created function. + * Creates a slice of `array` with `n` elements dropped from the end. * * @static * @memberOf _ * @since 3.0.0 - * @category Function - * @param {Function} predicate The predicate to negate. - * @returns {Function} Returns the new negated function. + * @category Array + * @param {Array} array The array to query. + * @param {number} [n=1] The number of elements to drop. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Array} Returns the slice of `array`. * @example * - * function isEven(n) { - * return n % 2 == 0; - * } + * _.dropRight([1, 2, 3]); + * // => [1, 2] * - * _.filter([1, 2, 3, 4, 5, 6], _.negate(isEven)); - * // => [1, 3, 5] + * _.dropRight([1, 2, 3], 2); + * // => [1] + * + * _.dropRight([1, 2, 3], 5); + * // => [] + * + * _.dropRight([1, 2, 3], 0); + * // => [1, 2, 3] */ - function negate(predicate) { - if (typeof predicate != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); + function dropRight(array, n, guard) { + var length = array == null ? 0 : array.length; + if (!length) { + return []; } - return function() { - var args = arguments; - switch (args.length) { - case 0: return !predicate.call(this); - case 1: return !predicate.call(this, args[0]); - case 2: return !predicate.call(this, args[0], args[1]); - case 3: return !predicate.call(this, args[0], args[1], args[2]); - } - return !predicate.apply(this, args); - }; + n = (guard || n === undefined) ? 1 : toInteger(n); + n = length - n; + return baseSlice(array, 0, n < 0 ? 0 : n); } /** - * Creates a function that is restricted to invoking `func` once. Repeat calls - * to the function return the value of the first invocation. The `func` is - * invoked with the `this` binding and arguments of the created function. + * Creates a slice of `array` excluding elements dropped from the end. + * Elements are dropped until `predicate` returns falsey. The predicate is + * invoked with three arguments: (value, index, array). * * @static * @memberOf _ - * @since 0.1.0 - * @category Function - * @param {Function} func The function to restrict. - * @returns {Function} Returns the new restricted function. + * @since 3.0.0 + * @category Array + * @param {Array} array The array to query. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {Array} Returns the slice of `array`. * @example * - * var initialize = _.once(createApplication); - * initialize(); - * initialize(); - * // => `createApplication` is invoked once + * var users = [ + * { 'user': 'barney', 'active': true }, + * { 'user': 'fred', 'active': false }, + * { 'user': 'pebbles', 'active': false } + * ]; + * + * _.dropRightWhile(users, function(o) { return !o.active; }); + * // => objects for ['barney'] + * + * // The `_.matches` iteratee shorthand. + * _.dropRightWhile(users, { 'user': 'pebbles', 'active': false }); + * // => objects for ['barney', 'fred'] + * + * // The `_.matchesProperty` iteratee shorthand. + * _.dropRightWhile(users, ['active', false]); + * // => objects for ['barney'] + * + * // The `_.property` iteratee shorthand. + * _.dropRightWhile(users, 'active'); + * // => objects for ['barney', 'fred', 'pebbles'] */ - function once(func) { - return before(2, func); + function dropRightWhile(array, predicate) { + return (array && array.length) + ? baseWhile(array, getIteratee(predicate, 3), true, true) + : []; } /** - * Creates a function that invokes `func` with its arguments transformed. + * Creates a slice of `array` excluding elements dropped from the beginning. + * Elements are dropped until `predicate` returns falsey. The predicate is + * invoked with three arguments: (value, index, array). * * @static - * @since 4.0.0 * @memberOf _ - * @category Function - * @param {Function} func The function to wrap. - * @param {...(Function|Function[])} [transforms=[_.identity]] - * The argument transforms. - * @returns {Function} Returns the new function. + * @since 3.0.0 + * @category Array + * @param {Array} array The array to query. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {Array} Returns the slice of `array`. * @example * - * function doubled(n) { - * return n * 2; - * } + * var users = [ + * { 'user': 'barney', 'active': false }, + * { 'user': 'fred', 'active': false }, + * { 'user': 'pebbles', 'active': true } + * ]; * - * function square(n) { - * return n * n; - * } + * _.dropWhile(users, function(o) { return !o.active; }); + * // => objects for ['pebbles'] * - * var func = _.overArgs(function(x, y) { - * return [x, y]; - * }, [square, doubled]); + * // The `_.matches` iteratee shorthand. + * _.dropWhile(users, { 'user': 'barney', 'active': false }); + * // => objects for ['fred', 'pebbles'] * - * func(9, 3); - * // => [81, 6] + * // The `_.matchesProperty` iteratee shorthand. + * _.dropWhile(users, ['active', false]); + * // => objects for ['pebbles'] * - * func(10, 5); - * // => [100, 10] + * // The `_.property` iteratee shorthand. + * _.dropWhile(users, 'active'); + * // => objects for ['barney', 'fred', 'pebbles'] */ - var overArgs = castRest(function(func, transforms) { - transforms = (transforms.length == 1 && isArray(transforms[0])) - ? arrayMap(transforms[0], baseUnary(getIteratee())) - : arrayMap(baseFlatten(transforms, 1), baseUnary(getIteratee())); - - var funcsLength = transforms.length; - return baseRest(function(args) { - var index = -1, - length = nativeMin(args.length, funcsLength); - - while (++index < length) { - args[index] = transforms[index].call(this, args[index]); - } - return apply(func, this, args); - }); - }); + function dropWhile(array, predicate) { + return (array && array.length) + ? baseWhile(array, getIteratee(predicate, 3), true) + : []; + } /** - * Creates a function that invokes `func` with `partials` prepended to the - * arguments it receives. This method is like `_.bind` except it does **not** - * alter the `this` binding. - * - * The `_.partial.placeholder` value, which defaults to `_` in monolithic - * builds, may be used as a placeholder for partially applied arguments. + * Fills elements of `array` with `value` from `start` up to, but not + * including, `end`. * - * **Note:** This method doesn't set the "length" property of partially - * applied functions. + * **Note:** This method mutates `array`. * * @static * @memberOf _ - * @since 0.2.0 - * @category Function - * @param {Function} func The function to partially apply arguments to. - * @param {...*} [partials] The arguments to be partially applied. - * @returns {Function} Returns the new partially applied function. + * @since 3.2.0 + * @category Array + * @param {Array} array The array to fill. + * @param {*} value The value to fill `array` with. + * @param {number} [start=0] The start position. + * @param {number} [end=array.length] The end position. + * @returns {Array} Returns `array`. * @example * - * function greet(greeting, name) { - * return greeting + ' ' + name; - * } + * var array = [1, 2, 3]; * - * var sayHelloTo = _.partial(greet, 'hello'); - * sayHelloTo('fred'); - * // => 'hello fred' + * _.fill(array, 'a'); + * console.log(array); + * // => ['a', 'a', 'a'] * - * // Partially applied with placeholders. - * var greetFred = _.partial(greet, _, 'fred'); - * greetFred('hi'); - * // => 'hi fred' + * _.fill(Array(3), 2); + * // => [2, 2, 2] + * + * _.fill([4, 6, 8, 10], '*', 1, 3); + * // => [4, '*', '*', 10] */ - var partial = baseRest(function(func, partials) { - var holders = replaceHolders(partials, getHolder(partial)); - return createWrap(func, WRAP_PARTIAL_FLAG, undefined, partials, holders); - }); + function fill(array, value, start, end) { + var length = array == null ? 0 : array.length; + if (!length) { + return []; + } + if (start && typeof start != 'number' && isIterateeCall(array, value, start)) { + start = 0; + end = length; + } + return baseFill(array, value, start, end); + } /** - * This method is like `_.partial` except that partially applied arguments - * are appended to the arguments it receives. - * - * The `_.partialRight.placeholder` value, which defaults to `_` in monolithic - * builds, may be used as a placeholder for partially applied arguments. - * - * **Note:** This method doesn't set the "length" property of partially - * applied functions. + * This method is like `_.find` except that it returns the index of the first + * element `predicate` returns truthy for instead of the element itself. * * @static * @memberOf _ - * @since 1.0.0 - * @category Function - * @param {Function} func The function to partially apply arguments to. - * @param {...*} [partials] The arguments to be partially applied. - * @returns {Function} Returns the new partially applied function. + * @since 1.1.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @param {number} [fromIndex=0] The index to search from. + * @returns {number} Returns the index of the found element, else `-1`. * @example * - * function greet(greeting, name) { - * return greeting + ' ' + name; - * } + * var users = [ + * { 'user': 'barney', 'active': false }, + * { 'user': 'fred', 'active': false }, + * { 'user': 'pebbles', 'active': true } + * ]; * - * var greetFred = _.partialRight(greet, 'fred'); - * greetFred('hi'); - * // => 'hi fred' + * _.findIndex(users, function(o) { return o.user == 'barney'; }); + * // => 0 * - * // Partially applied with placeholders. - * var sayHelloTo = _.partialRight(greet, 'hello', _); - * sayHelloTo('fred'); - * // => 'hello fred' + * // The `_.matches` iteratee shorthand. + * _.findIndex(users, { 'user': 'fred', 'active': false }); + * // => 1 + * + * // The `_.matchesProperty` iteratee shorthand. + * _.findIndex(users, ['active', false]); + * // => 0 + * + * // The `_.property` iteratee shorthand. + * _.findIndex(users, 'active'); + * // => 2 */ - var partialRight = baseRest(function(func, partials) { - var holders = replaceHolders(partials, getHolder(partialRight)); - return createWrap(func, WRAP_PARTIAL_RIGHT_FLAG, undefined, partials, holders); - }); + function findIndex(array, predicate, fromIndex) { + var length = array == null ? 0 : array.length; + if (!length) { + return -1; + } + var index = fromIndex == null ? 0 : toInteger(fromIndex); + if (index < 0) { + index = nativeMax(length + index, 0); + } + return baseFindIndex(array, getIteratee(predicate, 3), index); + } /** - * Creates a function that invokes `func` with arguments arranged according - * to the specified `indexes` where the argument value at the first index is - * provided as the first argument, the argument value at the second index is - * provided as the second argument, and so on. + * This method is like `_.findIndex` except that it iterates over elements + * of `collection` from right to left. * * @static * @memberOf _ - * @since 3.0.0 - * @category Function - * @param {Function} func The function to rearrange arguments for. - * @param {...(number|number[])} indexes The arranged argument indexes. - * @returns {Function} Returns the new function. + * @since 2.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @param {number} [fromIndex=array.length-1] The index to search from. + * @returns {number} Returns the index of the found element, else `-1`. * @example * - * var rearged = _.rearg(function(a, b, c) { - * return [a, b, c]; - * }, [2, 0, 1]); + * var users = [ + * { 'user': 'barney', 'active': true }, + * { 'user': 'fred', 'active': false }, + * { 'user': 'pebbles', 'active': false } + * ]; * - * rearged('b', 'c', 'a') - * // => ['a', 'b', 'c'] + * _.findLastIndex(users, function(o) { return o.user == 'pebbles'; }); + * // => 2 + * + * // The `_.matches` iteratee shorthand. + * _.findLastIndex(users, { 'user': 'barney', 'active': true }); + * // => 0 + * + * // The `_.matchesProperty` iteratee shorthand. + * _.findLastIndex(users, ['active', false]); + * // => 2 + * + * // The `_.property` iteratee shorthand. + * _.findLastIndex(users, 'active'); + * // => 0 */ - var rearg = flatRest(function(func, indexes) { - return createWrap(func, WRAP_REARG_FLAG, undefined, undefined, undefined, indexes); - }); + function findLastIndex(array, predicate, fromIndex) { + var length = array == null ? 0 : array.length; + if (!length) { + return -1; + } + var index = length - 1; + if (fromIndex !== undefined) { + index = toInteger(fromIndex); + index = fromIndex < 0 + ? nativeMax(length + index, 0) + : nativeMin(index, length - 1); + } + return baseFindIndex(array, getIteratee(predicate, 3), index, true); + } /** - * Creates a function that invokes `func` with the `this` binding of the - * created function and arguments from `start` and beyond provided as - * an array. - * - * **Note:** This method is based on the - * [rest parameter](https://mdn.io/rest_parameters). + * Flattens `array` a single level deep. * * @static * @memberOf _ - * @since 4.0.0 - * @category Function - * @param {Function} func The function to apply a rest parameter to. - * @param {number} [start=func.length-1] The start position of the rest parameter. - * @returns {Function} Returns the new function. + * @since 0.1.0 + * @category Array + * @param {Array} array The array to flatten. + * @returns {Array} Returns the new flattened array. * @example * - * var say = _.rest(function(what, names) { - * return what + ' ' + _.initial(names).join(', ') + - * (_.size(names) > 1 ? ', & ' : '') + _.last(names); - * }); - * - * say('hello', 'fred', 'barney', 'pebbles'); - * // => 'hello fred, barney, & pebbles' + * _.flatten([1, [2, [3, [4]], 5]]); + * // => [1, 2, [3, [4]], 5] */ - function rest(func, start) { - if (typeof func != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); - } - start = start === undefined ? start : toInteger(start); - return baseRest(func, start); + function flatten(array) { + var length = array == null ? 0 : array.length; + return length ? baseFlatten(array, 1) : []; } /** - * Creates a function that invokes `func` with the `this` binding of the - * create function and an array of arguments much like - * [`Function#apply`](http://www.ecma-international.org/ecma-262/7.0/#sec-function.prototype.apply). - * - * **Note:** This method is based on the - * [spread operator](https://mdn.io/spread_operator). + * Recursively flattens `array`. * * @static * @memberOf _ - * @since 3.2.0 - * @category Function - * @param {Function} func The function to spread arguments over. - * @param {number} [start=0] The start position of the spread. - * @returns {Function} Returns the new function. + * @since 3.0.0 + * @category Array + * @param {Array} array The array to flatten. + * @returns {Array} Returns the new flattened array. * @example * - * var say = _.spread(function(who, what) { - * return who + ' says ' + what; - * }); - * - * say(['fred', 'hello']); - * // => 'fred says hello' - * - * var numbers = Promise.all([ - * Promise.resolve(40), - * Promise.resolve(36) - * ]); - * - * numbers.then(_.spread(function(x, y) { - * return x + y; - * })); - * // => a Promise of 76 + * _.flattenDeep([1, [2, [3, [4]], 5]]); + * // => [1, 2, 3, 4, 5] */ - function spread(func, start) { - if (typeof func != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); - } - start = start == null ? 0 : nativeMax(toInteger(start), 0); - return baseRest(function(args) { - var array = args[start], - otherArgs = castSlice(args, 0, start); - - if (array) { - arrayPush(otherArgs, array); - } - return apply(func, this, otherArgs); - }); + function flattenDeep(array) { + var length = array == null ? 0 : array.length; + return length ? baseFlatten(array, INFINITY) : []; } /** - * Creates a throttled function that only invokes `func` at most once per - * every `wait` milliseconds. The throttled function comes with a `cancel` - * method to cancel delayed `func` invocations and a `flush` method to - * immediately invoke them. Provide `options` to indicate whether `func` - * should be invoked on the leading and/or trailing edge of the `wait` - * timeout. The `func` is invoked with the last arguments provided to the - * throttled function. Subsequent calls to the throttled function return the - * result of the last `func` invocation. - * - * **Note:** If `leading` and `trailing` options are `true`, `func` is - * invoked on the trailing edge of the timeout only if the throttled function - * is invoked more than once during the `wait` timeout. - * - * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred - * until to the next tick, similar to `setTimeout` with a timeout of `0`. - * - * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/) - * for details over the differences between `_.throttle` and `_.debounce`. + * Recursively flatten `array` up to `depth` times. * * @static * @memberOf _ - * @since 0.1.0 - * @category Function - * @param {Function} func The function to throttle. - * @param {number} [wait=0] The number of milliseconds to throttle invocations to. - * @param {Object} [options={}] The options object. - * @param {boolean} [options.leading=true] - * Specify invoking on the leading edge of the timeout. - * @param {boolean} [options.trailing=true] - * Specify invoking on the trailing edge of the timeout. - * @returns {Function} Returns the new throttled function. + * @since 4.4.0 + * @category Array + * @param {Array} array The array to flatten. + * @param {number} [depth=1] The maximum recursion depth. + * @returns {Array} Returns the new flattened array. * @example * - * // Avoid excessively updating the position while scrolling. - * jQuery(window).on('scroll', _.throttle(updatePosition, 100)); + * var array = [1, [2, [3, [4]], 5]]; * - * // Invoke `renewToken` when the click event is fired, but not more than once every 5 minutes. - * var throttled = _.throttle(renewToken, 300000, { 'trailing': false }); - * jQuery(element).on('click', throttled); + * _.flattenDepth(array, 1); + * // => [1, 2, [3, [4]], 5] * - * // Cancel the trailing throttled invocation. - * jQuery(window).on('popstate', throttled.cancel); - */ - function throttle(func, wait, options) { - var leading = true, - trailing = true; - - if (typeof func != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); - } - if (isObject(options)) { - leading = 'leading' in options ? !!options.leading : leading; - trailing = 'trailing' in options ? !!options.trailing : trailing; + * _.flattenDepth(array, 2); + * // => [1, 2, 3, [4], 5] + */ + function flattenDepth(array, depth) { + var length = array == null ? 0 : array.length; + if (!length) { + return []; } - return debounce(func, wait, { - 'leading': leading, - 'maxWait': wait, - 'trailing': trailing - }); + depth = depth === undefined ? 1 : toInteger(depth); + return baseFlatten(array, depth); } /** - * Creates a function that accepts up to one argument, ignoring any - * additional arguments. + * The inverse of `_.toPairs`; this method returns an object composed + * from key-value `pairs`. * * @static * @memberOf _ * @since 4.0.0 - * @category Function - * @param {Function} func The function to cap arguments for. - * @returns {Function} Returns the new capped function. + * @category Array + * @param {Array} pairs The key-value pairs. + * @returns {Object} Returns the new object. * @example * - * _.map(['6', '8', '10'], _.unary(parseInt)); - * // => [6, 8, 10] + * _.fromPairs([['a', 1], ['b', 2]]); + * // => { 'a': 1, 'b': 2 } */ - function unary(func) { - return ary(func, 1); + function fromPairs(pairs) { + var index = -1, + length = pairs == null ? 0 : pairs.length, + result = {}; + + while (++index < length) { + var pair = pairs[index]; + result[pair[0]] = pair[1]; + } + return result; } /** - * Creates a function that provides `value` to `wrapper` as its first - * argument. Any additional arguments provided to the function are appended - * to those provided to the `wrapper`. The wrapper is invoked with the `this` - * binding of the created function. + * Gets the first element of `array`. * * @static * @memberOf _ * @since 0.1.0 - * @category Function - * @param {*} value The value to wrap. - * @param {Function} [wrapper=identity] The wrapper function. - * @returns {Function} Returns the new function. + * @alias first + * @category Array + * @param {Array} array The array to query. + * @returns {*} Returns the first element of `array`. * @example * - * var p = _.wrap(_.escape, function(func, text) { - * return '

' + func(text) + '

'; - * }); + * _.head([1, 2, 3]); + * // => 1 * - * p('fred, barney, & pebbles'); - * // => '

fred, barney, & pebbles

' + * _.head([]); + * // => undefined */ - function wrap(value, wrapper) { - return partial(castFunction(wrapper), value); + function head(array) { + return (array && array.length) ? array[0] : undefined; } - /*------------------------------------------------------------------------*/ - /** - * Casts `value` as an array if it's not one. + * Gets the index at which the first occurrence of `value` is found in `array` + * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons. If `fromIndex` is negative, it's used as the + * offset from the end of `array`. * * @static * @memberOf _ - * @since 4.4.0 - * @category Lang - * @param {*} value The value to inspect. - * @returns {Array} Returns the cast array. + * @since 0.1.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @param {number} [fromIndex=0] The index to search from. + * @returns {number} Returns the index of the matched value, else `-1`. * @example * - * _.castArray(1); - * // => [1] - * - * _.castArray({ 'a': 1 }); - * // => [{ 'a': 1 }] - * - * _.castArray('abc'); - * // => ['abc'] - * - * _.castArray(null); - * // => [null] - * - * _.castArray(undefined); - * // => [undefined] - * - * _.castArray(); - * // => [] + * _.indexOf([1, 2, 1, 2], 2); + * // => 1 * - * var array = [1, 2, 3]; - * console.log(_.castArray(array) === array); - * // => true + * // Search from the `fromIndex`. + * _.indexOf([1, 2, 1, 2], 2, 2); + * // => 3 */ - function castArray() { - if (!arguments.length) { - return []; + function indexOf(array, value, fromIndex) { + var length = array == null ? 0 : array.length; + if (!length) { + return -1; } - var value = arguments[0]; - return isArray(value) ? value : [value]; + var index = fromIndex == null ? 0 : toInteger(fromIndex); + if (index < 0) { + index = nativeMax(length + index, 0); + } + return baseIndexOf(array, value, index); } /** - * Creates a shallow clone of `value`. - * - * **Note:** This method is loosely based on the - * [structured clone algorithm](https://mdn.io/Structured_clone_algorithm) - * and supports cloning arrays, array buffers, booleans, date objects, maps, - * numbers, `Object` objects, regexes, sets, strings, symbols, and typed - * arrays. The own enumerable properties of `arguments` objects are cloned - * as plain objects. An empty object is returned for uncloneable values such - * as error objects, functions, DOM nodes, and WeakMaps. + * Gets all but the last element of `array`. * * @static * @memberOf _ * @since 0.1.0 - * @category Lang - * @param {*} value The value to clone. - * @returns {*} Returns the cloned value. - * @see _.cloneDeep + * @category Array + * @param {Array} array The array to query. + * @returns {Array} Returns the slice of `array`. * @example * - * var objects = [{ 'a': 1 }, { 'b': 2 }]; - * - * var shallow = _.clone(objects); - * console.log(shallow[0] === objects[0]); - * // => true + * _.initial([1, 2, 3]); + * // => [1, 2] */ - function clone(value) { - return baseClone(value, CLONE_SYMBOLS_FLAG); + function initial(array) { + var length = array == null ? 0 : array.length; + return length ? baseSlice(array, 0, -1) : []; } /** - * This method is like `_.clone` except that it accepts `customizer` which - * is invoked to produce the cloned value. If `customizer` returns `undefined`, - * cloning is handled by the method instead. The `customizer` is invoked with - * up to four arguments; (value [, index|key, object, stack]). + * Creates an array of unique values that are included in all given arrays + * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons. The order and references of result values are + * determined by the first array. * * @static * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to clone. - * @param {Function} [customizer] The function to customize cloning. - * @returns {*} Returns the cloned value. - * @see _.cloneDeepWith + * @since 0.1.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @returns {Array} Returns the new array of intersecting values. * @example * - * function customizer(value) { - * if (_.isElement(value)) { - * return value.cloneNode(false); - * } - * } - * - * var el = _.cloneWith(document.body, customizer); - * - * console.log(el === document.body); - * // => false - * console.log(el.nodeName); - * // => 'BODY' - * console.log(el.childNodes.length); - * // => 0 + * _.intersection([2, 1], [2, 3]); + * // => [2] */ - function cloneWith(value, customizer) { - customizer = typeof customizer == 'function' ? customizer : undefined; - return baseClone(value, CLONE_SYMBOLS_FLAG, customizer); - } + var intersection = baseRest(function(arrays) { + var mapped = arrayMap(arrays, castArrayLikeObject); + return (mapped.length && mapped[0] === arrays[0]) + ? baseIntersection(mapped) + : []; + }); /** - * This method is like `_.clone` except that it recursively clones `value`. + * This method is like `_.intersection` except that it accepts `iteratee` + * which is invoked for each element of each `arrays` to generate the criterion + * by which they're compared. The order and references of result values are + * determined by the first array. The iteratee is invoked with one argument: + * (value). * * @static * @memberOf _ - * @since 1.0.0 - * @category Lang - * @param {*} value The value to recursively clone. - * @returns {*} Returns the deep cloned value. - * @see _.clone + * @since 4.0.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {Array} Returns the new array of intersecting values. * @example * - * var objects = [{ 'a': 1 }, { 'b': 2 }]; + * _.intersectionBy([2.1, 1.2], [2.3, 3.4], Math.floor); + * // => [2.1] * - * var deep = _.cloneDeep(objects); - * console.log(deep[0] === objects[0]); - * // => false + * // The `_.property` iteratee shorthand. + * _.intersectionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x'); + * // => [{ 'x': 1 }] */ - function cloneDeep(value) { - return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG); - } + var intersectionBy = baseRest(function(arrays) { + var iteratee = last(arrays), + mapped = arrayMap(arrays, castArrayLikeObject); + + if (iteratee === last(mapped)) { + iteratee = undefined; + } else { + mapped.pop(); + } + return (mapped.length && mapped[0] === arrays[0]) + ? baseIntersection(mapped, getIteratee(iteratee, 2)) + : []; + }); /** - * This method is like `_.cloneWith` except that it recursively clones `value`. + * This method is like `_.intersection` except that it accepts `comparator` + * which is invoked to compare elements of `arrays`. The order and references + * of result values are determined by the first array. The comparator is + * invoked with two arguments: (arrVal, othVal). * * @static * @memberOf _ * @since 4.0.0 - * @category Lang - * @param {*} value The value to recursively clone. - * @param {Function} [customizer] The function to customize cloning. - * @returns {*} Returns the deep cloned value. - * @see _.cloneWith + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new array of intersecting values. * @example * - * function customizer(value) { - * if (_.isElement(value)) { - * return value.cloneNode(true); - * } - * } - * - * var el = _.cloneDeepWith(document.body, customizer); + * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; + * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }]; * - * console.log(el === document.body); - * // => false - * console.log(el.nodeName); - * // => 'BODY' - * console.log(el.childNodes.length); - * // => 20 + * _.intersectionWith(objects, others, _.isEqual); + * // => [{ 'x': 1, 'y': 2 }] */ - function cloneDeepWith(value, customizer) { - customizer = typeof customizer == 'function' ? customizer : undefined; - return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG, customizer); - } + var intersectionWith = baseRest(function(arrays) { + var comparator = last(arrays), + mapped = arrayMap(arrays, castArrayLikeObject); + + comparator = typeof comparator == 'function' ? comparator : undefined; + if (comparator) { + mapped.pop(); + } + return (mapped.length && mapped[0] === arrays[0]) + ? baseIntersection(mapped, undefined, comparator) + : []; + }); /** - * Checks if `object` conforms to `source` by invoking the predicate - * properties of `source` with the corresponding property values of `object`. - * - * **Note:** This method is equivalent to `_.conforms` when `source` is - * partially applied. + * Converts all elements in `array` into a string separated by `separator`. * * @static * @memberOf _ - * @since 4.14.0 - * @category Lang - * @param {Object} object The object to inspect. - * @param {Object} source The object of property predicates to conform to. - * @returns {boolean} Returns `true` if `object` conforms, else `false`. + * @since 4.0.0 + * @category Array + * @param {Array} array The array to convert. + * @param {string} [separator=','] The element separator. + * @returns {string} Returns the joined string. * @example * - * var object = { 'a': 1, 'b': 2 }; - * - * _.conformsTo(object, { 'b': function(n) { return n > 1; } }); - * // => true - * - * _.conformsTo(object, { 'b': function(n) { return n > 2; } }); - * // => false + * _.join(['a', 'b', 'c'], '~'); + * // => 'a~b~c' */ - function conformsTo(object, source) { - return source == null || baseConformsTo(object, source, keys(source)); + function join(array, separator) { + return array == null ? '' : nativeJoin.call(array, separator); } /** - * Performs a - * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * comparison between two values to determine if they are equivalent. + * Gets the last element of `array`. * * @static * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @returns {boolean} Returns `true` if the values are equivalent, else `false`. + * @since 0.1.0 + * @category Array + * @param {Array} array The array to query. + * @returns {*} Returns the last element of `array`. * @example * - * var object = { 'a': 1 }; - * var other = { 'a': 1 }; - * - * _.eq(object, object); - * // => true - * - * _.eq(object, other); - * // => false - * - * _.eq('a', 'a'); - * // => true - * - * _.eq('a', Object('a')); - * // => false - * - * _.eq(NaN, NaN); - * // => true + * _.last([1, 2, 3]); + * // => 3 */ - function eq(value, other) { - return value === other || (value !== value && other !== other); + function last(array) { + var length = array == null ? 0 : array.length; + return length ? array[length - 1] : undefined; } /** - * Checks if `value` is greater than `other`. + * This method is like `_.indexOf` except that it iterates over elements of + * `array` from right to left. * * @static * @memberOf _ - * @since 3.9.0 - * @category Lang - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @returns {boolean} Returns `true` if `value` is greater than `other`, - * else `false`. - * @see _.lt + * @since 0.1.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @param {number} [fromIndex=array.length-1] The index to search from. + * @returns {number} Returns the index of the matched value, else `-1`. * @example * - * _.gt(3, 1); - * // => true - * - * _.gt(3, 3); - * // => false + * _.lastIndexOf([1, 2, 1, 2], 2); + * // => 3 * - * _.gt(1, 3); - * // => false + * // Search from the `fromIndex`. + * _.lastIndexOf([1, 2, 1, 2], 2, 2); + * // => 1 */ - var gt = createRelationalOperation(baseGt); + function lastIndexOf(array, value, fromIndex) { + var length = array == null ? 0 : array.length; + if (!length) { + return -1; + } + var index = length; + if (fromIndex !== undefined) { + index = toInteger(fromIndex); + index = index < 0 ? nativeMax(length + index, 0) : nativeMin(index, length - 1); + } + return value === value + ? strictLastIndexOf(array, value, index) + : baseFindIndex(array, baseIsNaN, index, true); + } /** - * Checks if `value` is greater than or equal to `other`. + * Gets the element at index `n` of `array`. If `n` is negative, the nth + * element from the end is returned. * * @static * @memberOf _ - * @since 3.9.0 - * @category Lang - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @returns {boolean} Returns `true` if `value` is greater than or equal to - * `other`, else `false`. - * @see _.lte + * @since 4.11.0 + * @category Array + * @param {Array} array The array to query. + * @param {number} [n=0] The index of the element to return. + * @returns {*} Returns the nth element of `array`. * @example * - * _.gte(3, 1); - * // => true + * var array = ['a', 'b', 'c', 'd']; * - * _.gte(3, 3); - * // => true + * _.nth(array, 1); + * // => 'b' * - * _.gte(1, 3); - * // => false + * _.nth(array, -2); + * // => 'c'; */ - var gte = createRelationalOperation(function(value, other) { - return value >= other; - }); + function nth(array, n) { + return (array && array.length) ? baseNth(array, toInteger(n)) : undefined; + } /** - * Checks if `value` is likely an `arguments` object. + * Removes all given values from `array` using + * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons. + * + * **Note:** Unlike `_.without`, this method mutates `array`. Use `_.remove` + * to remove elements from an array by predicate. * * @static * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is an `arguments` object, - * else `false`. + * @since 2.0.0 + * @category Array + * @param {Array} array The array to modify. + * @param {...*} [values] The values to remove. + * @returns {Array} Returns `array`. * @example * - * _.isArguments(function() { return arguments; }()); - * // => true + * var array = ['a', 'b', 'c', 'a', 'b', 'c']; * - * _.isArguments([1, 2, 3]); - * // => false + * _.pull(array, 'a', 'c'); + * console.log(array); + * // => ['b', 'b'] */ - var isArguments = baseIsArguments(function() { return arguments; }()) ? baseIsArguments : function(value) { - return isObjectLike(value) && hasOwnProperty.call(value, 'callee') && - !propertyIsEnumerable.call(value, 'callee'); - }; + var pull = baseRest(pullAll); /** - * Checks if `value` is classified as an `Array` object. + * This method is like `_.pull` except that it accepts an array of values to remove. + * + * **Note:** Unlike `_.difference`, this method mutates `array`. * * @static * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is an array, else `false`. + * @since 4.0.0 + * @category Array + * @param {Array} array The array to modify. + * @param {Array} values The values to remove. + * @returns {Array} Returns `array`. * @example * - * _.isArray([1, 2, 3]); - * // => true - * - * _.isArray(document.body.children); - * // => false - * - * _.isArray('abc'); - * // => false + * var array = ['a', 'b', 'c', 'a', 'b', 'c']; * - * _.isArray(_.noop); - * // => false + * _.pullAll(array, ['a', 'c']); + * console.log(array); + * // => ['b', 'b'] */ - var isArray = Array.isArray; + function pullAll(array, values) { + return (array && array.length && values && values.length) + ? basePullAll(array, values) + : array; + } /** - * Checks if `value` is classified as an `ArrayBuffer` object. + * This method is like `_.pullAll` except that it accepts `iteratee` which is + * invoked for each element of `array` and `values` to generate the criterion + * by which they're compared. The iteratee is invoked with one argument: (value). + * + * **Note:** Unlike `_.differenceBy`, this method mutates `array`. * * @static * @memberOf _ - * @since 4.3.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is an array buffer, else `false`. - * @example - * - * _.isArrayBuffer(new ArrayBuffer(2)); - * // => true - * - * _.isArrayBuffer(new Array(2)); - * // => false + * @since 4.0.0 + * @category Array + * @param {Array} array The array to modify. + * @param {Array} values The values to remove. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {Array} Returns `array`. + * @example + * + * var array = [{ 'x': 1 }, { 'x': 2 }, { 'x': 3 }, { 'x': 1 }]; + * + * _.pullAllBy(array, [{ 'x': 1 }, { 'x': 3 }], 'x'); + * console.log(array); + * // => [{ 'x': 2 }] */ - var isArrayBuffer = nodeIsArrayBuffer ? baseUnary(nodeIsArrayBuffer) : baseIsArrayBuffer; + function pullAllBy(array, values, iteratee) { + return (array && array.length && values && values.length) + ? basePullAll(array, values, getIteratee(iteratee, 2)) + : array; + } /** - * Checks if `value` is array-like. A value is considered array-like if it's - * not a function and has a `value.length` that's an integer greater than or - * equal to `0` and less than or equal to `Number.MAX_SAFE_INTEGER`. + * This method is like `_.pullAll` except that it accepts `comparator` which + * is invoked to compare elements of `array` to `values`. The comparator is + * invoked with two arguments: (arrVal, othVal). + * + * **Note:** Unlike `_.differenceWith`, this method mutates `array`. * * @static * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is array-like, else `false`. + * @since 4.6.0 + * @category Array + * @param {Array} array The array to modify. + * @param {Array} values The values to remove. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns `array`. * @example * - * _.isArrayLike([1, 2, 3]); - * // => true - * - * _.isArrayLike(document.body.children); - * // => true - * - * _.isArrayLike('abc'); - * // => true + * var array = [{ 'x': 1, 'y': 2 }, { 'x': 3, 'y': 4 }, { 'x': 5, 'y': 6 }]; * - * _.isArrayLike(_.noop); - * // => false + * _.pullAllWith(array, [{ 'x': 3, 'y': 4 }], _.isEqual); + * console.log(array); + * // => [{ 'x': 1, 'y': 2 }, { 'x': 5, 'y': 6 }] */ - function isArrayLike(value) { - return value != null && isLength(value.length) && !isFunction(value); + function pullAllWith(array, values, comparator) { + return (array && array.length && values && values.length) + ? basePullAll(array, values, undefined, comparator) + : array; } /** - * This method is like `_.isArrayLike` except that it also checks if `value` - * is an object. + * Removes elements from `array` corresponding to `indexes` and returns an + * array of removed elements. + * + * **Note:** Unlike `_.at`, this method mutates `array`. * * @static * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is an array-like object, - * else `false`. + * @since 3.0.0 + * @category Array + * @param {Array} array The array to modify. + * @param {...(number|number[])} [indexes] The indexes of elements to remove. + * @returns {Array} Returns the new array of removed elements. * @example * - * _.isArrayLikeObject([1, 2, 3]); - * // => true - * - * _.isArrayLikeObject(document.body.children); - * // => true + * var array = ['a', 'b', 'c', 'd']; + * var pulled = _.pullAt(array, [1, 3]); * - * _.isArrayLikeObject('abc'); - * // => false + * console.log(array); + * // => ['a', 'c'] * - * _.isArrayLikeObject(_.noop); - * // => false + * console.log(pulled); + * // => ['b', 'd'] */ - function isArrayLikeObject(value) { - return isObjectLike(value) && isArrayLike(value); - } + var pullAt = flatRest(function(array, indexes) { + var length = array == null ? 0 : array.length, + result = baseAt(array, indexes); + + basePullAt(array, arrayMap(indexes, function(index) { + return isIndex(index, length) ? +index : index; + }).sort(compareAscending)); + + return result; + }); /** - * Checks if `value` is classified as a boolean primitive or object. + * Removes all elements from `array` that `predicate` returns truthy for + * and returns an array of the removed elements. The predicate is invoked + * with three arguments: (value, index, array). + * + * **Note:** Unlike `_.filter`, this method mutates `array`. Use `_.pull` + * to pull elements from an array by value. * * @static * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a boolean, else `false`. + * @since 2.0.0 + * @category Array + * @param {Array} array The array to modify. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {Array} Returns the new array of removed elements. * @example * - * _.isBoolean(false); - * // => true + * var array = [1, 2, 3, 4]; + * var evens = _.remove(array, function(n) { + * return n % 2 == 0; + * }); * - * _.isBoolean(null); - * // => false + * console.log(array); + * // => [1, 3] + * + * console.log(evens); + * // => [2, 4] */ - function isBoolean(value) { - return value === true || value === false || - (isObjectLike(value) && baseGetTag(value) == boolTag); + function remove(array, predicate) { + var result = []; + if (!(array && array.length)) { + return result; + } + var index = -1, + indexes = [], + length = array.length; + + predicate = getIteratee(predicate, 3); + while (++index < length) { + var value = array[index]; + if (predicate(value, index, array)) { + result.push(value); + indexes.push(index); + } + } + basePullAt(array, indexes); + return result; } /** - * Checks if `value` is a buffer. + * Reverses `array` so that the first element becomes the last, the second + * element becomes the second to last, and so on. + * + * **Note:** This method mutates `array` and is based on + * [`Array#reverse`](https://mdn.io/Array/reverse). * * @static * @memberOf _ - * @since 4.3.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a buffer, else `false`. + * @since 4.0.0 + * @category Array + * @param {Array} array The array to modify. + * @returns {Array} Returns `array`. * @example * - * _.isBuffer(new Buffer(2)); - * // => true + * var array = [1, 2, 3]; * - * _.isBuffer(new Uint8Array(2)); - * // => false + * _.reverse(array); + * // => [3, 2, 1] + * + * console.log(array); + * // => [3, 2, 1] */ - var isBuffer = nativeIsBuffer || stubFalse; + function reverse(array) { + return array == null ? array : nativeReverse.call(array); + } /** - * Checks if `value` is classified as a `Date` object. + * Creates a slice of `array` from `start` up to, but not including, `end`. + * + * **Note:** This method is used instead of + * [`Array#slice`](https://mdn.io/Array/slice) to ensure dense arrays are + * returned. * * @static * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a date object, else `false`. - * @example - * - * _.isDate(new Date); - * // => true - * - * _.isDate('Mon April 23 2012'); - * // => false + * @since 3.0.0 + * @category Array + * @param {Array} array The array to slice. + * @param {number} [start=0] The start position. + * @param {number} [end=array.length] The end position. + * @returns {Array} Returns the slice of `array`. */ - var isDate = nodeIsDate ? baseUnary(nodeIsDate) : baseIsDate; + function slice(array, start, end) { + var length = array == null ? 0 : array.length; + if (!length) { + return []; + } + if (end && typeof end != 'number' && isIterateeCall(array, start, end)) { + start = 0; + end = length; + } + else { + start = start == null ? 0 : toInteger(start); + end = end === undefined ? length : toInteger(end); + } + return baseSlice(array, start, end); + } /** - * Checks if `value` is likely a DOM element. + * Uses a binary search to determine the lowest index at which `value` + * should be inserted into `array` in order to maintain its sort order. * * @static * @memberOf _ * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a DOM element, else `false`. + * @category Array + * @param {Array} array The sorted array to inspect. + * @param {*} value The value to evaluate. + * @returns {number} Returns the index at which `value` should be inserted + * into `array`. * @example * - * _.isElement(document.body); - * // => true - * - * _.isElement(''); - * // => false + * _.sortedIndex([30, 50], 40); + * // => 1 */ - function isElement(value) { - return isObjectLike(value) && value.nodeType === 1 && !isPlainObject(value); + function sortedIndex(array, value) { + return baseSortedIndex(array, value); } /** - * Checks if `value` is an empty object, collection, map, or set. - * - * Objects are considered empty if they have no own enumerable string keyed - * properties. - * - * Array-like values such as `arguments` objects, arrays, buffers, strings, or - * jQuery-like collections are considered empty if they have a `length` of `0`. - * Similarly, maps and sets are considered empty if they have a `size` of `0`. + * This method is like `_.sortedIndex` except that it accepts `iteratee` + * which is invoked for `value` and each element of `array` to compute their + * sort ranking. The iteratee is invoked with one argument: (value). * * @static * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is empty, else `false`. + * @since 4.0.0 + * @category Array + * @param {Array} array The sorted array to inspect. + * @param {*} value The value to evaluate. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {number} Returns the index at which `value` should be inserted + * into `array`. * @example * - * _.isEmpty(null); - * // => true + * var objects = [{ 'x': 4 }, { 'x': 5 }]; * - * _.isEmpty(true); - * // => true + * _.sortedIndexBy(objects, { 'x': 4 }, function(o) { return o.x; }); + * // => 0 * - * _.isEmpty(1); - * // => true + * // The `_.property` iteratee shorthand. + * _.sortedIndexBy(objects, { 'x': 4 }, 'x'); + * // => 0 + */ + function sortedIndexBy(array, value, iteratee) { + return baseSortedIndexBy(array, value, getIteratee(iteratee, 2)); + } + + /** + * This method is like `_.indexOf` except that it performs a binary + * search on a sorted `array`. * - * _.isEmpty([1, 2, 3]); - * // => false + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @returns {number} Returns the index of the matched value, else `-1`. + * @example * - * _.isEmpty({ 'a': 1 }); - * // => false + * _.sortedIndexOf([4, 5, 5, 5, 6], 5); + * // => 1 */ - function isEmpty(value) { - if (value == null) { - return true; - } - if (isArrayLike(value) && - (isArray(value) || typeof value == 'string' || typeof value.splice == 'function' || - isBuffer(value) || isTypedArray(value) || isArguments(value))) { - return !value.length; - } - var tag = getTag(value); - if (tag == mapTag || tag == setTag) { - return !value.size; - } - if (isPrototype(value)) { - return !baseKeys(value).length; - } - for (var key in value) { - if (hasOwnProperty.call(value, key)) { - return false; + function sortedIndexOf(array, value) { + var length = array == null ? 0 : array.length; + if (length) { + var index = baseSortedIndex(array, value); + if (index < length && eq(array[index], value)) { + return index; } } - return true; + return -1; } /** - * Performs a deep comparison between two values to determine if they are - * equivalent. - * - * **Note:** This method supports comparing arrays, array buffers, booleans, - * date objects, error objects, maps, numbers, `Object` objects, regexes, - * sets, strings, symbols, and typed arrays. `Object` objects are compared - * by their own, not inherited, enumerable properties. Functions and DOM - * nodes are compared by strict equality, i.e. `===`. + * This method is like `_.sortedIndex` except that it returns the highest + * index at which `value` should be inserted into `array` in order to + * maintain its sort order. * * @static * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @returns {boolean} Returns `true` if the values are equivalent, else `false`. + * @since 3.0.0 + * @category Array + * @param {Array} array The sorted array to inspect. + * @param {*} value The value to evaluate. + * @returns {number} Returns the index at which `value` should be inserted + * into `array`. * @example * - * var object = { 'a': 1 }; - * var other = { 'a': 1 }; - * - * _.isEqual(object, other); - * // => true - * - * object === other; - * // => false + * _.sortedLastIndex([4, 5, 5, 5, 6], 5); + * // => 4 */ - function isEqual(value, other) { - return baseIsEqual(value, other); + function sortedLastIndex(array, value) { + return baseSortedIndex(array, value, true); } /** - * This method is like `_.isEqual` except that it accepts `customizer` which - * is invoked to compare values. If `customizer` returns `undefined`, comparisons - * are handled by the method instead. The `customizer` is invoked with up to - * six arguments: (objValue, othValue [, index|key, object, other, stack]). + * This method is like `_.sortedLastIndex` except that it accepts `iteratee` + * which is invoked for `value` and each element of `array` to compute their + * sort ranking. The iteratee is invoked with one argument: (value). * * @static * @memberOf _ * @since 4.0.0 - * @category Lang - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @param {Function} [customizer] The function to customize comparisons. - * @returns {boolean} Returns `true` if the values are equivalent, else `false`. + * @category Array + * @param {Array} array The sorted array to inspect. + * @param {*} value The value to evaluate. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {number} Returns the index at which `value` should be inserted + * into `array`. * @example * - * function isGreeting(value) { - * return /^h(?:i|ello)$/.test(value); - * } - * - * function customizer(objValue, othValue) { - * if (isGreeting(objValue) && isGreeting(othValue)) { - * return true; - * } - * } + * var objects = [{ 'x': 4 }, { 'x': 5 }]; * - * var array = ['hello', 'goodbye']; - * var other = ['hi', 'goodbye']; + * _.sortedLastIndexBy(objects, { 'x': 4 }, function(o) { return o.x; }); + * // => 1 * - * _.isEqualWith(array, other, customizer); - * // => true + * // The `_.property` iteratee shorthand. + * _.sortedLastIndexBy(objects, { 'x': 4 }, 'x'); + * // => 1 */ - function isEqualWith(value, other, customizer) { - customizer = typeof customizer == 'function' ? customizer : undefined; - var result = customizer ? customizer(value, other) : undefined; - return result === undefined ? baseIsEqual(value, other, undefined, customizer) : !!result; + function sortedLastIndexBy(array, value, iteratee) { + return baseSortedIndexBy(array, value, getIteratee(iteratee, 2), true); } /** - * Checks if `value` is an `Error`, `EvalError`, `RangeError`, `ReferenceError`, - * `SyntaxError`, `TypeError`, or `URIError` object. + * This method is like `_.lastIndexOf` except that it performs a binary + * search on a sorted `array`. * * @static * @memberOf _ - * @since 3.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is an error object, else `false`. + * @since 4.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @returns {number} Returns the index of the matched value, else `-1`. * @example * - * _.isError(new Error); - * // => true - * - * _.isError(Error); - * // => false + * _.sortedLastIndexOf([4, 5, 5, 5, 6], 5); + * // => 3 */ - function isError(value) { - if (!isObjectLike(value)) { - return false; + function sortedLastIndexOf(array, value) { + var length = array == null ? 0 : array.length; + if (length) { + var index = baseSortedIndex(array, value, true) - 1; + if (eq(array[index], value)) { + return index; + } } - var tag = baseGetTag(value); - return tag == errorTag || tag == domExcTag || - (typeof value.message == 'string' && typeof value.name == 'string' && !isPlainObject(value)); + return -1; } /** - * Checks if `value` is a finite primitive number. - * - * **Note:** This method is based on - * [`Number.isFinite`](https://mdn.io/Number/isFinite). + * This method is like `_.uniq` except that it's designed and optimized + * for sorted arrays. * * @static * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a finite number, else `false`. + * @since 4.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @returns {Array} Returns the new duplicate free array. * @example * - * _.isFinite(3); - * // => true - * - * _.isFinite(Number.MIN_VALUE); - * // => true - * - * _.isFinite(Infinity); - * // => false - * - * _.isFinite('3'); - * // => false + * _.sortedUniq([1, 1, 2]); + * // => [1, 2] */ - function isFinite(value) { - return typeof value == 'number' && nativeIsFinite(value); + function sortedUniq(array) { + return (array && array.length) + ? baseSortedUniq(array) + : []; } /** - * Checks if `value` is classified as a `Function` object. + * This method is like `_.uniqBy` except that it's designed and optimized + * for sorted arrays. * * @static * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a function, else `false`. + * @since 4.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {Function} [iteratee] The iteratee invoked per element. + * @returns {Array} Returns the new duplicate free array. * @example * - * _.isFunction(_); - * // => true - * - * _.isFunction(/abc/); - * // => false + * _.sortedUniqBy([1.1, 1.2, 2.3, 2.4], Math.floor); + * // => [1.1, 2.3] */ - function isFunction(value) { - if (!isObject(value)) { - return false; - } - // The use of `Object#toString` avoids issues with the `typeof` operator - // in Safari 9 which returns 'object' for typed arrays and other constructors. - var tag = baseGetTag(value); - return tag == funcTag || tag == genTag || tag == asyncTag || tag == proxyTag; + function sortedUniqBy(array, iteratee) { + return (array && array.length) + ? baseSortedUniq(array, getIteratee(iteratee, 2)) + : []; } /** - * Checks if `value` is an integer. - * - * **Note:** This method is based on - * [`Number.isInteger`](https://mdn.io/Number/isInteger). + * Gets all but the first element of `array`. * * @static * @memberOf _ * @since 4.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is an integer, else `false`. - * @example - * - * _.isInteger(3); - * // => true - * - * _.isInteger(Number.MIN_VALUE); - * // => false - * - * _.isInteger(Infinity); - * // => false + * @category Array + * @param {Array} array The array to query. + * @returns {Array} Returns the slice of `array`. + * @example * - * _.isInteger('3'); - * // => false + * _.tail([1, 2, 3]); + * // => [2, 3] */ - function isInteger(value) { - return typeof value == 'number' && value == toInteger(value); + function tail(array) { + var length = array == null ? 0 : array.length; + return length ? baseSlice(array, 1, length) : []; } /** - * Checks if `value` is a valid array-like length. - * - * **Note:** This method is loosely based on - * [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength). + * Creates a slice of `array` with `n` elements taken from the beginning. * * @static * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a valid length, else `false`. + * @since 0.1.0 + * @category Array + * @param {Array} array The array to query. + * @param {number} [n=1] The number of elements to take. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Array} Returns the slice of `array`. * @example * - * _.isLength(3); - * // => true + * _.take([1, 2, 3]); + * // => [1] * - * _.isLength(Number.MIN_VALUE); - * // => false + * _.take([1, 2, 3], 2); + * // => [1, 2] * - * _.isLength(Infinity); - * // => false + * _.take([1, 2, 3], 5); + * // => [1, 2, 3] * - * _.isLength('3'); - * // => false + * _.take([1, 2, 3], 0); + * // => [] */ - function isLength(value) { - return typeof value == 'number' && - value > -1 && value % 1 == 0 && value <= MAX_SAFE_INTEGER; + function take(array, n, guard) { + if (!(array && array.length)) { + return []; + } + n = (guard || n === undefined) ? 1 : toInteger(n); + return baseSlice(array, 0, n < 0 ? 0 : n); } /** - * Checks if `value` is the - * [language type](http://www.ecma-international.org/ecma-262/7.0/#sec-ecmascript-language-types) - * of `Object`. (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`) + * Creates a slice of `array` with `n` elements taken from the end. * * @static * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is an object, else `false`. + * @since 3.0.0 + * @category Array + * @param {Array} array The array to query. + * @param {number} [n=1] The number of elements to take. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Array} Returns the slice of `array`. * @example * - * _.isObject({}); - * // => true + * _.takeRight([1, 2, 3]); + * // => [3] * - * _.isObject([1, 2, 3]); - * // => true + * _.takeRight([1, 2, 3], 2); + * // => [2, 3] * - * _.isObject(_.noop); - * // => true + * _.takeRight([1, 2, 3], 5); + * // => [1, 2, 3] * - * _.isObject(null); - * // => false + * _.takeRight([1, 2, 3], 0); + * // => [] */ - function isObject(value) { - var type = typeof value; - return value != null && (type == 'object' || type == 'function'); + function takeRight(array, n, guard) { + var length = array == null ? 0 : array.length; + if (!length) { + return []; + } + n = (guard || n === undefined) ? 1 : toInteger(n); + n = length - n; + return baseSlice(array, n < 0 ? 0 : n, length); } /** - * Checks if `value` is object-like. A value is object-like if it's not `null` - * and has a `typeof` result of "object". + * Creates a slice of `array` with elements taken from the end. Elements are + * taken until `predicate` returns falsey. The predicate is invoked with + * three arguments: (value, index, array). * * @static * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is object-like, else `false`. + * @since 3.0.0 + * @category Array + * @param {Array} array The array to query. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {Array} Returns the slice of `array`. * @example * - * _.isObjectLike({}); - * // => true + * var users = [ + * { 'user': 'barney', 'active': true }, + * { 'user': 'fred', 'active': false }, + * { 'user': 'pebbles', 'active': false } + * ]; * - * _.isObjectLike([1, 2, 3]); - * // => true + * _.takeRightWhile(users, function(o) { return !o.active; }); + * // => objects for ['fred', 'pebbles'] * - * _.isObjectLike(_.noop); - * // => false + * // The `_.matches` iteratee shorthand. + * _.takeRightWhile(users, { 'user': 'pebbles', 'active': false }); + * // => objects for ['pebbles'] * - * _.isObjectLike(null); - * // => false + * // The `_.matchesProperty` iteratee shorthand. + * _.takeRightWhile(users, ['active', false]); + * // => objects for ['fred', 'pebbles'] + * + * // The `_.property` iteratee shorthand. + * _.takeRightWhile(users, 'active'); + * // => [] */ - function isObjectLike(value) { - return value != null && typeof value == 'object'; + function takeRightWhile(array, predicate) { + return (array && array.length) + ? baseWhile(array, getIteratee(predicate, 3), false, true) + : []; } /** - * Checks if `value` is classified as a `Map` object. + * Creates a slice of `array` with elements taken from the beginning. Elements + * are taken until `predicate` returns falsey. The predicate is invoked with + * three arguments: (value, index, array). * * @static * @memberOf _ - * @since 4.3.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a map, else `false`. + * @since 3.0.0 + * @category Array + * @param {Array} array The array to query. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {Array} Returns the slice of `array`. * @example * - * _.isMap(new Map); - * // => true + * var users = [ + * { 'user': 'barney', 'active': false }, + * { 'user': 'fred', 'active': false }, + * { 'user': 'pebbles', 'active': true } + * ]; * - * _.isMap(new WeakMap); - * // => false + * _.takeWhile(users, function(o) { return !o.active; }); + * // => objects for ['barney', 'fred'] + * + * // The `_.matches` iteratee shorthand. + * _.takeWhile(users, { 'user': 'barney', 'active': false }); + * // => objects for ['barney'] + * + * // The `_.matchesProperty` iteratee shorthand. + * _.takeWhile(users, ['active', false]); + * // => objects for ['barney', 'fred'] + * + * // The `_.property` iteratee shorthand. + * _.takeWhile(users, 'active'); + * // => [] */ - var isMap = nodeIsMap ? baseUnary(nodeIsMap) : baseIsMap; + function takeWhile(array, predicate) { + return (array && array.length) + ? baseWhile(array, getIteratee(predicate, 3)) + : []; + } /** - * Performs a partial deep comparison between `object` and `source` to - * determine if `object` contains equivalent property values. - * - * **Note:** This method is equivalent to `_.matches` when `source` is - * partially applied. - * - * Partial comparisons will match empty array and empty object `source` - * values against any array or object value, respectively. See `_.isEqual` - * for a list of supported value comparisons. + * Creates an array of unique values, in order, from all given arrays using + * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons. * * @static * @memberOf _ - * @since 3.0.0 - * @category Lang - * @param {Object} object The object to inspect. - * @param {Object} source The object of property values to match. - * @returns {boolean} Returns `true` if `object` is a match, else `false`. + * @since 0.1.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @returns {Array} Returns the new array of combined values. * @example * - * var object = { 'a': 1, 'b': 2 }; - * - * _.isMatch(object, { 'b': 2 }); - * // => true - * - * _.isMatch(object, { 'b': 1 }); - * // => false + * _.union([2], [1, 2]); + * // => [2, 1] */ - function isMatch(object, source) { - return object === source || baseIsMatch(object, source, getMatchData(source)); - } + var union = baseRest(function(arrays) { + return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true)); + }); /** - * This method is like `_.isMatch` except that it accepts `customizer` which - * is invoked to compare values. If `customizer` returns `undefined`, comparisons - * are handled by the method instead. The `customizer` is invoked with five - * arguments: (objValue, srcValue, index|key, object, source). + * This method is like `_.union` except that it accepts `iteratee` which is + * invoked for each element of each `arrays` to generate the criterion by + * which uniqueness is computed. Result values are chosen from the first + * array in which the value occurs. The iteratee is invoked with one argument: + * (value). * * @static * @memberOf _ * @since 4.0.0 - * @category Lang - * @param {Object} object The object to inspect. - * @param {Object} source The object of property values to match. - * @param {Function} [customizer] The function to customize comparisons. - * @returns {boolean} Returns `true` if `object` is a match, else `false`. + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {Array} Returns the new array of combined values. * @example * - * function isGreeting(value) { - * return /^h(?:i|ello)$/.test(value); - * } - * - * function customizer(objValue, srcValue) { - * if (isGreeting(objValue) && isGreeting(srcValue)) { - * return true; - * } - * } - * - * var object = { 'greeting': 'hello' }; - * var source = { 'greeting': 'hi' }; + * _.unionBy([2.1], [1.2, 2.3], Math.floor); + * // => [2.1, 1.2] * - * _.isMatchWith(object, source, customizer); - * // => true + * // The `_.property` iteratee shorthand. + * _.unionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x'); + * // => [{ 'x': 1 }, { 'x': 2 }] */ - function isMatchWith(object, source, customizer) { - customizer = typeof customizer == 'function' ? customizer : undefined; - return baseIsMatch(object, source, getMatchData(source), customizer); - } + var unionBy = baseRest(function(arrays) { + var iteratee = last(arrays); + if (isArrayLikeObject(iteratee)) { + iteratee = undefined; + } + return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), getIteratee(iteratee, 2)); + }); /** - * Checks if `value` is `NaN`. - * - * **Note:** This method is based on - * [`Number.isNaN`](https://mdn.io/Number/isNaN) and is not the same as - * global [`isNaN`](https://mdn.io/isNaN) which returns `true` for - * `undefined` and other non-number values. + * This method is like `_.union` except that it accepts `comparator` which + * is invoked to compare elements of `arrays`. Result values are chosen from + * the first array in which the value occurs. The comparator is invoked + * with two arguments: (arrVal, othVal). * * @static * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is `NaN`, else `false`. + * @since 4.0.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new array of combined values. * @example * - * _.isNaN(NaN); - * // => true - * - * _.isNaN(new Number(NaN)); - * // => true - * - * isNaN(undefined); - * // => true + * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; + * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }]; * - * _.isNaN(undefined); - * // => false + * _.unionWith(objects, others, _.isEqual); + * // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }] */ - function isNaN(value) { - // An `NaN` primitive is the only value that is not equal to itself. - // Perform the `toStringTag` check first to avoid errors with some - // ActiveX objects in IE. - return isNumber(value) && value != +value; - } + var unionWith = baseRest(function(arrays) { + var comparator = last(arrays); + comparator = typeof comparator == 'function' ? comparator : undefined; + return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), undefined, comparator); + }); /** - * Checks if `value` is a pristine native function. - * - * **Note:** This method can't reliably detect native functions in the presence - * of the core-js package because core-js circumvents this kind of detection. - * Despite multiple requests, the core-js maintainer has made it clear: any - * attempt to fix the detection will be obstructed. As a result, we're left - * with little choice but to throw an error. Unfortunately, this also affects - * packages, like [babel-polyfill](https://www.npmjs.com/package/babel-polyfill), - * which rely on core-js. + * Creates a duplicate-free version of an array, using + * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons, in which only the first occurrence of each element + * is kept. The order of result values is determined by the order they occur + * in the array. * * @static * @memberOf _ - * @since 3.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a native function, - * else `false`. + * @since 0.1.0 + * @category Array + * @param {Array} array The array to inspect. + * @returns {Array} Returns the new duplicate free array. * @example * - * _.isNative(Array.prototype.push); - * // => true - * - * _.isNative(_); - * // => false + * _.uniq([2, 1, 2]); + * // => [2, 1] */ - function isNative(value) { - if (isMaskable(value)) { - throw new Error(CORE_ERROR_TEXT); - } - return baseIsNative(value); + function uniq(array) { + return (array && array.length) ? baseUniq(array) : []; } /** - * Checks if `value` is `null`. + * This method is like `_.uniq` except that it accepts `iteratee` which is + * invoked for each element in `array` to generate the criterion by which + * uniqueness is computed. The order of result values is determined by the + * order they occur in the array. The iteratee is invoked with one argument: + * (value). * * @static * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is `null`, else `false`. + * @since 4.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {Array} Returns the new duplicate free array. * @example * - * _.isNull(null); - * // => true + * _.uniqBy([2.1, 1.2, 2.3], Math.floor); + * // => [2.1, 1.2] * - * _.isNull(void 0); - * // => false + * // The `_.property` iteratee shorthand. + * _.uniqBy([{ 'x': 1 }, { 'x': 2 }, { 'x': 1 }], 'x'); + * // => [{ 'x': 1 }, { 'x': 2 }] */ - function isNull(value) { - return value === null; + function uniqBy(array, iteratee) { + return (array && array.length) ? baseUniq(array, getIteratee(iteratee, 2)) : []; } /** - * Checks if `value` is `null` or `undefined`. + * This method is like `_.uniq` except that it accepts `comparator` which + * is invoked to compare elements of `array`. The order of result values is + * determined by the order they occur in the array.The comparator is invoked + * with two arguments: (arrVal, othVal). * * @static * @memberOf _ * @since 4.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is nullish, else `false`. + * @category Array + * @param {Array} array The array to inspect. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new duplicate free array. * @example * - * _.isNil(null); - * // => true - * - * _.isNil(void 0); - * // => true + * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 2 }]; * - * _.isNil(NaN); - * // => false + * _.uniqWith(objects, _.isEqual); + * // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }] */ - function isNil(value) { - return value == null; + function uniqWith(array, comparator) { + comparator = typeof comparator == 'function' ? comparator : undefined; + return (array && array.length) ? baseUniq(array, undefined, comparator) : []; } /** - * Checks if `value` is classified as a `Number` primitive or object. - * - * **Note:** To exclude `Infinity`, `-Infinity`, and `NaN`, which are - * classified as numbers, use the `_.isFinite` method. + * This method is like `_.zip` except that it accepts an array of grouped + * elements and creates an array regrouping the elements to their pre-zip + * configuration. * * @static * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a number, else `false`. + * @since 1.2.0 + * @category Array + * @param {Array} array The array of grouped elements to process. + * @returns {Array} Returns the new array of regrouped elements. * @example * - * _.isNumber(3); - * // => true - * - * _.isNumber(Number.MIN_VALUE); - * // => true - * - * _.isNumber(Infinity); - * // => true + * var zipped = _.zip(['a', 'b'], [1, 2], [true, false]); + * // => [['a', 1, true], ['b', 2, false]] * - * _.isNumber('3'); - * // => false + * _.unzip(zipped); + * // => [['a', 'b'], [1, 2], [true, false]] */ - function isNumber(value) { - return typeof value == 'number' || - (isObjectLike(value) && baseGetTag(value) == numberTag); + function unzip(array) { + if (!(array && array.length)) { + return []; + } + var length = 0; + array = arrayFilter(array, function(group) { + if (isArrayLikeObject(group)) { + length = nativeMax(group.length, length); + return true; + } + }); + return baseTimes(length, function(index) { + return arrayMap(array, baseProperty(index)); + }); } /** - * Checks if `value` is a plain object, that is, an object created by the - * `Object` constructor or one with a `[[Prototype]]` of `null`. + * This method is like `_.unzip` except that it accepts `iteratee` to specify + * how regrouped values should be combined. The iteratee is invoked with the + * elements of each group: (...group). * * @static * @memberOf _ - * @since 0.8.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a plain object, else `false`. + * @since 3.8.0 + * @category Array + * @param {Array} array The array of grouped elements to process. + * @param {Function} [iteratee=_.identity] The function to combine + * regrouped values. + * @returns {Array} Returns the new array of regrouped elements. * @example * - * function Foo() { - * this.a = 1; - * } - * - * _.isPlainObject(new Foo); - * // => false - * - * _.isPlainObject([1, 2, 3]); - * // => false - * - * _.isPlainObject({ 'x': 0, 'y': 0 }); - * // => true + * var zipped = _.zip([1, 2], [10, 20], [100, 200]); + * // => [[1, 10, 100], [2, 20, 200]] * - * _.isPlainObject(Object.create(null)); - * // => true + * _.unzipWith(zipped, _.add); + * // => [3, 30, 300] */ - function isPlainObject(value) { - if (!isObjectLike(value) || baseGetTag(value) != objectTag) { - return false; + function unzipWith(array, iteratee) { + if (!(array && array.length)) { + return []; } - var proto = getPrototype(value); - if (proto === null) { - return true; + var result = unzip(array); + if (iteratee == null) { + return result; } - var Ctor = hasOwnProperty.call(proto, 'constructor') && proto.constructor; - return typeof Ctor == 'function' && Ctor instanceof Ctor && - funcToString.call(Ctor) == objectCtorString; + return arrayMap(result, function(group) { + return apply(iteratee, undefined, group); + }); } /** - * Checks if `value` is classified as a `RegExp` object. + * Creates an array excluding all given values using + * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons. * - * @static + * **Note:** Unlike `_.pull`, this method returns a new array. + * + * @static * @memberOf _ * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a regexp, else `false`. + * @category Array + * @param {Array} array The array to inspect. + * @param {...*} [values] The values to exclude. + * @returns {Array} Returns the new array of filtered values. + * @see _.difference, _.xor * @example * - * _.isRegExp(/abc/); - * // => true - * - * _.isRegExp('/abc/'); - * // => false + * _.without([2, 1, 2, 3], 1, 2); + * // => [3] */ - var isRegExp = nodeIsRegExp ? baseUnary(nodeIsRegExp) : baseIsRegExp; + var without = baseRest(function(array, values) { + return isArrayLikeObject(array) + ? baseDifference(array, values) + : []; + }); /** - * Checks if `value` is a safe integer. An integer is safe if it's an IEEE-754 - * double precision number which isn't the result of a rounded unsafe integer. - * - * **Note:** This method is based on - * [`Number.isSafeInteger`](https://mdn.io/Number/isSafeInteger). + * Creates an array of unique values that is the + * [symmetric difference](https://en.wikipedia.org/wiki/Symmetric_difference) + * of the given arrays. The order of result values is determined by the order + * they occur in the arrays. * * @static * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a safe integer, else `false`. + * @since 2.4.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @returns {Array} Returns the new array of filtered values. + * @see _.difference, _.without * @example * - * _.isSafeInteger(3); - * // => true + * _.xor([2, 1], [2, 3]); + * // => [1, 3] + */ + var xor = baseRest(function(arrays) { + return baseXor(arrayFilter(arrays, isArrayLikeObject)); + }); + + /** + * This method is like `_.xor` except that it accepts `iteratee` which is + * invoked for each element of each `arrays` to generate the criterion by + * which by which they're compared. The order of result values is determined + * by the order they occur in the arrays. The iteratee is invoked with one + * argument: (value). * - * _.isSafeInteger(Number.MIN_VALUE); - * // => false + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {Array} Returns the new array of filtered values. + * @example * - * _.isSafeInteger(Infinity); - * // => false + * _.xorBy([2.1, 1.2], [2.3, 3.4], Math.floor); + * // => [1.2, 3.4] * - * _.isSafeInteger('3'); - * // => false + * // The `_.property` iteratee shorthand. + * _.xorBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x'); + * // => [{ 'x': 2 }] */ - function isSafeInteger(value) { - return isInteger(value) && value >= -MAX_SAFE_INTEGER && value <= MAX_SAFE_INTEGER; - } + var xorBy = baseRest(function(arrays) { + var iteratee = last(arrays); + if (isArrayLikeObject(iteratee)) { + iteratee = undefined; + } + return baseXor(arrayFilter(arrays, isArrayLikeObject), getIteratee(iteratee, 2)); + }); /** - * Checks if `value` is classified as a `Set` object. + * This method is like `_.xor` except that it accepts `comparator` which is + * invoked to compare elements of `arrays`. The order of result values is + * determined by the order they occur in the arrays. The comparator is invoked + * with two arguments: (arrVal, othVal). * * @static * @memberOf _ - * @since 4.3.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a set, else `false`. + * @since 4.0.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new array of filtered values. * @example * - * _.isSet(new Set); - * // => true + * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; + * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }]; * - * _.isSet(new WeakSet); - * // => false + * _.xorWith(objects, others, _.isEqual); + * // => [{ 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }] */ - var isSet = nodeIsSet ? baseUnary(nodeIsSet) : baseIsSet; + var xorWith = baseRest(function(arrays) { + var comparator = last(arrays); + comparator = typeof comparator == 'function' ? comparator : undefined; + return baseXor(arrayFilter(arrays, isArrayLikeObject), undefined, comparator); + }); /** - * Checks if `value` is classified as a `String` primitive or object. + * Creates an array of grouped elements, the first of which contains the + * first elements of the given arrays, the second of which contains the + * second elements of the given arrays, and so on. * * @static - * @since 0.1.0 * @memberOf _ - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a string, else `false`. + * @since 0.1.0 + * @category Array + * @param {...Array} [arrays] The arrays to process. + * @returns {Array} Returns the new array of grouped elements. * @example * - * _.isString('abc'); - * // => true - * - * _.isString(1); - * // => false + * _.zip(['a', 'b'], [1, 2], [true, false]); + * // => [['a', 1, true], ['b', 2, false]] */ - function isString(value) { - return typeof value == 'string' || - (!isArray(value) && isObjectLike(value) && baseGetTag(value) == stringTag); - } + var zip = baseRest(unzip); /** - * Checks if `value` is classified as a `Symbol` primitive or object. + * This method is like `_.fromPairs` except that it accepts two arrays, + * one of property identifiers and one of corresponding values. * * @static * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a symbol, else `false`. + * @since 0.4.0 + * @category Array + * @param {Array} [props=[]] The property identifiers. + * @param {Array} [values=[]] The property values. + * @returns {Object} Returns the new object. * @example * - * _.isSymbol(Symbol.iterator); - * // => true - * - * _.isSymbol('abc'); - * // => false + * _.zipObject(['a', 'b'], [1, 2]); + * // => { 'a': 1, 'b': 2 } */ - function isSymbol(value) { - return typeof value == 'symbol' || - (isObjectLike(value) && baseGetTag(value) == symbolTag); + function zipObject(props, values) { + return baseZipObject(props || [], values || [], assignValue); } /** - * Checks if `value` is classified as a typed array. + * This method is like `_.zipObject` except that it supports property paths. * * @static * @memberOf _ - * @since 3.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a typed array, else `false`. + * @since 4.1.0 + * @category Array + * @param {Array} [props=[]] The property identifiers. + * @param {Array} [values=[]] The property values. + * @returns {Object} Returns the new object. * @example * - * _.isTypedArray(new Uint8Array); - * // => true - * - * _.isTypedArray([]); - * // => false + * _.zipObjectDeep(['a.b[0].c', 'a.b[1].d'], [1, 2]); + * // => { 'a': { 'b': [{ 'c': 1 }, { 'd': 2 }] } } */ - var isTypedArray = nodeIsTypedArray ? baseUnary(nodeIsTypedArray) : baseIsTypedArray; + function zipObjectDeep(props, values) { + return baseZipObject(props || [], values || [], baseSet); + } /** - * Checks if `value` is `undefined`. + * This method is like `_.zip` except that it accepts `iteratee` to specify + * how grouped values should be combined. The iteratee is invoked with the + * elements of each group: (...group). * * @static - * @since 0.1.0 * @memberOf _ - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is `undefined`, else `false`. + * @since 3.8.0 + * @category Array + * @param {...Array} [arrays] The arrays to process. + * @param {Function} [iteratee=_.identity] The function to combine + * grouped values. + * @returns {Array} Returns the new array of grouped elements. * @example * - * _.isUndefined(void 0); - * // => true - * - * _.isUndefined(null); - * // => false + * _.zipWith([1, 2], [10, 20], [100, 200], function(a, b, c) { + * return a + b + c; + * }); + * // => [111, 222] */ - function isUndefined(value) { - return value === undefined; - } + var zipWith = baseRest(function(arrays) { + var length = arrays.length, + iteratee = length > 1 ? arrays[length - 1] : undefined; + + iteratee = typeof iteratee == 'function' ? (arrays.pop(), iteratee) : undefined; + return unzipWith(arrays, iteratee); + }); + + /*------------------------------------------------------------------------*/ /** - * Checks if `value` is classified as a `WeakMap` object. + * Creates a `lodash` wrapper instance that wraps `value` with explicit method + * chain sequences enabled. The result of such sequences must be unwrapped + * with `_#value`. * * @static * @memberOf _ - * @since 4.3.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a weak map, else `false`. + * @since 1.3.0 + * @category Seq + * @param {*} value The value to wrap. + * @returns {Object} Returns the new `lodash` wrapper instance. * @example * - * _.isWeakMap(new WeakMap); - * // => true + * var users = [ + * { 'user': 'barney', 'age': 36 }, + * { 'user': 'fred', 'age': 40 }, + * { 'user': 'pebbles', 'age': 1 } + * ]; * - * _.isWeakMap(new Map); - * // => false + * var youngest = _ + * .chain(users) + * .sortBy('age') + * .map(function(o) { + * return o.user + ' is ' + o.age; + * }) + * .head() + * .value(); + * // => 'pebbles is 1' */ - function isWeakMap(value) { - return isObjectLike(value) && getTag(value) == weakMapTag; + function chain(value) { + var result = lodash(value); + result.__chain__ = true; + return result; } /** - * Checks if `value` is classified as a `WeakSet` object. + * This method invokes `interceptor` and returns `value`. The interceptor + * is invoked with one argument; (value). The purpose of this method is to + * "tap into" a method chain sequence in order to modify intermediate results. * * @static * @memberOf _ - * @since 4.3.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a weak set, else `false`. + * @since 0.1.0 + * @category Seq + * @param {*} value The value to provide to `interceptor`. + * @param {Function} interceptor The function to invoke. + * @returns {*} Returns `value`. * @example * - * _.isWeakSet(new WeakSet); - * // => true - * - * _.isWeakSet(new Set); - * // => false + * _([1, 2, 3]) + * .tap(function(array) { + * // Mutate input array. + * array.pop(); + * }) + * .reverse() + * .value(); + * // => [2, 1] */ - function isWeakSet(value) { - return isObjectLike(value) && baseGetTag(value) == weakSetTag; + function tap(value, interceptor) { + interceptor(value); + return value; } /** - * Checks if `value` is less than `other`. + * This method is like `_.tap` except that it returns the result of `interceptor`. + * The purpose of this method is to "pass thru" values replacing intermediate + * results in a method chain sequence. * * @static * @memberOf _ - * @since 3.9.0 - * @category Lang - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @returns {boolean} Returns `true` if `value` is less than `other`, - * else `false`. - * @see _.gt + * @since 3.0.0 + * @category Seq + * @param {*} value The value to provide to `interceptor`. + * @param {Function} interceptor The function to invoke. + * @returns {*} Returns the result of `interceptor`. * @example * - * _.lt(1, 3); - * // => true - * - * _.lt(3, 3); - * // => false - * - * _.lt(3, 1); - * // => false + * _(' abc ') + * .chain() + * .trim() + * .thru(function(value) { + * return [value]; + * }) + * .value(); + * // => ['abc'] */ - var lt = createRelationalOperation(baseLt); + function thru(value, interceptor) { + return interceptor(value); + } /** - * Checks if `value` is less than or equal to `other`. + * This method is the wrapper version of `_.at`. * - * @static + * @name at * @memberOf _ - * @since 3.9.0 - * @category Lang - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @returns {boolean} Returns `true` if `value` is less than or equal to - * `other`, else `false`. - * @see _.gte + * @since 1.0.0 + * @category Seq + * @param {...(string|string[])} [paths] The property paths to pick. + * @returns {Object} Returns the new `lodash` wrapper instance. * @example * - * _.lte(1, 3); - * // => true - * - * _.lte(3, 3); - * // => true + * var object = { 'a': [{ 'b': { 'c': 3 } }, 4] }; * - * _.lte(3, 1); - * // => false + * _(object).at(['a[0].b.c', 'a[1]']).value(); + * // => [3, 4] */ - var lte = createRelationalOperation(function(value, other) { - return value <= other; + var wrapperAt = flatRest(function(paths) { + var length = paths.length, + start = length ? paths[0] : 0, + value = this.__wrapped__, + interceptor = function(object) { return baseAt(object, paths); }; + + if (length > 1 || this.__actions__.length || + !(value instanceof LazyWrapper) || !isIndex(start)) { + return this.thru(interceptor); + } + value = value.slice(start, +start + (length ? 1 : 0)); + value.__actions__.push({ + 'func': thru, + 'args': [interceptor], + 'thisArg': undefined + }); + return new LodashWrapper(value, this.__chain__).thru(function(array) { + if (length && !array.length) { + array.push(undefined); + } + return array; + }); }); /** - * Converts `value` to an array. + * Creates a `lodash` wrapper instance with explicit method chain sequences enabled. * - * @static - * @since 0.1.0 + * @name chain * @memberOf _ - * @category Lang - * @param {*} value The value to convert. - * @returns {Array} Returns the converted array. + * @since 0.1.0 + * @category Seq + * @returns {Object} Returns the new `lodash` wrapper instance. * @example * - * _.toArray({ 'a': 1, 'b': 2 }); - * // => [1, 2] - * - * _.toArray('abc'); - * // => ['a', 'b', 'c'] + * var users = [ + * { 'user': 'barney', 'age': 36 }, + * { 'user': 'fred', 'age': 40 } + * ]; * - * _.toArray(1); - * // => [] + * // A sequence without explicit chaining. + * _(users).head(); + * // => { 'user': 'barney', 'age': 36 } * - * _.toArray(null); - * // => [] + * // A sequence with explicit chaining. + * _(users) + * .chain() + * .head() + * .pick('user') + * .value(); + * // => { 'user': 'barney' } */ - function toArray(value) { - if (!value) { - return []; - } - if (isArrayLike(value)) { - return isString(value) ? stringToArray(value) : copyArray(value); - } - if (symIterator && value[symIterator]) { - return iteratorToArray(value[symIterator]()); - } - var tag = getTag(value), - func = tag == mapTag ? mapToArray : (tag == setTag ? setToArray : values); - - return func(value); + function wrapperChain() { + return chain(this); } /** - * Converts `value` to a finite number. + * Executes the chain sequence and returns the wrapped result. * - * @static + * @name commit * @memberOf _ - * @since 4.12.0 - * @category Lang - * @param {*} value The value to convert. - * @returns {number} Returns the converted number. + * @since 3.2.0 + * @category Seq + * @returns {Object} Returns the new `lodash` wrapper instance. * @example * - * _.toFinite(3.2); - * // => 3.2 + * var array = [1, 2]; + * var wrapped = _(array).push(3); * - * _.toFinite(Number.MIN_VALUE); - * // => 5e-324 + * console.log(array); + * // => [1, 2] * - * _.toFinite(Infinity); - * // => 1.7976931348623157e+308 + * wrapped = wrapped.commit(); + * console.log(array); + * // => [1, 2, 3] * - * _.toFinite('3.2'); - * // => 3.2 + * wrapped.last(); + * // => 3 + * + * console.log(array); + * // => [1, 2, 3] */ - function toFinite(value) { - if (!value) { - return value === 0 ? value : 0; - } - value = toNumber(value); - if (value === INFINITY || value === -INFINITY) { - var sign = (value < 0 ? -1 : 1); - return sign * MAX_INTEGER; - } - return value === value ? value : 0; + function wrapperCommit() { + return new LodashWrapper(this.value(), this.__chain__); } /** - * Converts `value` to an integer. - * - * **Note:** This method is loosely based on - * [`ToInteger`](http://www.ecma-international.org/ecma-262/7.0/#sec-tointeger). + * Gets the next value on a wrapped object following the + * [iterator protocol](https://mdn.io/iteration_protocols#iterator). * - * @static + * @name next * @memberOf _ * @since 4.0.0 - * @category Lang - * @param {*} value The value to convert. - * @returns {number} Returns the converted integer. + * @category Seq + * @returns {Object} Returns the next iterator value. * @example * - * _.toInteger(3.2); - * // => 3 + * var wrapped = _([1, 2]); * - * _.toInteger(Number.MIN_VALUE); - * // => 0 + * wrapped.next(); + * // => { 'done': false, 'value': 1 } * - * _.toInteger(Infinity); - * // => 1.7976931348623157e+308 + * wrapped.next(); + * // => { 'done': false, 'value': 2 } * - * _.toInteger('3.2'); - * // => 3 + * wrapped.next(); + * // => { 'done': true, 'value': undefined } */ - function toInteger(value) { - var result = toFinite(value), - remainder = result % 1; + function wrapperNext() { + if (this.__values__ === undefined) { + this.__values__ = toArray(this.value()); + } + var done = this.__index__ >= this.__values__.length, + value = done ? undefined : this.__values__[this.__index__++]; - return result === result ? (remainder ? result - remainder : result) : 0; + return { 'done': done, 'value': value }; } /** - * Converts `value` to an integer suitable for use as the length of an - * array-like object. - * - * **Note:** This method is based on - * [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength). + * Enables the wrapper to be iterable. * - * @static + * @name Symbol.iterator * @memberOf _ * @since 4.0.0 - * @category Lang - * @param {*} value The value to convert. - * @returns {number} Returns the converted integer. + * @category Seq + * @returns {Object} Returns the wrapper object. * @example * - * _.toLength(3.2); - * // => 3 - * - * _.toLength(Number.MIN_VALUE); - * // => 0 + * var wrapped = _([1, 2]); * - * _.toLength(Infinity); - * // => 4294967295 + * wrapped[Symbol.iterator]() === wrapped; + * // => true * - * _.toLength('3.2'); - * // => 3 + * Array.from(wrapped); + * // => [1, 2] */ - function toLength(value) { - return value ? baseClamp(toInteger(value), 0, MAX_ARRAY_LENGTH) : 0; + function wrapperToIterator() { + return this; } /** - * Converts `value` to a number. + * Creates a clone of the chain sequence planting `value` as the wrapped value. * - * @static + * @name plant * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to process. - * @returns {number} Returns the number. + * @since 3.2.0 + * @category Seq + * @param {*} value The value to plant. + * @returns {Object} Returns the new `lodash` wrapper instance. * @example * - * _.toNumber(3.2); - * // => 3.2 + * function square(n) { + * return n * n; + * } * - * _.toNumber(Number.MIN_VALUE); - * // => 5e-324 + * var wrapped = _([1, 2]).map(square); + * var other = wrapped.plant([3, 4]); * - * _.toNumber(Infinity); - * // => Infinity + * other.value(); + * // => [9, 16] * - * _.toNumber('3.2'); - * // => 3.2 + * wrapped.value(); + * // => [1, 4] */ - function toNumber(value) { - if (typeof value == 'number') { - return value; - } - if (isSymbol(value)) { - return NAN; - } - if (isObject(value)) { - var other = typeof value.valueOf == 'function' ? value.valueOf() : value; - value = isObject(other) ? (other + '') : other; - } - if (typeof value != 'string') { - return value === 0 ? value : +value; + function wrapperPlant(value) { + var result, + parent = this; + + while (parent instanceof baseLodash) { + var clone = wrapperClone(parent); + clone.__index__ = 0; + clone.__values__ = undefined; + if (result) { + previous.__wrapped__ = clone; + } else { + result = clone; + } + var previous = clone; + parent = parent.__wrapped__; } - value = value.replace(reTrim, ''); - var isBinary = reIsBinary.test(value); - return (isBinary || reIsOctal.test(value)) - ? freeParseInt(value.slice(2), isBinary ? 2 : 8) - : (reIsBadHex.test(value) ? NAN : +value); + previous.__wrapped__ = value; + return result; } /** - * Converts `value` to a plain object flattening inherited enumerable string - * keyed properties of `value` to own properties of the plain object. + * This method is the wrapper version of `_.reverse`. * - * @static + * **Note:** This method mutates the wrapped array. + * + * @name reverse * @memberOf _ - * @since 3.0.0 - * @category Lang - * @param {*} value The value to convert. - * @returns {Object} Returns the converted plain object. + * @since 0.1.0 + * @category Seq + * @returns {Object} Returns the new `lodash` wrapper instance. * @example * - * function Foo() { - * this.b = 2; - * } - * - * Foo.prototype.c = 3; + * var array = [1, 2, 3]; * - * _.assign({ 'a': 1 }, new Foo); - * // => { 'a': 1, 'b': 2 } + * _(array).reverse().value() + * // => [3, 2, 1] * - * _.assign({ 'a': 1 }, _.toPlainObject(new Foo)); - * // => { 'a': 1, 'b': 2, 'c': 3 } + * console.log(array); + * // => [3, 2, 1] */ - function toPlainObject(value) { - return copyObject(value, keysIn(value)); + function wrapperReverse() { + var value = this.__wrapped__; + if (value instanceof LazyWrapper) { + var wrapped = value; + if (this.__actions__.length) { + wrapped = new LazyWrapper(this); + } + wrapped = wrapped.reverse(); + wrapped.__actions__.push({ + 'func': thru, + 'args': [reverse], + 'thisArg': undefined + }); + return new LodashWrapper(wrapped, this.__chain__); + } + return this.thru(reverse); } /** - * Converts `value` to a safe integer. A safe integer can be compared and - * represented correctly. + * Executes the chain sequence to resolve the unwrapped value. * - * @static + * @name value * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to convert. - * @returns {number} Returns the converted integer. + * @since 0.1.0 + * @alias toJSON, valueOf + * @category Seq + * @returns {*} Returns the resolved unwrapped value. * @example * - * _.toSafeInteger(3.2); - * // => 3 - * - * _.toSafeInteger(Number.MIN_VALUE); - * // => 0 - * - * _.toSafeInteger(Infinity); - * // => 9007199254740991 - * - * _.toSafeInteger('3.2'); - * // => 3 + * _([1, 2, 3]).value(); + * // => [1, 2, 3] */ - function toSafeInteger(value) { - return value - ? baseClamp(toInteger(value), -MAX_SAFE_INTEGER, MAX_SAFE_INTEGER) - : (value === 0 ? value : 0); + function wrapperValue() { + return baseWrapperValue(this.__wrapped__, this.__actions__); } + /*------------------------------------------------------------------------*/ + /** - * Converts `value` to a string. An empty string is returned for `null` - * and `undefined` values. The sign of `-0` is preserved. + * Creates an object composed of keys generated from the results of running + * each element of `collection` thru `iteratee`. The corresponding value of + * each key is the number of times the key was returned by `iteratee`. The + * iteratee is invoked with one argument: (value). * * @static * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to convert. - * @returns {string} Returns the converted string. + * @since 0.5.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The iteratee to transform keys. + * @returns {Object} Returns the composed aggregate object. * @example * - * _.toString(null); - * // => '' - * - * _.toString(-0); - * // => '-0' + * _.countBy([6.1, 4.2, 6.3], Math.floor); + * // => { '4': 1, '6': 2 } * - * _.toString([1, 2, 3]); - * // => '1,2,3' + * // The `_.property` iteratee shorthand. + * _.countBy(['one', 'two', 'three'], 'length'); + * // => { '3': 2, '5': 1 } */ - function toString(value) { - return value == null ? '' : baseToString(value); - } - - /*------------------------------------------------------------------------*/ + var countBy = createAggregator(function(result, value, key) { + if (hasOwnProperty.call(result, key)) { + ++result[key]; + } else { + baseAssignValue(result, key, 1); + } + }); /** - * Assigns own enumerable string keyed properties of source objects to the - * destination object. Source objects are applied from left to right. - * Subsequent sources overwrite property assignments of previous sources. + * Checks if `predicate` returns truthy for **all** elements of `collection`. + * Iteration is stopped once `predicate` returns falsey. The predicate is + * invoked with three arguments: (value, index|key, collection). * - * **Note:** This method mutates `object` and is loosely based on - * [`Object.assign`](https://mdn.io/Object/assign). + * **Note:** This method returns `true` for + * [empty collections](https://en.wikipedia.org/wiki/Empty_set) because + * [everything is true](https://en.wikipedia.org/wiki/Vacuous_truth) of + * elements of empty collections. * * @static * @memberOf _ - * @since 0.10.0 - * @category Object - * @param {Object} object The destination object. - * @param {...Object} [sources] The source objects. - * @returns {Object} Returns `object`. - * @see _.assignIn + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {boolean} Returns `true` if all elements pass the predicate check, + * else `false`. * @example * - * function Foo() { - * this.a = 1; - * } + * _.every([true, 1, null, 'yes'], Boolean); + * // => false * - * function Bar() { - * this.c = 3; - * } + * var users = [ + * { 'user': 'barney', 'age': 36, 'active': false }, + * { 'user': 'fred', 'age': 40, 'active': false } + * ]; * - * Foo.prototype.b = 2; - * Bar.prototype.d = 4; + * // The `_.matches` iteratee shorthand. + * _.every(users, { 'user': 'barney', 'active': false }); + * // => false * - * _.assign({ 'a': 0 }, new Foo, new Bar); - * // => { 'a': 1, 'c': 3 } + * // The `_.matchesProperty` iteratee shorthand. + * _.every(users, ['active', false]); + * // => true + * + * // The `_.property` iteratee shorthand. + * _.every(users, 'active'); + * // => false */ - var assign = createAssigner(function(object, source) { - if (isPrototype(source) || isArrayLike(source)) { - copyObject(source, keys(source), object); - return; - } - for (var key in source) { - if (hasOwnProperty.call(source, key)) { - assignValue(object, key, source[key]); - } + function every(collection, predicate, guard) { + var func = isArray(collection) ? arrayEvery : baseEvery; + if (guard && isIterateeCall(collection, predicate, guard)) { + predicate = undefined; } - }); + return func(collection, getIteratee(predicate, 3)); + } /** - * This method is like `_.assign` except that it iterates over own and - * inherited source properties. + * Iterates over elements of `collection`, returning an array of all elements + * `predicate` returns truthy for. The predicate is invoked with three + * arguments: (value, index|key, collection). * - * **Note:** This method mutates `object`. + * **Note:** Unlike `_.remove`, this method returns a new array. * * @static * @memberOf _ - * @since 4.0.0 - * @alias extend - * @category Object - * @param {Object} object The destination object. - * @param {...Object} [sources] The source objects. - * @returns {Object} Returns `object`. - * @see _.assign + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {Array} Returns the new filtered array. + * @see _.reject * @example * - * function Foo() { - * this.a = 1; - * } + * var users = [ + * { 'user': 'barney', 'age': 36, 'active': true }, + * { 'user': 'fred', 'age': 40, 'active': false } + * ]; * - * function Bar() { - * this.c = 3; - * } + * _.filter(users, function(o) { return !o.active; }); + * // => objects for ['fred'] * - * Foo.prototype.b = 2; - * Bar.prototype.d = 4; + * // The `_.matches` iteratee shorthand. + * _.filter(users, { 'age': 36, 'active': true }); + * // => objects for ['barney'] * - * _.assignIn({ 'a': 0 }, new Foo, new Bar); - * // => { 'a': 1, 'b': 2, 'c': 3, 'd': 4 } + * // The `_.matchesProperty` iteratee shorthand. + * _.filter(users, ['active', false]); + * // => objects for ['fred'] + * + * // The `_.property` iteratee shorthand. + * _.filter(users, 'active'); + * // => objects for ['barney'] */ - var assignIn = createAssigner(function(object, source) { - copyObject(source, keysIn(source), object); - }); + function filter(collection, predicate) { + var func = isArray(collection) ? arrayFilter : baseFilter; + return func(collection, getIteratee(predicate, 3)); + } /** - * This method is like `_.assignIn` except that it accepts `customizer` - * which is invoked to produce the assigned values. If `customizer` returns - * `undefined`, assignment is handled by the method instead. The `customizer` - * is invoked with five arguments: (objValue, srcValue, key, object, source). - * - * **Note:** This method mutates `object`. + * Iterates over elements of `collection`, returning the first element + * `predicate` returns truthy for. The predicate is invoked with three + * arguments: (value, index|key, collection). * * @static * @memberOf _ - * @since 4.0.0 - * @alias extendWith - * @category Object - * @param {Object} object The destination object. - * @param {...Object} sources The source objects. - * @param {Function} [customizer] The function to customize assigned values. - * @returns {Object} Returns `object`. - * @see _.assignWith + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to inspect. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @param {number} [fromIndex=0] The index to search from. + * @returns {*} Returns the matched element, else `undefined`. * @example * - * function customizer(objValue, srcValue) { - * return _.isUndefined(objValue) ? srcValue : objValue; - * } + * var users = [ + * { 'user': 'barney', 'age': 36, 'active': true }, + * { 'user': 'fred', 'age': 40, 'active': false }, + * { 'user': 'pebbles', 'age': 1, 'active': true } + * ]; * - * var defaults = _.partialRight(_.assignInWith, customizer); + * _.find(users, function(o) { return o.age < 40; }); + * // => object for 'barney' * - * defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 }); - * // => { 'a': 1, 'b': 2 } + * // The `_.matches` iteratee shorthand. + * _.find(users, { 'age': 1, 'active': true }); + * // => object for 'pebbles' + * + * // The `_.matchesProperty` iteratee shorthand. + * _.find(users, ['active', false]); + * // => object for 'fred' + * + * // The `_.property` iteratee shorthand. + * _.find(users, 'active'); + * // => object for 'barney' */ - var assignInWith = createAssigner(function(object, source, srcIndex, customizer) { - copyObject(source, keysIn(source), object, customizer); - }); + var find = createFind(findIndex); /** - * This method is like `_.assign` except that it accepts `customizer` - * which is invoked to produce the assigned values. If `customizer` returns - * `undefined`, assignment is handled by the method instead. The `customizer` - * is invoked with five arguments: (objValue, srcValue, key, object, source). + * This method is like `_.find` except that it iterates over elements of + * `collection` from right to left. * - * **Note:** This method mutates `object`. + * @static + * @memberOf _ + * @since 2.0.0 + * @category Collection + * @param {Array|Object} collection The collection to inspect. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @param {number} [fromIndex=collection.length-1] The index to search from. + * @returns {*} Returns the matched element, else `undefined`. + * @example + * + * _.findLast([1, 2, 3, 4], function(n) { + * return n % 2 == 1; + * }); + * // => 3 + */ + var findLast = createFind(findLastIndex); + + /** + * Creates a flattened array of values by running each element in `collection` + * thru `iteratee` and flattening the mapped results. The iteratee is invoked + * with three arguments: (value, index|key, collection). * * @static * @memberOf _ * @since 4.0.0 - * @category Object - * @param {Object} object The destination object. - * @param {...Object} sources The source objects. - * @param {Function} [customizer] The function to customize assigned values. - * @returns {Object} Returns `object`. - * @see _.assignInWith + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Array} Returns the new flattened array. * @example * - * function customizer(objValue, srcValue) { - * return _.isUndefined(objValue) ? srcValue : objValue; + * function duplicate(n) { + * return [n, n]; * } * - * var defaults = _.partialRight(_.assignWith, customizer); - * - * defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 }); - * // => { 'a': 1, 'b': 2 } + * _.flatMap([1, 2], duplicate); + * // => [1, 1, 2, 2] */ - var assignWith = createAssigner(function(object, source, srcIndex, customizer) { - copyObject(source, keys(source), object, customizer); - }); + function flatMap(collection, iteratee) { + return baseFlatten(map(collection, iteratee), 1); + } /** - * Creates an array of values corresponding to `paths` of `object`. + * This method is like `_.flatMap` except that it recursively flattens the + * mapped results. * * @static * @memberOf _ - * @since 1.0.0 - * @category Object - * @param {Object} object The object to iterate over. - * @param {...(string|string[])} [paths] The property paths to pick. - * @returns {Array} Returns the picked values. + * @since 4.7.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Array} Returns the new flattened array. * @example * - * var object = { 'a': [{ 'b': { 'c': 3 } }, 4] }; + * function duplicate(n) { + * return [[[n, n]]]; + * } * - * _.at(object, ['a[0].b.c', 'a[1]']); - * // => [3, 4] + * _.flatMapDeep([1, 2], duplicate); + * // => [1, 1, 2, 2] */ - var at = flatRest(baseAt); + function flatMapDeep(collection, iteratee) { + return baseFlatten(map(collection, iteratee), INFINITY); + } /** - * Creates an object that inherits from the `prototype` object. If a - * `properties` object is given, its own enumerable string keyed properties - * are assigned to the created object. + * This method is like `_.flatMap` except that it recursively flattens the + * mapped results up to `depth` times. * * @static * @memberOf _ - * @since 2.3.0 - * @category Object - * @param {Object} prototype The object to inherit from. - * @param {Object} [properties] The properties to assign to the object. - * @returns {Object} Returns the new object. + * @since 4.7.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @param {number} [depth=1] The maximum recursion depth. + * @returns {Array} Returns the new flattened array. * @example * - * function Shape() { - * this.x = 0; - * this.y = 0; - * } - * - * function Circle() { - * Shape.call(this); + * function duplicate(n) { + * return [[[n, n]]]; * } * - * Circle.prototype = _.create(Shape.prototype, { - * 'constructor': Circle - * }); - * - * var circle = new Circle; - * circle instanceof Circle; - * // => true - * - * circle instanceof Shape; - * // => true + * _.flatMapDepth([1, 2], duplicate, 2); + * // => [[1, 1], [2, 2]] */ - function create(prototype, properties) { - var result = baseCreate(prototype); - return properties == null ? result : baseAssign(result, properties); + function flatMapDepth(collection, iteratee, depth) { + depth = depth === undefined ? 1 : toInteger(depth); + return baseFlatten(map(collection, iteratee), depth); } /** - * Assigns own and inherited enumerable string keyed properties of source - * objects to the destination object for all destination properties that - * resolve to `undefined`. Source objects are applied from left to right. - * Once a property is set, additional values of the same property are ignored. + * Iterates over elements of `collection` and invokes `iteratee` for each element. + * The iteratee is invoked with three arguments: (value, index|key, collection). + * Iteratee functions may exit iteration early by explicitly returning `false`. * - * **Note:** This method mutates `object`. + * **Note:** As with other "Collections" methods, objects with a "length" + * property are iterated like arrays. To avoid this behavior use `_.forIn` + * or `_.forOwn` for object iteration. * * @static - * @since 0.1.0 * @memberOf _ - * @category Object - * @param {Object} object The destination object. - * @param {...Object} [sources] The source objects. - * @returns {Object} Returns `object`. - * @see _.defaultsDeep + * @since 0.1.0 + * @alias each + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Array|Object} Returns `collection`. + * @see _.forEachRight * @example * - * _.defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 }); - * // => { 'a': 1, 'b': 2 } + * _.forEach([1, 2], function(value) { + * console.log(value); + * }); + * // => Logs `1` then `2`. + * + * _.forEach({ 'a': 1, 'b': 2 }, function(value, key) { + * console.log(key); + * }); + * // => Logs 'a' then 'b' (iteration order is not guaranteed). */ - var defaults = baseRest(function(args) { - args.push(undefined, customDefaultsAssignIn); - return apply(assignInWith, undefined, args); - }); + function forEach(collection, iteratee) { + var func = isArray(collection) ? arrayEach : baseEach; + return func(collection, getIteratee(iteratee, 3)); + } /** - * This method is like `_.defaults` except that it recursively assigns - * default properties. - * - * **Note:** This method mutates `object`. + * This method is like `_.forEach` except that it iterates over elements of + * `collection` from right to left. * * @static * @memberOf _ - * @since 3.10.0 - * @category Object - * @param {Object} object The destination object. - * @param {...Object} [sources] The source objects. - * @returns {Object} Returns `object`. - * @see _.defaults + * @since 2.0.0 + * @alias eachRight + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Array|Object} Returns `collection`. + * @see _.forEach * @example * - * _.defaultsDeep({ 'a': { 'b': 2 } }, { 'a': { 'b': 1, 'c': 3 } }); - * // => { 'a': { 'b': 2, 'c': 3 } } + * _.forEachRight([1, 2], function(value) { + * console.log(value); + * }); + * // => Logs `2` then `1`. */ - var defaultsDeep = baseRest(function(args) { - args.push(undefined, customDefaultsMerge); - return apply(mergeWith, undefined, args); - }); + function forEachRight(collection, iteratee) { + var func = isArray(collection) ? arrayEachRight : baseEachRight; + return func(collection, getIteratee(iteratee, 3)); + } /** - * This method is like `_.find` except that it returns the key of the first - * element `predicate` returns truthy for instead of the element itself. + * Creates an object composed of keys generated from the results of running + * each element of `collection` thru `iteratee`. The order of grouped values + * is determined by the order they occur in `collection`. The corresponding + * value of each key is an array of elements responsible for generating the + * key. The iteratee is invoked with one argument: (value). * * @static * @memberOf _ - * @since 1.1.0 - * @category Object - * @param {Object} object The object to inspect. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {string|undefined} Returns the key of the matched element, - * else `undefined`. + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The iteratee to transform keys. + * @returns {Object} Returns the composed aggregate object. * @example * - * var users = { - * 'barney': { 'age': 36, 'active': true }, - * 'fred': { 'age': 40, 'active': false }, - * 'pebbles': { 'age': 1, 'active': true } - * }; - * - * _.findKey(users, function(o) { return o.age < 40; }); - * // => 'barney' (iteration order is not guaranteed) - * - * // The `_.matches` iteratee shorthand. - * _.findKey(users, { 'age': 1, 'active': true }); - * // => 'pebbles' - * - * // The `_.matchesProperty` iteratee shorthand. - * _.findKey(users, ['active', false]); - * // => 'fred' + * _.groupBy([6.1, 4.2, 6.3], Math.floor); + * // => { '4': [4.2], '6': [6.1, 6.3] } * * // The `_.property` iteratee shorthand. - * _.findKey(users, 'active'); - * // => 'barney' + * _.groupBy(['one', 'two', 'three'], 'length'); + * // => { '3': ['one', 'two'], '5': ['three'] } */ - function findKey(object, predicate) { - return baseFindKey(object, getIteratee(predicate, 3), baseForOwn); - } + var groupBy = createAggregator(function(result, value, key) { + if (hasOwnProperty.call(result, key)) { + result[key].push(value); + } else { + baseAssignValue(result, key, [value]); + } + }); /** - * This method is like `_.findKey` except that it iterates over elements of - * a collection in the opposite order. + * Checks if `value` is in `collection`. If `collection` is a string, it's + * checked for a substring of `value`, otherwise + * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * is used for equality comparisons. If `fromIndex` is negative, it's used as + * the offset from the end of `collection`. * * @static * @memberOf _ - * @since 2.0.0 - * @category Object - * @param {Object} object The object to inspect. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {string|undefined} Returns the key of the matched element, - * else `undefined`. + * @since 0.1.0 + * @category Collection + * @param {Array|Object|string} collection The collection to inspect. + * @param {*} value The value to search for. + * @param {number} [fromIndex=0] The index to search from. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`. + * @returns {boolean} Returns `true` if `value` is found, else `false`. * @example * - * var users = { - * 'barney': { 'age': 36, 'active': true }, - * 'fred': { 'age': 40, 'active': false }, - * 'pebbles': { 'age': 1, 'active': true } - * }; - * - * _.findLastKey(users, function(o) { return o.age < 40; }); - * // => returns 'pebbles' assuming `_.findKey` returns 'barney' + * _.includes([1, 2, 3], 1); + * // => true * - * // The `_.matches` iteratee shorthand. - * _.findLastKey(users, { 'age': 36, 'active': true }); - * // => 'barney' + * _.includes([1, 2, 3], 1, 2); + * // => false * - * // The `_.matchesProperty` iteratee shorthand. - * _.findLastKey(users, ['active', false]); - * // => 'fred' + * _.includes({ 'a': 1, 'b': 2 }, 1); + * // => true * - * // The `_.property` iteratee shorthand. - * _.findLastKey(users, 'active'); - * // => 'pebbles' + * _.includes('abcd', 'bc'); + * // => true */ - function findLastKey(object, predicate) { - return baseFindKey(object, getIteratee(predicate, 3), baseForOwnRight); + function includes(collection, value, fromIndex, guard) { + collection = isArrayLike(collection) ? collection : values(collection); + fromIndex = (fromIndex && !guard) ? toInteger(fromIndex) : 0; + + var length = collection.length; + if (fromIndex < 0) { + fromIndex = nativeMax(length + fromIndex, 0); + } + return isString(collection) + ? (fromIndex <= length && collection.indexOf(value, fromIndex) > -1) + : (!!length && baseIndexOf(collection, value, fromIndex) > -1); } /** - * Iterates over own and inherited enumerable string keyed properties of an - * object and invokes `iteratee` for each property. The iteratee is invoked - * with three arguments: (value, key, object). Iteratee functions may exit - * iteration early by explicitly returning `false`. + * Invokes the method at `path` of each element in `collection`, returning + * an array of the results of each invoked method. Any additional arguments + * are provided to each invoked method. If `path` is a function, it's invoked + * for, and `this` bound to, each element in `collection`. * * @static * @memberOf _ - * @since 0.3.0 - * @category Object - * @param {Object} object The object to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Object} Returns `object`. - * @see _.forInRight + * @since 4.0.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Array|Function|string} path The path of the method to invoke or + * the function invoked per iteration. + * @param {...*} [args] The arguments to invoke each method with. + * @returns {Array} Returns the array of results. * @example * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } - * - * Foo.prototype.c = 3; + * _.invokeMap([[5, 1, 7], [3, 2, 1]], 'sort'); + * // => [[1, 5, 7], [1, 2, 3]] * - * _.forIn(new Foo, function(value, key) { - * console.log(key); - * }); - * // => Logs 'a', 'b', then 'c' (iteration order is not guaranteed). + * _.invokeMap([123, 456], String.prototype.split, ''); + * // => [['1', '2', '3'], ['4', '5', '6']] */ - function forIn(object, iteratee) { - return object == null - ? object - : baseFor(object, getIteratee(iteratee, 3), keysIn); - } + var invokeMap = baseRest(function(collection, path, args) { + var index = -1, + isFunc = typeof path == 'function', + result = isArrayLike(collection) ? Array(collection.length) : []; + + baseEach(collection, function(value) { + result[++index] = isFunc ? apply(path, value, args) : baseInvoke(value, path, args); + }); + return result; + }); /** - * This method is like `_.forIn` except that it iterates over properties of - * `object` in the opposite order. + * Creates an object composed of keys generated from the results of running + * each element of `collection` thru `iteratee`. The corresponding value of + * each key is the last element responsible for generating the key. The + * iteratee is invoked with one argument: (value). * * @static * @memberOf _ - * @since 2.0.0 - * @category Object - * @param {Object} object The object to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Object} Returns `object`. - * @see _.forIn + * @since 4.0.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The iteratee to transform keys. + * @returns {Object} Returns the composed aggregate object. * @example * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } - * - * Foo.prototype.c = 3; + * var array = [ + * { 'dir': 'left', 'code': 97 }, + * { 'dir': 'right', 'code': 100 } + * ]; * - * _.forInRight(new Foo, function(value, key) { - * console.log(key); + * _.keyBy(array, function(o) { + * return String.fromCharCode(o.code); * }); - * // => Logs 'c', 'b', then 'a' assuming `_.forIn` logs 'a', 'b', then 'c'. + * // => { 'a': { 'dir': 'left', 'code': 97 }, 'd': { 'dir': 'right', 'code': 100 } } + * + * _.keyBy(array, 'dir'); + * // => { 'left': { 'dir': 'left', 'code': 97 }, 'right': { 'dir': 'right', 'code': 100 } } */ - function forInRight(object, iteratee) { - return object == null - ? object - : baseForRight(object, getIteratee(iteratee, 3), keysIn); - } + var keyBy = createAggregator(function(result, value, key) { + baseAssignValue(result, key, value); + }); /** - * Iterates over own enumerable string keyed properties of an object and - * invokes `iteratee` for each property. The iteratee is invoked with three - * arguments: (value, key, object). Iteratee functions may exit iteration - * early by explicitly returning `false`. + * Creates an array of values by running each element in `collection` thru + * `iteratee`. The iteratee is invoked with three arguments: + * (value, index|key, collection). + * + * Many lodash methods are guarded to work as iteratees for methods like + * `_.every`, `_.filter`, `_.map`, `_.mapValues`, `_.reject`, and `_.some`. + * + * The guarded methods are: + * `ary`, `chunk`, `curry`, `curryRight`, `drop`, `dropRight`, `every`, + * `fill`, `invert`, `parseInt`, `random`, `range`, `rangeRight`, `repeat`, + * `sampleSize`, `slice`, `some`, `sortBy`, `split`, `take`, `takeRight`, + * `template`, `trim`, `trimEnd`, `trimStart`, and `words` * * @static * @memberOf _ - * @since 0.3.0 - * @category Object - * @param {Object} object The object to iterate over. + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Object} Returns `object`. - * @see _.forOwnRight + * @returns {Array} Returns the new mapped array. * @example * - * function Foo() { - * this.a = 1; - * this.b = 2; + * function square(n) { + * return n * n; * } * - * Foo.prototype.c = 3; + * _.map([4, 8], square); + * // => [16, 64] * - * _.forOwn(new Foo, function(value, key) { - * console.log(key); - * }); - * // => Logs 'a' then 'b' (iteration order is not guaranteed). + * _.map({ 'a': 4, 'b': 8 }, square); + * // => [16, 64] (iteration order is not guaranteed) + * + * var users = [ + * { 'user': 'barney' }, + * { 'user': 'fred' } + * ]; + * + * // The `_.property` iteratee shorthand. + * _.map(users, 'user'); + * // => ['barney', 'fred'] */ - function forOwn(object, iteratee) { - return object && baseForOwn(object, getIteratee(iteratee, 3)); + function map(collection, iteratee) { + var func = isArray(collection) ? arrayMap : baseMap; + return func(collection, getIteratee(iteratee, 3)); } /** - * This method is like `_.forOwn` except that it iterates over properties of - * `object` in the opposite order. + * This method is like `_.sortBy` except that it allows specifying the sort + * orders of the iteratees to sort by. If `orders` is unspecified, all values + * are sorted in ascending order. Otherwise, specify an order of "desc" for + * descending or "asc" for ascending sort order of corresponding values. * * @static * @memberOf _ - * @since 2.0.0 - * @category Object - * @param {Object} object The object to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Object} Returns `object`. - * @see _.forOwn + * @since 4.0.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Array[]|Function[]|Object[]|string[]} [iteratees=[_.identity]] + * The iteratees to sort by. + * @param {string[]} [orders] The sort orders of `iteratees`. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`. + * @returns {Array} Returns the new sorted array. * @example * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } - * - * Foo.prototype.c = 3; + * var users = [ + * { 'user': 'fred', 'age': 48 }, + * { 'user': 'barney', 'age': 34 }, + * { 'user': 'fred', 'age': 40 }, + * { 'user': 'barney', 'age': 36 } + * ]; * - * _.forOwnRight(new Foo, function(value, key) { - * console.log(key); - * }); - * // => Logs 'b' then 'a' assuming `_.forOwn` logs 'a' then 'b'. + * // Sort by `user` in ascending order and by `age` in descending order. + * _.orderBy(users, ['user', 'age'], ['asc', 'desc']); + * // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 40]] */ - function forOwnRight(object, iteratee) { - return object && baseForOwnRight(object, getIteratee(iteratee, 3)); + function orderBy(collection, iteratees, orders, guard) { + if (collection == null) { + return []; + } + if (!isArray(iteratees)) { + iteratees = iteratees == null ? [] : [iteratees]; + } + orders = guard ? undefined : orders; + if (!isArray(orders)) { + orders = orders == null ? [] : [orders]; + } + return baseOrderBy(collection, iteratees, orders); } /** - * Creates an array of function property names from own enumerable properties - * of `object`. + * Creates an array of elements split into two groups, the first of which + * contains elements `predicate` returns truthy for, the second of which + * contains elements `predicate` returns falsey for. The predicate is + * invoked with one argument: (value). * * @static - * @since 0.1.0 * @memberOf _ - * @category Object - * @param {Object} object The object to inspect. - * @returns {Array} Returns the function names. - * @see _.functionsIn + * @since 3.0.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {Array} Returns the array of grouped elements. * @example * - * function Foo() { - * this.a = _.constant('a'); - * this.b = _.constant('b'); - * } + * var users = [ + * { 'user': 'barney', 'age': 36, 'active': false }, + * { 'user': 'fred', 'age': 40, 'active': true }, + * { 'user': 'pebbles', 'age': 1, 'active': false } + * ]; * - * Foo.prototype.c = _.constant('c'); + * _.partition(users, function(o) { return o.active; }); + * // => objects for [['fred'], ['barney', 'pebbles']] * - * _.functions(new Foo); - * // => ['a', 'b'] + * // The `_.matches` iteratee shorthand. + * _.partition(users, { 'age': 1, 'active': false }); + * // => objects for [['pebbles'], ['barney', 'fred']] + * + * // The `_.matchesProperty` iteratee shorthand. + * _.partition(users, ['active', false]); + * // => objects for [['barney', 'pebbles'], ['fred']] + * + * // The `_.property` iteratee shorthand. + * _.partition(users, 'active'); + * // => objects for [['fred'], ['barney', 'pebbles']] */ - function functions(object) { - return object == null ? [] : baseFunctions(object, keys(object)); - } + var partition = createAggregator(function(result, value, key) { + result[key ? 0 : 1].push(value); + }, function() { return [[], []]; }); /** - * Creates an array of function property names from own and inherited - * enumerable properties of `object`. + * Reduces `collection` to a value which is the accumulated result of running + * each element in `collection` thru `iteratee`, where each successive + * invocation is supplied the return value of the previous. If `accumulator` + * is not given, the first element of `collection` is used as the initial + * value. The iteratee is invoked with four arguments: + * (accumulator, value, index|key, collection). + * + * Many lodash methods are guarded to work as iteratees for methods like + * `_.reduce`, `_.reduceRight`, and `_.transform`. + * + * The guarded methods are: + * `assign`, `defaults`, `defaultsDeep`, `includes`, `merge`, `orderBy`, + * and `sortBy` * * @static * @memberOf _ - * @since 4.0.0 - * @category Object - * @param {Object} object The object to inspect. - * @returns {Array} Returns the function names. - * @see _.functions + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @param {*} [accumulator] The initial value. + * @returns {*} Returns the accumulated value. + * @see _.reduceRight * @example * - * function Foo() { - * this.a = _.constant('a'); - * this.b = _.constant('b'); - * } - * - * Foo.prototype.c = _.constant('c'); + * _.reduce([1, 2], function(sum, n) { + * return sum + n; + * }, 0); + * // => 3 * - * _.functionsIn(new Foo); - * // => ['a', 'b', 'c'] + * _.reduce({ 'a': 1, 'b': 2, 'c': 1 }, function(result, value, key) { + * (result[value] || (result[value] = [])).push(key); + * return result; + * }, {}); + * // => { '1': ['a', 'c'], '2': ['b'] } (iteration order is not guaranteed) */ - function functionsIn(object) { - return object == null ? [] : baseFunctions(object, keysIn(object)); + function reduce(collection, iteratee, accumulator) { + var func = isArray(collection) ? arrayReduce : baseReduce, + initAccum = arguments.length < 3; + + return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEach); } /** - * Gets the value at `path` of `object`. If the resolved value is - * `undefined`, the `defaultValue` is returned in its place. + * This method is like `_.reduce` except that it iterates over elements of + * `collection` from right to left. * * @static * @memberOf _ - * @since 3.7.0 - * @category Object - * @param {Object} object The object to query. - * @param {Array|string} path The path of the property to get. - * @param {*} [defaultValue] The value returned for `undefined` resolved values. - * @returns {*} Returns the resolved value. + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @param {*} [accumulator] The initial value. + * @returns {*} Returns the accumulated value. + * @see _.reduce * @example * - * var object = { 'a': [{ 'b': { 'c': 3 } }] }; - * - * _.get(object, 'a[0].b.c'); - * // => 3 - * - * _.get(object, ['a', '0', 'b', 'c']); - * // => 3 + * var array = [[0, 1], [2, 3], [4, 5]]; * - * _.get(object, 'a.b.c', 'default'); - * // => 'default' + * _.reduceRight(array, function(flattened, other) { + * return flattened.concat(other); + * }, []); + * // => [4, 5, 2, 3, 0, 1] */ - function get(object, path, defaultValue) { - var result = object == null ? undefined : baseGet(object, path); - return result === undefined ? defaultValue : result; + function reduceRight(collection, iteratee, accumulator) { + var func = isArray(collection) ? arrayReduceRight : baseReduce, + initAccum = arguments.length < 3; + + return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEachRight); } /** - * Checks if `path` is a direct property of `object`. + * The opposite of `_.filter`; this method returns the elements of `collection` + * that `predicate` does **not** return truthy for. * * @static - * @since 0.1.0 * @memberOf _ - * @category Object - * @param {Object} object The object to query. - * @param {Array|string} path The path to check. - * @returns {boolean} Returns `true` if `path` exists, else `false`. + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {Array} Returns the new filtered array. + * @see _.filter * @example * - * var object = { 'a': { 'b': 2 } }; - * var other = _.create({ 'a': _.create({ 'b': 2 }) }); + * var users = [ + * { 'user': 'barney', 'age': 36, 'active': false }, + * { 'user': 'fred', 'age': 40, 'active': true } + * ]; * - * _.has(object, 'a'); - * // => true + * _.reject(users, function(o) { return !o.active; }); + * // => objects for ['fred'] * - * _.has(object, 'a.b'); - * // => true + * // The `_.matches` iteratee shorthand. + * _.reject(users, { 'age': 40, 'active': true }); + * // => objects for ['barney'] * - * _.has(object, ['a', 'b']); - * // => true + * // The `_.matchesProperty` iteratee shorthand. + * _.reject(users, ['active', false]); + * // => objects for ['fred'] * - * _.has(other, 'a'); - * // => false + * // The `_.property` iteratee shorthand. + * _.reject(users, 'active'); + * // => objects for ['barney'] */ - function has(object, path) { - return object != null && hasPath(object, path, baseHas); + function reject(collection, predicate) { + var func = isArray(collection) ? arrayFilter : baseFilter; + return func(collection, negate(getIteratee(predicate, 3))); } /** - * Checks if `path` is a direct or inherited property of `object`. + * Gets a random element from `collection`. * * @static * @memberOf _ - * @since 4.0.0 - * @category Object - * @param {Object} object The object to query. - * @param {Array|string} path The path to check. - * @returns {boolean} Returns `true` if `path` exists, else `false`. + * @since 2.0.0 + * @category Collection + * @param {Array|Object} collection The collection to sample. + * @returns {*} Returns the random element. * @example * - * var object = _.create({ 'a': _.create({ 'b': 2 }) }); - * - * _.hasIn(object, 'a'); - * // => true - * - * _.hasIn(object, 'a.b'); - * // => true - * - * _.hasIn(object, ['a', 'b']); - * // => true - * - * _.hasIn(object, 'b'); - * // => false + * _.sample([1, 2, 3, 4]); + * // => 2 */ - function hasIn(object, path) { - return object != null && hasPath(object, path, baseHasIn); + function sample(collection) { + var func = isArray(collection) ? arraySample : baseSample; + return func(collection); } /** - * Creates an object composed of the inverted keys and values of `object`. - * If `object` contains duplicate values, subsequent values overwrite - * property assignments of previous values. + * Gets `n` random elements at unique keys from `collection` up to the + * size of `collection`. * * @static * @memberOf _ - * @since 0.7.0 - * @category Object - * @param {Object} object The object to invert. - * @returns {Object} Returns the new inverted object. + * @since 4.0.0 + * @category Collection + * @param {Array|Object} collection The collection to sample. + * @param {number} [n=1] The number of elements to sample. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Array} Returns the random elements. * @example * - * var object = { 'a': 1, 'b': 2, 'c': 1 }; + * _.sampleSize([1, 2, 3], 2); + * // => [3, 1] * - * _.invert(object); - * // => { '1': 'c', '2': 'b' } + * _.sampleSize([1, 2, 3], 4); + * // => [2, 3, 1] */ - var invert = createInverter(function(result, value, key) { - result[value] = key; - }, constant(identity)); + function sampleSize(collection, n, guard) { + if ((guard ? isIterateeCall(collection, n, guard) : n === undefined)) { + n = 1; + } else { + n = toInteger(n); + } + var func = isArray(collection) ? arraySampleSize : baseSampleSize; + return func(collection, n); + } /** - * This method is like `_.invert` except that the inverted object is generated - * from the results of running each element of `object` thru `iteratee`. The - * corresponding inverted value of each inverted key is an array of keys - * responsible for generating the inverted value. The iteratee is invoked - * with one argument: (value). + * Creates an array of shuffled values, using a version of the + * [Fisher-Yates shuffle](https://en.wikipedia.org/wiki/Fisher-Yates_shuffle). * * @static * @memberOf _ - * @since 4.1.0 - * @category Object - * @param {Object} object The object to invert. - * @param {Function} [iteratee=_.identity] The iteratee invoked per element. - * @returns {Object} Returns the new inverted object. + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to shuffle. + * @returns {Array} Returns the new shuffled array. * @example * - * var object = { 'a': 1, 'b': 2, 'c': 1 }; - * - * _.invertBy(object); - * // => { '1': ['a', 'c'], '2': ['b'] } - * - * _.invertBy(object, function(value) { - * return 'group' + value; - * }); - * // => { 'group1': ['a', 'c'], 'group2': ['b'] } + * _.shuffle([1, 2, 3, 4]); + * // => [4, 1, 3, 2] */ - var invertBy = createInverter(function(result, value, key) { - if (hasOwnProperty.call(result, value)) { - result[value].push(key); - } else { - result[value] = [key]; - } - }, getIteratee); + function shuffle(collection) { + var func = isArray(collection) ? arrayShuffle : baseShuffle; + return func(collection); + } /** - * Invokes the method at `path` of `object`. + * Gets the size of `collection` by returning its length for array-like + * values or the number of own enumerable string keyed properties for objects. * * @static * @memberOf _ - * @since 4.0.0 - * @category Object - * @param {Object} object The object to query. - * @param {Array|string} path The path of the method to invoke. - * @param {...*} [args] The arguments to invoke the method with. - * @returns {*} Returns the result of the invoked method. + * @since 0.1.0 + * @category Collection + * @param {Array|Object|string} collection The collection to inspect. + * @returns {number} Returns the collection size. * @example * - * var object = { 'a': [{ 'b': { 'c': [1, 2, 3, 4] } }] }; + * _.size([1, 2, 3]); + * // => 3 * - * _.invoke(object, 'a[0].b.c.slice', 1, 3); - * // => [2, 3] + * _.size({ 'a': 1, 'b': 2 }); + * // => 2 + * + * _.size('pebbles'); + * // => 7 */ - var invoke = baseRest(baseInvoke); + function size(collection) { + if (collection == null) { + return 0; + } + if (isArrayLike(collection)) { + return isString(collection) ? stringSize(collection) : collection.length; + } + var tag = getTag(collection); + if (tag == mapTag || tag == setTag) { + return collection.size; + } + return baseKeys(collection).length; + } /** - * Creates an array of the own enumerable property names of `object`. - * - * **Note:** Non-object values are coerced to objects. See the - * [ES spec](http://ecma-international.org/ecma-262/7.0/#sec-object.keys) - * for more details. + * Checks if `predicate` returns truthy for **any** element of `collection`. + * Iteration is stopped once `predicate` returns truthy. The predicate is + * invoked with three arguments: (value, index|key, collection). * * @static - * @since 0.1.0 * @memberOf _ - * @category Object - * @param {Object} object The object to query. - * @returns {Array} Returns the array of property names. + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {boolean} Returns `true` if any element passes the predicate check, + * else `false`. * @example * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } + * _.some([null, 0, 'yes', false], Boolean); + * // => true * - * Foo.prototype.c = 3; + * var users = [ + * { 'user': 'barney', 'active': true }, + * { 'user': 'fred', 'active': false } + * ]; * - * _.keys(new Foo); - * // => ['a', 'b'] (iteration order is not guaranteed) + * // The `_.matches` iteratee shorthand. + * _.some(users, { 'user': 'barney', 'active': false }); + * // => false * - * _.keys('hi'); - * // => ['0', '1'] + * // The `_.matchesProperty` iteratee shorthand. + * _.some(users, ['active', false]); + * // => true + * + * // The `_.property` iteratee shorthand. + * _.some(users, 'active'); + * // => true */ - function keys(object) { - return isArrayLike(object) ? arrayLikeKeys(object) : baseKeys(object); + function some(collection, predicate, guard) { + var func = isArray(collection) ? arraySome : baseSome; + if (guard && isIterateeCall(collection, predicate, guard)) { + predicate = undefined; + } + return func(collection, getIteratee(predicate, 3)); } /** - * Creates an array of the own and inherited enumerable property names of `object`. - * - * **Note:** Non-object values are coerced to objects. + * Creates an array of elements, sorted in ascending order by the results of + * running each element in a collection thru each iteratee. This method + * performs a stable sort, that is, it preserves the original sort order of + * equal elements. The iteratees are invoked with one argument: (value). * * @static * @memberOf _ - * @since 3.0.0 - * @category Object - * @param {Object} object The object to query. - * @returns {Array} Returns the array of property names. + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {...(Function|Function[])} [iteratees=[_.identity]] + * The iteratees to sort by. + * @returns {Array} Returns the new sorted array. * @example * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } + * var users = [ + * { 'user': 'fred', 'age': 48 }, + * { 'user': 'barney', 'age': 36 }, + * { 'user': 'fred', 'age': 40 }, + * { 'user': 'barney', 'age': 34 } + * ]; * - * Foo.prototype.c = 3; + * _.sortBy(users, [function(o) { return o.user; }]); + * // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 40]] * - * _.keysIn(new Foo); - * // => ['a', 'b', 'c'] (iteration order is not guaranteed) + * _.sortBy(users, ['user', 'age']); + * // => objects for [['barney', 34], ['barney', 36], ['fred', 40], ['fred', 48]] */ - function keysIn(object) { - return isArrayLike(object) ? arrayLikeKeys(object, true) : baseKeysIn(object); - } + var sortBy = baseRest(function(collection, iteratees) { + if (collection == null) { + return []; + } + var length = iteratees.length; + if (length > 1 && isIterateeCall(collection, iteratees[0], iteratees[1])) { + iteratees = []; + } else if (length > 2 && isIterateeCall(iteratees[0], iteratees[1], iteratees[2])) { + iteratees = [iteratees[0]]; + } + return baseOrderBy(collection, baseFlatten(iteratees, 1), []); + }); + + /*------------------------------------------------------------------------*/ /** - * The opposite of `_.mapValues`; this method creates an object with the - * same values as `object` and keys generated by running each own enumerable - * string keyed property of `object` thru `iteratee`. The iteratee is invoked - * with three arguments: (value, key, object). + * Gets the timestamp of the number of milliseconds that have elapsed since + * the Unix epoch (1 January 1970 00:00:00 UTC). * * @static * @memberOf _ - * @since 3.8.0 - * @category Object - * @param {Object} object The object to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Object} Returns the new mapped object. - * @see _.mapValues + * @since 2.4.0 + * @category Date + * @returns {number} Returns the timestamp. * @example * - * _.mapKeys({ 'a': 1, 'b': 2 }, function(value, key) { - * return key + value; - * }); - * // => { 'a1': 1, 'b2': 2 } + * _.defer(function(stamp) { + * console.log(_.now() - stamp); + * }, _.now()); + * // => Logs the number of milliseconds it took for the deferred invocation. */ - function mapKeys(object, iteratee) { - var result = {}; - iteratee = getIteratee(iteratee, 3); + var now = ctxNow || function() { + return root.Date.now(); + }; - baseForOwn(object, function(value, key, object) { - baseAssignValue(result, iteratee(value, key, object), value); - }); - return result; - } + /*------------------------------------------------------------------------*/ /** - * Creates an object with the same keys as `object` and values generated - * by running each own enumerable string keyed property of `object` thru - * `iteratee`. The iteratee is invoked with three arguments: - * (value, key, object). + * The opposite of `_.before`; this method creates a function that invokes + * `func` once it's called `n` or more times. * * @static * @memberOf _ - * @since 2.4.0 - * @category Object - * @param {Object} object The object to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Object} Returns the new mapped object. - * @see _.mapKeys + * @since 0.1.0 + * @category Function + * @param {number} n The number of calls before `func` is invoked. + * @param {Function} func The function to restrict. + * @returns {Function} Returns the new restricted function. * @example * - * var users = { - * 'fred': { 'user': 'fred', 'age': 40 }, - * 'pebbles': { 'user': 'pebbles', 'age': 1 } - * }; + * var saves = ['profile', 'settings']; * - * _.mapValues(users, function(o) { return o.age; }); - * // => { 'fred': 40, 'pebbles': 1 } (iteration order is not guaranteed) + * var done = _.after(saves.length, function() { + * console.log('done saving!'); + * }); * - * // The `_.property` iteratee shorthand. - * _.mapValues(users, 'age'); - * // => { 'fred': 40, 'pebbles': 1 } (iteration order is not guaranteed) + * _.forEach(saves, function(type) { + * asyncSave({ 'type': type, 'complete': done }); + * }); + * // => Logs 'done saving!' after the two async saves have completed. */ - function mapValues(object, iteratee) { - var result = {}; - iteratee = getIteratee(iteratee, 3); - - baseForOwn(object, function(value, key, object) { - baseAssignValue(result, key, iteratee(value, key, object)); - }); - return result; + function after(n, func) { + if (typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + n = toInteger(n); + return function() { + if (--n < 1) { + return func.apply(this, arguments); + } + }; } /** - * This method is like `_.assign` except that it recursively merges own and - * inherited enumerable string keyed properties of source objects into the - * destination object. Source properties that resolve to `undefined` are - * skipped if a destination value exists. Array and plain object properties - * are merged recursively. Other objects and value types are overridden by - * assignment. Source objects are applied from left to right. Subsequent - * sources overwrite property assignments of previous sources. - * - * **Note:** This method mutates `object`. + * Creates a function that invokes `func`, with up to `n` arguments, + * ignoring any additional arguments. * * @static * @memberOf _ - * @since 0.5.0 - * @category Object - * @param {Object} object The destination object. - * @param {...Object} [sources] The source objects. - * @returns {Object} Returns `object`. + * @since 3.0.0 + * @category Function + * @param {Function} func The function to cap arguments for. + * @param {number} [n=func.length] The arity cap. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Function} Returns the new capped function. * @example * - * var object = { - * 'a': [{ 'b': 2 }, { 'd': 4 }] - * }; + * _.map(['6', '8', '10'], _.ary(parseInt, 1)); + * // => [6, 8, 10] + */ + function ary(func, n, guard) { + n = guard ? undefined : n; + n = (func && n == null) ? func.length : n; + return createWrap(func, WRAP_ARY_FLAG, undefined, undefined, undefined, undefined, n); + } + + /** + * Creates a function that invokes `func`, with the `this` binding and arguments + * of the created function, while it's called less than `n` times. Subsequent + * calls to the created function return the result of the last `func` invocation. * - * var other = { - * 'a': [{ 'c': 3 }, { 'e': 5 }] - * }; + * @static + * @memberOf _ + * @since 3.0.0 + * @category Function + * @param {number} n The number of calls at which `func` is no longer invoked. + * @param {Function} func The function to restrict. + * @returns {Function} Returns the new restricted function. + * @example * - * _.merge(object, other); - * // => { 'a': [{ 'b': 2, 'c': 3 }, { 'd': 4, 'e': 5 }] } + * jQuery(element).on('click', _.before(5, addContactToList)); + * // => Allows adding up to 4 contacts to the list. */ - var merge = createAssigner(function(object, source, srcIndex) { - baseMerge(object, source, srcIndex); - }); + function before(n, func) { + var result; + if (typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + n = toInteger(n); + return function() { + if (--n > 0) { + result = func.apply(this, arguments); + } + if (n <= 1) { + func = undefined; + } + return result; + }; + } /** - * This method is like `_.merge` except that it accepts `customizer` which - * is invoked to produce the merged values of the destination and source - * properties. If `customizer` returns `undefined`, merging is handled by the - * method instead. The `customizer` is invoked with six arguments: - * (objValue, srcValue, key, object, source, stack). + * Creates a function that invokes `func` with the `this` binding of `thisArg` + * and `partials` prepended to the arguments it receives. * - * **Note:** This method mutates `object`. + * The `_.bind.placeholder` value, which defaults to `_` in monolithic builds, + * may be used as a placeholder for partially applied arguments. + * + * **Note:** Unlike native `Function#bind`, this method doesn't set the "length" + * property of bound functions. * * @static * @memberOf _ - * @since 4.0.0 - * @category Object - * @param {Object} object The destination object. - * @param {...Object} sources The source objects. - * @param {Function} customizer The function to customize assigned values. - * @returns {Object} Returns `object`. + * @since 0.1.0 + * @category Function + * @param {Function} func The function to bind. + * @param {*} thisArg The `this` binding of `func`. + * @param {...*} [partials] The arguments to be partially applied. + * @returns {Function} Returns the new bound function. * @example * - * function customizer(objValue, srcValue) { - * if (_.isArray(objValue)) { - * return objValue.concat(srcValue); - * } + * function greet(greeting, punctuation) { + * return greeting + ' ' + this.user + punctuation; * } * - * var object = { 'a': [1], 'b': [2] }; - * var other = { 'a': [3], 'b': [4] }; + * var object = { 'user': 'fred' }; * - * _.mergeWith(object, other, customizer); - * // => { 'a': [1, 3], 'b': [2, 4] } + * var bound = _.bind(greet, object, 'hi'); + * bound('!'); + * // => 'hi fred!' + * + * // Bound with placeholders. + * var bound = _.bind(greet, object, _, '!'); + * bound('hi'); + * // => 'hi fred!' */ - var mergeWith = createAssigner(function(object, source, srcIndex, customizer) { - baseMerge(object, source, srcIndex, customizer); + var bind = baseRest(function(func, thisArg, partials) { + var bitmask = WRAP_BIND_FLAG; + if (partials.length) { + var holders = replaceHolders(partials, getHolder(bind)); + bitmask |= WRAP_PARTIAL_FLAG; + } + return createWrap(func, bitmask, thisArg, partials, holders); }); /** - * The opposite of `_.pick`; this method creates an object composed of the - * own and inherited enumerable property paths of `object` that are not omitted. + * Creates a function that invokes the method at `object[key]` with `partials` + * prepended to the arguments it receives. * - * **Note:** This method is considerably slower than `_.pick`. + * This method differs from `_.bind` by allowing bound functions to reference + * methods that may be redefined or don't yet exist. See + * [Peter Michaux's article](http://peter.michaux.ca/articles/lazy-function-definition-pattern) + * for more details. + * + * The `_.bindKey.placeholder` value, which defaults to `_` in monolithic + * builds, may be used as a placeholder for partially applied arguments. * * @static - * @since 0.1.0 * @memberOf _ - * @category Object - * @param {Object} object The source object. - * @param {...(string|string[])} [paths] The property paths to omit. - * @returns {Object} Returns the new object. - * @example + * @since 0.10.0 + * @category Function + * @param {Object} object The object to invoke the method on. + * @param {string} key The key of the method. + * @param {...*} [partials] The arguments to be partially applied. + * @returns {Function} Returns the new bound function. + * @example * - * var object = { 'a': 1, 'b': '2', 'c': 3 }; + * var object = { + * 'user': 'fred', + * 'greet': function(greeting, punctuation) { + * return greeting + ' ' + this.user + punctuation; + * } + * }; * - * _.omit(object, ['a', 'c']); - * // => { 'b': '2' } + * var bound = _.bindKey(object, 'greet', 'hi'); + * bound('!'); + * // => 'hi fred!' + * + * object.greet = function(greeting, punctuation) { + * return greeting + 'ya ' + this.user + punctuation; + * }; + * + * bound('!'); + * // => 'hiya fred!' + * + * // Bound with placeholders. + * var bound = _.bindKey(object, 'greet', _, '!'); + * bound('hi'); + * // => 'hiya fred!' */ - var omit = flatRest(function(object, paths) { - var result = {}; - if (object == null) { - return result; - } - var isDeep = false; - paths = arrayMap(paths, function(path) { - path = castPath(path, object); - isDeep || (isDeep = path.length > 1); - return path; - }); - copyObject(object, getAllKeysIn(object), result); - if (isDeep) { - result = baseClone(result, CLONE_DEEP_FLAG | CLONE_FLAT_FLAG | CLONE_SYMBOLS_FLAG, customOmitClone); - } - var length = paths.length; - while (length--) { - baseUnset(result, paths[length]); + var bindKey = baseRest(function(object, key, partials) { + var bitmask = WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG; + if (partials.length) { + var holders = replaceHolders(partials, getHolder(bindKey)); + bitmask |= WRAP_PARTIAL_FLAG; } - return result; + return createWrap(key, bitmask, object, partials, holders); }); /** - * The opposite of `_.pickBy`; this method creates an object composed of - * the own and inherited enumerable string keyed properties of `object` that - * `predicate` doesn't return truthy for. The predicate is invoked with two - * arguments: (value, key). + * Creates a function that accepts arguments of `func` and either invokes + * `func` returning its result, if at least `arity` number of arguments have + * been provided, or returns a function that accepts the remaining `func` + * arguments, and so on. The arity of `func` may be specified if `func.length` + * is not sufficient. + * + * The `_.curry.placeholder` value, which defaults to `_` in monolithic builds, + * may be used as a placeholder for provided arguments. + * + * **Note:** This method doesn't set the "length" property of curried functions. * * @static * @memberOf _ - * @since 4.0.0 - * @category Object - * @param {Object} object The source object. - * @param {Function} [predicate=_.identity] The function invoked per property. - * @returns {Object} Returns the new object. + * @since 2.0.0 + * @category Function + * @param {Function} func The function to curry. + * @param {number} [arity=func.length] The arity of `func`. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Function} Returns the new curried function. * @example * - * var object = { 'a': 1, 'b': '2', 'c': 3 }; + * var abc = function(a, b, c) { + * return [a, b, c]; + * }; * - * _.omitBy(object, _.isNumber); - * // => { 'b': '2' } + * var curried = _.curry(abc); + * + * curried(1)(2)(3); + * // => [1, 2, 3] + * + * curried(1, 2)(3); + * // => [1, 2, 3] + * + * curried(1, 2, 3); + * // => [1, 2, 3] + * + * // Curried with placeholders. + * curried(1)(_, 3)(2); + * // => [1, 2, 3] */ - function omitBy(object, predicate) { - return pickBy(object, negate(getIteratee(predicate))); + function curry(func, arity, guard) { + arity = guard ? undefined : arity; + var result = createWrap(func, WRAP_CURRY_FLAG, undefined, undefined, undefined, undefined, undefined, arity); + result.placeholder = curry.placeholder; + return result; } /** - * Creates an object composed of the picked `object` properties. + * This method is like `_.curry` except that arguments are applied to `func` + * in the manner of `_.partialRight` instead of `_.partial`. + * + * The `_.curryRight.placeholder` value, which defaults to `_` in monolithic + * builds, may be used as a placeholder for provided arguments. + * + * **Note:** This method doesn't set the "length" property of curried functions. * * @static - * @since 0.1.0 * @memberOf _ - * @category Object - * @param {Object} object The source object. - * @param {...(string|string[])} [paths] The property paths to pick. - * @returns {Object} Returns the new object. + * @since 3.0.0 + * @category Function + * @param {Function} func The function to curry. + * @param {number} [arity=func.length] The arity of `func`. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Function} Returns the new curried function. * @example * - * var object = { 'a': 1, 'b': '2', 'c': 3 }; + * var abc = function(a, b, c) { + * return [a, b, c]; + * }; * - * _.pick(object, ['a', 'c']); - * // => { 'a': 1, 'c': 3 } - */ - var pick = flatRest(function(object, paths) { - return object == null ? {} : basePick(object, paths); - }); - - /** - * Creates an object composed of the `object` properties `predicate` returns - * truthy for. The predicate is invoked with two arguments: (value, key). + * var curried = _.curryRight(abc); * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Object - * @param {Object} object The source object. - * @param {Function} [predicate=_.identity] The function invoked per property. - * @returns {Object} Returns the new object. - * @example + * curried(3)(2)(1); + * // => [1, 2, 3] * - * var object = { 'a': 1, 'b': '2', 'c': 3 }; + * curried(2, 3)(1); + * // => [1, 2, 3] * - * _.pickBy(object, _.isNumber); - * // => { 'a': 1, 'c': 3 } + * curried(1, 2, 3); + * // => [1, 2, 3] + * + * // Curried with placeholders. + * curried(3)(1, _)(2); + * // => [1, 2, 3] */ - function pickBy(object, predicate) { - if (object == null) { - return {}; - } - var props = arrayMap(getAllKeysIn(object), function(prop) { - return [prop]; - }); - predicate = getIteratee(predicate); - return basePickBy(object, props, function(value, path) { - return predicate(value, path[0]); - }); + function curryRight(func, arity, guard) { + arity = guard ? undefined : arity; + var result = createWrap(func, WRAP_CURRY_RIGHT_FLAG, undefined, undefined, undefined, undefined, undefined, arity); + result.placeholder = curryRight.placeholder; + return result; } /** - * This method is like `_.get` except that if the resolved value is a - * function it's invoked with the `this` binding of its parent object and - * its result is returned. + * Creates a debounced function that delays invoking `func` until after `wait` + * milliseconds have elapsed since the last time the debounced function was + * invoked. The debounced function comes with a `cancel` method to cancel + * delayed `func` invocations and a `flush` method to immediately invoke them. + * Provide `options` to indicate whether `func` should be invoked on the + * leading and/or trailing edge of the `wait` timeout. The `func` is invoked + * with the last arguments provided to the debounced function. Subsequent + * calls to the debounced function return the result of the last `func` + * invocation. + * + * **Note:** If `leading` and `trailing` options are `true`, `func` is + * invoked on the trailing edge of the timeout only if the debounced function + * is invoked more than once during the `wait` timeout. + * + * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred + * until to the next tick, similar to `setTimeout` with a timeout of `0`. + * + * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/) + * for details over the differences between `_.debounce` and `_.throttle`. * * @static - * @since 0.1.0 * @memberOf _ - * @category Object - * @param {Object} object The object to query. - * @param {Array|string} path The path of the property to resolve. - * @param {*} [defaultValue] The value returned for `undefined` resolved values. - * @returns {*} Returns the resolved value. + * @since 0.1.0 + * @category Function + * @param {Function} func The function to debounce. + * @param {number} [wait=0] The number of milliseconds to delay. + * @param {Object} [options={}] The options object. + * @param {boolean} [options.leading=false] + * Specify invoking on the leading edge of the timeout. + * @param {number} [options.maxWait] + * The maximum time `func` is allowed to be delayed before it's invoked. + * @param {boolean} [options.trailing=true] + * Specify invoking on the trailing edge of the timeout. + * @returns {Function} Returns the new debounced function. * @example * - * var object = { 'a': [{ 'b': { 'c1': 3, 'c2': _.constant(4) } }] }; - * - * _.result(object, 'a[0].b.c1'); - * // => 3 + * // Avoid costly calculations while the window size is in flux. + * jQuery(window).on('resize', _.debounce(calculateLayout, 150)); * - * _.result(object, 'a[0].b.c2'); - * // => 4 + * // Invoke `sendMail` when clicked, debouncing subsequent calls. + * jQuery(element).on('click', _.debounce(sendMail, 300, { + * 'leading': true, + * 'trailing': false + * })); * - * _.result(object, 'a[0].b.c3', 'default'); - * // => 'default' + * // Ensure `batchLog` is invoked once after 1 second of debounced calls. + * var debounced = _.debounce(batchLog, 250, { 'maxWait': 1000 }); + * var source = new EventSource('/stream'); + * jQuery(source).on('message', debounced); * - * _.result(object, 'a[0].b.c3', _.constant('default')); - * // => 'default' + * // Cancel the trailing debounced invocation. + * jQuery(window).on('popstate', debounced.cancel); */ - function result(object, path, defaultValue) { - path = castPath(path, object); + function debounce(func, wait, options) { + var lastArgs, + lastThis, + maxWait, + result, + timerId, + lastCallTime, + lastInvokeTime = 0, + leading = false, + maxing = false, + trailing = true; - var index = -1, - length = path.length; + if (typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + wait = toNumber(wait) || 0; + if (isObject(options)) { + leading = !!options.leading; + maxing = 'maxWait' in options; + maxWait = maxing ? nativeMax(toNumber(options.maxWait) || 0, wait) : maxWait; + trailing = 'trailing' in options ? !!options.trailing : trailing; + } - // Ensure the loop is entered when path is empty. - if (!length) { - length = 1; - object = undefined; + function invokeFunc(time) { + var args = lastArgs, + thisArg = lastThis; + + lastArgs = lastThis = undefined; + lastInvokeTime = time; + result = func.apply(thisArg, args); + return result; } - while (++index < length) { - var value = object == null ? undefined : object[toKey(path[index])]; - if (value === undefined) { - index = length; - value = defaultValue; + + function leadingEdge(time) { + // Reset any `maxWait` timer. + lastInvokeTime = time; + // Start the timer for the trailing edge. + timerId = setTimeout(timerExpired, wait); + // Invoke the leading edge. + return leading ? invokeFunc(time) : result; + } + + function remainingWait(time) { + var timeSinceLastCall = time - lastCallTime, + timeSinceLastInvoke = time - lastInvokeTime, + result = wait - timeSinceLastCall; + + return maxing ? nativeMin(result, maxWait - timeSinceLastInvoke) : result; + } + + function shouldInvoke(time) { + var timeSinceLastCall = time - lastCallTime, + timeSinceLastInvoke = time - lastInvokeTime; + + // Either this is the first call, activity has stopped and we're at the + // trailing edge, the system time has gone backwards and we're treating + // it as the trailing edge, or we've hit the `maxWait` limit. + return (lastCallTime === undefined || (timeSinceLastCall >= wait) || + (timeSinceLastCall < 0) || (maxing && timeSinceLastInvoke >= maxWait)); + } + + function timerExpired() { + var time = now(); + if (shouldInvoke(time)) { + return trailingEdge(time); } - object = isFunction(value) ? value.call(object) : value; + // Restart the timer. + timerId = setTimeout(timerExpired, remainingWait(time)); } - return object; + + function trailingEdge(time) { + timerId = undefined; + + // Only invoke if we have `lastArgs` which means `func` has been + // debounced at least once. + if (trailing && lastArgs) { + return invokeFunc(time); + } + lastArgs = lastThis = undefined; + return result; + } + + function cancel() { + if (timerId !== undefined) { + clearTimeout(timerId); + } + lastInvokeTime = 0; + lastArgs = lastCallTime = lastThis = timerId = undefined; + } + + function flush() { + return timerId === undefined ? result : trailingEdge(now()); + } + + function debounced() { + var time = now(), + isInvoking = shouldInvoke(time); + + lastArgs = arguments; + lastThis = this; + lastCallTime = time; + + if (isInvoking) { + if (timerId === undefined) { + return leadingEdge(lastCallTime); + } + if (maxing) { + // Handle invocations in a tight loop. + timerId = setTimeout(timerExpired, wait); + return invokeFunc(lastCallTime); + } + } + if (timerId === undefined) { + timerId = setTimeout(timerExpired, wait); + } + return result; + } + debounced.cancel = cancel; + debounced.flush = flush; + return debounced; } /** - * Sets the value at `path` of `object`. If a portion of `path` doesn't exist, - * it's created. Arrays are created for missing index properties while objects - * are created for all other missing properties. Use `_.setWith` to customize - * `path` creation. - * - * **Note:** This method mutates `object`. + * Defers invoking the `func` until the current call stack has cleared. Any + * additional arguments are provided to `func` when it's invoked. * * @static * @memberOf _ - * @since 3.7.0 - * @category Object - * @param {Object} object The object to modify. - * @param {Array|string} path The path of the property to set. - * @param {*} value The value to set. - * @returns {Object} Returns `object`. + * @since 0.1.0 + * @category Function + * @param {Function} func The function to defer. + * @param {...*} [args] The arguments to invoke `func` with. + * @returns {number} Returns the timer id. * @example * - * var object = { 'a': [{ 'b': { 'c': 3 } }] }; - * - * _.set(object, 'a[0].b.c', 4); - * console.log(object.a[0].b.c); - * // => 4 - * - * _.set(object, ['x', '0', 'y', 'z'], 5); - * console.log(object.x[0].y.z); - * // => 5 + * _.defer(function(text) { + * console.log(text); + * }, 'deferred'); + * // => Logs 'deferred' after one millisecond. */ - function set(object, path, value) { - return object == null ? object : baseSet(object, path, value); - } + var defer = baseRest(function(func, args) { + return baseDelay(func, 1, args); + }); /** - * This method is like `_.set` except that it accepts `customizer` which is - * invoked to produce the objects of `path`. If `customizer` returns `undefined` - * path creation is handled by the method instead. The `customizer` is invoked - * with three arguments: (nsValue, key, nsObject). - * - * **Note:** This method mutates `object`. + * Invokes `func` after `wait` milliseconds. Any additional arguments are + * provided to `func` when it's invoked. * * @static * @memberOf _ - * @since 4.0.0 - * @category Object - * @param {Object} object The object to modify. - * @param {Array|string} path The path of the property to set. - * @param {*} value The value to set. - * @param {Function} [customizer] The function to customize assigned values. - * @returns {Object} Returns `object`. + * @since 0.1.0 + * @category Function + * @param {Function} func The function to delay. + * @param {number} wait The number of milliseconds to delay invocation. + * @param {...*} [args] The arguments to invoke `func` with. + * @returns {number} Returns the timer id. * @example * - * var object = {}; - * - * _.setWith(object, '[0][1]', 'a', Object); - * // => { '0': { '1': 'a' } } + * _.delay(function(text) { + * console.log(text); + * }, 1000, 'later'); + * // => Logs 'later' after one second. */ - function setWith(object, path, value, customizer) { - customizer = typeof customizer == 'function' ? customizer : undefined; - return object == null ? object : baseSet(object, path, value, customizer); - } + var delay = baseRest(function(func, wait, args) { + return baseDelay(func, toNumber(wait) || 0, args); + }); /** - * Creates an array of own enumerable string keyed-value pairs for `object` - * which can be consumed by `_.fromPairs`. If `object` is a map or set, its - * entries are returned. + * Creates a function that invokes `func` with arguments reversed. * * @static * @memberOf _ * @since 4.0.0 - * @alias entries - * @category Object - * @param {Object} object The object to query. - * @returns {Array} Returns the key-value pairs. + * @category Function + * @param {Function} func The function to flip arguments for. + * @returns {Function} Returns the new flipped function. * @example * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } - * - * Foo.prototype.c = 3; + * var flipped = _.flip(function() { + * return _.toArray(arguments); + * }); * - * _.toPairs(new Foo); - * // => [['a', 1], ['b', 2]] (iteration order is not guaranteed) + * flipped('a', 'b', 'c', 'd'); + * // => ['d', 'c', 'b', 'a'] */ - var toPairs = createToPairs(keys); + function flip(func) { + return createWrap(func, WRAP_FLIP_FLAG); + } /** - * Creates an array of own and inherited enumerable string keyed-value pairs - * for `object` which can be consumed by `_.fromPairs`. If `object` is a map - * or set, its entries are returned. + * Creates a function that memoizes the result of `func`. If `resolver` is + * provided, it determines the cache key for storing the result based on the + * arguments provided to the memoized function. By default, the first argument + * provided to the memoized function is used as the map cache key. The `func` + * is invoked with the `this` binding of the memoized function. + * + * **Note:** The cache is exposed as the `cache` property on the memoized + * function. Its creation may be customized by replacing the `_.memoize.Cache` + * constructor with one whose instances implement the + * [`Map`](http://ecma-international.org/ecma-262/7.0/#sec-properties-of-the-map-prototype-object) + * method interface of `clear`, `delete`, `get`, `has`, and `set`. * * @static * @memberOf _ - * @since 4.0.0 - * @alias entriesIn - * @category Object - * @param {Object} object The object to query. - * @returns {Array} Returns the key-value pairs. + * @since 0.1.0 + * @category Function + * @param {Function} func The function to have its output memoized. + * @param {Function} [resolver] The function to resolve the cache key. + * @returns {Function} Returns the new memoized function. * @example * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } + * var object = { 'a': 1, 'b': 2 }; + * var other = { 'c': 3, 'd': 4 }; * - * Foo.prototype.c = 3; + * var values = _.memoize(_.values); + * values(object); + * // => [1, 2] * - * _.toPairsIn(new Foo); - * // => [['a', 1], ['b', 2], ['c', 3]] (iteration order is not guaranteed) - */ - var toPairsIn = createToPairs(keysIn); + * values(other); + * // => [3, 4] + * + * object.a = 2; + * values(object); + * // => [1, 2] + * + * // Modify the result cache. + * values.cache.set(object, ['a', 'b']); + * values(object); + * // => ['a', 'b'] + * + * // Replace `_.memoize.Cache`. + * _.memoize.Cache = WeakMap; + */ + function memoize(func, resolver) { + if (typeof func != 'function' || (resolver != null && typeof resolver != 'function')) { + throw new TypeError(FUNC_ERROR_TEXT); + } + var memoized = function() { + var args = arguments, + key = resolver ? resolver.apply(this, args) : args[0], + cache = memoized.cache; + + if (cache.has(key)) { + return cache.get(key); + } + var result = func.apply(this, args); + memoized.cache = cache.set(key, result) || cache; + return result; + }; + memoized.cache = new (memoize.Cache || MapCache); + return memoized; + } + + // Expose `MapCache`. + memoize.Cache = MapCache; /** - * An alternative to `_.reduce`; this method transforms `object` to a new - * `accumulator` object which is the result of running each of its own - * enumerable string keyed properties thru `iteratee`, with each invocation - * potentially mutating the `accumulator` object. If `accumulator` is not - * provided, a new object with the same `[[Prototype]]` will be used. The - * iteratee is invoked with four arguments: (accumulator, value, key, object). - * Iteratee functions may exit iteration early by explicitly returning `false`. + * Creates a function that negates the result of the predicate `func`. The + * `func` predicate is invoked with the `this` binding and arguments of the + * created function. * * @static * @memberOf _ - * @since 1.3.0 - * @category Object - * @param {Object} object The object to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @param {*} [accumulator] The custom accumulator value. - * @returns {*} Returns the accumulated value. + * @since 3.0.0 + * @category Function + * @param {Function} predicate The predicate to negate. + * @returns {Function} Returns the new negated function. * @example * - * _.transform([2, 3, 4], function(result, n) { - * result.push(n *= n); + * function isEven(n) { * return n % 2 == 0; - * }, []); - * // => [4, 9] + * } * - * _.transform({ 'a': 1, 'b': 2, 'c': 1 }, function(result, value, key) { - * (result[value] || (result[value] = [])).push(key); - * }, {}); - * // => { '1': ['a', 'c'], '2': ['b'] } + * _.filter([1, 2, 3, 4, 5, 6], _.negate(isEven)); + * // => [1, 3, 5] */ - function transform(object, iteratee, accumulator) { - var isArr = isArray(object), - isArrLike = isArr || isBuffer(object) || isTypedArray(object); - - iteratee = getIteratee(iteratee, 4); - if (accumulator == null) { - var Ctor = object && object.constructor; - if (isArrLike) { - accumulator = isArr ? new Ctor : []; - } - else if (isObject(object)) { - accumulator = isFunction(Ctor) ? baseCreate(getPrototype(object)) : {}; - } - else { - accumulator = {}; - } + function negate(predicate) { + if (typeof predicate != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); } - (isArrLike ? arrayEach : baseForOwn)(object, function(value, index, object) { - return iteratee(accumulator, value, index, object); - }); - return accumulator; + return function() { + var args = arguments; + switch (args.length) { + case 0: return !predicate.call(this); + case 1: return !predicate.call(this, args[0]); + case 2: return !predicate.call(this, args[0], args[1]); + case 3: return !predicate.call(this, args[0], args[1], args[2]); + } + return !predicate.apply(this, args); + }; } /** - * Removes the property at `path` of `object`. - * - * **Note:** This method mutates `object`. + * Creates a function that is restricted to invoking `func` once. Repeat calls + * to the function return the value of the first invocation. The `func` is + * invoked with the `this` binding and arguments of the created function. * * @static * @memberOf _ - * @since 4.0.0 - * @category Object - * @param {Object} object The object to modify. - * @param {Array|string} path The path of the property to unset. - * @returns {boolean} Returns `true` if the property is deleted, else `false`. + * @since 0.1.0 + * @category Function + * @param {Function} func The function to restrict. + * @returns {Function} Returns the new restricted function. * @example * - * var object = { 'a': [{ 'b': { 'c': 7 } }] }; - * _.unset(object, 'a[0].b.c'); - * // => true - * - * console.log(object); - * // => { 'a': [{ 'b': {} }] }; - * - * _.unset(object, ['a', '0', 'b', 'c']); - * // => true - * - * console.log(object); - * // => { 'a': [{ 'b': {} }] }; + * var initialize = _.once(createApplication); + * initialize(); + * initialize(); + * // => `createApplication` is invoked once */ - function unset(object, path) { - return object == null ? true : baseUnset(object, path); + function once(func) { + return before(2, func); } /** - * This method is like `_.set` except that accepts `updater` to produce the - * value to set. Use `_.updateWith` to customize `path` creation. The `updater` - * is invoked with one argument: (value). - * - * **Note:** This method mutates `object`. + * Creates a function that invokes `func` with its arguments transformed. * * @static + * @since 4.0.0 * @memberOf _ - * @since 4.6.0 - * @category Object - * @param {Object} object The object to modify. - * @param {Array|string} path The path of the property to set. - * @param {Function} updater The function to produce the updated value. - * @returns {Object} Returns `object`. + * @category Function + * @param {Function} func The function to wrap. + * @param {...(Function|Function[])} [transforms=[_.identity]] + * The argument transforms. + * @returns {Function} Returns the new function. * @example * - * var object = { 'a': [{ 'b': { 'c': 3 } }] }; + * function doubled(n) { + * return n * 2; + * } * - * _.update(object, 'a[0].b.c', function(n) { return n * n; }); - * console.log(object.a[0].b.c); - * // => 9 + * function square(n) { + * return n * n; + * } * - * _.update(object, 'x[0].y.z', function(n) { return n ? n + 1 : 0; }); - * console.log(object.x[0].y.z); - * // => 0 + * var func = _.overArgs(function(x, y) { + * return [x, y]; + * }, [square, doubled]); + * + * func(9, 3); + * // => [81, 6] + * + * func(10, 5); + * // => [100, 10] */ - function update(object, path, updater) { - return object == null ? object : baseUpdate(object, path, castFunction(updater)); - } + var overArgs = castRest(function(func, transforms) { + transforms = (transforms.length == 1 && isArray(transforms[0])) + ? arrayMap(transforms[0], baseUnary(getIteratee())) + : arrayMap(baseFlatten(transforms, 1), baseUnary(getIteratee())); + + var funcsLength = transforms.length; + return baseRest(function(args) { + var index = -1, + length = nativeMin(args.length, funcsLength); + + while (++index < length) { + args[index] = transforms[index].call(this, args[index]); + } + return apply(func, this, args); + }); + }); /** - * This method is like `_.update` except that it accepts `customizer` which is - * invoked to produce the objects of `path`. If `customizer` returns `undefined` - * path creation is handled by the method instead. The `customizer` is invoked - * with three arguments: (nsValue, key, nsObject). + * Creates a function that invokes `func` with `partials` prepended to the + * arguments it receives. This method is like `_.bind` except it does **not** + * alter the `this` binding. * - * **Note:** This method mutates `object`. + * The `_.partial.placeholder` value, which defaults to `_` in monolithic + * builds, may be used as a placeholder for partially applied arguments. + * + * **Note:** This method doesn't set the "length" property of partially + * applied functions. * * @static * @memberOf _ - * @since 4.6.0 - * @category Object - * @param {Object} object The object to modify. - * @param {Array|string} path The path of the property to set. - * @param {Function} updater The function to produce the updated value. - * @param {Function} [customizer] The function to customize assigned values. - * @returns {Object} Returns `object`. + * @since 0.2.0 + * @category Function + * @param {Function} func The function to partially apply arguments to. + * @param {...*} [partials] The arguments to be partially applied. + * @returns {Function} Returns the new partially applied function. * @example * - * var object = {}; + * function greet(greeting, name) { + * return greeting + ' ' + name; + * } * - * _.updateWith(object, '[0][1]', _.constant('a'), Object); - * // => { '0': { '1': 'a' } } + * var sayHelloTo = _.partial(greet, 'hello'); + * sayHelloTo('fred'); + * // => 'hello fred' + * + * // Partially applied with placeholders. + * var greetFred = _.partial(greet, _, 'fred'); + * greetFred('hi'); + * // => 'hi fred' */ - function updateWith(object, path, updater, customizer) { - customizer = typeof customizer == 'function' ? customizer : undefined; - return object == null ? object : baseUpdate(object, path, castFunction(updater), customizer); - } + var partial = baseRest(function(func, partials) { + var holders = replaceHolders(partials, getHolder(partial)); + return createWrap(func, WRAP_PARTIAL_FLAG, undefined, partials, holders); + }); /** - * Creates an array of the own enumerable string keyed property values of `object`. + * This method is like `_.partial` except that partially applied arguments + * are appended to the arguments it receives. * - * **Note:** Non-object values are coerced to objects. + * The `_.partialRight.placeholder` value, which defaults to `_` in monolithic + * builds, may be used as a placeholder for partially applied arguments. + * + * **Note:** This method doesn't set the "length" property of partially + * applied functions. * * @static - * @since 0.1.0 * @memberOf _ - * @category Object - * @param {Object} object The object to query. - * @returns {Array} Returns the array of property values. + * @since 1.0.0 + * @category Function + * @param {Function} func The function to partially apply arguments to. + * @param {...*} [partials] The arguments to be partially applied. + * @returns {Function} Returns the new partially applied function. * @example * - * function Foo() { - * this.a = 1; - * this.b = 2; + * function greet(greeting, name) { + * return greeting + ' ' + name; * } * - * Foo.prototype.c = 3; - * - * _.values(new Foo); - * // => [1, 2] (iteration order is not guaranteed) + * var greetFred = _.partialRight(greet, 'fred'); + * greetFred('hi'); + * // => 'hi fred' * - * _.values('hi'); - * // => ['h', 'i'] + * // Partially applied with placeholders. + * var sayHelloTo = _.partialRight(greet, 'hello', _); + * sayHelloTo('fred'); + * // => 'hello fred' */ - function values(object) { - return object == null ? [] : baseValues(object, keys(object)); - } + var partialRight = baseRest(function(func, partials) { + var holders = replaceHolders(partials, getHolder(partialRight)); + return createWrap(func, WRAP_PARTIAL_RIGHT_FLAG, undefined, partials, holders); + }); /** - * Creates an array of the own and inherited enumerable string keyed property - * values of `object`. - * - * **Note:** Non-object values are coerced to objects. + * Creates a function that invokes `func` with arguments arranged according + * to the specified `indexes` where the argument value at the first index is + * provided as the first argument, the argument value at the second index is + * provided as the second argument, and so on. * * @static * @memberOf _ * @since 3.0.0 - * @category Object - * @param {Object} object The object to query. - * @returns {Array} Returns the array of property values. + * @category Function + * @param {Function} func The function to rearrange arguments for. + * @param {...(number|number[])} indexes The arranged argument indexes. + * @returns {Function} Returns the new function. * @example * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } - * - * Foo.prototype.c = 3; + * var rearged = _.rearg(function(a, b, c) { + * return [a, b, c]; + * }, [2, 0, 1]); * - * _.valuesIn(new Foo); - * // => [1, 2, 3] (iteration order is not guaranteed) + * rearged('b', 'c', 'a') + * // => ['a', 'b', 'c'] */ - function valuesIn(object) { - return object == null ? [] : baseValues(object, keysIn(object)); - } - - /*------------------------------------------------------------------------*/ + var rearg = flatRest(function(func, indexes) { + return createWrap(func, WRAP_REARG_FLAG, undefined, undefined, undefined, indexes); + }); /** - * Clamps `number` within the inclusive `lower` and `upper` bounds. + * Creates a function that invokes `func` with the `this` binding of the + * created function and arguments from `start` and beyond provided as + * an array. + * + * **Note:** This method is based on the + * [rest parameter](https://mdn.io/rest_parameters). * * @static * @memberOf _ * @since 4.0.0 - * @category Number - * @param {number} number The number to clamp. - * @param {number} [lower] The lower bound. - * @param {number} upper The upper bound. - * @returns {number} Returns the clamped number. + * @category Function + * @param {Function} func The function to apply a rest parameter to. + * @param {number} [start=func.length-1] The start position of the rest parameter. + * @returns {Function} Returns the new function. * @example * - * _.clamp(-10, -5, 5); - * // => -5 + * var say = _.rest(function(what, names) { + * return what + ' ' + _.initial(names).join(', ') + + * (_.size(names) > 1 ? ', & ' : '') + _.last(names); + * }); * - * _.clamp(10, -5, 5); - * // => 5 + * say('hello', 'fred', 'barney', 'pebbles'); + * // => 'hello fred, barney, & pebbles' */ - function clamp(number, lower, upper) { - if (upper === undefined) { - upper = lower; - lower = undefined; - } - if (upper !== undefined) { - upper = toNumber(upper); - upper = upper === upper ? upper : 0; - } - if (lower !== undefined) { - lower = toNumber(lower); - lower = lower === lower ? lower : 0; + function rest(func, start) { + if (typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); } - return baseClamp(toNumber(number), lower, upper); + start = start === undefined ? start : toInteger(start); + return baseRest(func, start); } /** - * Checks if `n` is between `start` and up to, but not including, `end`. If - * `end` is not specified, it's set to `start` with `start` then set to `0`. - * If `start` is greater than `end` the params are swapped to support - * negative ranges. + * Creates a function that invokes `func` with the `this` binding of the + * create function and an array of arguments much like + * [`Function#apply`](http://www.ecma-international.org/ecma-262/7.0/#sec-function.prototype.apply). + * + * **Note:** This method is based on the + * [spread operator](https://mdn.io/spread_operator). * * @static * @memberOf _ - * @since 3.3.0 - * @category Number - * @param {number} number The number to check. - * @param {number} [start=0] The start of the range. - * @param {number} end The end of the range. - * @returns {boolean} Returns `true` if `number` is in the range, else `false`. - * @see _.range, _.rangeRight + * @since 3.2.0 + * @category Function + * @param {Function} func The function to spread arguments over. + * @param {number} [start=0] The start position of the spread. + * @returns {Function} Returns the new function. * @example * - * _.inRange(3, 2, 4); - * // => true - * - * _.inRange(4, 8); - * // => true - * - * _.inRange(4, 2); - * // => false - * - * _.inRange(2, 2); - * // => false + * var say = _.spread(function(who, what) { + * return who + ' says ' + what; + * }); * - * _.inRange(1.2, 2); - * // => true + * say(['fred', 'hello']); + * // => 'fred says hello' * - * _.inRange(5.2, 4); - * // => false + * var numbers = Promise.all([ + * Promise.resolve(40), + * Promise.resolve(36) + * ]); * - * _.inRange(-3, -2, -6); - * // => true + * numbers.then(_.spread(function(x, y) { + * return x + y; + * })); + * // => a Promise of 76 */ - function inRange(number, start, end) { - start = toFinite(start); - if (end === undefined) { - end = start; - start = 0; - } else { - end = toFinite(end); + function spread(func, start) { + if (typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); } - number = toNumber(number); - return baseInRange(number, start, end); + start = start == null ? 0 : nativeMax(toInteger(start), 0); + return baseRest(function(args) { + var array = args[start], + otherArgs = castSlice(args, 0, start); + + if (array) { + arrayPush(otherArgs, array); + } + return apply(func, this, otherArgs); + }); } /** - * Produces a random number between the inclusive `lower` and `upper` bounds. - * If only one argument is provided a number between `0` and the given number - * is returned. If `floating` is `true`, or either `lower` or `upper` are - * floats, a floating-point number is returned instead of an integer. + * Creates a throttled function that only invokes `func` at most once per + * every `wait` milliseconds. The throttled function comes with a `cancel` + * method to cancel delayed `func` invocations and a `flush` method to + * immediately invoke them. Provide `options` to indicate whether `func` + * should be invoked on the leading and/or trailing edge of the `wait` + * timeout. The `func` is invoked with the last arguments provided to the + * throttled function. Subsequent calls to the throttled function return the + * result of the last `func` invocation. * - * **Note:** JavaScript follows the IEEE-754 standard for resolving - * floating-point values which can produce unexpected results. + * **Note:** If `leading` and `trailing` options are `true`, `func` is + * invoked on the trailing edge of the timeout only if the throttled function + * is invoked more than once during the `wait` timeout. + * + * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred + * until to the next tick, similar to `setTimeout` with a timeout of `0`. + * + * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/) + * for details over the differences between `_.throttle` and `_.debounce`. * * @static * @memberOf _ - * @since 0.7.0 - * @category Number - * @param {number} [lower=0] The lower bound. - * @param {number} [upper=1] The upper bound. - * @param {boolean} [floating] Specify returning a floating-point number. - * @returns {number} Returns the random number. + * @since 0.1.0 + * @category Function + * @param {Function} func The function to throttle. + * @param {number} [wait=0] The number of milliseconds to throttle invocations to. + * @param {Object} [options={}] The options object. + * @param {boolean} [options.leading=true] + * Specify invoking on the leading edge of the timeout. + * @param {boolean} [options.trailing=true] + * Specify invoking on the trailing edge of the timeout. + * @returns {Function} Returns the new throttled function. * @example * - * _.random(0, 5); - * // => an integer between 0 and 5 - * - * _.random(5); - * // => also an integer between 0 and 5 + * // Avoid excessively updating the position while scrolling. + * jQuery(window).on('scroll', _.throttle(updatePosition, 100)); * - * _.random(5, true); - * // => a floating-point number between 0 and 5 + * // Invoke `renewToken` when the click event is fired, but not more than once every 5 minutes. + * var throttled = _.throttle(renewToken, 300000, { 'trailing': false }); + * jQuery(element).on('click', throttled); * - * _.random(1.2, 5.2); - * // => a floating-point number between 1.2 and 5.2 + * // Cancel the trailing throttled invocation. + * jQuery(window).on('popstate', throttled.cancel); */ - function random(lower, upper, floating) { - if (floating && typeof floating != 'boolean' && isIterateeCall(lower, upper, floating)) { - upper = floating = undefined; + function throttle(func, wait, options) { + var leading = true, + trailing = true; + + if (typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); } - if (floating === undefined) { - if (typeof upper == 'boolean') { - floating = upper; - upper = undefined; - } - else if (typeof lower == 'boolean') { - floating = lower; - lower = undefined; - } - } - if (lower === undefined && upper === undefined) { - lower = 0; - upper = 1; - } - else { - lower = toFinite(lower); - if (upper === undefined) { - upper = lower; - lower = 0; - } else { - upper = toFinite(upper); - } - } - if (lower > upper) { - var temp = lower; - lower = upper; - upper = temp; - } - if (floating || lower % 1 || upper % 1) { - var rand = nativeRandom(); - return nativeMin(lower + (rand * (upper - lower + freeParseFloat('1e-' + ((rand + '').length - 1)))), upper); + if (isObject(options)) { + leading = 'leading' in options ? !!options.leading : leading; + trailing = 'trailing' in options ? !!options.trailing : trailing; } - return baseRandom(lower, upper); + return debounce(func, wait, { + 'leading': leading, + 'maxWait': wait, + 'trailing': trailing + }); } - /*------------------------------------------------------------------------*/ - /** - * Converts `string` to [camel case](https://en.wikipedia.org/wiki/CamelCase). + * Creates a function that accepts up to one argument, ignoring any + * additional arguments. * * @static * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to convert. - * @returns {string} Returns the camel cased string. + * @since 4.0.0 + * @category Function + * @param {Function} func The function to cap arguments for. + * @returns {Function} Returns the new capped function. * @example * - * _.camelCase('Foo Bar'); - * // => 'fooBar' - * - * _.camelCase('--foo-bar--'); - * // => 'fooBar' - * - * _.camelCase('__FOO_BAR__'); - * // => 'fooBar' + * _.map(['6', '8', '10'], _.unary(parseInt)); + * // => [6, 8, 10] */ - var camelCase = createCompounder(function(result, word, index) { - word = word.toLowerCase(); - return result + (index ? capitalize(word) : word); - }); + function unary(func) { + return ary(func, 1); + } /** - * Converts the first character of `string` to upper case and the remaining - * to lower case. + * Creates a function that provides `value` to `wrapper` as its first + * argument. Any additional arguments provided to the function are appended + * to those provided to the `wrapper`. The wrapper is invoked with the `this` + * binding of the created function. * * @static * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to capitalize. - * @returns {string} Returns the capitalized string. + * @since 0.1.0 + * @category Function + * @param {*} value The value to wrap. + * @param {Function} [wrapper=identity] The wrapper function. + * @returns {Function} Returns the new function. * @example * - * _.capitalize('FRED'); - * // => 'Fred' + * var p = _.wrap(_.escape, function(func, text) { + * return '

' + func(text) + '

'; + * }); + * + * p('fred, barney, & pebbles'); + * // => '

fred, barney, & pebbles

' */ - function capitalize(string) { - return upperFirst(toString(string).toLowerCase()); + function wrap(value, wrapper) { + return partial(castFunction(wrapper), value); } + /*------------------------------------------------------------------------*/ + /** - * Deburrs `string` by converting - * [Latin-1 Supplement](https://en.wikipedia.org/wiki/Latin-1_Supplement_(Unicode_block)#Character_table) - * and [Latin Extended-A](https://en.wikipedia.org/wiki/Latin_Extended-A) - * letters to basic Latin letters and removing - * [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks). + * Casts `value` as an array if it's not one. * * @static * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to deburr. - * @returns {string} Returns the deburred string. + * @since 4.4.0 + * @category Lang + * @param {*} value The value to inspect. + * @returns {Array} Returns the cast array. * @example * - * _.deburr('déjà vu'); - * // => 'deja vu' + * _.castArray(1); + * // => [1] + * + * _.castArray({ 'a': 1 }); + * // => [{ 'a': 1 }] + * + * _.castArray('abc'); + * // => ['abc'] + * + * _.castArray(null); + * // => [null] + * + * _.castArray(undefined); + * // => [undefined] + * + * _.castArray(); + * // => [] + * + * var array = [1, 2, 3]; + * console.log(_.castArray(array) === array); + * // => true */ - function deburr(string) { - string = toString(string); - return string && string.replace(reLatin, deburrLetter).replace(reComboMark, ''); + function castArray() { + if (!arguments.length) { + return []; + } + var value = arguments[0]; + return isArray(value) ? value : [value]; } /** - * Checks if `string` ends with the given target string. + * Creates a shallow clone of `value`. + * + * **Note:** This method is loosely based on the + * [structured clone algorithm](https://mdn.io/Structured_clone_algorithm) + * and supports cloning arrays, array buffers, booleans, date objects, maps, + * numbers, `Object` objects, regexes, sets, strings, symbols, and typed + * arrays. The own enumerable properties of `arguments` objects are cloned + * as plain objects. An empty object is returned for uncloneable values such + * as error objects, functions, DOM nodes, and WeakMaps. * * @static * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to inspect. - * @param {string} [target] The string to search for. - * @param {number} [position=string.length] The position to search up to. - * @returns {boolean} Returns `true` if `string` ends with `target`, - * else `false`. + * @since 0.1.0 + * @category Lang + * @param {*} value The value to clone. + * @returns {*} Returns the cloned value. + * @see _.cloneDeep * @example * - * _.endsWith('abc', 'c'); - * // => true - * - * _.endsWith('abc', 'b'); - * // => false + * var objects = [{ 'a': 1 }, { 'b': 2 }]; * - * _.endsWith('abc', 'b', 2); + * var shallow = _.clone(objects); + * console.log(shallow[0] === objects[0]); * // => true */ - function endsWith(string, target, position) { - string = toString(string); - target = baseToString(target); - - var length = string.length; - position = position === undefined - ? length - : baseClamp(toInteger(position), 0, length); - - var end = position; - position -= target.length; - return position >= 0 && string.slice(position, end) == target; + function clone(value) { + return baseClone(value, CLONE_SYMBOLS_FLAG); } /** - * Converts the characters "&", "<", ">", '"', and "'" in `string` to their - * corresponding HTML entities. - * - * **Note:** No other characters are escaped. To escape additional - * characters use a third-party library like [_he_](https://mths.be/he). - * - * Though the ">" character is escaped for symmetry, characters like - * ">" and "/" don't need escaping in HTML and have no special meaning - * unless they're part of a tag or unquoted attribute value. See - * [Mathias Bynens's article](https://mathiasbynens.be/notes/ambiguous-ampersands) - * (under "semi-related fun fact") for more details. - * - * When working with HTML you should always - * [quote attribute values](http://wonko.com/post/html-escaping) to reduce - * XSS vectors. + * This method is like `_.clone` except that it accepts `customizer` which + * is invoked to produce the cloned value. If `customizer` returns `undefined`, + * cloning is handled by the method instead. The `customizer` is invoked with + * up to four arguments; (value [, index|key, object, stack]). * * @static - * @since 0.1.0 * @memberOf _ - * @category String - * @param {string} [string=''] The string to escape. - * @returns {string} Returns the escaped string. + * @since 4.0.0 + * @category Lang + * @param {*} value The value to clone. + * @param {Function} [customizer] The function to customize cloning. + * @returns {*} Returns the cloned value. + * @see _.cloneDeepWith * @example * - * _.escape('fred, barney, & pebbles'); - * // => 'fred, barney, & pebbles' + * function customizer(value) { + * if (_.isElement(value)) { + * return value.cloneNode(false); + * } + * } + * + * var el = _.cloneWith(document.body, customizer); + * + * console.log(el === document.body); + * // => false + * console.log(el.nodeName); + * // => 'BODY' + * console.log(el.childNodes.length); + * // => 0 */ - function escape(string) { - string = toString(string); - return (string && reHasUnescapedHtml.test(string)) - ? string.replace(reUnescapedHtml, escapeHtmlChar) - : string; + function cloneWith(value, customizer) { + customizer = typeof customizer == 'function' ? customizer : undefined; + return baseClone(value, CLONE_SYMBOLS_FLAG, customizer); } /** - * Escapes the `RegExp` special characters "^", "$", "\", ".", "*", "+", - * "?", "(", ")", "[", "]", "{", "}", and "|" in `string`. + * This method is like `_.clone` except that it recursively clones `value`. * * @static * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to escape. - * @returns {string} Returns the escaped string. + * @since 1.0.0 + * @category Lang + * @param {*} value The value to recursively clone. + * @returns {*} Returns the deep cloned value. + * @see _.clone * @example * - * _.escapeRegExp('[lodash](https://lodash.com/)'); - * // => '\[lodash\]\(https://lodash\.com/\)' + * var objects = [{ 'a': 1 }, { 'b': 2 }]; + * + * var deep = _.cloneDeep(objects); + * console.log(deep[0] === objects[0]); + * // => false */ - function escapeRegExp(string) { - string = toString(string); - return (string && reHasRegExpChar.test(string)) - ? string.replace(reRegExpChar, '\\$&') - : string; + function cloneDeep(value) { + return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG); } /** - * Converts `string` to - * [kebab case](https://en.wikipedia.org/wiki/Letter_case#Special_case_styles). + * This method is like `_.cloneWith` except that it recursively clones `value`. * * @static * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to convert. - * @returns {string} Returns the kebab cased string. + * @since 4.0.0 + * @category Lang + * @param {*} value The value to recursively clone. + * @param {Function} [customizer] The function to customize cloning. + * @returns {*} Returns the deep cloned value. + * @see _.cloneWith * @example * - * _.kebabCase('Foo Bar'); - * // => 'foo-bar' + * function customizer(value) { + * if (_.isElement(value)) { + * return value.cloneNode(true); + * } + * } * - * _.kebabCase('fooBar'); - * // => 'foo-bar' + * var el = _.cloneDeepWith(document.body, customizer); * - * _.kebabCase('__FOO_BAR__'); - * // => 'foo-bar' + * console.log(el === document.body); + * // => false + * console.log(el.nodeName); + * // => 'BODY' + * console.log(el.childNodes.length); + * // => 20 */ - var kebabCase = createCompounder(function(result, word, index) { - return result + (index ? '-' : '') + word.toLowerCase(); - }); + function cloneDeepWith(value, customizer) { + customizer = typeof customizer == 'function' ? customizer : undefined; + return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG, customizer); + } /** - * Converts `string`, as space separated words, to lower case. + * Checks if `object` conforms to `source` by invoking the predicate + * properties of `source` with the corresponding property values of `object`. + * + * **Note:** This method is equivalent to `_.conforms` when `source` is + * partially applied. * * @static * @memberOf _ - * @since 4.0.0 - * @category String - * @param {string} [string=''] The string to convert. - * @returns {string} Returns the lower cased string. + * @since 4.14.0 + * @category Lang + * @param {Object} object The object to inspect. + * @param {Object} source The object of property predicates to conform to. + * @returns {boolean} Returns `true` if `object` conforms, else `false`. * @example * - * _.lowerCase('--Foo-Bar--'); - * // => 'foo bar' + * var object = { 'a': 1, 'b': 2 }; * - * _.lowerCase('fooBar'); - * // => 'foo bar' + * _.conformsTo(object, { 'b': function(n) { return n > 1; } }); + * // => true * - * _.lowerCase('__FOO_BAR__'); - * // => 'foo bar' + * _.conformsTo(object, { 'b': function(n) { return n > 2; } }); + * // => false */ - var lowerCase = createCompounder(function(result, word, index) { - return result + (index ? ' ' : '') + word.toLowerCase(); - }); + function conformsTo(object, source) { + return source == null || baseConformsTo(object, source, keys(source)); + } /** - * Converts the first character of `string` to lower case. + * Performs a + * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * comparison between two values to determine if they are equivalent. * * @static * @memberOf _ * @since 4.0.0 - * @category String - * @param {string} [string=''] The string to convert. - * @returns {string} Returns the converted string. + * @category Lang + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @returns {boolean} Returns `true` if the values are equivalent, else `false`. * @example * - * _.lowerFirst('Fred'); - * // => 'fred' + * var object = { 'a': 1 }; + * var other = { 'a': 1 }; * - * _.lowerFirst('FRED'); - * // => 'fRED' + * _.eq(object, object); + * // => true + * + * _.eq(object, other); + * // => false + * + * _.eq('a', 'a'); + * // => true + * + * _.eq('a', Object('a')); + * // => false + * + * _.eq(NaN, NaN); + * // => true */ - var lowerFirst = createCaseFirst('toLowerCase'); + function eq(value, other) { + return value === other || (value !== value && other !== other); + } /** - * Pads `string` on the left and right sides if it's shorter than `length`. - * Padding characters are truncated if they can't be evenly divided by `length`. + * Checks if `value` is greater than `other`. * * @static * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to pad. - * @param {number} [length=0] The padding length. - * @param {string} [chars=' '] The string used as padding. - * @returns {string} Returns the padded string. + * @since 3.9.0 + * @category Lang + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @returns {boolean} Returns `true` if `value` is greater than `other`, + * else `false`. + * @see _.lt * @example * - * _.pad('abc', 8); - * // => ' abc ' + * _.gt(3, 1); + * // => true * - * _.pad('abc', 8, '_-'); - * // => '_-abc_-_' + * _.gt(3, 3); + * // => false * - * _.pad('abc', 3); - * // => 'abc' + * _.gt(1, 3); + * // => false */ - function pad(string, length, chars) { - string = toString(string); - length = toInteger(length); - - var strLength = length ? stringSize(string) : 0; - if (!length || strLength >= length) { - return string; - } - var mid = (length - strLength) / 2; - return ( - createPadding(nativeFloor(mid), chars) + - string + - createPadding(nativeCeil(mid), chars) - ); - } + var gt = createRelationalOperation(baseGt); /** - * Pads `string` on the right side if it's shorter than `length`. Padding - * characters are truncated if they exceed `length`. + * Checks if `value` is greater than or equal to `other`. * * @static * @memberOf _ - * @since 4.0.0 - * @category String - * @param {string} [string=''] The string to pad. - * @param {number} [length=0] The padding length. - * @param {string} [chars=' '] The string used as padding. - * @returns {string} Returns the padded string. + * @since 3.9.0 + * @category Lang + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @returns {boolean} Returns `true` if `value` is greater than or equal to + * `other`, else `false`. + * @see _.lte * @example * - * _.padEnd('abc', 6); - * // => 'abc ' + * _.gte(3, 1); + * // => true * - * _.padEnd('abc', 6, '_-'); - * // => 'abc_-_' + * _.gte(3, 3); + * // => true * - * _.padEnd('abc', 3); - * // => 'abc' + * _.gte(1, 3); + * // => false */ - function padEnd(string, length, chars) { - string = toString(string); - length = toInteger(length); - - var strLength = length ? stringSize(string) : 0; - return (length && strLength < length) - ? (string + createPadding(length - strLength, chars)) - : string; - } + var gte = createRelationalOperation(function(value, other) { + return value >= other; + }); /** - * Pads `string` on the left side if it's shorter than `length`. Padding - * characters are truncated if they exceed `length`. + * Checks if `value` is likely an `arguments` object. * * @static * @memberOf _ - * @since 4.0.0 - * @category String - * @param {string} [string=''] The string to pad. - * @param {number} [length=0] The padding length. - * @param {string} [chars=' '] The string used as padding. - * @returns {string} Returns the padded string. + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an `arguments` object, + * else `false`. * @example * - * _.padStart('abc', 6); - * // => ' abc' - * - * _.padStart('abc', 6, '_-'); - * // => '_-_abc' + * _.isArguments(function() { return arguments; }()); + * // => true * - * _.padStart('abc', 3); - * // => 'abc' + * _.isArguments([1, 2, 3]); + * // => false */ - function padStart(string, length, chars) { - string = toString(string); - length = toInteger(length); - - var strLength = length ? stringSize(string) : 0; - return (length && strLength < length) - ? (createPadding(length - strLength, chars) + string) - : string; - } + var isArguments = baseIsArguments(function() { return arguments; }()) ? baseIsArguments : function(value) { + return isObjectLike(value) && hasOwnProperty.call(value, 'callee') && + !propertyIsEnumerable.call(value, 'callee'); + }; /** - * Converts `string` to an integer of the specified radix. If `radix` is - * `undefined` or `0`, a `radix` of `10` is used unless `value` is a - * hexadecimal, in which case a `radix` of `16` is used. - * - * **Note:** This method aligns with the - * [ES5 implementation](https://es5.github.io/#x15.1.2.2) of `parseInt`. + * Checks if `value` is classified as an `Array` object. * * @static * @memberOf _ - * @since 1.1.0 - * @category String - * @param {string} string The string to convert. - * @param {number} [radix=10] The radix to interpret `value` by. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {number} Returns the converted integer. + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an array, else `false`. * @example * - * _.parseInt('08'); - * // => 8 + * _.isArray([1, 2, 3]); + * // => true * - * _.map(['6', '08', '10'], _.parseInt); - * // => [6, 8, 10] - */ - function parseInt(string, radix, guard) { - if (guard || radix == null) { - radix = 0; - } else if (radix) { - radix = +radix; - } - return nativeParseInt(toString(string).replace(reTrimStart, ''), radix || 0); - } + * _.isArray(document.body.children); + * // => false + * + * _.isArray('abc'); + * // => false + * + * _.isArray(_.noop); + * // => false + */ + var isArray = Array.isArray; /** - * Repeats the given string `n` times. + * Checks if `value` is classified as an `ArrayBuffer` object. * * @static * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to repeat. - * @param {number} [n=1] The number of times to repeat the string. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {string} Returns the repeated string. + * @since 4.3.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an array buffer, else `false`. * @example * - * _.repeat('*', 3); - * // => '***' - * - * _.repeat('abc', 2); - * // => 'abcabc' + * _.isArrayBuffer(new ArrayBuffer(2)); + * // => true * - * _.repeat('abc', 0); - * // => '' + * _.isArrayBuffer(new Array(2)); + * // => false */ - function repeat(string, n, guard) { - if ((guard ? isIterateeCall(string, n, guard) : n === undefined)) { - n = 1; - } else { - n = toInteger(n); - } - return baseRepeat(toString(string), n); - } + var isArrayBuffer = nodeIsArrayBuffer ? baseUnary(nodeIsArrayBuffer) : baseIsArrayBuffer; /** - * Replaces matches for `pattern` in `string` with `replacement`. - * - * **Note:** This method is based on - * [`String#replace`](https://mdn.io/String/replace). + * Checks if `value` is array-like. A value is considered array-like if it's + * not a function and has a `value.length` that's an integer greater than or + * equal to `0` and less than or equal to `Number.MAX_SAFE_INTEGER`. * * @static * @memberOf _ * @since 4.0.0 - * @category String - * @param {string} [string=''] The string to modify. - * @param {RegExp|string} pattern The pattern to replace. - * @param {Function|string} replacement The match replacement. - * @returns {string} Returns the modified string. + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is array-like, else `false`. * @example * - * _.replace('Hi Fred', 'Fred', 'Barney'); - * // => 'Hi Barney' + * _.isArrayLike([1, 2, 3]); + * // => true + * + * _.isArrayLike(document.body.children); + * // => true + * + * _.isArrayLike('abc'); + * // => true + * + * _.isArrayLike(_.noop); + * // => false */ - function replace() { - var args = arguments, - string = toString(args[0]); - - return args.length < 3 ? string : string.replace(args[1], args[2]); + function isArrayLike(value) { + return value != null && isLength(value.length) && !isFunction(value); } /** - * Converts `string` to - * [snake case](https://en.wikipedia.org/wiki/Snake_case). + * This method is like `_.isArrayLike` except that it also checks if `value` + * is an object. * * @static * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to convert. - * @returns {string} Returns the snake cased string. + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an array-like object, + * else `false`. * @example * - * _.snakeCase('Foo Bar'); - * // => 'foo_bar' + * _.isArrayLikeObject([1, 2, 3]); + * // => true * - * _.snakeCase('fooBar'); - * // => 'foo_bar' + * _.isArrayLikeObject(document.body.children); + * // => true * - * _.snakeCase('--FOO-BAR--'); - * // => 'foo_bar' + * _.isArrayLikeObject('abc'); + * // => false + * + * _.isArrayLikeObject(_.noop); + * // => false */ - var snakeCase = createCompounder(function(result, word, index) { - return result + (index ? '_' : '') + word.toLowerCase(); - }); + function isArrayLikeObject(value) { + return isObjectLike(value) && isArrayLike(value); + } /** - * Splits `string` by `separator`. - * - * **Note:** This method is based on - * [`String#split`](https://mdn.io/String/split). + * Checks if `value` is classified as a boolean primitive or object. * * @static * @memberOf _ - * @since 4.0.0 - * @category String - * @param {string} [string=''] The string to split. - * @param {RegExp|string} separator The separator pattern to split by. - * @param {number} [limit] The length to truncate results to. - * @returns {Array} Returns the string segments. + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a boolean, else `false`. * @example * - * _.split('a-b-c', '-', 2); - * // => ['a', 'b'] + * _.isBoolean(false); + * // => true + * + * _.isBoolean(null); + * // => false */ - function split(string, separator, limit) { - if (limit && typeof limit != 'number' && isIterateeCall(string, separator, limit)) { - separator = limit = undefined; - } - limit = limit === undefined ? MAX_ARRAY_LENGTH : limit >>> 0; - if (!limit) { - return []; - } - string = toString(string); - if (string && ( - typeof separator == 'string' || - (separator != null && !isRegExp(separator)) - )) { - separator = baseToString(separator); - if (!separator && hasUnicode(string)) { - return castSlice(stringToArray(string), 0, limit); - } - } - return string.split(separator, limit); + function isBoolean(value) { + return value === true || value === false || + (isObjectLike(value) && baseGetTag(value) == boolTag); } /** - * Converts `string` to - * [start case](https://en.wikipedia.org/wiki/Letter_case#Stylistic_or_specialised_usage). + * Checks if `value` is a buffer. * * @static * @memberOf _ - * @since 3.1.0 - * @category String - * @param {string} [string=''] The string to convert. - * @returns {string} Returns the start cased string. + * @since 4.3.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a buffer, else `false`. * @example * - * _.startCase('--foo-bar--'); - * // => 'Foo Bar' - * - * _.startCase('fooBar'); - * // => 'Foo Bar' + * _.isBuffer(new Buffer(2)); + * // => true * - * _.startCase('__FOO_BAR__'); - * // => 'FOO BAR' + * _.isBuffer(new Uint8Array(2)); + * // => false */ - var startCase = createCompounder(function(result, word, index) { - return result + (index ? ' ' : '') + upperFirst(word); - }); + var isBuffer = nativeIsBuffer || stubFalse; /** - * Checks if `string` starts with the given target string. + * Checks if `value` is classified as a `Date` object. * * @static * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to inspect. - * @param {string} [target] The string to search for. - * @param {number} [position=0] The position to search from. - * @returns {boolean} Returns `true` if `string` starts with `target`, - * else `false`. + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a date object, else `false`. * @example * - * _.startsWith('abc', 'a'); + * _.isDate(new Date); * // => true * - * _.startsWith('abc', 'b'); + * _.isDate('Mon April 23 2012'); * // => false - * - * _.startsWith('abc', 'b', 1); - * // => true */ - function startsWith(string, target, position) { - string = toString(string); - position = position == null - ? 0 - : baseClamp(toInteger(position), 0, string.length); - - target = baseToString(target); - return string.slice(position, position + target.length) == target; - } + var isDate = nodeIsDate ? baseUnary(nodeIsDate) : baseIsDate; /** - * Creates a compiled template function that can interpolate data properties - * in "interpolate" delimiters, HTML-escape interpolated data properties in - * "escape" delimiters, and execute JavaScript in "evaluate" delimiters. Data - * properties may be accessed as free variables in the template. If a setting - * object is given, it takes precedence over `_.templateSettings` values. - * - * **Note:** In the development build `_.template` utilizes - * [sourceURLs](http://www.html5rocks.com/en/tutorials/developertools/sourcemaps/#toc-sourceurl) - * for easier debugging. - * - * For more information on precompiling templates see - * [lodash's custom builds documentation](https://lodash.com/custom-builds). - * - * For more information on Chrome extension sandboxes see - * [Chrome's extensions documentation](https://developer.chrome.com/extensions/sandboxingEval). + * Checks if `value` is likely a DOM element. * * @static - * @since 0.1.0 * @memberOf _ - * @category String - * @param {string} [string=''] The template string. - * @param {Object} [options={}] The options object. - * @param {RegExp} [options.escape=_.templateSettings.escape] - * The HTML "escape" delimiter. - * @param {RegExp} [options.evaluate=_.templateSettings.evaluate] - * The "evaluate" delimiter. - * @param {Object} [options.imports=_.templateSettings.imports] - * An object to import into the template as free variables. - * @param {RegExp} [options.interpolate=_.templateSettings.interpolate] - * The "interpolate" delimiter. - * @param {string} [options.sourceURL='lodash.templateSources[n]'] - * The sourceURL of the compiled template. - * @param {string} [options.variable='obj'] - * The data object variable name. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Function} Returns the compiled template function. + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a DOM element, else `false`. * @example * - * // Use the "interpolate" delimiter to create a compiled template. - * var compiled = _.template('hello <%= user %>!'); - * compiled({ 'user': 'fred' }); - * // => 'hello fred!' - * - * // Use the HTML "escape" delimiter to escape data property values. - * var compiled = _.template('<%- value %>'); - * compiled({ 'value': ' - - diff --git a/website/package-lock.json b/website/package-lock.json deleted file mode 100644 index 30f995fd34f6..000000000000 --- a/website/package-lock.json +++ /dev/null @@ -1,1196 +0,0 @@ -{ - "name": "website", - "version": "0.0.1", - "lockfileVersion": 1, - "requires": true, - "dependencies": { - "accepts": { - "version": "1.3.3", - "resolved": "https://registry.npmjs.org/accepts/-/accepts-1.3.3.tgz", - "integrity": "sha1-w8p0NJOGSMPg2cHjKN1otiLChMo=", - "requires": { - "mime-types": "2.1.16", - "negotiator": "0.6.1" - } - }, - "address": { - "version": "1.0.2", - "resolved": "https://registry.npmjs.org/address/-/address-1.0.2.tgz", - "integrity": "sha1-SACB6CtYe6MZRZ/vUS9Rb+A9WK8=" - }, - "align-text": { - "version": "0.1.4", - "resolved": "https://registry.npmjs.org/align-text/-/align-text-0.1.4.tgz", - "integrity": "sha1-DNkKVhCT810KmSVsIrcGlDP60Rc=", - "requires": { - "kind-of": "3.2.2", - "longest": "1.0.1", - "repeat-string": "1.6.1" - } - }, - "amdefine": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/amdefine/-/amdefine-1.0.1.tgz", - "integrity": "sha1-SlKCrBZHKek2Gbz9OtFR+BfOkfU=" - }, - "ansi-align": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/ansi-align/-/ansi-align-2.0.0.tgz", - "integrity": "sha1-w2rsy6VjuJzrVW82kPCx2eNUf38=", - "requires": { - "string-width": "2.1.1" - } - }, - "ansi-regex": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-3.0.0.tgz", - "integrity": "sha1-7QMXwyIGT3lGbAKWa922Bas32Zg=" - }, - "ansi-styles": { - "version": "3.2.0", - "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.0.tgz", - "integrity": "sha512-NnSOmMEYtVR2JVMIGTzynRkkaxtiq1xnFBcdQD/DnNCYPoEPsVJhM98BDyaoNOQIi7p4okdi3E27eN7GQbsUug==", - "requires": { - "color-convert": "1.9.0" - } - }, - "args": { - "version": "3.0.4", - "resolved": "https://registry.npmjs.org/args/-/args-3.0.4.tgz", - "integrity": "sha512-lKZ8xDF/cDhrjcEG+PIWzKo0o0f03QpOtLfDFqh29zq0v/+TonQVUhyQurV7LUrkglTAPTtGsOyD2jtfBKlAiA==", - "requires": { - "camelcase": "4.1.0", - "chalk": "2.0.1", - "minimist": "1.2.0", - "pkginfo": "0.4.0", - "string-similarity": "1.2.0" - } - }, - "async": { - "version": "1.5.2", - "resolved": "https://registry.npmjs.org/async/-/async-1.5.2.tgz", - "integrity": "sha1-7GphrlZIDAw8skHJVhjiCJL5Zyo=" - }, - "basic-auth": { - "version": "1.1.0", - "resolved": "https://registry.npmjs.org/basic-auth/-/basic-auth-1.1.0.tgz", - "integrity": "sha1-RSIe5Cn37h5QNb4/UVM/HN/SmIQ=" - }, - "bluebird": { - "version": "3.5.0", - "resolved": "https://registry.npmjs.org/bluebird/-/bluebird-3.5.0.tgz", - "integrity": "sha1-eRQg1/VR7qKJdFOop3ZT+WYG1nw=" - }, - "boxen": { - "version": "1.2.1", - "resolved": "https://registry.npmjs.org/boxen/-/boxen-1.2.1.tgz", - "integrity": "sha1-DxHn/jRO25OXl3/BPt5/ZNlWSB0=", - "requires": { - "ansi-align": "2.0.0", - "camelcase": "4.1.0", - "chalk": "2.0.1", - "cli-boxes": "1.0.0", - "string-width": "2.1.1", - "term-size": "1.2.0", - "widest-line": "1.0.0" - } - }, - "bytes": { - "version": "2.4.0", - "resolved": "https://registry.npmjs.org/bytes/-/bytes-2.4.0.tgz", - "integrity": "sha1-fZcZb51br39pNeJZhVSe3SpsIzk=" - }, - "camelcase": { - "version": "4.1.0", - "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-4.1.0.tgz", - "integrity": "sha1-1UVjW+HjPFQmScaRc+Xeas+uNN0=" - }, - "capture-stack-trace": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/capture-stack-trace/-/capture-stack-trace-1.0.0.tgz", - "integrity": "sha1-Sm+gc5nCa7pH8LJJa00PtAjFVQ0=" - }, - "center-align": { - "version": "0.1.3", - "resolved": "https://registry.npmjs.org/center-align/-/center-align-0.1.3.tgz", - "integrity": "sha1-qg0yYptu6XIgBBHL1EYckHvCt60=", - "optional": true, - "requires": { - "align-text": "0.1.4", - "lazy-cache": "1.0.4" - } - }, - "chalk": { - "version": "2.0.1", - "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.0.1.tgz", - "integrity": "sha512-Mp+FXEI+FrwY/XYV45b2YD3E8i3HwnEAoFcM0qlZzq/RZ9RwWitt2Y/c7cqRAz70U7hfekqx6qNYthuKFO6K0g==", - "requires": { - "ansi-styles": "3.2.0", - "escape-string-regexp": "1.0.5", - "supports-color": "4.2.1" - } - }, - "cli-boxes": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/cli-boxes/-/cli-boxes-1.0.0.tgz", - "integrity": "sha1-T6kXw+WclKAEzWH47lCdplFocUM=" - }, - "clipboardy": { - "version": "1.1.4", - "resolved": "https://registry.npmjs.org/clipboardy/-/clipboardy-1.1.4.tgz", - "integrity": "sha1-UbF1dPxoJYji3Slc+m5qoQnqte4=", - "requires": { - "execa": "0.6.3" - }, - "dependencies": { - "execa": { - "version": "0.6.3", - "resolved": "https://registry.npmjs.org/execa/-/execa-0.6.3.tgz", - "integrity": "sha1-V7aaWU8IF1nGnlNw8NF7nLEWWP4=", - "requires": { - "cross-spawn": "5.1.0", - "get-stream": "3.0.0", - "is-stream": "1.1.0", - "npm-run-path": "2.0.2", - "p-finally": "1.0.0", - "signal-exit": "3.0.2", - "strip-eof": "1.0.0" - } - } - } - }, - "cliui": { - "version": "2.1.0", - "resolved": "https://registry.npmjs.org/cliui/-/cliui-2.1.0.tgz", - "integrity": "sha1-S0dXYP+AJkx2LDoXGQMukcf+oNE=", - "optional": true, - "requires": { - "center-align": "0.1.3", - "right-align": "0.1.3", - "wordwrap": "0.0.2" - }, - "dependencies": { - "wordwrap": { - "version": "0.0.2", - "resolved": "https://registry.npmjs.org/wordwrap/-/wordwrap-0.0.2.tgz", - "integrity": "sha1-t5Zpu0LstAn4PVg8rVLKF+qhZD8=", - "optional": true - } - } - }, - "code-point-at": { - "version": "1.1.0", - "resolved": "https://registry.npmjs.org/code-point-at/-/code-point-at-1.1.0.tgz", - "integrity": "sha1-DQcLTQQ6W+ozovGkDi7bPZpMz3c=" - }, - "color-convert": { - "version": "1.9.0", - "resolved": "https://registry.npmjs.org/color-convert/-/color-convert-1.9.0.tgz", - "integrity": "sha1-Gsz5fdc5uYO/mU1W/sj5WFNkG3o=", - "requires": { - "color-name": "1.1.3" - } - }, - "color-name": { - "version": "1.1.3", - "resolved": "https://registry.npmjs.org/color-name/-/color-name-1.1.3.tgz", - "integrity": "sha1-p9BVi9icQveV3UIyj3QIMcpTvCU=" - }, - "compressible": { - "version": "2.0.11", - "resolved": "https://registry.npmjs.org/compressible/-/compressible-2.0.11.tgz", - "integrity": "sha1-FnGKdd4oPtjmBAQWJaIGRYZ5fYo=", - "requires": { - "mime-db": "1.29.0" - } - }, - "compression": { - "version": "1.7.0", - "resolved": "https://registry.npmjs.org/compression/-/compression-1.7.0.tgz", - "integrity": "sha1-AwyfGY8WQ6BX13anOOki2kNzAS0=", - "requires": { - "accepts": "1.3.3", - "bytes": "2.5.0", - "compressible": "2.0.11", - "debug": "2.6.8", - "on-headers": "1.0.1", - "safe-buffer": "5.1.1", - "vary": "1.1.1" - }, - "dependencies": { - "bytes": { - "version": "2.5.0", - "resolved": "https://registry.npmjs.org/bytes/-/bytes-2.5.0.tgz", - "integrity": "sha1-TJQj6i0lLCcMQbK97+/5u2tiwGo=" - } - } - }, - "configstore": { - "version": "3.1.1", - "resolved": "https://registry.npmjs.org/configstore/-/configstore-3.1.1.tgz", - "integrity": "sha512-5oNkD/L++l0O6xGXxb1EWS7SivtjfGQlRyxJsYgE0Z495/L81e2h4/d3r969hoPXuFItzNOKMtsXgYG4c7dYvw==", - "requires": { - "dot-prop": "4.2.0", - "graceful-fs": "4.1.11", - "make-dir": "1.0.0", - "unique-string": "1.0.0", - "write-file-atomic": "2.3.0", - "xdg-basedir": "3.0.0" - } - }, - "create-error-class": { - "version": "3.0.2", - "resolved": "https://registry.npmjs.org/create-error-class/-/create-error-class-3.0.2.tgz", - "integrity": "sha1-Br56vvlHo/FKMP1hBnHUAbyot7Y=", - "requires": { - "capture-stack-trace": "1.0.0" - } - }, - "cross-spawn": { - "version": "5.1.0", - "resolved": "https://registry.npmjs.org/cross-spawn/-/cross-spawn-5.1.0.tgz", - "integrity": "sha1-6L0O/uWPz/b4+UUQoKVUu/ojVEk=", - "requires": { - "lru-cache": "4.1.1", - "shebang-command": "1.2.0", - "which": "1.3.0" - } - }, - "crypto-random-string": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/crypto-random-string/-/crypto-random-string-1.0.0.tgz", - "integrity": "sha1-ojD2T1aDEOFJgAmUB5DsmVRbyn4=" - }, - "dargs": { - "version": "5.1.0", - "resolved": "https://registry.npmjs.org/dargs/-/dargs-5.1.0.tgz", - "integrity": "sha1-7H6lDHhWTNNsnV7Bj2Yyn63ieCk=" - }, - "debug": { - "version": "2.6.8", - "resolved": "https://registry.npmjs.org/debug/-/debug-2.6.8.tgz", - "integrity": "sha1-5zFTHKLt4n0YgiJCfaF4IdaP9Pw=", - "requires": { - "ms": "2.0.0" - } - }, - "decamelize": { - "version": "1.2.0", - "resolved": "https://registry.npmjs.org/decamelize/-/decamelize-1.2.0.tgz", - "integrity": "sha1-9lNNFRSCabIDUue+4m9QH5oZEpA=", - "optional": true - }, - "deep-extend": { - "version": "0.4.2", - "resolved": "https://registry.npmjs.org/deep-extend/-/deep-extend-0.4.2.tgz", - "integrity": "sha1-SLaZwn4zS/ifEIkr5DL25MfTSn8=" - }, - "depd": { - "version": "1.1.1", - "resolved": "https://registry.npmjs.org/depd/-/depd-1.1.1.tgz", - "integrity": "sha1-V4O04cRZ8G+lyif5kfPQbnoxA1k=" - }, - "destroy": { - "version": "1.0.4", - "resolved": "https://registry.npmjs.org/destroy/-/destroy-1.0.4.tgz", - "integrity": "sha1-l4hXRCxEdJ5CBmE+N5RiBYJqvYA=" - }, - "detect-port": { - "version": "1.2.1", - "resolved": "https://registry.npmjs.org/detect-port/-/detect-port-1.2.1.tgz", - "integrity": "sha512-2KWLTLsfpi/oYPGNBEniPcFzr1GW/s+Xq/4hJmTQRdE8ULuRwGnRPuVhS/cf+Z4ZEXNo7EO2f6oydHJQd94KMg==", - "requires": { - "address": "1.0.2", - "debug": "2.6.8" - } - }, - "dot-prop": { - "version": "4.2.0", - "resolved": "https://registry.npmjs.org/dot-prop/-/dot-prop-4.2.0.tgz", - "integrity": "sha512-tUMXrxlExSW6U2EXiiKGSBVdYgtV8qlHL+C10TsW4PURY/ic+eaysnSkwB4kA/mBlCyy/IKDJ+Lc3wbWeaXtuQ==", - "requires": { - "is-obj": "1.0.1" - } - }, - "duplexer3": { - "version": "0.1.4", - "resolved": "https://registry.npmjs.org/duplexer3/-/duplexer3-0.1.4.tgz", - "integrity": "sha1-7gHdHKwO08vH/b6jfcCo8c4ALOI=" - }, - "ee-first": { - "version": "1.1.1", - "resolved": "https://registry.npmjs.org/ee-first/-/ee-first-1.1.1.tgz", - "integrity": "sha1-WQxhFWsK4vTwJVcyoViyZrxWsh0=" - }, - "encodeurl": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/encodeurl/-/encodeurl-1.0.1.tgz", - "integrity": "sha1-eePVhlU0aQn+bw9Fpd5oEDspTSA=" - }, - "escape-html": { - "version": "1.0.3", - "resolved": "https://registry.npmjs.org/escape-html/-/escape-html-1.0.3.tgz", - "integrity": "sha1-Aljq5NPQwJdN4cFpGI7wBR0dGYg=" - }, - "escape-string-regexp": { - "version": "1.0.5", - "resolved": "https://registry.npmjs.org/escape-string-regexp/-/escape-string-regexp-1.0.5.tgz", - "integrity": "sha1-G2HAViGQqN/2rjuyzwIAyhMLhtQ=" - }, - "etag": { - "version": "1.8.0", - "resolved": "https://registry.npmjs.org/etag/-/etag-1.8.0.tgz", - "integrity": "sha1-b2Ma7zNtbEY2K1F2QETOIWvjwFE=" - }, - "execa": { - "version": "0.7.0", - "resolved": "https://registry.npmjs.org/execa/-/execa-0.7.0.tgz", - "integrity": "sha1-lEvs00zEHuMqY6n68nrVpl/Fl3c=", - "requires": { - "cross-spawn": "5.1.0", - "get-stream": "3.0.0", - "is-stream": "1.1.0", - "npm-run-path": "2.0.2", - "p-finally": "1.0.0", - "signal-exit": "3.0.2", - "strip-eof": "1.0.0" - } - }, - "filesize": { - "version": "3.5.10", - "resolved": "https://registry.npmjs.org/filesize/-/filesize-3.5.10.tgz", - "integrity": "sha1-/I+iPdtO+eXgq24eZPZ5okpWdh8=" - }, - "fresh": { - "version": "0.5.0", - "resolved": "https://registry.npmjs.org/fresh/-/fresh-0.5.0.tgz", - "integrity": "sha1-9HTKXmqSRtb9jglTz6m5yAWvp44=" - }, - "fs-extra": { - "version": "4.0.1", - "resolved": "https://registry.npmjs.org/fs-extra/-/fs-extra-4.0.1.tgz", - "integrity": "sha1-f8DGyJV/mD9X8waiTlud3Y0N2IA=", - "requires": { - "graceful-fs": "4.1.11", - "jsonfile": "3.0.1", - "universalify": "0.1.1" - } - }, - "get-stream": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/get-stream/-/get-stream-3.0.0.tgz", - "integrity": "sha1-jpQ9E1jcN1VQVOy+LtsFqhdO3hQ=" - }, - "got": { - "version": "6.7.1", - "resolved": "https://registry.npmjs.org/got/-/got-6.7.1.tgz", - "integrity": "sha1-JAzQV4WpoY5WHcG0S0HHY+8ejbA=", - "requires": { - "create-error-class": "3.0.2", - "duplexer3": "0.1.4", - "get-stream": "3.0.0", - "is-redirect": "1.0.0", - "is-retry-allowed": "1.1.0", - "is-stream": "1.1.0", - "lowercase-keys": "1.0.0", - "safe-buffer": "5.1.1", - "timed-out": "4.0.1", - "unzip-response": "2.0.1", - "url-parse-lax": "1.0.0" - } - }, - "graceful-fs": { - "version": "4.1.11", - "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.1.11.tgz", - "integrity": "sha1-Dovf5NHduIVNZOBOp8AOKgJuVlg=" - }, - "handlebars": { - "version": "4.0.10", - "resolved": "https://registry.npmjs.org/handlebars/-/handlebars-4.0.10.tgz", - "integrity": "sha1-PTDHGLCaPZbyPqTMH0A8TTup/08=", - "requires": { - "async": "1.5.2", - "optimist": "0.6.1", - "source-map": "0.4.4", - "uglify-js": "2.8.29" - } - }, - "has-ansi": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/has-ansi/-/has-ansi-2.0.0.tgz", - "integrity": "sha1-NPUEnOHs3ysGSa8+8k5F7TVBbZE=", - "requires": { - "ansi-regex": "2.1.1" - }, - "dependencies": { - "ansi-regex": { - "version": "2.1.1", - "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-2.1.1.tgz", - "integrity": "sha1-w7M6te42DYbg5ijwRorn7yfWVN8=" - } - } - }, - "has-flag": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-2.0.0.tgz", - "integrity": "sha1-6CB68cx7MNRGzHC3NLXovhj4jVE=" - }, - "http-errors": { - "version": "1.6.2", - "resolved": "https://registry.npmjs.org/http-errors/-/http-errors-1.6.2.tgz", - "integrity": "sha1-CgAsyFcHGSp+eUbO7cERVfYOxzY=", - "requires": { - "depd": "1.1.1", - "inherits": "2.0.3", - "setprototypeof": "1.0.3", - "statuses": "1.3.1" - } - }, - "iconv-lite": { - "version": "0.4.15", - "resolved": "https://registry.npmjs.org/iconv-lite/-/iconv-lite-0.4.15.tgz", - "integrity": "sha1-/iZaIYrGpXz+hUkn6dBMGYJe3es=" - }, - "import-lazy": { - "version": "2.1.0", - "resolved": "https://registry.npmjs.org/import-lazy/-/import-lazy-2.1.0.tgz", - "integrity": "sha1-BWmOPUXIjo1+nZLLBYTnfwlvPkM=" - }, - "imurmurhash": { - "version": "0.1.4", - "resolved": "https://registry.npmjs.org/imurmurhash/-/imurmurhash-0.1.4.tgz", - "integrity": "sha1-khi5srkoojixPcT7a21XbyMUU+o=" - }, - "inherits": { - "version": "2.0.3", - "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.3.tgz", - "integrity": "sha1-Yzwsg+PaQqUC9SRmAiSA9CCCYd4=" - }, - "ini": { - "version": "1.3.4", - "resolved": "https://registry.npmjs.org/ini/-/ini-1.3.4.tgz", - "integrity": "sha1-BTfLedr1m1mhpRff9wbIbsA5Fi4=" - }, - "ip": { - "version": "1.1.5", - "resolved": "https://registry.npmjs.org/ip/-/ip-1.1.5.tgz", - "integrity": "sha1-vd7XARQpCCjAoDnnLvJfWq7ENUo=" - }, - "is-buffer": { - "version": "1.1.5", - "resolved": "https://registry.npmjs.org/is-buffer/-/is-buffer-1.1.5.tgz", - "integrity": "sha1-Hzsm72E7IUuIy8ojzGwB2Hlh7sw=" - }, - "is-fullwidth-code-point": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-2.0.0.tgz", - "integrity": "sha1-o7MKXE8ZkYMWeqq5O+764937ZU8=" - }, - "is-npm": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/is-npm/-/is-npm-1.0.0.tgz", - "integrity": "sha1-8vtjpl5JBbQGyGBydloaTceTufQ=" - }, - "is-obj": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/is-obj/-/is-obj-1.0.1.tgz", - "integrity": "sha1-PkcprB9f3gJc19g6iW2rn09n2w8=" - }, - "is-redirect": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/is-redirect/-/is-redirect-1.0.0.tgz", - "integrity": "sha1-HQPd7VO9jbDzDCbk+V02/HyH3CQ=" - }, - "is-retry-allowed": { - "version": "1.1.0", - "resolved": "https://registry.npmjs.org/is-retry-allowed/-/is-retry-allowed-1.1.0.tgz", - "integrity": "sha1-EaBgVotnM5REAz0BJaYaINVk+zQ=" - }, - "is-stream": { - "version": "1.1.0", - "resolved": "https://registry.npmjs.org/is-stream/-/is-stream-1.1.0.tgz", - "integrity": "sha1-EtSj3U5o4Lec6428hBc66A2RykQ=" - }, - "is-wsl": { - "version": "1.1.0", - "resolved": "https://registry.npmjs.org/is-wsl/-/is-wsl-1.1.0.tgz", - "integrity": "sha1-HxbkqiKwTRM2tmGIpmrzxgDDpm0=" - }, - "isexe": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/isexe/-/isexe-2.0.0.tgz", - "integrity": "sha1-6PvzdNxVb/iUehDcsFctYz8s+hA=" - }, - "jsonfile": { - "version": "3.0.1", - "resolved": "https://registry.npmjs.org/jsonfile/-/jsonfile-3.0.1.tgz", - "integrity": "sha1-pezG9l9T9mLEQVx2daAzHQmS7GY=", - "requires": { - "graceful-fs": "4.1.11" - } - }, - "kind-of": { - "version": "3.2.2", - "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz", - "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=", - "requires": { - "is-buffer": "1.1.5" - } - }, - "latest-version": { - "version": "3.1.0", - "resolved": "https://registry.npmjs.org/latest-version/-/latest-version-3.1.0.tgz", - "integrity": "sha1-ogU4P+oyKzO1rjsYq+4NwvNW7hU=", - "requires": { - "package-json": "4.0.1" - } - }, - "lazy-cache": { - "version": "1.0.4", - "resolved": "https://registry.npmjs.org/lazy-cache/-/lazy-cache-1.0.4.tgz", - "integrity": "sha1-odePw6UEdMuAhF07O24dpJpEbo4=", - "optional": true - }, - "lodash": { - "version": "4.17.4", - "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.4.tgz", - "integrity": "sha1-eCA6TRwyiuHYbcpkYONptX9AVa4=" - }, - "longest": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/longest/-/longest-1.0.1.tgz", - "integrity": "sha1-MKCy2jj3N3DoKUoNIuZiXtd9AJc=" - }, - "lowercase-keys": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/lowercase-keys/-/lowercase-keys-1.0.0.tgz", - "integrity": "sha1-TjNms55/VFfjXxMkvfb4jQv8cwY=" - }, - "lru-cache": { - "version": "4.1.1", - "resolved": "https://registry.npmjs.org/lru-cache/-/lru-cache-4.1.1.tgz", - "integrity": "sha512-q4spe4KTfsAS1SUHLO0wz8Qiyf1+vMIAgpRYioFYDMNqKfHQbg+AVDH3i4fvpl71/P1L0dBl+fQi+P37UYf0ew==", - "requires": { - "pseudomap": "1.0.2", - "yallist": "2.1.2" - } - }, - "make-dir": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/make-dir/-/make-dir-1.0.0.tgz", - "integrity": "sha1-l6ARdR6R3YfPre9Ygy67BJNt6Xg=", - "requires": { - "pify": "2.3.0" - }, - "dependencies": { - "pify": { - "version": "2.3.0", - "resolved": "https://registry.npmjs.org/pify/-/pify-2.3.0.tgz", - "integrity": "sha1-7RQaasBDqEnqWISY59yosVMw6Qw=" - } - } - }, - "media-typer": { - "version": "0.3.0", - "resolved": "https://registry.npmjs.org/media-typer/-/media-typer-0.3.0.tgz", - "integrity": "sha1-hxDXrwqmJvj/+hzgAWhUUmMlV0g=" - }, - "micro": { - "version": "8.0.1", - "resolved": "https://registry.npmjs.org/micro/-/micro-8.0.1.tgz", - "integrity": "sha512-P+BC3kQeMKgoFYjqWSaSIjmu07LxFumL2i2h9t1iEadzRLl3KjUKNG0O9ii6I1z7C/ZX4Yi4sCcBucLqnsy83A==", - "requires": { - "media-typer": "0.3.0", - "mri": "1.1.0", - "raw-body": "2.2.0" - } - }, - "micro-compress": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/micro-compress/-/micro-compress-1.0.0.tgz", - "integrity": "sha1-U/WoC0rQMgyhZaVZtuPfFF1PcE8=", - "requires": { - "compression": "1.7.0" - } - }, - "mime": { - "version": "1.3.4", - "resolved": "https://registry.npmjs.org/mime/-/mime-1.3.4.tgz", - "integrity": "sha1-EV+eO2s9rylZmDyzjxSaLUDrXVM=" - }, - "mime-db": { - "version": "1.29.0", - "resolved": "https://registry.npmjs.org/mime-db/-/mime-db-1.29.0.tgz", - "integrity": "sha1-SNJtI1WJZRcErFkWygYAGRQmaHg=" - }, - "mime-types": { - "version": "2.1.16", - "resolved": "https://registry.npmjs.org/mime-types/-/mime-types-2.1.16.tgz", - "integrity": "sha1-K4WKUuXs1RbbiXrCvodIeDBpjiM=", - "requires": { - "mime-db": "1.29.0" - } - }, - "minimist": { - "version": "1.2.0", - "resolved": "https://registry.npmjs.org/minimist/-/minimist-1.2.0.tgz", - "integrity": "sha1-o1AIsg9BOD7sH7kU9M1d95omQoQ=" - }, - "mri": { - "version": "1.1.0", - "resolved": "https://registry.npmjs.org/mri/-/mri-1.1.0.tgz", - "integrity": "sha1-XAo/KcjM/7ux7JQdzsCdcfoy82o=" - }, - "ms": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", - "integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=" - }, - "negotiator": { - "version": "0.6.1", - "resolved": "https://registry.npmjs.org/negotiator/-/negotiator-0.6.1.tgz", - "integrity": "sha1-KzJxhOiZIQEXeyhWP7XnECrNDKk=" - }, - "node-version": { - "version": "1.1.0", - "resolved": "https://registry.npmjs.org/node-version/-/node-version-1.1.0.tgz", - "integrity": "sha512-t1V2RFiaTavaW3jtQO0A2nok6k7/Gghuvx2rjvICuT0B0dYaObBQ4U0xHL+ZTPFZodt1LMYG2Vi2nypfz4/AJg==" - }, - "npm-run-path": { - "version": "2.0.2", - "resolved": "https://registry.npmjs.org/npm-run-path/-/npm-run-path-2.0.2.tgz", - "integrity": "sha1-NakjLfo11wZ7TLLd8jV7GHFTbF8=", - "requires": { - "path-key": "2.0.1" - } - }, - "number-is-nan": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/number-is-nan/-/number-is-nan-1.0.1.tgz", - "integrity": "sha1-CXtgK1NCKlIsGvuHkDGDNpQaAR0=" - }, - "on-finished": { - "version": "2.3.0", - "resolved": "https://registry.npmjs.org/on-finished/-/on-finished-2.3.0.tgz", - "integrity": "sha1-IPEzZIGwg811M3mSoWlxqi2QaUc=", - "requires": { - "ee-first": "1.1.1" - } - }, - "on-headers": { - "version": "1.0.1", - "resolved": "https://registry.npmjs.org/on-headers/-/on-headers-1.0.1.tgz", - "integrity": "sha1-ko9dD0cNSTQmUepnlLCFfBAGk/c=" - }, - "opn": { - "version": "5.1.0", - "resolved": "https://registry.npmjs.org/opn/-/opn-5.1.0.tgz", - "integrity": "sha512-iPNl7SyM8L30Rm1sjGdLLheyHVw5YXVfi3SKWJzBI7efxRwHojfRFjwE/OLM6qp9xJYMgab8WicTU1cPoY+Hpg==", - "requires": { - "is-wsl": "1.1.0" - } - }, - "optimist": { - "version": "0.6.1", - "resolved": "https://registry.npmjs.org/optimist/-/optimist-0.6.1.tgz", - "integrity": "sha1-2j6nRob6IaGaERwybpDrFaAZZoY=", - "requires": { - "minimist": "0.0.10", - "wordwrap": "0.0.3" - }, - "dependencies": { - "minimist": { - "version": "0.0.10", - "resolved": "https://registry.npmjs.org/minimist/-/minimist-0.0.10.tgz", - "integrity": "sha1-3j+YVD2/lggr5IrRoMfNqDYwHc8=" - } - } - }, - "p-finally": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/p-finally/-/p-finally-1.0.0.tgz", - "integrity": "sha1-P7z7FbiZpEEjs0ttzBi3JDNqLK4=" - }, - "package-json": { - "version": "4.0.1", - "resolved": "https://registry.npmjs.org/package-json/-/package-json-4.0.1.tgz", - "integrity": "sha1-iGmgQBJTZhxMTKPabCEh7VVfXu0=", - "requires": { - "got": "6.7.1", - "registry-auth-token": "3.3.1", - "registry-url": "3.1.0", - "semver": "5.4.1" - } - }, - "path-key": { - "version": "2.0.1", - "resolved": "https://registry.npmjs.org/path-key/-/path-key-2.0.1.tgz", - "integrity": "sha1-QRyttXTFoUDTpLGRDUDYDMn0C0A=" - }, - "path-type": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/path-type/-/path-type-3.0.0.tgz", - "integrity": "sha512-T2ZUsdZFHgA3u4e5PfPbjd7HDDpxPnQb5jN0SrDsjNSuVXHJqtwTnWqG0B1jZrgmJ/7lj1EmVIByWt1gxGkWvg==", - "requires": { - "pify": "3.0.0" - } - }, - "pify": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/pify/-/pify-3.0.0.tgz", - "integrity": "sha1-5aSs0sEB/fPZpNB/DbxNtJ3SgXY=" - }, - "pkginfo": { - "version": "0.4.0", - "resolved": "https://registry.npmjs.org/pkginfo/-/pkginfo-0.4.0.tgz", - "integrity": "sha1-NJ27f/04CB/K3AhT32h/DHdEzWU=" - }, - "prepend-http": { - "version": "1.0.4", - "resolved": "https://registry.npmjs.org/prepend-http/-/prepend-http-1.0.4.tgz", - "integrity": "sha1-1PRWKwzjaW5BrFLQ4ALlemNdxtw=" - }, - "pseudomap": { - "version": "1.0.2", - "resolved": "https://registry.npmjs.org/pseudomap/-/pseudomap-1.0.2.tgz", - "integrity": "sha1-8FKijacOYYkX7wqKw0wa5aaChrM=" - }, - "range-parser": { - "version": "1.2.0", - "resolved": "https://registry.npmjs.org/range-parser/-/range-parser-1.2.0.tgz", - "integrity": "sha1-9JvmtIeJTdxA3MlKMi9hEJLgDV4=" - }, - "raw-body": { - "version": "2.2.0", - "resolved": "https://registry.npmjs.org/raw-body/-/raw-body-2.2.0.tgz", - "integrity": "sha1-mUl2z2pQlqQRYoQEkvC9xdbn+5Y=", - "requires": { - "bytes": "2.4.0", - "iconv-lite": "0.4.15", - "unpipe": "1.0.0" - } - }, - "rc": { - "version": "1.2.1", - "resolved": "https://registry.npmjs.org/rc/-/rc-1.2.1.tgz", - "integrity": "sha1-LgPo5C7kULjLPc5lvhv4l04d/ZU=", - "requires": { - "deep-extend": "0.4.2", - "ini": "1.3.4", - "minimist": "1.2.0", - "strip-json-comments": "2.0.1" - } - }, - "registry-auth-token": { - "version": "3.3.1", - "resolved": "https://registry.npmjs.org/registry-auth-token/-/registry-auth-token-3.3.1.tgz", - "integrity": "sha1-+w0yie4Nmtosu1KvXf5mywcNMAY=", - "requires": { - "rc": "1.2.1", - "safe-buffer": "5.1.1" - } - }, - "registry-url": { - "version": "3.1.0", - "resolved": "https://registry.npmjs.org/registry-url/-/registry-url-3.1.0.tgz", - "integrity": "sha1-PU74cPc93h138M+aOBQyRE4XSUI=", - "requires": { - "rc": "1.2.1" - } - }, - "repeat-string": { - "version": "1.6.1", - "resolved": "https://registry.npmjs.org/repeat-string/-/repeat-string-1.6.1.tgz", - "integrity": "sha1-jcrkcOHIirwtYA//Sndihtp15jc=" - }, - "right-align": { - "version": "0.1.3", - "resolved": "https://registry.npmjs.org/right-align/-/right-align-0.1.3.tgz", - "integrity": "sha1-YTObci/mo1FWiSENJOFMlhSGE+8=", - "optional": true, - "requires": { - "align-text": "0.1.4" - } - }, - "safe-buffer": { - "version": "5.1.1", - "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.1.tgz", - "integrity": "sha512-kKvNJn6Mm93gAczWVJg7wH+wGYWNrDHdWvpUmHyEsgCtIwwo3bqPtV4tR5tuPaUhTOo/kvhVwd8XwwOllGYkbg==" - }, - "semver": { - "version": "5.4.1", - "resolved": "https://registry.npmjs.org/semver/-/semver-5.4.1.tgz", - "integrity": "sha512-WfG/X9+oATh81XtllIo/I8gOiY9EXRdv1cQdyykeXK17YcUW3EXUAi2To4pcH6nZtJPr7ZOpM5OMyWJZm+8Rsg==" - }, - "semver-diff": { - "version": "2.1.0", - "resolved": "https://registry.npmjs.org/semver-diff/-/semver-diff-2.1.0.tgz", - "integrity": "sha1-S7uEN8jTfksM8aaP1ybsbWRdbTY=", - "requires": { - "semver": "5.4.1" - } - }, - "send": { - "version": "0.15.3", - "resolved": "https://registry.npmjs.org/send/-/send-0.15.3.tgz", - "integrity": "sha1-UBP5+ZAj31DRvZiSwZ4979HVMwk=", - "requires": { - "debug": "2.6.7", - "depd": "1.1.1", - "destroy": "1.0.4", - "encodeurl": "1.0.1", - "escape-html": "1.0.3", - "etag": "1.8.0", - "fresh": "0.5.0", - "http-errors": "1.6.2", - "mime": "1.3.4", - "ms": "2.0.0", - "on-finished": "2.3.0", - "range-parser": "1.2.0", - "statuses": "1.3.1" - }, - "dependencies": { - "debug": { - "version": "2.6.7", - "resolved": "https://registry.npmjs.org/debug/-/debug-2.6.7.tgz", - "integrity": "sha1-krrR9tBbu2u6Isyoi80OyJTChh4=", - "requires": { - "ms": "2.0.0" - } - } - } - }, - "serve": { - "version": "6.0.6", - "resolved": "https://registry.npmjs.org/serve/-/serve-6.0.6.tgz", - "integrity": "sha512-Aiaq6cL1YQztWeM2Wo8vqB4I6jemw1xzSIjj1AriXb8RMTs4EExlLW+/Wv5svloEsHj8rHgBXNXkbJYiU4CHcg==", - "requires": { - "args": "3.0.4", - "basic-auth": "1.1.0", - "bluebird": "3.5.0", - "boxen": "1.2.1", - "chalk": "2.0.1", - "clipboardy": "1.1.4", - "dargs": "5.1.0", - "detect-port": "1.2.1", - "filesize": "3.5.10", - "fs-extra": "4.0.1", - "handlebars": "4.0.10", - "ip": "1.1.5", - "micro": "8.0.1", - "micro-compress": "1.0.0", - "mime-types": "2.1.16", - "node-version": "1.1.0", - "opn": "5.1.0", - "path-type": "3.0.0", - "send": "0.15.3", - "update-notifier": "2.2.0" - } - }, - "setprototypeof": { - "version": "1.0.3", - "resolved": "https://registry.npmjs.org/setprototypeof/-/setprototypeof-1.0.3.tgz", - "integrity": "sha1-ZlZ+NwQ+608E2RvWWMDL77VbjgQ=" - }, - "shebang-command": { - "version": "1.2.0", - "resolved": "https://registry.npmjs.org/shebang-command/-/shebang-command-1.2.0.tgz", - "integrity": "sha1-RKrGW2lbAzmJaMOfNj/uXer98eo=", - "requires": { - "shebang-regex": "1.0.0" - } - }, - "shebang-regex": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/shebang-regex/-/shebang-regex-1.0.0.tgz", - "integrity": "sha1-2kL0l0DAtC2yypcoVxyxkMmO/qM=" - }, - "signal-exit": { - "version": "3.0.2", - "resolved": "https://registry.npmjs.org/signal-exit/-/signal-exit-3.0.2.tgz", - "integrity": "sha1-tf3AjxKH6hF4Yo5BXiUTK3NkbG0=" - }, - "source-map": { - "version": "0.4.4", - "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.4.4.tgz", - "integrity": "sha1-66T12pwNyZneaAMti092FzZSA2s=", - "requires": { - "amdefine": "1.0.1" - } - }, - "statuses": { - "version": "1.3.1", - "resolved": "https://registry.npmjs.org/statuses/-/statuses-1.3.1.tgz", - "integrity": "sha1-+vUbnrdKrvOzrPStX2Gr8ky3uT4=" - }, - "string-similarity": { - "version": "1.2.0", - "resolved": "https://registry.npmjs.org/string-similarity/-/string-similarity-1.2.0.tgz", - "integrity": "sha1-11FTyzg4RjGLejmo2SkrtNtOnDA=", - "requires": { - "lodash": "4.17.4" - } - }, - "string-width": { - "version": "2.1.1", - "resolved": "https://registry.npmjs.org/string-width/-/string-width-2.1.1.tgz", - "integrity": "sha512-nOqH59deCq9SRHlxq1Aw85Jnt4w6KvLKqWVik6oA9ZklXLNIOlqg4F2yrT1MVaTjAqvVwdfeZ7w7aCvJD7ugkw==", - "requires": { - "is-fullwidth-code-point": "2.0.0", - "strip-ansi": "4.0.0" - } - }, - "strip-ansi": { - "version": "4.0.0", - "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-4.0.0.tgz", - "integrity": "sha1-qEeQIusaw2iocTibY1JixQXuNo8=", - "requires": { - "ansi-regex": "3.0.0" - } - }, - "strip-eof": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/strip-eof/-/strip-eof-1.0.0.tgz", - "integrity": "sha1-u0P/VZim6wXYm1n80SnJgzE2Br8=" - }, - "strip-json-comments": { - "version": "2.0.1", - "resolved": "https://registry.npmjs.org/strip-json-comments/-/strip-json-comments-2.0.1.tgz", - "integrity": "sha1-PFMZQukIwml8DsNEhYwobHygpgo=" - }, - "supports-color": { - "version": "4.2.1", - "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-4.2.1.tgz", - "integrity": "sha512-qxzYsob3yv6U+xMzPrv170y8AwGP7i74g+pbixCfD6rgso8BscLT2qXIuz6TpOaiJZ3mFgT5O9lyT9nMU4LfaA==", - "requires": { - "has-flag": "2.0.0" - } - }, - "term-size": { - "version": "1.2.0", - "resolved": "https://registry.npmjs.org/term-size/-/term-size-1.2.0.tgz", - "integrity": "sha1-RYuDiH8oj8Vtb/+/rSYuJmOO+mk=", - "requires": { - "execa": "0.7.0" - } - }, - "timed-out": { - "version": "4.0.1", - "resolved": "https://registry.npmjs.org/timed-out/-/timed-out-4.0.1.tgz", - "integrity": "sha1-8y6srFoXW+ol1/q1Zas+2HQe9W8=" - }, - "uglify-js": { - "version": "2.8.29", - "resolved": "https://registry.npmjs.org/uglify-js/-/uglify-js-2.8.29.tgz", - "integrity": "sha1-KcVzMUgFe7Th913zW3qcty5qWd0=", - "optional": true, - "requires": { - "source-map": "0.5.6", - "uglify-to-browserify": "1.0.2", - "yargs": "3.10.0" - }, - "dependencies": { - "source-map": { - "version": "0.5.6", - "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.5.6.tgz", - "integrity": "sha1-dc449SvwczxafwwRjYEzSiu19BI=", - "optional": true - } - } - }, - "uglify-to-browserify": { - "version": "1.0.2", - "resolved": "https://registry.npmjs.org/uglify-to-browserify/-/uglify-to-browserify-1.0.2.tgz", - "integrity": "sha1-bgkk1r2mta/jSeOabWMoUKD4grc=", - "optional": true - }, - "unique-string": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/unique-string/-/unique-string-1.0.0.tgz", - "integrity": "sha1-nhBXzKhRq7kzmPizOuGHuZyuwRo=", - "requires": { - "crypto-random-string": "1.0.0" - } - }, - "universalify": { - "version": "0.1.1", - "resolved": "https://registry.npmjs.org/universalify/-/universalify-0.1.1.tgz", - "integrity": "sha1-+nG63UQ3r0wUiEHjs7Fl+enlkLc=" - }, - "unpipe": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/unpipe/-/unpipe-1.0.0.tgz", - "integrity": "sha1-sr9O6FFKrmFltIF4KdIbLvSZBOw=" - }, - "unzip-response": { - "version": "2.0.1", - "resolved": "https://registry.npmjs.org/unzip-response/-/unzip-response-2.0.1.tgz", - "integrity": "sha1-0vD3N9FrBhXnKmk17QQhRXLVb5c=" - }, - "update-notifier": { - "version": "2.2.0", - "resolved": "https://registry.npmjs.org/update-notifier/-/update-notifier-2.2.0.tgz", - "integrity": "sha1-G1g3z5DAc22IYncytmHBOPht5y8=", - "requires": { - "boxen": "1.2.1", - "chalk": "1.1.3", - "configstore": "3.1.1", - "import-lazy": "2.1.0", - "is-npm": "1.0.0", - "latest-version": "3.1.0", - "semver-diff": "2.1.0", - "xdg-basedir": "3.0.0" - }, - "dependencies": { - "ansi-regex": { - "version": "2.1.1", - "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-2.1.1.tgz", - "integrity": "sha1-w7M6te42DYbg5ijwRorn7yfWVN8=" - }, - "ansi-styles": { - "version": "2.2.1", - "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-2.2.1.tgz", - "integrity": "sha1-tDLdM1i2NM914eRmQ2gkBTPB3b4=" - }, - "chalk": { - "version": "1.1.3", - "resolved": "https://registry.npmjs.org/chalk/-/chalk-1.1.3.tgz", - "integrity": "sha1-qBFcVeSnAv5NFQq9OHKCKn4J/Jg=", - "requires": { - "ansi-styles": "2.2.1", - "escape-string-regexp": "1.0.5", - "has-ansi": "2.0.0", - "strip-ansi": "3.0.1", - "supports-color": "2.0.0" - } - }, - "strip-ansi": { - "version": "3.0.1", - "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-3.0.1.tgz", - "integrity": "sha1-ajhfuIU9lS1f8F0Oiq+UJ43GPc8=", - "requires": { - "ansi-regex": "2.1.1" - } - }, - "supports-color": { - "version": "2.0.0", - "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-2.0.0.tgz", - "integrity": "sha1-U10EXOa2Nj+kARcIRimZXp3zJMc=" - } - } - }, - "url-parse-lax": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/url-parse-lax/-/url-parse-lax-1.0.0.tgz", - "integrity": "sha1-evjzA2Rem9eaJy56FKxovAYJ2nM=", - "requires": { - "prepend-http": "1.0.4" - } - }, - "vary": { - "version": "1.1.1", - "resolved": "https://registry.npmjs.org/vary/-/vary-1.1.1.tgz", - "integrity": "sha1-Z1Neu2lMHVIldFeYRmUyP1h+jTc=" - }, - "which": { - "version": "1.3.0", - "resolved": "https://registry.npmjs.org/which/-/which-1.3.0.tgz", - "integrity": "sha512-xcJpopdamTuY5duC/KnTTNBraPK54YwpenP4lzxU8H91GudWpFv38u0CKjclE1Wi2EH2EDz5LRcHcKbCIzqGyg==", - "requires": { - "isexe": "2.0.0" - } - }, - "widest-line": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/widest-line/-/widest-line-1.0.0.tgz", - "integrity": "sha1-DAnIXCqUaD0Nfq+O4JfVZL8OEFw=", - "requires": { - "string-width": "1.0.2" - }, - "dependencies": { - "ansi-regex": { - "version": "2.1.1", - "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-2.1.1.tgz", - "integrity": "sha1-w7M6te42DYbg5ijwRorn7yfWVN8=" - }, - "is-fullwidth-code-point": { - "version": "1.0.0", - "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-1.0.0.tgz", - "integrity": "sha1-754xOG8DGn8NZDr4L95QxFfvAMs=", - "requires": { - "number-is-nan": "1.0.1" - } - }, - "string-width": { - "version": "1.0.2", - "resolved": "https://registry.npmjs.org/string-width/-/string-width-1.0.2.tgz", - "integrity": "sha1-EYvfW4zcUaKn5w0hHgfisLmxB9M=", - "requires": { - "code-point-at": "1.1.0", - "is-fullwidth-code-point": "1.0.0", - "strip-ansi": "3.0.1" - } - }, - "strip-ansi": { - "version": "3.0.1", - "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-3.0.1.tgz", - "integrity": "sha1-ajhfuIU9lS1f8F0Oiq+UJ43GPc8=", - "requires": { - "ansi-regex": "2.1.1" - } - } - } - }, - "window-size": { - "version": "0.1.0", - "resolved": "https://registry.npmjs.org/window-size/-/window-size-0.1.0.tgz", - "integrity": "sha1-VDjNLqk7IC76Ohn+iIeu58lPnJ0=", - "optional": true - }, - "wordwrap": { - "version": "0.0.3", - "resolved": "https://registry.npmjs.org/wordwrap/-/wordwrap-0.0.3.tgz", - "integrity": "sha1-o9XabNXAvAAI03I0u68b7WMFkQc=" - }, - "write-file-atomic": { - "version": "2.3.0", - "resolved": "https://registry.npmjs.org/write-file-atomic/-/write-file-atomic-2.3.0.tgz", - "integrity": "sha512-xuPeK4OdjWqtfi59ylvVL0Yn35SF3zgcAcv7rBPFHVaEapaDr4GdGgm3j7ckTwH9wHL7fGmgfAnb0+THrHb8tA==", - "requires": { - "graceful-fs": "4.1.11", - "imurmurhash": "0.1.4", - "signal-exit": "3.0.2" - } - }, - "xdg-basedir": { - "version": "3.0.0", - "resolved": "https://registry.npmjs.org/xdg-basedir/-/xdg-basedir-3.0.0.tgz", - "integrity": "sha1-SWsswQnsqNus/i3HK2A8F8WHCtQ=" - }, - "yallist": { - "version": "2.1.2", - "resolved": "https://registry.npmjs.org/yallist/-/yallist-2.1.2.tgz", - "integrity": "sha1-HBH5IY8HYImkfdUS+TxmmaaoHVI=" - }, - "yargs": { - "version": "3.10.0", - "resolved": "https://registry.npmjs.org/yargs/-/yargs-3.10.0.tgz", - "integrity": "sha1-9+572FfdfB0tOMDnTvvWgdFDH9E=", - "optional": true, - "requires": { - "camelcase": "1.2.1", - "cliui": "2.1.0", - "decamelize": "1.2.0", - "window-size": "0.1.0" - }, - "dependencies": { - "camelcase": { - "version": "1.2.1", - "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-1.2.1.tgz", - "integrity": "sha1-m7UwTS4LVmmLLHWLCKPqqdqlijk=", - "optional": true - } - } - } - } -} diff --git a/website/package.json b/website/package.json deleted file mode 100644 index 3e7c1e0d02a9..000000000000 --- a/website/package.json +++ /dev/null @@ -1,14 +0,0 @@ -{ - "name": "website", - "version": "0.0.1", - "description": "The official website for hyper.app", - "dependencies": { - "serve": "latest" - }, - "scripts": { - "start": "serve . -c 5" - }, - "now": { - "alias": "hyper.is" - } -} diff --git a/website/readme.md b/website/readme.md deleted file mode 100644 index 1781513f596e..000000000000 --- a/website/readme.md +++ /dev/null @@ -1,10 +0,0 @@ -# Hyper.app's site - -This is the static site that shows up when you access [hyper.is](https://hyper.is). It's hosted on [now](https://zeit.co/now/) and served using [serve](https://github.com/zeit/serve). - -## Contribute - -1. [Fork](https://help.github.com/articles/fork-a-repo/) this repository to your own GitHub account and then [clone](https://help.github.com/articles/cloning-a-repository/) it to your local device -3. Move into the website's directory: `cd hyper/website` -4. Install dependencies: `npm install` -6. Run [serve](https://github.com/zeit/serve): `npm start` diff --git a/website/static/apple-logo.svg b/website/static/apple-logo.svg deleted file mode 100644 index 5b37a4f51076..000000000000 --- a/website/static/apple-logo.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/website/static/arrow.svg b/website/static/arrow.svg deleted file mode 100644 index eb936111fe0c..000000000000 --- a/website/static/arrow.svg +++ /dev/null @@ -1,10 +0,0 @@ - - - - Shape - Created with Sketch. - - - - - \ No newline at end of file diff --git a/website/static/card.png b/website/static/card.png deleted file mode 100644 index b7153b17d9eb0acd3e35d3697b5b8842a6f02b09..0000000000000000000000000000000000000000 GIT binary patch literal 0 HcmV?d00001 literal 21326 zcmeFYRY25j_cc7~t)jG~qys3DLwBfzASEbW4&B{p(1;+&prnF;(%qqSNOwzj&CoUP z_2YS-|N9+$&v*14ya(@n;4L`wi|g8Z?X}k4SLk!)r}($2Zo^xq_MTB%RM7gb4xpMhVANlhI^JK;tZPnN?b|~ zQl=J`a$ZiRFT9jr8hcqA3!5-VO579k5CIpkHFZJW^RTtCa~AOsXSlqs2>3hnYXrl+ z%a6ENi!=P|p|q5q-;=U;GQG#oDZpXO&CPvJP?(dOUx=57pZy*W7dJnGOBlh;#lgib z!p$YZ!*%c9|1p5OIhmM=s7cHI`(EHDaRv()7Y7jp!rk4S)18;o-pL%nEi5dI;Nn5> z@Nj@na5#I~xgb3_?3@|@a|LNrXJaQz2Nz3wyL-?Tkw*5eF5(Q}N&ocB`bTCDznL69MIvInF zGh>8qT=cYJyb#(TiQXtWV!s7l9GtL zowEzl&e&95TATq~htty1M1-41T8f8PP@0d2OOTseM&Pj&?~^BdQrz6a0zy(!Qe6M} zuC%?etF5V>%YVLW^1r_;^IyLU1%#~wxU;mWlck%fiL8^o?Y+wv7qR^B&+_EIUhm)E zHTmz)BK2RtivSOUfVTJlvEBdq6^J3|um2Og;D`SSe^WaU^G+bRS9^cY!eA;j^3soA zdW>&O-KwB5eS_G_+S*`Zg5!EWc?~PFFOs@?JEW*%>BbdDnif+NmzJmb^A%#46^CZk zyoR&dZuJnM5AO(?kWWJ%2NVPqv{T)2!!fy5l$>|suRbH6E=>J~>2so=VM19|RaqXV z(Ehr;!kx=>{J($v-xc^jbp@tF2U%biN~LJwbuQWq_JywPUIi?AIlJz#=@9=>jD+$P zSV`0*3+$2fKVPX!39yC>!ODyBKP~zu>UML^D>b@R-{QOu!TGhu)G95sVOzwMoqG~y zZT0zT@0+p^SpO@vQYpm=1(cQeeOWJ=mx=>?J)M~~@P}9LFJ^-F(w;r3*yGno8|Ir zr6!U30`f6s6?#+oVYN?^%_3?ftPkFf%*dgb+vkg8yy+ATwBy;IMK7Y^uxG?qboAJH zHxif_Z!j^_Nc?4N-4bfeUi-)ApB}ft8}w!y|IK>cJ8S=_E%;ru$y|54q@UTDK*GW1 zh}KJmxFJk|mRyi_?)eu37k*OJ`e78gOsn?pN({5_ME@1r)fTMh{=1n%{(>DAHt9ovKUS89l|-D$fPAa2(yXOlnQ>* zFt^@)TJzD)^K@f2<$OuM2f?xSl~wK^3#D;}t9x#ip4lma*P9s#Nq^hFiuPH~znLQ9 z*m*Hl>|31fi{|UGwj8gM^Zq1PTr|ldcp#Hs^-$y7;dwZ5;Zgh7&7o^8gOZ+#=yz-y zu?)AvU>i7^n1uThSvmRU9d*I$7VVNmu#$kR zx5z#m+vojd>mdu86m%jCo<6TGtP;Q6_l^6`nC$7>lwu}!cs4nLTDnH(aTF_?Y+_1G zQY%$)^(3R+%~+61r!l=X3;TKN z=}`Rj>M|JRhP)l?WjekvBs|&qmT=IsOfiKrTMZlk+q{~A^_)t<)_2BeqDtMhio^(# z;vNJ&SuyoLJ^geoF<`mt29u$v`_aekDVJ9VP8D~eQ~OuHE*`hMz)l_wx+nXpKl;Z) z{Dcl>5$Nz4#c>CtBYc7Ms6B66m`Is6m7D)kXQ{hujGWereqXcN^RCWow-X^4-7H^} zvoXx063)=XZclit@+rcL9Z^3wG7(Lkftd1W`jym5a5t(JwPYD@UfNQmBx~!roMPy; zHN-?gd_`Is<`w5+TBp!Km3I7^N%*`?mBj6b?WdaPWlP4NrmMdKkI7SxyU%+#S&SOP zVj1U6m8J&UUe+$EvYoI#v)0y@u1Wn9b~ssWQJ=Jy5J~w`fvQw&Jw|}4{k2J&Qs&fd zSf0`qort=dFt1wn54KutnQQWWA6F%|$M}?}B5Ldz^99k5?M>1+>$mEJG2@N!+6%8X zjO?F_!YBvJ=(C;v%5W=V6th&AAwHU~ed1u;a_`mo_?3_l*xm_t>reqCHC60VgjjZ_ z_ITR~r+knBwl#GZDU1@~ptvh#;InXSa-hIAPIX=+8%?G^DiB22RzCAY`X3_VD=V(p zZ~3L>^*ZrOyNkVW>LIj_cy65izV=6(y(4GSVC%)_iPE zj(}P4uSLR25*=m?5o(WeRRi9XunVzl% z&e#2iGXJbBdUENK;l(g1h3TZrZ)6nFAh-?pjge;0o5(MQzWR{f@0k5ap`=#KZog2f zHCA#=bp=5Dt9SL-Z8i0qrM{^&dklTB+`vF-Eip6?ON(qM4D3_MBP$yd%Q1bWkGDJD zaE=?N`i!Rbab3toJ%}iBvebE|)@X7S+D9OP;~YBooCv(TT#&KG)W#$W&iSbQ@{72*7ku;P$A&wtgd@Jtw`UC=%** z2TjZPt-8}KI6VQi0DC~x4%%Gu^o#u~Us7vYa~Y(w0qMhxwX4@k?xlyoIKEu(ctcFB zJ^c`CuRarNEqW*5k;f=9xY>u&u=@+I`FM%trg3rc^uzjNqvuUEN3&lk*@{1tU!sl< z1L4Bry^zJ76>iGGaV%5L>P#TP?`^P7HOET{#uD%SjvDD7I1b_;8~dug4QqSe4n@;*Qhk`RM|mIMN$LbePQqU$A z?hG)UgB}=+BQv)T75nac@YBy0*1Bo^sk}X6&TE4|yWY_Y1UG)B^xt_$&(uLUVy~_0 zpheCk5Ec}wEfsy!LI#AF7Nb6apH}D>hnDwudCj{OKhftMY6wXGAmODme%wolbyP_CPdY~>*IysK`S4-ovBMM4(nu)j1NJIT&#Aq_alT6LeSI7LV;vOz19|cG@S?@k z{+|>7z=(-q)BPQNn6SB~;%<@kCK45&&bg-UZ;t)n<%`X_PJR>mak;EKPa4ZnF|;dN z)71bB8_;{1oQ*y{w)n)_`G`-R_8p&C0HSL0KQfx0f9*v(EwWvM(Wqah9zIuBb+OXX zknHYc&9ozha!u#4K~MMvTX9Y8?3k#0P!~Ce&R)BUANqTYay+lOa!+j^Uwx^=Y(pps zvvRW77)6nR9;s<$hP+K?mL3IkXV((`qVFqxB{a0$D&cXP8rf#ZSb7mfC{Db$DwhX; zzR)z^2Z0mdBV;?yXKCUa)lwD`!F1rP`yTZZ#R4t<`q^PU`$JY!Yu;~xf6F(^Ch8WA z4yW8_roFdmlYL3nL)RF7Vkg@RJt1U6K%sGKovDP_ zTnOWn&+ie&f|+%n_8D1*!=8Goe=<%LVua}AcG%0{ZwFhx zO?R+-CV|b7Li_m5S_k_}8gDdC6_GKQo^zqh5O^!MCMzTeUUb>} zVK$0;G|VcHdX%&DQ}I_zm~26r;Jw-OAY?bVq3C#Q++o^t+4b{_>&?#H!kJV;gI) zhi_^=U1GZm9%yCCi001(nol8`fhNN;Iw)>;ihuPNTEXx{Ef&!q8!@`nlj46g8!Wl= z>l!zSM!Um4201=RXV>*2-C{gFr-qBlb9@-JsQp>l+LFUkh#QtGrz`!MoXndqB9gyH z|MxBC#9rjZ3l(uP^z5H6ydx%wwKeTJM}ugjyLrYrc70Kc!jh5grX1hO^+)TfVK}|< zR&cz4Wt}?m78yKMBM{h)LHOZU*inOlCQypXgp>2%4!u7ILuWA`L4=lWT52jKPLIfX&i9|r@w#@Eivc9cS``k+#1~!u)%#-g$6fYr zZK>8yiBRS=BmCeQ2S1V*O2raa6(jUOs=Y?_4G*KtJfr!aY&6y6t@Ou@I3i5Pe(^8)$?dDs63d&so zC3*ncW`pVdW_%CTc}Jd=;RqK?x$|3Blxi27wdYMGr|hVtslE>!eb}v{QTOZx^9?A$ z`AKD@wNd%niPWNQ8%?1kq6>|s9sz(#mEW(b|FifJlo}}NxvfV{wc|6Yx9d&;x{a{F^^6F*S~_5CGKLvrq92gRX6$hacC277F)U-sFJUqLxr-ht zouz)t^5rIf??Yv3$CJ|z1@wLjipwQ=?|VA6w9Jl}V0hq3mGHxC|E1dHjmZjY9%_$8 z+^=C#D35$|1p*X>wtha9n4O1JxjDHV5usYWMOHHG?;}%*xYd^~wZ91Ro|}cv``61Z zM2nkKLkn#Fh)b7*V!0tUvgV@+{64Bwu~FJs{r5M9CUW&Xy}^fh!8!(dcPxc%G6pUM zD63^54FxxcReZ)XVr>?C?A>oUc54kVi+0_AGGSl&$)>)L<9CNW<;Wk}(-}Yu{!_YB z&)!8P-xjQ`;o=a_^700>Xx}8SRK99s)$YUNR*IJJ(xPHrn9h5{4_9xjdjZ#r2Y`kxV&2!lzuYC*1{QhwnfAL?bM0zKjlP&y#`4>mx zpWo$cHAtgntmE zTDM1}#mi*y7HoEZf|G8aAlr%fD}m$nYd49NVpp8;LT58JP$$OWI7+}v$FV#_Fqsk$_X89}>mMg=;@JJ!( z4SQr`8pV(j=4B(V5fS^-PWGpNZ1_mwS4$p1G9uxYmAs7wYQ)M@N!G@(ki#f`WRCD= z>G$NN!qC(^W|zPs_m7OQsv{;P@K)x#*z^$7-%gBrB=}Gr+av$Y0$W+^NAE7()z&p& zyGyAYatV{k;BX68EM^AX3Qs*5r@Q4ulN8dnuacswseR+-~rd2cgW)rr;eC-k@ z+k$0gVrNwqj5Ttali9AnMWNE0wL&~|S=dgFFY`NaFe01)#)nzI_bB^WF_YzYc{6G0 zstWOkI&fCa8<(_NXXilD>~(DYouxIBBJ}vf>K`or0?+>y&YD({Z?$6yJ0;jAwl6w0 zLP|%;RjHzg=7qj2x~d7NZ&p2hArpSNr<{17u7|1zkrMvod@rG-8Hjrg0>AS1D#B|@ zjvrBxLF!{p#}jX|uR_0$z4KT*y+BGsTG{4g_R;R8-;gc+rUr$2_xHX`PlhE&+&>SE zk)G;<{d@vyN}aMLqq_3Sbf8I01ta#8tOrgw zD2jMweQrWD!B7^*91ix_Hy`#0*Qz7HbAU3mElfs3v48Rl%t93i3a{EFM`FznA3l$) z$)|YT#aXlLTeDeg2qV&cS%=nP>9{jclo@aIT)Lk2(oT?LYAY6tB(Wk>`&oXo<-idE zgM!?&pM4rruU&DPpRFj@3iMi0>RCYrPmwgf3A9DSs#E8n)AD5$2e#vG)ZHnM;HjQG|Huxl-Ps8t}g*X*83`V8G;k?Y4D;mwOM`P2=LYiZ_lYoN};RFEnpU%>Ded8FNQACH=;9Zva{E}a~VOB zWZ!-JOUN$}N}YaIU#kSHX8Uol3zpF$)R+IPrLLpJ))9g(T6w6FF!SQo0z-RoDrw8Y4vXrk&8Oy!1JeCU^{Za5^aS_h6R9GGFb;b|x z8Fyl2x-`Yqw8;qO8I?{xHA`#9cLWE#)>0XeC@raA4U4lhP?=bhVM*=0O!4caG9lXW z%$C}xqz(5~NoiX`=bi@6bvzHlfs%8=-!}J0*Xr3 zv;Nw0;eh9L<3O1*jlj3EjHkeE+w3f*5UNdmxr}m@R$s|V6^}wf(Ho~GR77AYC{Nzf zfA9k@U*yS^!W>hbK?H}aDA5gzdYleiMwM(e>30UOk~zbFU^+7KOY+gNT?EDwIn8oJ zm`CK%##!Fc2L8lMv{aONYl{MrUBuRa;+XYu7HYkG_KyVzWMior7^)W*tdtjpTrrha z+(V9`t@5s1)`E&{L>f}KwCJp$_VtfilqE-dztH5B+T)QoA9#z@yHu<<1A{FS3F4#~ z#S(chUn)oV4wEUSxK2CQ@C$WkSl|;QwhKR^b-MgBmTw+*3Nd6Nh^wHVa2rl~Zq z^Evk+ovpS`*%NkMCIXA>NV%X4dHuUaxU900@>cshZDCusje*2@VeCISHWTVU|IrM( zT;>E*`64DuZ?9=w8G*Lb0Gr-=)ftoH*ZL>+Ba*8x0kJdyU<91{Dv&(c~;Il59l)*nGYT|CkP zXIT0oiI?jrPTF6xF~O&F<3Z^m{1 z2}(AaQxPRu_xCuRv8b#_GukV8&vu>Hu6Kp-gOI~&w!h9Nc27o2T?0P(PxxNnTuh(i zk@%u@u-^rkw(B){+~zdA2@Qwq?G0Si2ISE9OE=zBs&KI8{S$XdeG$>I`%a6nJ)G7mp|6_v>-%2k}>m6FYU<^+ZGy{U-9Yo0VjkZNrnn1{2HOTz*_qTS+jvtn+lw)5dv*&f%JUKmoL+1~KzxN#VDcrzsJNdrIs&HB&F8X($g>bs+p7wBELCEFC zdM_jyWVElh7g>*QO>@)xE6(T#@t>5LM(A*W2Y;GF>G8^UGC8fx>b)J1c?xUVs@#RD zvL8++#%)n~Npi-g+cu|D;l7`StrrDO%}e15r~52b+_@tiQeL^+bJP@FHQZnBaz=lr zydky94TXU{VT3|V8AWt+oP^VUS@rv8r|D8uzNe+>a6&wbJ=&5~`*?hd?Y4mFypIc> z@yn%rUFiG1)RC7FyUN#K`1_f-)Cq)Sc$&R~|EX6T_ozZ1wlyoxE zP|6z6lV(d^@s0Mv@t2CeXpFw%eMs$pcGT#;QhdB}|6Netie``XKA-JEgmPc>G^m03 zhx!){zecva&)a7t-4De(FV3C`FUT`mc8-U~Pk1+7hpPUeY}3)qMUjN1$9H)hm9@s0 zE4mM)+?C6woqG=^2&Pi)Khg~Z)vW@8bwkEC60!&Z*Wf71t(e-sqI z_PQDdJ2Q>CL@s zSe@aSg1z-r&ERPRGO?m^aFHi7$qkrQwzjq@r<2QGzJWlvN_Tvyx0tyE-!7Z*c}ox?n=-(Pg|?eiesyL*K@SxV+w_MLHEGM8lpZZFwwfuqrme; zcKuklf?K6s9PM(AH9bBES=jXbZ0+}DOWv!K+^ZrS=HAt}a+ez#hY(k`3ZA735x;%_ zV7NfJXmX;1RopzYV00u9XX_Pie_MET63B z6AnPG6tw(q8>4}^6kxg2{7(i_8vdk3N{G;G;tNg^^|W8PNmI}T?pZ$NrXs%oa&#lf zeR}Lzn$~CM_k>;briQL9S$8{d*6i!g52PI#V6fibhxOQVs~i~5}%5u`9E2GCF*P##c!SU$t_5IQ%s-V*hi4WvLJ4Cy4y+?Qud29$BB>yPHb zH8D)v;D=dWiNi@}&_Ae{{~!w4S8fst?!b*AQ4#B__s7;_PwNSvQU;IV^psCJDd;`O z5%NCR`2FtYHn5c>&sS9vp3dX+!~xIi%}qKj+nvwGA1cuuY}xK>bTQRN#Gq!p=*7ZV~TdQm|(=o|vrW zIkWkzBOuc0yf^wxpNSnW#F+p2+y{Tx{FPE8k>6Sa$C$P%;;w+rXgH#dvK))Rq7g9< zlys_GEK6rf$%v(%cyAQ8HlPPGlui%I>wR19ng_(V0RtSk=EC1+xFmhfq7oA{Z{6D2 zZKWsd3}~!4KbWXLD9uj-9hQ{y4RinVb;H){TUG0MM8xhBw&fs)5jrI+%#z3Lz##Np z`nXP>G9nRSNkdnbDL}aKX z4q+(ae{uGCFYED|JusJd=Ud%zyy0g7-v{+RAFP151>u6k<<@Qa0(WU9%T{YzPWI-k z^S(GW-HRe$rp;1b1Pi zuKJ|9wBL^d5LOg#NS4~7)|8!B#rl0ticq|yQIq_w#i&`^o0~KazZ5_h1vGEnPB+W# zFU;2Wz0U45x{1(}!GK*)t}M3OMD%1${5EdD#vq)bWn*_J->;Ol8dpBQ^M_|AM|qR! zld{#BdVjqK(oI5`2*GKbcIF&9a@?Qx0F=hP)^iC(HwvO=#(|HUbOB+SbKvNd+XM&s zKr_uz8vVINkN6=THR020Ot+~2vgpiDhB;hB4N;i}ts)t5BVDHAmpjQ)S!d%Tb#7pn z=-ekA4UZZqhQ%0KsFDrO<|wLhr{`ND5+r=Rw3fiWfPQqpa14#d-#0^HGax^+71d;#Rs?|o-u96(A^fxf13crbPn2)Fh@aA^ z+6tRAWPO{0F4e8d{QYZI|7xWF+5A!nP7<5m-k)8wYowmm6gwgx>C{` zg>OCKAq>}dY$h8zBO-2u`!2E>u5wlehK$ZKxofd+dCfKi8lLpWRf&}qoPp*W2@0gQ z9|Jwma{AIuSv<>Y)*nLPW&w#L1LGTG#ZM!shTt&)e_jkNBm%R2U&C42XX%Uilfe!2 z^Bzg;S=O*c>|RSGJ$5b}(c-F^I6#t8M z=9CSdxS(aw87VC-wFTYKp^rzJu&=SeLwWt74#Z7M&7iYsr)rw)Ind0$aiMdd`1tQO zQ%ITN4!{`<{Eiogbm55R=*9vg9OJ3Qbg&luc9oa|DVLh{ylMjBg(xoC{z111TS4pL z9N&X6W*P^Yp`CBRbmO4th_u%4IMR78d}O8NCwxsDc-@G)t@QIJH_)r1b)V!mSprq^ zumH@OfQBin7yuW6pmK*ln5C`+QFlASS&r|EL{~-Y$pk6iEn259!RZqODU%y-#^GIh z0^?96H0}6QuD9Vmb86sTIk%dbLhx+`bjp-FwnT2?Qk7bbaAvwqa)JTnWOvdj|y|T8mv4cfe8TsQiyHnA+GZIOn4MV6_>P zKHC@^yd2f*x1Vj8+l`)$nq%dztTl~k(<(3P{5(bDTdnX}{dd|)Iz%&aq~I4xuEW}J zkBy>EPS7(s8qzeRWqh{r>Vcx6`;;r8*v=zov+QC0I-g_Ec#GKzM`yV=h7|^xw0RFD zmghX660Gi%rLM(YhSO;UkC%yiK)VrO5YDd;4eR_xY=ao{1YI{NiT77nq?@=3K|N?K z7?k1|`09_nkP5<+uR_SYFXRgPF=FUn>-B-e5PLGBxr{UakYfErtclON5nnLTecCg- z@)a)F;z-g3}(xa+&Mxo?0aqs%ohF2b1K)uwfD}zU!~_L-pSUg+g(W(X>M| zF%npw41VCmAYFET-*hh@BN9CX&Dx4BkQ(M)@njFS>aiC`cAx73VrmX_kxbRCD4~~qxz4)q*Gfqu`zT$zPz0gm*$&8T9_gmf^57M!=(1h}ePK>? zc#`vd9GNhC%t(LS_V@R@`NY$$YJ~EnbC0+Jiam6I{_O9~>`gwEfMv!=F*NneQH$jH zfMnn@Z@19Az7QcU1!p3+aZA~R-GtaxleiSNqyD%$m*3YZd^U{fozE{@zS&L06nXU* zCr3O1jZq&3W_&PQ=WUFUdZ3LyRm%JRqa_$2z#c_nDNnuR$%kzj)TRw4`S6ox+B-o;=R!X1RBtwbBw`IjD_jBy3MU9iWucQ?R{hefjge1zZ!I`JwU z$D^HDM9t04&eu5Zg>((H*@vMn1ko3fQ;FRk%4h;W3$!~R zd}%=bK+RPUUKn@(L-*M;n6;WDD>nBRhQ6U+=8 zl79wK-PwX?Ec#V|UmAGK26B{*GS~^bIgevF=XTGIS|$Bfz6C$25nKC_2E~5Vp@HxI z&|O}$NgqrX+*&212f{rY zoY-L{*hQz?Fq|9sR4VF4M*6MqAmFlIocUe7R`;n%aFSE;d1wM2mlm9 zfV`etezEdY(hGZW`j1h@fh2LM>Ke1c+) zzxvBi59sSxww8I)I!eJVdw?;ffPoxv&H1&xRkeMLc3^f#khjju{OhlzzNNCjtR;y# z4C{PO_Ey<6ay)=?G3!n|t_Exp0Aiu?qaG;_?>w^aBG{Dthu@+CrN$|V3+6! z($~$qiVm`DUI!zAFqjrDm@8l>rMU7+e}J6$HGWV=D6AlFwT~275^lgz9_4cRp_e61 z{Qr}`;#CcN5iLz@pwfU?&pc+0{VsEZvwNrev0dA|L`)!+}1 zwj2gEP&wBxvl$bWzzpp@NU$ja#X2w)lv;6{;^22bHF8GQ6YQ#10aF9U2GE%KIa-CO zooTiP<;QJ}terq5VZzO&DhC@gC04$^1LF=3U}C8rw^|hQhxaBS9nFKhs{)QPC~0kOO9(250fLA*f`{^uk9_=jVRvhR;30DuUY zyFz(MP%Q+MC?t_9h5VR3O5^~9mGe#R^`}!rQ5qP` z7T_%4=3coP2_S0$3m(QW<6j(NFJ|Bc{Prd(pm+mb2e3)<)vwnDNnE@pxdlI=Dg|_j z_W8L+yI5iinD`2ctQ^wNHPt4cz8x-(J;M+J4rW_EbZb^uZ*U)(xkS z`41jj&}S;bH0O&@(c9S@0I86%7w4zJ`T@eTZS=l-eWF_x^ME649z*ViXJato_L+Vw zhx=zpp-s9BD6J!1#MX0)4@Qk69rAz{1MpJkK5JMADY3*gBI5I#Hvw-Njk2j)&ERG@ zsL`rer5E>d!6X9bBnM;b*l$d1^!dl|ZTNB!wVhlQ!ub7fGvHs$N{CL531)ueV*az8 zH)QSbC%EYWIgB1(#hp zBjn!@aI2Nx{|rO~5TKt)Vst-`I)P^gHV{xt8z4fUdD#RN%g;i~iOvm{w_3?Z!ps?M zOd{3f5wz^G6-`FGvs`5yXX! z)#?&7A}$tfPYMh2JV&-i!5mJ5bDQNX&J6l&@Yzser0<3?+%z!l_AIMOR>4P215eY1 zwvUj-1RN+Ll-NR)6pB;d>v%CPzuT|TO=9N_VWP)e=QX?)?g9tIvuyymT* zDOyjlWz2F97Sy^yG06x0J3mDYuc`Oy&*U8gdE_?N6biJynmT!{GWI;ovhw&2WGRlq za{QF~2oBHT0(wCF(W1rx*f%=kJekc+?o??Q2GiBlMlE3HW=s=9hFDJbRtJ1~&OZ=J z;DoZtmPUQ_>gF0U%Z?=KA4CSzl0QIk=(+(m4p@$V9y!6cbr6>4lgknm+@+>{}s1*=VISev@*AoC~(CShnC7|0l5stCpoK+8V)O>fWVu_6BSiAOh5?n7* zB`8y zK6y9kJpKar(3jnH68L=86Wc(HXR~Gij5lF7y-j@v&V=f8H!gbGfsg2Kz_+rvEIb>t~?mG25RnC zlol8*PH}+YlCy(xPYa*&YCFF^)lEAG~U%+7L0MJ4C1cbBI#b0P-IXc$&fiIZi76VnH0bLKMA25VbAhx(Kv>ZSX zA`I)!&bR&jE5M1EOLI9YEFb6)p!5SbH-Im2x?PVw+MO31w@52UidukzFsuCA=sjm( z&EYCsEHFy~|IoZ4F-Ao~*oL*{6kJQv$MGpZTm$b-GG(Wz4({E1uK z59(Zj109q&Fy+^HlaS@U?1w0nlyoAn1{A*`aRsMbUiANLnZK64L_|I3KICdU)MtUw znQa?U{T`|w2*~cAI^R=`Tr?2(Xz(!Z;97Nnemx1uCUE`x>kYMijiXQxWaI&7i@3+F z^d~Uxn?ma^*6RswaU=&s`8D1z*&o)$?gUFh04IU|82OSyzAZh$zV6t28k3Cak(6}v zpgz3wMBh1xkQew;v7Z+6QjY(amyKIxXU(pcr5AjJw0D=eP}9hKq-5Qiw?NR2?=#KV z04X54zY1z4StY7hdAA-H#M5u(#sLJyo*!-l8x1ZK@T1pvmHP3vkPT<${?kE>;00 zJUaig-Q=55XOK2na&JU7*+PdyAmiA+Vm1iOr03|QSGJh(^XA;ilw!rr4q)_O`1n+0 zkGpypky&w0>oz)@=-eIZYzNW_=z@H$LZjj?fm4XiUPa>Qgp+erfmO;@pOf(bk{+_` z!OZOKTa|11{13{3A_=mlA7ThfC&4?ci)22t5IKuFL!;b$i?2*L-H zDFcbWw>2szPN^l2CIeDkoY{ zur^!66MH&CuX(GXFUW!lMffFGsz=0HVe%Bn0TRh2plJqn^jk3)P%y>Lb{eregjgaT z^`m=$rx8{bR+T*2O9FBZ0W8fZI#FyGasNDM(h(`^h(#bpAp^fr7qZ72gR8(H4GMNG zA_@X?(Su163Hy*S`(u52hhJADPx>N_-dGWJj{?>1*!%cqa}0UiN=4u(w@q5#kw11D ztIjL+zz5WE$=y(uCOj4fXm+Glx{Z4FMlB}74>*9RRirHUy+%kNW=mKct=CWOq?P>{?D-5lHK1{2qTGJ80hrQ+9H8+8 zxH3Ei$XgC%ao5DzroBJ4#;s#XH$rM2PoX1^g{j=4CE(grJIDmuDklhVBqlC(t^yHR zy%cY)3}DNF68<{SJt1Ky&;wvnzU#^oUveG<2;GUo>Qsa*f_iWunx7uYLQy$N&Uagw z*M~*dwp4wz8R$AGmyP4hhyt&+;4V>cvde1YmK&gRIUmGmtTssa7aEs_wm~xn2u9am zudfu2vx0{6Bm3v-zt;P!C}%my??8suET`lGN(%?|NroFP7!*oS>8R9Hl>~q3qU@OM zoai_Qu|g0=Pkg3;?*iI;6GZ)Uo)a06YZlBkjKqty`W&(3_aZvBxvYI6XZbGgpHD0= z>;PDMP{Kn4|5B6-l#$NOEyfwr6}@mivXMX+JQG46X_R(=!#wLzABT;ey-(U>T6|8Q zBqoGLN5D=eD-`6wR5+{0UNm8qoolpf=1NKX;cQK9)KX}};T6bQU8qWHR)X|tbj-^Q zAQAn1OBZx_8XqWr?)AL)+an0*GrcZLJ}UL7t(|?Dq|>{%ahvuke2&p{%Hz6zsY_c1 z*@F~r6#m!crY9SmfdZc{;R6z#2)9v_3-pPzinWiSS@zMt%?TS0))V@A^21|0GtfyN zV22lCK@SPg!}F(YNqo{pm_T}R39w%B zYQkDz5I}4K@(2A_f%$N2ET{8aW7&DS#uGG6q)8<<;!AGeQR@|%wEyY%#~%6zHwpp$ zB9(P3*bziitAKaXh)#`%quzZJv_lDVijR|=5Hc1(5ZA%aVvV}7tQ}jxSMgFxs)_lH zZs=l-)x{c!aG|9RcBa0Fy+xmO`$zl4>Nzxf_R3dNonaHsuYTRyy0&T+_{n4pb0B9A z0f7Q-$>1DHchXZHeUc&lQ=nq#%g2z?OJt9$903HwZX~i0cv`$H69#T_M@fb^kg*O6ptBnG zw2r)fSZj{L%@OeN{BB`AY+&yxWKkAQ?t_Mi4=8U--AU98Cv*MKNwFhm7|76HHxLg} z%W2Twn{MVho4dbn(kF_0yM^$l*@)Y_{4MiKyTb92o1kGENuoZ~v~`g1Nr_~>2@osSA$3jH5iuT` zcBs>JbNzI9SJEmz)jN80Ds9%LZ1sU+Y)kB#*e=rD&XO4h3zD z+-8J3XqY(~f$@P^>&-3i_anbf=t&!i0Xu)AYf~t5Ci7SFVqQ{2dds5$>XYcS>C{K& z+Z9O#;1D|k^OJ!1;lZuD)?f0F5;8YB71#L-GN07 z$P^8*_GoWxWkZ^dn?C65?s^)XV-s=Vt^v?@qWGPyp_I=I!D+9xHmHCI_Rr=(4A(Ig zBSf-&Byy|z2M-2Bi6jIpodJ_tn}Vn`0nPD^#9!FChTo8y-^Ix;^6&&Ejix2*pPwV^vs_tn-ls?m2GNwP((n>%6 z)1>|Zv~5Rc&6gL7AGDtV7uy4j)ik0YlLQEq;>Ju|ZJ<+n&i67UYp>|%Da3K+D(eI@ zG!go)NL{$z@Q4FvG*$w$PB*|{2%y?YaD^u6l9OB_DJ_x3PcN$8C;bL~a3)bt8K@ft zV@p5C<0=95fi`Vt7z8s#(Eu=Z$jbyk)r~SR60Ke0?ggB73F^|Y3xN3ys7Anx18GFT z$cmD{7?X4_G_TSY1?QfGs;OTIL~w?ca;=;MaOKeegmFVT*@>>UfWpQN2$@#7z(1X% z@|I%M<J|%3R-`Jv?4B`RSI7xpc50?5cxjiLHT>z zAA4GRFwREfIciq=%ynTlkr1R=&K)ylP-=6VF0yu@ihZfNGq6kc7fZm8!CRK3S=*Uy zgkXk}%KVdv9^QJcLm&+xY{)sN^;3Xsqyrv25&CH)oj5r52ZRAQ-ON192Axwn!j4s^ z#IaTh5&WWfnWa=kgv-Mkx0O>`Lw3K+Iq95x_SqRVUx7v`p3^`Eef19++@BBO4FB|{ z$|*Wv{3?UpDb2Q$L=CFT1-+7EyYs>OvoATDcMH?-D}UFbj2w?JBm8w#ZQR>p)(pKb$jNerH51xI@7}nf5&jamRtMO8pFeM&pR7Xg+C^(lv}b2$ zw|-1mRMp+x9lkzp?yOl>#m{`U*-W~6yk9Ru?Qf4Xx9vXY@%sJL{|h$8+I5B|Cns;u zzu)&{=cY}U@)jL6nRoWY36I5=Dc(z#y%CMEUc7km;lqcWot=U4F359=d9O=LL_|b~ z{idSR%flij1-XZOeSUua?Afz*)ob+MOp42tvo2c`(_8cV33KI@KR|y2Q_An(zXcP3 z8U5n+)iR;75)voetaRlUc2}$Y_jWHo{<7-Ios46LO3h7`9PBH*IWB1Lf4%Tq$N9@Y zr@M+4TgL4uSZMRjr*boJ*g2ie%n0IvZ-Jd4+5KL=_kEsSb}gO#Wcu{gvVw-662tON zH(!}Aw4osD>e?%M)3%(sq`P0l_D$~PjiIZvZ)}v^6e|0Bnc2VJO1u78JI%elFKKhp z>(VtFYB(+g-vbU4omv?8xMaHODc3J=FIFZ2w?WO8-Irz^vb@_WcWRrl@6)i9ZGFdI zE?UUdp8J#S&5Q6o&-zL)9rG&`mcOx|MRFn`LBzoc=H^1|43Jf;qDLJ x{0~-jOF-uXj)Kt;7!3j7G^qZ^^$g4mm9HxE&;1Jpo|wtN;OXk;vd$@?2>{KC-Wvb_ diff --git a/website/static/download-icon.svg b/website/static/download-icon.svg deleted file mode 100644 index 1f6649188fdb..000000000000 --- a/website/static/download-icon.svg +++ /dev/null @@ -1,14 +0,0 @@ - - - - - - - - - - - - - - diff --git a/website/static/hyper.png b/website/static/hyper.png deleted file mode 100644 index f8ffe17c99cef5e742afb716dd2f91ea835ce1cb..0000000000000000000000000000000000000000 GIT binary patch literal 0 HcmV?d00001 literal 33099 zcmeFZS6Gu<*EXsV6lE;|r3nfM3+YV(6{J`I6%ddrp$UROC?dVaU;!y2N|UN0oq)8^ z2`U`}(mN=+%odnQj<>wUlP-}}1u$v)WEIuQfOobwrTlzWVEkG#~pqw?o5wqpkl z9QgCr%^Pp0Ip`$Uv zy1o~8FC2>Y4OjX>L&L&weeiYQ4NdxRT^+_R)JnO5*5YS(rE=S_*F3belH2&t<(DvM z>O9b9)Ve{fb>q=>9cc#o2P4t68|!fFY);~0qHn5qs_m?{yl;6~`D|xK>t*@Y&9!*# z>jEjt>-h{^icbz4gi+DZ|NWozi0VfvwpscA`8&!V4PpKw#;E`CelErLZ(#oD+tP8j zPyW5g{(opNtN*<^=?|#e$7nEueRhKC|8s9HuHN<||8W+|GJ*nJy_pXRG9>@kT2IVW zIrsPak4O0Q#4PI#F17uCKZC!B@BiBL-v{_dbpPG}q~7WOs?gs`@vjk+UB=pQ)tFPJ0a)qkPHKc3=WDDf|p_{TwzbI*UF#J^DD9|u87 zI{t+c|3ZoXQR(>?O8oyGN(gc92L`pjelP1L#SLTX5^d&~Skk%z^ll0LDRTR|)3u!r z>&p5mbA@4xxcQAqtpy~XY-MqUvfEcpw@{BT^v2_4tTji^Zt;}A94DWgZ|A|cOh2~0 z%eiq0!%2MQNzeWERN2EmZL`y*G;>s*BX0PP+)9)8xEdA{Mky7d!m$VM?N>g^s9qUu z7tI(W7T@aK3SP#0KaI|LI`%F7Q%a+nW3&R%T9zct4Hno#YiUsSk2+;dOr^|nkpO5O*>M$3r2-WgMk zrj$<;U`XsT^Gx|1XJR*pVdcu49ah$st?7lZRQ_Jgb_{$;zwVMkSkq;hoY&Dk&b#Sj z1tY=ux-vhWZ6|)(u2J7?^rpzLg-{dQ)bC5&-b|4}avKVq3&@`3BkhaDXTnAOHk+)a z*&zedbOsOHVtf48I^{4C!-aLU9edf%H`!WtFD#&CH%>J^i7joL9#4-^F$kHStu%9N z@ATez&@(6E_#=rgtM$P~2OQh@Drw%Ua^g?I%7e9c^L}1)7r!hu7rb7wclVP%<33Va z`EW}Os=IcoDSp;1IP6|d7P#3J6fa^v{uS;T+KM}p7)OlMd_e2eGR>e_o5X+{w_RQ0 zu?%s=Ef&C|MZSjbcnwWynD{w8uBexuJ%-C2*t_GiGd;KV>cE^Ra&>8F&CwK7)Zy#4 zZrRH6+!wsbbL-@YMnOail26`mb*;&L&#`jF;FsRRxBYx%>>DA0lJp-WW^^qs1-+cd2z1`!f)bHArW~KjKnah&LES4wQJYJoLXgz~( zzk?)VXDR~x;yCPt6TTUiGNK|jN|P*uYmmFUD;*=bh4=bh+6edFGg%z5FnqA?80CPL zsW3N`V7Kwuy^g)EOu2T=>OeG`bQ$~{S?~!kcgN+@!r31mwGfwx)4xX2h8%Yvd3{>4 zo&u`)J-GVg2d0ib_9~%;l4U*I91F763Qs4+aSLHw{J>;(;v;0O)jP+&{|r}If#27M z?vskZ_j|Mp)1qAQ0D1fm5!L37{PpdHX8f(~k!90s=v^%#n3w!PdkoHRnGKbJ+Td-JWmx-+^w3y&$FN}j$h+AWtOOZ0x2(zl8j9AmXcb~`@82$|FHD2b1 z6(Qi+`edA>DSGY)IyQu&Qd#KP>`@-EMht({q(}E+{rVObMi%J#lNDFnc4h+aA#o!G ze7vGTRdzh&o1?PjdrcfE++PR-WBB8b+Odhd%=8cD>@2t4#gOkYryVNTV4j?~r@hnV zdGhh0l#+TD=*r}X;H${4Mv>;mXWg3*PF;0YU@x`g(X>UG6YLUeC#CE+#_smOCn!(q zM@xeth-6+NpIeg`#k$tsZ+Hlk|48+QW{ihehT=M7>qKAdqw9S%-zM6e3heo}!}j+} z0{i*dFTR5IgL93d*7ZVqo30&VN1dmwDKiw9OT%qgz2|)`;vAd-SsrWr6Enmk%xy?6 zDJ<57%9S^if*Iho&uZHBO{nLD=t_7rU; zQc=Oz5YFz9o9%~%eh~g6FvAEP4##ag&dw`ZX^~A^X;n~2aH>1CK!rB%y)ZW)=V5| z?Uxe4NV3>;uD^G#QT1m0zN4;mWi~yzJxzWsL-NX%c)66k@K>^nCAOC`CkBrdZre`< ziXiN8_BMG4<)x4ML{ zSZR;cH|g883s8h}&8189KjM$O$evuhjGk^-csfs6#FZY%?L*`c4|xYx4KDVrc7Eor zCgqz_8&hsI-I-ZAv3D*{L=gCI(7|>@j@oX zTm`i7S8<-~U*y+gw2T_pzrSiw!H&-%aK@jDT4d%vIr^={&6KwKI_RHqES-pQA#9x1HfIE~+ZSrd zOvO95>%r}%?tbVt5oX(K;0X&M46{(h!tyYB8;mt})gSh)>I1N<7om$$kX4<1ovYEA zC#{wEXASrAp<(XtL7GBe(ZjfpOO@R6VJ8B^Uw{QJytLmPYztF4gQun3bsK}t~l&i zK#xhL>zQ605+sY8>&FRtyBUhAwZQK2)1$g?rZaVvAHHZV#2gs*Q?R?6&9T6G$K!mJ z7}c_T+{Tb)-yyougEVM)qtibVDDEi~Jeailf-?ERs##(8xHLmNY(CjlqBrAnF;aDT z1v|ElZ+K@4JMO41G1e?$;vB0kCwNZ28zatp!_-k%8f@2lri*df*sKdP9bT z#1rHc|2WFLP|vwW?+QZHKW8_r*Q?cg`0brbzn&F-JtpL0Uk1FrR+N_bL=cg&!RZt{3}#*v*@4S7zKO)|vB?okp&*iGnQU3@ob%b`Fj^ zNju|w9UlTXWNgBlqs27pIgvY`>MuW099FUD)XQo;aTe0DSs|bmjsxY+`k2E z2F@(S8sy{I@`DBMCsV+bCe64uowu^J6jta}Oy9O40v(x~Mshsjt{w^L7nX|cdY?{B_s!^-;jY1?A?`tThm!k*^^Kz}7Q&f)gM1lR6}Fn6;d>ipsU*>ca4NGC>O$>RA%$isH31I$^>?2d)Jkv13m z(wkiUPJ-x&qiAWDXJ^Dl(&{I^6z7)9d?F?l9!*m+rM0egBnWNrg7yKko=gfC8I3A=;0AoJQ(2e<6M3{XSpNW8Pt@G>9^g= zGM12~I!A9U$=w-LJ62G|j$gV_w6Jq z_|GA~=n?w|&p?q1qbT2>LdSy6d&R6;Ho4pIBJy7=c|@2md&Mld-W^`A#gzn<1NWax&&Xk4X5x@Q^+52aKrb@AY=rTbFt*a{;HT=0aOkTXY1jG?1 zn;i9$uLplmfd3OWDCA>W7y@#)gviDtWIYT^SmTZl)@{MS8b=l9V?5r>uvl9q_dCC1iO#; zZb-JeY<@i%C;`WbV_2PHjug=1m4_H0|0(_w#G4ab3Xqaei~P7S%1cLU9;=^JtgRs@ z#aZbJqDyP~IOopKBR2JC+|@3Q_^gDqxVK+BX|1kg_Z+@eSkqff;S&8%2ocC&h}N&# zbQ7AMz4Xzsym;`jDxpcg>ioiT)$Uqun%sIX&yaJgT!(zmQCgk%9zU)Qn_484Od2}T zt~v}cQx1p%2ZWtgfK>0fsHWPO?VUNnRQEMxjoz=#$&1+1-h}pTiTcxT*GG_htG~a| zY0P*W>AKFv;YzQu6mo>4#(TxGMo-Rg#2E6$4#3M42WUVJK@YZdGa4XEwu~+xPPNZP z9!sNzBuCY^0V0p7%<7Np9m^B2V1eYW$?8d+nochnb9p9-xo`XT?FSR;#zzfFP@)lY zV4G-dtl@RE;|jiCWz~L4-O)>%jZIMWykA~(l!$7;>Bl!^b~nfB6&l3Wn5{#*gLWfo z^GjRtk;m^&A>!sh5`P%W0-b?(?`5= zRyX(d!$i-?PxUhITVQPuEk506wkjexI*R2Kyz+)nfGY@+T^U6~LgZ6UGX!P?*79c> z+!s==tntPclXP8fcPT9CbFVDE;=%&3ftjzgV)4H(DV(r=Vb~l;ERy>ABT$6sPxeur z+Q6l@y1Dm25)^p-9F}lZuS(%bM&OY%E*`L$USOu{_Ny*cT1@AibSyuz=e8aKV?^Xf}@jht$k zY>J26RC`R3#FF|=lwz7aeB{>VN| zp`pPrt7(@pkY9`Yq71IcE8DwPnG-+y*?;@?O~40E6X>%Hh%^1$<#O=VhB_eQbrVU z23=|oJMviWIa#?6!YrBS?IMdTJA=u0_5Hb`ym^-Ehbx^y3`Rs+%<#_S#jvtqQhXy0 zV2K0i`0cgY`vGU7rJ#wvUIuk90A@m@&O^m52 zn;c@KxBHV`zYThxRhTEg<_#EnLtc()DKE^|&TB^1wEvv-1A!aQ?(D6Z?se_997mlx z`hY0?xYt9*JkQ!k;ZWbHuEtvwU8n%Eo_s!}M7}u1TU7ZB@P&*(wBW>{VuEJnA-XH# zwT0EaQKH7NCVPaQH0?W=Q|NewJ}$y=npu7BV@F@+t*wuhv6mtt7{LMz+}N<+7czGV zs%82tsmQDmgdNb%t6NMYA79uizx@f1+}pP3tk$Qp;-crl7=|gb9W@UQ54gbJDgYf! z(Gt`FBJE|EAT#o%Z}^4^XArCPA1n~r+G<7m^*?SF=`aOnDx6C6PE{4FbipXeBq;_c zN*fBzl}i|Av1Tx78~@+sY1hB;+*hPJgkvz`87ZQRpS%;&T}GJA>ToDuh{9^Dtlm50 zx7^5=2K3ch&r)q|oD@Yf17vcNU<|gFdp0lNxLuj^kF%0k?oxcErW<(jKKM-{l4mN@sjJ~9)zHthRO}1elx@P~)^Fxv zqC%?`sq*DzBIFqI81Q`!BKt_h6dcQUV3?9KPj-IO6MvnntD~k8{~YIt+#a|Wzn}wq zOM4?dGQUUoLT{tkI1OZl?^i)MZNC_P47$pL$7)8G7LN2UD0T1qF zcyAdk@dp zhIO8oaFYJi0_~s+Oi#CHqBD-X%<6S6_!W88BW0?yTfM|&4XP%tA8cr*4lDRAyQ)RK zQ<ME)8M|rh-q{{#A5JycPmSKLYQY}nh(oA+ z|3%6NVa&jX{;YFFKnJ~x@+dR%uF*rR>g^7FdMNXxdgthk&Hlx5oS6_Zb84rn0YcUX zP@W(l;7(RFLt?#4Q_~Qw_qxmIN)>CRZcu*)6-t77`RemF_X6tiU=H}|n1se}UMRwS zHY4c+#%72W(g!21RBmZQ=aLsM3SzhhiamD59bUzlqLi8I>U3(XSO+py!yn-syNoEA zR*VIxcbtA&ewzGg{zyeCs;%GA>ADE4lz*1an$9WM8JK4hPKDjg$0i!Ojr0_78&SB$ zRLDE1a`~gX9sclW+@OY+sWehA+XSGi;D2=H*XcE~tFJ+t{{-CpA%9(A@-FHAiWj)7 zmEguJWtp1ZuGwfs2}7abfkwSNZ8+1#J5c^Yq8VEjl-rQ??#GFS?%p7Qz&xq6zv}vx zwp8}$`HK|2L(zIjCPZXesm?3%(f$DSY$E)A?ArSn z6K)8>p39{BVkm5ex(0WT)xZYPT!;rRMR+i``}736cTIc6NyJDPI(zBRd;O-8BA@ys`jBB|DY#tE0oGD+L~oC-tAKyGzUG#76aHStUL=+ zjmI<(crZauq7sj?dc{;GI{m9RVK^@7?&k;x9y!k)=bdYm?DPt_*RKd|_Z#HbsiLo` z;os073`6Zq^s7el7P~uXAOD5A%oxabcCy2|fB`PSDKQY_7mxf+2kDh2JMaaa;ygfRiX`hD3Gu zXo!?dR?L8IW>DrIsN<;VWI11V>%V@@Uiu*lZT0yFNrfw)4{?%T$K2#fb!NI=Xc%nQ zc;p;x1%8ienR>k7%L^r>y<}`~Lv)JYEF}m34(bF5hj`=Xnes3|ZDy$n3Kppj3 z>>)fu7j9;KDJsbEj*6W~URP{vuYApM%F~?$Pp8h-Zx20P9u+qi>#4l1LC)ECqf*_T zRXpM&Fko%`((HL%hCDf}o|i_LoP8l5Xm$r2*STrIoNVOpjbIX?S>dtTCFY?YV_Le5 zBFc@{bl73WFp1}wF85$FY2`=zsU?AwNA*lDLaAj4O-&%$jpN53w90;kD(~ZATV;ky zBO=OnMcYo7=d$%EKE(`}&Qm8{sJxOMs2FwlkNRuyGw{~>SElnP_ya&G0q$E|)X=Tz zs35AM-UVSode+ZCG}YBXP^3&@W__g_6nouxbi^vPYsYBTE6WH+o!|Bx`01C0JgSJ9 zVktbM135*v6$FZE^R3*T{J8Y6+OGpRqHuRmo0z9rb%5eaYIDN<)s7vlMD*DgwPOsb zM)tZCLn44YbQYU&0&)zNR5C0@m{anwR-; z1ZH_6aHb%ckjVhIwB>e%N?6XkT)nYEHa*ZQOU4G}hfHHe+{_K%(C53g6KFsov#)?pMhws>y+xlu^PFZixOc3LJ>YSuT7X8$ycFF|Sz9VAgb6 z=fCv^5TYQd82kVqr5>tqfI@~EH~lx@X=!+l&pb6EK?deVIGEBaR7Y4KJNV$V3d>JHL^Ky_ zRjhnn{78QF{xl5td^GNh;)S0@9%H0^mwLm|AsrxzWq|8AuKxur1-7mM4m4nsrup(>PED?4on!wex+Gxe3IQDGx~I2T;_Y zrfT?EeXb6IAmcEAue(p@_*8!Ey?Dav@gaePJ=TvE@#tdy9u3Xyw)27#D8)qV@rS-roEY7Z&e@x#=Pva?)eDeC17IMM zz3u`bLNhPe_2z=HIFup-o#gnTjtefU@wAfWI`=thUagKSu8mGs+!nnFMeOfy!Hp&U zG=}sv;wl$sLRX>}>r0SPTUxWY#u&W6Y@Rh0qs)L?_rXKG4X)4csh5w^&=QUhLHLbJ zyh;%5-p-C?O zN=4?wg*}}?2gUB0|JXGmG-a9DQ**x-=?*}o8r{Q6nP*{$UqZ*|+hRov4>svP zL(uh}Z`W*vC_=8F^3avnHFNS@`3;% z3S?J@o3b83GIK!XrE)hNX&SP!jXrvV3$f&}Kh@X(jK1t3dD-+L#SpKVgW~2{M{4Sq zkKVxIOe74lx{v`u3Cp^Ap=9|SKpiA49GGPdE$oJxOpn$R;o%Cbcz;L~WaS>BUUm&Kq>&)ho@AIC=E-#0YtsP5aH6!l z^vDhr6KVdNIP+fB>=FpzOh+a2-*b(GRaYy&pNFAIAHjU&jIQjTg*1|8RbTOQm#Iby zB!=5ZYg}@at2DJh=d{XkS~aErb5vv~y)?eOSr#UOvJ=_%k0XU0aCM*|F+zQS1g;g) z)F2%5z&ulVd)W@=>E8ixy3eJ?=d)g$DZ4-Vv2+wALHR4@blj@)(ucROV9IXK}KMx z9pRUz^QK;v>CXIqvo8!loPWxM{HV!5^kk1jiqJLxBK-@?mW&Z%w|PIW&-O9i&}LBW zIwuHmWhPa*w)e{H$h!VS(U>|)wE0>#Yf%^5!IOA)1xyaxV!0qJE<4G!Zzs2RvH{&| zN=R442ri^0LgtYK%)`%C5Gu>*sQs)8u!zuOK2cLPz~EqsZygj)S?dWBv!iO_qxW5T z7bkTHEqUdH-4M3W$5oeyELKIc-(Za|?By^>_tDj2xwy=z=ZBOO>G49@uiNL`8SNr5 zZMG(P7w07-UKGgpH|)O6Er`TRwOjT`C%rOo=Gbr7{g1Bj?{|1n$66R}CXj)-rU8xg zuGKVjRR7f-7*Tnirp6lWj=i$IA~hF#ouL6UY_ZodMT2Sjp*#ygy-7om2KS8SKx%jU zuSbO1(A9=~yK221rPtJkwcBL~>302*%kj);{y{-4=dLorHWuu9&M!t^Xa2b?Tt)$I zBY?x^(*^QIe8^lL2kfovS@51Fe^ley2bb;2&{b4!ipwaSb{UZaDg9mhWY=>3oF%FoC3bU0Zu@wOYfl5g zTqLS(Y_<bk1$;It^jKy2Lr7WPU;l|KPg(6l&ToEv z=+3X2x6IczVWYQhv7~=PsKNFDkIjpG2B{?uIDVuw3Q|wYE-OBW~jg$DuYqg zF?g&j3J^Eo1>x|#SK*?|OaT74ZF; zB_OwY)Be<;McCRC{*%k68jx==B^h)TFGe+ zr)_8v8NrP1H8RQCk<$N`d8{V$o@xQt+-^WDo$%)OJ^|k`KHW<8H3*nf9R}qhwof_v z#AD->is;1a({igT`!|9kRXT>K!%wZ=d8zYE|?_y7CP z|N9wnAl-lE_OA^7Khpyg(-FOV|9uaj&1hf|D%Cz2=Qu1+0FsdB<;Eoz(10+tfu?UB$ek!!|`?V_jJ>T2v6imKUTVrxb;~^D^FoM?#SXwM9cA2 z-Ve1x&$#v8ue01@&)B*+%2M_FxoAh8{OL#42ScyZ$rTbiK;KU~)%)SS{<@K$yRxbK z%YDbt#RSD1rLZx8^QvRHM3_$2W|p4J?ZNJ@ZJ~;Xy%5{wn+t%*u^{-<-q9P*#>O^F za3HSrXh;y6DZF3$>1farCce?36hRfuP{($5H?SH@K??#Jp0{_aTxQx=zj5x0k8sW< ziC}uU7s}>xX5yV&Z1#3iFIEbm^P2=0THPSHeGpc_ByNtt__t6>4m5!Da%pd8Wu>*R zvu1q*v}9+{j=l&lKrL)<^;<7k-}vW~q?)#JYbg{#fWJ@?Jz!U` zvjLidvT{o=HPrGNcI=CXq-Rh6EpIDON{@XR>%4yus&k-@&B2^pI9iR|sYiYf3&T@d zd8%{Wa7!ksXo+=|D509DkVJNz8Sm*q26s--uDna#|?G%pZEUcmtalB6|> zm;s0K9p7vVndUeXHu%OpZ) znw9n^=Y2Cv21#1-O`m;E+zk||edu{WXK+BsbgRkSy?vv_f~Pv@v+YNFoK%mRDWN_3 zuF*=0n6Hgtp|w`eFA3XOrd$stLZgP?o8jfCVi%%xcR)=01~`=%^4PCt)7|Al(1LY8 z!+cgJB#^Ly+}l`PN!q(2w_u|&NAUefw~falcgMf761(sV$lWPqJ7}fHlDhY+(byec z-!b-)=?&fpN(R~}Zw+vd*{_!2$Lt2lJ09BchTJY+}= z)o>M#J}J51yW4n;Xrsrs%6`3I54ygxL1M&ieO+KMP{*JFzhj0(JJm0Jn{Xjv#1Zs+ z-C~$FPT8ALaxj`zKpim~*Bt@)N|nna<`H*8z6UYrYWOX`)y}@pgb(2K^DwOP@!Z}ybo>(68IPZ+h1LXF zl{2n7{Z92~225-DbL}yG=S(~1`da)qJbdrc>#*e;GdwO(xD-JsDtfwguGl(53 z3WPSs4o(Y0^E_j}t%)rs2?B24AH|>*d4#HiQDm1%_MG40oDHdMmQQ1qF$r${Hg&Fz z-9>By`~w5PHI_9IaE^W*yK=M{Wq#~)jvvE(=Pee-a;pfl5@8A}-!BZ*Gs^ZE>W0=U z>@HbwaQ5`M_87DG8NzFSh1#LBm6-)y&tSXs;8OWocNQ$%^`v-Ak98?Hw-L{Y8hge(+@=eN3jg2=8d=tH}A|$m&7xgWrks$0c5e)5r$|&UX}F zUo?HF@{6AAyP0oy96zt+xL0Nw+fu3aojhDG)slKvI;VWGY<;Qk>u(E=0d{7&&7V(0 z`L6sr3SMow*PjhI-7YHYHcVV}cTaF$?|WE`3{!OYSjIfzcG!tdVdoJKyM4E=m7{Ti z(rUS%Skuy?#I==3wc4Xe?vBi}y;)#-%`j`<;mNo`{2F%Y= z>{bU#(guMTw_qD%96u>koF|HnzTy<%c+Zfki4oQR6xzrT2$Yjm^Ucd~9B1g@9 zwtifvOUdZJdRhRmm|us<4p3;!hhhjnva*4Vxjp{drOCVZ4*_l#TXql66gY z1g#Snl(ZqKkCEog)U6&_5m)K6ZGYHl)Vl(U{x}0PN)GrQo zx_W>H792C}-Lr9l_!*E^zpv^{QQQjEZ85VNy_vY1)D)RsrK#!s`t-OAzgU^Oj5%Ji zM$B(1SUcw$gPQuoT)jf zVK=f(3Oo`U8uDA?g?4@U>yB?1vH_&qg8hDbMt`RYH~^+{fy6hgbHTOUr|i(+Zf2aq zyp47%k$=MpWf0VOnAf4#s8~>_t1*9|tEOUP8L7M6rk9{`J-$V<#vgwM@1c?>`)eD- zg!to^$6v2YkRq+uYMaVRYr+>jpCu4fKl=_okR{R65OSO3iUl^v zR|zyJQDUZvNEU>j((fX2fbQ5jt8A@wYA&bTVRx-PMOAx>=*oehjMZ>`rUx>m{lGMI zh?0C;pmKc|5HnwnaDHz^E(Mzo9tVWtpSSoDBo`h7{uXw!gFR_?H7$)ai!xJvh|Vr- zIOwNMoIU0iCvjS(BO@)bUkWxy;)Ie2c;z`8S*Aq6Gl2HDfHwj7C2do5_SBpM6I|^g z0L5}0bbh~|uJ-p-VK!wHHUP9kATgAYJ9-0aSYlAg55rC(MVC5GlmK|uF_V^*$SoN( z6Sx#4lK71EY?n*1s%Yt7#$Gci0{)q6J*Eo2zi3Sxf&=pbtv9d42haSg%j0an_sI5e z;Y1WX6$CH=1^X4;MGZiS*Q-JTFrF5`;l*#C-*`@-dv11+G=#F+y0_DsVA{8jp@lCU zrcm7O_^+-P}0)8=b-x0LI-wE6p2US)BC@ zIDNiaf-xBz>%a>6#ZtupTMjdGGHLUM{KRj7KCPp-!1av>4)r<9^-)Ko#wH`iWlokRPO1!I>^u>rpy;0dEfS>H3oN4-8(>8@9<&F1g@D zFOb#12R%lYou&HL%!<4_uf&B+h=b;#`!qR4z~2Qdh0?VlSx9ML(^dc`y`!p;$FJuz zqrqYh|0ofcrU?iNo&(A_ir2VIA1Lq)T!!iPZBl$2*#0~Dp=uH_6ErU!P+6e7Ri0Lu z!~g_yXY7zj|8-PK23eE4KjBP2YQ+zB<3EC{-{Tde%UY`yINk%MU#Y7~eD98D$|81$&I$jUzMBIs4bq zPg_&6t-QcQ?l=HPQN-ZUU62?FhOpjfD1>m$EjNp4JWTR+vz4^k6x{y%(aN5f z5dfK9Ks{~8W|a5+%?hZ?#cKHWP|9?FKLHJWOddGTg;Zy5=sZy6n*8@_9}@jed!%T8 z5z4v18?A)FauNwA|My=e0brI&BINuZig_f4TgXg2rOmpZvxBX~NiBe_PIrjt@*gKS zfI0>z&Hy|T~8non3qP9T43zt@fAU7oc>+IhRz!5BD_$U$YpHtI(PXn!8`88vR zhxi{SP&BIpM>y4SIUMrGf8Q3DqM1CvSSuO${{L8q^2rM%epO7%%m4kC|3`6~A?jT2 zP}nd3c@dz++U+x24pqnh;{;EtL%xcPG=jd`C0%R*xeWdH0WGc^9ERzG({2S=`a;7=JAELy&LYBAX@U%-({(m#eFvd zp9|_gGx)t-e8;&syEjA?|wUn^-QcSes_g9y#iD-?|Y+Ze0sRc0UMjA(LYAv1q z7~DVQ7A2S9ZO`%}Z{-u8oB&;GPQ`N5t?TGZB43jqafrqAdrl>EG@GpF7cMsmxf}7O z6m=U4A?@>OnFU^LjqDLeRzWc#e=cU2j^RB>c&%pOBLqFXhUa^xgPNCI9co<@!Khvu zKoAmisa0Dz$H}WkQ%-qU(tPJd>=w@RK+pET7;xo`PovSY_& zCAMdLq9&T*GZA2|mR#qt(2J?8HYa&XFe853jF$6N+lyQL*<)b}RfrlRsuvP>MP7x9 zC~qq9dp3&{e~M{mO)lnU4IZ)R>}4PR{lW!IhD_Eo@2w_>e9UgyxVnmMS#B=b12qm| zCDV}g9gw$c*9m4q56>n3C-69upHKfieh4s{aS9VZ(kbef0u*9HCXTu;`l422+IWhCYhY#zq za&Nojzoy0hBWjwWm=n_ z&e|x|&8&UYV(#=U=81aA`reQ6biUKqldqw7>gSVKC79=8ndaUo@%LS}&*R^F!S2Ay zWXoh(vn`Mo-)@4>U`6Zi42PW$%CFduU(9a+3y3yDYKWGknVlwFsrPC-OAOv$>GlqK zkNAjY1@uQvrI-^3JGn3h%{JLuS{F+7gm;bYNboREcG7#WXJiLAGLEgiwrL^q+vJ&Y z0#Bp)GaWUl5D{flQn_Pm*JJP53IOb}!`s6fsRq%)sf@ehdRy!$HY?E_i6F49F zBxyqSLpdR2*b&BOaJ&Sm9<;*Xlqav3oxzM~P#SQHt!pTs{-)vCq`fRtkL)iPere>xCSEt5Wv)hP zkPXLbC3b*4-p$5K(k6@G3Jh+=T5>BKH!V%*k&^YyGqT6z5-d#&iJD2CON>3)q4 zCI)sYIfq+u&PP$P^CGiQ*iYVT@0OUqg&}Ib?k&v@5ww&Y-w`)Y|1wou5$-SMckWQX zh)Z*-(`lgz8*L1$WuB^8S{fQ54vnNB328_{zou<_pXn>-68~b;z72*|*Vdi#4iAB+ zj#TIpzg7smS;`qbrXxz9R|lu$FDAIO-!e{ZlUMS!Fhu0Jnp{xcs9Z_F+bNWufAuop z$_-zhORuDU$UOb=F=SKjN>J@gFg|%l*XvT{r$!b=q^ID&oK3o?z;Ydy-FkDinlITuPfB7nDy4c_+5sXYXsYKT{#L@7X z4`ntgr-kZTQ60ZeuVE|P-4m1%FVTJuV=(P2qb+IiOcT#+S;L=As>jng-2r(&WAe+? zg0wE_&k*rQ>aLBD_WaGCC0|gNd8G2vgub)|up6UtpB3JU| zPd=}0s4lLU5b^Xlg|ZFd51z?r!*V|fH4`Fyxq9SGggmMBG1K^dOs|~|awLjyP!mr5 z45h89V)XZwcEY+c>}tz2wJ*C#*OMIK_orwY7W0TkgR{5QScI6B!`cj=4w^@_8zg_U z^1{)GRuQ^#Q^_r(LM#a67db0W($?*P0dCy4XP2x5;S43NhrJ~pr&(vUgez+cIA&Xz zFYOr^$iv=Qzoqfy7Jm7Y2bM+SY|b`%0}kvoedpZ{rk=waj4p)S38vnWW$6y{4sLrY z(Jttp3oNM!ag|tNLUjWP8fNXJ;{2;)l|h6W35FB3+9JW>4z&?g9;}K~ub0M~XdWqS zl(rUKZ}9N4ES!-YUV2p_VsUjBjDe@|yM5g#v9eR)@O;2g#&iVK0~A`*^p&x2fX`ND zq8UCh!JnD5_3)SxH|rIKCm5#cDy!Cua&d?9H}Ml58d4%nD-gkeMh(oKOG)vmKm;ra zY7-Em(>x+=f}i{X^~eU5mo@2V*0Y`Ea$~1j8`8X$4Cv>${(Q`i(CM_xW$9Qmf2MII zR6Oy(spJ51bBM{ZK0U`H)2xD<^^~Jf>L=GbLSO)}_A-$MW6o$SEYF$T%)JvR;$P)a zxtbz|Q{f?j22W$2kW)hAvnr>yo^P+Vl1A}OHovk=ruY))O!3E@f>duj0=DMEN1FQd z{LJ*r2=4_?1GR*b4|-a6vW@kg8P>W>Gzr0S3DTcMWuHSdFJAlPq5d$~wQH2E z5>9nb%(GE-d2f*sQOs0d<7F!GRmi`o<#q0+TuUgQsdD;ho+c{z^ALA(b|WqeqVfDr zJd`=z7NAf5Y);UACbu+R9aGj*3MQfNY}Ida4pd@Y0nj1lDJ!id53(*W1{c-)l2ZLG zf=aD*oPnu;3F-SoI_^D8h&2C#AJ*hmwhWbelMUjBt8gk`3#RJ6&*)3O$&Q&s;{3y@ zxg@0$h7Jykg>;&VQ6}0PB$!ZSEBfhagyppSzAhiMVj;0+@R!2ZPcOT}qwY z3=ULX{QWW<@z(zS`EETmk&vH{D}JB%Z=@;m>ZxGMs%XJ;vvMGUe@Jw@1Z(*^DI^Sl z5%C{ePMvkt?6I)dsT%Xxv@V6)ga6WFotVtt~DLyAR`dafXDl(m$e3F z807u*2(bcWYv;22!gXgfUImM!iX8V6@<+F5X%Wk;sQz4fR^g#^lQG%a{2-pS@#F{H zXJVw5U6A+gC=0gNwQouJP3_6~Ad%E~QnRkM{vNiTzrbVJw8A{%UT=+Ltw)f#&#+wq zZrL^KmCS6q)>%!bCBF!*2&s;Z-ytGjW5Kt)I1ZYB#rBTIgR*dbntEO7+cO=qu~{W1 z6=6~Y^vcH4dOaIj_cZ(pD_3_58zPuqEHy#dG(>4S**I8V*l3^CM-UQU?omcI>q6hV zlKxyV#9-#kQJoj;VS88i006s`G|Swo6n-mjQB#fX^f_|~UZ#yH9q22K(v$czZ>2olG=%CHHs*Y{tYBKwT3GeDZt7tD z>{IJO`W4)!8^ZqKq~;T`9<*maMFYU}*5pCRp<~h3BcBtRn9m|~F)v|xG@2Gd!@=G` zU@Ac*FXrQ^t5KA3`xr2a)IE5q92)Y7aYn_kG0h=s8^T#nF<#YsNZ)qK?a$1|W1&H8 zooh19p)(Kmax2S^7P;Du9oVh7@RC18Q@Q1ad=M()LG_ah5?rQ@?7Z(bZ@v?kRFaT6 z%y{AGR#ez|E^eNb2mUYLg}rN=L$1t65p!JEWd>xt@d#6F8pe0NV56XW&)t5lYHxAd z4>YMu1vDm_Be@ZIH8PLK8#W2+kq-m}wH+q1(bdhB}z}) z2L?ZHFUx(G&(*WeyW3iJ#y(56 z+AVJlr{3c$(m-*~y+SYX*k+pwXQ;U_udd!(%YmsSJ=jF$gjyyeyfLvLCO<)Pq90pX zAMdT5G$r!@OC76bk z6SNc{su|5`7nG;2UdyA~TIU_Ff0wRZc;437aGnJ|ps$pYUJ8n__4S$daMCx6c&H8} zsl{CQ<^aBDC(qR}Z6khkB0~GlsS!-c!ucc3X@N~&#+z@yBPG9xBArD4;+DvE@hMA7 z%U&OTFB1hk011v~vL@ZiTH`Mtshtu=8^x8>-^um6>4?3nj5{*en)P%N-`GL#Olp^Qbm^PQAw6fNBJQr- zyBVy}6GvMN?j)bdNt8eT#1yCsuxYHr3EW6OiHQ~x4`Nql*r|1G$bH0~>EY!Ea=cxc zLPuWJ|D~^&Y#FJaqdsUcX#I5W=B-PuzW|HD9lgM-$J z`BF7Ywu$t(Ob-PynpPkox2Sj5bz9WyZ5jtq(SaEOA)E8f80hr(>{Fy{G(I6}nm}vS zPx4jG?1!AtQ!3VDoAJ!i8)cldA1G}?0GXq;0uq5}$;bCkg>@38ogHnuZxV=ICDFMc znDJNzO4DDI$IOVr#6oQiTP{uuuT#W>npbnSyia|eotUp~(TW~4`R@}f8s5Q1F@-xM z8AZ6QCSN({OkydwEHRGTqn~udImALaA}!-yx7s|guBlTd&-=Av>P>jA_Mm_uI?f!4 zm$#|gO5G?)$|LFOjF8UY)ZJqfJUgaVaU~g*J?LW<>XO}Bu9h|O_MZ^-0%@M2hI?KC z3am2aGiQgBG^rENOgV6>sp^Wk=VZ(6ZEwXr$|Z6!*IJi1145o#6KaT zaDQbODB!#a#yCg$cMVG*&CJV3zPWKWQoe>l2dogUM8JLs0ShPQJZs1rFh@`KBKO#W z1sVqInVrZtGt<3*!>0=E$FCeR>!$%a*mu>Bb=D+uz8YI}v>HnTP+bi5JLjEiOW7$6@nA4$JT2PJy8g(#5HyoKch@8p30% zcYU#iDJ>niK9L*|Ubd!WNL0B6yn0Yk@mVRbo(Wp|^l5y=x}7oPJYzwiMc~k2+KNo2 zD|%+~)i5AEm>PKi&F=v4NvWS!0U`*K(w6Wcu|n-6&L{yQD$&?gRPb-M*dE*ffHyv%(AtAQ_gL_D6YJH zvYRU193OrdBL_g+wQV)P9m*X|4lPdr*Qz2$RDo{awc*TKh`WCGL^aD^RBtB}F_655 zuCXVDW+NJ*3cx3ywAny^_gn7lqgHI{y_!F~l!Lb@b$?D#2YZO;M0bW8w^U_tTxCFB z!v+QspQ$O6OJ&@}ARY<0SNTy#a0) z=Ng@t*|;#s)#pKd&-;td${VoU=V;XIspy(W=4@Pgi{#o87x~holY<=r{$$H8mTjm; zoMl6m*&%%XQ=63i3Ch!qn%q~5t+$8Eg7f5DPKC5_(E?V0ylMuunc80#^)N(CH- z$BSefytpok(AOUy8;pUbxs9_K&M3PI?oD@6LX#w6RE!2uH1bGnE)&Bz_srsSF4OCC zI#Y=(HfwYdX(46CC8yr;=}TyPX_5}FjuGTiWloRuc_1h{*W}g3~;l&-l35EUCb2kEsC;u1CH%n~;6TJ7ThQS=JDg zmzy96auQPCkD`B8zo*$3j~c82Q#XYBa{m5$Yfj~%*YfR7#UDR$llR>D33 z`vhFsEwBODCl-`r%i!{K!Fs^usX;jgm!}KLF{A&aJWY=Fq!}3*jbiqG`R&~6{Levy b=NcnqOU^YHdS3;YxDm$3Z|{@cM=$;jU_t;} diff --git a/website/static/hyperyellow.gif b/website/static/hyperyellow.gif deleted file mode 100644 index 5816299acc2ac7f4fc092bbe4fbb954d7fc54767..0000000000000000000000000000000000000000 GIT binary patch literal 0 HcmV?d00001 literal 187586 zcmd42cT`ht(=NVu8X>gMI|LGXk>0^jq=R$;QRxCAA{|5w5Rh)9cS0|sMmmBTniNF= z5l}2N0UOmqQ8{^@=RMzf&v(A{t@B&If6ivH_S%Gf@0r;%*IYAm$HdH7L(}6SXaz`i;JtOs&3u7)!N$n;K76b{{AOVo=ie~9pPoKYh-PqjP-r4>3{m0L}{e#0_zyBNoP?Ufv zh1{2jWS4dup;QiBM`O)PP486=rSm8UycxMyJ$wUWm?mJ>QZt$(Y2V~F+EV+ZK*4LQ z)U36x1%&fy%#F6zKd-y-Xk{p1T4s{7TC4WZA*ZnF_=P~&5*leT%HpYk3?feh75&;_3dSo z8v;B$Vv;uvlF~TD*xIl=`0VSLV`p}=n?2ONepXSDT%sP*p)v2S1l!<5;OU&}rzoZ( z@q*dR*?5lBXN)ZgytBLWg_Xc0L}=l=I0mgFOGp7FN(+QyWJ}$tTAP{x1e(YJK#=Fb z34LVb=y{J&8M96XZ@KmQa||h67&43O!30107)B{Rfk8ARz{9fC63wFpC24 z>|v~UZlncrDxS?|X()wpf6`s>q7tUXFyHk)lE|D=2>51-tpEigD>Fy%U^6s|Kx8#b7$Y>K zo#-}Ab(l(C5|RG#IN*|^kdjv>#SRc*GkkU(h9r5S0M?7)HubRyjM@R`GTs!(Ui$+| zE)d{Cg_w3Gy#{7Btn8!_+oIOJLDrst*F-i;s!348nyBI1iaGxRWF+`dvRst4uoH8{ zAlbHNotzLXo8qdN+Q1OlGU>}7l)gT5hD8I`ITAc1SRim=E2Z>_PtnDhSLZ7;o%pcz zwGqJh_FP8#q|rHIo1BG&mFX$w4vdO@>nkpI-NFq%5gV2OTm|D&jO` zI_Jv|)mzjJu55N4Jv-RAg+AB2Jr8@HaskFTnY!~dborO)9XL2toEf$N>&Ou@xO(*c z9`-I0Jc$Pbuoemm{j2~7C@Qj?b7TB_np>SN$Gr9w7oZ;uVI4HlIrM>EOKo60*sFhN zHT|6M5|0s;Zat0&*<@oOE~wz5QpN~)7zS23t<=!x7d(L;_-W%s6rA)-!$ZUy zIWW>jNd_wyF<~hKvu`NZ|15|AMC4$}Z%WD`T9ozXNE=p(RoFb%letWCD8}esntqKa z*N4kPa^kk>XTt<|2IjKlv$utOb*eds8;qacyO+6UiWNxz@mMq4Fe@UAPH0!7TWiNQ zGUmW*{Fmg&GQ5T4gTskFi5xl6qwc~HcaKQd6vn4kWlwZdzL@NQKupZ zw+`h?E8F?TuJ_wtB0+lE3f5 zIn}R5wiZq=4RYK4!!H_oe0F*zo!b%G{#E~S`l+{Uxt&+PU&P02yDlE&bk(bF=-upb z{jikNeK$Nvw^IA`$FZFIo$VXi_j*o$ZOQ3*^!<+3khb*}b3yNd%I4+Cd8_a81rJ__ zZH6vhvD&vTcsSj*8NSVL^*gBG(X(%xkzlVScq6hd#!5Q=rvJi@d{-fp^=3%9Wbtj(n8qQ!&zVtv&l3#BQDrww}HnmX&{RCSMh-&mia;;4Jd!By-{b9;|9p54oe ze7Y=jxHpXV$Ada*%OHAT#MHVayWr`Hxc2_2O;$^8z2yh#)B9u2&sy?3pMH?P^6H6E z^1Z@g%T=Y4{ilA`t;MrXSJis<$Ahz4OV=#dwC4ApMLlaR|M_%H?{NP)fw_%LXSHs? ze=w0^-B!gtzHY32Fi8?J#r#8~=xG!})&+0?m}oyl+65C66B`>FA0MBjq@RF8^5x5yqoX6*?f?A&SI1zo z2%hCDQC0rk(zkoqZt__6F&M&wHIy7Y!C-*|aVlPvloD2DlDHk4ismp3=S=MAl{$m` zoAM!Oi_5zIOV$M11x>QRz(ATJw-ew8bF2M3zeasNT|ebMXNG94)Uu znu5q^vC%?H@NY4A{<`Plzlk9wB}KdKOaqvpxr4O^RH+A_0Aa>7-*!KhldA)!N|(W(kQZ)mX?i;4UO+cMMcp>NKa2M zC@7#%DC6VfFJ8QO_3G8~@-mHy{`~p#FERex1FlPZ=hT0_bNSmnh#ZXGFoQb1jgeCB zBIqueP*L zKVFK(Vrdd9C@9b*Ha0dkH8nkb`ZSHI`}_OTsCsN{Y(hdpW@aXhRu>i)*3{J8xpRj` zt7-l+Ffc%))h}PZq*--oX=!6)V{2>c@bHlKBzOr;VsA6JPg7k232|p`sG5*}k%|qWMKWKf{n?K_>&Akz_w9E5tep7iqEcQK#03OmW1N!#V8<8q7Hs z$=yW|4VajqKR-__Dj3HDWoASi_ZAaS@x$`R;~dj67~x#*4(d5#1=tIsYPtd?ndKmd zYmiSaz?ftW<+9|HFUF?d=5o-H8G;NB;Y9wn2isrvh^M_l)qh3pf3k<7q9V;6wCd&m zvdCgOmg$)&HvscU%!5(ndJBH-|)A8*~7ow52X`$*bpq+bGy_jK6C1eMlK{? z3d0edhSg_I;rJ7ELw_w~@)v~5(pTw|hEfR(y4&Z@OaSXXq2XHSV3E*|&T0(n3tj*o z7e@eikfOms#ufkvlPEtN0EHQXc;T$fbR02)qDY=ZK3{>0fFMjvC{2L38g)|`$NQJv zxJt{(L~%jWRIES)?ovw|Bb+-XHh%o3#Y3@vY=)@$%`$9j`)H|y(@oB>8_ACV#%4b# zw=ciJ(Cgv1I#2R?{`vqo1;7C$KmJS{j~_pN_wL>5>gxCJ-)YkP-yd*6 z48RCQt1wk_Wcul$L=nUN$R&XH*%D6N06;_jmWYG4oNNb8KfZr?3{5|FcJ_ZH($UeO z31x0>{*O@M;o&rmGcq!0qS1n-x3`xDuC&PiN4g(Be$Y_%zn2bv<}Z(Nk@wRQjsKX| zC~e&T`Ei3TquN6NWm=0s;xRWKKT$76GokqzXK@JeOrsmpAz2XQu-7O&3LFHJ1a74< zvt2jp%ZE$K*%C;P7GaDm%y!~>ARU~Tr14J-{GAOnXc`sLbV{Ph^Y1YrBO{}vq(m$9 zX((!DW=7M?&CSiz(=#9-AT%`e%9SfL1!>4Y(~*V@MMXulg1f1yiKguR`}b+cK+9{> z)6+C$purq1we9Te{QC9lzgPMH=ckAxJR#UrmhZ+$O~`1VR>ed^n5zSxj;<-f!U5K` z;78X)A>Pd2>~3Ife!r&VPOV{wZ+K!@_O_BB0g zzzf`r=A(lO@$m46f!w@&9EL(Hd;;{j7+zi%XdyofNr?3>oR3F{TY%A&IWHP)Z~`Z@!D1<9sFV-RCM4jO zUt=f)E2%>60SWFoOfUgAz(ypUm5vQ?rnF>c@B%ywyb}OsL4d^o4H==tJJFp1bd0ce zmrUuH8qt)cWTLxB`;bhRO#d26DQQ=DjPYl7kENZx;_jI|GF~A$}D7bwU{M zx_!CkaUg5E;Re{09Af&s;&PHR;4$f2t^?K6Fgu96$b+c4?%qIb-14}+1<0=O1UN`p za}hqKM|bpDoo-bQ4t_DSJ3qna#oot&0k3=P70dcj%e2)r7CBi)yZ#>i(Niy zFWu&^*% z1SBUX|KtAu5IS1FiI(60qu(?+Ir$&%|Lxnie-h(AJ`VSw1^3Del3!EWAmt%UQ51ig z1uhDhur<)7jktp28_aV z>SqZ*#zZTN1pR=3z#u6GK5RH4l6WjD>z@GsJLzixjzAi~_%}DBJsu)SywUjND@%20 z+w1h!cfE%!$xEjBtEqLL#yU0_hIcGye`Ky5Jo{+^{;xc#0eAq-K*#?y%s;3{;|>4V zhK3QeJV^s&8rh-&G7TdxUc5-d2pV;ub>wKohXxQOB_-9>)&F$lXlO_Si2pL$;Ya_< zlTCL5KR*nXeI9o4ebk-J*v%s<`9Ha zYkhZqbFVk<`R3sfA^!iprdq!y8bgieK)_O1-7!fg0D)6TB-sZr19(tJjMU&MBVzh- zlmg(n06t~_*lbJ{36La|0tjmW^ofZ@ibx$Qfjmg0$06NqFjaVBE|%G$(0$Q!EKkm& zmyvw=gfmHE41%|5Bf7E$m^o#5*b%`}EqhBp*M5-LVdA4>gNeV3grmt>B#cOW3KA*J zffiYSfMb%5Ek>-1@kEBKS7{gM$T=U{QE{AV*_HKNexCL7r3b9LC~=gP5@fPypU= z8uQ9M-v1M){2HB&K!;ByrCrP+1mGbTLSP6yaO5zmi_WD-P&&^r!nanb7XV8P5DCE4 zpiwti@#V-R5CCID8)g@;DE7j#;l{Qn79g^EB&zvItKfKJI#Zi|5b`b$YfXKnQhZ}Z z)t!g<<-`otTb_r|=Yzzz6Rrxx>rH4L2SQAWohk z`Nh~sQ_rI4+}*t|a^Kc82vCqCRK(fjhp!8uq16Y3(;F;O#n2n=$u*yzkr{(>wb91V*E(s{3pN@77xcd0IYiO(W z;hUfb-$&PwusxJ4;^ph1chG^aYY9$wen;@Qb32n2&XJl(@(B9*#`@HCMRySK_$%UL zqLPC9Dnz+VHJcIpomyo%bZKqs5-1sY%_%;$PVjDg+O<{kY3#oT1Z^&h5$wQn+zUOYSI~>8Cffp#FuCY zQ0{AyJRlOja3AO4;J{Pz`BaEF{TV4_oE8(?#lPC>$6XK{oLp%L6gLOQ89E+uW)_Jk z2^1Fxw-Mna7xQH)8yC+>afTwUMrqX8*cEAJpBuEcy4@uv z4sk9N;x&S~wESJAc(ph;eJ8gp+ie858H%%3oNP=%JRU%6s~c^L8)&B^l)j{~Gv_wwAeD3)NtLfs8QP?e+(&i+s223Rr4BNw@8o!x z6j1ISyx2FukHT4|D0#=*#48u z+&}`Y(G_g-oY;A3zAgpNIg}W0vHQu&i;2JU;@gKsU1ss0pne;__RUCrcjM{5{?g#N zpI4uH1+nAty5W2U{qcLwvR*TylkZ+MyzIScG|DE9Vn?2!0wvM~3{VTJohNhmavbT* z$6Y3p`lL^HSxXtod@_KCa9TfjI!Sf<^m#6?IV*HsxlHdZm}J7L+&ikbc1eJor`L1% z^H_)BFVv%lzd!FZ3KqsadUTWuz-aAa7?={7Dmml{TaETJfZivu8R!Z}c!& zyNF#b_THBRhMTl7d6}tN1aYPYeoP6&6mqiXukKM_pXR`q+84&LM{ml2>mH`F(Iczd)rI!X8RNh4ZJ`pG~ zVW6zDJGrSv3I$QJJgf0^3c-X)y0NFg6A&SH3qq%ZY$MVKTP*^%=enpP$Fc76M7T;Y zFmKW$N1pNJFH}pgKh<-tE$j%1f3J6p6xM-~c30D~<6c)DfX=Y)E-PA?b}zFYSW@RB z&&gw!6SOxpj{ucR*5oCW-okD__CSETZmUJ1e57NZph8eY-pEEhHYx$iqyW^j*7oxf zprE-B=2Oj)(68$Vr?+xYml*p15?sM1;5MVm!rJ4>fQk;_QRp~zpGB6Jx*viqq<)2{ zkpL)*fSx;qAxyZV<6C_Ib)Jck0|cp~l`k^`YXfiNN9cNQ-`t3}jh=v_Cv=-xj}Z_$ zXWk)TIUn~&0GJBCfP(_i)igO6zv7ridTYQ~D{XFv@&U0DWG+OCO}8h{4nWpXl(Qx_ z@{<^koCtzy?xwmbXeNe19p#s(Ku}AxM&lF}BCr*=swMQ42auzP0Wr+eo&-O2!y|t& zWSA$a1c=bk!1!LwxL>@;SrUcm{~%@gQ6{&0Mgs%7joHP&u!S1?_P|CJ0IVqW+xn@2 z8hSjqX83M9n@(5w-Sf;?b{mm)pC(RMGe0vG5_H|q3}hnNFv-5>Sgw~)K1*vCv7@=^ zICSXCHzONGv4C;6KBV$8$=1^GJ>$0#Q{P~GjVyX`b$F!D$3GkJqpAg^+%o;HWO85j zL%jDe#pu2gUM-_;+Y{MjKE;|@#5f_&@X?Gvc?$2Of)!Nc!34>tWY`H%)uFkB-$QKq z6MXJar0P?}vx?>C!>|g~QkHNJ^vz)o8zuVbPHwH;s)^D{$dV)(>UP9#a`cqlgy~y9 zWRPT|z)=4Q0P^Ku-O5HbtWdmNhr!z_8cF6QOvn1F`G4F_Wte-v^Fv)Lwqpms_hON& zQmpr=FWX09d70^Iu}x~z%}jW$-}gFkM{vkN|A+TFBbItwO!H+OW&Wn#)l@T2Eg;fk z%&}3A)4E+21A3SfDmZLL0Rb=tQY&>rbI(bt!`|<6&T9P1C&F*X+wo8|RWvj5NjzKY zmA3~rdOxG@{A$1C{EeYpxRUO~&b`gJOJyRkqyUTxGldxRwCVc0v{Ta|&+fu?Nb0`+ zy1gOk#C=)Wy`?sw)yF~qM&g+e`&=i4$HfpagSEu7_2e~C_0S{9D*1S~S+~4sZo{eH zccO-$NP%Gmz3WzYV`fiRk;-QA+J~$cURk_9n6Za2P=exH)XDIPRl#Dnykr9$Wz~a_ z`NL|fPTKu=wOj^c-3t4XK+Ssy6CQG^ad8vfyudt653-ZTVX<@sY*;0^!A+>2MquI=V3PR+w%h0@Nj%T<$TK=rPxYBV+UGDz$g(lcXyAbbW z{{%H`NUnI7P72p-8lYo60h1@iGhl82+*AM|PgPR=crY*7q@Xx-5mQ<;0>Q#N@4t`% zP`#0Fx3W5W*Q_>U<`3WPJ?nh z$Ib;N_?Xr_xXF>m%vX}I6-oHXMb3sPK$4Fp9{1JU<}^I}WH-4N)UG;r2gp|vLsp8N zzAi7|bB%vO_66_#mR%bPJlk`vgFzFiV6MdC7@3i_2ALY z)k|IryBaP{VUa3P)5{`%GCs+D zHijs>$`+*a$IipS=Nf>lQJWWc9Y{XR!zdqN_UshT>i#pu@=J+Z1dW4DA&z~aZ5>CqB6Af$A z&nTs=v8kna>lOPYJ0zu9hiTpOaax@^`PSR1oh^QKC|2@ixZrNs&RXi3-6&1Cb;?WK znud%g>^hrRaii9>hlbHXVL(iWP8*k%=r=&mK#z&!BANvI)q2eVdSzbyO84*$r-bM$ zHCG0BvY=Z|`va;lKu2aalHV~}z|o+>Q=4aneYRST@gsf>a@Dp*!g|2@ys^^IcWm)v z46Htz*Y27oL^<0qIP|)RjAoR5Qe@E2%j|Xumv^kS=r3(^ia|*6$6a!bU*R^|u?8PZ z=qVu_zR?8;Q!cwO&?XyYmwY6*lxuCEqMVyy9_HyfiV;iA<68puzK8!3!-zzHlAs8u z0xmAhhuaRg2)Ssh4DeE246=a`7ZF|?AZk=@UJX1OEgd^-%wtp7_U&A^hDZ(?b5CD{ z5hKk)${r)?uy3h7R}{JAg5k#Jvh};Wi{pfr{0u!jG{`M*- za1B#s)h9+4&gB2t)IzsL0lk9JGr{zQmnY1tzFPu743nQc>}%!ui@f z{hgvge^HFMCoWn1VX~(*;zH_@XMaesZ-RJ|qG7DsMg6J(UaHnas{~|88cYCllQD3N z0*vGd#h|b4C>-4bvGO}WJptETq_fai*bFJ;rOI7W1{D%K@7+88($+m2!dRF9>f0F% z^!uc_V?+!vZx#YUQBjeO`VpcPLhbU6Hgf=tKmE;f^u=B5PDAXQX6Oyp(CH4@g*Rh79e21;TW%a%Bv!)t z#&(NUQ7{099aNI-&lWMzYKGe1$ggh#2uwdyby+F=_ll)cSAA>5&v(5(C*yPXLE5oN z@A~Fe#XCEaY$471Rn6l|q6;`VYLy>OM&#v~w^idkn4LR2NzFnWID?T*2~gNDEP4!) zsFIR@N4NmnxpNnL_fn4Q4|ADI$Ek>6U4mIw+$lmbg{elu9q8Y+}Lf|_b83CHy!VIGsLG0Xz z9!nCJYWzb3Ie4?uVy?exfQIpK1uwwzucmi2cB}6sAO>x;y1!u8lX{#C_?yt^-IbJIPc2 zpi9ZT8mipw4KhvP%?qNPvV= zE^CWIlz&-4zVf&3h?n8GXHr3{d75L69{vd;&h{QE%2cE>gA=b;A*dIl#DUH~ zbP9d%m}e7{`-clu(isRq4V<^n*|1lmH^>wDB5ym4QPCMtixv5N?-nlM)a$5{JafgU z1&qGzfT5d+hq#LAlDqp%-$NBkPRmAS^N^S)rSo~kD(o(;jb?WS)Kp#!GVKhi3Jfu^ zaljy@oMQ^Qm&uQv_)!6#6$6fx%PejgC5$`p-U%(rWk!jZYE|2llOnQ*hg|owL00nc zc>^)~&_}fj4<{1NS^pXg(h=Ei$QOo`GUkAxe5we6PP4}+kL(TW_p18gNHvPKuly1= z8|6`?sGyJyc((9WUUdIF?6EK{&hBc&XAULFdYpGsLcurTNxF1r7cjfvYnZsErj9_3@a1NHAlA zp^{|ZVF!qojxrd(;#P5|6k|#q2NuRBcE^|8o-MQ)3bd3zDHi+I4Y2a7VNd&W**zbP zeSXb&$dYT!apw7??CpBb_A{;0653ik6XA4k$MMF)ZM|Kc87&u2-4d&8>>l-fVCmm4 za6z7U2jTf#=r`s>An2hyYHBqsa=MqgrS>2~gVh~8!ioY8Z2U8MpnMrj;Xy+QxhTEI zB0a;4&%E)bK>6)MF6pN7UxN%W`wyR=m_G5A8eNZBb(+&pn+r7@MQB%n$VW>tE z6L}TG8;c3ioqd^|r9CB!%kD>J&!v_5>NbmJ>%J;1dsY14Rq5MT<-cE%-zq{Pr8ERy z|40t*f?TW1yv)-1`p)my6v6ox-TAgN^Bq^`yO@GwGvj1SrMwwM9$m%ul~L8{&Z16F z2<`Ouvc=Ax_sIK-$>$7nDUj082xE*Dy(}pLp@ehqBlqolppizuVqm5Wdz7QrVXxx@ zvvwPJ|JCjtogQXZ!q~znJbFjMItMT@l~hWxr5jnK>px{LmX;@B#F8xaV+C+7a_ISH z+1F*PnaKR2EI(8FhC$m^jC__;f=^wGnNui6SQi8JyzDth*00vn(V;cPIqJY3zoo+QohD zsW~^bXBIQ9D{S|v0*WHCU4Lqy&gPJ*yE3pk7b5Nj_nc1LxP3@TKgtv(OUC6aysyEEAQoq1mBv#)n=S z9m{LeamUwfWI7r)t-`*DG<+Eu_~NwxCFFtS7zTiMux&zoU(5}kSX0u zP8XB&oR0Vqx6#P_5$xKiPXR8s8J%a=FFooE1)fBt!+Kl6{I%vQDQ zqfOraYmCt2qV74R(o>VHWCPOOiJn%6&2@CfDD0-OLEp(MyOy zTvF52!@V{9*~@IT8LEem)4sI3M@PIFoW1AB@=h@C`$_ASq^RApb@_uhLy0%YnWvun#nl;NnfgY* z{!Lx3)9Kz{kMD}Ur<7iKRUigI9T%0(^#ynNCnoRJDt`ksGiB?@Og%NV+2jek)c=g1LW@{RK$&K7PH_^)5PV<)$g~!{3}W;%1pWnLGm;2&NWfD-xCZj4IdKjCr#$dGxkj%=_ z4wG$1GS~Uym@O4Z1c>+%u<~@<6tMzIVWCJW&PH5#yjbnh(%kjxiuh}%qmXz!Eecsr zB(@Xn(MtpRRxUV-GwajoiaG%ePouuHVM|-kbT7c}IcTjL1T))m7_}@7dfy+ugqkU% z58>K#OK+6C%lT*;7p@PbDsuT*v|UVID0+EgdQKD{+$BRm`W=%Mqr*RT&y!Se5o#fL zyqT&yDXf`;0F&uic9v|=L;a^-%8=^X&_OUk6wZuT`TP2fipOXMDUp5ryqYb5+ye6# z43dM4!%y1)RDCU8n7mCFrV>X&@V=?EzN@Eu0IVd!x-y}^Nk6_NzKN7s(2e`^_}7il zXE9JVXL9@zU6nz6EK+HXoXBFpQ%PjEbFNI{_AIPS<`0>xye^!;Q+6BLKQTT3DUMB2QS(Iu7BjAsMo{)Z8=?Evm`3Psp$Vf=zxM#7&hddQ>!{1ef`x?B>7jI| zExau0SQwY;bR@~Q$S)NvolnB_tNpYIL`^<^i9&$FO9AQUA^%>8>sL;d9Wd zjSF*G1jcW>*M5O4?ifhV1u9&Y+=FrhpuAB=zp}0uys6y;9^{a}N){e}ZA-n{rcHof zP=6p}MoE0AO{Kd@cl=$RO=RL&1yVDrhokCl1S2w)?&s_ye$;b1RuW;uZ32L9WPuzF z3tx>2dr&Hr6dn?wURTg3bHZJ7f&L^^m|UXa@H~yn55&safL|2v9YG9xr?}*TA0RbE z1yp+9{!}3AiYH^EC3>@=(j*Y|!#5od6({#0CP<9lUurusL|zF~`F1mG=qz8N7s7tCqx zV^GMCz`6X3X#-vdG`tFaK?*{N*0m#AjP;60_ac%e zb44&#$u(nNV|?fgqr!M{Dw>daM2DicwQ7yB=J@4HuGpQgheu4Doa~$&qU;=;u?Q3w zJJFL{l$iw^fJG&8X-k|)W%lI6v&1qcah^udXO)Dfad6SGa&jAsGGuXR z92=7~^2YBAVssOi&C!+aeKC*Oq}?VLK!_nHGhR}C5INf<*r4RgTtR&c>*LM+EAGX*!leaIc=zX1R(y4q4FPk0u?+I0TvBe z@C~#*V-f3%*D*i1fgt)X=Rx9WB5kNF+p%612QpI50g!K}s^j363JaM?Ya41h9wD_t z0$s83SpZ|CH(+*@Q=>`S2PzOXlkQ4*uWO-U)|hczFN&`jUv>T-6{5ui`-e0YN%q1im&@s^yw32 zuqCCg7@&-rZ6PGf42~xe>f_RLq6V2SPhYAd`>Q6ikTFAZ$`$%BUF#JKlAxpE2?R0HLbMZqtU!f!jj@ ze|Rt;d|J~T5M9538J1&SP)t-bFr|({x!ehb^vpJd5$5}hyVsdZ-3Sn<-Tr%!Q2@Vt z4WmrH9Cz$S6Oe?s-|P-CQPu#Sv&f?_KS4UAyMs&u!QtaBi5ll9=bj@8&kuJxspBK4 z2K@BGH`%2(2ZHXE1dw7$es|?(Cgusuj|uz!aOh%33bC`Sc0o{!d}#srdrWLI+Fq;l z&zKnF%aWhQOE{tebGP5m2L!#_fBPF8mxWq7dHH9;72F#e8CACG`ukp6w*w`@)N;Ee#dFg6)mn?2Hbi7T4C%)(~lEcFFw$PA1JyJCh}XS@*04e3)D=;J>jG8 zbnz}qFQ;~}eRz82Sh)L}Z^(5;1aQHhzKj20PXgcPVuMG$Ap@q7YEW2%H8gPXIv-kb zlrz-~96^I;=^h-twFFQ+4>3|{Bbx8}KWhK;l2@(vV9!rcJJDw~+!e~c5IKmP91D>+*zg$Vw z+P1xZxadvTYG~9cx5Do*h+@=p&7Dw^*WiBMWje{DtwUMnEEw+3LM|d!f9Nib$_hT0 zr&l(9qj3Dbz{*i!1ins;8K_pNmbx`$;0SpV`r5wsv5wjRAQX~s+su~qnqEvw$o}}Z zH#SlX+|PG32_X)4d9@hFr){*!t%EtWgoAn?*u$i~JM4q}#P%@Tv6pmLyIzBR0_wn{ zudz@xz-K|MFl+civwT)WJso#zjyT+I{ zQJO~4XGq~={~e(LeEeF%oDdM7{6n!3(p*6|Rzmw?WGBpp)64w>2{&Lq(_&x>oKwB! zIy>gXr7L^;kJ+n?u2(bnBc6b)&cLZdd+lG7#xe(&3$6>X-7PswNRF`j5-*9-E&li! zwHKJPR2M@Aji}N`^8%inPh5cZBsDhDBxu7bu5AlIQr+!f?jrGKtYpds+~CJIo z0wiRRYP*jG<{%3<%9w%(!M7?)*f!`3lC17pj!c=D?>ruidRh~uqwx^O1g+3i$yN+YT= zdOq#lpF7-Un-`ZN_LVcK8|uf06Sfjqr{AmoIc4-tP~q{!g*(f2Qm5z<)Btywa-0T_ z2{9zNEa=;7##^JERCsNO>Qfiy8)|Bv5XBl_MJX_Mu&^(}Qa6E%E-pj2@G4rRZp8V0Uw@?$csm*dVf!-YwEcai2SL^Ie@<_?5&SA7k z<5X$Ek>xtw+} z&G!6MFEZDMG`Rj^tZ?50<_itI7Kop2xgJhd--%(LLFb1)^4axY-YU*{=UKDx!j?1 zyXaE5W7~A$=~>OWJmzSzgD&%%PDW05j-}n`KYQ@7UcvRSKH_d@R9}4FwyNuC@N>@1 zgVF-(Xi-z*{*%JnNB1O$eyaorqE{ARWgms3xtm;3TVar_`ik=BI+QLMe&~d2^}R#> zwD?S4#YYzRiy>Aw(C^xxdz;>0kMGH(w(MVP&Qj@%{@pqA=O$rW-t+d$)awpgB)MI~ zp;V=Z*-kZl;_Y3LLRNB-!FE*OotE$2lAer;O&0V!YeW62vh6xPnLBOb3-=tQ(wcr2 z$?f`SHu+o(Rey2irCfzkVtUm445A9#xCSViB_7w~=}xxXJkhQDXP^7Q6~f9_fOp?! zmx{ozadI8JKiQB#Zv#xL1jK~Z$IV7~UTt@~_Upx_$&dD2+po1n6*W_e?{u2tID43X z{h+V-W443+I;(S}Z5YlxWpQpT)}|i^dProSva;yBGG`=)43?VfwEHzIJV~@-CSOsQ z0$k|q7X~$+5@RlNi(EV}GEjH5*e+o+Qft>Cva4VD1E*2HVZg;O>??RVlhdIpFsh~xHoQJG3EQbh64l(P zW^c{8ZV<0G;~7TK0J!TgKj^SG=YoW$&L7>2&|gxldvX2~LZmR|(#D{0rL%8Ar)2JV ze=cl*uPAVoSeHggIe$qN_r}Pce(O4&fqh+sWS2AMAs5hXj6v*SnoXUe!u{Y=rw&9w zCtr}o3BwVLRq;8)Vh5aS@zzlWcqZ&VmEGBbUDAr)Z zv#^4scz~+?EIj06%zaS=2vCtN%uN#K8yf|rinvlYee0B(KQOpGNxkNr!ipjc3t9E4r@W_<&!MezxDv1p0lB6MNwpH|+yHR_ z_)N4qPY-+~=kHhMflJt+O0gMHnPjqr)3;+|OK0EAVc>OVUsc`QfS)^9w{)d)(%}Jr zJCONhadD$CX{e;&$1z1k9e^TlFr&C_pxeCfdC-lyM=vIBRKXrxdSsM(GW)WarJcj} zPDx;Q0Mi!Jp@ASME&iiWCa4l{PzA3d!5_8u8;)|NMS2njGOeOA{4He%jb2&Z8O3eD zw6^xUDYC5C5Do{lPdo{Ri(7Wt$4cPfn)g^ zZ}m{^F}(?64uUfmzN%{atkziF$W(R6oQ_vS-TrnS-Bbk<57dI+!3T zy++>Ph)@bt!rFcCIS9zsUP`rb%ntWK^^HhwzZA(<2J?8*`8!X1h5#tnz3VIsX z{og_@GeIiC*IHp&t%n3huTw%UmBB?;wb|OXytc{i$oEQK2~FqS??Z)Q_vl*mGIYFj zK`@fPMHp}?WF1C=-0H;)mz5UX9M@2?;qk5Nzr4r=^7z2aUooJ%K_!tk!8jke)2&4x z0-HazD+l~E6cH8~L^>1*9T&?2%924GI@ofA2d+(g%|XoW*VXsIu-J94_>Oc{9f@np z6~D6BlikSfpOju~BPdmbQFmZ8SU6woI9{<#BP-8XnCLfQJv=B1`sHZIhW4r;{`iLA z=24GMz}zeLa)>N$Emqy~iOb3oe|)m-r$P?P4x~#aCn8X_H}%P|&|n4E7{tf9olxZeo2!3mDJvcl90h4&zNt=CYyl*LDTq(uaUw9Cv$e@AL*xDeJjN_ zKFhf3BWIBOSO!i&6B&Qu7&rG@a3FKX$d0y?=UZtis6#okl|AVwHNgHI4MXD3kPcUhn4h4Jn4^G=)dv1pQFPo$*Pr7 zVh_f8d)f_zCZwe-45a@apz;l7X%6N%4dz7+rgruI>GbJlvr=%s$Fe+#UiOLelgsHK zM1<-e{-po}rxC=(sINXqn<8}oLJ7Z99eTY_c+)S`^zm9TM|9MRLigmk*lsdvIy3L! zN}R4*K!JN3Ph*1Dq-qTJ8Sn+^eHeMEM>!?d>B1; z$Wo$f%oO(hBgtqbI^JgJPjlEWy9oy!JsUSOA1k^17{E~17p`aWR6=&AYu zj`huBO38mh3{4@V5>ZRf+oT)|iHB(?CCM?BD@=Xt^TuV_ls^l*LLOg-BS(Dj<7 zE9ydz-TP^)QxbspDH-1vqoJ>~e@=%5m>K>Id}XI}6pjGih117kXR%Y$P=Y$fUO4Zv z+#*?8Of8vPZ#HZoC{>Pl>sAYu*@db&OHEYn=aUt>ML@I<|Fx~NY9mPn&&^59Ib08A zyC3Vmuk)AXt4pnCd%esP-ESi3uT*vBwaj#46JP1RxbhTkj!2t)@$u%K*IS&N#^FeZ zw6L0u%`2_?z}H#>l5*1z&hL>29CJSW0ade8DsJ&e)g&Qt;k^bE z116<~>g)b-mSE4&_n&9|n7!Oz^$-WLr9ODR zb!hiab$+HIb~K8IKX_hY7QQ6%cI_2L2dSheW#9n9kA3`r=C>3lu`)W_6%pf$&M&+{ zZe1U*mxkifyzh?ObBoG2=a$3hy6@FW{TV_Cb5>1n{b(7BNtU^ZB4+FG=pQQXi2u$k zJobI?b6=jm2(Rh?u%{kv@rQ%@qku=|M(D zxyT=1tLR$lp|5XL#gXikjHTmq)^@|{8_Ws2(ULpPp0r`XmW@JPfs3Xqx8MHwvOaJ^ z*rfVg__M0rA~YLtnB~UbCRkdFVr<+sW-F@OkYq=bYs;hjL$-doX55lNKj~%VS>F0u z1tjT%f>gFeQI&YsU1m4t7uvk30xB0iJ(8Z&i$a;q8b3ys?_90^%Cb;!h zx`bj^Ia8c{)o9qDutQDV_1L+M)=|M3i>(*CMqN9#-hR@Pzv@1vex8w{|FD!6P20Fv zy54G)V`cp9S0>WXPcFhmtXS;hFV1^k?$=kfHk^K08s|*#wne6!WH)D8ob|jIZ;sGh z0h0exY`}t&UjdeB-phG(7bWjy1G;;R?NtGFi;I0;O&9(7e%*KZ)pqk&`<-8ppZ|)G z9Y|b${lrB!u|ztV@Au{2fxbJxho1i)dG~wt@b{SDAD`YqL1CqP_Gx{0hHznox$Z@D zmx}X>14D7*chzF%%Af41;Wd7OaJS-{v{jZUvoCl;uZ@wL`atpq^Z;T7~qW*#^xTET5h@78K_P$ZEC%y=7&$)|}V zw)&i|c=cJOx76q&(a=Aqtn))6+>*^b7ihs6tTZr(5k+YSD$ zeFH@m7i?$n?!@MG3$49B)v5L##gyQiKrC*FVameUQ<_fg#UOKIdBf5jqC9po9kfcR zd^@0B>Ud(tyC1;s@nMDOdkf2tf9+@QLb!M!Y)<)aLJpY%4M5kjU|iZTE_(G_cdWfv zCzRcuya3@eB}Ip^`Ppj+a5!0jV9n}A(V-d1_8>p34cQe2wMv+WwW_OW!>ZnVFMx26 z32(uCDc(Q`^}<+by!7b=N-~E%m-7`4(xN-`QFtPdd{>Ixne*~f7zn0(>=GfyOMI~^ z61BF^52xxaQb3T?o*-ZRKrJKP@AUrB^V0@IA#`1ZQ~_;1hXr|HlNN6m<`@%s;f>!A zg|Ow!{7MjN)cAuthoohV2To6_6jEe>2jy!Y!+vx}hn@dW*ec&oxn^JaP{6;7XVL36 zQ;^-qtJ$X)#bA7=Lu!22jmduHvWgP7!H3Y(8V;4z3u}}}+PRHL$&2z4MjUTwW_O~t=61v&QX?bW62&!ilzntvk*kD2$)$-Ir; zj==Tc3$Las62Er6%UhlcLXjwS-f!e(1!`q=0vT0sMPlc*ri6X~wmm21@F@EMFWb}o z|x8n)*?IXq+lY;*~l~i!XQCKNTlFOJ>jQ1u^{;^Rus(@coblMK^ll= zOMcu!TUuX zBeCd!W+3ILXlx4TgU)b}O=W+_&S|_iK-rVPILS^{u_Gju4U+{Mff7IF6|IrS$jUa= zFW2melf9x4&559Zq(C5QCsFvS}gpDhCNFIZ^<2x{Ni(}bjx-mg*4$VBkS04TMD0+45!93DsK zi6sG`E3;@f9dbUfCWh%`8wv7rX9WXQJeu54G=s`A!>3JTqj#ds7QxbLfI=wQOjc(y z&g*cG36%6`sG5o`F!y1coY{K9Lm=EjlM_$&BACL37qR<66}X*8kQ@7*cMdg~SpK4w zD+TRR;GBR?#iue$MGk<~-`i3SWon|MP<+mUqNDNn<(U~OaL%~bnu#WHT>uIZ;}!+z zdouE^-IW=I~mN;1*G9b{tw5qgXGjbV_u7N2 z=IyH44 zHcQNfUG9i5LjW)tKp>frcZI>M@rYm`1a=Q|!N;v5zBpPOk==?MK~x@rHuYS@TBROl zu)1MF?jqCL;Y{E&7!WLzKH8PTlJSNG)hPji?nB>99Dz3F!^E=9+ZAy%?btKu5^r`c z+QOqC#1yE&gPe^Fim`pa-rp>uhzTqM>J}#BW(ABB-!%byXTZ}XgfzceW^Q%UBC6}*CRFhIGx?01jjKkhbWWW1mXf4hA+SJvg(6P^&W%YE8C0n z5L+|J@$>$Z+H?~=*X!=&k=i@W%+#Tvs7W?4SmBLSrreTm7r9ygg2L!L?Dcn59D~`B zz7;W}2YR9l=>`&w)mM2KBa{_RH8Wpfdv?7;^C)I9Kmk4Wp2V@aCYo~`L9L|4Y}_I- zESc@~1X19H>^sqt8^i^K&nE^g35j_)7bk*}m_mU07M-jP0}6`e*qd_GDaSo>mNS(p z$~w1BJ_$>KWHVH$GHyxDZho5Ji5EA77bLm_F0lL%%<{lD3n0hk4(we}PQ84PlYy@j z?d@Vd@&ibZ&^dwWZ=EEtTb|S!)~ETLew>J&nj?2=o&Q@Jbzd0>a~$LNR8_!M$s3vB z`T5gbT0)(@dkTy!#SBT4s&o08yIhp{?vaH7kWiO}-+P!lD8OITV-yI2azK zW@#1UCzb%p#4y;)*QExB#g4nOjoeXt##WJNcUgtn6Kv_*MH$(O@K+Z18ti666YKyJ zT5=gPSobP8A;#H!=mpzXF+=93I_YF@J)(n8O&O&!mRYU3t0>1pykKBy^rw^hc$X|- z2A|MNWv~N=T#T<1hvAi(8mc;D1gG}6NyWga&lG3+U}6yj zu!K=3YB}B}GQ7JBOeCROP`1e3v>ER)N__HhwmjFD;PmX61b^Kak+JbheyiHuzw1O1 zCTuO0@md@UtT(T<>Wj9$Plc!V@*s$JUVFHn=APP;pNWZY3*4fd(7!9ZgyS+x;nc(4 zG6qE@#eulDfI|a1*xX_wMLJClx0GoKbBZi?)k#W$1%o`ks_A|db*(xaf#UJ%y55hK zDUhH9Wr?u_Faq0?Dru>vR$R{aYrM7f5h6sT$Pp{Ct*o}XlyNkxj>BDf^@ZW)RD?TCTV1+wgNw*k8|dCk9+< zJwr`m;Vx_y4W*a6CUB%f1QuBu^vI^L@Fm2AR5BBmL-C8=nIB0M^v~N_i5u+Td0~{a zW!oVEFpd&8G^~qtX`=vsqO~S=Lsrr~I$3fE0t=K3LQ(a=cQ=Mr5%1g)A$kab`3f4C12KK_BZyW9X7#b_VcS zmJp2^69ss-ypiQ5leJcyHtaw*kZ?Y!abFwi3}e9T$0^O}j0T@1k_?dmMwu!A+!l9{ zYp7!#JKiLXr|V(jggnN+isgmIL>QZgJ&q6}jMx4GmL{1ZcFtYN3$8jPTJHb}z|%#I zrM&}AQpUxr?gMIWz#9hYSTnUj`pu2m}1%i{~C| z68NbvmOQc@C-qzzm7`+W=bEKCn4HKBAUX*qj6DK(*mMXNkQ}6lQ%i8w=Nttjm^gk~ zfogY-d4O^9RdG4eGyz65rG%ZMF}M-0tA!c07UDE}xZzNz;>=ygj}%u{U1>K(1OwFP zx{U8Q=q08%r+JyK9GgGrvpwJ+J(1#`o3|!_vG>n7^#l-N{qcW-HgUU?N6Wb?*MsOx z7gLIo&4Fz7c>*HiBtGdexl{qc;C`VQ=TtV}Xh2*@2^i~?9$|s2ewj7wrVOVUq(XPd zv9$FpxaTc7CaoxKYv!-Ix`Hyyjh_$8NFKY7@e!S4b(PE+f1*-O>RR0Pi3OL$Y&U&K zU}0OIU}rg}4PV2GkJ&e~yb};oy+Vn{z|^2Jd`l7qh-;55yv?XjYVK&QJ-YMOb=ubC zO_$+src|R^UBMFSsjobVI2R3QMAgYjHb%~B$jIM% zZi&M83NmM@XPSArAZ^gc>tRE>1D8fc?_T^E9;UJJAumWKxckyH;k;q}GXsM;Q^O`} zR=BX8a*(OV*@(v6Vzo;W;mW6K9uX{mYOn;J@vJ82<&Z5?a%Vn zxW)lPfdb!3&Ha21k%Ff4{E4R>K7PLdzcj@&R@oGxG;Og}pCkmj47SRR6TvN=j5&pU zsr!Y;js3y=Unj-3?4&K^4`1f7OlR^*DLH^TBdS+aC8>eI3TK;?UWLh#+w^R2M)Sf+_xC!rrCN{Zo5E4uo$VL=Pc!3W>jgB~2pm-cJ5-E!WxnnvK0D6iUAsx@u#E2R&|2*CTQxLPkH4nT5!dVTY7ORctxMh|QvItOahp-|Uo=lauO#9TXhr})yXuWUu z2#yom#h+Pk_gLKVv&z5K&byGULC8z*U=O%TX6amWKZ;DZOm zatn#9IHkUouJHc4BqcK`)Ka!q4oN4UNb;fz1-|YA`-kGLMW;NBwk(`7_3~#gM1)v} zrwqG+4-;ZNTP=CT$AraqlWA(+&C%Jm;W_k9uh^aw)gEA`W=l&BAE^&fPeMX{Mbumv zd}5V?=hbir%S@j<4Xg*4Rd=o&ha#uSltO2jycqs^u0bIP_K8^C#ZF_Yzf7rt%9jt& zw+85mHci=Oxc?{JH%j=$?JLNMSSjq4EaNL*{Uzo?Qe!KArI)ozRxRk839@3ISnQ^NZ9H;exP+eNBEN4M9o# zfH8c~HT|&vx(FfY9uUowWHj0pBZFn%nvQtKBzT9Z6h|l}k;G0LN0I1)&y#h#m2?hI zxP?oT<4Qm3s(Tn8!ySFg>(@#U4{QIEm)}V@GU8tBoJXSEtYx7*acn|<6bFzp5^(ZaI9#>ydh_T$1$N4P9E)Y3LQG}{q~-L z40k{&R$rwOSJ5^e9ZO{OSt^yFuvm`;YerNfTb!hhRrXSi4$E(72UeO#FwH6EKyVr&WI~fk8_-^|2j+Ed< z>uSk@QfaQxMpf1xWix3Sftkv5{k-Ack4n-|$j{l@JZcxB5FlZ($aahA1(NcdQ#Sg#p#s9qV5nET%nLU zf`w5?L7YwlG?Ux29GW@POkB@D1fJDl?tQ&JFlTZh{~D$lGoxn8*?%N`~t)0&wi zoIpk?_(I8<1{+(gk|a9HA_L5Wf^3ll!eM4-SVOY!+q}-Oa@0MvaeT0kNIOtVk>QoL zJLxfEbZiWdyzP*@vim^o#I5ikGeDZ47EAJubT=wuFWf^!?z*?a9s&;OZn06)KubN_ z!xK~Kf)YNBS?z>?LYCFLKIqj+jS{HsvQBxm0wtkeCdZM8CQ3=`|N(Ojq!DnP1 zXBUId`ns|yKaLoaDyuhDwE#4dA$QS`J7^v)8n4uz*1V#p6jeci1RUr<${ai?QxIDt zh@5&%GjDotJ@}LZbMrblRS)`6`l$@?gcqbZCtSU$^eFs8R5(}OG|fDDpJYvZlH8M= zc7og1+k^b+^jf4zfTd-HQA)m%@V8W1zZE!Zr3vd^-l4Uq_CU;CIe;MwmY8j32`}dt zZNYs=IIfk%pSF1YJyzmoc#tE#@!N#2VN$*%ATL?K`sHDMU9!ZiZfAu7vOBJmHZI=f z)rDy&av>Ia(j=fG$f`#y+j<-c>X(s@VaUL%&G=5P5!8bCm6SSgQ$o{7K)1|Tu{4z^ z(Ip1XWEBYIccTh!cLUAC{w@)%rqKZ&{`{ShtwFj99c@TEKdJ8K-U}F>muFNjFz|3M zlvKo>rC*AWMWj6TPD7%}$G9Va8!#0P9wH#H{W6y>q03wu%os|<7i4XW5{f7ItRITk z&7l(%+J_YISFC9(0z32d3+lw%7O~5phaYYk7UDJmtiWgLuWC$UJD!Cqq_+x7Ozat&?>OJje6NDJI*|3%I;*uF1DQRz zGK_q3_huiS1+P7v3+e}_`eynM&Gua_?nl+oBi(VsZVJO!7e+>XPg>tqiXIA~=_UU5 zq3d&erMQST435$5^-<=#~X_6_Is#~jk`_6ru-TyT!t16)M6X)_Q9^&Pkm#p?gA-weDLkG{f9sefzlrw<~LfV0l)z}S19#m}RY ztE^Zuo-BpG@;N5`vp$hK`!%mpFc=OvwJa@EnuGc-fKH&l@^!u@vTS5lc*dD-R05#S z&o;1Ikd41KwgfhJPH*lxZ|>jNJSg4#`E2v|+s(iJ+5`l*z*<|-ewTOTg+*Aalk!|IP3GtOq}zohLr~&b_jWr|#=zfLLAhS<(V^V7slFK(kS$q*J=d2kLoye^$uyau*-V zLz7gWI#cFElzLX6(STgf@v3&Jj5%L*`I&RKex7>1dH7wyh#)GZVoF<+vX?y1V`_Tq zoRgY`S(lj@L;Y*o8o!5Vjg8{Mg`?+=$7GvqD>dWHf*zU5w)0gJs_l*1^^|4rs~s}~ zsyu*wp=~Gsz++?{8`0by8(?X}C@w%l&zDz5`PS(-kKT*jt-n{V_uqT0DROw=`n zJhiL~9?2yX2?VDTc!J5(>fEx&Ro)j$o1Kq%KF;2%=U;P!a4)I{nqgh=hq5rCeDpYO z+!2zt#m+^df7yN)FgU26kLFwmg}}Ht0>=}R4<0PS@KNGDF!aUz*CFZ3ix&d=yrUt$ z>pA%-33P*scB%s2D*jlm=7G?yfG1u>Y@!7;25-QZttDAJ%6`>Xfx46xz%F?JhVziO zc&;8W0(f}1w&E$6cVEd|C)te?C~h_l?vpm0VS2qK>jwik#gktKyGueQI3(?xxP3_8 ze;j7le3PrY#7|PY@EDs)breFY32Dy`Q}sO0T2YpDUYZtIaGq1>N!46pcFwalMpz?C zL#FZJvI!^9u`^eH?>U&af!@vL*wEZBT-?wytT^A$`cj9t@xJ{lE62tM({9C$ZS#Ti zjSt_&@HVxtWH~lH`dD7v^mx5xzNurgi}&7>-3iBgProl0-+T6JXa3&vLogqm0bzHd zcQT2T(7Vt|3-oSQUB2cXc5A2R-m!##!km9M@wNawNaFtvbN&JC9|4|^Y;XVIU5~joJ_XZE=d%t7y>^iSsax-C-cck;)yW(qzKcx=mvalPmXE-#FWf$ zN$h*}8QD7^iujrW6?=tGot>jerNU+jd^}8;Kxrkq#>9KGN}JNC<~jqYG08)x8d7v7 z3(823*06=vfu(bDml8wDiqnyfR}R>hDBy%3v|hR9+884~oX<6d#K;1-NA^qJS6C!; zDTpF$P}XFj`V%xR$u$oj8SUAqEQ=sxcGs6WIDDAHOhqqgfyqv+hfhez8FD+?!&VU} z>#VMp5Dn_ya$iHBKTVxd!79w0$8iMm%j1@OG?j0p8s5h+iCIgiAK&5O;c_Q-zvtmm(u(V+(aLrnDEn--#q`v9FmVfhc#_xp&t=AM#BD<6N=K z(JW4@w$`7%sk}Rd%bGHQ#8$PAAh@I@bs*eoNlvQy#>%=$1y8fjfUBQC5)rI^xy~B9 znMtB{j9rs=HX4l&Tvbn^`psv*_t!U{15C183@Df1RwqKD;i!qH`emyd z%PY$O;r?#oaeFl=biqvN+x>(@*_{CZO}g4IdbeR`NcN;t&O6E_(GYKiarOA^y|OU8`9a2y zJJOzfx3O)~*qC_h2*|O>m zMl1j8L^)#Vb8>PXxj=-3gpSNS|2a|q6A!z&9f1J;7DN6M4@}_6CM;^utu?>j` zZgI98?&OeU%$tl%I1Y!va9bDl^ueh-bV`qQD?3;DxfxF{olFic;PHWHOinb^Tk*4W z|B;80^CODC$gsf?k}S?~Xj(&FT9l8(m7BJUe$i`oH`f#MzeFfQGF^q|xgL?D`z*qv z`0W`%(cKvq6@i#X<+-4v{!6(s<0S>0|3ozYa}id z*ex_qB@mHiamaM;o6DNQ$jxp=uK z9tw9pm-G$cSctT&qfu^qPN3A8U)$93WnOm?33FYvpKs7Z^f6{_2or}>IJbSu7s0Jg(q{ zTXDW{uCc(+BJ?&oBP6LI`vPkE;=`mvQj&e7j;2abe{92X+0-tH6iOf?cv&%~%WQ?E zyS~n&!Jio|twNSX4bk0MB|rBPU})+&-0`-yah(?&xt5H%1jkc=)v!4yE4~_+T@+GZX`5%xi zqV+nSbu>W{e5<(w5>c;po?&?X89rQ2&DUC#TsUBoN5i)Z#6uJBSkoWbwq^VNj84e+NMpip$Upl&qe)x_9Cq%S|V(}$ZjmABz171gG3OT^|5WdA4(noBTjO6thzXc;|a zB8CO^AB3=cgY;R@e~RH2f(N+wzElo;sBc+Kjp*%Qe6h05cTrA_uvyD-JmDp?#JmC^ z0sU>OmW20%y)@$)0#B1&*TJc@aBr2qkKS&>&*m;y(CWEj4egt6--P54kc zAABK#Tu;J}Nweh~wujbB9sdAVn}g(xm=QL-7`Hldq3Wuc+EMr;&I!# zJLP+n+nQl`6BDEK7t{>&Xaz~?%(g+ekE_pttl@fqkpEVTcVKOPgh%|X$(aYD4Y{3@6BCJLnVa#}TPJ7cb6Zp*wSKw^siJrn3 zHeq&s6pf9O&cPkV!p@GTplO`?!d&dKnMHN^N48+8!bC1%Tr5}Er7+Ck4GJ8KMPRs0 zlISh)`*2PzmPaD^ryTv4*fhoPpQVR|v*B!hJl@hpow3%{!LhjwAT1n9)S?Ev$)ScY z66Fq55uR!g&SbMuCZ3IhD14Z$bM~kxMa{%WFG7N=XHtu1l zNt@K+B!M$gBaT{~@$SRs9_249jy;The5KP1&L(Dh{)K?~Zvq6dmB#5Z`Xn4vi212@ z$NU16vOd%5`)>4U$M?;}?o`3E&z}6)U3*pU@>1YetohfK;X7xK2o%2#<^_|e|0Yn7 zBiAwiXbotG5ikqt1%O+VzWBG+!1X#PNrw>(avEa!r#de*LH zXkY%TuyW4pL!oz{|LZ`M(RZl4lh{RzVq!zDZIL1&B*w}A{vI4Uq^}Tt##;~4 zStKS&aYf~^ve(^Ol+kC7GZ@hoZ3yl(s7%xAzAOGUrvDJk z8K;P-pXFl|sv@Ecv`y2ZJ*|9tg@Fd4wwz*vqb??cwW9Gve2)lf;ZhffTNEG7ZgSBr znq3Fhizl&ZN=FBtZp=Ch<5HoM6dOuuJ@9m6UVPK{LeA}j)?-bTxp~|MtI;lcf3u8_G8x*!_BC5g@_W zDe)NzApxiS;;G#s##(pMlnl!j(2II8X@k_`4`!#C4auj6lFePjdOCXqtR5F1h+VN! z1EAtml6S%Jq)`&(3@sGPx?z!I6W0f7LFltnKc$i}72N#=!Z9E|N}9K+NcfS+NagYN zEdWajnL+exq>qE@9JqnC85-N{c7}^I3D%^WdP+PNd;?l3+*(<)ZseCiwr2=S@Kiy$ z2SHh~6j)%Km`Q}9kva+hy4;L_n)U1&C|jE-P-6vN1hE)Z$zIvD2r@jDWI9obs{k9Eg?j{Se$uKven^Z)DQ|L>O*5f_$B zqeT`bE@3HCo?>{V$=vygQlgK18Ks=ABiufqtT1$(h?2C@uu7FbQeyv6I} zS~MCJ?#Vqq(b6XKyqWQ|OY%u;Gp*gyx~p2;PfYf{#IOVtGYbnd+H%#)#cu9;SR*2I|4XlQRaw-ktNL%Aoq(2K;A^g_EJ-ZHtB5OGHMNp)~ds z%rzd;{K*R(b~{?KLOKH% zQP#jK{6tK*PP#xjgy<&-x67ZEEb3EAG(HRgZ2U z?b~3x)kT$33GYLcWI$yFSu0ne0epXFS*pI}_F}f7=xSS6r6gtfz37$zZu80M0f!4L zW1q>#Ii9sM)oQ*v>4+(@EvZ^E=fa~B4l`OSdv zoTNmFtR%zX`Y9bwmr}L&Q1k#^oX!?G(41F zaX}Drn)E^5F3#F7x!sA;0|{PfVJia?_cT{BK3>;;QO*iH zmYDm*q=cG4L-f^ow2Vk$=Ev`Wg4rOl)^tz|D1N!fef8Y82 zee?MWS(ot*ATVCOIPMNh0$|dN(`gr9g18p>-u+B?{G(AGNDu*j0<_bO0Tx#fbP`0< zuH`2P2mlc%C@+Jq!$({3L{k@l$)4eO`3qQ0hVq4PprdT*viqXQ;%{-rW6TwL?5Fv6 zz-T_D>(yHT(7iF7a{+xZ1?S(E;h8N%($U~!x#9SR1@0vq$keu4c#QfX6+!a2a4hEp@*|p-Zok1}zU6&>SfL=N{=Nj$3A`^wlDBb&5Dg{;}u8}Uc z2tHZKSe0aGfQi^Fz=90N@=#!7mRDG545+Ndz#?3gfz(Nct(s2b9b8^`G9gkD$U!v;Y_>^&wuL#E1N zD9pkYl+q~!*1tWdfE_ca9$nAkY$ve^`>S9Ge$rfY5}M=4bE3CZiwT$EQ$u3vtVZz9 z+nFeCxEWt!ES!lU!`${0-20a<-j)=NH(#_@CQ_0l3H1&uD(4zC%Rm>uPC}0nrqy#E zC@1J^L!ntQPA{nhOZz`SQAFA>nw_F@1RY}o zi@+wK4KcTRV*z3w+ac!wrI~VKFggwoF-jr_GP!}O@P@UVGuaSgz7y0aRJ_2(hfO&- z8bzM!D30fXi25^e2EBxREcSJX=7m)`Q)DjndWf)5j2$o!@jS#B=v#jWb|(@W(}_eU z!QZ#-Oyyzh_C^rm$@A<^8&KRLTtc@a2I(XW(P`g6PNrbkDbqkxBM~LNm594b0{52n z+_EG@>yN1**`3F(A9gPPMwJzpbPzK;*%#F(A3QS-V|>=|jp4XMt`D#o5%!s%=6b5r zxZb+OPX0|f0DpZrtw>5bOFLOrIs@Q=5%HuM53CC~6E+l`CN~lX=}B)l@Ta(b_>v3r z(R&KX@$2`{@2@+y1QWbq`5RN?qIQcy1Sqi`Kc{Kzfyo0G)B`6} zl0UOWV&yQ4e{+!;!!w&$G>Xn7m29WM=+cyztwt2tATy4(h}W>#5Po)wpPN$cg9Z$v z9F)ZeJ7QH%WSdWxCPjU!C5M2Dr~K{~j{(n`rZE@9f-jl9nJ##!8pkn#qO>Ilo{z=Eu#=_h&ubYsCsmDf} zX`gV(+nahs-{-lvz{^EUpPgxZ*v*!n>&^ij#9zS6H+#&=S7hz)?X(_xwpdAR!6!b4 z;Fw7FBKp5_F6ZTAw=YOP6G2=nRPD^%=~aTmwcaDwoVIuv45c-nX;i@=<1xZD)Q*1s zNSBM|YKwPwp#R{up{ZoP>9nu}+y}daTdl*|)Q7x|UtNE*`7NSzBZBtRv4#z{^sF|| zee^gi<&W#}#HZ#f&XL9Y(-tQmSTe$Pi2}&OAE#-xdw0+N`RsW3bLQp$#o2pBH5s>E z-uIn^6haBTijm$4Jrp(cA|N(EiUt7z0S&z=h8}w89fBZDK?JFygd!aT1q4B*Nl{c3 z6vV>hDKl%{HP1WWtnV}&t?+t&$C2e9~0%%@q=u}LL44C7+dt!&sF+8nCCX4S8w@vAx%8X zOpk@#kKWHBpp8BU%S`U~aJyY}m`Z(K#BL_;D#jY687>oIi(*$y4GtAW$4jzh<5+@3 zy=3yFV!V%+N>s>F#Vha1Wf$C6$aWHEJDVU@8lRV&bMJy;i(+1ObqTz$R{F8but{-d zhQ_!*D=QnTXf-Pm!9F$o7A?lk%=Uy`u)}h3tM69=4gG9G4d6BYC7+{ zzljnRN%lQRZ@63enlF^KM?C-&Kc~t+Q*C*LtXKs4P5q|wOV<-KU^97#WoJEz-8peA z*s}Xq6DvUN&8-v~#VQdEpGfZZ5I-AfqTv<9akfb@DxGPGCgS?79;QtD)i9@QxHg&q zwQ>-db|>cQGkJ)ZqTI0ZHaQYgDGjmNLPg~g9-oAb%dJMvq;3fkv3^wXRyUZ#k?t4o zyA)CydzhHU?%Y+Ozc5uz{7R1!iNn{JRw!DG^ijEOyy8>7j3=`{#jMnl-@Kao3!hgG zw=8{|G;2swJT*h!jJ+Q5rLmK2zx6~st_vSuZy{|WKUqseC-|=|iVEIPmgd&e4w#p_ zx6B&tGs9zyLUMwZ-48%^59Mxo%h^m~ z`bsD&iie8euyaUi-3^&a6DZl?AhIT&TR#5X%*9bEP_GBLbn&{|K(HLkIyo>D1~-Go zrVy4*ILBt~Z&9Z*on8CI%M!!=BzoC1WG8HSRqQDND~=wkKNqz3`*L3-N>a=D42wsv zRz%(v4?Crm7ud@o%)M!3q7@OyH*Vq5!@*ruUh#-WeJKw?J>o2n@Q@KuCrE~1%MyC3 zW|B1}YNBY5;K!#rT`etcR%A&&h3#IKL&d!UyS=cebmx!PJkuKL+6>t z^ixp;^WdoV$M&r?LaO+3OSry;=35U+t2|(o*ZHq74gJs(^@qt@zq>)4+|d1xFb#z< zlvjqa+j=XbI9%`h!uW!>9%8so{r)-#+_hoO)_Sp# zGvY3mKjv=WQ*sN%9my>NSGyGUSg)n+PAo_dr0l)LP2H-|ym|Y6@M26AHegAWJ#~Ls zRCqjOIPv5qM&O?&9Qytyl=gG2DERZwby~dQ!QnZWQ2e!3 z$wef9_t~-J4JeEdz7G4%Mg|@S*Xw+FTACWZ+1GW64))v-`TeCu=|MXZN~$M(t8n;o z0I&o+HQIn%+|~xS8lI+Xph6zdw;*a*UCxpRN5g)-PWwyV-0i9-|LpPt_AK^JOqQLF zDD*<@YDkfp^2R}^>l;WXAAo3h4iuvau;YAPEXEBXg*(N6EcVE(VH5rwEChrBqG!UB z6d>w|MOn7B|M8*56`eY^W1ZJ6vOE!6>~#z<=kLRclKjP{iZCF}0QvNKtZ9}rCgB+X z^GIcL;5@<&Zs%)zq#hZ|7vUAa8Xb!* z>7QEy2E52tsfIAJ`^Fi9P8avfF(`M^_WSfbJ>wGH7e*1x+n{~!Y49Qi4pkTRauQGU_<6&*4H7VxV){;2*JK;EL4bdv(8aO{eT&zI1I!ZP5k%ySH|12W)tx9f@7@HkPnn{F{ z0g43u&?GDM3r)n{4$O zZE{MrpVX>13u@QfZ{H~v`lwkpOy0bEwyxQ*`U`Av2H-D?ypvhY^QG2M-HyF_=)Sb6 z7Gf5re?H^zX$lbnRF7rb2L>SR>Xp+kjy}JeQM@dEN4X+_aN@^Qco}Q)*_0P!5RvBM z71$eC{2o~&<5=ZJ;5sDx!=;H(-a47OGX1Ywwx2hDB-yM=g79k{%~5{cG3xaoRY?22 zhJSEiiVUzkKe}a^7v7cf$u)lSar)W3z@Rt6N{pioA4lcPaxcmmEzXy?Hu1t(*c-#N zY2)RMX8*CtK95gAy0#ip)xq9Y>0(4i2a;9ldm{P#aJ#WPSj z{&3Ix(5Waq&p^ajX&g4Dwki3fL#T25ac$GmUCp08vzxfEYOCg2+p%l=(~`{f&};YH zEkD}NAI!9syaAYTSEqe7U(wlG8saUtt_b~_EfE7a@PF)nr=M=F>HY9go)Gz7iw1dR z)Y8&A_UVPpF9_;{lbFf}fW>YRg7i*cvayXMJywJk&-=IjV=K{X9HMZ(Y(4e<4XX^D zo6rWjAJj@aSal*~bVj&SOX^0r&hMqZ{=GF`VkF8M8_F2HhRIToBdm!lGhTgb(s$aC zh8c@jQpjuKj1<<92;rzE+sRNPmlX&Qt~P=OEA1=uAO^~Xebd8ac7`JKXQMf%P3=%= zQ73~PSP*>H24gnAj>zMNju>buUSI=qpfm{od3uLt)h?4YIe~xM3D(F8ph->v2D#!! zOr*1-yMmh`&mVutN+s8<_yE(;&M^6bG_JJODLTYOy$jk$eTU;ql5 zfc%C)+`w&s5F%iG`?^hpfg#961lOPe`U4SPS|f!`%}!0}!-KVD+<*_Z+JADi6Wx7y zaJENgqZ9|Poqz`^;iJ{^Zh{SL!M4%bZPB{3(I*Cd*cbgz;$sXwyb;z>MtL#jc&|6D zF;@FAH8#M^fS~}^%Q__1uFVsoc^o8zNWpdejStIGVlp8 z=M-hj0kl7qXI3<4Rxxi@ga-(U6+;s-xb8h37k|YSlA@#(;*cA|&D)@eJEwTs0C$}W zkFW-L8$wA$u!aKR!zA+oFc#wV5DJ8W$ab58`TQIT#Gnlo4YDYU6qbpb%=d8{b(RQg zv^$!Qgg$74yyF+i#^GwnsFe^T3prez473hvaxJnT2_Opmg->MKE zO;LeOIMS1h$D|fng9238?%wVGuc`cGSmJtmzcW~dM78rLo>&2d*3*%sj2@2LWgaj% z1>~Wps+!@|efC5sAXw&L*dqP(cSQc%>m# z6ql?h1;4V#aR)CAC;Cd@K$A&e3lILK`HEpcj!5#C5D3>I{A@l{UJJ6%PZhP!gcGUW zW)L1g&_V{nNzW`=%oE3g9@J!GT27{QzU7c6qvPXf{Pi=86OoHx(naK*S?S^GEaPoJ zJ{aJq!^m2Y2ZO-FHe=BS>Li7gN=}>D@ViV*V<%=!8K;{@<%&`L%QkX#gZT-O;nALu z*qTCal7ccd&&N|rIXB&55fEM}ayt{^!VYb?UJDaJI(SQI> z_DglC0v0^s&vke`6mrp%rOhO*D*@gvAcAl%xQQ$Md3P*nCs)y;gEK6Cjs^OEhkd{gEE zKhLBX)%*`R1!6Sd(qLX-!VzAQ?Bv(V9karZq{5yW$bM+9z5UUe4WQZ@1V2y%uCXM> z7qkW@r2O>&y{H-I1fhy9uIT^n*Y|yj3nm&Q!6ttvHy!! zZfa`!zqE*mr&66uJpOBoh^~3+6RzlB0xYf7aG9us3p6kPOuMO2@#M~knZbD%)ZFP+ zef(Lp5n4Is$oM@&A(@I+&J>bmS<8^6pFjRQ`)O%UDb_fh+X^?GQ0yuh$}SQLEMZb4 zg(L-vuR)1iIW9~3ZiP}w{ypUqM;SJ|6sfyO9mf=5X8t zYQpWP{j%!s#swuItaSANEb?7hkaDGuOaG!U9=g(kGCziM?3O}R9$r)n(l3i-au!sf zWo67Ky2|qtUA4qsm{O0f(7WR|QaX?pyySCX*2B@XY3mI&=dY2HMxL`&{R0&bxmpWu zS&tpylxqDsr;NTUw3#VyNq&Nnve!$TaOkDP4A?6mx|HuU?ZQjVXEM3CKd}k08M6IR z7dw8VGU8{n6FN@%&WAf^v{jW*=gvx}I5j^mRI^Vh*dP=HRv7Q?+*6Woeh`??s&*#- zgDn@0Z+s}_hD4LkJ)zPK%iaYob((m)@W(p>ci+-`nzwRiv8P}g<8P8X@8o|Y`ab(w zB6QEEFaUnFd-GI*f){sR^1HoYGP^g=?%0p{6Rn%+4j!+;K>b6tp9Iw+?mz*P;wwRu z)2D?0Snw3P{IM8}3jEmK+T$z`w^SU^^pKp%+(#LVj$kiZ&gVXsPXcT$l-=@});-pYjBOXHKSx#;iAo>`h%7tvA&q<7RWr<0@bX zTIi5rra8IJG&lPA1|N%*^*6uh+Iza^q8~b_h4sbGjnU-~IcqN^v4jR;m92D!f|AUV zS7n#IS+xI1eD2t45sGQ}yiB%a{_)JAzY#U%^*_PW6-+lBW`g-Qc&f>5f$PPXFeV^= zY3t&i@&5`(%L)X0M?Zsy%low!oKUv$q-m=$k{I&nw-Ke+{X%!bOka>;_!X9>0mUy{ z{(MVLQl=A^r0;UWPr5Alzp!|4%r)~@4N31Mr;_FO=_NWUFz3~kBMsA+&eeGe1yssg z&T>bm1if^6aQxxx>jMgV^SsY}_TFH6Q-TM8-A{Y($Oy&##TdTp`%9F6CNY|y_gAPU zia%GgY)kMUoO^p8fN-B6067RN!r{g(^n})8Q8-)2a)H?Oj#VaM!oj=p%+%12w+eCO z6(|k};g1ore!L93zk}C^l_Ki^%yx|5$z&4?Gf30%*V&C|$%&OM3-nb@Qn3vRvVwnSDvajk{a(GN{~Pgy3heK#ne`_d-+s z_t|KU4dLx?Ok~iImU{aXVF%J+?yBOK!h!)b;Di(1PJYys{jk!qNP1WTQh*X^d9*8&S*F zFo_ePYloj{ySom`f7ZskZ%ve}?4wyFYEFc+WyE$cde+%(hpy**zQuwhbHE#ndx}-d z8x5D`hpWfCn6Q|y$rUDinnU?)R;Bw}?tcsi&&mOFNh8Sx;x84g2L&li_%i-;GNhc>IgP(dX=XY+Nv)FjoX^u~{xte?B z`&|X-z|-Hy$rR7Ub&q(H57u>cGeTii(@-GoO5I9`h{pU!3-6i}P+2`>n>9MVWineS{Een0(s8 zQ>PL}=DAa@v&zLJMciIfg!J}ad6!|z#@NlW=w(^BRmE}c59jyDY-f29%+KLa>k1&u z%^A3!$Lal7wd2Dm?&!VnH*Kkt!Gz-XcBzyTiCc;%c6ds|n?q9iv@YaRRlfo$+N*P@ zxjxeqMbx8w-2+ZDzL=t7_``gHjKj}iyYa@HI$i5mMXkOPZyNIkEY?&Ce~v<>>9In4 zPgEcO93!PR6|Gyi_i+$Vr|L_-N12TE#|HTE(g+`gts_TgeojzQcZ!v8j{QbG#ccFL zGLs_dX|5gJm&apwRRw745+c`o0Q4q5=4suItd=_2OOx#s~9KY2pE;gZw>U$3GSo-KNHd`-+%5$%_Q#Id*IE|sn<8x5ru1>5%}2 zIV%LrzzIytRpe8@Qr@CzWVkZWf#iP;K`1#sj?K3MrI%K`a#{yX{%*fKMtfJc6%0{% zx`?!|T>0+jhIm>> z=jJUxv)ZEfKpR1&U18^H*Zd95ll!pc0sm4cuyImKR7-(=`kBO^nZ1~fsr6JZ=4z#P zG%?dBr){sXkTX6eC%0R4Md&52TP=fmf`Bw|uBrUbmM71en-bYCCAeTa;CbiZL#N2e zp9PTa>q`$(>c%f~9o*n(Apa<`oJW(2A$^sE-$-ERC6xYN0Qf_Re)^bU1VDKCOFHIm zg^mfG+^L2y@yWgNfSwoe9dZ{QLpXtbB8()atMMjZ2_uQQyaQUB40ioHiK*IwP82he zn9JjckiWmyPanz)5w^cS@A|7?3(&oAQ0JE05Ip%1Id!d>i;=;f5ZUuZ;UZxB~~e58nJ#2y0Ak0Bqmi~7WOn+zpOwncs31L}Tg!l|H7f0SBY z#QO`;_`H8;W&ak<6Z_F83?v20frB0>Jy%qJR?*NDina#Ph?vxeiryy7reca8CKV=T z6u29>cqcRhFra=lpb!O|+lfXmhVjv1b7b&XFXSHwmH?DPO2D*NzNZ0VM*z3ZFx%1M z)M-q*4Y5krF=v)hJ5kK#1d4_zj|-oKTbm~1iqv}vV8?(n{SXFL#fphnvi1m&26?dw zdwU!lSd^Lx$OlM9#$A`hfrpCKVa(QGh7I@!NW=w0YTZGj+%UC0ucM+#{y<^_ALSFl zLtq8SgiuKjwNL z@Uv}E5{lYlStep(&XBNK)CGR3Cq90*62bKoc+2lmCoRqt3Rzi;L3>{R1jOZ2d=xS1 zQb5?@#91g$D1Ruhm@dd#^)0PxiOUM_meZ=CpGvbK%UE)w$Ahy z&BN4W2}~ej1&*ruf@vW+e+P3vOeFdr1DnbUpAxSZ5cAJ(vIC~nlj(^%K*8(}7&i`v zBBbfosP$$PB@L3<{l|djW zQlun6`DmzvJc=fbqH29Bb{1+vfp85e*AtY07aHF}j@=(BKT$2ax~9m%m+_zm_c5e2 zh$Plkh5Lq#)gzQY!Td`oviwUZ-eH8Q?*Ch;DkLQIA465fh2sB0_Wl*BlK-2!$^Qsz z|EI0MkotFn%14n7qD%7vX@eDtcx~?N2~O)cQWh`sw5akaTny{=^J>C{f$>Ip-sANo@w|_wE>{l+ZuvJJhv$3-J)isHhh_an{$og0;O7z0h6TPi)_NO%`P>o%vrbf}Hjehco z_Q4Z%Y)OT)GGl%47B;>6^;J!*Nz5$6l<_N#18BCPAb9VZ^fFthB-GR z_`crDS1L(T{x|%1n_gPjrl;a;J}=~}4r*p*(o$#h{R9b|EWC-U!Iz8Oe^l+)Jz5vQNpQ&QFF;!mKD~fSF@z!>s1v+lciKDf6>)$TI4gFW z5vs~2rv&w1eemfAQlo3EWytT9g8o9#sfD1ot}A1~(*cK1G=Tps6tDk$pXXlB2vskO zkRb&K9N}=i;*8O6I_?*nEU}oIVDBxG#l8}mMa}5AVW**FYsb3}*ZB@WwR?7*TJcX>4dtFH)b4VwR1m^A7s z6O}{REeNgP2X^1b;P#T11VM5q*bpuE)@6WIq8#zi$nj?RRdgoxiQmT%wBS??M zW991sDaPnhxO6u%nGH;bt^JI1Pwkzw21zi2pt}dThfy(foFDkkyKxFY`iK2FwIXOF z){R&kr!vNwK2S}7m1EbzIv4?+E-=V7GjKaz=sgF=Y^R+pTX>N?_V-@|SpmmZw7lx7 z%0xEo^?Xq@cn%6&mFecp*(n_oUr_n_Y80|M8LJ=QDlYcQaJ%gAMoFuqi1ze`0Txb( zV80cA%G^w!U$9=VZcv1Ek}n2y%!-m$mjcG6C#UMttB%ME<4=2>;{29HD$#XBzt=KH zz%Zb%FF_8?Oon=^`FVO6sg5DK;%&ayCJ5DvanQy+IX~0BdtF7HW(FX3lM-r%MaRO2 z@jf4Ref^ng&{YFx?};depm{d8wcBQjB$bQ9-Y=gr!M_Cd34msEiSxsR{;A_?XwE-Z zReoNaitWEkGLcv~d->J*KfX<+f68Sq9C1JMjg@-ON4@GYpVUlk#x!e!!99Y*>#$s>Ca zrTGHNpQaVLTWPI%>U?8mT3zJs(o$!~IXq`T*h-*+@afkl;g2}m?cQwgIy*d%u-S{> zI^v~sbYlu{{wSZ>%_Fk;UR&ouYklvt4Rzm$Z67x$od(6;)uQ zQ2F5D+aoTT!)&CWf}ev?f;xK*#RDymwA4R%xgy9;9V(`iBkkhJmPpP}k_bG;H@lhdz*e}<~cuRc06 zLe)X5A9YD}TUVvRqY{H!9`Oxqc{(_}Vw!#E@utjF@5;gJnR<=3f#MI4aCIqopZoE6 zHQ09g{Ooc>Yp2YonUllpbk*PGP&gKV>^ltZ@CJ24tw`gOdu_y&k4qE>k|TTP66S^) zrvl1GT1R`iHUi(T`4@kT>uR|I%j(hhBfgitI#;C!usez+ewL-3?{R7Ek1i|j6wK?+ zs&%!G2aoTR>=Y%|1iVACY63Z@*=Cl6j&&Uh*ai$S9S=4L4l}$PA213!rNQZC5aB-o z!#<59Bb#f}JSM<-JH-d@AJZ->4UD{)yzwOY6#2DK73tZNH-60gI%^j4?al8dw+48c zm#}Cp{V!jl`Yj!2p_q}Dd!%jdM{83@UeTA0Ux%fhcATn1cn+Pa|CTggRl#vYPcBWQ z1goYUi$WMM!Erk!@i$lXJVJ)LMLxxHkrnuHmpr8XeDiNF8=uk3Tl!f7Woqv-VDT53a4?KZ2y_on6 zFSd5kP5t;gxb@1T3$E$_$D#*{cG~^B&c=6($<^R6w@dCuC-U4Z#H9h{05VA!cX7`tKHAVI+qf+T zz#AHXi%gvv;o>IvwqVDSN+Yvf?L$^>;IL9R%pLEcnef0ht|BLHNR6O8XcISx_Zu`| z4RQ~$(+LYn%)(zPKYv=PB93H78G*(pa3$m0DC1nQ$Q;jfye@4WpKW>~cf$@&2ubQq z7#`GyU^)I67%;0FY`VlIM&F449y6etlpo}1A$=)8`tql0JPi@uZ+c=77d;$6DVruH zu0$qc>{c)6D7Qt$b5YLkYuf>Sd_2+Bc@`pVMoIouVqWw{b|g1E!BxTnhKpgRcz%Os zgiblFR3|7syS-lR0((VD(Rk78?W@x?~A0F2|qUU(8zZuL8x&;=$3 z?8yN{)Y=8s2TfPjOfDThq5`4klYP`(22JBHUCic~Fke`|dilpK#beozZL>>)vQ;aP zBQVxy?l~p!tDhwFj%p?lt1{e~a%)yHRw?-8Rn8V8+s~L=S9s6o1_;0_vc~)1Un#e~ zydvv)Iwj9|WUUaYOtd4eo-P^E%?b+5f?g|a4NHT2X1C|pZ2I39(1MUH&<)Pns_}If z3tK|*jcYkQ{)L@$g-^|H7&H_Vi3caEiZ>=)$h^uZ#5&Gs9Q(OnIDyiFQ2{<6F3n#+ zdG(*AW8_#g5zIaZ&Uk7GG>};MiZ^7mcxfj=T0mZ~?wqGClnAb5JXf+1 zShD%EG^MHJFm|VyivVtB0=!s|2dB+O0GVH(%;hjz;|BTMN~`(77%_0nl~KtBa#(}a zrl0^_8;u3INZ?)$jR$jv9|xxPmX5EM0@~#iG1|2NaCOB~b67jc?j$D=G}nHE(MLAt zQZ^G)2GGg?YjCUrSiFeW=m5B}di;bF97G#laz!$<+`BLAQXbG@RzBfbj@&Mv*)2!W z?!IM=ELwx->`%^xf@~em#@dns*8q@S3fr!T;kx_H4eW9SStkM=u9f`dO6rrTR5P!< zYF}AYQ3;U1u5$pExr#FpADCFdHDM7pTm>vv-8#^I;R;q%;vEYN*F%Ar+UmonW}sj~ z`OlW}zhVGC_DpuI)eUof7CzvDto=DbfN#Qrn_$DTSVKFgu?sk%9{^spul_SsJ5g)G zXAL&*6mt`4-(5hi2AXO`-Iynyg9vVym#?eU#TbAnb8yTMxPDLv&?^NPdnyF}GHnBH z9An_hT;bqOoM7Ewb3L(&lPf4K19xET0RQQtmfvs@50H6y&``6MWx@QATh71AA8@vR zDERoH@Q6Qq!<{2Sjr_p?LatF#?gpHCPwH{wigC?MCirNmQRSl-NGR>?z4uK5xLoj1 zb-t;xAF$OnrgYSvaCo#E1X9aujUPX%&S{K~29-x1ojv6#9*#f6=``CVU1KMdhGl_2 z@|uYb+PVTQt`03%KYB-Hwp_cXHug>Vdpd02Ud$&Pe&ZK}VRl(0YFN<}m8@|tgxVA` zXbmWu6Uxj8ps@?MaYxzzBbzKhe-}cCl53+$KkUoO%WcsG`cKibD@;Qo(j-Rqz2B zU^rC*L^UxIc#8l#pn?(i0IH6ff+~b#LPm12s74NCbc*Q#k3}(H3AT#CXK>#sl9PpS zH8d~R0z3`HJd7~@W2G3jK5HIWlC6532ssQ+0%w4y8;Q`4duSdiXhf`Au4V6k+=;+e z?cZbPCAYR?+e3tu*=V%=Bw$AlF_YB#DXE^{8tnT>cW>$poCgXI0O>>sA3;=<48~k} z^7$i*|0c+E7A$Z8E0ybFv0YVE&=CvT(1E^@cHwJGRv+M@zkqgY8UxWlclUfQWJlFL z*`n3=heNoCtO5;C#P3d{ZP5J-Q1BR%&YlwnJhI%1$doV4uEs;HNm;pT#0p3p?7V=!v8bVOhBI zR!_*iB3oTX8{eJs`(=l4A_(UI`5)GV>pq(y)uGNpUF0DXBfLkoyBrq*SN&%l6P4Qc z8MYWWL+fiR8xH8?;l;7`38`meM$R(;4H|q3HP~xDD2oME42s*ldIuY7xXD9)7%;XQ z#!3c1Xp4_+@rPoDI;iORU(ecDh6k}cbPLE&?}m0r+xuU`!o$2T?mhP_12}L4E#7MF zjL(5K4&m;hrP|<8UKVSxHhDA*t13nu9o-uB$QY2e&yQ-Bz^Kaalp8fC-MG(dvE{f_I8pi1=9vneco2LlFmf-_!VIDxJ# z4>A8V%nXdY+@6As@%}}>P$f*Gp8y|{A6!|SBGF%j=nTTjiukYy{`<2Xw8=5Et{b?z zkW-M&$K%J2XiVil4fbnSX#xZQP6_#{_k|$;#6smg#u{&(Bei#q3}iVRn?D6r_|w_- zkzbYm7&p=Iq!8+R3gUcUq32`AS>oesV;we)^B(7L#SH^*e4tympl1sP_>bVy+hm{ULPS>-zXmY*J%UvUoPAOMqh%*|APzX;Nb8t7mm@Fz;NOII}7eV-Ze13 z>A$*gIF>Or?stsQmz)3S2`e+^5@fh=enXBN?qk*5f%pqmv-h`ZK1p(=#;w#6DMD`_ zg$+7A4t9Y;e5`ei6DXG+g#1c7t#LbA0m;rv2@YftL!i^poB=Ue+L76LlKzs+XzBR; zGNs%*W$d=DC3o*>R@~1bUP%tDeb8d%(;8#j@ubc0X?M@v`riJ5>(2(y0b`85gvl2# zr>19K&Cb1^UwHHO-Qv>n$}5n01%$4CdrVCjGKDt7-Q~ebE|uzOz&2Xp*=@IRQ^<+u})%E_sJYfImolkWLKj?vpQ7q z!F}-=AJg`$ToZs`RPoZavvPEzUUU@D32Ct3IRni`k3Jd=2RJ||iwLfP8B1q$UmwNd z#Ax-<$H=NnEgyGkn&8_=4F~Ujk!WSTBUzJ=L%Izi=#pY4dQfEaXewX){WnC?+p-(Y zOdc4#1{vlit|{mEO7qc69j|&D&qb9DA1Tid&ukXE``#nhUU$}K2F(MQsbk3Y2(_-x zrPAXemBjTxAlRBYL}xL4Vi$PyD%pL^QR+3g4%?<5p6phKgSt{2WIi=?=c`fg?~_+E zAzxXi=_lvadGBcO9m!q1=?6BD{jVGCE&3u+I8hB5ZGRwX`Zv>yOR{4d7ACUaR0$5< zGPB7s;cu9nRN1Q4FWZ`H<6dT#Gm#lnZ2Y#9nWk*W>_{e#K|58}$`HcMT0JH@bz<~~ zbL0oLO&cPc9shF50^Uzhe{SrRM9EZ^=gWLxYRNL%$xJ=PoS6m(XydTeNqwGF4YI8< zge(r_m1Jhk4y}oOrz&&d7&*tySL;|L;27_El%y>t9dZ&bnO+df_T%b3U%yzQg>~%4 ziX%Gf{H4-@Wu_XnrW1lCWeZawWw+lhyy7{`CfL|Z`ySQ|h$M*(YY_vC(gn#i)h}Q) zGT6_zTFxYZDFo2Nf^TR`HCZwalL06~oC@3QlCO{qlBa5%aF3Nn?Ve>xyi{jr*%UKe zy`dI!!bJg3V336^Sx?V38L+#4wHkJ<23{m*}9+H_rxq0 z%I4^LH3WuP_Xy(FZYZ2=OXq!YH!Ul~mH&fxa!PWYPs~<%u-WKKPdz@|ZtP5gwk3tB z;@4RH0<6g1#nmWW*?@Ey@MB?OQM~Sref9;**PrOz*^4nFadAPhwk|>wgeusK1{zCo zSWU7rwuo_O#gM-@bNy|udPR~u0P&tSwFG!*>Ll- zj%M3oNjP|XzRA>S%~|sIw`tgO-7WR(DYw8A+5E>(VL$D6Zjax1rwt}5{HW;JPhTUi z!7464+Up8_e&WMl$t|JkNsIl6PoLji4%^jp+9;d~dHL?+H!1o!&zPb@KC6%E%N$6{ z7ZjWKk+=Pvdha+IqWDLNON!OqY+)o};omf*iD?gK#tN?OMci7gG8u?i@n4}%soI#P z@Lm^-1(fGmm-IRK!wl4(6YSMk7JFm3*Muk;#*it)x*OYaqDr1;)N@RadQCi+(ES|; zNt90Qq8doLg%+8q7-Sx{AAgt}>SfOPz?u6Y_Pw-wRvg=iN^8db$wWSbGYk7OI$o3y z(w4qu?_SRk!ogLw;DpnVj-X8aT2tJ}=3F>$d!D@U2Q^hai+$t0sG~hRbnfEl}HolzOUiir7H2{ z%|Q(Zw=#HSCb+!IsdeuwkPNWdH;85?Vf(7KSpbNlp_NO?)N}o3ao{g4!tL6!TJb_Bs6-QvKj^}cBSJlI^Hb`Y zm5I1a0d-mJS6UHwEhnE&FwoD*k?88G z&W4H0yUz(8=9-2ee7oOIfFdg8JHFERahnk0iu~IHAO&&gf=;=q&Tos zk4q^++qcx{b?niT==oU)nO>*e+wj|Rt^G>S!tLostZiU@)iowIy&n&6Uo0~Pr0i1J z(4SM@VZ=0dJ$g7ztby+r$&Wi9+HgId4KI87K%;GcS#X};9|k1EW}6yaYjAyr=5l0` z#Bm|4v5lIF#8d_BQjsp%oUM((BtJn2y+9Y@_VClhZ43XBXpiPuGzSdTJCucB!%PAU zqM>}vOYNe9#wtA5?EQNsciiZ>9f3(42WE@YARIJ8ktD{W+M`u2B$Dj=+CmbkCI&$& zGjI)YfHCdk3E|HhfH2-_=w$W@Zt@6|I4MP|ykb149$WItH8KO1GQDFrtSCkzN|!2u ze0ivH=&A=m5Cpgh6iEG6@&zR#B&D5ThFvUW-t7>q6k)vtqaLRY;-^O()FB>6u=Y}m zb0U#+m^69INq-I!6ZEQ{W5UZ6K^%u+gH)5>(3z{NAguH<^*c}aI$?xcS~Hq0O~=!G zGKc0D;bf-Yo}T_<+JYZHH^VTH8=+A0+npAZ+p;*VYun+LG3h^NZgWZaq%cbjV35tKeQqwv=iD0e`IXn$QEdF}0S*i`~ zE83xHI)Rto^0Pd`?^e5;05kH9Xf^8V>8C*-+)G*ExbUmM7v)dE&siaM#CEauC)@M8 zp@8G!Ztv;80qQrx-s@ZzVz+DZ#t~N59WD#5KK|$7tdIQ4uf;FV{MZ8=h;%r-Byjm(253zOAnX>tf3E<$-D@c3e+ zDAARl#AF#C=x0ralR&}9>t@mj9s0#P7~;{)^gs_grc1$$KSf=h zjY81_(fAk{5(6~BaFB##q#?W{30{&=uMOh!o~tO`T>=X>PXMygC{e&e3;_GUAYurF z6Boe`!0hl4UNW;7HV(cWb(mlZ;ie<=>=^$caTf;@#W7$&TWol+(6^p=cK*c0+}kYl z+ld^JTy_uy?snl_WDSL!5rlzTC$bac4Kxxq+<_cCq&P0F$OGV^-8P`9a!Dm;<0Gv2 z5W1wqL<)1ZaSUP!&}c}RR=%Dhjo_mtRU@OOLC;5~@jO^a(|!`vBXtCbWMC=80ZyIEfobYEFx11PViyf95kBtUitQ<^d095R*t=WS-|RPJi7byEgS0Jc>_x1>F7t&<8v zFbHZQ(;y)EDv5g#;9g8ivV(l{fE?H%Shc9>)>H)wq@X&TpLTmBFE(*Io*0srwol>4 zCk$<*ABs%?=!8h+xr9||Pl#uj)J2F+Tk7&`D#suaWliCzMu=_$QKU522`X+Vdz$g8 zY)iU8qKINCavoHL!Km!EEN=dEfw{QqjR3dyiyOvnHWwj*cHmRHSY8_QSNG`47s;&H z96>F#>SiE452}!#DB1upZw9?+%Rew7d*H#=NxqK#&c)A9~>QP*T@qS&C`I)asm*h>K z&AhP zp&xEKo}nSaZW+%6t;KqmONFC5LYWBOoObp^sX#8-n?cstH8+qC7b3(Q7N5g+^h5Zx z=ADf7aEW6f{DRnusyj7R?pZ%*>|$3`62pem%ZK>X?1##SHGvBR)_*Ize}njU7$AP& z|AVso-}#FFe{-Jy4Tyi7dzqwz4M>0~4|;2tPONM;#EeIX^7W+KOFJg@DRdJw`fSdt zj75m>ZpBT}_CF76d)GW8l(wl~P;`xyxg`@NnIM-G#Z2;1Oh{4AI!BRlkWDJY8T#o) zu@~FgDImyFm#SFVJseorYGnVxScEVPrgBL(!)Delsd!0;9>amhaQ2=$LsUyIsf2%ZzGmmoMkwWO}wH z{I@?9;7m6fCp`l{nm&n?6506mjBcfS{3iFes52~j4^)%G4wa=1kZ*Dg3as-z62{ZC zp;Ih*YLn^tU|?W`Hdd6JC!I%AKn7mm<_I8UY!T^4j(nvtSJN;iR@(0Lta!)eDe_9?H)p z4RfVqimYr?%ATb2r>x0d8125G>6bPBfx})^t)xU}>4~dbH)CEK7}fL#uI;YnTrAm} zkrfYTEsa*9ouNLK38=7>bv&pg{)*2mvyJb)PayFt*u5X~oGG?=-GvhsvX0H5cTEoS;5P)=hNb5y?iW+L3x%+}|gXue+bK(&LoJo%a$1URDOuclG7tXVx zIBrSZITraOm{o8>c!m(!gmZsmi8Q1`>{pPQ&*afC$z0~cIU|8QvNv+kYo>TQQ31(s zX6?PdSoU16-*7RWz%EjisW!Cuvi!p4k~pgiXGud|*=-+AJ)U=q-E)v1sIXMUgN>{= zh0^@6G@I|M{8EM;`>M~G9hW$3^c1c{bNcFjos(5`AG(sRwki-6pZ~Oh4<)HoQN!p4 z*dOkJiu&YAv-MP_%X5vW=qIw#mO4H@io57bK1{IHF#XiBa5f1@lr)|H^oZ-aPG8$b zB|4VlL(9j{EF67u53;}fvjMt8=RxPse>OnxG~DO}`Giq7;8Kpg^j+C496RJlvtSFm zZ8D^n*WJ4p_scg>AHo?U?DtR*n(R9y?FC*`YMgxOmdj;blyE?x8|XP z|8tG!)q^%V&?DQ=jmzaRBIc4#j56xn1@EbSeFk4)*X0#B;}~rDY39-|G=0|fUzJF8 zKVEyce)=&_Vu1Jy0k0S!e#m-V@EcH?8Vo?U6!sUuJS=?yA{^0*ihQR)MtO@7$cqrQ zlAvW@cA$NpiN)#%z>=pBcla8%|0W1vt8gN3mZXh^eRSg+C#?IO)7$&t!bgR@P1C{9 z=gQN@=wHHC9<_WTdHto&kF-7oKDm^Sw=8?hm390N(%v(u$+ltFz3(Ih5?W}Xs*zqb zARWZeq^k6e(xnLjEEK`ed+$B;4xx7lO#u<n~9#~pyOh?t`uPI*D9!^2qsbl-c!_||afw0JxvkZS5Y za8-^VZZWkUhT zL&|%$4i1`<2tqh0YKHB8H3%lPG5jpXuR8b3WwNgc9S+7IrwEDo=t*m_wG41f2<_gu zJbNjhr-GvwIeF*4$LRW(a%uvW;_j%kDHEXDc*+{`F|#Zj3Vg9p`Q81+Ym|QtB-6;z zfAsQa-8%O%PN7>iWG)(XU6*;+oOa6qPe`7+D(?DY{LLAAK+CgO@fJeIa1(o1rVS%1 zprfxMB}H_+B*fgUF!A_c4uonDY&a4gJ#(HG?l_3_f#r9L(HRx`g#m-$*~2st69#+SGM&BDSy2v-&N0h`k7`_438;EIB+MT7D!JRhY8o!lqa0Kkl&>BhImD-X(#%bpC2fMwR|M zQR|<6P}bed`O0^l^hCh#<$rddr6cFF-EC&U|-&R~x@OB?)EvoPw;Q93P z`JJbih|~u*KmOi}smd%#MLcs=z4U9=NAJ{2>rvWeyIr)9&hnY^z5Nf@g7WT4IOD#$ z>yZT&?EnadP`h`sqwt_-ktB${G65%-Ro+=@zWTM!@6XOwZPya?qh!<5zCC;Io&l*X zmj+9JHOF47>FMcv$v!-Hym#1a(n;H(hf=(u1{_W^`a_ytjjzUAUCH%&zV~hwdHtYWr|*$7_r@pjA|H;|#}6-R zSr0h=aLj9>e|W`Q5<)M3HyfJ!@T=d0+0)_=;~(j<+uIsE?wY;ct<6~O#tJxkG0Ts^ z_p6nZP5Bb1!BNh0zpPS0`_(Pq$8NfZnN-u5?6<<>HE*BqW!LX;`KW$>TKK2V?UR?z zIiFo|75PsC0&hRnFRMN9FkEO9Fk7>(c3q6k^Y@O4+}UJMBX>&U&1#gdS9vYA^wJLw zT(>@BX*;D^eDJQgaBC~(iF@RC+dDMvN5ATkSFacy;R`SRoDE&KeK|Jpwc>`byLWNN zOOKbSg?v7?Re2B9T8zpp&){G@7pIyp6a9+E$_2H~PG1;c{;+UyjW1S+08x9jy;|3N zt*-M!^6=4-apzf2Dpaz?!^OM5UOe3W`tVe9R5irdB7I&Nxv27**FAbfOQh-%sI7UA zjo|wBp^TPIJ6FAQ}iq1npk3aV;}Q#$KBf2x92CUpOC<_?Bui>&E!)=qUflKMNL0 zTDXk|8qGp?%Q8)4HGs7rvh?4BZ{5>49Vs($bCvZt4ibf%$93sdA75TekMC-V2{e^tZ8U=rL>AvQ&<;slwO96av3@rk$p~vw+YSj6isVN)zJD&*qMw6jIZ_l1YCuu)usxpxkPOlZUCm-Ot{4kU{D*dkf=b8I#OSUfG zI97}qo%tAp#%1}?@s|YT-uT^Bc`rMEUlA?hB&Q|!MM!Q0rX*1%d(O>^H^Alh4>+xY z985k<^yi&hl}Y%oK4P5dQX*ck6qs&RAVa6Dyic0MTgSwV-r<``OV)hv}HL_^CDWwz6yoY7fO zl)*An))X+V6=23vjzsPumf%Sg$TB1A8=!O7GTSB~JJKH<96{C9$j4`EGUH^UCbX-v z01li|{7;=k1dxoN+)(QvahXnKd9*n2T{t+%0#fuT{oS$^HR|%2ZaN!j)goTCu|Vrj zoz`67d9KnwD`|uR%Y_VfY)(*DzUgKT90mC50HX@Bk7KPUds^rj;KyUxSvS=tR-n!- z{bxYo>2i(ys+;MnpOhjPIBTB!&MoV9Sy8_NnDwpbGXnT3LV+-J&@&~{!$R_CE0u(ZwSwJ*Nxe=kqPA0N$WV71oz_3Loc`n&HU{G%26lc%;Tj9INt z`c=L99UvlVGPpdbiB*|-H3=>Nwzj4S=}NUx`Ys(5`B_ux?gFM{%}0W#)dIjmE|3sd z+al^jM=rpAD^^gb>(OEUP9S~S zsv&43ekreEwWq-gExZ1!0g=vyC_8IFu3YAATu^JgL;~1Q1+Nv)8$+SolQbMD@KFb< zSOgWTfjAn~bPWZ52t-4|%IsSK>p)Ng53m85{Eouxb|4mCplZ}K;eg1+Ls(H9CM3!Q zQ`7!1^yC-hT`6Rn7nV+<;p1kzcfLdoN3!(;H~D14p&3)2?U_9<0(L*BZY`wI2McpgC;QZ>>1ch1teYOb{)KZ(3|d0A>P! z1gqhPZ6bQqviX2@9?kV2Bqs*WOs1kEx3J@3>}0AD9qNyh8M-GG!dMVB3y5=H65PlZ zLV-8FR7BK4ScvqTWZ3z52#u1oAgLq%ggMLu!e#)k&WA8#ItR$Tl>UvraYumYxk05a zd%l|R?(S4eQS=PS+P?K+smN`o~A-OgCM8fdW;!A+Z;9kv(14k=ZgyKSU8A%fb#iEbr6RAt{3DM z+QU8?!l3zA;Eh;Y>I!g6chKCSl_nG{U(3$jpvLae_ETCo#KHF-kPjYcn%@Jc^PtqF zCP9FN#1F<1VLz4FktlF{Z*Yv6Jl5OefCp&wNOZW;XLU3bb|9HE7xfY=gdHmOU_&Pi zap}uo_GyzX!G)7nzI{lobq}W>IHyG;}0Nt>>QdUX1`}#ES-PUg!<-d*@h68VuK$}D0 zRxNNr415!W{;HtYa;yY;)YH7_WfU?1>DAjJrs%dgGw&BbDm_60(7_HM6kjHO=gxhB z8n1|_)_+;?JO~=alk4I!>=_5AKb#B?>dXN%*ojjIx=#lPW9o?Zd*sf7shaJTiFIT{ zupZ+<;8QpjtWh5P$LfF=zmNcB-=NNqZ;_knk|uV^zikq?YZNx<6K>39 zd$%u>o&qW4L_GP~yI_5h5d#)YiN9HydMnkvu?j_s&BzkE`W{}qhnthdojEAwJl`+& zl51Y-^1QU|yln8ieBr!e|Ge_6d6hr&xHAiCmlrf_7p?{`XcsPcq5s|E`Oo4)DTN^T zzs#Bby$kej;luwwf&ef6{O+CCUGY3$LziP=7q!H>lC|f(?{e@mCC#aoSn<0c;3S`G zSz+s>A0(7q7Mx0E;zLrYWR)oQ#dbYk!@q6WVv`PH0l^Xx`u+k2f@s=+lCCFhz_zrLmZ6)zWl4CR!Ao$BL9fx{&D3Zk;Ue8pjd(Ln zn$Mf`giy3%W%Wx#X&soFvDX%;$8G?-Vgui*nXnMEy~s2;_rXsRyR4CNrRY?1q%|#K zA`T8OvcpO})6JE*7{zzKxdiDd+@}*rc${{&G_#<@=bO&f;5EF1fNu8Hry}Om?H0O( z=|!5FSrZXRrGRcY)E(kw9EnOZ=D7QjqrE)sm89kCmc&de-YuFEz8+rstQ(91t{$AJ zoQq%fx=N28GV^T{Un9%viY80l-@zcYYWLC%j`q$YNTKuz6^`hJu;;gQyZ`XLWh>}5 z+12fh-?L&}hAS2yiiO>GXEv|^)9CJMhRY;Ms5G+vOkd-WxK;&>|2)GIN?lX**X1}R zhUyppfVg(W(PL_L|B0KWuRJnc7;1F;#@RH#mTmu8I)jwXwBwPqJyc^mm3!CU4CCXp zg{m4@;h>x>#YCZzP>kxaxnL;?7K=$VB5IC|(o7?eTf^j3NyJxmY!Mwl zXVya7Ove3Gf7kUJe86@L9iv61hOtbSNL10)!<}3FgjLKoQ%*f<(kN8$pIxB$gz8cy zX;I29keT}qEy}5OCnEd)?oJiap~tPVB+GrbCOb)2w6;EtXi-O+CW=-y=dDho);%rv z8bzljJ!%Gl7w>2g8g})~_y4ZeHcbZBq8-Q1sKWzkwJ|qOTS-#!4He;Nb7Q*~Uh%aZ zn?}guv+G&C65YG9tJg(%I(o%=zew%g?ysMVrwAVeOS~ydV>Tm{9YT=&KQE2_BYa@} z&(hdG>TMn$0C|^(44lm_@Bw&f@Xdgzw>V^in-&8Zr9s)X09d)HmI)*ynJ{cFua6r) zr!<2HHNGa`=XAvqq@YwbFJX_h&)MKmJWuy=04;Se7HShjH#K4`M^Aw(;8 z3T@GYx2!)TevU$e!z^8D5*gP#!fvaO|%J-4*xFiboJyIqp+NO%Qr2XV(X{8Ng< z!hO8FU3J?#|s?;F>J)^v|mF<;ZB)N`OE(P)GU=Jr88aWd>G zp;*EbJ zCEk7y&!Hw7#stIG!@pUL*v=xEWy>?JB0ZXdtB=`c9il zUurJ!dwBVx%acCcxX)?4{JDZGW+Sa^jRe~W3lL3~>B^N#QqgxFG0VLMbj>*=X)Iq> zkR6_QBbnIOCM37Nq((Pj5bVz_M8{pz86h$cOljOy9TVn_`1}R9LOcD_Ykc5p%PDi3 zJ@oxgjVhAb)z(0ph!WW~%YHeuSI#dR`%xoA-vimto}D%vm(N*hSW4-KBKE2t&s7gR z`e+n>q5bUs@Oyfos5yt}&HjD0?QtniC46Bz`$MP$R#R1~L^mORwQgN$NE<08wO?;|ZBHxGwGWW3C+vOW zkeA3Z@>KcgkgJqC`!KNUZbu^Fqq@y2Cr-(@PjV!lf6bAm5lqcOKft~L5*KYjWBi>KLiV&mN^J==A)&YsidXN~te zPe^;dKYF9`o!7~FHxmLn`?e%-miA_u$0bee9}=5Jrp0a@thc3b=5n*<(Y2A$t$)k<40};2 zsr3S^b@cmpk_hid$GmV0;HRLxDqm^~|3UTi^&#L6oG*l-?A!jFmc=`_!$rE8yIYE> zvadcj+PC_N?q+POL+~<-0uo}n#@D(nuJ&CqhXuidx%oI(9Mq9keFZr`bZp8hpTZodJgV%^J^?VcDn<6<9<6|j~&V3ZAb zo;QMlO4dldWa_Z@d)sDG_uf1DTzxR~`Oyf!+v0UCiIyMr@5i`v$EdTI)1U-G?Dp-E z@XHu?uFLkw?LQ{iU#NBFItdOx+P0-iqas>k>6d3?jJ)p-7in+@j-1LT;Xgi8bOPEr zd8m`*-vsM8Bl*A0WUdbci5A-HN4I&Dahk5y1nw(m?!wJgaPq^F6?V{aGxo=d#9v2o zJs0GL*MIpHy_H(DZYmlH-8l+-&|1=b_O?^mx=$_iT7I@C?;7OM_hIkf8xB>a<67IZ zfx{UQo)5a8cEcaktKI#GtW(;Ou~x&%~aNW&!IX{*U2G^y!4j zk((%##ga#Q7-UJ2rF1Ep9z@DyMWQj`-d_R#Er8M)K;w*t z3_%Wc(92(vgNVIY9i?psrm+BEgiQpEw9oM+r~$az7Q^&5s<_M+ugIXgEK%xOyDRomq zG)-#)Ef!?H3)(VBv$>LJsiBRR%?gYzRqTSfbIm zxaQ78u`h9ySR_Lm*z(7|*EV7^P-U9|Yy>4gFDt6B0*qOaoB_$utmKpGWX5mFfE{@5 zc084W!gzJcD`D{M*AylMz#@{0EmLFLc)-w_`luR9jY{LSyv2f2gU%!%;feS80Cs|o zxZ4d_x9T_tuq&+bfde>2V^vrH9Xf+_Ik)uwuQFMV;0aA~NKAsdh+~U3DBB7+EysRo zjV;wy%lD5$KtZ+*)#u0RXfowrAIE}KfnihbBLFa#5+KD+hNtsO|C2wdN+*o@XSu~X zMOS0fTBDQ4v2cSdg{oYHUy6%1SZ$tL`BV29DygbFk10xu+Ag`CGrvV4f9(hu($4Qf z+@#*f?Ow@Wa0U!_@`pKXsSY!kBfx9&1(UH>2{9(@I3oy-5<=xawJhWq0rq2*&#go* ztrT*q1L&C$wVlGP9W1#9%brs3uDj^cSpN7#(V?3pBRS@EIB3FAeC$@_mQ(zDrTDLi zBozzs6e23p$0XL23QG=KFU_pEUd_f=3FgxvJ{l32O^h86MzzFY@t^AC0L0`AGa?R zatB;LoMWeiZ+P$uP{s>@wfGc@e{@DQYDky@wiE}{P+mUKtT;A(#T34jY&LwVe?Urp z41_Tdd_pdN6bn^AGP4pu^^L4YBIv7u;5B@TQ!N)8P%?oBP`Y5jCQzbXNpo0nIG2r@ zggy$Ogn{L?_T|6RfZ$x}n}G-lr^AGzqQjM=520uj)!Q666EfN=uk@4;1OA!;G~6Y4 z0ZOb3zC`6@xkH%obQ}gSKSc-{b&ii*rCp245QVT3sYq53CTulEwVndn96D4L25>*I zssTqzY!UPoK!t7|aspMqO@Vo4sQP~aNxD&1To)QwYj=?Ga0BoNRf@!Owz$rB?5w54jo+jlfY{`C=N)537q`@u0}B*w_s? zwOt8kDjjMA_$eCyK8`lgp43pw$b`D^c^Cf8y(tg_I}T*0kTo+_(7&Sb>NEANfmGC} zdcjFR)3PCu46p)C^iNsZq#$!vJj~oItU(O|f#s(yx)5dp=yBMLNu|qiFGmE`R>fU_ z6I*y^T2zK>)o~?;lZ;Z_EaR4~f_4>hq}CxyEe4M&jO%=yhAc=UbuqWA^pPMwj$UoMO;hQq}U>D z&`91b8<&KtBBAB6JTiF@gf66iS5#cF-~X^Ae^*dDzfWtIn4|;I3lgE2Z<5x8K+fL8 zmYVH7DjGY^2`LfxlzwRfXJ#1s?vXX*RDle$Atwt*!KaF;Pz8vB;na<7`+z2QZDahZLkSX68y5LkG z=~?Kd6VJBqtClnJ)ba|BuGnx9pi>^*QlJbYWB&uxF#fwLkx3Djg#E8T4P|5Oe_w(4 zFQDeX29W=|tmD5CmSFx*K+VIZG`?cIHYMm7FQ21kmH1~`Qnz6`PoVDp(}Tc4xVXRm zh5Y9iBm7@d=4SaY?CZk5baJvb}-4 z{DQ)wVq!^YS@}N$$ThWf^$q`;RBwWUbr5I+CII?5>Pe5>O9eM-JN8woksB`4F2!kR z_*k}k_+4p7h^yO+P>BxuNl~(h_u6K1#F+@_AuzP)`{tK~dJy3a*un4;6b9~vDx1vx z4mi8m<}=ZrqBKT@1W1BZ^Lg%`Kh5O`n*h(B!bKb4^6x za-R`nD(|_ySzNC6_GR7{Y)M_1xYogAmvmb6II0CF9}IU|jw~|cT6z?dCgv8NtSfdK zQY0FUhU8FMW0f*#zHjR*_Q&fhik&w2&1G_>`Bv9TN{Zkg7ga^15XN9O|w&nq^FVZFkx~j5Y-P2@syMN$-;8~rpQ8<#~vb^BjZ+`2&Mz3WW6%f-LP zQ70XmG(_o^!(*CByM-wsQY zbA?Lr@R3je5vD$b`+My$Y-LS2F7f1>_OZP^J$3+yv$p;E+oIlZ^!J%3XBZo*v zw{)e2Tu>WPiv)YXwtD33Ft7Q{?usA-7IkhZIr^&p=5O3RDFI$o?Dd3A;g?zIqX@&e zAK|>{PI=}FNQ3yBlxfMqaq_8T-sglK)loVgT}% zecfuJCkq|1NQ8Ae_C^sTwT4zxyreSMe#h`;12GyeZ-lfDa4=uEqyy7&NbCPFf_|qH8F}doQ@A}LmL@j$`_L9&q^0bke6X%pXM(_tsg7TxV z`b?OidQ~g+rtDYQ+XAQMwwTG&lwF-=D~1B;8J$sANw5vYc?T6(fS468Kr zShl|Z*swMv$ZX)gj=3ke_j;1T@?~b#d(>zh42U7I0#Ros=_OLsKHIRjixTHAS6JnY znjv4zH5a4yoc`RmHzUX^B}sYv;lq|}9v;;lL>kXv;_OW(eYLpw%l9no6FRW?7Z*Zu(u&xUACY4jGwiUwjkb7(4ChTH;hE~XD=8{ zo-aCZ(DYe27=SoT>weC{K;M-vUQ#8_@4wa+BJ#6^yVewV2M0Och{&LCrlXni>q;}8 zW&=9uN=`S`Z|uZU$z!-{5L(W^!*0I5`$Z&NvDq@BjUvq1E5Gu&&YXvSXRyn}oI$v) zBACyjddj5#%%9QPCv)`ccYTfARWuLyPmuYg!xoye@117dL^3TuvCuJSYJAL8N;tm$ zVtwyD%}~&RRHvj!UCDPP@jKGfvH7eOAuqXK{22uG52_BV#{i_k_4{il>#YWS13#X5 z8+_<}4Sf1B2yGx%;Si(@*FOQGXeE%1%FiqwELa?-jdnzPg>Oql;=uPpw zf}B|AQ_A8~$)z*FLv%ee_x^sX6`S2Ld)@5Q$tr1@tgfo(PlO2MF$*%YS}bC+k%kfXGz_CN5-vGo0_2tj`t05 z+Shyf(-gK|%Uo>ke69C+%J;-U_wxDI8X=0$_MdIu*4lj<-KSswm;fLmedo-CR95C? zq|OL_iPyX1cNh8WI!OSp@C=bKeYN=pM{rH?uc?$_DYs9?RKG7VUAgk~hDGR#n}vF) z?h(7;sdT8mI@6sZoRI}HMl&)5Cd1hiB`}8PmM-DGt$yz91FmkAY~34$R%!{|Sz4#J z+%&F8)qCc+b}p|Gu{8b*r_2KQP!Bg2^u`Y!sC~fncT=8LRt}CpJ|CWQ&0-g0LjMSe z(HVrl@CnbnO<#~Ec(ND-Ni$287N?U0q#eWL)R~tKFVYcBsmZ2omqM|dXZZQ9GldyW z39%@>;n|<#kiJB@Dgb;t^$M^zi*cflouhTC*oUPAAt(-MCfk8;h^GvY4YiDA5b9=8Q}e4F7Zo=6eGO_ zPHD(0o8N?zHbZ4%`1PLf3fQa5l?S{UyIvL({hk=@sx2rfDabL-pA{34D}2X&NF+{J z0hcNAw@q}^BJodVLMbVsr7iXalQP@)Tl=O#B`ABz7N;0r$8Q42x*U;loWSOT3*y@P zk2ieJ$veO0O-_^Z|6$~i@J>Li3!P??gv*kA=L%eJVF4=mpx`a{78Xb=w;w$GB{j0A z?fec2*p*FTwv3>uNuaHjEsiuOr>lHr63ckf^peeUDPa*# zgHv*Hl!KGWhp3rt-uKec60^V(JHZp}(I@qY#!f-NH&|<&Wnmlt@H=8xix0KpczUSn zN+gG*Isi;5JZqgE0Y||GoF3v~{6|ZKz4NTev#xzh?x2BYSyy01byojI+KzV2){k3j zY#bl9-OqvY*=3B>gp6v94Bryg8&|pfIHL-1o`u;4+Q}$n?QJBv zQ)l8^`ZV?ZJKv%^B~5Dy;pN?V>sarj`^fw!d6b}|2?q%C=Q&9Q_|8Vv5+WMyK-L+0 z3K3MSm4DMIpB)=rhF3`1{Fk1D6h+aK)ER)2HAv1B1rL{k+fLvaCctx>(b!L+c=!xD zMQC9{Z?sC#D7&zL%<*#K>iUY=KPZp^-M>+w?hT6Op!f(^bm|83F&%P4Q;IkoRGG2# z|6zduDGCcTPWl%Mgj4@z3Fd`@EI8!HSluR1G387RK=;3W}}p2vlL-h{u)Jj zCh&@`;IjbmbVq<%S6Ge<_^1OYt(Ga-gBM&t`i%!Agz^{&Uyp0P*KWBYtip(^V#J|> zg8%4ql-O7m6`?9Ij;btJdgs7Ow!F$6k|6rfhX_<1T1MYPSz^09w1b3;=ms(A?}l0|G+;fJZF)mJw0`IU`59z zL0c%!E_dY@D~Ow-1#AX^Te^9A-GG8()3Ksj=Un;E)uz9?jf~`yQ$^Ac9@x_*(VQUR zxLU*-sonr66~%B8^BAm~L448OC{U@nTx7I~ZLf(ATOKszd-qrKIX!^g4yobP!q!VF zB!H|>TVNifLTs~CQ0thYDLe&ij%|h2rK@nasjZQ64BD>7Bk1g?8y#WmNK2uVHZxM& zCA%htz_wEnvX#?ewHT#yMSyAEgHgG|Sb;Ob6upfh6%)`djx{!aTANJ(IPoBb^AV&B zYy^T%y$~j#u(lb3M0MVbYZoK1NN$vgliNEX(A)8l_;^T|9=JB#l^6sGQ#zYo*A-R= zbv%LOK80X?+S7X(L}$81XS(R{)k%9DSp=Y#Ld~SKA#t4{PiygdJ%l$M%p{^9wwr0D z^CGSwI{u&3m4j@R;z9YN$~SdEe-8*FP{893VL9xZ_=gTEVB2ULsjCo5sYjD5gZ3(p zCLrJAKzF6S=abNU56DO^cw4FPIa0Yk2*N>PxH;KRncAY{Eo^{t=kVYu8w%X-Eq)mf zyr6BrPfLFLxt<~;sm>p45JS|{vI^lri+r%-1b~QxvkJX)w93@vL3Sb+T)gv7JpD7p z?xi&dbqY9#0c(AF1nq|CYq^?fIZRK0zaGURSTHr8wOR?hURO+^hUA$Vm|l*!=Ywjb z0k(%7@z#TIpie3R(nLEdf&u>qbxbRCGZV-kJpimHg!Yguh#mCaBj4QZSxW;h^g*!o zK=vPu|5#9iL z;vu(eI$PF&YU{^$JlfGD30iy|C8JC%7y~^>cM~A@_xhrBK?AX8<9ZVoYXApn{AWP> zL_(L}o56mu$xAQC_3KAO4<|E!k1*pVUgb{}{+{Ud;Md)sV#18&1x?Zic362rtb%~p z{SG=pjl;`MQ)95lN#*Y?jv4uSU`fZG00YaeNzu03QQ z!hL3v6W6i65B$vse65FM^*iPIdgo3?1WD6EGeCSnSKj_~Ed05SWb@Yo$g`m5xZsY3 z{l|&Fi+k#ZF4c40KAAg7m`4_l*(skrW$7QTiANalEC|}o3t>Q8>rUIJPk3Gdck7;X z8udl*LtORe1ph1w2SY%cp=GWGMttY>`00B}ox$+~?5J+5_&%jqMC*h361w)kzw1%K z(CZ14P6f}_SI6lM=5EtXuoAhPp7ljhZs(QR^Pdg8=p96+kblQRrh?`@E+ZIb>aiY_ z;$`Qy<;1PTzK6XX1Z!{(HT*>X$*=r+@tIzE!W7%@Zu1~$hX?fYZdY~?^jbVbf2u1^ zsiz|UrAL0*+_TlP#Kl6f9^sS{5rbD3HeRW1l({6#*b<)*^=1sbt@-`(oP!|NeOmoZWz^Y`|`Az(Y1@iZ+k~8+7X%41YIJXWuZZ zykRZE{U@5E`XA98`u{4L`=2c)l&;%ssTzDi-0E~sIuXRayVUILo8MI=y(HU zaGb6zikfQJzC;9Wn zbn?{V-U|#9#4Q1a#bZ5j;Z*cUDa9GW5X1!`dVv`I%plwtel|pz|04>dMroZYIFaXO zpm4@B1)>;V6EL2Qe&{Zlz{wAu0Vx`BK(LhxCNC>R@O6R|h-&KEuo9easKZ%FFNJYi z&2i$YmxJAC3F_?@4)x@gC5c2xerEmOpOn94Q^teL| zx29^ywnPtzbO&E`v% z=*U0C(XJI;4&^E&Q$ zhDU00%=zo*>4J=|Nq{5+sePc#e&^e)b`vvjPltu%GiRVBakOBf2N_zlP&YWDblnc_ z30gY-Iihsk{@hzO&u@@5^=vwj6?FCZ)3GWYT9;!+|GeP=zt5*@vOZU&sGdq8Sc`!9 zkiAzAHg8h9vV~lQH7Sp%yh@#v%rsiKmLCHI6!^zp%9tTo1#V*`ji-5jw$jNfh!-xi08*_JQOf! z6c?Y(i;?R8mVa#H&IiK|CiX|UuEzZw&ETDCmbqT)21a^AoS*#t9vj48bdmd!=)$4i z72Y8MO%ufJPdS|9yjiUeyXc%h(a^~cIOYTZ{P&;LV0bekuN=-m!+vmBo(kvC911vz zj{SOF%;m!plOZ5K-4(^b1<(e(iQ#QQz%8#DvgJ&@18E4cYUr7aM-wRC)szkGluMF@ zGvizgGe|m#;l3sPaUt9Do05V4nc`7MtxsLE56-4_p2A$IVrFJy_6uTCJhYk2j!Pq= zJ1yK+HyhmP<*C3St9;rd+B~PY|7s_RN3I zrpsW+THfvT#_OCpyxR-;He*qWXGTl})^9)lEgUKAq5nousk=b2NM8+~2czG60$6M? zGVSP2hSZnUejC@mpsvf39|1u}VT>NR09>Yrmjncg9L|My+ud7TPK9au@SJoz_!gD$ zFd*uL8HDwp_$tIgiI>>71E!OgyJOfF1!Y3hA~+%)^ejl!=f9QfDTmdhgTE_sI)wRo z4?Fe!&N}4wzYGJy-qX8xOy$)#YdYcuo|^NX(yFl2zanS&>6RQr(=}?Q4YHnG@ZsWVjwQwgj0DS)O`#Su;3Bsc1>Cf&xR7Hte7-depTP}@18;SHgXDI4kYr7$nDs&u4XfNvwCz0*(!q#Ql=4G>Ini>&PpHUjW zHPL5CV}x8P0ZJ2CCu81N2XGd{wi|O*jm6}f=yT+o>hti;HdFb8l`qpy+N)V0s2m)+ zz&AM(Z{MiqxXn0=KiuW_oIvabO7NfFaci87v1nd%mt&?qHWkm*x~WBnx%M*OD)77{ z0blTMsA7fEO_@x4xC(SV5DV7vx7_R$;k3S2yiloJr*r8~}urbj}jX2YXJ!sk| z8Int*38udlV`w}tBJB}KzxuZzOKyamlGNvf`Yl1@J5R1BNr@4~DP6bjJ{T7FLD1*s zSE~oidj~}=JuhQ!2#>c11#5sNF>zRPwTH!pDfzalO#1s@(QlVU1P4}QU4=KNV@NzY zXPc+mTXLC^Ievn!%dx<^5xbhy=|@CyP~m%^hl#H3$vSVQb|Yl}zA^Yn}8x z&?!vqguU%v$k80q2dDWkJ+LVa*IzQkG;N6$g(8i=4UF43vV>NI1b058ZAsi&AZln%P$F{YUKkrozSEy{# zbF+$W@bVuoX|+Y!egZv>P7hh8ePKShD(!1PkV-Z?RpExlbAMiGKaNP%-pYFdTbC^2 zyjRe{3K4WT>5ASN|C7r0;<$4wjG=xmAC%F`KkB9b{wb)tRj@G6JsCzb`R)Atp95w7 zx$tin#3PPv4LF3pbv1wX37=t;*%#ibe)?Dc89}6U*73wpa!^}G+Ponqr&fpGNJxvQ zy?MzzA%uUEDUeU-^35lV9>YwLY1>g08E8(oW)- zm|uSITk~tZj`knF&uQ^C;XAKsxE>s|PjX3iUnP$m8hgZR)mgIZ?|=Hy&J-rNc4()0 z5PIH#gWKVI2mPD}3;5{tIp$G3(W@$z$@TN2JZIx?8;*VtXkT;+^MQdZW8BLwvhaIu$A!k+j zsMhd$ZMw!7%GBza&K%%*j>^B7q69|YNHjji;!DghBmqo`gW(b$3p26dOejE+byS?c zHlx7Rh!^9RR=N^bmjzza0BEvLu0@hpHO($ZY!n9U-bgy6P(R0XXd{rLl4iD=#fe7o zkE=8bo`-a7mLnOtgaOz$n5b(wwuD)+XkapijRF**Q)pRI0+?bsSS)#HeQ406#F?CA ziXlvn4(1pxPVazfkyF_GL5OF%@2k;5)LD9@zrC_#ymF8DP7 zU_Gork;}u!%V_M%mTLghpB2{lOm-Z|omX+@7d65l6K+-ZkG6+EiTkX$L?LK9I2va~ zSxmB=Ei@B`gjhhBaYRaef;puuOdf(dL|JlH31Yy*SWt;n&SwW6>=c{+DoLEJ;>Urr zD}c8s#Xwtes?SwR0g7(#mfzE{YD%rei_+{&0Q*0gdGV#^MIq5vu^%%sGh=As#2Utw zO5K=h1w}~wZvCWUECnmtbpt-t01R$5amZpj9X?&FhLB%1Ij&`08-V?O@dq%lpSlsIkrHb?=iz#GL&TiG?xcaX;kPo}{ z30xrM$PEc=ZR*v}UgxcC?tH9`F@w`=Y#=YkA&AF#* z?huJU=y|dFey&19N>zUx6`89tQ`_nwwyiF&O<%R+s}*H&tx9ICkh-TejM&6*(#oMn zVwfSZk~_rm+Tkhn;(29^)~%GVt1Ye^jU#TvmKs~f%6YUi#1{$%Wp*e+t@mnv>^8Z$ z)zcF?@xLlqa8~rh2sEzy)@rBzWQV?enNls_n%BcmF1_K=IUPWfwgVw2Rmi{+iH%+< za`v|x;w6JZeqzn(N-;XFWR$yjc)5>)NcrxSVDSkx$W}v&wg=a#j0fKMck9_zEzrVf zfJRGIDiUqKGWMa-q1an%$WzY2FCG-L$>3!RAk%H|`g_LXxTMl{bZTAMSuJ42jT;n~9E z3qxUo`gX1h!&;A7uG5a_$^zCi6!#Z!{wIu5K>XK!ZVZJoO8#FdqyOV9(*G;UH~~KV z?`g)r_jCWhQbwF*&0UfYYep){q$mNf2%QC(3a55@U^KckvTq_H zD$+~nRSk%AF!bJglK|2?(nSqQ2a%#Q8(joMupnY#=iO_aJ@z{1J!|a!1?Cv@zvsE1 z`@SwFA$CIqDj|TLjYF7;g$>Oplx++bqUK<};}qc@^RJfCr8rU6bQ-j9icngHA==OZ zQz%qS)g{EHiJ?ZPON0wYiZe3LGf%aWfvh)dgUetEoHq+$%v;xz;iBNB0yEU$L~@yT$^^>TJy4i*mn4$HCtt z4jYm4OVzZFJbFzewz)d9+OfLine4jd2hFMXh(y4cu1A=&u-FgFs3l~Sd#|pIx%vGQ zpO;E~R#mewI#ud5%BfyIwn6fgGtCeC-gUH4<`*TY@4<%`MD>*OhW(u%=j*ODIy~?1 z+FNXMnY?HCu=~^N-rIZcolH-7T?&##lOd+%R7c|xvuP+?XH6zra> zQ8Yqz#4~T0=V&ni8(=5E4=yTP02v@2Y}{u`EZ_r^JS@W87c{~8Wa)YWFyT`R0!T-j z3EVMWR3USg3bkU!k0Bdr?6bFg~x^HHciy-f35;;B+b4^1n7JWhSB+dkD z3u~K#a?_6-g{5&jf?izG)*A&b-d>w9eQ!8W#2ml8;SI?iazKj7LI8}RQvqP2-w{~> z=_T7psenLcU50w#0wIJ7X;YC?#3eX`2cc2SeqQwfO#RWj)J!WrDPmsVV=0Sx48ZtusY59Sq=!UmvZB@xMBw}eK z+NOH$e7$dNi_%POJUwEM5ZG7qx(L!Z>2>aA(%LifVC0dEO`R9waBsG>pxQ|%zf#p- zZOp3M?5}p}zgXHE`s)(;iD5?E0|gT5i$bLJ+eTEChz*G_>>GAKV*x#yxsqjxZ_as_ zNb(+l@U`Zpa)(aOA4h977Ah1>wG0_fs|Y_pJPhTV)b@E(Ta>+E+gJdp;CIqN6&ybh z9%#`uL?bytN}xfOR=oPWtt0k${$}H+VpB-vE4ZQ-?gL$|S@@dPk-jbYlJ@SlG(bI7 z2Q>Aw?^n69^Isi$c+vgh{Z}!e1{YhPRUK?M!pa^Plw-LWaOO>Uk|?r~wmtUsWx4(S zGBDju8~nQb?QYRtrKniPx;mP^E51~nYpbm+Wm~eZ^v?6;l`?v;p$|x<=Uh>Iov89% z@mBEuP-T$ur}(b?mf|mEf`%*aSEvq_SL1vP9yS|n927mvexch}f!bSkFp3E}RvdoU zKj&?5UF@Y)i~AHT?YD`Ac#oe}#JzTVkKdHQ{*6X(#j6}vFsd}ms%q{(f$r+odYmqo z;W?}BM0q7>fA|ZM%2sN*RaOEtd>m4ZNya{W(I-*=iV1RjsuZ6LW2M3Nd-P zBf;x~>nRJ?s4%eeOmoWr-kP}=a#bQ_%g`e&I&1K^>*KRiKff4cc)=`}hAO)%JYjMU zxtA$i%d{d6`6~enoi#(ZizGuLHj0-gf<(FupGT`pzyG$R`E0+!z$!#J4G<(t0cW0r zNt~p8hVK|H#Rl6_UIM?6PTg%vqKV`jYi)9MQ>l}Lusr|E)FyPltK6zfhWa&%?ga_0 zJaG%|fwwizRIOGYy>iCP*sCxn!X_U-<`T^aO$@acZ;I?%mgo@d?mHsXgv6*XH(M?q+C$}4B(xsPiMZdmVRn+{| zv(CY!XR6XqjUY3nS1)zC8b2(TcFe>pGp3Dd;Ow7U&aagHHI&ROQzYdq*%WupMrid~kef`EseNZB9hg+3@z#u+s6>w1_6xEtchRo8ykcYC|A+r?}v$ zhZ+^m%S)d191H%ts?d_NjxCH=HpxO3rt`^bTd8p|-o2}K*^^Udc$uFvN5*2x@YZb^ z-pegi+Rg3GU<=DR5z#MEH(UtLhU%*N_r!Y0So~VgPJPbJKq0U@t;mNUTk}42r2GA& z7LUILvkFXXj(%zu@tqH51QmT{HSb)y++$&XnWH}Y#oKclRkE`L3sgn9E=$nQq(>jM z(qwb|+ZMY=<-Y5^9H4Z`>&~{Q;{6DVVbw2fMpi!vi4s*C=X~1trR$O=Jxk(kC3K<` z`~5=I=8~=5`OMN`C(WZnqg!S8`kK6TH_gVB!`C@+NBXfoob9)@)N?Co&Ry9VE*$mc za*wO)(Y+}G+%V8|@C07fUUy6BR(!^O^S!RJ==3r8s7%0fM8|mKjyUjeb0ziZw&*P~ zXS%Z3v3y9`#1c+0Zd13o_tU^dPst?XnE$LIou8-4JYP0NuiP^thJon-bgvLYfC_mIHyfyoxgo! z`DCfKyRC>q^eb9(VhM^M6u@fjx%WQehB#lspy8|9<9o1!utC(-rF3QkhZZg#Db2r} za?rzqr%fY|&Bb0=TH363&eHJ5>l!r?Z6tfS6*+Ha7(c2MN{eAwtPS$1QyU3<1^h0% z!KB+7sQ=WV{|EOYU`Q1>UuK8V@4xZ2*C5vUanGCI1!7}Gzvg$gk@x-Br1=HI$r*%2 z`t}W(8;W-0s=3Py>M)<3t8-y=mBTL-SFhZ7NM;IoTTz4P-ly-Q- zA9;LVKhQPFLAOqPsjf7x-Q4Y@MEvQGDaf|r>ZfjV8ME5V+`i@*jz#yv)R~vY>Wv=o z$Q82|D^H8KU(n8ZufZ=DgqH6}qG!E9M}}%#Eh7dGE&k5C)!(ce^P=N{)>MNo?mq1s zAGmST5MhgT-k2^(Ude41kGr3R~Ef##v$({fC7jtbYmki1n zsXA+f%k}LIEpZkOo4lCFu9(Llet09O@2d*C!ucr8SS7bu?cPXM0sP*mr4lAiI8Qco zi(|y?E-o+5=7e)#QFBUGf)x|*VkOM*JzBFj9zS-@8=VkP$9dZ-A-FJsT@9cjxc9l) z(s!KWOcc&@jk?d2c>jUmjvFUsn`@_3V#8p9v9rzBDyzs|&i=Rxm5&KxrMPOg?8*p~yW2Rijn+lrWYgDOBRj4<3gC}jzj!nTq%WmkbasA!%+Z$}(fCwkrBcr(z_vP8 zf*3ExXW{lCJL4A(=FgI%aJT)>Hs!Q0nCC8T%2b$d-!UI|II5}KDzh1-Hk{YgBA>F{ zqNvitZDue*5)Zpo_GnTp3nFUoGxBH^l>z^7-cX$Kfz5m?1xH~7MG%m_FP9@M-4SY`g(sg>dVSr z0nV3$M6TVS!r!RMl7(1hsA2$-SGXbdD*@VRX)*D5n6SIx`Hn(PB04*2zR>(wyGHlo zBWJn#`rN`Kp&q`gW!6Hh$M$lu&UPJ5~l9NZ`0 zgtB?GQzEx{zKH+E8JBSG)7zzOy;zh-8eB3_iSusDa?}8>xrlBV+D*?h3#TuPY z6ibS}Ot}#<_QR>tDRb-@1M{_v9*;;nPR@dF)#DsB`1}YCxZX=@qeT=@s>Y;{T+Zg2 zy**fU@Iice{mPI=C~id|rNfXKSN)v7`bl=CqP3`@O~Kx)6xLTh9}?5LvmBvB$EwhC z({-HaK+aAryR+|k^&fT`LQlA$8Fo5CNaI>^dqW%-x~5(#rSG)ynj1G9Xk7G5V&^Yx za>{9Q0$FGH$jz?+c+;*EH>xeMy29|~H74?<_v8V2&Bn=wYi`N{%b7&yLNBnB1mhHh zyebX1)TJ{`gx)LJO#R?UtmE9=jk64HIm~J)TWe;)f(+UJ8Z)vXdC5U1)j5F!Z?P3- zFhmCUIw41%wzA(Qk0C*}OciqL>!2NA2H0G$x3S?R$iZ7pR_pTzt-t%v|LwnsB67Du z4-Qlv83n-idChz|WW^JPB?Vxk<7Wf-X(ii%!;T$EVKkAOX~vd4)BJu#M@!{J>p1SS zft8N=qYfIv1G|_9aG;B{MQN4wU`qzhEUCoYsG)ie_^AhIrF6zSgEk%@J+7&ew`;cQ z;&U(Vz?80;iY~i{U1?A^x%1`J*Up&RyjRdYo?|Ws0ylnjUpUtz4=E?Ma|Zjgl=E6f zhMi|Ul$Eko6}Z;?A`w)K>19_3KXVG|Pl`931DpWzoK6P8)5ogbXQ*CO>Id4L>)M*= zDEq}t)kdNGtO@#sHTG*``^NfWmxBq(h`AkiZIHv*giSt%?KvIbkO?NN*7p7)e}qhW zk`gZIcyeyw2NRGt#JjE}_I~am`qkrmQt;_e#Lh2E>wZ8z>`9q2FEzgF?Dshmgy3N` z>45F`Py#ha;!{d7~Ul!X4<*B&msO$}R-R$GhSaJ#H0*}7#A(if%wNnY z*Y#P-d1&-iV5iER+6J(|Bih7vXaY}(cc(FJG@wigvh%9RE!I7aECYDwB&C*ep8SSXtSB-8i)WBeqL$jIr;`QGilnoi6WeY z)JkIsP-jEG9o@*J6*8I0n?vdTc~Sfb(!MeSIa{LPE4GL|ajno1c9`X<1PW9}in^C!?Yl-k!25ux~n zJgx~A!uu*5^RGv!g_%jFd-ge`=75L|b^^-^VrH;;ap=)%-umiAZc4pFioysOi_wzV z+RC~zBfSxtc94yAm7!sO(&k|LaDe4SGC0u${Fq|X9%R*jw7xDmy8mY4@zgY#2_aqnQD@djQ)ZzRY|}J2$hag9jXDwg@w`p^x{TA(-9xsTZ*y9=wCC zexMCy-S^-fnmPYz?&_zP4xbhxKP}z+wDS1Vn|Ghy{r$9h{$Ty;!Db}Se`cEhiHJ%B z7{T=a%S`j%N~ZoJ(EPutXGzYB%fysZ(^2vkn}X_?tWDIOq;jK%gJWJ z;eb1ydAdVOdAWc3$@MHRwI0u5ergSKUTN_F7kXASKa!ah#mIM83(iN4W^%pmYvWI@ zXDP6R(V+N)`9i}rP#R_eaeN6><$SCv0@SE5Q6K&r7)GW?Ox-1ePYYQ(*u5&L?o&m; z^XOdo8mW*Bb5(4N8Irwx{lc_#>vVa~wm;Yn^NsS2Pma>$A!e!Ok@Smva0V3Zo2_>e z^*~|^aqwK3T@*9ZEeaUCMH1P5h=Hzzo$RW9aeoe6#9{h5PHOg_cE@0@o%t7I2N}*` z&tEjpB&BmvrnJ$R7W!Yh5LX_-qgxrf#Y~YTnj@Mfr8-z-E6iyS>c{i^39qJIIuY=z zUu?w`Pt1HJJ{>o-8f>^;vMO@j@8;q}*+UA#+lRqlci&F-w7!2rfYF^d=xtkjmdGOJ zFxA_>F`CJ*f6t(=V{5Wd#^>GCf5|kn-~v{Ulz?4wrddLc`sG0?$d#OFhJB5G^XT7Z znnsWMzwa$QxP5+grHue4!4iQMZsn*0fFjdUg`oOQJCcP}!Iwuh7>3w(k-!lL9Kqx3 zBS3H2|;4g3fs-T3%11#8%+;l6KY{g|=U< z#WHpWt=}c|$@3(~!Dp}zG+bi^078NI9#EFW^E*<@l1LCJgxiDw$zV%Z9|uw(1ocjn z{PVKF`AkHB*CI?wd=-0>k^=4kYIAxOFpwv1JUB?!bFmN*C#nP zxn-&!uwe^suDB5(ducD1{68ShwV;KPwk8Y!imLBLP;u19CwlkQz?5nhvBYpHs`vJY zbkDU6#@_te3V%L0sWOo4@6MB0sjGv6t}A{hI-p1HwNT3|;5eEg{5gPf4DJ?1!zwR! z1{!dZ?%xlc-raQYYpJ_YGdkU00KJm0uY>Ju_0;;jRdg#zF^)!g#C^Pi6=(xhusnd` zJ3$h8K70Jho_b)ppzT{r@!|tOV8Ev&NNv*9w#TeVz3ue-L*irXUs10z2(3e^M(o%E zZFl@>`J5;vtp!H_-2RP*;I-sMAhlunur_42NM_QJZTZE)%*Bo`Z8`h#*DpK=tZ2-mS*l$D51PXS=oTyXwzh~fJ&%MtUyVFaY zp0DBFcJ*7-(vfCo*u$CzZqcopKG>am+wmdD?I#MV745$P3w?_El-_u`Ug0p~HJiM{ z&b{=LVs6_3cS5AT93jmU zwKt%49ORZCqh@}pv(4l|IexWYX0d`3+nM%<8amUnA*5~zjdL^T&zljla$gP8Vs0ZFM!_%sXM){ZnGGCX&U7?FvMsD`DHO$yA^8w zj`OPh#fwY|E@b^aoYbT~i>yezbjC%Ml*vKrK7|INt&dVl;G`!i>V&iJgrihX3V>o^ zOpE6JQQ8YH{&QMP=#k~y<+r~$LEl+B2q9C} z2eYaLI?qBo6lzA!m`?l9)_oHa?#IcFxgcizcOw)(6wqR2*SNdDS_PiLzPKeWF| zi2jt>9jyq2{CXf7LDpU^{b9HNv;Jza{d<7uOQz6y^?Pqyya4-OpB?~>1sUfr4}>Zn zUY+D2Tr|S;XO>9dgV;o->@AFfQmkYDQGC>pG=XPwDZ<`PDaiOM=$@x!5+=+gb>dKH z6KyTB%3O7|g?sTy&&psl*K13w$d~vp$(7MC5{~*o^62L6w@phyV%ljhy1e3~5?B+= z*!ji$`}8c6^J;mZuM&?yZ$dJEb*uYwa*E;bA#Sl}n^RaTNbqrcqT;L8bSDx0BRv-U z)rM4#BXjDv9R67;$sQKp8EtUnpmK^;`P{bl<5vx5)rA4y2Kp6AS1rqz+nDy+v$vt9KX^HkM8eHJ+ka0I=>N_=W)P_BM^Im$^>iswODkE8 z$SnzC`B3oO?A&_DkbRIAjj_Ej%SK3Uz~Rkm$@6!{*G??>2O{cCGVX?NiDdLmY+=3@ zzZgi9f6+I6NgaUQHt1~b1AnfSYy|Jy{{}#_kz3<&Eu+1D~>?609 zWiW+muMxNRzy9Y-Qa?(T`|qWjZjrYCT%YVW<@Sk_=037ojOhOO?h-2{uwwjeX+u}^ z^2TUrtC+_x8BqT><-_8iLFHnI<_kw(d3}_w$)6oj+HU3oucU$Z{OJ1cwv3V&Hloj^ zyt*SGWE;}%`16}cdQ22_4HFh)nL5XRV?*V4kJ#TIsHI96Y27h--d+?k7s)xt!)J0q z=c-brjI4~D@D6HpT|hLz|JE00rfU~Dsv|gh?aXV$!BsmgcllUTM=gaQ8WtWdn#dcP zUewZ&=VM|73nR~jB?I_;#K+X07f4jjiH63+$?qsC21_W91s%@uP+$VRs9YQZBf{F9 zcRz6c=)ldtj1>%Yl-7#Ubr)1uQ^aFbK2`~jIs-g10?zS~XvjHaP`-Y{@hHLnQH;8A zH!#28n$jB|opaS*A<5{6AhPhHZR~k98oslPJOB7rCos|^M=s$anc`4O?zKx%da%&q zMHDsCTUO4Wh9D@lneqYk&!-&Ii1^TRLjr%dLW@07b2>aPO(e?}Juhp7+joTRyM!z( z3B6;F*sT&MAN9Wc%^PgH-rF0YgJzgFOCigfpLqC%wX2T=`i6Fz{>E_pzHcJb75uj@ zIJgR()N?ym05EC?d@Rt8iJ2ioH{QvUFKt=u_2`ByAWJ*YZ4vc-HZ#gJI@uItAzmP- zKe54C@fDoxZ7B_3fYD(_HXNv4d65iQW?juri~>W}1V!N-Y$kl#)WM&ba)#%qzxwB- zSsLc;_^TwLuKvtPXUcsf!@@GdefA$Ex79U(r7e%vKlOIB2(s-WjF=0+baL=w|AEf3 zkO9#E7a5%;8-=&g1*`qZ4L7v$xZN=(FF`f0i2PR6PR3AWb3~I(@fK1cvgCr>KhgO# z#QZ<1;GYV>6Ar|}=?(qC77*Ms2ML>~yM021kZzMyR`fV3HVGhyiD^YZwHJz#hf;a1 z&<;k!w5sHxdo`Z}FxCZ1mW$NQz||;#TyQh+D87;;QtEn+d$~CJsJIC)|Yq3mH0eS?8uU7cwUrl`5ys_w`$pzA5~-q^L8(@ z2q&SCne?qLe)3KzEdtAQ2a8~XmcK6b9=d{&3l!>O5P|hTNeVRdaavB)EHhDlVlC^EDhs65qQHS4<;o*Mxm}7;$&z(Z->O3@Y7&dJ z-K4C(n`EUGYstvh=ZDtks-lYf>q{FTXpL=WokFpgDU}GXIE74;i^?XTGk1`JZjHkK zJB8av3TIV_4T-u1faQ7+Z5xdz7TM?x%^;bHghnAkcO$en>32> zG-ERP1qsbl-q1p5lfWTznYL+A55nj+ky~uFk~JLwm;%s{QCNRh69wuE_;^6KEPC2Z z8a6D*;n$)p1udI^lOdG^Nfr#U8bzf1;7w7AY@NW;c(efmMf5Eu3@98A;jp!(t(A3^ ze7s~~#nCae<((x1NdyX79*TcVskHE*9a%2X-Y|`A9cXC45G7s~U4r%V=JF7^{R~wP?Hry{f`v5FarqGvt9Vb!bis}90LAo07U3I1P)tf zkq<6R(Q@;`A}1g9t~6i7jz}ZvJb`8@$%Y0K$a}x(O=#0CE~>(xBZxy5`*7IIYImhF zV&Je>7Y~@NJ}b;@4f#z;gD0g#GgzpM>aHejBd;cuLWMTt`BS$G-e^xIssK(mR$rnd#(3EIQEw?Zn%PVCpZt6xbLGY7+dm?sq74Z# z@d?;CGSo^YIW03w1o&UexqlC}deGU`-P7CG|8U^Zzo1r6pA8L@OiulK|Mxlt zmkj~&J_rB?8vsbPx-k}cO)UWq()wC?0kDL7 z?Ecc1TXTjI^UoVhX)uv7Rdk$ZGv{UqQTlp}Xj!XO9{Z>wQIHjv`GpTCVn7f55+JEo z7X$2LT>S(rwyGFG^v#q2UzCbplV4&bRh#HhvG&>lSYSF3u<4iekgIvoL|^JIjkmaF zS)h1VsaJcv={ogxt~{C+J7~~Bh3>8P$QQB!7?ESK2@6;i>TiJ%ny2INO4U~eG!40E z7?navG^;kpn_rtx9Iv@^THIMv$vl|7#bqTSL`emUzG#@F8dbY}EVAk|Yc^dO`0MIS z0FNVq`WuFK)%G~*7KJ*8f@Y?%f`R_zq*~nX-k&eXiKw9mT>kw6CA80kZ?y9Gxd?O$ z>4B~ycsnSZw=nnYTKDto4w}wgokhlQl|Z;zek@zIW#LBwEBwKo57#{ytY0|_QJH0< zfY)UY-Whv;`kr$u&%jdGA!Iq2U&(eDH4|R88u9QN9Z2R zEt>^oQZavDR+%iMj=nVRea1dFL7$}0 z_(*1w!I7Sbg=@T?}FFV50RU%>YUcRwJlh2RV6e&EDSW$pjg(u&x4y%2qY=c zRg2lXJ<&e>0q(ZLoieLI5rC;qPdPI-DF>cp|D%o>FCH(d7cgy7jl2#u$&^w3$zTyS zsK{N3I;YHwPt^6&21Bhl+1)GkKPc*@as>%fQ2-#76^E|xrpD*y8pV#i#K4m|o-rG-&tCmYqddJjbUVO6ep@C!_D|=Tr zU_yzNg>W3|y*oKiWASo2-Z{wzIwSw+Wn%L*Ht25U3SVB|zpe{+`VhVdhuXK!hsdTG zpDcA4b&T*tQOrM-uWk%LcVthojJ1p@46dup0a^PzSA46v;g7cgloVi1K`7HZIm+KY zGJPUGJB(Iyi+^f5b4Lwx{*vkeOSmr}{wlWgK5%H!jmT6@4z7rktph*lg!e>!wo zUqzmkH`l_AdWhRfc;9Z zCSh=>S5}=4-&}^%mX7z8VJV?>7~lPo6w1-wYhZt`Gxme|T5P(&S;0)n?eBqh)@A&T z=`r{8#~N5mb~i<@!Y!(#LGwE!pD|I^dUa#Mf?YH}>=Z z?Pe^><_7rl#Q0Zsmjt7gFC{S`N54>rNvN&d(%ymAZrA1a<-c?bxN%*C&iSNgDGshJ zox|v*H&HwVXNDc<4^B<9OONuts+3jKx=Z7y50@MRY$%htooPqa`1GkRkJ+Adj0l&l zwI@DTH)MR4V<>+Rd+M5l<&9D{D^r0y*-AuQQagvk4j!k4DPc4Idt=75Yqk zy&^ww6RPs$-?3s!u`v*kzgWmg@p9h?l*~%+r(3^#yAmVMdzMmA2D!fql~7QWV$GdH zY@EiXjO5~Fh1Y#qMS2!4+-qWS{gyhU6*%&ODsMCHn3pGaTlmSaL1pqrfZI3M{46$j zHYc)+xJ)rNm$Ysvm($Ur!|`y`%bclBJv?`lZ+Tc^I=haNH zq`eJWR?v;<(9K4{We^i$n+@n*s=xnwJ~s5LGlAx0#73%mCu(26EGWhF-5sDVBT7 zto&3Ofg_u~3Cid~f^f_Eh9;jY98B0|O5zB-12rmqIA*sU8yV=pL+(9~iDTaUWhtj1 z00d#cch3k>WKC==Uj3yn=?6Swd58KnW+^Da6V*D#TuR zm5x<13SquOLETFRwVEJ#e9tJYCJL3>7j8F%##t6i!cyXC}tH{{VOb>JUJTC0hmGjZ;WQ zlhU4AQRfE3MibNCCq(5t-4()uI2^>d8gt)MfK170uS@BQ^{3sOkue_*{uYO1vUPVQ+{B5kU6ks~slG z0J)yJ6m*gqb|&1R)>Kb}{PfNY)%=D;DKihyCx*&HuX7kW1?S^||@q z-f767-v4!{`H$!3w6wIGoSf3q(yFSerlzL<=0ZchJyD(!dDC6J?s+z}`0hRaw=|HB zABhV5nbiS$av1idxax^dd_C{l3b%U&Ms{TBqgCtPAF^pOx4zb9{SiT?fz$$I8b~Y| z)cbE~ApbXantn1g9)cPu$%b19UV(r`Q&T5T#lDMrw+d{m#Zc1}f?H`XqW9wVkM=jV z4x?d+qm+ZBsin6N6TXe8+6~g9F^F#j)fh^Kdu+j;NOC`m@;iv%AwSuOO8#(Ldk4QH?76Y z=zz`O2DTw0NzeV=2-U>pI_I%Es|#F8M8caG-zcOVk!4~Af{k`PW^ zNsA4T$*;f0zq$N#8v>~q+5}ydO`P6l@O7|Gm!5k&X~cn|xwCh1v6S}(+?jNyjbMsK z%20>raubroC0T>wFp{hx+fH381bdOuGS`E_Ags;0Re-J2EZi)Uk4E;8$zh}ZWvOlC zMRo>nsmSWtC=R~u=g~2;?hLo0_9<9HHKK%!bMC0}FnZjJvUumIN-s_B>#$XuCLO)f z%#!;~ubr+wqIf?MKw5c~#nKCs1b8LbzNJENL3~b>`f$~JDgvsWHw0O$ff(8V*=2Qf zmxc+1W|#I%WC+-_%74FF^&%$*pF9SOIGZUZ-A#rHw zrEDJs&P|l!Tg+Z-4VGuW4GH*&3l1@a?RR7fh>1U#kzV(0pS1`ZJL_C<*Qe=T37ovq zvm8lxvuiz_?nd9XM9R(nk(SAW)`Q1lp9fkgc%oZBt)5Gwd8h|D*2VMS_XMGD`iU}` zG&ISNwA4D%1l-s&vBbaqLkyXS;8U8cL>1qLfa3sa23L@t@7_PDOV1dvDy9Z66i#Gq(e=@p1@dRf+325v-Vu4`Jv=#<({D`R z@(O0A43g5FO}8u z9&umI(E>T6OR=j-`s_~FYEIbW0OTrf5NwWz$2sk+O%dmN_jF>O(*i|pPJvISNit>) z=IwKGy@OhI2K!GEi&ZNxafW4sEVCIeKQ&!zl%~iw(L^Mgd#A*Q4?zkW*w9zbxODRQ z9pSF)KHQiybRvL>
ts&Z?-QHow0Pr2S&MGPzG*5~PrN&aBMJ%t?pTApS`S)P3+VgDzC(zSt=>M zu6ZpUv&90pNICx$gZfUOVFJd;ki+1=HD;S&`zlTjl z9`~CsyxDGzZ}(MBa=ETXAr&X@nurZKu{yAGC-0OUZAL3pcCOr(vkczDN3T3k-^`OG zT9YcEYgKd8cM=kJKB;g>FFc%~`m?Em1x#}^==cDbV|k>Rvr zPvPZ*=-^A92q4PVS~ewAyk6^a)o|=o4?j(s$m%z9WZveiSvUf#y7}_064e1Mez5r_ z{nuGN8rCB8RafC-jwD4@wen$&IAEj$c&y9Uz&A>Aw$)PK&wH3s`|)FN6>YICS>d$fwU%yZPt)g)a9%n84?>O8@s1mWMVg#613Sk7za||uei@Im5La!5L zDTR0-$qzQm)MIj#m8;qOpI?(t#-u(?B0xv;Tb!kiM7b>qh2=b?V8&ji3S2#4vLY{5uh0upyEaij#{?( zDvW;Ez~M*~)68H=N+!f)^6(Wm7GF3Sz9(|&$KsvHqxKvUq+YAKLf;k$GaxL$NhA)g z&lF55gjJIa#%Dd#{!GY{&sGJB&-bSB_9@Ey{ODgGpFLRm0(X?=NTQ_ubX<$$S(=)b zn<-~@q2p3s?GsYi(Z+7jnG;9oQ3`M&r^ku***Qu7@@0|}_m3=a{mFl6By8xP zkFne#Ya~{^1J98)5<5#LA47HCW$T0*wX!U#6*vz%+U=7E-WP*~W$wl#C40rGQ!$|7 zDLJ{Rd}t$ID-N2xd*$|5v945XEX2Bc1OB3rYBG(pL#e4b{y}e_9PodbxNmH3ZGYJL zxVyLi>EQF>(U-5^z90WM`FZ;5_aE}W8%E2e(?%SOp#{=M3Jl9N zL+Ejmo#+`SHhp&G-LLMg)H*SOf82PM@P)#}1$2$BQo!oIONM?VYziGNmrhLy(y2(pe9AQ1X4fcLN49{If< zAomIw7QXve{4mNO%6xMbMSxn%=p_|yeEAAdw_f1Ei%EAzQIyNHZVKiX z#Pl0b93^G4{;AhsCvguC-4oaW-zUD;wQ z{&XO~dKn_e_}GvqG~;wxTB5K5XG3VlHH<;)CtaaJf1#VC?eUk=f+xi5vtVRak%$ys zY~c1K+SrBdlJ4sZ`iW0gPbcqHZYA-y#t9wPL|hz?#gbDIuL9TC6~UgB)QOh9nd&Xa z9%q*v*nN^|-WZJiuUC1~JEp(k!ISa;2&KJqy>>_XW&n7h|NHl*WCH?pXFLT~0N9a8dx5GjdGC7#OM|G2gH3)ur zX!a$47_;?QSh~gK7*NlZ>ko}S>0GN7H5*3^HgvFUwqKHxigGkWE98_4R*5E0mM;Yh zUOqak052{Z-ty#^f@l&H@xQr3oC zZ*q<&Y<6){^Q2sqs5cC?_{K>^gH<=5qvc%GDLbh4P-PWe9QR}+&?v+^$9|=J7k#HP zR)h-cu`xfsB;4%Iib>vzUd6Q(R;;jo$rNdrK(&9%vY^ye%X4KlG8n@2)VU>8M7!X& zDOemHwX%fI(~7~hpZz0UtppFq5oU7{pq@E&w)>do%g3UBnP~+4>vW+Z-;dxCxp|G* zY)dvlRmb^Y)8@Vztw_!tqVHeKT{%9+YXMs+)L$Bk#J&vwBJmR*uXz;6tg~pK*~o=! z@4{VG_UvF?ESKs#a+*FXB0njNNFtqYfbRe#=yRtED<{N;}Wf$4yVGYv^OGePs? zx{+^JB+W4$dMdZrfY22gjKCjM$I5M>W+y>ChQc!|&`g{~^*M@9)3k;sBuB`)E^MFT zgH-oVN&H}YwuOM!Wf-R(&KIu7a?ap?u=bW=QU3qF?|t7B4BaqDI5b1(kP?bRw{(Ye zt8|GtL(Y&xgMiX0sf36+B2uEH3aCg5HX?&$YRD%*C_&`+2|K zF<=#c?j7G#k@tM?5pp}900w$ zepCyA{d~_wAybxW`~-oa(iKP9WMTBs>y5U37Wgo{vT^N8@1zruCT}`)&YWF%Om!4s z^1QXK$sd<@{>Z0fY4@kr^u5g1n@3_SnqIum?6|q|MJVoG+l@~JPa|HPIJY_1wnFXh zzr_`QG*Lk8<@e>-IGEK+QRvU?O&j+3?{rJ^!82xv4R(G;hML~B_VUjmeBu<$keiqf zd^%H<0JR~1Cn~O;wp*0EKZC)k{bE6=pbu5pkEUJJA;5f{PBM2GXOM~4`?mU|PO_#a zi8tR7*kDg;9tsDepDhapq)~gmOm!sI4hWrAaj$dkIts7WE333pcxd44lMF8(vXgh^ zE;k#7tBG)~1ZR|FMqFsEEMN0k^&b*VTG>~0i(0QM#nqi$ZsahuJw)SJbTAD*ZbYJAvJu;?52_L zLIRJsxxP%Le1JNK^E9Mx)8aR8y43tg+UO#SPBpgunC*+#S)&Od;~fh+{VMn)8R3V; z8@7+5)P)%4qe3k&p4WWfQP|)rhh9#)dSc;g)K7>%zqM(?^VNt7H zzmUGgO&3P1NL=t6!gbH)t9VN@NHa2QB++?oXyE5F@zul1kpi919e$FccfL-!u|7Iq z=Cgb!89n(*wGKRBdT{l_S$tE#TdC8973F);FG-JgbJUjG*k)ql)d=p(tDR>Y*`GaQ z5)e>uHKcThyNJBx7le#wpcVDLXVShmoKKCCFIXnBhTMaA2xOS-?%VZyb&yuNA+q3A z;zgOW)Ty%D$GM#^#9;`K0CgOaz!90t#sRuof>28(GNSc<_OB;>Tk`@x*;Y%Tn~mW| zLWz^Sus?eR{9;6H+75T(XL^$Qn@pcKC`F`)Gy&w-qy%~yU#;A^FCW+d4 zgChtQpqYQqQG&CKh>}SX4&>EbV8&yJ&oYufa)7HwAP+~p+`&H)!_~v@8B#t;r~Kjo zW{J(`?k!?C5)$acNFvX)Xh4Zi{Ii2Wg(@bZ>RmL92BC zKm;I$IIgZJO9cWc>1tg7uN4>&2b0N%brE2kGqToru)7E114R5ez_Tcr&j^GfprXei z-dz~~ZpKys75s;-Lck1hQ-xJ&yBQlx44IcoX250eVi@wOlU~w^!we~{8MvgLvHA~jXsm{ojk9E{ zvo0P8k*ZS_ceCWffahq?1I*3bfw-yJ0u=aMGsKS}T^Y}5;E?MYC!Jjc#>?m>WV!Rk z`EnTWqf^d9lF*Ot{C8!PAL<}I9}6w<(xF2o3U>6nP|l)ksuLMmT_E2@k@ZZu&YAPO z4B}iObK)}ccTo{IFmVTESw{;P@^@A4?K0hcL}DoMaTeDvVy1Eahy=ODWch zFWx~Hd|WI(R1SHPNyjxxo(9tGC0R}al#p`h)18&IATJmE%R@?zF> zIQjB-B)uzr2VI<505Q!JUx=?TZ7CLaE|Y2j3Q2jz&Kb#Q(0K_cR0nsO>6PtS`ebq! zy_T*Es3xQ8oG&5qr3)r`GA*z+=b|4(Q0t)7Js-SSMv62B$7f59IFq*2Gj?`>obRX{ z88Q=)_i6w-!kBy2snXw=5_f+f=`xl~lqnaWX0sDO0na?AYH}F?29WdG24Eor5bF(y zcbWd1nb}iQWSoJyL~lLM@WE!a#bwCu0zhV-`YKW(6V8B7c^QNpj<2=pDmJBD5pRWi z`!et(*G1vd^6Y7mG)te61n=jX&`cXf}3;omP^-uCGgMRE$|Nk6&1Onk-D59dG zf{r5E+S>j*6!CwvS3RhWHd%lF*Is38o+Df65&pNByv?Tv{LuGCS0|7A1qf7f31KaagN`p)3{y<2dw3Ho&PBMV{zf&3iBXzZDNmtf1lHe@ry zUVO`r-Qq+xicqU>$H1}AiyL|=4}5Bm+gaVW0KWY4`c$pZ?H#IL`w%N1HI?%@w(7?0rjICCt_c(Tw@xkDhI+Z zeCr1LPpYoIe>7pvI-F_WoE>YLKoL!|r@?NCK7H;okfUFca8=y_4Lo^qZxQ=E{;6=> z8H3U%fA1|Iu%#=2DHteocwpu6f`NLWS)u8)EaMw^H5Tg7UBx2xw`^rKmm=|YY?HmB za?A_7Ub0LJ(O&7~v5mHs+t3u)7ap4y@aym}pBbQRW)8d<^*v*-UGkH;pUN`hA{P?O zPf-VtzhMCt9=3f{uEBSGymNb>K4~$CGT*)1i_YF1?vk0>z1ODB@@b^e*j#ah@AOpI z=ppf`@G?HhR5^Sb%1_QH59h-@C4*8z7IsL|{gfTvUUMbzhIwHG}3J~8(IL6jOvYV$J4_xbI-9%kwphyC^@zn zi`Th!Sui{Y=0wCPnhfgba{PUjL0f~@sYZjPOPyG7F&kLf;`rm97hbPpU1Y8($$n^t zXD@#3>4>-lQbZytXK-@H^w_ZDxb#t`3D4lNVV%mQE`vjNt56Di;v2p>sdr6k9ykrC zZJBgy?&>@Q?Ysr)$;WM;`JdH>QtQG&HMJLWtVua>k@-KP0s=)@tPyp4{m1jI5_jHu zf;9tGJ)1tMp2Uf5!XAZN+ak@a(oN`4m#XRg*V5;fa;-0Ykx$wjQ-PxYz9)%ZNt$cM{KyzN>Xi@iPp$~}x z8td5U@R@6u*9N4u@6=3Rh^f2s=Q$D&yOcxZ+OOV1QtTv$J^$%eV>nN}en+tK&k?!Q@>uVA1ORZJNltewg)x}3nuE9*|?*;*Jlw!|7b zeBQ*jc0=k;HK(FxFq6}7hDFEY)rW~nGb|R;`CqoM;2{BOt*`ZMcE--beO~xaY+*wV zBgJ~BnL}mm^kkLVNpdUXcgFCh%W-A?;BQKPc1&>fS_eezLCA+Ui^<<%#O5F+o`skN zo5>&94x)X}l6XCr=H}xfX;q_ZaaLz=c16g*T(M_5y4mjegql=eiThcfuY>a*YFkH> zibJBqBi$7`W_af>oMY_g6;WS&aw7M{J6S@O@Edu+=}b_Lk46PmyAL9=?PG%-KX;Ju zr4$>x1?A#6mro;G`L6J;-q9UGm6de9g}W)V&gIczUOc2?;^xHyfGa=E~Z&^PiPKVBUZuMuUd229`nVr7wkn~F3Xvz`0{s z)_D>A|$Zt4z8PzNEa`?>+VTh9- z?qrGqv$Q-Ro-XPJy>8?Fv#M9_j>NYwboZ&7$M=plC2r;UMsmCTfin?+^@~=q+|R3a z#iaYl^pyytxu-H`+z=U!C!)}YzXoA`t%n?q8#h~dUwl#rhQsV}{}Ms)?F_MJo+E4s zdO|Fg0228rNx5tlw6nTJ9{2b;TtV1iqg>GGj~mY6zu+q!uF0PygG<`lK7TkC*l_?0 zVqx#LlbFN6=Z%R(A}C-K!Pyi~B*OW22`*#NL6iV~D=@(!#w7#dCY(Lfbe^dUdaD+3 z>l=(Q1B&F2#D%4JHbF|#FeXg6HVInDASgFOewY+<`j9*IOd>AT1O;ab6L8w~yZ{K> zqG90EG}^Gg2U>-XBYlzs@CiKYJI?HX030Qy2ceIk39jeArU%D?as@$A&FMZncJbqW z=SjR5NM|mN1OLWI*yz3*`TygLWN>is|ACRvpUu`mhX0w77#s3W)sM*i!$>Cf$>w}a z`6hp#%~!dh;@Y0ouDIhXF-@D-6CO5}n_2I_5p6NM{eCFvVxrM{9KDVo1SsE>VaEa@^#yjG? zk7brXU{^J9_R>9+y3B(JJPa9@cES_?gm@qF73`9yR$sLPqJ(kA@pE@^H|hF=+ z>fSiZRaIt;&gomg^O7^3^qEL6BoEacz~fg6fR*7Ff$<+sKV%g;Ea=MDYdKv8YQ#zh{o%M+}BM;QuyCp+GZH}?Ks4=NJHTqtLF0(2V0?+w$A z3;m2l?zx`@Qpc^c2`znso`@LLwTv6R>e3VR3QfNwb=ig)hg7ri%T!f)kSAE%M<;iRv2y*JlysESWU*gcP=iSm^s(&%#5lp1y{!!w-29T zC86;!)}neo*YcLHj=lLErH-b>4)Hwh&T|I#@WWDlXuC*BLX%UWv+r}y%Hm)_+smAd zvPK#nETs^AZw_te`-OMOg>jKd-mUD@7Qs`@%V^$DM8L?nHCfS-KMJ|>?TU?yDKE}; zZfaoa(yv;JuZ#1k2nXAT;|~{>G%Zw$?Wg2TSfA084{AzlUxRFPUH{ly019n-c>4_L zkplziGLG+CbUz04s&c+A9$uBfHci{EEq%oHy0IyV?M-X{5w^D-V=JuhdYu0SZi$Glil@}D=%ceZL&BzffV362 zbyVYg=>+McqSOdutc_3pp|w|fEQ|9#`Wshf%kqGfx1N!gBb5f~>owLjS*%$ai|SuU zgSF&b9NTUQVw3%}t~om=Xs1j&sk3D!Ihzf+r1Ix}PxXs7C6jk01sPOKj;O4$CN88O z1ycjfJc%1Z{d(Gy#({cogO@rW4ls)lWHY)e*yFa38y9LmlM=l2t4oy?=@stIPmgr# zj0hTP_DDQXO0SM8DU0+Y6;ganv!o382T+{$amTYShbqbc%-0R`EN@tk2{djAV@Qsc zmGs4J5rkvRsQKkH>VK5$aULrKCXJ9wE!KvTO_$}`}V;8#B^Qrbx(`h zX|SHFniD%$x98=Mb=5H2={Cx)^c`cdrv7bDVpK(H3)r!1Sg<%5KyzLQP~sB2crj%Yw?;?9l5aj7aTvMzpLJ=@}!5!v|U>9Vd5D0paVZ>r`*tV*c> zOa}k0#O#F^rgM;XgU(1o=!|5P&PdJ($K9(K{8Z2%MQ0>Cb8Q}v=!~TF{Lw^q>6hQV z>u-N8MkRfIaC(asli;#`M)mT|Tid@K1z;SzIKHy%kIr>~*dCI|5K7p$m`2;F7(#RW zbMHk%1%HYgre}3~U6L119Yuw!^5DEeQuz)EA3=fx>QbApd`Bk3mY*lxT$;rq1WoQUhYvG0}eLXmJ&3JI?wA$D9?9DAN zl&vMx1<8>~r}C37$ef75>}&>>b@Q_hhtS0uqg7GXePh(x2oB!>+|w?#@ztz~0RjE@ zp;z79MrlmM4WY za!-+u%XOJ6#zq=^`O}d8a7&PptJZwUe52(%%sn(~@W|aaMxv-dR!6l)-n|Bp5cICx zGgIk<4t~QBC9PwB>Db)aFDDIt_>AoI`R=cMZGN4Bneq&=wdI<<@vQT~Noi`2dHuM0Mv$ow;f#aW|c z=zdF@g2DB0&g=S|Z{o+Y3U61(A{M`b9Yb5nV;8YbTkKR#Pq!nESbyGyKMpn4zk1(R zHp!YX#(h?dc|+(=G;SZ?HG_;{;bWBe^-pf0XIVIiP`k#|1hP^{c@iFlG68Vx!!I0;)~DTUCk?1nGcO73~pQl_n-_yyxI9@U%!q& zDsxuJewXtEdE?Fs2aw7aHg+APiOzo6Q+7%G^(qA|WZgx_B^*B6FY6$DpCR(H|Al1y zk-Kw?+S=C37ta61CAX@tTM@A$VEHQLO+yl#T@-FWP-`G@%}4` zUIfzks96eK8R*r&$i&(cG+NCpwE_jYNX(QR<@LYF9H4JaZXunQc;*OH!=KZ6 zNf)U#Fc-;@eUpxW!ZKJfIamz%A&yb#2E;|kdl{EA&54ni$mYaS=v8=hWWub$M@J@2 zD40eI#5$9ab3jJo3gvP6va2aKyK|7`kN`Q8lbTVE5s<-wX>>;NmznJTWhQdu`~mem zh27$snjD|ISHru!y|av4ASMnFI|1W=U6d7A zfDKE|FUY6R0~=u?T)PEY_8`}4k(U5UlAPzSQGlhCT zyyQeVbm0b69tclyF3O6_e!`iF#e>llhC!i2=w_Y=K?-UIZqC`lK?Se2^qVPBaFm zX94RlaGf!44~?2P%3LVT+Z}+^TXKp0JLO4n^c|wS-U)K%K)HZt&R9@h7=u^P%|F2)W`!QIxK;^z@u<=reVNwr^_K- zl?tW^-y3iyK-8-XuqbB`oU2QqrvE!5u{zXXquF5R(y;g+VTn2&mRJHgKq~zNWM*dO z=H@ zp_3|Rp-M4-JRFK%QYOy%3iQNuysW9`=qQojL4DHG4K2KikPglja@0$k?DDN*W%7sT zTODDyj<+!(v7rx7X5JDzBJLsPDdvOZx6_db5j%stD8{2o?*a5uI8st7$6d&0hfGGM zdZQQ(kj$sVvgrkYS5tV|W7HBAtHiFjx7A-kHM6uK+c{Xf|7rc}D>oTPB8XANS-A4h zc6>3M_wJ94#ENltA&V;{`{kW^TqQXDxA}OvZZh-ntmFst=#Gxdpj4ucSY}37@)(&_OwL0Pp#oWDb8oI(&Sp>!wU7t zH_s=oHBDc^r!WbdUT?O(4Cj)uKeXCxTLqzvCF#Q=^KDxEPWLB!+n#oM-pdp=>$|#i zE${(b;Ib_h=z^iC*KL(`z$-{Df_vCgKY-!H(p>1JZw;$=&j?cW!w8K4lI;gu^(_9= z6pR%uKSMwNULk-#gQ1>}fvt9p*FU1eoEo7C_De@F7+V#>LqNAT6uGKO7y#f-Ppano z9>6L?e*97BzXq1uxr%*!Pq@o+3xUs?a(^-CSDEeAbNhzSK;+KDrq6t|(ynAG;WSsj z^X(hKW$(|uwb<(SgAmn-V;+GTCUEW`HDSP+<_{~2J#1bUG+G|Otb!K=;BIRLLA+|| z^8^JyBZrXQ2ETQ(Ok?wUru-oX?<{p*{F3VptfxBx$EM~H^}Jh>YGXQECZ5jjG)9Ff zJmja^nS4=|$lH@-s43KVW#oC*hRuWHn5lmQlH0M(sMi20p z=S1i$_Z0bmV5kVt<>EZwOqx!p{FiFCXv z0GektUCr`yn?lU2o-73vRQ^d_rJ1q4Vew7M}*J$~!;>HCTTVKt}Vo?mU_oUL!{xLIZJeXL3EHN+8}w&8tde)smv zVCC`4O984?7oJ7WS;y1_Jo%l#-Pki4b+}aF@#q;sV`mTYu^T)vQ zOHi{lhw^ym@PGuAAbM)o0DWQ;cMx# zy{$*jN4pbIO&rs<`^!gciHLg&Rzyplfz!4KIzdjX_)}r_Yg37!c)gx*Z1%9_!8X@V z6Hh4A1W(r(i2dqx1u@EI-_53~1dqX^LKz{<4AXU{1AV+1+6F^Cl$Dj3zmgJWt35_9Uo#=89C_ z-xd)VNW7lP_LE9EdFu6DK7SqS5%EQ-n&Al<5mvBJcl{d_mV2IfPKv#n`hzV7IGr>N zV;#k#M59KoU5RtmLlpNVGf*5(V7E?6} zYYrwBs1pUdS+%8%SSqAzEFJ5wd?MtFgOGu*a`e zUlxAH*s8cZr&Q94tforZ4BBvx+c&IHL-}{S*z#MWxCYYjp3x!6j`jLIv?||hMyWm6 z2Q@oH>te9&9kUf)%xb5*%sG|=ffDz|K!Azfz#YKT`ZtO8|LRHL5l7Ak!}2A@t%!gq7jkBxGKSo(My75McH2RyEbt6Lr;` zgo%J6Hf3h8zWZZW62DlVeY)D2y1VopQEmbIMkSaPH7}awrndFbn6LL|Afa6mEAl4b z@cP_E>uc-f=#OLD=$>2NV}9NdOOZ#zKdomosQQII$k?*M1E+>IbP=l$P!y)hi#Ds0 zwsGP8q9p(io-iPTv_qAJrCDeD19tK9yTwPP1eG&ka6lubD!h3CJ1jU9mSAD$qBf`b2Lbo4)(^XX5Jf0^_Dzgsr`t2&$m^M9+uF@FB9I-Jl$ z*^*6kbG}l|ldCZgqP^_d$xd9aFHP^P9BXhI;4i(Nc*?Qe_0wR|%io$f#>C{53x-m3 zc{w#J+lHmt*Z4^=(< znl388lmi*l718)NRH7SG43@(w_zE_wPTm{drRdWFLq#EW;=0643YrY*Tr4hp13=0- ze|POYC)$=Hd$c5BhSTqn9k^cf4`IJoF5zffp3^hM=SC2nkU# znLLT}oy@2(o{C9e7WtLSvpw^AU`o8{tz4yQ{A+pywV4l2v3sq3!=m@enQFdb@NNsV z**^IA?mcVbmgZtW-(5$5>GB^{Dn{`h)rtWYN1$Sd?;^DsgtrK5_5ds{IY}mFjjkoD z!7#uzz;&PwKWVC!xPN*$xSYX~mv4LJ&JB%Y+6@?qv0KAN2)CQlwaE{Tn%T1o3Vcqn zV-Q2eQNwtW9}o_Q8toPnUErJ-#_X`$;OLX!)`ot2+J$OsmD7eFMSC6fV-+w2J-CF! zC3{ebfe_Knv+HQZ=tgg{3AWgFBGj|YINA&Z@fyqe77sr?75~`ZK41k~cG_dGLE>q8 z^OT_g@aTNnLMfBNVyF@BZr7KvkR?4 zQOQ%?{k2$4)8^Ie<^^NZP_6Rh1#O1Jt-8uKd7KlaQ3kh|Z{l6j5ND+wpIMyx*s%fI ztr~oV&XnR@V{URfl$0^Rn>aJ-;^KU;2HnYofTuabixmg~BlkG><=CfHt&(r53=#{J zR$|36zwy=-C#0I%!}SR^iSA0xL7ok}0ZcT)WQ?XQG1X>}uR}<62Ct*X8*S(1lBV%0 z%uX`Ozct6?36OPaf(J~gVqCU^%)Eb;oT!QKZOgvpQ1sOCuD6==fGHN^>R7jsX78#m zNod9vE{zgk?u_~h#K`a5mjutpL@(R2HNR2_oSt0}GnaWS@c@RnvhLGYKO(REsQVXB zd35_hWx*qjrx9}&?QsW_4{x!|M96j;22(VT1S8AO0wl~Gh_3f@l=+ZXy!xIygi5qfz}r_};;);&N%OP+0Z zufv`((IKmBH8*+NL4T|OCwt@G-jB%^oMoY<_1Dx%%Pmoh)%Wu^=eSMO-f!I`NEJf~ zyR!avLo=%vV~4&r#eFz#R>XJZqZ0$k3}a8A)Z?D-6kJ(Z68YGpM# zvQgi=FL^wvMi{(Yf?KGU7iWN(-!$bsZh?4@IN})*LLn9ZtY`ojJpQ?in z*6X>qS!`U4L|Azy--Zbxaiy-7#@$hC4N}C~S@gN&KDEmCiq(ZprZP3jG!PT^M9*B( z=QLHs0GVOS`}O)`NO!DZx*G>}W}J^hW0f!vU-Yff7n{DxY2qJFjiK_&I16D45qIa$ z?<|_w&+GeKJ#Hx7WQ|9meCh6a*%`5$@;l zlN!Z(Iv2T6y5y_V>kfjfJ0`iDt2+a{H4f)wjty3R2@%l?36ae-U>^Lc+d;3(QK=s8 zt|~do$4p{(RdrNb==BB=PQpF{=Wk4Kb@Y@Vg#48s^wV2S&Rza3|3X)8xj(<}da#y4 z@Po$X$EVtRJMJ@t`pD%i&GCu!-D*Fpp#|J|GThxCSak*On7NX^6FDFQBqf1vuFpTl z)P@*9XN|PnIEwgb6Kzi-EEV0M?)3|e;~fe-GtXT~s(g=6Aiy^Pbt8|~z2~)D3_70O zuAX?D(oXm&J3n^q-Ro%H>Ov8-#Gj|BS9`=S*BwoA?pMrQwZs-En3;4I6knIMFF-U* z>Y-#SzbkT_WR#hT`98aPs|Y##FeD{+#aGu$m69eXm&e#v&ZJl}s>L1%ivXN>=A9c< z_`cKM+IAhzCl;mhUMrr&4S9Ze&Nc+~l(ci8s@T1py4qUEXT*9eo!>K@aQ3E>I**;Q zr?;oyci~lh&wU?z8!G_|dm=Yd*7g`x|9}Ov4rVuJ?rs)he>z2$BNnD5PlrsA6O`nn zc8W;vay4uUXfyjRwujEk1b|R@VFe|s-2TjZIPcYZ(Z@9KI}fobn@BqVg3lhI~hM2yw;nUcEYBDYf*z*HIsq8|4~_7 z)s-KWyk67gycOallH^w1m64pes;ZPN+lXf_5BJ*JriC8e$=15O)zN$P9p~os4%s;( z=G*1DpZPhG4cam}VGdkYp(?D~!!0uWZ1)6+@8i_lgnhbgII1ieDus@}s3^+)&ADFN zjMzSo2mokLCWAjDYmJ?j6uFTV#f$C!dY3si6DyV!o#|@nU>EP$blHb9^=f57kYKy?&Ot0@?DE|=!@7Ub>LG~C(Dj< z1+jjB05_hF`*7OlwR7el7+qUr4mH}}Y#RE0hm(+cZ5>K&vOxHsp#AwtUtvWPAaw!_ z?nFSw5m03WrU3%WB7yCIz=0-mp$RosM7|x^i+uR|V@IT^fE$IV{EtbV-x$W`1uNf$ zI6Y;I@nB{$#J4Nx!U2jbLaId&iozgS2JsR={xI-pb37kDS-u+Jrhr8JA^w>Z6`y46 zBJ9WkWH}CfBc>?DLDHm@qhV?FoQyJ*6s=|`BLfPfH}O!3|7zkfA*GS2kQfQ1H|ucW z;`nx9)`3uZDX266#271k214jnjsr(}e<5`DSh7VNAnpYEt@2$7AR!6B38xgMu2k^@ zK^{*K4KPY`ki6ocfP>`je1@OfP-q#%fFm8jfwagnP?wTH->p%KOS`I`&a#?TyF+BH z&XS_rX__;x(o1+e>B40O_L}8wb+RTp^I!UI%K@6M?^=);&XfTs#*-CRGynGRcnZWB zXG-C-r06|7xMadApC1mC|Cb-0qD0qr@2h9o?))v``8LiUdw}*B03M(+AH_j$kCFKZ zygsBH84hp7xLnBsXeI8iuzRlz*5j0`gvyq}U+~e*il+;^yMkPl?C*BqPkIv%B`?o7 zyW}A6Rv-kCQyw}|enw@mucrMVWu7_6QC$QC!g8c=`7%JNHYHycn-Yu`G!BG#Fi5Fg zAWuEd#~YgemeqQ9Joi^%wnTY06F&8dQ=ykk3TIayD?XKbmqhR333SReDPv>^1LaXg zy5F-^(WMmw*~bV)uLdm9)FhGbXo1~i4fW(T&>d9(kQdfDJb$PiQ}~cqn5q?`g>yN zgD`hi!}4dH!UVk6uj&6_;b#<$zSQyTRLG%$!2(5-M^tc|GWX4Jo*NppF)taZB@Zp z8Q*o}Q$W=r(~^X@d4DtqPQa?<3T013D^#h8s{AAvHzjkE)eoON zwO>6i)X2{F^0C}{H)@>gK}oCo1C>;ggTD5vuAw)aRLX2j8XwFpMd95fzw&}?_+l)N5vxl-(EpC1- zhL^OH+$iTMZkOdXCn!;h|vz6e${3p7p%&j7G6bSbrk z8L)a4&Z-_rXx18z7XsPjXQ(+fN~>+*?38W-jExWTCI?ZS&>HTmP6bM47(E-qN1!f1 z!08B{&^CXhl+wW_RW09HTQKMb+|~}EJ=eM2m(bE-2ZgnELYac0`9Nyx+rE{|Lmw+& zf0(=qtALgW18k_c_jkvzR)%esE9W4 z>$^K7Xr?*Jif(Yc{*WvbH#UJ_rLHMxWwp<=uN(Gm`l<-|J@ai94xZX`k;9k5pFbch zBgQNDH;gPD@ojxBY=kY#*a}+ZWQHt$^x=WhWw+k(HMY<}Rohdev&5#VBNLIC=QSh6 zm_yy3kA8pnZV1kttJ*bga`g8~7c%H<)WYFXTvX<_KSv{S^&ahgJjr}`@74LpKN^oc zy-h`xau1gdhPOQ^j3%inEX|&EeR8vEYRagiyCwL-IJgq7HhN1>6_2MxdVUEV6H*4` ztUeZsJZC~)+rW9Am$qX&*z9fi_~Hn-m2zqgpP_Bl^3iSEOkm!vK^B3t2#&bq@iwzm zzO8r4><2fXlr(yeR-BzaHv2e|gNkcaYzLod&dsPt-+pAlZkv_jdGC7Pk&*azvbilk zB~}$$5*z8ss7x+CppfkTd#^C8Rsp+*zGGUsZ|&>_ca~oQ9XKsiTM7 zcprLALmRBq#Yg0=IgG)`$3r}T0z&+$lJxhE3CAqS|s6GQR-MRwoR8!Z~|VX z+O1@FHCgnTR}|9Z##chNRjwvm?W5Oseno1D!(VpJ!x+iZM-X)b>~ z!$!)$(!^Htuurs-KkdDDP`rce{I_3I;cjgrgg@M~m%K9?wf!t#moVH1GwcgNpas-rO90 z&3om#N-poa(VZPh5=!wJ zGGQ}9i;a`@T3>5TJK-GC2rOUcuhzHj_Vo@G-aE}oGLbQZ8%Ik;mV_)77D3jPOA4{@ z+lFtyg$_3KyN|F-G1z~!Xj*KSz?KzY}Ly9IZsa9=i7?mDM8z@5XNfpeqhJtXd&a& zwK^`2!ufT<1dg%Ou;sGpk-IFW+sTc7K#on8knP#Gk>MMa)rgE+7A95`Y*ddThvvXj zLi=v#-<~GYuDMC%vvv$c`V03mRd#+V7jRG*nr&E%QD7*`u1qhVq??dUIi1)cL%AzMS|T}CcPT(Ngm z@MAxuwXL8QlgX#EtC8UDH}E;oc;-%HO-S-2pTM4s)&n3s!&gZq6)F2+zC}@?;99Ol7%ZqTTXq5+q zXC#;kTS~w0X$FQ%;xa9bT;3l_Kv<;7K9w@NWYzO?Yq(>{TyE-Z!Xw^nX{^IL%ID}8 z<)7AWevvh{-X3f^X6vH!>fEV#^Zq5t`GqoA!ug(nFWq@(GyK1Fe(nfxnoAw}Sa(m* zd*yK*%&EwG<62@IUv<}5-k%FQvcKP4$@uYP`gUAb=kLIP*f(dllD=J(i~V(<=N{=+ z+rbzu0bGlsc>F{c#gAyM^YsW>6YxMbOZX>kCF&2+b6a6goutdnQS(ttmaepH!d=|1$*JjU88{wC}_tcdmHR0w~@bBv~5R~?4 z%{<6E!Ph3up~v#IZ$|I^QwF8yyQMucRIv9A(gztN5}!zA>3R^xO*@dJs)8VvFqO7F zuSzBDE*0+r6|K*;>C}Df+X&5Xk9D4^#J*8A@n|B(N=G3#!k>tpPF6lsy(3raM7H)m z-833N)3!U_KcFY|Bnm5KPE(BzkI^(L^zr(3dRO;+lb-m^bnmM&CPQ)JB~e@sO5|FS z#M=%3$-C-a2)qf&$bMeshf40Zd%%l0zwz0$A9lx1IH)-7t9LXXgXUytk-1+21KLOB z-;W3H9ss6L!oX+k;q(9_NbftB(Hv)h8&clXMwOMz&sHWTFXgC)xZ#@piB%Z+JxR|4 z9UAYi?qm}dzUUhN^w{7A_T)F8N1_z}0i0(<`1#0_kr9eb8yG0n6={cCNYT38E2I>k z;prnaT13S1N4Bb|w+Be*JL&|?2O)QZ9?lx1*{SHI0GzxYk3Q!=cM_g1amX&zk-3pW zlWmbTzOGOyUIYqAyUQrtpOaN1n|IK6G51vw*9&5MPlroW1B5(bF94a7?ql*;fP(Ou-6Tn(#9<5&gQdr4vF^_wt_UDqZ`Mx3^bfJ|^^S zLr?cw^p~B~2SitTO+2$_;*pHpKXE6!%GAS^LK4;T&1@}))58*Mj)kRWTa(L&vFf=& zXCD!ZjcirsPzqf8hHNHo+)?=tx_!*~6zY=6SNDV%C_$g>>D$qA59?)XoMbaq)EQ^9 zd}Cx8@ujX~CN|fF4zMS9yp*ccV<}A%<>R>@g2=91S7yetdH7Af9K=NjRCd@9X_jOm zSVpbT z*6V;6waUWu@E;xM#DUO5xVE+;B!QP@SA?F5LO#L5vJ{~^dkt_UNS6yZHZGObb9o^` zxtCxb+A6bAETm~H9IhF`Zq#(()nx6E#h+f4he3qcX)Fic|v)N**n z)!#*#(F&^GYe8|e*3nm>YJn?Ezz`E>hYbX+gH@_f%^RWqN%?~aNiD>M!9kIsOyEA# zvHO>R7p=}0clk&EFV^1ktEs+S*Pe5xkOqVv5H$1-p`)V4n_g6q-a`jP3`lP#^s00a z1Vir{P&#T5q)1ml>_Kc`!-l9RJNNUfca3MPwb#4X-edg%4EVs9<2rxWaUJK0gS{JI z`)YIKi#8-4NVfp)xwO}5Lc8=JZXo%oQsb7l9agjcrP!X=<(J>=+y5Q|$XMq!wJ7=j zq;BpzP`ytG;C$llwCwcD9{0yBeriuDY~ms_vDv#NnTkV7#G$*bLP?FX*1AHLI+B!w zyduDIzuMkiKoVzn$&klwbO3^#KVKA#&Lg`|FqJFzAQ>V@3+vCfC`BG_E(;QI%M#zs z;49x(5$h#>n{Ry^2mR2X8k*Ak5n<|B)UCqGHGuZ@S?w03<3-G_u+v)ITT2sfPAFBlKn||Dx}JUE zhxs)SBHJgl0g02r(MRHnt%KLFpcuPdVghvVsRAve|s@{lQ0RCR^tdWUEsV_1Js)SNlAM!F?&5wRx+Zt`vf3KlJwVwIBN zm=13Fi-PVJ@R$xBGaI-h6jfa2S0HujMD)T(MX{cU2q^tsOT@fw=pw?*#GJ-0U$>4cs~wjMx+3BCx^=i|5z7$dfdO z_fdw&*x=q1+i$Zm(FWrg%&|j~aAQk?-?ngUzA&moP%6*Da1Q@=j%UY=D)fk>OeG0% zOSTqm+zK=prhJm|+vbg;}4}x8%Tgktg$`rKHh>Tt$e)T8nVK+R&l~2=`dQ7RS7x0D z1<92>(ln)j!O1b=5wwO7avqSSpz~eeI1RYaMf^^+HJ`FX*I3?s{`P#o3Y@44-?MT1 z8H-OY_byMUeo5%k6*eeK9yvd_WV3(5ih3_?PNKYavlab&D| zV}|R~f<*_Q{TuLm2VAh386%CK26@eB3!7~aS!0O@kKyLKH5rfBelqnJb?nsp9~60@q_X3v+grV*WoGLv%DSm9*AScwt4(%XkI4ntJR||oM2Dh zN_X@y2EE>2PSb|(1{`MdZo z!wt_Nwg=Hh@A&Pxm*9g4uBn^r#3gf&S?>cAwnyPOl916m7VfgJEpEh!G2aOAxrfZ$ zvwrgNH}A9(#PY&8U%u(M0S^C0MH`|y|9iNL{8BcL?^5-tRa}Sv31}cWFMKNh>?`_j z0viAR0{QQN#y_7HD=RDi)u}NwH1wYz5C6f4B7LiT|J9y2ApRor)!#x56|tZaqgk%K z`!3Bj*_9b=SWGo@UJk`n3oQKU-(qIpT#NM$A`l8ct1sp)zkfTJsBS4HC=@2AjK-#6 z3GrFkS&6iyBkCeKMa2Q<=vMhSf^W$shI?6_6t^g*y1B)*T*|AJ*_re;^ww!doXe z5IE949okr@(M|n1+HfqELciaGMO`b3n*tV*!U7D{?5-0qU+`K#_onGv4ze+R0-k68 z)@aCmQ88fvi5m|?JHhije^nt! zEJXm(_%i7QA4La%46z#saTU31gR_2z8rnqSzW9VDXePQ{jCk#h@$L3~XFy1X;^eE0 zc3Zt+c7_^q32d;J=>?zx{x}JBvHKb9wd98I4lGvE`fjWnx1ndE+lv1)7Z|+h_*o|n zhr3=_6a@iZ(3tZCdA+%45wn6DWgI;Qg^?4n_N_927gY!=^~3*+@`YmW02;=&SQFLT{VMX}`{w*`c2~L_J)KXi zK2}~=@6A)!{DSVnrdea=y`8gx-m&Wq!wP0O$?AwRZ&IAn`W@qJ?IY~{PV~i! zfxa=?0l7*s#kG!iIF}6#?FSy(Lr#Bwlo~Vp?Au%p{Z+s0dgnu9*@a@ojiu02i{FJ@ z5^Rdeg|`h<#9=(w5T3px@0=EoFh!FBUAq!q0wJ$<_edN)%&qgDq$mA_Ts^8Fsx~u~ zA%DcK8r^O;WAs)}+s0J2)_e9ugcfUR?8W+;37VU^YE#x=NV9QL7bM>YjVYTC_)^-t z_Xl3$02=GpPH_N@3hAha5w9g?p2U8C&;2ZstBRYQByyB{B~AVh?s=BpW!&mHQxDvW z0!JR;Wr^vzm{%90c%lF)+Nr{wH}e_fNbQi%ZaB!%R+_aoZ1;5vkkW>E>g-K}?Ylac zBRD;XkRg524#6l}-8%Vl+iG}p>nZNN#vXy+nu?*@S~H3hjdl|~(!$ynI~hV8XZP+$l&2gPrDuwLv5n$@$v#=wHF%S zgM-xfpE&OmW(u_EOzEn(mO2=C?{d$alzmk5^mcb4O=7KKpR+UYBMsDq>BuKdh?SL| z5YE{nWCD7MW%uW;0N| zQAy$#4Nj@EI#J*BlV~M9Gmp;{)VldK)uNEk#Q}&W0xc^ec{V4dBA)v;llC1?Q2tz< zo%G;4;-g1-JJp*IhI3l3i`p(w?A_v z%%;wSpM0W;v<8+Xbn zkGDQdV|I68V^o6$q#iwZsCz~fO80J+95BugA@oI*%Syq90L2AEsA__(-xHFafQ3_E(W zZm9jT~zjDjQY))a(-uGuL(3;liOOQ8O=gb5z?fg~1e#)nN zJ}a(Z0%%*z(W+9M8gR+xD3(Y`%qe4R8^>tga-GQcgUvIOVsbzoTl`@0F{C8)n5u zzB;LPz_DNdq{s5%Yeo0At(;ye-d+A?%{^f7mTYgal0h<11&4SD60qtKt@ zK4nzp2Xf1logB?GS3*=|xdN52yV%3mKlB7Set)X>6q`#k9zORpPEh?S>;DqJ`k#bDjkb3q; zYL6+Lcmf=h9scye#?mxJez4p0pad##n0kT!qpL}lV`V=8cK`Yj9jJ<)Q%HDrbN|n! z)>Rpzz$ijyF8YSy)6Gx+s5zp4QMvIwnd{&|XycKe8|}mM7GSve*za}MouA9IH#U1_ ze}9PE`NihFxixm|&*zGr?Kj5`Jx(0@vpGvVpxeuO;!LAq+}IdxPR$X44E<>Z_iE1p z!g#Kon-qj09;_n6L;;ux(M*Q|^5{c_45T0fuF4kT+-3>lvHt`vdPtxM1*Eh7Att2I zF?rygUb-q?fW)N9Fo=qCG+ltMj;E_KlBKMPitOY=ThP{P5xzXSS}*2{9)u;)h1f`C z^4}duO3^7&OhDqzS^FpTw`hC>(0e2GOcZDO2h=iv!aQJ>3u#YC zuVMhMZ_WyA030x4KMX~nVsYdom;$sZf0myFiH*~_so0xCDd=A4xB^6@MkYo$0e!j*BTFeSg-V2Y@oC+GDSgCvBtAAUKV>M8E=}ctG3UoJGWckqVG~rgCCYNj zszkvq=|di7;8D&x5I~`cxxCgnf^0O34T!MLhBQGOTB1V%db^eTAv!w)mEFn&+_nJt z8{l^I`L&GH-wJ6ty$}qYrW2i~o|h-ZPR;KHcoZQDK8=4v^QRfok(7ULIZJ9Te+`v! z&Ito|D(Ijh_^27&)=8HHsM#D4qg6jwSRspmr~i%yLJ7qxq&#hfH2pPbUl8E249v=d zz{ELGHVv~8FG$YzB7?W0(=C5w_!Dx4n7e-JWk^v0A!2$#V8JEEd12yNM>3ccjX0Q@ z`p+XfIv)HyRxCr#mIhKdU0YgvlQ%{3G#F={^s{6rw7<$A5~@O*d9KMEf&xogh~?>f zQ+O%oRPYr@{68gw*uOJTF^9@{_}_xoIeka}ITQW!bnc&(NB`~_{I4?+$0+afubHT- zs^P;wB!hLIEN*i;T!Vj}Q}`QNf4-Y3uO)VVPG3wm$dl>Q&LrF{Qel0pWCAtcd6Adf7b3=Z>%vl_^cM!e*Y?O<#( z3zk9n1Be;#&-c;_(94}zFb{q;!*Qc*xH;H97&$-b^yi)VJNm4TWhQqZi_ya5!ijBk zIFV1n@(=_ShLTDv3@K58rjn-Uw-L_w)QGe~RZSSrsEZYGQ<>K6vr7hRE!0keVOrDx zBI~3HVAp!|MYjDL&nw~QMX5PCRQsC%L7$-5rs2sYu%c^*CDWH~BMElM2W7K993!Xi z%dKT{5_r`0yzj41G&;}(;_)u5kmPdp+G%^9I1S(ad->9?tzS31+09zJYypASD=+-8 z3zgBw!8OLn_T~3(KS51*{XI0nG@AA**K^4{VOY4NbwP|H-|FripU9QSUGdf2q(v`T zG{;LK#b5;GJ^n zZu_DiBs%q%0flTd*Mlst-844~iNvx8*&{h!IH)zIRK{ILw?`uO$EPvbsvbp`r{)Pf z!?f5}`A!ZlsUH3Onu&b)!$-FejAtaP5;?-Pwog%v9gDbFm!|p%Sv`9%^CYE)Fpmh| zS6LVMmdNLv`GgMFws2?JL#q8{_s_K36tmiIy=b=e3i{^a;+2HJUx3;asU@8Dy9h@Q zw9LM>07_4eRP&+4W(A3g5n{{Hy>_>u2V?k?wke>(kU`unr-E$%J$FzVATvmIV$3= z3#$=@H*xUyIjph4qy3<)v_QNjzjRZl#XH%0h4rr*tM`tWNtpbaRXM@~v@3T7UOjq9 z>-MjyQLBRnwk4Ov9|h|tyz&eg$c*^-Dq;7w0#@0JbItOO$2VTpzD_Vbk$m24*vNGV^Kv~f=RvjPEABUfhQveM)PZaEXe{)k}ZmpmdkfN zJ*Mz2yQ;R+apo}j5JBlzP(%+Ni57a zj0ntmqw&m{oW%OEB6qw&8&Ik)DD5EbTmer-E5P`rbI$#cRpIGf{;SpyXb+zAYz`xv z;(GaMzw2w;1(4ufRDtl_7b@Ohpth<)iC>LfeVGcc$5+jqS5xPCW0$=>ESm0x9rlTH z^ux{t*X_?@)OjSY?6xhCY%8z!Y1OnmslSzXx9Am5+cX1qYqyB*td0+WFq3rW9qYY* zqy0*v`z{LXWcLuiZgAQGmHYgy%k>)F9rzd(UkRxP6Pk6MCH5$Pt?az%uq9&E@3uhG z0o;IxPx$eUD!YEA95*>w*Mb7=?4Xy+NjwXf8n~F$ov#tHHIsFfQ*KwrHGM>PwP(?q zeCmqVe1KpnC-D$3y_pkaL|l>Ixqcw+#Q8=8F5TMbiowe^3oW>}2T~Q=PN6kM^a>~Z zqAFjvW_hgKT43hf*4$sbN7H4Wurx+<@2Ag;$R~mq*vE~uSy@+hE7t=D-*HS}xM}1s zd9h75YS}ogCiu=58gg|q!H4dd?t7-dH0u@l$0@*F5LYmrQYQ7uEkJwNWteC0n3NKa zP0nI=MJ=sf=5@S~7R*@~rkoM8I*=8clB(o%Ss?pRxPTRssS-f$aOkx;mM01f!^ZIy zvfWnHi*0{>YY-T{y%AE-Tv%Li@#H@H^@5|}(z~*a0zi3-{IfNwExMAhJP|+9xaAt= zEb~>Cc`m-PKWmCSJC;lRx+5oM>9#vwhYPe;_RR16>Y-Em-Q-rRmizO;)kOR9nkKKp zs`RPZI3?KJNuG0&<5TO!w^EL?r>W$)DaM>{cr7JT&i6!8wNA+otBif-jRA4vhl;~B zYHpl6mrsAa^DY29^Q|Bv%xzBX_m{<~lack;+$45OKfJJFCtMr#8wmT=UvYpD8NM6q ze(tBT>#DEHSC=Sl^*<|~mi;=N9d`y*3kW&icPU!tmRa!Rjhg8&N@ie}K1Uw(pl0Za zQ4>Z9H|dL2b*0yGLT8~Js#>m&^poAui*L0`etm68=Xl$J5{|dstyNwICh%pS5o>qz z$*jsfgfc*D{Dbn0h5Hjq1}* zVn3e4no-_+1#BO@%k!ht@}Q*1_`XUd>gUP0KVKNU*WZ{P`+2wG&)247*Vi5YrNi|Z zH)Z+HCb<{5?@9xX5yp^0O#tjTX`9sBh~#FHrD&4;;)C-@(TpKPl_y6X;t9XB1tEwl zNo`GJu!~}hAW`Yqceelmsu9ACmVu+5)gm;JRYt;p3mY9mK*xu^o~9%a7A_%n?(b0| z(sp1d*iCteCl8?rB(^i-q?tgmHQ2)Vhg6-F;6tS$0Zswz+090dd_z-_c~*DstQ4M8 zhI+Pw9w9P^bR|MQ>|GZEKz;^7D_S9g9wBTUFTg+x&uL;viLb{1&WN1JM)x}=OR;Fr zd(@=!0KSZ5RVrO-1LzA)L^6^{jMNIrBx!QeqT^YmtvD2g3rPh>^Jzc1&;lfSKy>0w zJ#eKI;u#10$74`UG-*~!D+vrUOI6-VCIK1z)}SB>?BF2dBr#V`cASLG;KK3f z8HLsu4lqt&(3M%Kl1*oKL|`Qu7*3R^$RG&i0UaBFg+3SQ4In~_*WjcTVyZMV%U&Vr zL@$jwj=?g~ym=@dMoO*&W<0&xnoF1w zck@2|^Y^$PPVuZ{P!xYw3cxz)L7MO_s6Raw_9jjbA8+lPrZ^XmY=YD~AQlRSV{-*v zfF?u=s`HAa$R+mCS*jcVUo9*8@0e1-i75;Jt(fxfdJhgf{_m?BPE08(D*D%$@?RHU zacWsPs~ddtztpmN)cjja3I7!PkC<|chihKrWt+ZemRxQhwYZ0uqf>$%XFoMc(-_)zC+0xbDUR-!bKjwev!U4)0g$~O_wCEC@X&iC- zU!Zjai&)3G_Rn)iFlj9h5O9ZvQ~sSpHTgsq`x*kM%>so=wkf8u$aBfW}}|bz7pAJgr|vR4^~jrXHG$AKv{a+u@4_ z$XhN!7G;AIKBzhQM1}<285t@`D~P%(d&a~2%(R^Aj`f(#xBC!8K1}m%2d!DO36Sch zgCI7rqR|Wy@5r!u9ik?TfOLo*8=s$YnGjqmqTuvd#X(Orwsxm3a~C_NPQ~{=O#oh` z+a!7K-MrxRP*PxzW@W^tOp)mCMS?5D;Jc_Pvb%7F)5WfHKLf}qbBimjjLyl8=L|sE zQ>+ZDkRyus?i+KJ)k`PM!7zj8d|enIL~@i$IwE8j~6Dj#0w znZ>50R*?54;h>TZSf|WudLYNbcDm(Yne0v=JW!~hK@_>f%CtKyO@-$_o>iyRgcnY>-ar?0U^r0HSNz9%IWdkw&I3`Uiz@$$5u^8Vzq6u*84as znSHi`K>jZy%GY^5czgJMvpv_pa(>{H_JUohbi`fz0PdMZm#8P)_dU{cxtG054{$&5 zZ+wq?c%r8g_b6n5JL>U?*&{sN?e=2|=LUZ?gM{-d{K83PvQ^dS4x{%=I9QFc^ zcuRYAezm84sVqFV0U<-Zvcgu?Qs058+8VaT|1_75shwqB7O+z(ZnR?*!{l<0>B|~F zd2P@K*9Tf|q`a6YABumwc8?A3eQRj`R@3g{nrX!;kB;nU%gBV=1$l3S>U?f|U(BdF zoz@&%Rt{f|-xo~asNXw1pX@S7Y*w~kWci7iJksEzb+KM&xD>eE(Nm5T^|Ls=j`9=S zsB4SA9Xh6O?GyaG1BoUcQcS}16{VIx?8-ho+`^kL$LXA6*Gs#)j85HHRi9&I?w|d& zSRSi+=)|%T_%)L^d>LZ-=FO#C`3rv(uW;quRx_|~`v|6V1(3DBY*U9dnPz;hlMOqa zr1HG#119yrpNKKgG1#`QL`Zh0U>tquR46U-RcYf?eTOtP>lo${s^!!4OMOijB%kX- z{<8%xeS_Hfj|>7$0mbrHZ?1{GynI;|eZp+CvsNU3zS?*xB+5FrNR+Ot(!CIpsFPxn zPK1@~L-H!&gBN6UWC{&5F~-L5Dw99GMgeAdvMJg!Qm&nccL=TfW%kjmTdrQ>yZl+d zEVf{{z{^-<29dT`)F$CXkHS&E85M2?S)T%@^4%t#*=>SS0;f8M9hmjfW-`Zco(1Z~ zFYW^ADHfYz_yJ^@Kqii41@EdMagl=4$0kbbjlvIf>l0<(`AqqT>(JhL@#r6sF&}85 zmkbAfIkx@flHS1cW1oPXYx^Vmu(B0SKA*3OI}41H;(!$ zo-|3fS~^#zd){}2nRRIYiF+qhCaz2&HE z&`(F6MRoDGCrHlguKBG5p9}1{i@dxQIdHd5+t`a~zFpO{k+9^dC03gzYVIaM!d`Lo zB-%H-rt^V>r5M*_@QEk3oq^jQ6lJk0)*81I%7KusEB2BjDs`nyJf&)y(u_UyZP%Ga z3z}aT&W|Haz0)zOvojq{gWAF_!M8s4Mar-(w)JfN*-V`$^Owz9zZWO*_n2~-t0pD5qUpZfG5VDW6CJTSoTzGiR zM0(5_$S|tAWd1VWY8thgQfXIpZ97|QQffuQuV&zLR!9ZmrL7=0$ylh>*YLd<50tUg z1Z)Rduu@4b%%n1L%j~gN?`J&JbmXM;w#M<1r76{Pi8q5~qq3OSHQsM=w!57sQ&V26 z6?S;eI`qB*9X!v_$kTwT9B4#uCTBaUGz}ywbWAZE~O> zdauR|m2rO65{h>cOG{+6-Y$3(9UD{NwEemB#WfMv)w{Bn;W|$IbN)vS1@Qt!j-^hD~j5_5@V)T~>BOXZAcJH_OxKvuZbMdpq^8i1;7v+z|BrDYl<2|cs&eCao ziV;eil}X?_aKy+CM*DH^fvAB$YR_13bG6#ZH+kYC$?hJrVO0qHppSsaIB@X}_pJZ+ z>Qg3wPg*c-RZfd~NW3q5S*mD{r(VfFg%O zPD`)hU_WK2ER;4R^<{G2s;}(q+p$mp|Bwld=V%|1+jLV9@a84Qf&`7=ShSmod#FU*?WZa{~+_z z=`Y-waeObvc;g#?3z)HKsKBZ(*I2($!sM6(*OCx|6c$455M((>*^~}sDat*I6Mf+U z=W7BsxsTDY*Z#uaXpD!LAs{+~_Ct^f$Osa{u&6|cmq|nDR|B)zRbWF@bQTc1Bg9UW zV#ZW{SCwWaW&vnbQi2kv`|1s}EDt>lhab4XK#z~p5O9?%FvrVz@7WaGAtU&nqD@P zjHJfp^`sbX#alc5ofga#(vbS78?ONoAR09nFGKo!<3v$_d=!#LO_Noeuvl6OXK}(q zqO0U3OA*2FaVRXBE<;JzVbY~&3HV+hE)aMhg<)pqAyZgUycAlsJfzf{k+pGlx(6jp zNb}dvY-UCAu@kwev9%(Zob`r0D(PSbDB1*tImOj(<)~9QceaU6@?a-1O>`p~LyK@D zqmDWymYSaZ6m>S6kZ9@zcCAD~f!RWHi8sx#K@>1*Eb5cU`S`}Hj_&{=j{}3|a05BK z%V~+sC_Q#m$9MXoNW2<5FK{jakA~rB(E{dB+UxAA8*ws>Xz2|gLjm@07pDIR2{oLM zF#Z1?5;%MpCnWqU-^B?D|Mf28Kk!{&GM~qPb1E4ZpTF%=49a;IJ=BdVUa9Z z8zq;UY|>|HsG5@dlXb};OR49*@gYtWr7f%2(&H+BoWhfmj|V7PlSDWIp2NOJkz8>m zoQ_<#+zaJoCl~%g8zi4-UPVKr4yu45B_zz6a z1plf`p?PV8XqE;6&(XY}#4rzt>+*9p826!_qHsBlG7E3z-0L!mDzB_49EqRZ690qY z+zE%L;fn9*)82-uLL9w2I0oU$*WoM%9flMwMN{!p^bv&pRW%|&1RQ;e%Pp+%iyY~v z)h=y)VH*8O8&YujZ<+h!EI@48ZzJzLY(RgtK-HgpWojs-dEXXlO5K%GxkR#mpd)Jk4&k$hlyBTEeV%Vx=Mf3cdD1vD6CJUX3>frQL<#Un zKX*Ozt;b740`tYiW|;MD4s^bNlGVflCC^D1K-f74Kds|_PM`ma&-vHCQLK||w~Eyn3ml19Bzxw5TXGW+q@kp=1Z;Gq%Hs1;6GY}GZK&+P)bccrwyCLB z@% z0=fNPgLZC}Sq87IOqYpuuWJ8Rh)HODB5Z$^8$K9t^+@qG3aQ7~qS!sZ!}5Z2tWLiO z<9g79bI{Kczf+zA7=eAUnqpISb_MJ8<>pDM8{fnATpYK}g1&iprrtZ=M}sz17mFV4 zs~M#MElwGB9hZ;K3>ZDib#!Q1cw`G-I-W1dSL+@1)1iIlxZ=+Z9+P|b1hh9w06XU~ zvuC!88_4ClEJ4$wZwl>&cf)pvS`Y8H3^@q@>tfxQ3>6mt!SbYY+5|59m zLyKAZoiAg4P0VcM*7M)`&v)BP2I+Clp~K(+dDmq=S!pksuNmMl0;;9QZ+kvr`>2yu zS2MZa)Lv*SynsV)r1kw^6uC%MKU8g$LXf;_WxkuKC(Z9W8wk930Zk3Rd07^RW$ z#r)}u$-~{Q=U|$*3|I><)lLsdJRNxh^psr@b$yVnGMhg9!4I!=Plc@W(P*G*!Q{fj z?PRWs+XppFj>)*iRKn_I=6W*Ei8hGcdCM=8n{>jEf!1-?wz_vY$ihr-wZrc|yi?Z? zx5EH79=%xzl)GCU)Ly5uU(sT3!`))dx_UKxl$B3b-i5mhMBVF(hr?QI=^NJ?fgg(2 zzablo?&Bb!U zH3bcHg{KZ7C-fVS(s9WE&D`qNh6M}jyL*MVd<9hp0)?dBh1mp}2;Ak`^0GLx{xtBk z-i=e!AuU3J(`Ve?wms01t$^`Qn-z>-{(+}O`Z~9}>)$PV)*VC$kT91O5h7#~TPk-l z?0KxSQpDNTB^E3SD=4*NctK_rT=Y^9nvI?Ws8mBVc>=JworC#v<>2DsneBDQ`AhMHR5W;w4HCj7eQw|R#N(Bdi4#3E7SHjgz}7dV`5XLY_IFq3{U$M>{FnXF zIwq;d!mGZmytIDjT%6~Vne%x@DfP#<=@)euD=Z2yJy)%cFq$EA^U>&D&yt;S>Rzo@ zoB5uD${KZc{45dTo~Wz0x4!;5Cjf3{==OffX%D(RtTuG~3CqdXy4JK{JBRb4YtVymC`{6l^*1DTX4hA)(iM)9}xEmGJ>+Sg!Am z`P{yB3h7<&}}g?d>^JApJVWFBiR zbexAF(7*5K7^X}0K#cEm}N#5R@unh_wL4546O&jI7sJm zVnKi{@MvWQ=y$v>6mo_9@r(BlCp*ANdM-iPViuaqX5qcnjoHSu*jrcrAlmmFW;@aW zTn2fqK;A$^j`f3Y&>h}dM*e0>i$V6@6s~^_6zV}c#pzf9#@VO$31g+Ps(G~RGx6U7 z0JxTkZ5`^~6CwYiJIY;p?Xp`xQign1Y3{7Ucc59G z7IYsg&uN4u#RmXUPtwstT*7O5iMd0xkBxLy7M-87Xkf)~8f)*A0)$@u>!x6RI>18( zkEX{dk-*1eXQ%X%b@XXc*0g>mK-dBtUIX`fAhZJ5%$2?#6>CCB^c0DtzfQnzq)4&i zLZijFXrNywCU_%}T6)%V88f99sbHFT)-ml@I;Is5ULwXyk-)-6fCDXgr=yFO)4!Rf zBsa!Jl|db)2!2jJF~j(kA^a4aoEb3lB8WW$9;0U%d z5b-^jI8;P7X9Ymz%4f&_atuGX9BnQVqd6Cz^!@BsK&~<+SH2p0{072pU{>@YyYCrH zcC<7jLhenHDkI|GCi`7~KmRv#Ci~I<$;tk|?sVcj|NloyDYiW3@5!EO_OLpGGucnr zN#aI*&RDd&*z%ay|CQ;%ne6B2dou=Gl6|jpiUO$A?p`0&5830=GauC@_`>B$+;NHN z83$=e21sF{%>05w*#Ra}1VK)xlfDN^6kAzar|y9jsBdX4iD+&scU-60(~(>zfWdxp6fG*;4}S!SRb`>T?Vmm;P?`Nl!)00TKIN) zMJ-?2{BA5sQ_j4C10Ds^_<>|j8j*P?%NkPQf<(5(`)PoAZ7)uLS&>AaLE^ZymmjdD zldl+ZD{S=xG+H}124esCc4?8z^GHoZ>?GjQC2{kQ@0)u=hRy-)`?ead4Os)2?h+jq zaC!17R-BzcW6N{=HT;6KhvZdy7ONa0GJD^-G}ge#UG{c$Dlk8;IXLlW2{b2A@9k^N zUb~rz`BPPwy7+EAkG6-s53j+3-2m|0I=^TkU#oE!r7{$3OFlaf<<36TI@vo5B6{!t z5pN?qBd!Z<7ax1nyx#P9^88CQD;^r`BHCv=X|25k3_tvam+!+2@An)NfA~I$9{J?A5_L5^QW#j9=-eI1A|iwmfH`>=n=M3{z2hIyESq-CSJzh6 z<@XtuHSTV2w!+f~bu<@Y6TK&ySA89`i@Nf9OETh}(PV!@gVVEy zo%Pscq$nl3|JB`^5YzVs6(JTXpN?0k!{XyCFYFO}aV7D9h9S#hN7#x#eA$Sxaf^@e zj--WC-`*G*H))Pg=nKAf2codMrzq2HdWzaTAPzDnV{T7pE&3EB{PXZR-JLR>>U*vKOhohazP#&i6 zYeUz zKOT1ux_q?#?#~4YZi?M^7wAGy+a-yEI>HZpQ_Wp=&Zi&lRyFS~Pj#rGd+I-V;<_ed z3HjK_O@amz6_!`eHgCp+v|l#zKKJ`nJu8aihVMECndyRktG@Q%&&AyyO? z31_2!^rxQjJxq3Xn~7Cuu6TOUNUe#V(F^>#BM0?c}` z!6dB39l=@!-^@BukhZ^aPQ7I2Ik)Oz9~Ga@=CEsf{r)tB86YpKxtmBn)reSz7-Zns8YPBt}N=thxreXH!{520oK+LbY3%8-Hj!M3wJ;(!12l-p9 z<4M=5H=`Ad)+FaM@6^@^r*fHSt)I&c+bNRR{kv)3UrNWr^RCq?$OaxdFR9~#W1m)w zkQYct+EN7B5z|i18l0Pl)>9Jz5K&lLGSvNZKXa-^btScrYu z6w3R(?$Z8pV}VgZl(5 z_huDXW*&d-JyKE&H8{t4=lB3WfzuL!k$nPf{AW!I9_N1%zIGB9C}t^i$;e;6Ae&?S zSyuVLj*vfU^UjgrEiwlgUCDW9l?pGA^Ix~Gx*BSp^)g1=2nvwt*kCr*HDXo$39oFX4xE4dl=o*TUSwJY2JvBQdsN&W?U!()djk z;=wN$cxru7wdfy3p{qY~ZD`+wv=ki^r`j@}s-4VMt8p|y8nJn!wDYn3C$v!HvQ;Ug zn!a*JuHq8)xKk4lW`M3+?#>xq>bP}U)FB5=!C=( zaS9Kc*6NHlFDuVT-FYrMzp&ZT6a8_w{fkyD`|*7_4>w#a42+Jf*Yvw8_6^L($c zMT2H{i1Uf<(Or`@1B_7nWM0GO=Xhd2X}3lr$)J4j`SWZ0SF%AVN~P_Dl>B_oF|X2l zDphaxD&%}C(eO!i37iSb1ebR*TUaXQ9~E4PzH0TVCqzWJu)Zpl3EVY3+CsiwDPxBA zbIwC|P7EBVbsKRKBHdZX-Ab)%=Mo}Qg;_OTY`ywNTdy@3n0MY^Zh=CKmX1}vQoq&O z2Q%GV*J_WP_m_qTQ?N>16Z7u?Jo^!RZmRo%#{0Cb@W-ze^!lGve~7pOd*C1WzpX;$ z?PYNt-ALNywu@=jd&~Ck%L5ipcR6X72`N+q{tskFNjL;Zf6PXcdV%qi6ncI(8=^8; zXWcdggcQgEElmJYjY^jlr9dLlDIC;>j%(ZIsHthbMkG_AjBTWBI(=ftl^G5*8$;s* z^l>$6#pF8n%T}{Uj4&+>W=B+2VE`~S=4UQ5#wr1bk<5Ael~e1;d1NOeP4Yr9ZbVfq zZ7*b9MZ;RNpn&w;XR1U@hZFmwz$F$;g+f1|Kz^kgz>?NhgVH@YgS!ZJ%JNf0ML@$_ zA%%GCxLOjLb{!J%jKiD@N$xpM`5;Bphe*^gEjw>`o!<5NQ#_y0!HIB}0NnfQ9$SyH zfwwJXw2$VeMMihsLQFXl+>*<QQmyAtXkO!p69Nbvl^jHb!qDPSf1>{sQUs1?2NotDM~v!3v0rXZyh^xud^=Ou&) zL9VeAKcdSlodq z5{VN6qK`IV4h4dxT%l)0GVtliLjQbK2hd!3XGEwe(sNYaC>VcKrsr~~-F@iNmZ2V7S?)67v2;A8vrTSc=*t~sGSW#RVXZl9@ zR_^C*s&BuXTik4n~bjh z?<46sl9-W~O!iK(RY}3J1)%PAL!3o^*;%Lp`r2)FzGRm2dXM5>6%zg)!`*!4SacE> zUPRoTGlp9=j^Xs3<^XR9>88UI$m#++0o+}+;-W|p0DYAaC-X`U4`1QEi`+H2*rEXo zl@~Lt=%$-g^6Wz<|5`k3*vwr5S(BIAL1awSEqA=hG7N62iV+r2k-63apqwJH47&XS z$P_;LP^%2=fh9rYQ&x1dvTg~ik2U+mZ~;c}p1A*3dvIy?9`XGf8m#1D0I!hvi*
    0S|ZkG(-u$bj8sk91L0KeAx`|e712_qC6JK4_CU9a|~nE@xVIrEf2}bk6Hl@|>Ob z1ARS?ZGi^e8(*LT{yxvGCaOi0EE;t7|JoFMb8S*XZ$-XJk)e9t#ut_lbe`?<9g4n#fSy>n`%3`9n~B5bA*D6}Tgwld42JT+ zADQX$W?w;hKLzcmd;RiDuzq#>GkvfeJ?Ib3#jo#o06s}FSor{ z$+*y4;zN`A00Wb>!uvPNLBlRB!Y)0pdU@6U=Bl47>s9l^GTV9oXx>q5tzwQtwka2> zmq}_@T}2W9>+f`xAYs-2ZN0c zks`?u4}l0yfoX8LeD}VnqjJzLCCtK-wkSY`Ecl3vDCnq{QzxI2KSe44N zuDhv%ifd-yX7D+iI+9;k%}PWVSpX(ptD)BfcS<9P-~M;>Xu2prLO(o9Lh<^VwmyOs zI`+8AR!R8wF2Zeoc57b2T4nxDd7`sBVyrCW%jiA^4t9M$^LkqJD@QhMRsQw*;>Kx`(mdG8PEk7` zKLC|fK2#uNr_pSVY;@|LtQiV*IbISpuIzXAkp{6DjtlFk@ zpZvaP`IMt#B<08i+IvH+-(*htb_q??j$gienVe0P9@e&QL&tK1UdUE4Cwa?_2YqAc zrNTb7%MrtcRmG%S^W)j3MCRKWsw1^girdCLuP?h>&aoeSfB7z5(Fi2q3X;r(`!ido z-i@7Omv%mHs}$DX)v-C7%{Pxz@91dPbiKkurq?wH{H)=x4*-)~`xA@FPv$*m3r(r* zb*}n*)~jcWT~qB1L6dv-zs}weX#(pWs(g0f{F_q)oNh)D$R$_}f&m~5dd+A4$04PFciyx<-4%aTplNEo3U+)NC7CQ6imrGr512Z6*pm;*&qUdTl^ zD49(sz-oRmIdlOqG;f6A$QrmfJ^CUVmxQ&t^peiI7K2Y`JE1FIB9lnz1XoHBe7Nqa=*8oU4UD)z78b~82@i3eM z#_1**jA0{@bLLP^o~EOqIHjYh=Yum+rQhLPC1-vgk-yFFMNu2wJ&X;^O7~^Jgk@p_ z4}|?Te}cC^22=CiV=#i{vHIx=-z#{9NbmI9ss^sUxi`fM`mAx6@Y+*@oIp1M$x`6^ zfrqCZclj~*BuC%`92J6`Dw&DWeRG%f;O>Y^pxlh-w0xjIlUG!nmu;t~w9);qAHfS6 zo>Z?Q4Z4t+CeMGR&j0A%4zlij_MhwCf4eF9Z$sz*R`=G`)wQ;^{y%l^zoX6`b0Qn= z8~@x3+F)bQo{p3G=U&jf5l8;y-}iz{>Ma|C_2A~@$q<2p(Cqg<`=?`0qAVvGf>U2P zKi-z2d=MTJD@PSgo&|_YO}os<$`HYrlAd3HiD30Ed_-^)hEp(8l+_eO)YgRqjZMw} zBh;A)1vP=eKM%o(QfW3|j~L;AY=h1Ge0rfSrj_koq=+s*ki;rMgQJtqdyxRZH(Io$ zbB8I|q|f`sc6IR(OPVtY+zc--9tM@{uX84n1Lc1hFelnR*r-R;o-iD7z8VD6V+H7Z z+9Dz>sPkoJgpWXT78(z?E1e0S%&c__!mW3J3xZWThqG^;ppBr|~p7|j%z z93K}Vw!%HP2N8I@eJ#MT>BNQmh|UwZ#h!iz*qUr^W#YB04Ut5{Vg8>SYe-*STHbkV z-9Y(Mr5=KST*FZT1FN;P*o#f0yuy*uthbl@AIwzw4K&{P_RkqhprLetG1=F{{s-|7Rn#qYlVHKDn%Q=-1TDyn2pn z0o2W;q`$Or1FO>8TvqS{s z5+YjBtd35eyERteOYcl8Bq*0)L>J2~CmsMc!9wLiD`6oJ)`-?la;xO7wbZH=w0J9y zTJm2{6&u#VLY+4PUwg~^bxcUMIgTw>;{(sEBsQMZWVz#LtjHkwz}zCyUXWB7uMBc_ zHAnbcKFXnY-aWNyc;{rEI-k&}gEYRrx)8sICviA9&s1Cq)A7gOp8&Su7u9u&=tw$s~KR?+$br z7_S8u?CUq-ica?qn27J_ofsdzzrt{&CDoD4(!^XVFq_sU_-7M+xlwktiM}?QeY&^C z>2Rj)G~d%XL~H(n`5(0)v3%GkDDxv@=bilc#6Qk^>X`;+3%SNWk8LFLr=V6~Bl_bp zkd=hdcXxM-4*45Oe~vOzdHlNY;BjW7g%J>Rh4ZnP_*r3L_n)8U=i4fF>e#TBYvV`a zLH6;^euzOelXpD?joaQGX2*%^ofBGDVk}fdsW#K>+lgkdP4AUmH;Gr*_Db?5UoYwI zN&FyvSH#F$hI=5!Bbygak>E>;fc3n{nIHDl!peR1`!1v6nE^#|hkYuEnHKNfEw}h? z=Fc6}r;f)W+XL~MUfn#vCyJz#wP80)$OV<5$JIqOXpgoY^?)uvx}OLipEzAy5R2P$ z)Z0WI;_9vIXFso1xp^zd6w(IK5a|UFc>NDW7mjhPSo4AMnEKVxJ%uiz9A-^(p$YZh z95VwfwcA2`6J=m_k!y5{YC##&Jm0ckrOQNo5oQ?3Hp|~+KKC3DlZRM#x*xV%YkDpVEo@I}p zyF~mU15f|&s;iNrdVzGU`JWVoWL}p|I2TqFObJlPR*0s$n=o=M_EukRsnz%PX)Pk5 zghzwTS}akdtQJh61V%m?{8^v9jf))7o{>qBe&O0o$soZn(;`4~m-U1x7QCUItaUc{ zsF@d7S8KxuMb28P&ACeI#5^}+(6{OmvC?siGB6)JcMfK2&Zn)npwg3h?cLIY&}aHk z`d&6slqM$WL3dkTKj|ANXo)Tc8P|0xvCkhfPEv+kzEFHcQUHId%~deO8e2E5G_qS^ znL5N;O;?H5d8_$TAkla_Ucf~>BMZjR`Y+6d}+(3^Dm$^@}^b^0^H|`bbo@9pJ4W zqC=g@#tXcU{>Tzqe!KMOaFKCvKh`=2W^uuUt^X)0f{K_L7=EeZmwxlssAi*dM-c4n)_PeoZ79EDWaaU9GqMc`sgKqj5&Q~?B9_=Uj zplV`c@KU#U9VL50#elzTOwEtvdmVmAP}gGC`PJm)8&DsBqGm$#6(>4{>47;FI8Gw# zUZQ2pheD2$d6w0iW!68=^5f7JZAEwV>;imO+GFJeKsEaTDo~r20m<-ha&zG&;{4I_ z8fjEASSa>VjfH@T+0~d`ueB`Zj)_m?bgx-O_5F3Zjmtm*x*mPTxe;#k23XuOG*cYJ zepwkcyKs7tp|MrIf2OUhvtE>5bo=$KEoUBHvf0RFg;urX zc1~(-oTfS``Qy6M=n7Qi{?4nhQplCWlgqOs?sxaJW<^%e!RPdcAmYEz%W&IlD{RxPY3R#AJ9*5?eTY=-V{s6M_nf( znXs3^Ts{%1jCL?ay5Lt^_5RgK#9gVl`(iA-dlVvXL1&WP!pQyr4u7T37mZHAL*9Vj z166Q@A^=Z)bI_WEpGUE(tXbfX2o%Lgorm|uIr?K;=p4Yra3s7%GGacj_u!I3FUaK` z;Cre38+%O~c<9Ub4-2-dh4Lrea#BA%9D#)xcK<$hdyrp}GIQqLA5W<<``ed859185 za11d_+!BDS(xRy0VQz7^BG;)Os+_TV@6p#?hojt%e%)&dHUGTwXYV1<;`*;wSP*{` z*8if?{I3w!|4eD}3Z!bdm%9C*D=dAfmGxiA$z|nY%6~R(iZG*|S017HpyYhRLlfp3 zgIhceBpBca&%ddE~L;N%Ag>3N8q3@y9lN(9}md ze3K=TL~cBy;=)cIkpn*gcc}4Pf($@J^EHqxo7H9Pr~wAHB zMG6QLuW(6gXEn=F&xo3KssISTdn+TNAB9>`TwTAuWHf*GTcZ8yXmxz^fKX+a_u=#F z?S+^GSJ#Fo?0}cPSXk+bWsAa5aKPI|Q@;YY$E$ih>OT?Z0YxJL+`^cQdw^Dtm&P0G z4c~I2^^bzs!tnHAid(`zchzs134(d^?iW-FAi=k4^WWIdsF(q+MbKPYFHE>aMaaA5 z54=v9qsKNvD7*mg{gjY$b`ZT06zc}cs753yP5N)y77!N&$kQ#jf*8*~ABc`x9*9JM zK6{%vMpF>)7$s6GP;G?ZJt>YX)ymn#*&;FXdLYVSJoug{iFi+^-HAa5;WRQzSat5K zapH|!$SeseEgRK#9j?p`<=7t1^)EF&aaOLRtWH!9>t0FEKAl0n7GqlO{v;eA==@0- zlNdkMRD%9lED9A+``mJV#G(tG(clEN&OhPzI&WKWxii*2OIJy>?*6mF z{G|P7pBk=u_w3)Ny4$-vr7P8b{I18d|BPn*?sI@b&k!+|>yRogsPMoLA%z@I1dtys zn?xWOJ)Mlk%$R1;gBla8Crp4?B?c~5qklxTdw(pQP^O_XEE>sh?*@nWn(NbZqaiv% z$yTwWu-oCPKT(Jv~pHy^=oDtxb3Tv?5L+=7HdG% z?KIZXEFyHd6-+C}_K2N%b0G@KcH&5pQ(Vq1TPiD8)t`ctIVQ*%bD|+V#Z0w(f`g~9 zi)m`^yLa?;P-f68?^*Hbf@D#WLr);v(YezTHF$~JqtgZccSTJ#U0X%QOedvA5;(_C zX}8}AdvyoxcP+q;`ebNul^G)5)ag~df9PWg6$n^=bm!}u}K?2X}%u6;JNiF+?E zxo{_py`~XzUW@B|Ak>$1+G96xPa)*c{{aOMgj=5Q3oBGHbk<_ye7mD@SX4gb_~4*| zbFZPT^Pn~!Tlp;`vgT4D^w`n2?pfxaPkulYosiu3t5ex*j%i4jTE;KmZMCt&MH|U* z$A(iTsOEYfoQv*8Wsi*r(c(FIFXY0LIo&Vbnpc)TLj*lPFuawUz++uH56GsfZEvrSBy&_=w4xlGHC0UgMe3vt= zwbCh>lhFj9&%Y3RrjKQ;sg0Nr2#3|gKyf3kU9;yRn=1DgA1h`!fXb{0#KQF^V=@V) zUlr)@64Y_{^E7)!K~Su@Y|PBMBB!Aej&>AHv6^Mz=;*DwruUbaXye`4Z0TBBTJ-N6!ag&MY+_vK+PL39&2u`qYe}JxD$-t*frZej8sVUf$ z0bbpzX^#~?3Q-z$!f!KVcx7!WsPl<_V^48O84?x@QZF#2baJQIQmgKco(%bGNZ#ZA zL=kU=+z#85GOJO8j1h-iBjs}}$h}sllq;tlek{Qocy&{F!<^-7=us+_wysWFeu6?G z#e?MpYS1THhSZfIZi51M#eB`)nu%C0)MnzhTfv%igjJUIvs@^n&Z*K ziPmQS{vQg7g=4nC3aamF^y?Jb49#U!v*l1E3oQ8q_`@%ilaFxO;G&^jLbsuQaE^93 zqWmG8b7={+$T*gTHWSUt=t^vjP)aTfD=$Dm_ZL;wP9p)#Rqo0AaX0_Y`C`oZSGkX) z>yyL)l_h>PY8Q=jeLH)j%DsMlY?_+OFx68wo#!uI=yZDjWOzR9o+okOx;*8)7m|0B zFoK)fx5M^vo9?Uvi?0BBtqHZNV4=AbrYD5aRHG+gv9!qSn<3W72r2bf_)0Z{-5+0c zziir{40fQkmg`FV!8c!FhEmDPL4E~qxC_w?gpLzeF|>Q){BT$L?m`}bZUuhT4mOSV z4h!E%sN>~49nmsq$;_MB6uNpkYLwcN{a9~H%;t2=a_T=+n*GCqixVy^rsVLlh)VGQ zu7F*Z2xfGbpAPW8q+`IwLKPQK9jUt%;m2UO}B)zB3 zaJ=^bmzo{ipok>vyz?EwMF&z7UtwUz`y*I*caWd?V2olQ7*9H*IxjDzB37jaWE+9X zCrvSR5qVe+JfI@{AXWmNe9m^y&4w7L*o<$xC>=q8D|~~*$yTys-LK^lz^M&DyKef9 z`ep3mjPm6UD?kErjj+IABwrKd1vuv6=O~F-gyaFtoZ`wA#;$e*&!4XhdZY#6`1WF$ zHy(*wB?-HA3JM(@P%)iNv5*4DaMKr}#T#Nv7lMkl13x4KUxwg&@P0Z_yCq?UmH29^*#LyGv^L0rSlnZLh`v^DsV`;c!9 z(S$|tGRUO&5SzzMd93-F#UNwMlczvUd7C3mb5{@F<=&{|Xe~ zJB0#}{||{thME82p}+qg%>3&9PdSd)$l@OpUnYQ#-gvymUx!%*OJ?rl2?dyO3-z&$xf`YsebR^nGc<3S< zsw;p5T!O8Gp|TnWxoUQdVRjQa^jOU_ZVC*MvaVbMKt4PVSc`x9Au8>HS2J3OI3Pg* zWyQGR>4;!3kJmRD5>5pYiC|;1Qy@gVhWCLn`73ky$XY6Z(r1N;uZQ1chw7c-p43-s zMC{8D7xpA;Z*rp5c8O*6_1fIf`O)vW;Kx?f7?C2sJurng=o+@^JHZB`6!8a&<@GTK zsPP6gyrveDIUOh`?t|IK)^+u)xd z4yf*5HEX;udezfCS)2N0QqV1Gi(+i|7g@7&JCPEWw_f+wt1Trpz0^?#stFYM;4HJw z+>nl?P9D?G&*G>;yRh=NB=uqbSi_|)p#q!pt#Z5#1A}XEOoQSQL2{N^WHVY+$cG@I z@h1{{3y42vHu?fG!h3gxx@7q4?z`${_f&RRXJwQ@IsMm`2eF1cH0)XFP_?G*yF7@X z@eFGfIoJFlr9ApXU`D7yLS<|dd&gyEnT$12uUM0v1+mVF>f8&$mWcF`3wdlYW@h=| zXqXv*lO|xDkP5^L);iQ?reL}4joq*x1xU`ca8beC%8)fx)7u7o$ApwTkVmLmkCwyk>g9A)H(aTF7`oOmJYuLqhY_kc?U7!#?g9TY1Z zq~vKo_!0VfsV6j{=1&K1gzC_oad-=d!33jCyx0pe{xBR}$&;8jI^rw5*#y}eEH4iS{JRLeI zuF)ji_m(ybueG2GHpAX6h7FzB%qrbYTB%5zZ<~+!8IBL9sZnwW&CrhLeAK~9$bvk+ z{l`I?qWCLwUZ3{!a4Ai{*e;K6ppbWmKpP8}^AY>%xyam=PxPB1mpM$1KU3hpyaitm zFJsU5=If71r!`PcU|;n4NVT6l%y)2+cO%?Fc^)wwaXKDz*s;lc^4svf@oBN&cIBf( zE}Vb?1HM=%za9R>g&$J6Ac5Nvrk&i6@=avF=MO8#O*DddD~&xvKPH`(7|EI6H&ka^ zVtyo&77}eex15|we{K}u8&bY8eJhv0%Cavuf<^$_ICu&DNCDuBJ&+oP^Qg^W!+>^&9yP?Z}9`eS0&xI=Po7l4Drb88`6B{rmTLl$NUnNY;3zkUuu$P^FBMJxl9lBxOz~1~Y1XdYU|<)2Cv}w%Tx-XuUHK{AnF%st zE+V`^Y}XzIQO+1FgP8=f?*DK-8_@qQ6TRFjzpGgMh1_yA=J+Lg+^pnJVi@SQ5H)$z zehzYr1e|{HtiU_@{}!PREH#^a$C9yydy?n}#m{gJV$S*oUZ0`rw}R6`v1d=6(GIp+ zk*PBGsWmA7=$L0ay#ZDw>VlrD(yeI38g{wg)UeJ`%|0_$g~t=!ZC75Z>`GR9{Ll|0 z%H-K?G0}EDF*W1dUDvdKeKGu^ha|k%R69YvXRYL&nWl-2ww-!yop!>eWe)ve_2uiv zR)v|h8Lu6NX3GiDFIzC>D+vg^JXOuQw6cxColU>I7Yc59{}q_2{OfcYPt!)A(BDxN zk79{8XrtODb4}SZ>bBbRzriL*{V9PDLzJaMV-lHc3A9XZX;guJ6v&x!Fk2T9=Iw+> z*b>2UU2SAjJWi--YvD4?1e}AJHwens0;(UiO|!R6st7EJmzcz)!< zrv1RnA7;FM^ccb{oHClyV9FQ8XtJ{WoJ!8XnFQ_5aRaH&ld7(qCN00y9- zzrA!f|5-CkM06b2d!xK7#>pvuPhU8IQi6ebZor3S;uno$rin3BM57JwSg-+a{hNM#xKM&e;Yh!L zP5|DU#>RoU4`pgvoH9UQr#YMdHgHPr2SiI_L6P$R^TBJ zO@2Z}Ma9U-_#X~^|EDmsyuAEBgPH&Ltv2|qY+QV4*FQ5mj#rWff9i6R&f znOT<*tSnRk{OlRorH>>Ek?aUU_2WWn`p0#T3hSF50{=s0tyU03T2k z912475{z9W$&=2qKt4WVCJMqq=|vC+q8=+!iv*LaSwK~oi(K#+;nr&kLsvoOF~&Sl z9o$bbY=y+DO@VZ^llVk1h1U%UmUp|O8% zwbJ|iCqb0uN0E4s`FrB&%~gHF0rgC`iPti#=T6@1LaW#Hc2%4D2m0`W1Za$T9sO!KvqFMqYJ`MV^2^1hJlmnm zamp^sGY7RVlozPce8N4-{Il?rE}^!*V=X{oJG(5>yIuAoh(5lyNTcsH+nQNBldG;@ z^&~$(FcpTtrYn_IlcnWJU|u3laAq@JgBe|gm?%fWFSCh( zd5)oZygi;IaRtpe)A}qqs8kXf5B+l9-fwQ92VD!~1a*+WAG|u(bH~TK*2uQGJgSb#>`}dD^6p%xbrk&1rvP3H7y;&nY#H`Dt07D9w^z zcSjm)gbSW*qt8$kUl6^2lUaToWFv9lCxPqPBraL7h?%5asFuqG)3D&pUWIs38+p2Z zgX5Oy>2g>=bBi1KPxHl&1kc^O&M1kqb@UY+@7%&4&%O6@Xi)T$;Olp@mINCC-g!S> zoJwL1|C*^%VCL>_!4xk##3j|7a0X+}A-B5mRJ{s@) ziB~Q^YzA`+ezc;U{ijD=Q zw`A{;VdfkeW|op+CYl26sF-RsE5p^%yLH*GcHEl`GgrwlGj3Top97nQpwL5q`PubsunrIw`0W@nJa|)wZOHs{Y?FKUyO^ zZY{H>r|%pV5I^Py!3O8tiW#eE~}8&+Y)n#Dx4Bf_^=#PdX2I& zT&-O#i3yvA5;IF+dnpC*t%KWMl#u2{!k9lzkJf4AFOCS@^t`P{`@=#ubK4<8G1S0< z4u=O3zOXpfrlge0$r&pW4^@Ln>>&b_VHWSlkwVl{*kuOK{uNFqo znWg9czo}J5+VqCx18T@23@=}sq!Ev;Nb2GQEteN>`%^`(IZwQZMA3m>%gQE_=Nj+x z7jm9>4ofr+)@WGdh_sO2m@ZS}ji3u}m#XKD+U1B|zdqzOeO@%WX}s&M0L%iV*>Z>}A@1w5tl>n1!h;xrpFCn;^kPLwJ%-tQmQfede zA_%WKKLKCWnH7cdv4-Wds6fTiBk1c2z^pqjz~GXoYc`Q!mYpH6B;J!%dl)>T{2j_O z`2fSazz(XeDspZ88SEL4N~8Kr6c-K)W!(YQ zn)yVS97Mb~ulWfb`4Z##zGz|UU1u%gT_OV2`<~yj6^8y33Bj(tNeox%y(|reY7xM_ z`zlbj+aTrZcyLr8Jw!77wLxPc^xS-aoo&Viat*(Myf9GvHuM{pB~irH4Ft38%col7 zcvD>33F?mRPvEh=3SyxffLu`lx&AFAMJ|Eul_L=~JtTg@vw2^8kCIE*Sg7L9ARhaG zZzFEyUVqoitkjPtXkN$<1NmV=Vmt&#RR2+Wr5_>*ZfwMDKW)IbavI%hjeGWvK3)wX zqa0x(4nP`mvCCnl9;}{gfX-c@RS+LRT(yQGaq?q!N4~i4-37a|NhSeVg!KaUPz!6d3Z`i3Hk?2qW+ePFUWGS?tdm_`F|Ej z1_uYpFa7Tx|Mw~*w-oiI(wZ-Scl#-A6eO?mM30cYZ#}3ru%bJQ<|<> z14pL6^@R7WQNdQR<{Bx?ey=iR<6!lJh)4`Og|j^z#YPpCk}9pq;u}vMVNA;}K!?K_ zm;Bf0LjCI;aNJTw-@p>_8D@ z{W0gxyQ422_*pI>Rd|FdNwBW6@so^C`kL4FXI2YNXKVqV;c;ueZjSz{{ii&QX}>nq zn*Z|L{efAc(v9}PO#K-UP;!nN3Q#YJxK3Tg9n={76Ny_N0GldN4Eb|;bYf<89yHm? zJQDv=Wrh>)8JOiq50nI3T1l(sViQ~YU|1)U*W_>}tTL9tRR|V`kKX+wLgiBUg^e-k z(VuFrBxyMjM{QvSI#6zdHWO!JyW$TW@1`TN3(f+@aKv9!-2^i9)p?6-c8#tb zghE9Dypy<&OdF4hp?v#0BamJdF$<}XUTUuNHv1-6pj*M*?}Or5L4Ko1)lG5Vg>|Gs zAZ!b3FBj=yX}&8O{aPaJ)X&7S`F?bjYG>?`uJ*H1?Ic`1*XS+fp$!MSr%~>vpIdlF zbN{#Z{qA49@2lf~d*5Hg|MtE+*Hd*RJGbxKcy}*1j7zrf_xE`Aeq+$R+xKlPN$T3! z{@&N;n`;-7DW}f(@su6B7*7nC36(_bM&U7%#ypJaQm_+qEI5WE`KES+%*>u7+pM4O z5WG?+X{JCA)-95PZzozj$%cjfVrQyv}w~QgwYv1>KGLx7`s|!q`3zSjOp=p;>0P`Cm(s~)1rssVMFbbr3qiE{AH??s!7om<|fIEV@zh} zpgIZjwDnf5u#C`=h|$31kL`B8f#PDy9}?W*dzp}2-?w~H6rXu=GV97{h+o?(yVyQo zRbG0(hSV5l_l!!od{kOf6#U>#5>C-Jy{Jvu=T#(n5p!etkrT`Gcf&i%ljkK z<-Ph8PH=lPL0D8tdH#~U1oR$0=|Bs(wZXIf?We*gX9*Ut?ae4IitAElpVcQJ_Iez2 z*PF6aFS$J({*(VP-_p`8BrYK_UW=kI?^&cj$_QC=1h3Q!fybZ(@U^8k%FNj!E|@`* zEZK-@pv@sc=8JfULF;3?N+(h7?4srS<}tI&LB8We(3;+jJE6BF zEl-oc!PM+joaA66=4#}R4X2`~>R^|T*Z$f9=M#;vk_oTzmV?7AP|Rw~k(+qh#CC2+ zO}6ycE_yrXO|ypCoJ%j!^D*b3;hT*1FA}{m27x5Lp>OiX;bj18%{(Qf%M4Lt> z*q?1Jy&8+ke|#cinnV%mqVsExM@vwqYe!V%5@g9llJ34@Uudi*iVpCqyGg~*?4$N0 zefN7|G&U`_Rvu-Gy;pj(i0O-z%3;CV89XCLj;sgTkfZFUbzHUOm=u2##J@;+gWT~l5+IyJKZd$TIStcQHhlj^v{oCv8|A&Ds+_Ko-nIYqSKoT!a8u z*%~z41G~^`i$F$7nugRMaqLO0ux;Ibs*pPW#Nxi-dx)@c{(!!HmoaPA&6iUiLRz3? z7traKVRJL9dLPrX>R^ z`%H2I57Z1!{B(zZ`rvTU3 zNZ{C|dq~Nq5(L}IXcgud`dbf-O~TSYXNhRjCfwmS#I4S=sH96Y?XYn1zQw=&-d8#^#>l6XU)Ye;uncvrP~Tr zB0gS3=GwWG@4Gj;u7EPN*c(KRJfK`E6h3SN&~5!YmREm+=ssS0_AF%!rnLd0 z2?81{2%ngZ2(Ny~6Z;5reRx$a8*oxCu{M5^((yX*#?C%)(7n{zlCgW9+NWzMq#x<1 z$vaO?_Z{lr0HADbz*ioBZ;=8%SHAB7mF8lb)eiv8k1KOv*Jxo$31?U_#|InXh)QWX zm;TM*#qkE9=9PhyLlOIALT-C=QU3?1696I520$0Nexmn+p_4rFBX3J0e{&a-71Os* zW^_)??@y+Z?f*dN`Xhzn{$;BBpFrdoSrk_Nw?tu9R@T2g<@*0oz3F@$@^>H-YuUhr zCRfhiuJdw~XU^2LY1LW^z(0~J=lvW^8R}(r+EX86gC>vFxypmA+H0h^vO2=09=zhd zCxHwJjfuU8b8x!B&%_#+o*`ytVU-MLPRlGx*VWHs_b9GNw?^Eqtc{6yQf~wNPgHNn z^spHWKH2~yW>63Z3F&H*CH?{NX!wd26`y2mD;GFj!FU6JQwNBKQUW;11UhH!P;3T& zU3x1ExpGOOC41A1+-v`M(_sjEWd_{cJ{H+@hGH;*bq?Qex*n9L1} zFn8E-9>m<4GHP(3zYlOh7f!QZ>%^`bFDf{mPh#mBkWeRUCEVVD3pxidcSa(EInq0ZSvv>uyvy%DyC zd2DNgl%)#i=Dg)TVfZ?CSbx0pW^+aRboVp=E8kjTV6WEDGzZXm^(G^Wr1OB*6Tze~ zb2*=BkOUuP621%V!y3{m;$sosG`e^TeKcya5!JGpcOe=$S>SPu98j|ZeVvTVzfnIB zNsK5H6=4siRMaZJ|1&twN|&v{!b+loo-RTgsFTmQ)7%!sXJpo4y5&tHO_}6c`GX|` zl2>oWXNH(x!s%ZIkys#zgM5+?y^2|Ou8s=K6gU(mRDo%t19J>IX4q&?(JVgXXE$EMm_c< zLA~a>(B5N?fqLTpC-KGs7S8deAr2dK%X2YKbnBFIl4l!HRk!}Ue$k%uPRGjZ3$M;^ zp;VIBHd6Nto^4k@-M@UwbTP7FfRa~Ll2Xkj88}!8E|G*x^d#MXfr9FRdj2+>4`-b+ z(~S8pR(iC2nUzZFG@78Vp)c5c?LgTo_PQUi?J!EIkRN*DK>OWcwx30_^1W&oI+5K< zSkY(RS<6`y`&h!mDzBPxxt8f>aAKX~(1laA9e>R&*f_|L`+icW+P_nbQy!g>J z&CZ@W+i3Q|D$H{NCep zyVK9@uAR01^V0bhdzS=bI3BFhrWvK)m{V2G2OF4M`PG9$%fIwHy~qCG^xkIp+>-wG z0IA6vV`+d%*h7B!{i+QlYy#vS)ThT6XVBagbv-;VuaQ_QEoY1%Qj+km^`5ZC zt02!0zO~hW=pvmmd4HlEvr=ZXR3#C7>mD0&mUMWxXYo9e@_yK4XFaoaj0whi7$sCX z;oN9FN%f{Z6~u(~G)<=HZgESM@XO$`|6Q&yD57!hlir;CPT?ZQv$B_R9u+CxLvXGS zZYheh861JV6|&!IG~EuG)9{rJJucEf`lth-R~)k)>!x*!32+~4VwIu90h4{=tY9i$ z0p|>0GGyAPXJiw@#5?LlnqhrZM=_t?iI2~ja5mpiFGu|xN*d6+$gaYFm!Uv6biyI` zS7i1w?zRxaYqZMYvQsG+p|ooPmPBhr%tm8cRI$bg@ zQm}AK!t;!+7>-APcSIv*5vDO@NjLGkR9D`gV@ggAbIRpnSp3a2Thg$KK1TO37x*S} zW&1wrEzIKkN=73GZyl@P)0;;b1`;t1+7Sz>Y6l-PbJ{8a`guJ$cEUt*u8(70WVNg? zvv81ud@L-V*BOk80F<9R83m^-xj)46n&{4p47m>f(p(vrT$P)Q!Qfbl-g|{Moys-+2Gc_`Boo zpM3`@jiDcP-=D4g>_3@o4F5U){;#v2&w;>Pad6wgWlI9{$Pl5D7C2*;PGgu2nUUY#3OmMP$*bF7%@VU|b*SU7MF z^y4-lHmw#YoaRuF6!EIT8=pr8b@8sam&gM@W?7~^Fqg(n|-wWXj@xJjbMH2{AC)uHf=H);T@v^^J*SdNKf z0F2p=ww_ItnFe;;_N%SYs<(U-!Q?tg405GKt4jeY1au(L)r-UU2;w&K0 zTQ83UdFvbE;psG52&|73jM8!gc_~9BBL5G+n8>)X#ZskAUtt(&4|oC44w1)hu67*9;06`5Sg`ya9w<3jAIFG7plT<@MpoIB{SAe1}u*_^q$3 z=}Q*h*&kIT8T@pY<*$p9-`oRYT0=6XVtD?9o}Guw$677r`Pwa>9y8wS`|@o~5?|(T zdk*=-g`L0K1Dkv0FW$GneE(^Cb++W8FD0kR_^Cg zVEi+|%#c60I4X$R57u(0zEBM;l)3PKk@ntSO}%Zm?^+27kWc~%y+|(sG4zh1ccm9W zq<4_sL=C<7-g`%+cQAk;O+-L!h%`X~6+}@`zwA8Ev)?n`GsZb*pMB0>uzpx;toxdu zd(L^q8+#5E7Utgj^t!*;2hEX~;;RDjyQELUyvt@z+1Q9Qlo|O!x~1LXsnIl|%d5O< z^cO?8gXpg#K;PZW%ehY@nhAsrcZc5$4zlZY@Rg4fcI6z1b+Ei1ZulexqQfC$pgY^W zlTycUBUf0zM8&L0n_Ksn1HKj!V;fpmub1r!Xl(4a&^2NY#M(y{4jw#MWff`bBsl{g zHk~6{o5yKvJUgb~vEH3$qH~AJ3o16(yO$Q!eJ*;AZBst?u0@|*m*i7O zoy`EEX~aJg0S5fM`3+STyK0pLq!8{FsQ;iPB?;8uJy*RpX@L4g+;|HOv*Q54kuGIV|%ZIHI%e0mfU*}A3k`bvGuA#w`k`E4Nr`a=g|Gh_aU{`2D<@gHn$QOPkktbVvC14 z7=wp#MY0=rEbp|`eO*}$rFo-g60l(AWcVqq=+zJgXmlwhFPErskzZbA$7c>nAzaB= z@a3yKS0Hj5k~+Lv4(S0Z+72}C2Tt$)K`cJ{OrYcwb~JKgl}Ob_>@ zuwzZKMK_$WODFAefH5m+SYyt4(RMMednm^=S3&kHEER(CX8jmI!fRX)tC{h(-`~V# zM`RHc(rJSpPxDG*P*2hM z&E-!6#JkZ0ds(hc>EXL3Oik95CZNQJvJef%Y;!?L{4&R-@ZK_VJk~&7{zg<#)zu@N zHice)E{kL}rYd%45$R7)D~%eo7d|F{jq{TSqQ6qeZMC#7K&Z4hecx{Gw5$ft)Iz;m z-5j45AH<$IfKXKj4N4H-BCBn%UGDTeH;r_i-Ob$(Qy6j95(tE(*d*?a#(&CYdZhox zw>p}j*w)JQW9?d@Ni1LycVVFPv&c1K-M#uEh?e+^r)b(n*?an#qR|G*kW~Qc|JW?+F)kWtNP>jd8N-DJopEkHWqHW9&0!jI|(iRCI{h%q}Bw; zt9giAN@{fa^M4sOMN*8XU%ol*?SJ~fH+1gp`uS-ek-CkPv|rm|{n+$c&4}VU4ExQ8!^84n`sXmA(BbfNs zCJJsQH~Gap7HRt<4$&Gy_TfP+1%fV~JYxgmSxAU~sPz8ZHT*blWjh5kA&M`BICkK3 z?9BxZ2;E_8eUSAC2qktLLsyk0KE5*l3s%a%HTst=Fdc!yAg;8qvOionR|3KvQv^%z1h^L zsGsWvS0cWMH;OEJ`}N7L{Q2<^WFI^FhAo+@A`+&o*`xkxW1B_zs!l`uHd%4NFgI<- z_}e*FhSX3pTH+B>M=TokpSg0`#xUYf9YUD^A#^dG4;EnG)X-&z0;a-xOvb#>AWZ zF0M2vO(-MlgNLi}<>Y#&n@&g6_Oih-v2n_lya*4GL~I(ILdu8kwm(lGd4@m{f0jVG za0Wv-FU5VHQtUn6C{#S@X7n}&!(;DOV!M(vd+{jHU%w;7%@Fio_>T^Th!7=2=M+_d@p2o4_+0|Fo4tkp~1?oX38 ztjwQ~L@c6HEm@InzoM6vivbS{e{A;;D{}Ewwk&#+cpawlVfIbdkV%mUhkFK5LpwQx zO;1Ns!z;h%ZSt@RO~Ftv5-B$`Lnn<3c8nLm50$`+3q!w~dmHB6k%6QWD-*g5V>DQN zA;*wPUZ~(v)Mx2fZX{4h`8lidEydB!4z-+BW(=*Bh4IvL=#HEqTRi*c=kJvlGU{Q`Ivu+UP=dGixX6iCgh~utyafMh+0MI>D4Ed`A8f> zuE)3x1L{;1I*YgLY!)hSm3I_c*A)|1vw*^?Agzyd0fTfCptr!08x?~1dM_x-Vh{=x zx;B5RFAdrM)KD3Z-EXYT_uOx4tZ&|LZtdOQZ)u;x9<+9^k}|&iyUhn}!>9WP4~cM* z!}iCFUWXmi0xgG~^D;JAkWz!q2UxK1A{pskWn%$wjh;vVUdM}k>3=B(hz)!sL9oHY z-h(egM^hqShrh3SeI5C=+wyhv&nf9<6d)J%Yk(T1Gy~99RszKyjnWkm4&}m6Y|;>k z_16i-B=E$VNf;OMZ}kGeMWQnM_R7k0VEvRv>x50eiZaQqVy9%}7E*^QbOvyblIwYJ z#rN#3bz%AWmoDCa6zaV%`2|29DB>S{Ty$$Dq6TXCBF9~27Zd?nE-td!;jgxyQ$?#( zJ@rvg9R5`m+x4Ek;O%G+PJrxQ&+Fca$cuTJ%(cmN?FRxN(N!cR`W)D}3}A?XkzOp2 zYvu}Y*DIkTk~d*LR+|=BsDUlNOMkGhgkc7_+r2q<^~}T$80$RYOBZ{6{!94^-9xb4 z(QKWQC;`+`o05v2{!EQ4Eprp^(@j+UD793dy!+L&;Gn8euCNK}{l)Zi49~gD3p`*Y ze!qyV3>qjabb*RDrdUN=1G)WLKW7&1xk*|IP;e>1H`;-Jcpa7u%n56-wp2i98*bbu z{M*_PRAa9E(AzJ(=rNm_Tyqn6A{2{OJC5&;dB1qWP5XM!?eN0$s>c*X)4MmX-LqfD z2&pzb9x*fssipt0xB5h-@A9`h#rs=K$1kU0YMuE~PP{blS0Am%T?25R9P5t~g_X+} z&C*ZUxnLfH0s;F4HLcFCv2f(xhZQ-k-MabW5vSMZ`Pu{uykUaZ zVU^I?-lE7kDyita9(?dxuUH-*SNo<$L_HYj^>6@g9J(@m%I_Rvpfy$gTmHUt;~8L9 z{bQrmP6CRo1YcDVca+wP7|CG~m+0k2^T)UZ z{hm#_ZETG=tRud5G5Juil)H+ zmT_i-wm259;nJASCJmyqDYt2h`^1-K6udd9$P?h<%1gY(f3slMWM-1u+xxkwh|Eh* zhf3wVIisHE5RDe|=~$oo-f04Rj$VCfv1Ai*&CG~_)k0#ss92icCG{-ObbkJ#$CX*1XK(h_HtI7xY;!v5n&P{T_RoT@srv>RQ@CHR@HS0QxncTueqeak#2kq0 zJ`g2;k@uoik{V}qD@UOZj>6wb)VI1BxAE*KEh8Xi^4r5Ml=wAmRC1|Hk?{3|X*<(v zGh}`~azlM@hM#|Nde>rSawo*gsK`8s*#O{~cq!3#&-1PHL5KnQ+ja|{{4j*k*1h*l zSS{BeGguf?#);coedhFwnu$NC3pRKr%n9H?iveg6$jJ&mxV5zh>8Y4=UiTCk z@Ezh_Ox@B@IvZr8>@Vob4+j(f9-hSi^Hh1IroIJB5y+%bHClR(Hj~oRFuNFVzGJW> zFTf||(yb-wbbVvTwbJpLg^|gYv(eJe`{4y9hY6u0rV`f@)P;JnR6qUNI*r$*?u9!m zQGGNco~qT<1xHUx&k2yhm(ALLI-kh;jODAieZZ%5-8@6f(>#_bG6hCtRdK6w$Ih-* zXqLfkWvM{lFY0pDl9Dl9N}COr9lC*qCyIJfvbmB@<>s;4g=#Hb1~lz4Y0E79%koH+ zpFM+9bG2LN2P~N-cC}XamJ@b17#r~_ysSFXGe;$**Hh|5wcI3O{)I@fYvPk1V)ssz z2UbPWPRuH#lWNA}vVxuWrGXnYE)$UC5p%$NDycqER3jw0Iqa59Z}LUkN0Fvq$!!9* zk3J-K2&E(m#r};`ydFmXFf65C?y9kyJbAC$WjX?vRaIMB8Gi|W@^1EzH zm8sOH6n8U%G>e`n&Am!~EvIRe=lD?Dw3i}%lNqbq=qvHU$~`DuDL=iI$D@1I>6K8% zuW8|*g&BV+fZwk&0G7_2KQ#HWbgjICMN>W+~ zP+qew#3pGavMw9m?H9gWB&%E_y%L>WQEe^Xl^~Uqt0S+O_A&RO9FkWGiB5MzdOOFXJgJZZQc62FYH;nVd*@+mXpm@fJ`m=6ltIa5-zw)L*+I zC!YtkFmq4y*RiOo3l0gFuW*wcohb0;m6&!7ZJ%Pv!RUldC}kAg_RjGL;!P~&xg8Ru zh6s&c%!gUY#1;nuF?&}%T)giOD09UseS4hW=;&9i8|DAXpk<)&x2$@-6Am{OTCkjd zQ6v1W(MDs(kB+b8>TBDh3F&z$lTMGITz;V}GBnt^CF7(+*wIzp zF57gqq{)qLb1PNnRS6*z)6H>*BXa(_$WA8(%(7sQYDm5PTKih%0JA1e2>VR7O8RjK zhy4A6JxxK3Ds3!aBIQ-uUEvXqEh(_EalV$2kbkE)mO;8yuD0^ho3fj5g-*?TdKw00 z0p;?r;3el;_U78P*OffQ9x{^U#S(YJ_Xwv=<#tvcS6J`M$yLC+v^fO<@{I!Yen}p@ z^p!Ps;PkHhiNPd`!XxYYFg>WhcuSAFfQmd z;6G3lkQ4uuPfJBZt_W6?xSVgE7he@Zldl_iBNG@v&#wKyH&j<{uuwuoGZSz^)5-XvzS!udwn>9b9Zz z7PA2-`8w>GFlS(gv5UwtmxS6<4!6GOVgOj`*^JLJBduXua8N|rgH0x&bPJZn==vH{ z*Q_ImK?Bq?k~bt6&Wk3zP>|{da_>SNC*uH)kF<#vT{zKuypFS81P%Mgplr)ZsDU3O(rU3i>0l33E#M zIrd9iS;-|LsWyUDW&@OqgB@}3eft4jO&a>K*vochw9;13ga<~~XaYq0b>@dT(s<&*MyU>K@${2p1i?1*m&VomNL_FG1 z2hsN6H}!t@)*jA7Q9Z@1RJe$d7I!3bcbOWE*btp&s~rViu1az8tRHurG-OgD@9|*CkIBv;ZcQ z`7h)&Dt@ZCnkqgr*?Cx)Wn(JE+wrK<-|e^~tJNtYVy1X_CevNG{Lf4!`>ZmKyV6@t zfxzr-g1C6^Cp2vgqSaYfFuQ-#v1 zLSAqqF|LjLjCKI4W_heW?o^ zAX*yFFKRTO2?#z>g3gpeGI#{aHu#G(pY<6)emSsKma%2-$MEB*H9Ck_DGp3(Oy9W_A!4X{Z%(y3>{ z=L{g1RXHV4%aS*rN%%eEAuw8IqH5`2AP1-KQ^D24OTN@Esnh6LI_RY6pJr1Fp^sKm zKg;SqrAYOmR-r-}e4{0Am*c5i5F{|!l)X}Z_j;1Ro76!Od=pY|d?|5rWsyKWMFbF) z^mqPV>cbD>Kj#$X7uu|4zd5wK1GH8#k{TG@N=E`GOP_2F1t zqMBW$rqsHLZfa%V_CaGRTiy>-#6G9=8+&8uKu5FqvPqS^LwVWX=j{c175@OpM7Qyl zn6{WfcyC7s%4In!SLV#51xJ-+&73EVOHy;S43kS^ZQ|!}F$VPQkoW{Ab6$j}NHR8q#4&wQy#9fd z71Y8q`wY!TzE{!KBf)u67-#urJM_{Sw+Mv17w zjSbqHLv(b_{PxS&AIG@B_mhl-t5s{1s6{{d1G$e|qIo$r3R$E0##>Yb{IY}{3li;k z?tSjwS|m*3w?q{hk1DUFdI*;Okg9x9lUT~iAli?wdichjhn_6f=yO!uXp9y`9$BIv z6FKFsgAP|z&2m)xwU0N6q;u$*LU-~;^BlJoR3b@2=nmt!ZWk}TT)%xX%oZKs6`&ts zxu#VtaLujrXlE~JQscRbR#`4>1HQ1T{D^9BkSdOXnFjWli$7kMvACc8`FYPIHtg0t z1OFlCoPow?1F_+RAcjp%^Z}yLGnUMM$K1ipDxxruAit!+GfTF*sKN$1$4Yj9`VNmS)9M}Rv58A@?_-@b<OwNs@(!cS4<(7!l}SaVY4Y$Y33jfA zjD)F5LK%f>@y8M%=>HGJJUHyCrq3jHFT;U8(Cy}UY*)Er=hyE=dp~;Rf_0mVP++4NgevE3q2PAU;;^~wBJ$Vfc;K>in$W=078!dotBpimh`TXSSHcsBM4w1#D-9*d9Ai>|BYX7vbFfAZ<*j%TYq+f~gG-tog2 zH{M&HB?Jit8;ho9hh`T6zli263jwy@tM}xX2eF*=!7prf8dpCyl~B@{xpn2!IEAa> z()B2!w^{lATB&W%d@-eRuSDLJpJ6FB%)gq$`O|T)OKhJ%Q}qM`(W87aY5q0+it!KJ`TwOSVOoWU}GH#PW&g`R1Fy)_3k>fhT%kbE;R5 zIy1;c>_Ks6#m2K&$hagnSKr0nuTubCx8n$`-!5|8y-U{KM!al_lUVY#BvlgD<2pxv z7$&u%xdd-*UF|MAEUh7ZKem*yZK{OW`I6Efe0%yb-!9)r5XawsFPduX_);c;A)>Zj zhxCiC1ehWr+gkjCWNXG|>Sh&Co<8xU;%7lkYPI-;xW&dYgrk|4$ifYNa?|G>#lCmF z?A!!i_NzYd2*_h?I#;mD-t3I)X9c8n`C%@sryY+G0A-3Mp+)tyv+xI|iYxQ=!oF8m zIrW1PyvUo_&5rH~p39z=as4DWY)A_%-_z;0#ivaa2TYQshaPABX2G*}l%E0fxly+; zT>pkL(zlh+vSxI*GanP@5KwY}-8GSoxOh$F81&Fa2=1`ixgN9!;iFHXG5) zxJ8$F;VR;_6Rlew$}8R?@9FI^a(Nnz(JZ#VtiQ!{&d_ciQKq=n(M}pa6OP&}eF0x&~ z(y(yR@jTp4g#GiYwLuNpucmx57dtjRdQZu6kDrPlg`1My+*Fwif~;iBS?7|PAxd21 zj0_CQUfK#BX;*-&mp5lDbd=u9SLXIfRUG4PSZ+~rc{@LLYW4U$Qtu>0eV5w~+li=QLPDP&&J!|A5D&M#?PqA;IZ?!#;`(Z0! z=&pNV?VWjlbnQiEnEczk%P$`ziF}w8ZN7UZ&o--Bf25awcy^QSuG+#*m9)Fj_nSUQ z=ehD5FUp#s?rp5Ja3ZHj zD^yuE`lyood259JV9SHF&tl1+6R&KC`-aPWZ-vp zZg4MD?uiIJ4bkPmDfJ1aB_JsjKWFyKOy%A6cY1+4;SG!HUJ^~|=GkpVU}gDFq%D33 z20XjD(0-Ze)Z>1g=c5Abg;;~jS4Y{@o%>@Za!z^o5MkI&H}fC-SD=2<6!D@=?v^l| zJ^EEtAI~jL=IB~TG>=tug z4)I6J_TQL*$>~Vx8t1C4ZC$R?x}})%rtJ(r#>&9r zo=BRDzKRYrxh2~hXKNMb)E{5H6z45>%lB7&fLuba8USy1Xf%ncQ^O5sM^U<3N9bT9 z8?j-`SSfN57~ZLWE1`MI{<)=o>PK6z6Rc>cxbj3u8zj7E+|gAV%c`zh&lBfalh{@b zWc|WA$%u%>`T+<6qld|N{CVM3sIFU0 zr`)X%{?0K;)e@d$pM+(0BCE|}o~UaaN#Pk|v*@3sC9OzSPdjzGUj2m@v1%xG1n^ad@`so$(9`uKN8f+T=8qS@TF|O3MCpnGgbL<3b3K^8xU`LVb%C2p=2NR z`I)dX-TJ2CY8M*0dTkb3v3y##kG1(cuoqpXr`r)m!v0sGZYCHp&27gUuaoR_GbTfF zs(v|1Km*6Om9B?sYFlKP$=@58QWcc(gNEtAoQ(D5BC_~AQ=Ri%UZ&^o$vAFj^0-}&etk#N z5_^rZ*qB9&{!F_rHmj&6OEDx2vLjD&d+71u1FSVN1)S(Z4gLGFlRh~n3F^@^=adQg zmnRgTyQb(;;!|MaZPrrVy+%R;A<^jajF^%*k2?XGL>H@-gD;9AgE`sPTtjatvqXFVwN`H z)UDco66TM#yB99rU6i>g5j6Tldo$5{I0@?syMHDvDKKE!A7Ce|byK(})&Gk}d!uOBf1^`MD^Vd9>HDvxl|es836WAtsT8m7s7 z!jeTISbbO|Ko~FcO9GAt2fjR#03zhmq2P)X5OYJV6b9&_G#F8E%#k*l0DkNQF6b(` zH4AA^HiYf{u!$r)&tT)=QsWCJQuDew)E@l!&B+%HGB(wJ$^n?{Wh#<^Duw2M0F?>^ zFgQ!?9|*2OKspPs>ISw)Pbs~|W(Q%fe@({(B{+y z65#+2{0&7_bUrLwddR4uQ{Y|uq3Q0WsQ*{~l_ z^=$rqq!Q)Glh$~z_$%CPDZl$O53sbTmMr~SV9l8M?As>c< z&Cs^xt^O*cwY#4K{NOUh&|tYHz_{oyC^AIdHBeDa)!$-UfF!;1!I2W{V}h3}ciqH+ zwMW75{M+HlPT@tiktM|uc^vnOKICOSG(lXr0ia2bhTIkBUcJL$tOku*5_s7H*~9U_ zaiC}jp(rhex@AFXRiTfJAS+QQG(ngTAmiU)xcHO;StCF~jz=6M_#*-+^N;DDaU-tV z6HQHo1#pkD?FD}*LVvbE=>Jewp(q_p1v2rFU&gFpDI`S|!Z{{LugYW#fB{A{ijIim zBWiOl@R-Q>*AHaCgAd09x#$^XOEKP_G#_msQvTooQIMh{F$qgdHmN2>vF5(kOu zS#XLgZI5by_LpybHZ@iz|ajhp^yC{7-Gs`x18 zG~6s7VOqqW*@vAvd;>vBdo$C`h-4vqkK9E37}0*0qVMe@iW+W1^PXMoPFz;>j z&Tx_4KN_{Mg^U|Oek?vYYNz5=da{H>Q2T*tT+9_4j3H4pb9iP^an|6Cx$BYBNQ3!% z(QLjTIJY+6+%7bs#Ek$zS>qZ0jmN*(CWVPl+d=Z(W3s=5XGbXNYHrF%JlV|VrJl6~ zpXj;c!&z{6K_m*SYvnMYWA-b3N?=Dttz9C!39&c9&=|uGS{CP1SvBc~_mxH&i6acg z&kItY3spXM8=Jd80t*gw;2eR8lbg((i=oDNRwQf5YmL0cTUOIxoZkQ<$gwQ>mjSN| za)A^2pV1$PybgaKG4s&qd4smN6{OEfNX!cD1B6t-D!TL;QyJ96XYxqlIqf3fATZGq zNv&u??&wY9;>}{#IuSn(Bu0&r`^{5ltzHAUq=|F)<|&QRAT1nF7iA25c%=37h&*bv zVR4jd9+E}iFT+Fc9t!R0zfmDlYqmaJ?6sgvJ%XZ=nUjfz?Sbk~{!53Y^__Yc;;{yR?=du3VGRRR+Ki6 z#!BieZ1+c|Z)Xp0JdSF7Q;>gOguru~-;?j2n0KsSPQ=#D$Ogw0F z`YQ5vrK?B=9-4Mu`h3cjWew`*sqwrBMji|`^10gg$A?0+^nd8fX8L@)<)_{c3iApC5(bFAoh-Lqjq(|mWX(nK<>R10lTRH(TCcG7`YOLLR(`sB> zC<#8QQJEuEZJLC1T%QbNi|D*KL!nXJq^#Q zSI1#)Jj`MIJXMyBZY!Lzv-&)0@v8Ssmp3qTHOOIKi>`#+C1dRH0f*_aTkZD+U zbHlYO(F=Tb@A1fzbUpNg6#YjL_W7FcL@`If-y;V@<$>{(OV>w-&rUurx7>O*I`aGH z(e_-$^+%(BfB!l;c>nCtqYF|Klh6i%jM04~ib9}q<06_$=Ho^TN=s-n7GvSQ8OQ9} zxEaqL@^LePD_&?TkuTqUD@mxnaVuH0_v2OyZi;q68)=#9eYDhc2wn_|-&#x(W1FB;nnS}ZRNPA-?_2O%x#!Zfuj}U;uUN{TD zy=hGEQk(tsfV$Pwu5zK2iP+W?vQNAK6=iTOP=)g52VsW8WJJkXG2uf<{$UcnR-4`n z4;eo_cMgk--vjFXXo!LU!d|gCTZ4>9DoP|;<6Al)8~l;Y^i+q!o6=tU&5#N~B5_NT zvSaj}f=xN(*8W*@9=@~LDfjQ-jK|~MUe*SHw$$=wKCLK=osXi*hB%~3q8$r4xxpgY z|H^Jyu%kDid8cJ1THggwSNHL1+g2$$fItpa37u4rZHdFwBJ7=aV1P{{=VsMAzsY9{ zBI^J`qxedLTB+rJ7pmQQpJbsCzk;`bg2?5^-f#lm#r^>rGZLH z5zhdPMNTYi+6O$(Qhv8w`)jQopw!ujG$6+xuRMrI^QOhP)T^D&qto}IK3;mUqg3@H zN#8<&g`=+f`qhq$1jF!7(}!fu4OkD|QkYAg?$_>Vk;~o6;pep)4{Jvh5r_QLiS#Jl zxLDV$7GwQli(0c^gkWkt({__RLzqil1Vf9~5Y*`h-;?HkheOL>d<1r;h_)b?nWSZO zF5VQYEahT+pEA+Lcp`?(Fe^wY>un{mwOO3k;+l(o=^F?J*R97tdtJqrJzGgm{!ZFw zW0N=bMqnaeXP*q3N&H0?G76~+33I`{+STb-m+{5_6LrDT!D-#ezA z-SA8wRh?(9igQCdAA|#kTG&nysIC{$7KZBT96OEYijT8rt!OHrrxOkc$uy3q1g6q4`(PWl}dIu}(RNIiW)5!_{8u!wj1uX5&S@2MX*KzXgktPzLK zGlJ#u9KbbHj5U1kt)sH8PsE2apILVDPE<9u=jmg+7b|Sd@WMi?5e_Tw4|9$kuX~k3 zoou>8*mi&VQyLr8y=3{!FHjH5yJ7szUoL8RrPMVwZrBCC_R*yYm!9Q=ht4j<7pnvYL?7dE{6y5EN*FkFIPi;G*q`5`@~h-TL8+Qa z*T)9q9bzxWGwt?h~l3@&rb2X_q>e7P4Ywte~bjisUWhr_a?=1pJk z#&o{_M~t2b^{t6Q|Jhh)2jt)H9{h42D%&y(i-0d4rB@4<{}9HjpPl%fqlmz7DYx+1 z8|7q&CzGFBZ{0hW=giJ|vSVWM%wT3B;9RJ3`^WLg9iwZU5H9dGav*zdd0W%tor04~ zw-xurC%K^Sm=UEB^WOFXA5MQeDJTBmj6&zZ;BS0?U9kp)4jInLozrG7yz;Xqvv;yL z{P&IIlrySf=2H7fEan+C&8<_u9n;328eTpv*ZW8hFL+ zTOk=*NVC~DXijYybnk}cOV93h7@2U$x|{9K!0T6z=KeU>nBW_Z1A)7{gWIwNd>Sh z@*=swP;n`^Jy=+&#*70GHq$ep8OL%YJ4yy7lb^YgmyQs?=%@dQJM+baur@uZ3q1`M z&PA?!b<+XNenG{^l(}amKxULp1_ZKv;$ri_nr&zKexrH8n8j<&Nsh`EZpu1+m8~jm zzU2?nb7g-G%fZlt-*rfJ63GhI_81(bT(k@iE^KJ~}*}l%R zJIk|Y$#;~`cec)V4bOKk%J&?|_kNx4dzSBacImx%L6CKUJRl*v2wlx$tF>p7 z($6ejktQ%sI1~sF*@P+!6;NP_J#;7&;^YtQJ7Sbn1>ZVAvXd(Xo zVEFxjkwvIRCCN-dD*7V3Hv_R7hhzy;7s(gN7!_d&98pK)_pI3lIv~9cj9(Uuf`yTM zC^Xy%e7ec(NFYbpmj*i^6DY|lD9OvjVIoE))OZ$NLWy)`NqQk=)+VyRA5js-wp+qcQb^qw&m)M=**gaCHo*^8gR<2<3KW1N+j8pqbJ;9yH3wg~CR9}9t)5|o<3Pw@>DgJ;+*u({1WM$b z16^6|#|?2et{4xmq3~x)p#!5Csp&i+Xja-hRLN%)EpvM~I35U4aH-zaSS^TOlgt3K!h(`X!vS_`cxbw2pOfZs|kvoQd(@q(=*a$yr zjx=go%&H*UM9W1KdL$P{9$~sOQRpLD1OaT{q)ptYq98PnCD*hJHn`b5u5)e(#(iDpB1dIEfJN-J8|f_8l*iDF(q#L4aDj5)%KZiI_yu zdkok|6z_UMejjyCRXr?KKnol+S>qTiD}h*fjssYOg@clUBHBN^Tc@O3Z>ZaV1k-+Z z8?p76DE1h#{YP{EyU0p`q`7N>jQ_Lyg@=bnL_`FK!zn5%s;Q~z>FNFV3}0YiAj$pm z-!=DtH^BVA$nbd|jQWXo8FbCh&vX8l=1%{Q=ANY);Nev(x|u3$m-LO-)6HPc?DH=%J{}y;pA^T) zXiiIn-*8M)3l#sv~R>qxwgIN zHlM(_p~!}tE&C1FJ8fo*9R3ckh!K&)o+6>wHK1NuU?`)1%VQUT>$0qgM=sH}+9N#F z>$MNMzs4v_Fe&$zbb-|jxF$yig-Q1}*O4&tUi>TLN6UNCXp8-_IOGk(JOQ36R(3-; zXQ@xC{d3CSPtynG@QpCqOE{g(azaZMNd)uixNcmaDfaOsjAizXh;uM2w7(Nm_jBBf z^@i0Z=k>!El?jsUKote$_b1Vi)U0U;fSVH9PL*19-%gX;ZQM>*I{mnvfrkt4WNI*a z>}2T(H0@*?$b8z#G13zLkZWe);R3M|KoRn6LxlN3dkHQ=fph-M4#cUrX}8$B_tS2P z-<0rPY0#?2URl^~(_VSxsXQ?skH8T#!Ng403Vl*0E>&%#5D%)dW&&09c&rNuUl}0O z;ouuUCSkq5u2zB+5PQQV_=#GKR5qoheMiUU4RBL>D45N{ECvJ5EfaZJ=A~xXS zkwl1e_YeTijf*(fh)3KINn3&7h)|n#8{V#yYo74bc>w>Q8dyVYk5dKi;|Ee`hF$Ig zk+VcV;};SDQy77V-N5vI%@~;|fEUBb5FU-;wxNXEaSMsWg9( zM-NlZONG-^8MgwranA`&y*1%}^a>x3y!}Rx?N3{#EZZpW zv)~I`&o#d&fYVq$@Xpcy^}x)N$4FE1B6}- zMVg|acL=>}=v_mVA`(LHy-1TTozSZqdKEzdX(9*;f(1KPcAo#UX3g6BefL_kcRpp3 zd#<^Xxs$oh^E{5@*QY3WK2l*d^YmTVj*{R4b`Wzd{YJG2q9L#|aUB*9nPyz*+;120 zZGJqQVoVg4)!3k{m#NBr>Sk~&k?OU1TynBbLvzu4*YCUoWED_Iucq>|4*M3tksAeB z74nxO@&ilE07DL;BnI*|?4d?RL;@Bh2sc0)EuH%9U2Ip&G6IqB7Q(WI5D{d37FZ=r z=y;g*lUJOeLM1#PZiIPV?>e1hWvRWM25)wg&qi?t@}1UbYU&6)UgIN{Sa$Qq&SW?0(BYQZ*DSTc>+juFHw2j+Y=ut08cU_Q)L3xcFPczm zX;0_6C3J>Gcv59O!1`DykA=lb3=+KH6is7J^Da~fyk}2!M+(S(ljU4m zSHt61Vp$3XeCfPgqvyXN5@bnd`3yN4rN_zEpo{q#swzUs(+B=qGo@*B94!N1Ke(2! z8$tl>wioS;^m6jF&!8McfB*A&uzFA%g+uy5lu2QwL2Xw=&)9M8ENJs{9ynrr##N;= z^r8d>!W%whT<&LNkZTJZ(g8F^Gi7gBOCVDsLc_9YkzyA30UAODNFmVfZJg(LmMB^K zju(OV)`sfh8>2JsGM<;$g$rKN)&E^iih@=bw^l%_E0$034y$Q4bnn*MKmKTRkaNKT zw=uw3gO=)$i+t(=oaD>~nUZ4((F{CK+x46bug%!{G#Y|fTFN`uiroXIT~GCu<&>IF z#Vq<(1~j0)U;-wDS3P!x+$79?Pr2GNL+;+7KxJCUH-*D7zl8?k1Ges5LTJh|9>?r7#(%tQ^2)MV`N^C6au&1H%M00kV;-uqDK?IJ5UnQzMRALF z%PpORSn_oizb>LGMTH0#rSpbKnvGwb>Jk!vz&Eki$o2jx!Ux}+g} zki**ja~@7Mvl$sHI&V@})^m`ms?U^aCV5X^l%M@-{KzBc25os^q-);Z_Vn9S+B*B+ zBGT2C>mkh;lIO=(#X3{Ok5O``_wFVC;ofBX$Co1NZ@YexuY_C84OMSe^{z=iYVh}L zw8v~kcwgv-n=CaOh_Fqfn+)K;>Z~quHu!3}8D3M>d9W3d)Aq+Z!`vwMf?Rh;qQv=5 z6^9Ay0<#nsow+{ajL70!8~we~lvf4$8!nH&Fc8oN_8TFVaj85H-Dd{4Q`duggU&o~ zJo|y$${dIbIg=`)IAD6OII`+;T?YF_5ANp%^w}Ao$wfD>T2WZ>5-A;qw zwyDzv4(0Qi6YuZ?!_US$Fyva8!V~a?F|!X(t$GDmWfy$lm%({2OkRnieq$s6j*RwO zEB+c_7wP+lb?1naY}-HAY?L`EHmARiT~y?5f3#3CrJ}{YiyThgKH8T*rUSSDaoX*O zN%Jse&ZrA}jKFp@AQlPsy7Ko6ZAS0Shl%n~FA;ViaMaU=XEd}-5a4E(=RT2RXO3td ziDJu*1rcZgEXZvX5a_#zkt1HS^uq*#-iqE96LVC<$gdE>C(Xk-Fk)k3x%Bsl@LNd zWreT@OE2ptT{jn_Bi>G0O~RRj-1d_k0|8^PWZx0Cf>jYNTL~WW^*h|cAR>KsJSg7v zw%th5T`#o7u_=OE`&6O400mVvlBoBS%LctP&SN!d?g#znZ!}S@oxA`Atn1}0DnD-8%<>9#zEi3z$F(L z7;yY90+9E8e0MS6HnZ&Cs7yCdvTy~PT^6WF0D;7^T>Xgf$YRmpIaiAh7sh~I%CZPz zK=uKVrzOLz$I4((C66>JSHT;2djeKUhUqf%WC`%S#>UZYOY>G{0`xpgI5<%tvp0s5 zX#uhbqO<17f4ReF62Q(02(S?C-;?vL?4X%MV_A9x_i@oVeO_2HTU-|G$c9~u%s#pR za07Ju>U0-&*v4@1^NaZ|^iVHMp$IDf_B8WZ7l7To2u>(!1O(CeVrnso$Ohx>vJ~y^ zkjb1{6>N9I!BOEQJOEeK8=&@>xve4(PRU!V%qHlgT0xxt%q0op1+9z8X5#6b4dDAf zGIAT3C~F-2*`PIXkTVZo)1A`0W{j`QK;N<1J3Qw~i2PRcg>W1%d7QnI;* z+zKx-qd>&hil9#fUEhG+lQ~-hq6dEf`2k=9OQ=xIUC# zBV+wIQ>Ow!`dIO_56pxDCGk{CqN2WdS3`5s*XpaqD}b*%)v^Qtu~03E5n|4&F=$LP zuc|SeslmOh(TCTXNz__4qFEOr&EX)MnQNUeA&2!^W7ayC0koTaomN$eY+xO=$7MHA zXT4shH&Pd9fDX35rxAEBY(Plh-^3T>KVFH;035^!F#M-lgu~&itgO7eydokZ^78Un zEY`@#hzd<}c6Rpn_a_ht)Cw^!E-pPiomw8&)YP=KwRLuOQvDI*UOvP$9ActH+FXRe@SmrQc~0%Q;S|RXawtI9@TORBN#*;mlfKGu`sc64{5{M!JXqGk5b3bNooW?uZCJD~lC782RS!yJ`&4F)r5CUaO+VBrYD!kR)AX>uhHQ z(7X_j{G4G)y_=9U7JwoUa~XCH10Q82k+^BUsSxP!Bw{*1cyuBr2#(1XjS?heSkTq&aWVsW>!MW11(L0Z81vHUjn5#Iqw?3Y zw%Y*QlCUK)l?0*ivRM+;RhPmQ4AstF#iqb)q>lNaY%~?v7*R0_QJP)~I&6R0>6;aO zNqQC~c~45`1w9>p+u`<|vd(c!K}Rc)N!f`mn3QLSyCw?HzybuudD5`5MaQ0&{`pJZ zI+sgfWPnCLZk4M@;yC|xkbW=;tKejh1a`5-a$XmSBQ2r&rb*=E~9$gFs59kHkPSil=Vni(V143OXM?PUPW}fNSmwE>-E{%{e)Pm>7lVxZIt5(h(fjLxflp>A9%d z4p#=Y+^f)-e}x=n{`XQn@1mJl$*e5tq5=3DX!>fFL92oFR?c!BPEyn0Ps8GONLUu6j4ij2^THX3z~|FP>dJx|P#FeO z6h*Z2xsH&_6qY`4*pT*yY}4E??z}MxHV!;zZ6$HXoJIHUJb>+PTyC=M^m#th-Sn&t zKbmsZu%~&g)9Y!Y(`--6MlWG^rp&On_4#1f=fmf-y=^ZZ5+MkFqdxM^XcC*`Wojy} z%OHrX(;5K`uLHT0aB_-W$Fq4Gc?h$bDuo1v0PJ`|F~|zaa0a6XSQBF#85PeHjrpiy z@YOebwL>FF92PLJdJ$-5P{bj)HHWSBJl`3!siFYg}?pqewo4Y8RPF; zz>ckdYI*b3AF)&Wof70r#S$HJNOopNw_Nq_L?1XV|JrG|3kR+Y3>F~(R;)jvn~|f! zUdsTS@_HR;1uZ04_d9*fv|_?e5+MyL+=5oLUVW%&mscW=@q#8{<^DWZ$EyMv#JFB2 z+2woXgYKJ!Y$q_daoVN9!E}^l>#`LNFoRz2RR|>=R&M>tii4743)goJwSA|{5v31i z-Y#xzxykE~v+on};~n5Z+kmyQib+Fe7qBVxlthkzmmu<}pE@b5&ib+T{4X?WCmh;T4)TyS^Zql(t#3ob)h0tJT+U!C+!H1)0?h6jn2iB4}m*7zOqC1dalD>NPexqFi6qJ&bnZagFoXi$v5Y@wVT+L7?8gkzMsj4u}hpcqfWU| z-6UyBiQ(+k_=tP$#f;~AN=~JA<|3^0v2_(;`35S$RWbd=^#rl>bID#88(Ddd3PcCa zv!tu-eSFDM+oveDOqXT(aVPNV=!C*rR+4=uLIQrEClV}Fg!ES8zh8?XEUw6@jOX5=spF~wY1n_0pHW)Cpn_tO% zo5C*ZHqEb?;j_FbjPkGGu&~z+f%~LH_bf?hzi$Ag52b9%By#ARh^sZuq%l2LEb*Fw zDLZzVTfgk@j_GPlyKl$vcdJI{ATC#;PV&W>Y}v^`gWX#`mlz0N=JzWFJQ?gd7vhTHQ{!B{tvGTVMX!&6WH`0zH05-_$-o?}3OGm|SSY(5F#Y?q^Ih zB@QC4nw2Dck)R_x8>b|^920VY6+%yqS!}@}wQeyYMS!14D*!3R z0AgRs`bH;*32-+GBLWpit59XbvLwL5o~5ZK#Y{KE4{+}iV?C%@4@fC>5En4P9e0eV zuth1!>-M*9_2d?qf^0Ty%voTnXq-lh zls0#Do0$xw017eyo8$4fu94N2fVPU&1hHqpoEqe6uQO3g3?j^q(ho4U0VP%R4zlt< zv0t{+EwXO55%Q(Qld_1&lUOjBIp%UfB<$kb-d?ukDJ7GOjs}>@7C!N|i}NL0w0I)e z?W-TJJ~8TG__4sKsX&t*gk@*MW0)p3KZdGZSY^ea z7+ut`G}ucv9LWA@Ia@5T61gYNB~0@lNZ)^?qvC)t5C{T53Dgq<2nK@FfRM<4;Lhyq zz`uNFumCMsmJT8d1F6wVBj~01!DuufB?ZVU0GBTVLPA3SbKnK&BcSF?P%~z_01j9X z#}zD~!OUpR&Y~erW2Ovo<>v4^%WG%|m|Flgc7UBd;GzZbGlV%i1Acx$a0n223!sk7 z{@ViyORWf7rzH1%S=6KoYDz_P9xFDdF20~qB#tihh8KCmpJ`lN)x5Z`ul^CI_uIkz z^qTFdvmNyqlaK&VSw1;AKuHNuSq(HbQK2lr{RhBGG3ROt=j(esuj_d}lKFoPik#k; zp`rz6=YYjUU}F<_u??IK%bbp4c3uLn4}iDtfG=Nxzkh+4n3(@s-%uxaqobq$`?~D^ z_%7Wk5dfGBoSYMrl2cOC(y3C|?3~=Z{DQ)wJH;iXW#xA>oD7&qfS8jIZEaKYe+wP# zq!o4&i*;%onVowy|9D~X$~Qj`~}0$=wY3Z>4T$C(*0ikEY=$74=6fjy?RzN7r-Mm%J3tzRMBJ; ze@fF-YhYe#rVS6;w61g~SenIzM!OHZJp~8!O2xcM?({j5!%@0M(lFQ&<;qnx{fm*` z)o6>OzOx3aKxA42}>Xv`b&FFk5O%U!%jE50$9c+FQoN4 zFnpgT(L_#nC6>ZTwk$Cye9=mU#t%C>PAb;m-gDyfD6Vo+V1BQF6tgmmIva^w$vK`6 zU%!(=`>J<6eDTk4lkN_(?7_XfUxYfI5d>j76l^MsA zP~?(&;hU|Su65{Iesle?wz!;zes#JRW8OL7YP$%hoh90O!@k||c*X7FCf=qrZbd;9 zxEMv7hwET==j1Sz5;n9j)xKa=Sri&91_)-mu^LFU?>&*iOy^aTZsQ=>J1&NQ}8 z97;5ItQ3p4^t?_HX&v}BAkg*zdc;Q_;heQ8m=I|~x6ddxNp#HXMDlh%u}(eLwc_C` z*0Ua(%F?}+Fv!&RvcQmuikBH=960QeWE^}yvB5C(Y2_lr{co?2kPm)-<3m3D3!S5m z>bPzphWEL#AX?~A$_EgJ`~*C@DJBIu1u<--d_b@@YY>qgc&SuSGhQlCToe%)FfDwq z^kd2wUS^1-lqE0=k{x1>r2+JqWq~sgtopnx=2GxHM(dLL6U-2KW`=}pk)H<8e@KYh zE>yzo`48G3#`rbg86fEZJTL{27c^+4VS*hXdDtV;958nYw2ldG{D_X0w#w7jk_Sy^?f# z+XFOtLho6IE_4cpN_zHcV3D%8Kj86fUlZ*9-NgBk0|09bT4^Ev?UZVtoo5+LZR@!7 z#ob0`>I3naQxA;;!u0p)bJCs@9C@jPp?muJq%;hXZJ5b3$bmYq_n~9^x5iVzk}|Ze zkvojAXC8th+kEc2+8@vefOxWuy|g-c-d;sPO6WCw9dqv*uZCP)SSA5HT6Qp6Sx|F2 zvwL$zG4ydP**}jE&%0ZIg;DiH^9Biub30P@+-aO{nQ=QfZd#KAI2W^7;!fD=XBoYA zr!!>s_rDTG_`?toDdyz2tE-0+i9J_|%qi=LJMSH{J9w?<-7zOSJkxz}c^6qB z)@Fn5bK8OPVtlJ{D?MCqO`#FFynmmBs&M}{CSDxGBTsHVIQRaBk6BR6@|JC8+lA~@ z-LY|GnDrF^+kAS-J+cb zTq}=&pj+xc-SF*C??1kM(^dUjX#Z^E9~}5sD(JJ(4>)A#dVWu-&6yyxN%Kt^?)#-4 zh(qqKJ@K^g;4Zv45(mP5YxDo$SA&|@kz@L_$Z0rNr`{8udYDft4n+%mz6`x!_WHe_ zAe)`i=&G{c-&U&PfM%X%hqUm>{OU`rZR{*sITuJm*O6b8{p_v$S&^1c0B%R!s>`f&o_sx52b}b5X8#(~dmn z)IqURdM>ZWyZKDb-!{b~&n5P^z3z^^>>L|=csAvbvT;QTcF3|@VV37{z_y0ai3 zC(Que@b%5#o^IK7YhV4?{B4^zcmVT-(kGTWALpWgI?%a;Q?HW z$7N~N245Xz6!fz@xfxE*Y29e-Y(QI9T;dzld)#8vtA}u^c&?~IZByTCS{0XvD=iOC zaB=Q@U3J!0T*Q?SIAvnxu9^Dp+xm6$+}b*KKF=t%Hhy)ve>+Iu_j#(rETpJk8QWlZ z`g+37wsUQ4BEG%)d9(M2swT>+i&EpEqN&B8z*tLsY-i{-hx%nM*=kzx10-p?mo zjO-AFP9P;zr(PN7biVm@lp3RBpY(dpo1Hj}%&}I?nc04oS6wBUq%tHnps~dMqIcZg z+0p1zhwEngs~@V0&+mz|mmeHSw)j7I53$_Nk-MS2=ZK2QR{F3L+%_P=-Ceyr^gt76}_S@XBk z&oLZn12io&h;v`BM9M$MU%kikx%Fc6QPh4LbK8qjSxCjRU=BOQpT9`6q?ibc_~K4K z-Miw@5>68@1iR)JvAaRG3pXA_a869v@P?VbZtkqQ=k*l&hLn5yG}ztZ{Zm7MKAxhC zm=@hNK{bhA_a0Gxthe5OCwnER%>L>wOf-jxj*1`MGWH& z1icjB-@qpaBi|mM{{2O@#BdYA%0wDlA~cK$DUHdRHVMN`jX#Ku8-`s>#8&F_h!Y|Lnzn+P9tI?KI(ZSqA>k}e7 zIq|A(QbJe~Ei9oEPjp{M@Y98GB#YKuqinmWnS}jVCuTScrB;`$ky|D=%dZ(aV+vL!EXsB@9@BQQo zJ0XGg0`)KwWq*d z$HB6c%$2D`w=gKe0;)2a$@UrShD(nPOaH9|amD4h;xgBZawNiuo7{-BsTeOTDLW~v z+bfyTjdOMXGB?j>%=t{1pP#y6yge-+5(vEV{kXPFIEU3qEo?3s(uV-LxacCPi z#N=vThOdm=l8PPy1_QcKZuhqd$kLg#G(0hkTraV9Q0w=kD32%F<^e zAP|-54DIS%i#u5jV+p=*qVL(}Df2+Or?QR@PIYyrqhC!$8*yiAYG(iOEFkLV7JJ9K z5L2ab1%mX%_%{VL{W*jm@U4Rk{k6I#)J2~^a*`aqmT2k?El5gfoJs+Q6=kYG9PCO5rc!{T+SLne56u)36}Ghu3BfHc0H+P#e(R&TXj3Q+V9PkKT0O>1F*?qob62Q z^_haJDbZgAqXT&*sbjeo>R7H=B4XfPZudY__d*-ZR=%iWFadGAQhhH&QzfLM ze%23;MCI7~=h-(*vo;jLUyXUNHo@u{-f2Cm4+6~ z_4EnC8dt(E_v_*}n;v0p9>mx!qTGT{5L+t@gu0-4oXKRqwaZdu>Nvc`>h=>}ofPfc zC@2!JL0rgdNwp$?lzh7kPJJ^VzVm1uLAREmLfcr?mi(aRE|i@@XULJ3c|@-L;%d=KxiJOx&5g)iStwJffGR#aJw4LurjM90f6x>=0x>uPj{ zwQ6;=!L+5YHzJoJ|A<`s^I3N;NXeV0>Cr;aIZds_Lnq~pj^A(ve^&#RW&67dx=ZY2 zM6W_Q`xTK0C+{!8W~pwP35u~}z8wn|D;&Wgqw;F;?anqWWThUfUvL?W>V~l5>)ake zi=MQVw)d}Y+=D8$ZJ%DrXS?yC+JpeH1}ra>yGO|Mz}+R=4f?FF2)RXsv_uPs+2~l9 z3?hrahiF^2xrJVP{#028uPVH+?#qUq&@zi)3r|0a%(hg*j+$`bLbBxD=AK$!=R@!> z*>}#GD_Zm>4Tgt`>Ze-vseM=QPzW_*>seG#-JNijD7205y4|yJb&jsTKRA>_tKYmg z;w8ehdEsJE%|)-L`e$A}@Y0NI6KvX@z1fNBZaRXuY$&pf-;}iQJPI9r&lcVis^)(W z^RUG9f!5GN5yV*DRZfLLHQ{#sLvMtVnX2`58xJ+t@nGdx*}<;+k7g|?x#}RPpyyv6 z93Ud3eS<8uw2hQb4f8^}s)AY`E_r-Af}0c!cTpa8+sjD`83gj_NaM_I8v1h9$ssoI zZocvesY^#fLmRo5adq+?$94jIs>w8p-U%07Vh3GThHoA9n#o(gu2%aNe6`xG?`7kI z?OgRVgvXVok#_n1InRDJLo>zdeyub|FjOH?{vld^;KR*_VF{5bKdI5UIv#J~J;DZ3 z;~fjnv`953gBA+lNc#siCEtTMOTI6n7 zSnF71f4BhB<)yIMg88F=jE2OXeEy%r0k8YdD11W zm03BLiM#q+xu0#ky1RI4-7FN<_!|o}6eC(^5D3V#E|ivo-@*XCu^soUi(>t1jrsc=)oTH`XglE{fS;obN{v>+i}EwysV?EV*wPYGpqb5LY~(i zvCW4lic)7QjO?M@nEm;zD{JV{XP?)Owtfm>;G3<1p&PVsH-5jBbrf>bL0Gyk!C#=S zewEr>Ns+B)*!0L-Z}bR?qPzL-D6Ai7d(&kjI!9hCxs;>X2(FRuqn(`|C9!4&UUE|W z%n3PEfM{-9G>+B#{#EvN-gV|~)stQPjN|3~S?wIRP-7vRN!~E5p{(qNBHE!{tl;6f zJZ~+-{&yWsmZWHMpLaP;YrPiKkcz%0;B`VD6z2ejaZ zdFdkOy012#x3xUNsBOZX zp4r+yhrjt2QTguGz2?F0*g>M}1I{nQN%!RPt<4qpRYET;xb0mA73`ru>n}>UdGJ51 z&Q*0-@@b`=4DdMk@L3lhahT{IH$yM$eGqyY*0#Eu6CPluX98J~zw# z>-?q{nfK~d|DOTQFCig+_U9FjvbI#De;F&%9TrAjra2C_{&Il)aw(^^NAlLBX~vr? zb*H{NzORmcVJqhQu$`*CkheC8vYkzbK76LV58kz1ZEoN4ve7vjdJpg0S|4nEx%$&B zHww`&3NdqgYrdy{%ATClamH!<(=G{Qh@m%7iZ4Oy=I;C~~jfR3jMH!cs zj92XO6P*Z;CW|nd=Jn&fEvC?ZZ^PFoj31t*;HDUy{AMx!{7R-#8VIW}*Uk^yLuP5e z5!vsIAyfnR-8TA&c6xK;2R%anH%%`hmo`svK&X=cQ?I-zf>Mzj1ON+-tZx5qG^K^L;F zp3ca;5A?mIR1oz%HNANRHBZ4m4}Y$m`gH#7v*kjjP16s4%0{iypXVzT=id)8sK-Bc z`ooga!l?OFE7XvI{Y&87@1Hl0u7qzbaRmS#ajRRDUu^_H4jS$4B<7iJ({z3r#qjjJ z#c!SQ<^Hpi%4NS*{Sgwz+JZ+4h|8;*(totyEy?|nS5ONsQZW3=AvG6mq4Vge#Qsxg ziGosSee38_oZ_ykx!g1yng(r@7z;*S}HA*U7AF~u#spI{%<{7m*NtaqVl^H zl~vU>wS~^kg{-pYW#ePpNKj0dY+Y|(e_v_Iz=MaB;gO8`^3+_K$g*>-VP8tE}$S~_vDWA`8gJ5{OE0~itw5&M%Vq89A%n>Ov1RmU- zCJjR!DdGEL%H9dWCAE&FOB|ZJHAOk-8aJ(-abqe+$u`HCo$bEEc`??k%3O4{Tds#9 zcs8k`Qd{NxqxuMIA*xnU=uWy;fef*$V8!6mn}R1B20PIiDpR}A96Bi}W z0KMGRE>c(HvgT}#;oZyVT@hdIR)$9;X+1@M?w+%c2p=^P{8y?#Uf27V<6mpjXc)FG zjr>MF272~6U);~P(H&&75tD|96P9D=tT#~2V}!fz>DrT)F~4g>HzTTWIx~9L)K6gX zq-Mb>#CH`JI}6en^MWide+6rBP9HYgH0R8yh5#FZ7K{9y1f!T|idA!k0!GYiN%G}+ z1<8qGUP&owWbSEXvJr}dRU5ER@I{FZ+ZapdnA~q0EQzfFT`Y;JxVw=2e##owvag8G+{BI!URj=6RxFn5*Gl z?h%W!@N8Bz;!kSiQv1au z5*8%r5yyY(%;yaGAvNg{X4_92WH;%Frw@P=zUhX|uSrXkFE0+^SDNmx>NyCBaCt0Wpn`%mrdHwyJTrsq|2KBX~KaT;#OUybX{IEB62iAX(u zv+wq%m{m&XNdku^@;F9Ge^$5T8yqp*O?erl)6>tB8GGy_Ep)#dI9>t$QQ8#hnZ)za zx|G&zN)Ap_dwZiUWJ0V!7uQisb5JQ0KWJJPQ;- zIQtW%l0Jk-%vo16*esKrw!>n$GkLkvnI-cQg_Tx*N>=YMdCOa!_mk}Opk)r)1C@+u z_DZsUP=Ul7j0%pSw1Csn7`_~@R|2WNpfeFvrR=0|q~Sv-k8sS@cy zeC=7D1l8tjDUwna0lgIidB8{RNT`fz+Y+eU<{H*@_RJeFTq~O2vXq&YPDRq$B)B}t z^eqj*TRb)$uF9I3KoM1%!m{4}`IKr(srP>poS-d`mx{WeMa$2-SnT3jl_#dTex2u> z;(JyjsGeq$swynpTDor0l2?JA2+he;cNL{QxWYDZMzaD`wief5+`Gp7kB*YSRs*!d+_d(iID}`Oz-rZD-sEU3 zr81O~tRV6FRJIN;NK3Y-pLD4zzoMYI%|5&4i&5mSiBy-nXt-W{o0FfafTN|@t*_kv z*wvce;@2QB!BY`Pgt3Lr@vg3k=vP# zu~FSqnU45tj`U2umZKbcu{pgKdwQ(>Nb`YX9)r3)#?;D5zR+PLW{y-B`eP2IsL8uP zOpwa_gw&iT(9WZ@Ej9ER{Cb)aoQV4oTehRkwx7gB=GYmp1dW1{IhVeN7$w$ZD#{nz+}}Z6J)!kb9LC&hRXA&CKlBHc@&t@$fA;$K=leUc@)(<^7N4K~cFr{K-hh(~K|S zqihFKIK`r<3}+tL)`(x*v7Dsix4zsTUqd~=BHtR|wos9y?x_1dPb+RB3pc&d(wdp$ zOz-UE@31OmsPld?(v!P+W$}=&kKDBNdET}BF#lQ4K?w`^+`X#(Dp{74Jl_?meg-G+GWrFsSjt_THMM^Q-j??c{_EOt_mu{V@v> zMPs)fYZJMx{b9=Sjykuci9tQDeOE#WMGAh7igCz#ufyGVu9cWu)^e)%PHzP$-dxZn zX-~Mj;PquOZpAgX*5Yq@=p_s*1>#&hWKqFMy-`YvkSLqjoC@dQo6c?(v6RqowW0tI zWq-?)@TDHt`?`T%1SsMAbuW~+;nYQAZsI4l__S45COsQLFBdz{NRDsdBPH7iE=Y!L z0Idyllrw25A%$r_p3ln}%dV}yN1(mwyj16#3QKh2bPoxQC-k_t)kD<^;=OU{1!!ns zeq!W`rw4{r%oAE;>3!>aU=H4oN5oI`+f6k(A2$z|+qN#nU%iSvTvS7yZJv3h7B~wj z`JA&3`aI=2UZ2)9k-<5Uc{kDRgRRe*ge2ibm&fRvJYrcZiqIQ+r>-2wCQaN?7euqq z@VK0{y@^!0COrYBFCv29fO)!n+@5B0;B(IY$T`cC!=jkmDy+kig}mt^$L|L0)x#zi zbDyZ|KHFxh#ey{SbF)!8K6niu9EU4evx>||*;Wu1u#{eKq>YJCGIQDlY>H4I`3fkX zmUSZ8!wWF)60=b23aPR(4v`NZGY?uWa2pw0`jy}VAjd` zX~&i%2!rmpdJEkZnPZbgvfX<(U3CtYaB;4{;j83PY1~dBi*+I0LS7aj)Qu7~ktbly zPC7;l&0VmS-f?gROaZ*!oj4O}NRP8H%!O0WjeOPZ!l{8>T#2o_LBbbiHe68_9`MYv z_t-JX6o*}XL+?f~b;E%^)$pi#!`zsQ2Yxu%O~VShY&exe)y$!z!LV{I=mtFyo3Ag| zVbmASQmJ6@{p&R*57_T#LTASk+jB!3J{fK ztKE2dwhC(p5tuts-6`3!08@6-!2XHd0D1y<>oi@MzLQQcgc4Ya#i30K*tb6lio?+g zi#n;trH}J0nM3cAj`MJpcm7nG{U%(LUjSF?Tfd%`I4@zbss%dIwbr|(x?v0&@P@_0%7nb@QHe}=|kn#VKP`Y zgSeUodRvBXc1U;5%RWGHvdwQ{jD%Uuz#c4drbgY>ai9Tf>0>MpKF4~jnmZ1Y5-!Z5 zls$CT?w#^;WGO4c)g`b8@GR$%b*!Vb0h#TxFo~TUcFAwJ+I$I^55YW^Xf;U`f2DQl0S%W~ zwo;91$@)*2yF{xL&YH%|1KVA7mxjX|f2XfHptswm$AINYjgCNfY35?nbJ}Zng_}>p z&&W4wQB4^hlw!7fdi6VHvmPa$Ur)<(d|GVaz#8ur+Y3>#?)V9a9uR?c@-DcXSh;^F z>{S8voq&14fn)ZFvo2Nji<(?NVdk90G-gdjuH_%y__A%FJ?g-5uT4@B}CkL1v|i|tD&>02ZArEK&)q4Z_& z^^XGmIS%~~u>A!k{iDmYv=#m3O^mb)v<5ivU59}^9N6F(DD@p^E@7zr1pq{_6AoOq zG0-!Jq{V?dePK)$7#b%coWeIWa&c(PVQ3<9XsTprX7HaR(fMCP|0anpIow}~ygw;9 zKt=#D|GI1bBVv0-Rl3tr?JC5-88@gxD=;iBvtjlflk2~ZmVaK7`k$9j$9MnrlK-rt zLS1G1|B&eLU*&1kL%XR#;OBCW*u@Jv zAUCwyjk0ag{{%a9)L#21*dYa9)Dalv;g+JLA85Q`rJGYVIP=}m*ykGB&4ZrqwpbET zG)61~8Y~CVtNF1fffaYl$NsBQWG8`g=*?F zxHTNnZEVnwf)WR)06m=zVBg8iOcpcaJn|4;)v4-8X7qZOT15u+l!Y zEe9!QDL!8Klu66AV1)?M)k86!Yv4WxT$-0z)UO{2sKsagau7z)dE2v!21jk_fW{C?@J1iHp26!xQ_w+dR0_juS)=3Px7Lpl8z>Ku_ygZ*z@0)BbDYP z1Zip>VZYEKGX{$9ys)D@6F<-N8}wp->-Cl&V+FvN)O7Y%iEiiggE@P?@=J`(8|C|> zeu0#YZ5`Pk>BeC`8)YvT`$RzSg^;aWn_e)pT8ws^3rUFY2@N4*r==k>+|cRdy<2D2 zog3kyLcFE#?}_|zKEC-Gfu}f54#Ha-TuRL=P6;+$$S2b`p+g&xuiv^?gs~uPw9^ql zB>v@jM+mGgd9mQB#>kHf1Xq`Se+wN}yyIsA^P==!((O5|GiwSYm{)x%TE%e7Wf?d5 zmJP134@RUv_S`k!DbvyG;Th0}Gaj!3o3MLn{>U&+!?PfR_PU%4K-4~ov}e0QZ1gsE zG98P6wFsz^n84727Pn~ch30wo3e9_AMLmZFBV5g!2ED* z4)RQj?x}0d=oj*!NR)O*6kQhcV&m=EOLNcfEp!YT1dZ6WYL5~22=2Z3A{OM#Wf?m@ z-5c~Oxwu4A$|9hVoV&VKa&}e9GTLh?A1g7#p^BcqCY=@ZFhHb&X*Qwka0Xko->REb|RTZK=Umy5_73Cxgc z9O~|5)>ZZX@EdXaPXDxjHgm@8L1WJ;5!K>D<8wy!SIVPDYxYe|ASt`cZkcN-XFd&s z;CIv4U|ptJc%jk=W=uYx=RUhJ-r5;e&T}&_*;` zVwA$gNb=)mc_@m}@?D|e@$cG+nO<%zcmh)o3Zk}9yrx!(+4Yk9QVRAaoI);T(I?x^ zIoj>77%9lLoE&SgQ@6NMBgDMjP*>HQ^8zm1<0rFFOSQS|z0=Ty^!lJWbTFoVBh~I1 zvAh@_E$h$eu(UQtRzY(Ibm&-QAzC~gIX+6=HT=G)a*4%+9NzCJVv##5?BL#GQr>)` zv6AD`t1iXIpIG4wM<%^PvSzF^Bj4$U1QVbVcGLu z+1m-#ta%*gc~tl_&QFkc2{!J%!cHu#%V=~sI93-j>sT(QjqbMKzoYQk@mgl^n-^J2 zl}T%Ih!d0bmb^Z05?m7Zu*V_hse1mEw-WceP%AUT z6$iej*!u3YUhxy9;jZ+J@ATn09B%q4f9P#x@7*`6A=$$j^X*@$Pk5(BgNr7gUkwWV zc|0m7ta^d_-23o5yKZ&O)h*5IJE$An`aI;(a3uG|p~w5|+=UkpcI{$ToGCvGwPZNH zO?wPxm2KRghwbRwby>yjpmU9c#m)~6UR5kw=jmnMIj6?;&oAcv?6^7k;`8|g{huO9 zU*G2W`(YQWvZkHO1Mci?MeN%MI^_Rq)YxFoi3X_yBkIdtJJ*zgkq-{eo>4-p2f@=% z=fE9_`i5wS5U(NHD49%^2=!S7<9X!kjY<*MFJV@Hbs zD%a;-xM73&Q7x=GIfvWSiHB;!A2vI#R(D6IxJ~}-eE4xVW$Dl^U+b{juT?se_fTgK zT^my`nLBwBe%Pb?f(Gk(o-RwBbsw7%74fr?Tnjr5SQU-@jbiL{Io5-I>baaaL_OgU z$sk3O9HLK&8U#KF%Qf=Kc%XTE?3|y{F^_o#3w@gLA(~*fDr!Q-dQL>oP|aV`!+1=B zgRXC~uEReOae-N_Fm2~X^O|R#7~M=#slZsiC@^e%M#F>T<~l)tBd($1K(4I~eAR&@ z3}5v31ECS7W062M8Ssu=h>Qr)w)1{Qc0#SF#?&g6Fp;0(EpKwerq)8ds+BqHjfU1G zXe477gvzro`>p)rhXQ>kLTQi^RKSJJMF>f>SjSxNTGw#r8Z#S4ihNTDm zAOXp0u+qU0A3gPqoJcCMLaijEu>_w?+JW^X`!A4Z2X=7MID$&7_$l%J@JniQcpj<_ zG=TP;HB7pUEHEIU_<+HOQGiVuVMddOhmz?2Xc5U|3tO^sL|~v_vUgH)P+jtITrxKW z)}_SPT6q-8E!kheFL7K|!&>SiTvNRY$p}er!5E~B93|xoPo#BXV4{fJn|iSQp7I$zs;dIvAXFxuqCd&pIf-)6EtS~dXXIRw z%E5U83ecRTq!JFns`6#`D8a;gBxbQX_va*nVYzHWOi6ki+-Ts!fL+0WgZh~m(@oIG zlt+5&lazBk3`)$o6miMdJg7iiQBWb8B!%JoD)oqt&6p@!XqRQ7WKn~!x_$w?m?UFq z3l>VgdGB63>@}<{Sdmf?a1FE3l!f`Co16O`NgRKhX1q`jK7l8R?^m9$Zhg*lZ*Ws#31mBu!f#%IBo21;csHM1Fo z)~lt4qGj?lYz|DwjEbqLLcQ!j9c(}uQ{jA5;)_^VnkLrCNz=Hiq9AM>dK42!Vc%7A@m5N ziqy+s;jSc^>+)`*M=1P)N!yFT&2(K6TT7B2kjYg+ig!NHUn2K2_cT&7WUiI979%IJN$%SiokW)xV5WM95h&n0v~OK$3YQY!{9j* zmw#-9+4AlkhBMCA9hiyMdI%AmsqnZ(B(@T(M!9X}jH>}0yJ?)!x;3q>(2n2>*t0ED zfoXd=2Wh%a!>`6M|4vpmjB%=-lft%rknQyMs;W4#Q$pfm1E7$>lB(sCUe4j@RGo1B zhB8|PYZePn3j#%}l5yh}ZP~{9jV%as7q@cz1Xk3-_g3NnJKwpA+BhUGySh<`P&0T} z%o4^DdSmGLohPRJ9a>y{gX}L>gJFoOrbBW0A>W&_w3v1e-1OQ5f8xd-mR)#k0DSn) z#U5AtRDqM~$H}zVI7nohyAE|zS7vA3C|tQ0V99r2g=bflSa%j&ehCgw6uXT^qy+QS zd}E2nFsr)2d#xT^zgxx#W-lCUjCJCE7l&kNVOstszQ|UlKm#Ltnq#HgbaI&3C>=*} zu19AiFe@FdA*B!Coo=$7t<=tg-knF|JH47@aE$b0>@c4S8SF~27p}{HNhUC-tEsvx z#6>3euEd2OUAI>|!}>ZSa%94Dy6;qX$7{=6{?T2E+k#}WZK^K2A&v+KB+P_EUvO}6 zKpYXMTTnwo1Cmi39UURs03@A2x=Bh(N>)}@VPPTENw=xa0Dx4&bjMsbNPdwu|B90D zL#dW!{~%(3Q+peLPr{w_KY#GuU1typ|Aau98uXD8``D4?tiPHX5zr6Iszb~2{9DWJ z!t}(@n%9Ri?>ycJWa(}G?$ptU#i zsVmL~pp+SBMSs5qTVM@q1Ch}EK<$)Uz?ZFVNhKvEO-)UGeSH%X69~Ql5memW-MzfL zAc6`6Ux1!SSXdbJP?D08GBY!w`MB4wUx)ZFTTO-#`Ez7sWO8zHc6N4YX=!zJ^~aAN zn-A=N>|)-a(0q+$1rxf9M1u%~jDgbA*V!#^O;ntH_%8VVltPuitwXzE9Iws@>%>ZZ zh{dhR)YrN;dwH7TU>CvmFe?1``LL5AHi-Cu&3;A$IJY+wfeI70;}9So7Qhn(K+Z)$ z7KAV!FBA;p7ZBvp6Xp^mpz??U0(%ifLR{Ix*hVHnyf8n3-Iz1~BJ4h%H|5FG$zxa| z(uVbh9o;~X8643sut9qO0u$io0GR+mT)?LPpbD@?5GF};h(a`HM7tIf{HYWN6G>a0 zw!=sH$?mEm9@ut@O-gkrEu0NVYb(xB;DBvURAqJ{Cy1gks{jW5aX4cm9w>RQ zj~3to*AyL37}7-yGO@=T!>{Cr!czFk&Xj`DqVZdV=FoMu$h}Ce+ANn4GPfx#i0bu% z$M0siu-$HRn95AS08xKi66Z82)his1k6@Ry4wG$9b^rvTWNQ8G0XSb;U0Uhrvcl zN%_%qwKWk58T(2LM~B*#(wEHU;i`{Yra9auZBN~I+4X8KobwS5m$&!e!!YLc4@KE~ zY43niLJn@q2yq14Vx5f{a5xW5_He~r8!f^+6Hr7LvxCm&WDm|$8^9$ye#{D>R>r1d zIH~zFv6%eL(H<{aXJQpMF{3VhrJ|dd(L-3x+Vxq6ejDCn6EixUXhjc)X_y*H9VVGk zt%gjbGS%nPT*9oxxsMc#&S!YMDm|2WtXQBc-K+M^5kBvG5N6c4-Q;!d>8CN9n9={6 zD0MC4$n`hHIh&$XK13KTy_)8=DN0>`3-vSpQ&EcV_)=B3MEO#6pBgk|cfe5QUCoHy z@psUS-ST&}&(1EstDB12oUxmBe7RwvxcvGuq(?0--(BgHdEc})cKm(w`m6Hy_kMg{ ze19LX$gZ>?`5_VuE4gB&jeY0R$^(p%?1y$9d+!e&_@fmcItc+wAG(Oqva8*sbnn$3 z$&!lIUfH^()rSgQvLE|Y#=SrGtG}-J_(=Q9(#OXXmK|#Y`usj?gT~|=YeQx`->nT> z8twQrVq@>~Y1HB9jZb4P0q;JIyGHN$JmHb<^ZCiKk{h3&de^=CJjuecC3pYQvekhb zkc2E?1Y{T3+1asJtgx^!i9~|vP3r3E1_lO@)j59r_?a_jAbS%Y9-f$(xMghW>gpOA z8Xz09xVZS?!-xNXdY=F3#bmbyaGEc?$@cc1#NDJ05^|L5!OvpV;Bh+_YZJG*I<8?E_BE z;GipTKLn0@1OL+?AP|I{2N4mFw*kq?ASVYD6oBH=&5rQu+n}ilJZJ~~{a|PPTpeY5}jzjOV~l3w-e@z&f&4R>3>;Dj&JDzV2rB3atpMLa0Q zG}?@&s{TM6WkwgHX?L0WK+KE=Sj6!J5)wux@Ds$G2t)!G*uITl3=5dW2zWBTpr8~J zAPNcOumC<8K2{)s0C*e_P6W79GH5D+8xZ)Y*bu-(&X98AZQqto){0N+g1%w#hI8z+61W8MJOxr5j_@R)G%1khmBIX@tvqDj9E7d{&u1vn<J!i+%_^e$|%3fR~nN&z5j1HV%WwiCe?s6bQ>QdVEoDE&fLNh%+7(gi+}9Q|K_&*H?}myDv+=fL4v6N z$||_zl$n#8ZWnoF^W1B3NojUzd8SCkt;(wE+gUZWu?2OFcbl4HuHS2Id(hsI+|t?8 z`>?OFyML2aaA#y}e4^*^6Npt%G5K<4b}nTaI`;bJ_1k1PorO_jF2pe8j&!r=|PyG)&Q1>T{s*j+aR0pPVB zznQ?d&|*>>eVHj9uYfYG^5Khd-qtBlHkdsNt$RG=?h*?SNYH za_V*Es3xFwlit(sM={ed*tf?=j8uBluC)F=T+;OoLJfE)#+ zy;bPEF{j5n-(jkTLUnu4LYZA8F1}{!fcK6i0}-%K8{>k}H^W9;w8tk>MPj$P8^D+? zW+`a<3R;1PaE=XfgGV3pp*`fK4o=uYdqv?u5UH?4_?(P1)5`-p1>Fr0BKoIv5i$`d z3Q|{gtSEzG=k3eWvBBkond02 z{KO+p7(Od)vqO03wq%1Jcn@VP9o@pkA9kmNbuW)(7|O_Ng64*7QbeUNY8o(%bR zWl{gfl=L6|1NzA>YlF&Mmy-DYk#8S0{uAHs+qL7%v(w`~U!DiPzVYQn$d`9tUeZ|P z)~6!)PpnVV$v4+$;&(1X!IzQT*SQq?6JO^uj^6zGDkot1>+Aezxo-}Xlg<>75zK& z<(Ez6_{DrdY%yPawh8G{H{CKse%WUOT=xHAP!D-*dgg!Epql&@@&Xyu*k1-UIc3wJ z=H-K{*FZ_>rdh4I1Dcw_KQgNju%)XTJna8-%L+OC&;M#$WUFDWjR2WcDl;f@&8_$r^u4b~Icv)F9HG65Mib9INzo?~-E@U(7PFk}w zV=H8qeLOgzD9hZ9^0;!KTK~dpg zJjfiqi=f-VyN8#^#A~&d|BTnl#VyR{g~G8TQpU?=bUtz8(2mO>hhdOoA3|#9wboYL zmPTn|j#ntcD07+jGDJg_f3^=$RWGt^=)Mqav=g~xCb$eRY3NfDPYmZw8GktWY1MT-AtLjonqTe znb58h}IU7L=1g zVYrYG*pj(^561sMhKU2nUqD&f?+V!8#pC}K7Dm6`wr;yrDV*axLd=nNHvp+KTSK}EJfR`nZuKxiG%fDR< zHJ)t-;J+Hrpa8tHt9vs5{|hW^6bis0aqU?SoIoTJpnzMLOctI?gt77Svp-+`n6yn- z-_THBcN=57rERTu8EzhNm08tqVIZ-{5D}b{W?ZQaErvNAtuOo|ZWfz|m=i&mr2 zMgo2-6RmzM2?PPTBf+9=)+h<3LmK$%s**$zPP|S&)jHow&PG_l+V{}mJ!#q}B)dIh zjzr)voZA$v3R^_5Qlj|Ap!|0I>t(^~Yfr)xxr*#IW}L9y^DJT<7J1ZBTG|jd*(@a_ z6W_WAC$YatI;c%F4#MYDs%R7*Hh8&DckDB=jTLRu;AcQ}vk|*>Kv-37PjHyW5--41 z!|Rpc6#gpa_OxzyVp0;Vv^-6 z>_R+~++{5$oJtdVo2rZx`*Tyn`OGzg_l&&VrsKwRmko%U>-*BUe{d+Yahp@l3M1dl zkHoeji=It`g$46gn{BvW+6{dd8^*bfk6{GmS1I9 zhs;Tg67(RtW zN5Hy}$u%tsw-+S}4Vi%VIo6isrWIM>Z3$ZNN`NL`=Zo1E)od@6WXKkkQE^M;WQB7l zdz6Zg0zqD=f|<#Ez_qpiQjN$7Hm2D=R`|&lSODp`nZg4Bkdjy-s!WH`1UiK|Zq$JM z)-z0AU_h<(4&KnDPd2>E^LN84O97;AI@R@R*Rp*B;Dm&aMPNy$!bN7A& zcbexc&>RbTj5$JkFl9)VJ0(8F@m9J0oo~99RXZgtn)2X2QtkdXk%Z%*#d(HrtTI}l zk6l_h`*kT9F%)VR;pvK~t?8mH>#X<^_4U7kDY#lqythC^D0^DHe&M!5@HT{SU8lIb z2{Au5ok&|)Qw{xa*jM0NoZxyy9UGDkg;ea8 zlEegq9GN2|kN!F^45^>c^>+t`e<`S&-}0Bz6%-2a@$o?jd?O`KMsGRF>i|Xj;K+7FCaKP2o6IEcLg4 zk+PU>$Ll+24B{=OaJSRKX_qLTxKin=t6ys82?vvC&+<-_n8zdR1#sqiwp+o;uUB~l zTJX2I1Q7BQkH?eAWJyU$XJ==qK(}?g8FFCv@85?YmyaGj8XFsX_Uzf*+}z(*{}(=E z(tvbgiu)DRuek)TB$4v$?0qxDYc~jmMzFLn6+AmVl$C}t?#nyYNswi5!TdE#t6Z9I z#o@Oy)n9k(^T*@aRJEa7B@hTucm_=)fC_0&PEHptT!5ZaYHI40D_5X5=dUvphK7bF zCMITPX8wiS{Nr1;rYN{ynF}oRY!G!PmddxN_bb=SVCd0EF57xtKD}gOwKDM_Ynxt8 z;Fuq0P}B&OTsy7;f^XEF$xa3%KW!ox+G%gcPc6%T&$nSU{U>E0vL^_Z=#^GD6o z7Q{jVDGmBv&>HX~TW8>la%!H&-G0&Zohxd_IPFzT@!Q_oWwx$Wv+>WDUVnS^3zi?QI||hMy{XX>-Iv}Kee0exX>^?k>PS7ceqk@a{j{Y89(0U%Z;<< z-*n2}li_$)>)#IHZ^pSofcy_)XXuvxQTU8BS?Laige1=vuHM@mX+Ye>gd{A~M|_!*L1{u(($ z6(DFhCGQQrZGh`6^`}?69((~uf zA#3&5O44Ql#BycATNqy8*FzFa>?<7#GBf?Vx6z&BMAwVwD$ZvnImUY@Pu5&`Y=4>0 z4ZHn(L}XO76G2Nm{*o5KG4|4BhC@=ab^<*+$CQk5<0j=oaWCewQrU*9nC{?vzjvTa3f4Hyl8466F04SaOk{Jb%nN){b>F86YEKT@AwzP^Uh=m zlBgUFy+ec~+a*fIOY;G4De>(x{I3AwY=hgS(MvMO1_6Bs-!a`#=*YBd6db_afTccY zaTf?Z%x%LO$`CCyN!H-0?mZ=bxZY9rT75`^|6lyJORl_#>O8W4Sq3*!6e0xw1>{`%=yL3C#C*^{;P!UvBzx;x3Gt6@vs?{|W8zNrV6Z diff --git a/website/static/linux-logo.svg b/website/static/linux-logo.svg deleted file mode 100644 index ab645e4bdb42..000000000000 --- a/website/static/linux-logo.svg +++ /dev/null @@ -1,7 +0,0 @@ - - - - - - - diff --git a/website/static/windows-logo.svg b/website/static/windows-logo.svg deleted file mode 100644 index e16d275ad66e..000000000000 --- a/website/static/windows-logo.svg +++ /dev/null @@ -1,3 +0,0 @@ - - - diff --git a/website/updates.json b/website/updates.json deleted file mode 100644 index 77e9232b75a5..000000000000 --- a/website/updates.json +++ /dev/null @@ -1,3 +0,0 @@ -{ - "version": "0.4.5" -} diff --git a/yarn-error.log b/yarn-error.log new file mode 100644 index 000000000000..56d20f25630a --- /dev/null +++ b/yarn-error.log @@ -0,0 +1,7075 @@ +Arguments: + /usr/local/bin/node /usr/local/Cellar/yarn/1.5.1_1/libexec/bin/yarn.js + +PATH: + /usr/local/opt/openvpn/sbin:/Users/leo/google-cloud-sdk/bin:/usr/local/bin:/usr/bin:/bin:/usr/sbin:/sbin:/usr/local/go/bin:/opt/X11/bin + +Yarn version: + 1.5.1 + +Node version: + 9.10.1 + +Platform: + darwin x64 + +npm manifest: + { + "repository": "zeit/hyper", + "scripts": { + "start": "echo 'please run `yarn run dev` in one tab and then `yarn run app` in another one'", + "app": "electron app", + "dev": "webpack -w", + "build": "cross-env NODE_ENV=production webpack", + "lint": "eslint .", + "test": "yarn run lint && yarn run test:unit", + "test:unit": "ava test/unit", + "test:unit:watch": "yarn run test:unit -- --watch", + "prepush": "yarn test", + "postinstall": "electron-builder install-app-deps && yarn run rebuild-node-pty && yarn --cwd node_modules/xterm", + "rebuild-node-pty": "electron-rebuild -f -w app/node_modules/node-pty -m app", + "dist": + "yarn run build && cross-env BABEL_ENV=production babel --out-file app/renderer/bundle.js --no-comments --minified app/renderer/bundle.js && build", + "clean": + "node ./bin/rimraf-standalone.js node_modules && node ./bin/rimraf-standalone.js ./app/node_modules && node ./bin/rimraf-standalone.js ./app/renderer" + }, + "eslintConfig": { + "plugins": ["react", "prettier"], + "extends": ["eslint:recommended", "plugin:react/recommended", "prettier"], + "parserOptions": { + "ecmaVersion": 8, + "sourceType": "module", + "ecmaFeatures": { + "jsx": true, + "impliedStrict": true, + "experimentalObjectRestSpread": true + }, + "allowImportExportEverywhere": true + }, + "env": { + "es6": true, + "browser": true, + "node": true + }, + "rules": { + "func-names": ["error", "as-needed"], + "no-shadow": "error", + "no-extra-semi": 0, + "react/prop-types": 0, + "react/react-in-jsx-scope": 0, + "react/no-unescaped-entities": 0, + "react/jsx-no-target-blank": 0, + "react/no-string-refs": 0, + "prettier/prettier": [ + "error", + { + "printWidth": 120, + "tabWidth": 2, + "singleQuote": true, + "trailingComma": "none", + "bracketSpacing": false, + "semi": true, + "useTabs": false, + "parser": "babylon", + "jsxBracketSameLine": false + } + ] + }, + "overrides": [ + { + "files": "app/config/config-default.js", + "rules": { + "prettier/prettier": [ + "error", + { + "printWidth": 120, + "tabWidth": 2, + "singleQuote": true, + "trailingComma": "es5", + "bracketSpacing": false, + "semi": true, + "useTabs": false, + "parser": "babylon", + "jsxBracketSameLine": false + } + ] + } + } + ] + }, + "babel": { + "presets": ["react"], + "plugins": [ + [ + "styled-jsx/babel", + { + "vendorPrefixes": false + } + ] + ], + "env": { + "production": { + "plugins": [ + "minify-constant-folding", + "minify-dead-code-elimination", + "minify-flip-comparisons", + "minify-guarded-expressions", + "minify-infinity", + [ + "minify-mangle-names", + { + "keepClassName": true, + "keepFnName": true + } + ], + "minify-replace", + "minify-simplify", + "minify-type-constructors", + "transform-member-expression-literals", + "transform-merge-sibling-variables", + "transform-minify-booleans", + "transform-property-literals", + "transform-simplify-comparison-operators", + "transform-undefined-to-void" + ] + } + } + }, + "build": { + "appId": "co.zeit.hyper", + "extraResources": [ + "./bin/yarn-standalone.js", + "./bin/cli.js", + { + "from": "./build/${os}/", + "to": "./bin/", + "filter": ["hyper*"] + } + ], + "linux": { + "category": "TerminalEmulator", + "target": [ + { + "target": "deb", + "arch": ["x64"] + }, + { + "target": "AppImage", + "arch": ["x64"] + }, + { + "target": "rpm", + "arch": ["x64"] + } + ] + }, + "win": { + "target": ["squirrel"] + }, + "mac": { + "category": "public.app-category.developer-tools", + "extendInfo": "build/Info.plist" + }, + "deb": { + "afterInstall": "./build/linux/after-install.tpl" + }, + "rpm": { + "afterInstall": "./build/linux/after-install.tpl" + }, + "protocols": { + "name": "ssh URL", + "schemes": ["ssh"] + } + }, + "license": "MIT", + "author": { + "name": "ZEIT, Inc.", + "email": "team@zeit.co" + }, + "dependencies": { + "args": "3.0.8", + "chalk": "2.3.2", + "color": "2.0.1", + "columnify": "1.5.4", + "css-loader": "0.28.11", + "got": "7.1.0", + "json-loader": "0.5.7", + "mousetrap": "chabou/mousetrap#useCapture", + "ms": "2.1.1", + "opn": "5.3.0", + "ora": "1.3.0", + "parse-url": "3.0.2", + "php-escape-shell": "1.0.0", + "pify": "3.0.0", + "react": "16.2.0", + "react-deep-force-update": "2.1.1", + "react-dom": "16.2.0", + "react-redux": "5.0.7", + "recast": "0.13.0", + "redux": "3.7.2", + "redux-thunk": "2.2.0", + "reselect": "3.0.1", + "seamless-immutable": "7.1.3", + "semver": "5.5.0", + "shebang-loader": "0.0.1", + "styled-jsx": "2.2.6", + "stylis": "3.5.0", + "uuid": "3.1.0", + "xterm": "chabou/xterm.js#7cb4b8e" + }, + "devDependencies": { + "ava": "0.25.0", + "babel-cli": "6.26.0", + "babel-core": "6.26.0", + "babel-loader": "7.1.2", + "babel-preset-babili": "0.1.4", + "babel-preset-react": "6.24.1", + "copy-webpack-plugin": "4.3.1", + "cross-env": "5.1.4", + "electron": "1.8.4", + "electron-builder": "20.5.1", + "electron-builder-squirrel-windows": "20.5.0", + "electron-devtools-installer": "2.2.3", + "electron-rebuild": "1.7.3", + "eslint": "4.7.2", + "eslint-config-prettier": "2.6.0", + "eslint-plugin-prettier": "2.3.1", + "eslint-plugin-react": "7.3.0", + "husky": "0.14.3", + "inquirer": "5.1.0", + "node-gyp": "3.6.2", + "prettier": "1.11.1", + "proxyquire": "1.8.0", + "spectron": "3.8.0", + "style-loader": "0.19.1", + "webpack": "3.10.0" + }, + "resolutions": { + "rc": "1.2.3" + } + } + +yarn manifest: + No manifest + +Lockfile: + # THIS IS AN AUTOGENERATED FILE. DO NOT EDIT THIS FILE DIRECTLY. + # yarn lockfile v1 + + + "7zip-bin-linux@~1.3.1": + version "1.3.1" + resolved "https://registry.yarnpkg.com/7zip-bin-linux/-/7zip-bin-linux-1.3.1.tgz#4856db1ab1bf5b6ee8444f93f5a8ad71446d00d5" + + "7zip-bin-mac@~1.0.1": + version "1.0.1" + resolved "https://registry.yarnpkg.com/7zip-bin-mac/-/7zip-bin-mac-1.0.1.tgz#3e68778bbf0926adc68159427074505d47555c02" + + "7zip-bin-win@~2.2.0": + version "2.2.0" + resolved "https://registry.yarnpkg.com/7zip-bin-win/-/7zip-bin-win-2.2.0.tgz#0b81c43e911100f3ece2ebac4f414ca95a572d5b" + + "7zip-bin@~3.1.0": + version "3.1.0" + resolved "https://registry.yarnpkg.com/7zip-bin/-/7zip-bin-3.1.0.tgz#70814c6b6d44fef8b74be6fc64d3977a2eff59a5" + optionalDependencies: + "7zip-bin-linux" "~1.3.1" + "7zip-bin-mac" "~1.0.1" + "7zip-bin-win" "~2.2.0" + + "7zip@0.0.6": + version "0.0.6" + resolved "https://registry.yarnpkg.com/7zip/-/7zip-0.0.6.tgz#9cafb171af82329490353b4816f03347aa150a30" + + "@ava/babel-plugin-throws-helper@^2.0.0": + version "2.0.0" + resolved "https://registry.yarnpkg.com/@ava/babel-plugin-throws-helper/-/babel-plugin-throws-helper-2.0.0.tgz#2fc1fe3c211a71071a4eca7b8f7af5842cd1ae7c" + + "@ava/babel-preset-stage-4@^1.1.0": + version "1.1.0" + resolved "https://registry.yarnpkg.com/@ava/babel-preset-stage-4/-/babel-preset-stage-4-1.1.0.tgz#ae60be881a0babf7d35f52aba770d1f6194f76bd" + dependencies: + babel-plugin-check-es2015-constants "^6.8.0" + babel-plugin-syntax-trailing-function-commas "^6.20.0" + babel-plugin-transform-async-to-generator "^6.16.0" + babel-plugin-transform-es2015-destructuring "^6.19.0" + babel-plugin-transform-es2015-function-name "^6.9.0" + babel-plugin-transform-es2015-modules-commonjs "^6.18.0" + babel-plugin-transform-es2015-parameters "^6.21.0" + babel-plugin-transform-es2015-spread "^6.8.0" + babel-plugin-transform-es2015-sticky-regex "^6.8.0" + babel-plugin-transform-es2015-unicode-regex "^6.11.0" + babel-plugin-transform-exponentiation-operator "^6.8.0" + package-hash "^1.2.0" + + "@ava/babel-preset-transform-test-files@^3.0.0": + version "3.0.0" + resolved "https://registry.yarnpkg.com/@ava/babel-preset-transform-test-files/-/babel-preset-transform-test-files-3.0.0.tgz#cded1196a8d8d9381a509240ab92e91a5ec069f7" + dependencies: + "@ava/babel-plugin-throws-helper" "^2.0.0" + babel-plugin-espower "^2.3.2" + + "@ava/write-file-atomic@^2.2.0": + version "2.2.0" + resolved "https://registry.yarnpkg.com/@ava/write-file-atomic/-/write-file-atomic-2.2.0.tgz#d625046f3495f1f5e372135f473909684b429247" + dependencies: + graceful-fs "^4.1.11" + imurmurhash "^0.1.4" + slide "^1.1.5" + + "@concordance/react@^1.0.0": + version "1.0.0" + resolved "https://registry.yarnpkg.com/@concordance/react/-/react-1.0.0.tgz#fcf3cad020e5121bfd1c61d05bc3516aac25f734" + dependencies: + arrify "^1.0.1" + + "@ladjs/time-require@^0.1.4": + version "0.1.4" + resolved "https://registry.yarnpkg.com/@ladjs/time-require/-/time-require-0.1.4.tgz#5c615d75fd647ddd5de9cf6922649558856b21a1" + dependencies: + chalk "^0.4.0" + date-time "^0.1.1" + pretty-ms "^0.2.1" + text-table "^0.2.0" + + "@types/node@^8.0.24": + version "8.9.4" + resolved "https://registry.yarnpkg.com/@types/node/-/node-8.9.4.tgz#dfd327582a06c114eb6e0441fa3d6fab35edad48" + + abbrev@1: + version "1.1.1" + resolved "https://registry.yarnpkg.com/abbrev/-/abbrev-1.1.1.tgz#f8f2c887ad10bf67f634f005b6987fed3179aac8" + + acorn-dynamic-import@^2.0.0: + version "2.0.2" + resolved "https://registry.yarnpkg.com/acorn-dynamic-import/-/acorn-dynamic-import-2.0.2.tgz#c752bd210bef679501b6c6cb7fc84f8f47158cc4" + dependencies: + acorn "^4.0.3" + + acorn-jsx@^3.0.0: + version "3.0.1" + resolved "https://registry.yarnpkg.com/acorn-jsx/-/acorn-jsx-3.0.1.tgz#afdf9488fb1ecefc8348f6fb22f464e32a58b36b" + dependencies: + acorn "^3.0.4" + + acorn@^3.0.4: + version "3.3.0" + resolved "https://registry.yarnpkg.com/acorn/-/acorn-3.3.0.tgz#45e37fb39e8da3f25baee3ff5369e2bb5f22017a" + + acorn@^4.0.3: + version "4.0.13" + resolved "https://registry.yarnpkg.com/acorn/-/acorn-4.0.13.tgz#105495ae5361d697bd195c825192e1ad7f253787" + + acorn@^5.0.0: + version "5.4.1" + resolved "https://registry.yarnpkg.com/acorn/-/acorn-5.4.1.tgz#fdc58d9d17f4a4e98d102ded826a9b9759125102" + + acorn@^5.5.0: + version "5.5.3" + resolved "https://registry.yarnpkg.com/acorn/-/acorn-5.5.3.tgz#f473dd47e0277a08e28e9bec5aeeb04751f0b8c9" + + ajv-keywords@^2.0.0, ajv-keywords@^2.1.0: + version "2.1.1" + resolved "https://registry.yarnpkg.com/ajv-keywords/-/ajv-keywords-2.1.1.tgz#617997fc5f60576894c435f940d819e135b80762" + + ajv-keywords@^3.1.0: + version "3.1.0" + resolved "https://registry.yarnpkg.com/ajv-keywords/-/ajv-keywords-3.1.0.tgz#ac2b27939c543e95d2c06e7f7f5c27be4aa543be" + + ajv@^4.9.1: + version "4.11.8" + resolved "https://registry.yarnpkg.com/ajv/-/ajv-4.11.8.tgz#82ffb02b29e662ae53bdc20af15947706739c536" + dependencies: + co "^4.6.0" + json-stable-stringify "^1.0.1" + + ajv@^5.0.0, ajv@^5.1.0, ajv@^5.1.5, ajv@^5.2.0, ajv@^5.2.3: + version "5.5.2" + resolved "https://registry.yarnpkg.com/ajv/-/ajv-5.5.2.tgz#73b5eeca3fab653e3d3f9422b341ad42205dc965" + dependencies: + co "^4.6.0" + fast-deep-equal "^1.0.0" + fast-json-stable-stringify "^2.0.0" + json-schema-traverse "^0.3.0" + + ajv@^6.1.1: + version "6.2.1" + resolved "https://registry.yarnpkg.com/ajv/-/ajv-6.2.1.tgz#28a6abc493a2abe0fb4c8507acaedb43fa550671" + dependencies: + fast-deep-equal "^1.0.0" + fast-json-stable-stringify "^2.0.0" + json-schema-traverse "^0.3.0" + + align-text@^0.1.1, align-text@^0.1.3: + version "0.1.4" + resolved "https://registry.yarnpkg.com/align-text/-/align-text-0.1.4.tgz#0cd90a561093f35d0a99256c22b7069433fad117" + dependencies: + kind-of "^3.0.2" + longest "^1.0.1" + repeat-string "^1.5.2" + + alphanum-sort@^1.0.1, alphanum-sort@^1.0.2: + version "1.0.2" + resolved "https://registry.yarnpkg.com/alphanum-sort/-/alphanum-sort-1.0.2.tgz#97a1119649b211ad33691d9f9f486a8ec9fbe0a3" + + amdefine@>=0.0.4: + version "1.0.1" + resolved "https://registry.yarnpkg.com/amdefine/-/amdefine-1.0.1.tgz#4a5282ac164729e93619bcfd3ad151f817ce91f5" + + ansi-align@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/ansi-align/-/ansi-align-2.0.0.tgz#c36aeccba563b89ceb556f3690f0b1d9e3547f7f" + dependencies: + string-width "^2.0.0" + + ansi-escapes@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/ansi-escapes/-/ansi-escapes-3.0.0.tgz#ec3e8b4e9f8064fc02c3ac9b65f1c275bda8ef92" + + ansi-regex@^2.0.0: + version "2.1.1" + resolved "https://registry.yarnpkg.com/ansi-regex/-/ansi-regex-2.1.1.tgz#c3b33ab5ee360d86e0e628f0468ae7ef27d654df" + + ansi-regex@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/ansi-regex/-/ansi-regex-3.0.0.tgz#ed0317c322064f79466c02966bddb605ab37d998" + + ansi-styles@^2.2.1: + version "2.2.1" + resolved "https://registry.yarnpkg.com/ansi-styles/-/ansi-styles-2.2.1.tgz#b432dd3358b634cf75e1e4664368240533c1ddbe" + + ansi-styles@^3.1.0, ansi-styles@^3.2.0: + version "3.2.0" + resolved "https://registry.yarnpkg.com/ansi-styles/-/ansi-styles-3.2.0.tgz#c159b8d5be0f9e5a6f346dab94f16ce022161b88" + dependencies: + color-convert "^1.9.0" + + ansi-styles@^3.2.1: + version "3.2.1" + resolved "https://registry.yarnpkg.com/ansi-styles/-/ansi-styles-3.2.1.tgz#41fbb20243e50b12be0f04b8dedbf07520ce841d" + dependencies: + color-convert "^1.9.0" + + ansi-styles@~1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/ansi-styles/-/ansi-styles-1.0.0.tgz#cb102df1c56f5123eab8b67cd7b98027a0279178" + + anymatch@^1.3.0: + version "1.3.2" + resolved "https://registry.yarnpkg.com/anymatch/-/anymatch-1.3.2.tgz#553dcb8f91e3c889845dfdba34c77721b90b9d7a" + dependencies: + micromatch "^2.1.5" + normalize-path "^2.0.0" + + app-builder-bin-linux@1.7.2: + version "1.7.2" + resolved "https://registry.yarnpkg.com/app-builder-bin-linux/-/app-builder-bin-linux-1.7.2.tgz#a764c8e52ecf1b5b068f32c820c6daf1ffed6a8f" + + app-builder-bin-mac@1.7.2: + version "1.7.2" + resolved "https://registry.yarnpkg.com/app-builder-bin-mac/-/app-builder-bin-mac-1.7.2.tgz#c4ee0d950666c97c12a45ac74ec6396be3357644" + + app-builder-bin-win@1.7.2: + version "1.7.2" + resolved "https://registry.yarnpkg.com/app-builder-bin-win/-/app-builder-bin-win-1.7.2.tgz#7acac890782f4118f09941b343ba06c56452a6f6" + + app-builder-bin@1.7.2: + version "1.7.2" + resolved "https://registry.yarnpkg.com/app-builder-bin/-/app-builder-bin-1.7.2.tgz#daf67060a6bad8f5f611a0d2876d9db897a83f06" + optionalDependencies: + app-builder-bin-linux "1.7.2" + app-builder-bin-mac "1.7.2" + app-builder-bin-win "1.7.2" + + aproba@^1.0.3, aproba@^1.1.1: + version "1.2.0" + resolved "https://registry.yarnpkg.com/aproba/-/aproba-1.2.0.tgz#6802e6264efd18c790a1b0d517f0f2627bf2c94a" + + archiver-utils@^1.3.0: + version "1.3.0" + resolved "https://registry.yarnpkg.com/archiver-utils/-/archiver-utils-1.3.0.tgz#e50b4c09c70bf3d680e32ff1b7994e9f9d895174" + dependencies: + glob "^7.0.0" + graceful-fs "^4.1.0" + lazystream "^1.0.0" + lodash "^4.8.0" + normalize-path "^2.0.0" + readable-stream "^2.0.0" + + archiver@^2.1.1, archiver@~2.1.0: + version "2.1.1" + resolved "https://registry.yarnpkg.com/archiver/-/archiver-2.1.1.tgz#ff662b4a78201494a3ee544d3a33fe7496509ebc" + dependencies: + archiver-utils "^1.3.0" + async "^2.0.0" + buffer-crc32 "^0.2.1" + glob "^7.0.0" + lodash "^4.8.0" + readable-stream "^2.0.0" + tar-stream "^1.5.0" + zip-stream "^1.2.0" + + are-we-there-yet@~1.1.2: + version "1.1.4" + resolved "https://registry.yarnpkg.com/are-we-there-yet/-/are-we-there-yet-1.1.4.tgz#bb5dca382bb94f05e15194373d16fd3ba1ca110d" + dependencies: + delegates "^1.0.0" + readable-stream "^2.0.6" + + argparse@^1.0.7: + version "1.0.10" + resolved "https://registry.yarnpkg.com/argparse/-/argparse-1.0.10.tgz#bcd6791ea5ae09725e17e5ad988134cd40b3d911" + dependencies: + sprintf-js "~1.0.2" + + args@3.0.8: + version "3.0.8" + resolved "https://registry.yarnpkg.com/args/-/args-3.0.8.tgz#2f425ab639c69d74ff728f3d7c6e93b97b91af7c" + dependencies: + camelcase "4.1.0" + chalk "2.1.0" + mri "1.1.0" + pkginfo "0.4.1" + string-similarity "1.2.0" + + arr-diff@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/arr-diff/-/arr-diff-2.0.0.tgz#8f3b827f955a8bd669697e4a4256ac3ceae356cf" + dependencies: + arr-flatten "^1.0.1" + + arr-exclude@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/arr-exclude/-/arr-exclude-1.0.0.tgz#dfc7c2e552a270723ccda04cf3128c8cbfe5c631" + + arr-flatten@^1.0.1: + version "1.1.0" + resolved "https://registry.yarnpkg.com/arr-flatten/-/arr-flatten-1.1.0.tgz#36048bbff4e7b47e136644316c99669ea5ae91f1" + + array-differ@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/array-differ/-/array-differ-1.0.0.tgz#eff52e3758249d33be402b8bb8e564bb2b5d4031" + + array-find-index@^1.0.1: + version "1.0.2" + resolved "https://registry.yarnpkg.com/array-find-index/-/array-find-index-1.0.2.tgz#df010aa1287e164bbda6f9723b0a96a1ec4187a1" + + array-includes@^3.0.3: + version "3.0.3" + resolved "https://registry.yarnpkg.com/array-includes/-/array-includes-3.0.3.tgz#184b48f62d92d7452bb31b323165c7f8bd02266d" + dependencies: + define-properties "^1.1.2" + es-abstract "^1.7.0" + + array-union@^1.0.1: + version "1.0.2" + resolved "https://registry.yarnpkg.com/array-union/-/array-union-1.0.2.tgz#9a34410e4f4e3da23dea375be5be70f24778ec39" + dependencies: + array-uniq "^1.0.1" + + array-uniq@^1.0.1, array-uniq@^1.0.2: + version "1.0.3" + resolved "https://registry.yarnpkg.com/array-uniq/-/array-uniq-1.0.3.tgz#af6ac877a25cc7f74e058894753858dfdb24fdb6" + + array-unique@^0.2.1: + version "0.2.1" + resolved "https://registry.yarnpkg.com/array-unique/-/array-unique-0.2.1.tgz#a1d97ccafcbc2625cc70fadceb36a50c58b01a53" + + arrify@^1.0.0, arrify@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/arrify/-/arrify-1.0.1.tgz#898508da2226f380df904728456849c1501a4b0d" + + asap@~2.0.3: + version "2.0.6" + resolved "https://registry.yarnpkg.com/asap/-/asap-2.0.6.tgz#e50347611d7e690943208bbdafebcbc2fb866d46" + + asn1.js@^4.0.0: + version "4.10.1" + resolved "https://registry.yarnpkg.com/asn1.js/-/asn1.js-4.10.1.tgz#b9c2bf5805f1e64aadeed6df3a2bfafb5a73f5a0" + dependencies: + bn.js "^4.0.0" + inherits "^2.0.1" + minimalistic-assert "^1.0.0" + + asn1@~0.2.3: + version "0.2.3" + resolved "https://registry.yarnpkg.com/asn1/-/asn1-0.2.3.tgz#dac8787713c9966849fc8180777ebe9c1ddf3b86" + + assert-plus@1.0.0, assert-plus@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/assert-plus/-/assert-plus-1.0.0.tgz#f12e0f3c5d77b0b1cdd9146942e4e96c1e4dd525" + + assert-plus@^0.2.0: + version "0.2.0" + resolved "https://registry.yarnpkg.com/assert-plus/-/assert-plus-0.2.0.tgz#d74e1b87e7affc0db8aadb7021f3fe48101ab234" + + assert@^1.1.1: + version "1.4.1" + resolved "https://registry.yarnpkg.com/assert/-/assert-1.4.1.tgz#99912d591836b5a6f5b345c0f07eefc08fc65d91" + dependencies: + util "0.10.3" + + ast-types@0.10.1: + version "0.10.1" + resolved "https://registry.yarnpkg.com/ast-types/-/ast-types-0.10.1.tgz#f52fca9715579a14f841d67d7f8d25432ab6a3dd" + + async-each@^1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/async-each/-/async-each-1.0.1.tgz#19d386a1d9edc6e7c1c85d388aedbcc56d33602d" + + async-exit-hook@^2.0.1: + version "2.0.1" + resolved "https://registry.yarnpkg.com/async-exit-hook/-/async-exit-hook-2.0.1.tgz#8bd8b024b0ec9b1c01cccb9af9db29bd717dfaf3" + + async@^2.0.0, async@^2.1.2: + version "2.6.0" + resolved "https://registry.yarnpkg.com/async/-/async-2.6.0.tgz#61a29abb6fcc026fea77e56d1c6ec53a795951f4" + dependencies: + lodash "^4.14.0" + + asynckit@^0.4.0: + version "0.4.0" + resolved "https://registry.yarnpkg.com/asynckit/-/asynckit-0.4.0.tgz#c79ed97f7f34cb8f2ba1bc9790bcc366474b4b79" + + atob@~1.1.0: + version "1.1.3" + resolved "https://registry.yarnpkg.com/atob/-/atob-1.1.3.tgz#95f13629b12c3a51a5d215abdce2aa9f32f80773" + + auto-bind@^1.1.0: + version "1.2.0" + resolved "https://registry.yarnpkg.com/auto-bind/-/auto-bind-1.2.0.tgz#8b7e318aad53d43ba8a8ecaf0066d85d5f798cd6" + + autoprefixer@^6.3.1: + version "6.7.7" + resolved "https://registry.yarnpkg.com/autoprefixer/-/autoprefixer-6.7.7.tgz#1dbd1c835658e35ce3f9984099db00585c782014" + dependencies: + browserslist "^1.7.6" + caniuse-db "^1.0.30000634" + normalize-range "^0.1.2" + num2fraction "^1.2.2" + postcss "^5.2.16" + postcss-value-parser "^3.2.3" + + ava-init@^0.2.0: + version "0.2.1" + resolved "https://registry.yarnpkg.com/ava-init/-/ava-init-0.2.1.tgz#75ac4c8553326290d2866e63b62fa7035684bd58" + dependencies: + arr-exclude "^1.0.0" + execa "^0.7.0" + has-yarn "^1.0.0" + read-pkg-up "^2.0.0" + write-pkg "^3.1.0" + + ava@0.25.0: + version "0.25.0" + resolved "https://registry.yarnpkg.com/ava/-/ava-0.25.0.tgz#8ac87780514f96a6fd42e1306eaa0752ce3a407f" + dependencies: + "@ava/babel-preset-stage-4" "^1.1.0" + "@ava/babel-preset-transform-test-files" "^3.0.0" + "@ava/write-file-atomic" "^2.2.0" + "@concordance/react" "^1.0.0" + "@ladjs/time-require" "^0.1.4" + ansi-escapes "^3.0.0" + ansi-styles "^3.1.0" + arr-flatten "^1.0.1" + array-union "^1.0.1" + array-uniq "^1.0.2" + arrify "^1.0.0" + auto-bind "^1.1.0" + ava-init "^0.2.0" + babel-core "^6.17.0" + babel-generator "^6.26.0" + babel-plugin-syntax-object-rest-spread "^6.13.0" + bluebird "^3.0.0" + caching-transform "^1.0.0" + chalk "^2.0.1" + chokidar "^1.4.2" + clean-stack "^1.1.1" + clean-yaml-object "^0.1.0" + cli-cursor "^2.1.0" + cli-spinners "^1.0.0" + cli-truncate "^1.0.0" + co-with-promise "^4.6.0" + code-excerpt "^2.1.1" + common-path-prefix "^1.0.0" + concordance "^3.0.0" + convert-source-map "^1.5.1" + core-assert "^0.2.0" + currently-unhandled "^0.4.1" + debug "^3.0.1" + dot-prop "^4.1.0" + empower-core "^0.6.1" + equal-length "^1.0.0" + figures "^2.0.0" + find-cache-dir "^1.0.0" + fn-name "^2.0.0" + get-port "^3.0.0" + globby "^6.0.0" + has-flag "^2.0.0" + hullabaloo-config-manager "^1.1.0" + ignore-by-default "^1.0.0" + import-local "^0.1.1" + indent-string "^3.0.0" + is-ci "^1.0.7" + is-generator-fn "^1.0.0" + is-obj "^1.0.0" + is-observable "^1.0.0" + is-promise "^2.1.0" + last-line-stream "^1.0.0" + lodash.clonedeepwith "^4.5.0" + lodash.debounce "^4.0.3" + lodash.difference "^4.3.0" + lodash.flatten "^4.2.0" + loud-rejection "^1.2.0" + make-dir "^1.0.0" + matcher "^1.0.0" + md5-hex "^2.0.0" + meow "^3.7.0" + ms "^2.0.0" + multimatch "^2.1.0" + observable-to-promise "^0.5.0" + option-chain "^1.0.0" + package-hash "^2.0.0" + pkg-conf "^2.0.0" + plur "^2.0.0" + pretty-ms "^3.0.0" + require-precompiled "^0.1.0" + resolve-cwd "^2.0.0" + safe-buffer "^5.1.1" + semver "^5.4.1" + slash "^1.0.0" + source-map-support "^0.5.0" + stack-utils "^1.0.1" + strip-ansi "^4.0.0" + strip-bom-buf "^1.0.0" + supertap "^1.0.0" + supports-color "^5.0.0" + trim-off-newlines "^1.0.1" + unique-temp-dir "^1.0.0" + update-notifier "^2.3.0" + + aws-sign2@~0.6.0: + version "0.6.0" + resolved "https://registry.yarnpkg.com/aws-sign2/-/aws-sign2-0.6.0.tgz#14342dd38dbcc94d0e5b87d763cd63612c0e794f" + + aws-sign2@~0.7.0: + version "0.7.0" + resolved "https://registry.yarnpkg.com/aws-sign2/-/aws-sign2-0.7.0.tgz#b46e890934a9591f2d2f6f86d7e6a9f1b3fe76a8" + + aws4@^1.2.1, aws4@^1.6.0: + version "1.6.0" + resolved "https://registry.yarnpkg.com/aws4/-/aws4-1.6.0.tgz#83ef5ca860b2b32e4a0deedee8c771b9db57471e" + + babel-cli@6.26.0: + version "6.26.0" + resolved "https://registry.yarnpkg.com/babel-cli/-/babel-cli-6.26.0.tgz#502ab54874d7db88ad00b887a06383ce03d002f1" + dependencies: + babel-core "^6.26.0" + babel-polyfill "^6.26.0" + babel-register "^6.26.0" + babel-runtime "^6.26.0" + commander "^2.11.0" + convert-source-map "^1.5.0" + fs-readdir-recursive "^1.0.0" + glob "^7.1.2" + lodash "^4.17.4" + output-file-sync "^1.1.2" + path-is-absolute "^1.0.1" + slash "^1.0.0" + source-map "^0.5.6" + v8flags "^2.1.1" + optionalDependencies: + chokidar "^1.6.1" + + babel-code-frame@^6.22.0, babel-code-frame@^6.26.0: + version "6.26.0" + resolved "https://registry.yarnpkg.com/babel-code-frame/-/babel-code-frame-6.26.0.tgz#63fd43f7dc1e3bb7ce35947db8fe369a3f58c74b" + dependencies: + chalk "^1.1.3" + esutils "^2.0.2" + js-tokens "^3.0.2" + + babel-core@6.26.0, babel-core@^6.17.0, babel-core@^6.26.0: + version "6.26.0" + resolved "https://registry.yarnpkg.com/babel-core/-/babel-core-6.26.0.tgz#af32f78b31a6fcef119c87b0fd8d9753f03a0bb8" + dependencies: + babel-code-frame "^6.26.0" + babel-generator "^6.26.0" + babel-helpers "^6.24.1" + babel-messages "^6.23.0" + babel-register "^6.26.0" + babel-runtime "^6.26.0" + babel-template "^6.26.0" + babel-traverse "^6.26.0" + babel-types "^6.26.0" + babylon "^6.18.0" + convert-source-map "^1.5.0" + debug "^2.6.8" + json5 "^0.5.1" + lodash "^4.17.4" + minimatch "^3.0.4" + path-is-absolute "^1.0.1" + private "^0.1.7" + slash "^1.0.0" + source-map "^0.5.6" + + babel-generator@^6.1.0, babel-generator@^6.26.0: + version "6.26.1" + resolved "https://registry.yarnpkg.com/babel-generator/-/babel-generator-6.26.1.tgz#1844408d3b8f0d35a404ea7ac180f087a601bd90" + dependencies: + babel-messages "^6.23.0" + babel-runtime "^6.26.0" + babel-types "^6.26.0" + detect-indent "^4.0.0" + jsesc "^1.3.0" + lodash "^4.17.4" + source-map "^0.5.7" + trim-right "^1.0.1" + + babel-helper-builder-binary-assignment-operator-visitor@^6.24.1: + version "6.24.1" + resolved "https://registry.yarnpkg.com/babel-helper-builder-binary-assignment-operator-visitor/-/babel-helper-builder-binary-assignment-operator-visitor-6.24.1.tgz#cce4517ada356f4220bcae8a02c2b346f9a56664" + dependencies: + babel-helper-explode-assignable-expression "^6.24.1" + babel-runtime "^6.22.0" + babel-types "^6.24.1" + + babel-helper-builder-react-jsx@^6.24.1: + version "6.26.0" + resolved "https://registry.yarnpkg.com/babel-helper-builder-react-jsx/-/babel-helper-builder-react-jsx-6.26.0.tgz#39ff8313b75c8b65dceff1f31d383e0ff2a408a0" + dependencies: + babel-runtime "^6.26.0" + babel-types "^6.26.0" + esutils "^2.0.2" + + babel-helper-call-delegate@^6.24.1: + version "6.24.1" + resolved "https://registry.yarnpkg.com/babel-helper-call-delegate/-/babel-helper-call-delegate-6.24.1.tgz#ece6aacddc76e41c3461f88bfc575bd0daa2df8d" + dependencies: + babel-helper-hoist-variables "^6.24.1" + babel-runtime "^6.22.0" + babel-traverse "^6.24.1" + babel-types "^6.24.1" + + babel-helper-evaluate-path@^0.1.0: + version "0.1.0" + resolved "https://registry.yarnpkg.com/babel-helper-evaluate-path/-/babel-helper-evaluate-path-0.1.0.tgz#95d98c4ea36150483db2e7d3ec9e1954a72629cb" + + babel-helper-explode-assignable-expression@^6.24.1: + version "6.24.1" + resolved "https://registry.yarnpkg.com/babel-helper-explode-assignable-expression/-/babel-helper-explode-assignable-expression-6.24.1.tgz#f25b82cf7dc10433c55f70592d5746400ac22caa" + dependencies: + babel-runtime "^6.22.0" + babel-traverse "^6.24.1" + babel-types "^6.24.1" + + babel-helper-flip-expressions@^0.1.2: + version "0.1.2" + resolved "https://registry.yarnpkg.com/babel-helper-flip-expressions/-/babel-helper-flip-expressions-0.1.2.tgz#77f6652f9de9c42401d827bd46ebd2109e3ef18a" + + babel-helper-function-name@^6.24.1: + version "6.24.1" + resolved "https://registry.yarnpkg.com/babel-helper-function-name/-/babel-helper-function-name-6.24.1.tgz#d3475b8c03ed98242a25b48351ab18399d3580a9" + dependencies: + babel-helper-get-function-arity "^6.24.1" + babel-runtime "^6.22.0" + babel-template "^6.24.1" + babel-traverse "^6.24.1" + babel-types "^6.24.1" + + babel-helper-get-function-arity@^6.24.1: + version "6.24.1" + resolved "https://registry.yarnpkg.com/babel-helper-get-function-arity/-/babel-helper-get-function-arity-6.24.1.tgz#8f7782aa93407c41d3aa50908f89b031b1b6853d" + dependencies: + babel-runtime "^6.22.0" + babel-types "^6.24.1" + + babel-helper-hoist-variables@^6.24.1: + version "6.24.1" + resolved "https://registry.yarnpkg.com/babel-helper-hoist-variables/-/babel-helper-hoist-variables-6.24.1.tgz#1ecb27689c9d25513eadbc9914a73f5408be7a76" + dependencies: + babel-runtime "^6.22.0" + babel-types "^6.24.1" + + babel-helper-is-nodes-equiv@^0.0.1: + version "0.0.1" + resolved "https://registry.yarnpkg.com/babel-helper-is-nodes-equiv/-/babel-helper-is-nodes-equiv-0.0.1.tgz#34e9b300b1479ddd98ec77ea0bbe9342dfe39684" + + babel-helper-is-void-0@^0.1.1: + version "0.1.1" + resolved "https://registry.yarnpkg.com/babel-helper-is-void-0/-/babel-helper-is-void-0-0.1.1.tgz#72f21a3abba0bef3837f9174fca731aed9a02888" + + babel-helper-mark-eval-scopes@^0.1.1: + version "0.1.1" + resolved "https://registry.yarnpkg.com/babel-helper-mark-eval-scopes/-/babel-helper-mark-eval-scopes-0.1.1.tgz#4554345edf9f2549427bd2098e530253f8af2992" + + babel-helper-regex@^6.24.1: + version "6.26.0" + resolved "https://registry.yarnpkg.com/babel-helper-regex/-/babel-helper-regex-6.26.0.tgz#325c59f902f82f24b74faceed0363954f6495e72" + dependencies: + babel-runtime "^6.26.0" + babel-types "^6.26.0" + lodash "^4.17.4" + + babel-helper-remap-async-to-generator@^6.24.1: + version "6.24.1" + resolved "https://registry.yarnpkg.com/babel-helper-remap-async-to-generator/-/babel-helper-remap-async-to-generator-6.24.1.tgz#5ec581827ad723fecdd381f1c928390676e4551b" + dependencies: + babel-helper-function-name "^6.24.1" + babel-runtime "^6.22.0" + babel-template "^6.24.1" + babel-traverse "^6.24.1" + babel-types "^6.24.1" + + babel-helper-remove-or-void@^0.1.1: + version "0.1.1" + resolved "https://registry.yarnpkg.com/babel-helper-remove-or-void/-/babel-helper-remove-or-void-0.1.1.tgz#9d7e1856dc6fafcb41b283a416730dc1844f66d7" + + babel-helper-to-multiple-sequence-expressions@^0.1.1: + version "0.1.1" + resolved "https://registry.yarnpkg.com/babel-helper-to-multiple-sequence-expressions/-/babel-helper-to-multiple-sequence-expressions-0.1.1.tgz#5f1b832b39e4acf954e9137f0251395c71196b35" + + babel-helpers@^6.24.1: + version "6.24.1" + resolved "https://registry.yarnpkg.com/babel-helpers/-/babel-helpers-6.24.1.tgz#3471de9caec388e5c850e597e58a26ddf37602b2" + dependencies: + babel-runtime "^6.22.0" + babel-template "^6.24.1" + + babel-loader@7.1.2: + version "7.1.2" + resolved "https://registry.yarnpkg.com/babel-loader/-/babel-loader-7.1.2.tgz#f6cbe122710f1aa2af4d881c6d5b54358ca24126" + dependencies: + find-cache-dir "^1.0.0" + loader-utils "^1.0.2" + mkdirp "^0.5.1" + + babel-messages@^6.23.0: + version "6.23.0" + resolved "https://registry.yarnpkg.com/babel-messages/-/babel-messages-6.23.0.tgz#f3cdf4703858035b2a2951c6ec5edf6c62f2630e" + dependencies: + babel-runtime "^6.22.0" + + babel-plugin-check-es2015-constants@^6.8.0: + version "6.22.0" + resolved "https://registry.yarnpkg.com/babel-plugin-check-es2015-constants/-/babel-plugin-check-es2015-constants-6.22.0.tgz#35157b101426fd2ffd3da3f75c7d1e91835bbf8a" + dependencies: + babel-runtime "^6.22.0" + + babel-plugin-espower@^2.3.2: + version "2.4.0" + resolved "https://registry.yarnpkg.com/babel-plugin-espower/-/babel-plugin-espower-2.4.0.tgz#9f92c080e9adfe73f69baed7ab3e24f649009373" + dependencies: + babel-generator "^6.1.0" + babylon "^6.1.0" + call-matcher "^1.0.0" + core-js "^2.0.0" + espower-location-detector "^1.0.0" + espurify "^1.6.0" + estraverse "^4.1.1" + + babel-plugin-minify-builtins@^0.1.3: + version "0.1.3" + resolved "https://registry.yarnpkg.com/babel-plugin-minify-builtins/-/babel-plugin-minify-builtins-0.1.3.tgz#4f21a7dcb51f91a04ea71d47ff0e8e3b05fec021" + dependencies: + babel-helper-evaluate-path "^0.1.0" + + babel-plugin-minify-constant-folding@^0.1.3: + version "0.1.3" + resolved "https://registry.yarnpkg.com/babel-plugin-minify-constant-folding/-/babel-plugin-minify-constant-folding-0.1.3.tgz#57bd172adf8b8d74ad7c99612eb950414ebea3ca" + dependencies: + babel-helper-evaluate-path "^0.1.0" + + babel-plugin-minify-dead-code-elimination@^0.1.7: + version "0.1.7" + resolved "https://registry.yarnpkg.com/babel-plugin-minify-dead-code-elimination/-/babel-plugin-minify-dead-code-elimination-0.1.7.tgz#774f536f347b98393a27baa717872968813c342c" + dependencies: + babel-helper-mark-eval-scopes "^0.1.1" + babel-helper-remove-or-void "^0.1.1" + lodash.some "^4.6.0" + + babel-plugin-minify-flip-comparisons@^0.1.2: + version "0.1.2" + resolved "https://registry.yarnpkg.com/babel-plugin-minify-flip-comparisons/-/babel-plugin-minify-flip-comparisons-0.1.2.tgz#e286b40b7599b18dfea195071e4279465cfc1884" + dependencies: + babel-helper-is-void-0 "^0.1.1" + + babel-plugin-minify-guarded-expressions@^0.1.2: + version "0.1.2" + resolved "https://registry.yarnpkg.com/babel-plugin-minify-guarded-expressions/-/babel-plugin-minify-guarded-expressions-0.1.2.tgz#dfc3d473b0362d9605d3ce0ac1e22328c60d1007" + dependencies: + babel-helper-flip-expressions "^0.1.2" + + babel-plugin-minify-infinity@^0.1.2: + version "0.1.2" + resolved "https://registry.yarnpkg.com/babel-plugin-minify-infinity/-/babel-plugin-minify-infinity-0.1.2.tgz#5f1cf67ddedcba13c8a00da832542df0091a1cd4" + + babel-plugin-minify-mangle-names@^0.1.3: + version "0.1.3" + resolved "https://registry.yarnpkg.com/babel-plugin-minify-mangle-names/-/babel-plugin-minify-mangle-names-0.1.3.tgz#bfa24661a6794fb03833587e55828b65449e06fe" + dependencies: + babel-helper-mark-eval-scopes "^0.1.1" + + babel-plugin-minify-numeric-literals@^0.1.1: + version "0.1.1" + resolved "https://registry.yarnpkg.com/babel-plugin-minify-numeric-literals/-/babel-plugin-minify-numeric-literals-0.1.1.tgz#d4b8b0c925f874714ee33ee4b26678583d7ce7fb" + + babel-plugin-minify-replace@^0.1.2: + version "0.1.2" + resolved "https://registry.yarnpkg.com/babel-plugin-minify-replace/-/babel-plugin-minify-replace-0.1.2.tgz#b90b9e71ab4d3b36325629a91beabe13b0b16ac1" + + babel-plugin-minify-simplify@^0.1.2: + version "0.1.2" + resolved "https://registry.yarnpkg.com/babel-plugin-minify-simplify/-/babel-plugin-minify-simplify-0.1.2.tgz#a968f1658fdeb2fc759e81fe331d89829df0f6b9" + dependencies: + babel-helper-flip-expressions "^0.1.2" + babel-helper-is-nodes-equiv "^0.0.1" + babel-helper-to-multiple-sequence-expressions "^0.1.1" + + babel-plugin-minify-type-constructors@^0.1.2: + version "0.1.2" + resolved "https://registry.yarnpkg.com/babel-plugin-minify-type-constructors/-/babel-plugin-minify-type-constructors-0.1.2.tgz#db53c5b76cb8e2fcd45d862f17104c78761337ee" + dependencies: + babel-helper-is-void-0 "^0.1.1" + + babel-plugin-syntax-async-functions@^6.8.0: + version "6.13.0" + resolved "https://registry.yarnpkg.com/babel-plugin-syntax-async-functions/-/babel-plugin-syntax-async-functions-6.13.0.tgz#cad9cad1191b5ad634bf30ae0872391e0647be95" + + babel-plugin-syntax-exponentiation-operator@^6.8.0: + version "6.13.0" + resolved "https://registry.yarnpkg.com/babel-plugin-syntax-exponentiation-operator/-/babel-plugin-syntax-exponentiation-operator-6.13.0.tgz#9ee7e8337290da95288201a6a57f4170317830de" + + babel-plugin-syntax-flow@^6.18.0: + version "6.18.0" + resolved "https://registry.yarnpkg.com/babel-plugin-syntax-flow/-/babel-plugin-syntax-flow-6.18.0.tgz#4c3ab20a2af26aa20cd25995c398c4eb70310c8d" + + babel-plugin-syntax-jsx@6.18.0, babel-plugin-syntax-jsx@^6.3.13, babel-plugin-syntax-jsx@^6.8.0: + version "6.18.0" + resolved "https://registry.yarnpkg.com/babel-plugin-syntax-jsx/-/babel-plugin-syntax-jsx-6.18.0.tgz#0af32a9a6e13ca7a3fd5069e62d7b0f58d0d8946" + + babel-plugin-syntax-object-rest-spread@^6.13.0: + version "6.13.0" + resolved "https://registry.yarnpkg.com/babel-plugin-syntax-object-rest-spread/-/babel-plugin-syntax-object-rest-spread-6.13.0.tgz#fd6536f2bce13836ffa3a5458c4903a597bb3bf5" + + babel-plugin-syntax-trailing-function-commas@^6.20.0: + version "6.22.0" + resolved "https://registry.yarnpkg.com/babel-plugin-syntax-trailing-function-commas/-/babel-plugin-syntax-trailing-function-commas-6.22.0.tgz#ba0360937f8d06e40180a43fe0d5616fff532cf3" + + babel-plugin-transform-async-to-generator@^6.16.0: + version "6.24.1" + resolved "https://registry.yarnpkg.com/babel-plugin-transform-async-to-generator/-/babel-plugin-transform-async-to-generator-6.24.1.tgz#6536e378aff6cb1d5517ac0e40eb3e9fc8d08761" + dependencies: + babel-helper-remap-async-to-generator "^6.24.1" + babel-plugin-syntax-async-functions "^6.8.0" + babel-runtime "^6.22.0" + + babel-plugin-transform-es2015-destructuring@^6.19.0: + version "6.23.0" + resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-destructuring/-/babel-plugin-transform-es2015-destructuring-6.23.0.tgz#997bb1f1ab967f682d2b0876fe358d60e765c56d" + dependencies: + babel-runtime "^6.22.0" + + babel-plugin-transform-es2015-function-name@^6.9.0: + version "6.24.1" + resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-function-name/-/babel-plugin-transform-es2015-function-name-6.24.1.tgz#834c89853bc36b1af0f3a4c5dbaa94fd8eacaa8b" + dependencies: + babel-helper-function-name "^6.24.1" + babel-runtime "^6.22.0" + babel-types "^6.24.1" + + babel-plugin-transform-es2015-modules-commonjs@^6.18.0: + version "6.26.0" + resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-modules-commonjs/-/babel-plugin-transform-es2015-modules-commonjs-6.26.0.tgz#0d8394029b7dc6abe1a97ef181e00758dd2e5d8a" + dependencies: + babel-plugin-transform-strict-mode "^6.24.1" + babel-runtime "^6.26.0" + babel-template "^6.26.0" + babel-types "^6.26.0" + + babel-plugin-transform-es2015-parameters@^6.21.0: + version "6.24.1" + resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-parameters/-/babel-plugin-transform-es2015-parameters-6.24.1.tgz#57ac351ab49caf14a97cd13b09f66fdf0a625f2b" + dependencies: + babel-helper-call-delegate "^6.24.1" + babel-helper-get-function-arity "^6.24.1" + babel-runtime "^6.22.0" + babel-template "^6.24.1" + babel-traverse "^6.24.1" + babel-types "^6.24.1" + + babel-plugin-transform-es2015-spread@^6.8.0: + version "6.22.0" + resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-spread/-/babel-plugin-transform-es2015-spread-6.22.0.tgz#d6d68a99f89aedc4536c81a542e8dd9f1746f8d1" + dependencies: + babel-runtime "^6.22.0" + + babel-plugin-transform-es2015-sticky-regex@^6.8.0: + version "6.24.1" + resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-sticky-regex/-/babel-plugin-transform-es2015-sticky-regex-6.24.1.tgz#00c1cdb1aca71112cdf0cf6126c2ed6b457ccdbc" + dependencies: + babel-helper-regex "^6.24.1" + babel-runtime "^6.22.0" + babel-types "^6.24.1" + + babel-plugin-transform-es2015-unicode-regex@^6.11.0: + version "6.24.1" + resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-unicode-regex/-/babel-plugin-transform-es2015-unicode-regex-6.24.1.tgz#d38b12f42ea7323f729387f18a7c5ae1faeb35e9" + dependencies: + babel-helper-regex "^6.24.1" + babel-runtime "^6.22.0" + regexpu-core "^2.0.0" + + babel-plugin-transform-exponentiation-operator@^6.8.0: + version "6.24.1" + resolved "https://registry.yarnpkg.com/babel-plugin-transform-exponentiation-operator/-/babel-plugin-transform-exponentiation-operator-6.24.1.tgz#2ab0c9c7f3098fa48907772bb813fe41e8de3a0e" + dependencies: + babel-helper-builder-binary-assignment-operator-visitor "^6.24.1" + babel-plugin-syntax-exponentiation-operator "^6.8.0" + babel-runtime "^6.22.0" + + babel-plugin-transform-flow-strip-types@^6.22.0: + version "6.22.0" + resolved "https://registry.yarnpkg.com/babel-plugin-transform-flow-strip-types/-/babel-plugin-transform-flow-strip-types-6.22.0.tgz#84cb672935d43714fdc32bce84568d87441cf7cf" + dependencies: + babel-plugin-syntax-flow "^6.18.0" + babel-runtime "^6.22.0" + + babel-plugin-transform-inline-consecutive-adds@^0.1.2: + version "0.1.2" + resolved "https://registry.yarnpkg.com/babel-plugin-transform-inline-consecutive-adds/-/babel-plugin-transform-inline-consecutive-adds-0.1.2.tgz#5442e9f1c19c78a7899f8a4dee6fd481f61001f5" + + babel-plugin-transform-member-expression-literals@^6.8.4: + version "6.9.0" + resolved "https://registry.yarnpkg.com/babel-plugin-transform-member-expression-literals/-/babel-plugin-transform-member-expression-literals-6.9.0.tgz#ab07ad52a11ff7d2528c71388e8f901a4499c2b2" + + babel-plugin-transform-merge-sibling-variables@^6.8.5: + version "6.9.0" + resolved "https://registry.yarnpkg.com/babel-plugin-transform-merge-sibling-variables/-/babel-plugin-transform-merge-sibling-variables-6.9.0.tgz#140017e305f8eb4f60d2f2db61154fbd71a9fcdd" + + babel-plugin-transform-minify-booleans@^6.8.2: + version "6.9.0" + resolved "https://registry.yarnpkg.com/babel-plugin-transform-minify-booleans/-/babel-plugin-transform-minify-booleans-6.9.0.tgz#e36ceaa49aadcae70ec98bd9dbccb660719a667a" + + babel-plugin-transform-property-literals@^6.8.4: + version "6.9.0" + resolved "https://registry.yarnpkg.com/babel-plugin-transform-property-literals/-/babel-plugin-transform-property-literals-6.9.0.tgz#4ddc12ada888927eacab4daff8a535ebc5de5a61" + dependencies: + esutils "^2.0.2" + + babel-plugin-transform-react-display-name@^6.23.0: + version "6.25.0" + resolved "https://registry.yarnpkg.com/babel-plugin-transform-react-display-name/-/babel-plugin-transform-react-display-name-6.25.0.tgz#67e2bf1f1e9c93ab08db96792e05392bf2cc28d1" + dependencies: + babel-runtime "^6.22.0" + + babel-plugin-transform-react-jsx-self@^6.22.0: + version "6.22.0" + resolved "https://registry.yarnpkg.com/babel-plugin-transform-react-jsx-self/-/babel-plugin-transform-react-jsx-self-6.22.0.tgz#df6d80a9da2612a121e6ddd7558bcbecf06e636e" + dependencies: + babel-plugin-syntax-jsx "^6.8.0" + babel-runtime "^6.22.0" + + babel-plugin-transform-react-jsx-source@^6.22.0: + version "6.22.0" + resolved "https://registry.yarnpkg.com/babel-plugin-transform-react-jsx-source/-/babel-plugin-transform-react-jsx-source-6.22.0.tgz#66ac12153f5cd2d17b3c19268f4bf0197f44ecd6" + dependencies: + babel-plugin-syntax-jsx "^6.8.0" + babel-runtime "^6.22.0" + + babel-plugin-transform-react-jsx@^6.24.1: + version "6.24.1" + resolved "https://registry.yarnpkg.com/babel-plugin-transform-react-jsx/-/babel-plugin-transform-react-jsx-6.24.1.tgz#840a028e7df460dfc3a2d29f0c0d91f6376e66a3" + dependencies: + babel-helper-builder-react-jsx "^6.24.1" + babel-plugin-syntax-jsx "^6.8.0" + babel-runtime "^6.22.0" + + babel-plugin-transform-regexp-constructors@^0.1.1: + version "0.1.1" + resolved "https://registry.yarnpkg.com/babel-plugin-transform-regexp-constructors/-/babel-plugin-transform-regexp-constructors-0.1.1.tgz#312ab7487cc88a1c62ee25ea1b6087e89b87799c" + + babel-plugin-transform-remove-console@^6.8.4: + version "6.9.0" + resolved "https://registry.yarnpkg.com/babel-plugin-transform-remove-console/-/babel-plugin-transform-remove-console-6.9.0.tgz#a7b671aab050dd30ef7cf2142b61a7d10efb327f" + + babel-plugin-transform-remove-debugger@^6.8.4: + version "6.9.0" + resolved "https://registry.yarnpkg.com/babel-plugin-transform-remove-debugger/-/babel-plugin-transform-remove-debugger-6.9.0.tgz#b465e74b3fbe1970da561fb1331e30aefac3f1fe" + + babel-plugin-transform-remove-undefined@^0.1.2: + version "0.1.2" + resolved "https://registry.yarnpkg.com/babel-plugin-transform-remove-undefined/-/babel-plugin-transform-remove-undefined-0.1.2.tgz#e1ebf51110f6b1e0665f28382ef73f95e5023652" + + babel-plugin-transform-simplify-comparison-operators@^6.8.4: + version "6.9.0" + resolved "https://registry.yarnpkg.com/babel-plugin-transform-simplify-comparison-operators/-/babel-plugin-transform-simplify-comparison-operators-6.9.0.tgz#586252fea023cb13f2400a09c0ab178dc0844f0a" + + babel-plugin-transform-strict-mode@^6.24.1: + version "6.24.1" + resolved "https://registry.yarnpkg.com/babel-plugin-transform-strict-mode/-/babel-plugin-transform-strict-mode-6.24.1.tgz#d5faf7aa578a65bbe591cf5edae04a0c67020758" + dependencies: + babel-runtime "^6.22.0" + babel-types "^6.24.1" + + babel-plugin-transform-undefined-to-void@^6.8.2: + version "6.9.0" + resolved "https://registry.yarnpkg.com/babel-plugin-transform-undefined-to-void/-/babel-plugin-transform-undefined-to-void-6.9.0.tgz#eb5db0554caffe9ded0206468ec0c6c3b332b9d2" + + babel-polyfill@^6.26.0: + version "6.26.0" + resolved "https://registry.yarnpkg.com/babel-polyfill/-/babel-polyfill-6.26.0.tgz#379937abc67d7895970adc621f284cd966cf2153" + dependencies: + babel-runtime "^6.26.0" + core-js "^2.5.0" + regenerator-runtime "^0.10.5" + + babel-preset-babili@0.1.4: + version "0.1.4" + resolved "https://registry.yarnpkg.com/babel-preset-babili/-/babel-preset-babili-0.1.4.tgz#ad9d6651002f5bc3f07cab300781167f54724bf2" + dependencies: + babel-plugin-minify-builtins "^0.1.3" + babel-plugin-minify-constant-folding "^0.1.3" + babel-plugin-minify-dead-code-elimination "^0.1.7" + babel-plugin-minify-flip-comparisons "^0.1.2" + babel-plugin-minify-guarded-expressions "^0.1.2" + babel-plugin-minify-infinity "^0.1.2" + babel-plugin-minify-mangle-names "^0.1.3" + babel-plugin-minify-numeric-literals "^0.1.1" + babel-plugin-minify-replace "^0.1.2" + babel-plugin-minify-simplify "^0.1.2" + babel-plugin-minify-type-constructors "^0.1.2" + babel-plugin-transform-inline-consecutive-adds "^0.1.2" + babel-plugin-transform-member-expression-literals "^6.8.4" + babel-plugin-transform-merge-sibling-variables "^6.8.5" + babel-plugin-transform-minify-booleans "^6.8.2" + babel-plugin-transform-property-literals "^6.8.4" + babel-plugin-transform-regexp-constructors "^0.1.1" + babel-plugin-transform-remove-console "^6.8.4" + babel-plugin-transform-remove-debugger "^6.8.4" + babel-plugin-transform-remove-undefined "^0.1.2" + babel-plugin-transform-simplify-comparison-operators "^6.8.4" + babel-plugin-transform-undefined-to-void "^6.8.2" + lodash.isplainobject "^4.0.6" + + babel-preset-flow@^6.23.0: + version "6.23.0" + resolved "https://registry.yarnpkg.com/babel-preset-flow/-/babel-preset-flow-6.23.0.tgz#e71218887085ae9a24b5be4169affb599816c49d" + dependencies: + babel-plugin-transform-flow-strip-types "^6.22.0" + + babel-preset-react@6.24.1: + version "6.24.1" + resolved "https://registry.yarnpkg.com/babel-preset-react/-/babel-preset-react-6.24.1.tgz#ba69dfaea45fc3ec639b6a4ecea6e17702c91380" + dependencies: + babel-plugin-syntax-jsx "^6.3.13" + babel-plugin-transform-react-display-name "^6.23.0" + babel-plugin-transform-react-jsx "^6.24.1" + babel-plugin-transform-react-jsx-self "^6.22.0" + babel-plugin-transform-react-jsx-source "^6.22.0" + babel-preset-flow "^6.23.0" + + babel-register@^6.26.0: + version "6.26.0" + resolved "https://registry.yarnpkg.com/babel-register/-/babel-register-6.26.0.tgz#6ed021173e2fcb486d7acb45c6009a856f647071" + dependencies: + babel-core "^6.26.0" + babel-runtime "^6.26.0" + core-js "^2.5.0" + home-or-tmp "^2.0.0" + lodash "^4.17.4" + mkdirp "^0.5.1" + source-map-support "^0.4.15" + + babel-runtime@^6.22.0, babel-runtime@^6.26.0: + version "6.26.0" + resolved "https://registry.yarnpkg.com/babel-runtime/-/babel-runtime-6.26.0.tgz#965c7058668e82b55d7bfe04ff2337bc8b5647fe" + dependencies: + core-js "^2.4.0" + regenerator-runtime "^0.11.0" + + babel-template@^6.24.1, babel-template@^6.26.0: + version "6.26.0" + resolved "https://registry.yarnpkg.com/babel-template/-/babel-template-6.26.0.tgz#de03e2d16396b069f46dd9fff8521fb1a0e35e02" + dependencies: + babel-runtime "^6.26.0" + babel-traverse "^6.26.0" + babel-types "^6.26.0" + babylon "^6.18.0" + lodash "^4.17.4" + + babel-traverse@^6.24.1, babel-traverse@^6.26.0: + version "6.26.0" + resolved "https://registry.yarnpkg.com/babel-traverse/-/babel-traverse-6.26.0.tgz#46a9cbd7edcc62c8e5c064e2d2d8d0f4035766ee" + dependencies: + babel-code-frame "^6.26.0" + babel-messages "^6.23.0" + babel-runtime "^6.26.0" + babel-types "^6.26.0" + babylon "^6.18.0" + debug "^2.6.8" + globals "^9.18.0" + invariant "^2.2.2" + lodash "^4.17.4" + + babel-types@6.26.0, babel-types@^6.24.1, babel-types@^6.26.0: + version "6.26.0" + resolved "https://registry.yarnpkg.com/babel-types/-/babel-types-6.26.0.tgz#a3b073f94ab49eb6fa55cd65227a334380632497" + dependencies: + babel-runtime "^6.26.0" + esutils "^2.0.2" + lodash "^4.17.4" + to-fast-properties "^1.0.3" + + babylon@^6.1.0, babylon@^6.18.0: + version "6.18.0" + resolved "https://registry.yarnpkg.com/babylon/-/babylon-6.18.0.tgz#af2f3b88fa6f5c1e4c634d1a0f8eac4f55b395e3" + + balanced-match@^0.4.2: + version "0.4.2" + resolved "https://registry.yarnpkg.com/balanced-match/-/balanced-match-0.4.2.tgz#cb3f3e3c732dc0f01ee70b403f302e61d7709838" + + balanced-match@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/balanced-match/-/balanced-match-1.0.0.tgz#89b4d199ab2bee49de164ea02b89ce462d71b767" + + base64-js@1.2.0: + version "1.2.0" + resolved "https://registry.yarnpkg.com/base64-js/-/base64-js-1.2.0.tgz#a39992d723584811982be5e290bb6a53d86700f1" + + base64-js@^1.0.2: + version "1.2.3" + resolved "https://registry.yarnpkg.com/base64-js/-/base64-js-1.2.3.tgz#fb13668233d9614cf5fb4bce95a9ba4096cdf801" + + bcrypt-pbkdf@^1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/bcrypt-pbkdf/-/bcrypt-pbkdf-1.0.1.tgz#63bc5dcb61331b92bc05fd528953c33462a06f8d" + dependencies: + tweetnacl "^0.14.3" + + big.js@^3.1.3: + version "3.2.0" + resolved "https://registry.yarnpkg.com/big.js/-/big.js-3.2.0.tgz#a5fc298b81b9e0dca2e458824784b65c52ba588e" + + binary-extensions@^1.0.0: + version "1.11.0" + resolved "https://registry.yarnpkg.com/binary-extensions/-/binary-extensions-1.11.0.tgz#46aa1751fb6a2f93ee5e689bb1087d4b14c6c205" + + bl@^1.0.0: + version "1.2.1" + resolved "https://registry.yarnpkg.com/bl/-/bl-1.2.1.tgz#cac328f7bee45730d404b692203fcb590e172d5e" + dependencies: + readable-stream "^2.0.5" + + block-stream@*: + version "0.0.9" + resolved "https://registry.yarnpkg.com/block-stream/-/block-stream-0.0.9.tgz#13ebfe778a03205cfe03751481ebb4b3300c126a" + dependencies: + inherits "~2.0.0" + + bluebird-lst@^1.0.5: + version "1.0.5" + resolved "https://registry.yarnpkg.com/bluebird-lst/-/bluebird-lst-1.0.5.tgz#bebc83026b7e92a72871a3dc599e219cbfb002a9" + dependencies: + bluebird "^3.5.1" + + bluebird@^3.0.0, bluebird@^3.5.0, bluebird@^3.5.1: + version "3.5.1" + resolved "https://registry.yarnpkg.com/bluebird/-/bluebird-3.5.1.tgz#d9551f9de98f1fcda1e683d17ee91a0602ee2eb9" + + bn.js@^4.0.0, bn.js@^4.1.0, bn.js@^4.1.1, bn.js@^4.4.0: + version "4.11.8" + resolved "https://registry.yarnpkg.com/bn.js/-/bn.js-4.11.8.tgz#2cde09eb5ee341f484746bb0309b3253b1b1442f" + + boom@2.x.x: + version "2.10.1" + resolved "https://registry.yarnpkg.com/boom/-/boom-2.10.1.tgz#39c8918ceff5799f83f9492a848f625add0c766f" + dependencies: + hoek "2.x.x" + + boom@4.x.x: + version "4.3.1" + resolved "https://registry.yarnpkg.com/boom/-/boom-4.3.1.tgz#4f8a3005cb4a7e3889f749030fd25b96e01d2e31" + dependencies: + hoek "4.x.x" + + boom@5.x.x: + version "5.2.0" + resolved "https://registry.yarnpkg.com/boom/-/boom-5.2.0.tgz#5dd9da6ee3a5f302077436290cb717d3f4a54e02" + dependencies: + hoek "4.x.x" + + boxen@^1.2.1: + version "1.3.0" + resolved "https://registry.yarnpkg.com/boxen/-/boxen-1.3.0.tgz#55c6c39a8ba58d9c61ad22cd877532deb665a20b" + dependencies: + ansi-align "^2.0.0" + camelcase "^4.0.0" + chalk "^2.0.1" + cli-boxes "^1.0.0" + string-width "^2.0.0" + term-size "^1.2.0" + widest-line "^2.0.0" + + brace-expansion@^1.1.7: + version "1.1.11" + resolved "https://registry.yarnpkg.com/brace-expansion/-/brace-expansion-1.1.11.tgz#3c7fcbf529d87226f3d2f52b966ff5271eb441dd" + dependencies: + balanced-match "^1.0.0" + concat-map "0.0.1" + + braces@^1.8.2: + version "1.8.5" + resolved "https://registry.yarnpkg.com/braces/-/braces-1.8.5.tgz#ba77962e12dff969d6b76711e914b737857bf6a7" + dependencies: + expand-range "^1.8.1" + preserve "^0.2.0" + repeat-element "^1.1.2" + + brorand@^1.0.1: + version "1.1.0" + resolved "https://registry.yarnpkg.com/brorand/-/brorand-1.1.0.tgz#12c25efe40a45e3c323eb8675a0a0ce57b22371f" + + browserify-aes@^1.0.0, browserify-aes@^1.0.4: + version "1.1.1" + resolved "https://registry.yarnpkg.com/browserify-aes/-/browserify-aes-1.1.1.tgz#38b7ab55edb806ff2dcda1a7f1620773a477c49f" + dependencies: + buffer-xor "^1.0.3" + cipher-base "^1.0.0" + create-hash "^1.1.0" + evp_bytestokey "^1.0.3" + inherits "^2.0.1" + safe-buffer "^5.0.1" + + browserify-cipher@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/browserify-cipher/-/browserify-cipher-1.0.0.tgz#9988244874bf5ed4e28da95666dcd66ac8fc363a" + dependencies: + browserify-aes "^1.0.4" + browserify-des "^1.0.0" + evp_bytestokey "^1.0.0" + + browserify-des@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/browserify-des/-/browserify-des-1.0.0.tgz#daa277717470922ed2fe18594118a175439721dd" + dependencies: + cipher-base "^1.0.1" + des.js "^1.0.0" + inherits "^2.0.1" + + browserify-rsa@^4.0.0: + version "4.0.1" + resolved "https://registry.yarnpkg.com/browserify-rsa/-/browserify-rsa-4.0.1.tgz#21e0abfaf6f2029cf2fafb133567a701d4135524" + dependencies: + bn.js "^4.1.0" + randombytes "^2.0.1" + + browserify-sign@^4.0.0: + version "4.0.4" + resolved "https://registry.yarnpkg.com/browserify-sign/-/browserify-sign-4.0.4.tgz#aa4eb68e5d7b658baa6bf6a57e630cbd7a93d298" + dependencies: + bn.js "^4.1.1" + browserify-rsa "^4.0.0" + create-hash "^1.1.0" + create-hmac "^1.1.2" + elliptic "^6.0.0" + inherits "^2.0.1" + parse-asn1 "^5.0.0" + + browserify-zlib@^0.2.0: + version "0.2.0" + resolved "https://registry.yarnpkg.com/browserify-zlib/-/browserify-zlib-0.2.0.tgz#2869459d9aa3be245fe8fe2ca1f46e2e7f54d73f" + dependencies: + pako "~1.0.5" + + browserslist@^1.3.6, browserslist@^1.5.2, browserslist@^1.7.6: + version "1.7.7" + resolved "https://registry.yarnpkg.com/browserslist/-/browserslist-1.7.7.tgz#0bd76704258be829b2398bb50e4b62d1a166b0b9" + dependencies: + caniuse-db "^1.0.30000639" + electron-to-chromium "^1.2.7" + + buf-compare@^1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/buf-compare/-/buf-compare-1.0.1.tgz#fef28da8b8113a0a0db4430b0b6467b69730b34a" + + buffer-crc32@^0.2.1: + version "0.2.13" + resolved "https://registry.yarnpkg.com/buffer-crc32/-/buffer-crc32-0.2.13.tgz#0d333e3f00eac50aa1454abd30ef8c2a5d9a7242" + + buffer-xor@^1.0.3: + version "1.0.3" + resolved "https://registry.yarnpkg.com/buffer-xor/-/buffer-xor-1.0.3.tgz#26e61ed1422fb70dd42e6e36729ed51d855fe8d9" + + buffer@^4.3.0: + version "4.9.1" + resolved "https://registry.yarnpkg.com/buffer/-/buffer-4.9.1.tgz#6d1bb601b07a4efced97094132093027c95bc298" + dependencies: + base64-js "^1.0.2" + ieee754 "^1.1.4" + isarray "^1.0.0" + + builder-util-runtime@4.0.5, builder-util-runtime@^4.0.5: + version "4.0.5" + resolved "https://registry.yarnpkg.com/builder-util-runtime/-/builder-util-runtime-4.0.5.tgz#5340cf9886b9283ea6e5b20dc09b5e3e461aef62" + dependencies: + bluebird-lst "^1.0.5" + debug "^3.1.0" + fs-extra-p "^4.5.0" + sax "^1.2.4" + + builder-util@5.6.5, builder-util@^5.6.5: + version "5.6.5" + resolved "https://registry.yarnpkg.com/builder-util/-/builder-util-5.6.5.tgz#f2d156541b8df9599456848e057566443dc04c82" + dependencies: + "7zip-bin" "~3.1.0" + app-builder-bin "1.7.2" + bluebird-lst "^1.0.5" + builder-util-runtime "^4.0.5" + chalk "^2.3.2" + debug "^3.1.0" + fs-extra-p "^4.5.2" + is-ci "^1.1.0" + js-yaml "^3.11.0" + lazy-val "^1.0.3" + semver "^5.5.0" + source-map-support "^0.5.3" + stat-mode "^0.2.2" + temp-file "^3.1.1" + + builtin-modules@^1.0.0: + version "1.1.1" + resolved "https://registry.yarnpkg.com/builtin-modules/-/builtin-modules-1.1.1.tgz#270f076c5a72c02f5b65a47df94c5fe3a278892f" + + builtin-status-codes@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/builtin-status-codes/-/builtin-status-codes-3.0.0.tgz#85982878e21b98e1c66425e03d0174788f569ee8" + + cacache@^10.0.1: + version "10.0.4" + resolved "https://registry.yarnpkg.com/cacache/-/cacache-10.0.4.tgz#6452367999eff9d4188aefd9a14e9d7c6a263460" + dependencies: + bluebird "^3.5.1" + chownr "^1.0.1" + glob "^7.1.2" + graceful-fs "^4.1.11" + lru-cache "^4.1.1" + mississippi "^2.0.0" + mkdirp "^0.5.1" + move-concurrently "^1.0.1" + promise-inflight "^1.0.1" + rimraf "^2.6.2" + ssri "^5.2.4" + unique-filename "^1.1.0" + y18n "^4.0.0" + + caching-transform@^1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/caching-transform/-/caching-transform-1.0.1.tgz#6dbdb2f20f8d8fbce79f3e94e9d1742dcdf5c0a1" + dependencies: + md5-hex "^1.2.0" + mkdirp "^0.5.1" + write-file-atomic "^1.1.4" + + call-matcher@^1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/call-matcher/-/call-matcher-1.0.1.tgz#5134d077984f712a54dad3cbf62de28dce416ca8" + dependencies: + core-js "^2.0.0" + deep-equal "^1.0.0" + espurify "^1.6.0" + estraverse "^4.0.0" + + call-signature@0.0.2: + version "0.0.2" + resolved "https://registry.yarnpkg.com/call-signature/-/call-signature-0.0.2.tgz#a84abc825a55ef4cb2b028bd74e205a65b9a4996" + + caller-path@^0.1.0: + version "0.1.0" + resolved "https://registry.yarnpkg.com/caller-path/-/caller-path-0.1.0.tgz#94085ef63581ecd3daa92444a8fe94e82577751f" + dependencies: + callsites "^0.2.0" + + callsites@^0.2.0: + version "0.2.0" + resolved "https://registry.yarnpkg.com/callsites/-/callsites-0.2.0.tgz#afab96262910a7f33c19a5775825c69f34e350ca" + + camelcase-keys@^2.0.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/camelcase-keys/-/camelcase-keys-2.1.0.tgz#308beeaffdf28119051efa1d932213c91b8f92e7" + dependencies: + camelcase "^2.0.0" + map-obj "^1.0.0" + + camelcase@4.1.0, camelcase@^4.0.0, camelcase@^4.1.0: + version "4.1.0" + resolved "https://registry.yarnpkg.com/camelcase/-/camelcase-4.1.0.tgz#d545635be1e33c542649c69173e5de6acfae34dd" + + camelcase@^1.0.2: + version "1.2.1" + resolved "https://registry.yarnpkg.com/camelcase/-/camelcase-1.2.1.tgz#9bb5304d2e0b56698b2c758b08a3eaa9daa58a39" + + camelcase@^2.0.0: + version "2.1.1" + resolved "https://registry.yarnpkg.com/camelcase/-/camelcase-2.1.1.tgz#7c1d16d679a1bbe59ca02cacecfb011e201f5a1f" + + camelcase@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/camelcase/-/camelcase-3.0.0.tgz#32fc4b9fcdaf845fcdf7e73bb97cac2261f0ab0a" + + caniuse-api@^1.5.2: + version "1.6.1" + resolved "https://registry.yarnpkg.com/caniuse-api/-/caniuse-api-1.6.1.tgz#b534e7c734c4f81ec5fbe8aca2ad24354b962c6c" + dependencies: + browserslist "^1.3.6" + caniuse-db "^1.0.30000529" + lodash.memoize "^4.1.2" + lodash.uniq "^4.5.0" + + caniuse-db@^1.0.30000529, caniuse-db@^1.0.30000634, caniuse-db@^1.0.30000639: + version "1.0.30000810" + resolved "https://registry.yarnpkg.com/caniuse-db/-/caniuse-db-1.0.30000810.tgz#bd25830c41efab64339a2e381f49677343c84509" + + capture-stack-trace@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/capture-stack-trace/-/capture-stack-trace-1.0.0.tgz#4a6fa07399c26bba47f0b2496b4d0fb408c5550d" + + caseless@~0.12.0: + version "0.12.0" + resolved "https://registry.yarnpkg.com/caseless/-/caseless-0.12.0.tgz#1b681c21ff84033c826543090689420d187151dc" + + center-align@^0.1.1: + version "0.1.3" + resolved "https://registry.yarnpkg.com/center-align/-/center-align-0.1.3.tgz#aa0d32629b6ee972200411cbd4461c907bc2b7ad" + dependencies: + align-text "^0.1.3" + lazy-cache "^1.0.3" + + chalk@2.1.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/chalk/-/chalk-2.1.0.tgz#ac5becf14fa21b99c6c92ca7a7d7cfd5b17e743e" + dependencies: + ansi-styles "^3.1.0" + escape-string-regexp "^1.0.5" + supports-color "^4.0.0" + + chalk@2.3.2, chalk@^2.3.2: + version "2.3.2" + resolved "https://registry.yarnpkg.com/chalk/-/chalk-2.3.2.tgz#250dc96b07491bfd601e648d66ddf5f60c7a5c65" + dependencies: + ansi-styles "^3.2.1" + escape-string-regexp "^1.0.5" + supports-color "^5.3.0" + + chalk@^0.4.0: + version "0.4.0" + resolved "https://registry.yarnpkg.com/chalk/-/chalk-0.4.0.tgz#5199a3ddcd0c1efe23bc08c1b027b06176e0c64f" + dependencies: + ansi-styles "~1.0.0" + has-color "~0.1.0" + strip-ansi "~0.1.0" + + chalk@^1.0.0, chalk@^1.1.1, chalk@^1.1.3: + version "1.1.3" + resolved "https://registry.yarnpkg.com/chalk/-/chalk-1.1.3.tgz#a8115c55e4a702fe4d150abd3872822a7e09fc98" + dependencies: + ansi-styles "^2.2.1" + escape-string-regexp "^1.0.2" + has-ansi "^2.0.0" + strip-ansi "^3.0.0" + supports-color "^2.0.0" + + chalk@^2.0.0, chalk@^2.0.1, chalk@^2.1.0, chalk@^2.3.1: + version "2.3.1" + resolved "https://registry.yarnpkg.com/chalk/-/chalk-2.3.1.tgz#523fe2678aec7b04e8041909292fe8b17059b796" + dependencies: + ansi-styles "^3.2.0" + escape-string-regexp "^1.0.5" + supports-color "^5.2.0" + + chardet@^0.4.0: + version "0.4.2" + resolved "https://registry.yarnpkg.com/chardet/-/chardet-0.4.2.tgz#b5473b33dc97c424e5d98dc87d55d4d8a29c8bf2" + + chokidar@^1.4.2, chokidar@^1.6.1, chokidar@^1.7.0: + version "1.7.0" + resolved "https://registry.yarnpkg.com/chokidar/-/chokidar-1.7.0.tgz#798e689778151c8076b4b360e5edd28cda2bb468" + dependencies: + anymatch "^1.3.0" + async-each "^1.0.0" + glob-parent "^2.0.0" + inherits "^2.0.1" + is-binary-path "^1.0.0" + is-glob "^2.0.0" + path-is-absolute "^1.0.0" + readdirp "^2.0.0" + optionalDependencies: + fsevents "^1.0.0" + + chownr@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/chownr/-/chownr-1.0.1.tgz#e2a75042a9551908bebd25b8523d5f9769d79181" + + chromium-pickle-js@^0.2.0: + version "0.2.0" + resolved "https://registry.yarnpkg.com/chromium-pickle-js/-/chromium-pickle-js-0.2.0.tgz#04a106672c18b085ab774d983dfa3ea138f22205" + + ci-info@^1.0.0: + version "1.1.2" + resolved "https://registry.yarnpkg.com/ci-info/-/ci-info-1.1.2.tgz#03561259db48d0474c8bdc90f5b47b068b6bbfb4" + + cipher-base@^1.0.0, cipher-base@^1.0.1, cipher-base@^1.0.3: + version "1.0.4" + resolved "https://registry.yarnpkg.com/cipher-base/-/cipher-base-1.0.4.tgz#8760e4ecc272f4c363532f926d874aae2c1397de" + dependencies: + inherits "^2.0.1" + safe-buffer "^5.0.1" + + circular-json@^0.3.1: + version "0.3.3" + resolved "https://registry.yarnpkg.com/circular-json/-/circular-json-0.3.3.tgz#815c99ea84f6809529d2f45791bdf82711352d66" + + clap@^1.0.9: + version "1.2.3" + resolved "https://registry.yarnpkg.com/clap/-/clap-1.2.3.tgz#4f36745b32008492557f46412d66d50cb99bce51" + dependencies: + chalk "^1.1.3" + + clean-stack@^1.1.1: + version "1.3.0" + resolved "https://registry.yarnpkg.com/clean-stack/-/clean-stack-1.3.0.tgz#9e821501ae979986c46b1d66d2d432db2fd4ae31" + + clean-yaml-object@^0.1.0: + version "0.1.0" + resolved "https://registry.yarnpkg.com/clean-yaml-object/-/clean-yaml-object-0.1.0.tgz#63fb110dc2ce1a84dc21f6d9334876d010ae8b68" + + cli-boxes@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/cli-boxes/-/cli-boxes-1.0.0.tgz#4fa917c3e59c94a004cd61f8ee509da651687143" + + cli-cursor@^2.1.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/cli-cursor/-/cli-cursor-2.1.0.tgz#b35dac376479facc3e94747d41d0d0f5238ffcb5" + dependencies: + restore-cursor "^2.0.0" + + cli-spinners@^1.0.0, cli-spinners@^1.0.1: + version "1.1.0" + resolved "https://registry.yarnpkg.com/cli-spinners/-/cli-spinners-1.1.0.tgz#f1847b168844d917a671eb9d147e3df497c90d06" + + cli-truncate@^1.0.0: + version "1.1.0" + resolved "https://registry.yarnpkg.com/cli-truncate/-/cli-truncate-1.1.0.tgz#2b2dfd83c53cfd3572b87fc4d430a808afb04086" + dependencies: + slice-ansi "^1.0.0" + string-width "^2.0.0" + + cli-width@^2.0.0: + version "2.2.0" + resolved "https://registry.yarnpkg.com/cli-width/-/cli-width-2.2.0.tgz#ff19ede8a9a5e579324147b0c11f0fbcbabed639" + + cliui@^2.1.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/cliui/-/cliui-2.1.0.tgz#4b475760ff80264c762c3a1719032e91c7fea0d1" + dependencies: + center-align "^0.1.1" + right-align "^0.1.1" + wordwrap "0.0.2" + + cliui@^3.2.0: + version "3.2.0" + resolved "https://registry.yarnpkg.com/cliui/-/cliui-3.2.0.tgz#120601537a916d29940f934da3b48d585a39213d" + dependencies: + string-width "^1.0.1" + strip-ansi "^3.0.1" + wrap-ansi "^2.0.0" + + cliui@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/cliui/-/cliui-4.0.0.tgz#743d4650e05f36d1ed2575b59638d87322bfbbcc" + dependencies: + string-width "^2.1.1" + strip-ansi "^4.0.0" + wrap-ansi "^2.0.0" + + clone@^1.0.2: + version "1.0.3" + resolved "https://registry.yarnpkg.com/clone/-/clone-1.0.3.tgz#298d7e2231660f40c003c2ed3140decf3f53085f" + + co-with-promise@^4.6.0: + version "4.6.0" + resolved "https://registry.yarnpkg.com/co-with-promise/-/co-with-promise-4.6.0.tgz#413e7db6f5893a60b942cf492c4bec93db415ab7" + dependencies: + pinkie-promise "^1.0.0" + + co@^4.6.0: + version "4.6.0" + resolved "https://registry.yarnpkg.com/co/-/co-4.6.0.tgz#6ea6bdf3d853ae54ccb8e47bfa0bf3f9031fb184" + + coa@~1.0.1: + version "1.0.4" + resolved "https://registry.yarnpkg.com/coa/-/coa-1.0.4.tgz#a9ef153660d6a86a8bdec0289a5c684d217432fd" + dependencies: + q "^1.1.2" + + code-excerpt@^2.1.1: + version "2.1.1" + resolved "https://registry.yarnpkg.com/code-excerpt/-/code-excerpt-2.1.1.tgz#5fe3057bfbb71a5f300f659ef2cc0a47651ba77c" + dependencies: + convert-to-spaces "^1.0.1" + + code-point-at@^1.0.0: + version "1.1.0" + resolved "https://registry.yarnpkg.com/code-point-at/-/code-point-at-1.1.0.tgz#0d070b4d043a5bea33a2f1a40e2edb3d9a4ccf77" + + color-convert@^1.3.0, color-convert@^1.9.0, color-convert@^1.9.1: + version "1.9.1" + resolved "https://registry.yarnpkg.com/color-convert/-/color-convert-1.9.1.tgz#c1261107aeb2f294ebffec9ed9ecad529a6097ed" + dependencies: + color-name "^1.1.1" + + color-convert@~0.5.0: + version "0.5.3" + resolved "https://registry.yarnpkg.com/color-convert/-/color-convert-0.5.3.tgz#bdb6c69ce660fadffe0b0007cc447e1b9f7282bd" + + color-name@^1.0.0, color-name@^1.1.1: + version "1.1.3" + resolved "https://registry.yarnpkg.com/color-name/-/color-name-1.1.3.tgz#a7d0558bd89c42f795dd42328f740831ca53bc25" + + color-string@^0.3.0: + version "0.3.0" + resolved "https://registry.yarnpkg.com/color-string/-/color-string-0.3.0.tgz#27d46fb67025c5c2fa25993bfbf579e47841b991" + dependencies: + color-name "^1.0.0" + + color-string@^1.5.2: + version "1.5.2" + resolved "https://registry.yarnpkg.com/color-string/-/color-string-1.5.2.tgz#26e45814bc3c9a7cbd6751648a41434514a773a9" + dependencies: + color-name "^1.0.0" + simple-swizzle "^0.2.2" + + color@2.0.1: + version "2.0.1" + resolved "https://registry.yarnpkg.com/color/-/color-2.0.1.tgz#e4ed78a3c4603d0891eba5430b04b86314f4c839" + dependencies: + color-convert "^1.9.1" + color-string "^1.5.2" + + color@^0.11.0: + version "0.11.4" + resolved "https://registry.yarnpkg.com/color/-/color-0.11.4.tgz#6d7b5c74fb65e841cd48792ad1ed5e07b904d764" + dependencies: + clone "^1.0.2" + color-convert "^1.3.0" + color-string "^0.3.0" + + colormin@^1.0.5: + version "1.1.2" + resolved "https://registry.yarnpkg.com/colormin/-/colormin-1.1.2.tgz#ea2f7420a72b96881a38aae59ec124a6f7298133" + dependencies: + color "^0.11.0" + css-color-names "0.0.4" + has "^1.0.1" + + colors@^1.1.2, colors@~1.1.2: + version "1.1.2" + resolved "https://registry.yarnpkg.com/colors/-/colors-1.1.2.tgz#168a4701756b6a7f51a12ce0c97bfa28c084ed63" + + columnify@1.5.4: + version "1.5.4" + resolved "https://registry.yarnpkg.com/columnify/-/columnify-1.5.4.tgz#4737ddf1c7b69a8a7c340570782e947eec8e78bb" + dependencies: + strip-ansi "^3.0.0" + wcwidth "^1.0.0" + + combined-stream@1.0.6, combined-stream@^1.0.5, combined-stream@~1.0.5: + version "1.0.6" + resolved "https://registry.yarnpkg.com/combined-stream/-/combined-stream-1.0.6.tgz#723e7df6e801ac5613113a7e445a9b69cb632818" + dependencies: + delayed-stream "~1.0.0" + + commander@^2.11.0: + version "2.14.1" + resolved "https://registry.yarnpkg.com/commander/-/commander-2.14.1.tgz#2235123e37af8ca3c65df45b026dbd357b01b9aa" + + common-path-prefix@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/common-path-prefix/-/common-path-prefix-1.0.0.tgz#cd52f6f0712e0baab97d6f9732874f22f47752c0" + + commondir@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/commondir/-/commondir-1.0.1.tgz#ddd800da0c66127393cca5950ea968a3aaf1253b" + + compare-version@^0.1.2: + version "0.1.2" + resolved "https://registry.yarnpkg.com/compare-version/-/compare-version-0.1.2.tgz#0162ec2d9351f5ddd59a9202cba935366a725080" + + compress-commons@^1.2.0: + version "1.2.2" + resolved "https://registry.yarnpkg.com/compress-commons/-/compress-commons-1.2.2.tgz#524a9f10903f3a813389b0225d27c48bb751890f" + dependencies: + buffer-crc32 "^0.2.1" + crc32-stream "^2.0.0" + normalize-path "^2.0.0" + readable-stream "^2.0.0" + + concat-map@0.0.1: + version "0.0.1" + resolved "https://registry.yarnpkg.com/concat-map/-/concat-map-0.0.1.tgz#d8a96bd77fd68df7793a73036a3ba0d5405d477b" + + concat-stream@1.6.0, concat-stream@^1.5.0, concat-stream@^1.6.0: + version "1.6.0" + resolved "https://registry.yarnpkg.com/concat-stream/-/concat-stream-1.6.0.tgz#0aac662fd52be78964d5532f694784e70110acf7" + dependencies: + inherits "^2.0.3" + readable-stream "^2.2.2" + typedarray "^0.0.6" + + concordance@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/concordance/-/concordance-3.0.0.tgz#b2286af54405fc995fc7345b0b106d8dd073cb29" + dependencies: + date-time "^2.1.0" + esutils "^2.0.2" + fast-diff "^1.1.1" + function-name-support "^0.2.0" + js-string-escape "^1.0.1" + lodash.clonedeep "^4.5.0" + lodash.flattendeep "^4.4.0" + lodash.merge "^4.6.0" + md5-hex "^2.0.0" + semver "^5.3.0" + well-known-symbols "^1.0.0" + + configstore@^3.0.0: + version "3.1.1" + resolved "https://registry.yarnpkg.com/configstore/-/configstore-3.1.1.tgz#094ee662ab83fad9917678de114faaea8fcdca90" + dependencies: + dot-prop "^4.1.0" + graceful-fs "^4.1.2" + make-dir "^1.0.0" + unique-string "^1.0.0" + write-file-atomic "^2.0.0" + xdg-basedir "^3.0.0" + + console-browserify@^1.1.0: + version "1.1.0" + resolved "https://registry.yarnpkg.com/console-browserify/-/console-browserify-1.1.0.tgz#f0241c45730a9fc6323b206dbf38edc741d0bb10" + dependencies: + date-now "^0.1.4" + + console-control-strings@^1.0.0, console-control-strings@~1.1.0: + version "1.1.0" + resolved "https://registry.yarnpkg.com/console-control-strings/-/console-control-strings-1.1.0.tgz#3d7cf4464db6446ea644bf4b39507f9851008e8e" + + constants-browserify@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/constants-browserify/-/constants-browserify-1.0.0.tgz#c20b96d8c617748aaf1c16021760cd27fcb8cb75" + + convert-source-map@1.5.1, convert-source-map@^1.5.0, convert-source-map@^1.5.1: + version "1.5.1" + resolved "https://registry.yarnpkg.com/convert-source-map/-/convert-source-map-1.5.1.tgz#b8278097b9bc229365de5c62cf5fcaed8b5599e5" + + convert-to-spaces@^1.0.1: + version "1.0.2" + resolved "https://registry.yarnpkg.com/convert-to-spaces/-/convert-to-spaces-1.0.2.tgz#7e3e48bbe6d997b1417ddca2868204b4d3d85715" + + copy-concurrently@^1.0.0: + version "1.0.5" + resolved "https://registry.yarnpkg.com/copy-concurrently/-/copy-concurrently-1.0.5.tgz#92297398cae34937fcafd6ec8139c18051f0b5e0" + dependencies: + aproba "^1.1.1" + fs-write-stream-atomic "^1.0.8" + iferr "^0.1.5" + mkdirp "^0.5.1" + rimraf "^2.5.4" + run-queue "^1.0.0" + + copy-webpack-plugin@4.3.1: + version "4.3.1" + resolved "https://registry.yarnpkg.com/copy-webpack-plugin/-/copy-webpack-plugin-4.3.1.tgz#19ba6370bf6f8e263cbd66185a2b79f2321a9302" + dependencies: + cacache "^10.0.1" + find-cache-dir "^1.0.0" + globby "^7.1.1" + is-glob "^4.0.0" + loader-utils "^0.2.15" + lodash "^4.3.0" + minimatch "^3.0.4" + p-limit "^1.0.0" + pify "^3.0.0" + serialize-javascript "^1.4.0" + + core-assert@^0.2.0: + version "0.2.1" + resolved "https://registry.yarnpkg.com/core-assert/-/core-assert-0.2.1.tgz#f85e2cf9bfed28f773cc8b3fa5c5b69bdc02fe3f" + dependencies: + buf-compare "^1.0.0" + is-error "^2.2.0" + + core-js@^1.0.0: + version "1.2.7" + resolved "https://registry.yarnpkg.com/core-js/-/core-js-1.2.7.tgz#652294c14651db28fa93bd2d5ff2983a4f08c636" + + core-js@^2.0.0, core-js@^2.4.0, core-js@^2.5.0: + version "2.5.3" + resolved "https://registry.yarnpkg.com/core-js/-/core-js-2.5.3.tgz#8acc38345824f16d8365b7c9b4259168e8ed603e" + + core-util-is@1.0.2, core-util-is@~1.0.0: + version "1.0.2" + resolved "https://registry.yarnpkg.com/core-util-is/-/core-util-is-1.0.2.tgz#b5fd54220aa2bc5ab57aab7140c940754503c1a7" + + crc32-stream@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/crc32-stream/-/crc32-stream-2.0.0.tgz#e3cdd3b4df3168dd74e3de3fbbcb7b297fe908f4" + dependencies: + crc "^3.4.4" + readable-stream "^2.0.0" + + crc@^3.4.4: + version "3.5.0" + resolved "https://registry.yarnpkg.com/crc/-/crc-3.5.0.tgz#98b8ba7d489665ba3979f59b21381374101a1964" + + create-ecdh@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/create-ecdh/-/create-ecdh-4.0.0.tgz#888c723596cdf7612f6498233eebd7a35301737d" + dependencies: + bn.js "^4.1.0" + elliptic "^6.0.0" + + create-error-class@^3.0.0: + version "3.0.2" + resolved "https://registry.yarnpkg.com/create-error-class/-/create-error-class-3.0.2.tgz#06be7abef947a3f14a30fd610671d401bca8b7b6" + dependencies: + capture-stack-trace "^1.0.0" + + create-hash@^1.1.0, create-hash@^1.1.2: + version "1.1.3" + resolved "https://registry.yarnpkg.com/create-hash/-/create-hash-1.1.3.tgz#606042ac8b9262750f483caddab0f5819172d8fd" + dependencies: + cipher-base "^1.0.1" + inherits "^2.0.1" + ripemd160 "^2.0.0" + sha.js "^2.4.0" + + create-hmac@^1.1.0, create-hmac@^1.1.2, create-hmac@^1.1.4: + version "1.1.6" + resolved "https://registry.yarnpkg.com/create-hmac/-/create-hmac-1.1.6.tgz#acb9e221a4e17bdb076e90657c42b93e3726cf06" + dependencies: + cipher-base "^1.0.3" + create-hash "^1.1.0" + inherits "^2.0.1" + ripemd160 "^2.0.0" + safe-buffer "^5.0.1" + sha.js "^2.4.8" + + cross-env@5.1.4: + version "5.1.4" + resolved "https://registry.yarnpkg.com/cross-env/-/cross-env-5.1.4.tgz#f61c14291f7cc653bb86457002ea80a04699d022" + dependencies: + cross-spawn "^5.1.0" + is-windows "^1.0.0" + + cross-spawn@^5.0.1, cross-spawn@^5.1.0: + version "5.1.0" + resolved "https://registry.yarnpkg.com/cross-spawn/-/cross-spawn-5.1.0.tgz#e8bd0efee58fcff6f8f94510a0a554bbfa235449" + dependencies: + lru-cache "^4.0.1" + shebang-command "^1.2.0" + which "^1.2.9" + + cross-unzip@0.0.2: + version "0.0.2" + resolved "https://registry.yarnpkg.com/cross-unzip/-/cross-unzip-0.0.2.tgz#5183bc47a09559befcf98cc4657964999359372f" + + cryptiles@2.x.x: + version "2.0.5" + resolved "https://registry.yarnpkg.com/cryptiles/-/cryptiles-2.0.5.tgz#3bdfecdc608147c1c67202fa291e7dca59eaa3b8" + dependencies: + boom "2.x.x" + + cryptiles@3.x.x: + version "3.1.2" + resolved "https://registry.yarnpkg.com/cryptiles/-/cryptiles-3.1.2.tgz#a89fbb220f5ce25ec56e8c4aa8a4fd7b5b0d29fe" + dependencies: + boom "5.x.x" + + crypto-browserify@^3.11.0: + version "3.12.0" + resolved "https://registry.yarnpkg.com/crypto-browserify/-/crypto-browserify-3.12.0.tgz#396cf9f3137f03e4b8e532c58f698254e00f80ec" + dependencies: + browserify-cipher "^1.0.0" + browserify-sign "^4.0.0" + create-ecdh "^4.0.0" + create-hash "^1.1.0" + create-hmac "^1.1.0" + diffie-hellman "^5.0.0" + inherits "^2.0.1" + pbkdf2 "^3.0.3" + public-encrypt "^4.0.0" + randombytes "^2.0.0" + randomfill "^1.0.3" + + crypto-random-string@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/crypto-random-string/-/crypto-random-string-1.0.0.tgz#a230f64f568310e1498009940790ec99545bca7e" + + css-color-names@0.0.4: + version "0.0.4" + resolved "https://registry.yarnpkg.com/css-color-names/-/css-color-names-0.0.4.tgz#808adc2e79cf84738069b646cb20ec27beb629e0" + + css-loader@0.28.11: + version "0.28.11" + resolved "https://registry.yarnpkg.com/css-loader/-/css-loader-0.28.11.tgz#c3f9864a700be2711bb5a2462b2389b1a392dab7" + dependencies: + babel-code-frame "^6.26.0" + css-selector-tokenizer "^0.7.0" + cssnano "^3.10.0" + icss-utils "^2.1.0" + loader-utils "^1.0.2" + lodash.camelcase "^4.3.0" + object-assign "^4.1.1" + postcss "^5.0.6" + postcss-modules-extract-imports "^1.2.0" + postcss-modules-local-by-default "^1.2.0" + postcss-modules-scope "^1.1.0" + postcss-modules-values "^1.3.0" + postcss-value-parser "^3.3.0" + source-list-map "^2.0.0" + + css-parse@~2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/css-parse/-/css-parse-2.0.0.tgz#a468ee667c16d81ccf05c58c38d2a97c780dbfd4" + dependencies: + css "^2.0.0" + + css-selector-tokenizer@^0.7.0: + version "0.7.0" + resolved "https://registry.yarnpkg.com/css-selector-tokenizer/-/css-selector-tokenizer-0.7.0.tgz#e6988474ae8c953477bf5e7efecfceccd9cf4c86" + dependencies: + cssesc "^0.1.0" + fastparse "^1.1.1" + regexpu-core "^1.0.0" + + css-value@~0.0.1: + version "0.0.1" + resolved "https://registry.yarnpkg.com/css-value/-/css-value-0.0.1.tgz#5efd6c2eea5ea1fd6b6ac57ec0427b18452424ea" + + css@^2.0.0: + version "2.2.1" + resolved "https://registry.yarnpkg.com/css/-/css-2.2.1.tgz#73a4c81de85db664d4ee674f7d47085e3b2d55dc" + dependencies: + inherits "^2.0.1" + source-map "^0.1.38" + source-map-resolve "^0.3.0" + urix "^0.1.0" + + cssesc@^0.1.0: + version "0.1.0" + resolved "https://registry.yarnpkg.com/cssesc/-/cssesc-0.1.0.tgz#c814903e45623371a0477b40109aaafbeeaddbb4" + + cssnano@^3.10.0: + version "3.10.0" + resolved "https://registry.yarnpkg.com/cssnano/-/cssnano-3.10.0.tgz#4f38f6cea2b9b17fa01490f23f1dc68ea65c1c38" + dependencies: + autoprefixer "^6.3.1" + decamelize "^1.1.2" + defined "^1.0.0" + has "^1.0.1" + object-assign "^4.0.1" + postcss "^5.0.14" + postcss-calc "^5.2.0" + postcss-colormin "^2.1.8" + postcss-convert-values "^2.3.4" + postcss-discard-comments "^2.0.4" + postcss-discard-duplicates "^2.0.1" + postcss-discard-empty "^2.0.1" + postcss-discard-overridden "^0.1.1" + postcss-discard-unused "^2.2.1" + postcss-filter-plugins "^2.0.0" + postcss-merge-idents "^2.1.5" + postcss-merge-longhand "^2.0.1" + postcss-merge-rules "^2.0.3" + postcss-minify-font-values "^1.0.2" + postcss-minify-gradients "^1.0.1" + postcss-minify-params "^1.0.4" + postcss-minify-selectors "^2.0.4" + postcss-normalize-charset "^1.1.0" + postcss-normalize-url "^3.0.7" + postcss-ordered-values "^2.1.0" + postcss-reduce-idents "^2.2.2" + postcss-reduce-initial "^1.0.0" + postcss-reduce-transforms "^1.0.3" + postcss-svgo "^2.1.1" + postcss-unique-selectors "^2.0.2" + postcss-value-parser "^3.2.3" + postcss-zindex "^2.0.1" + + csso@~2.3.1: + version "2.3.2" + resolved "https://registry.yarnpkg.com/csso/-/csso-2.3.2.tgz#ddd52c587033f49e94b71fc55569f252e8ff5f85" + dependencies: + clap "^1.0.9" + source-map "^0.5.3" + + currently-unhandled@^0.4.1: + version "0.4.1" + resolved "https://registry.yarnpkg.com/currently-unhandled/-/currently-unhandled-0.4.1.tgz#988df33feab191ef799a61369dd76c17adf957ea" + dependencies: + array-find-index "^1.0.1" + + cyclist@~0.2.2: + version "0.2.2" + resolved "https://registry.yarnpkg.com/cyclist/-/cyclist-0.2.2.tgz#1b33792e11e914a2fd6d6ed6447464444e5fa640" + + d@1: + version "1.0.0" + resolved "https://registry.yarnpkg.com/d/-/d-1.0.0.tgz#754bb5bfe55451da69a58b94d45f4c5b0462d58f" + dependencies: + es5-ext "^0.10.9" + + dashdash@^1.12.0: + version "1.14.1" + resolved "https://registry.yarnpkg.com/dashdash/-/dashdash-1.14.1.tgz#853cfa0f7cbe2fed5de20326b8dd581035f6e2f0" + dependencies: + assert-plus "^1.0.0" + + date-now@^0.1.4: + version "0.1.4" + resolved "https://registry.yarnpkg.com/date-now/-/date-now-0.1.4.tgz#eaf439fd4d4848ad74e5cc7dbef200672b9e345b" + + date-time@^0.1.1: + version "0.1.1" + resolved "https://registry.yarnpkg.com/date-time/-/date-time-0.1.1.tgz#ed2f6d93d9790ce2fd66d5b5ff3edd5bbcbf3b07" + + date-time@^2.1.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/date-time/-/date-time-2.1.0.tgz#0286d1b4c769633b3ca13e1e62558d2dbdc2eba2" + dependencies: + time-zone "^1.0.0" + + debug@2.6.9, debug@^2.1.3, debug@^2.2.0, debug@^2.5.1, debug@^2.6.3, debug@^2.6.8: + version "2.6.9" + resolved "https://registry.yarnpkg.com/debug/-/debug-2.6.9.tgz#5d128515df134ff327e90a4c93f4e077a536341f" + dependencies: + ms "2.0.0" + + debug@^3.0.0, debug@^3.0.1, debug@^3.1.0: + version "3.1.0" + resolved "https://registry.yarnpkg.com/debug/-/debug-3.1.0.tgz#5bb5a0672628b64149566ba16819e61518c67261" + dependencies: + ms "2.0.0" + + decamelize@^1.0.0, decamelize@^1.1.1, decamelize@^1.1.2: + version "1.2.0" + resolved "https://registry.yarnpkg.com/decamelize/-/decamelize-1.2.0.tgz#f6534d15148269b20352e7bee26f501f9a191290" + + decompress-response@^3.2.0: + version "3.3.0" + resolved "https://registry.yarnpkg.com/decompress-response/-/decompress-response-3.3.0.tgz#80a4dd323748384bfa248083622aedec982adff3" + dependencies: + mimic-response "^1.0.0" + + deep-equal@^1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/deep-equal/-/deep-equal-1.0.1.tgz#f5d260292b660e084eff4cdbc9f08ad3247448b5" + + deep-extend@~0.4.0: + version "0.4.2" + resolved "https://registry.yarnpkg.com/deep-extend/-/deep-extend-0.4.2.tgz#48b699c27e334bf89f10892be432f6e4c7d34a7f" + + deep-is@~0.1.3: + version "0.1.3" + resolved "https://registry.yarnpkg.com/deep-is/-/deep-is-0.1.3.tgz#b369d6fb5dbc13eecf524f91b070feedc357cf34" + + deepmerge@~2.0.1: + version "2.0.1" + resolved "https://registry.yarnpkg.com/deepmerge/-/deepmerge-2.0.1.tgz#25c1c24f110fb914f80001b925264dd77f3f4312" + + defaults@^1.0.3: + version "1.0.3" + resolved "https://registry.yarnpkg.com/defaults/-/defaults-1.0.3.tgz#c656051e9817d9ff08ed881477f3fe4019f3ef7d" + dependencies: + clone "^1.0.2" + + define-properties@^1.1.2: + version "1.1.2" + resolved "https://registry.yarnpkg.com/define-properties/-/define-properties-1.1.2.tgz#83a73f2fea569898fb737193c8f873caf6d45c94" + dependencies: + foreach "^2.0.5" + object-keys "^1.0.8" + + defined@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/defined/-/defined-1.0.0.tgz#c98d9bcef75674188e110969151199e39b1fa693" + + del@^2.0.2: + version "2.2.2" + resolved "https://registry.yarnpkg.com/del/-/del-2.2.2.tgz#c12c981d067846c84bcaf862cff930d907ffd1a8" + dependencies: + globby "^5.0.0" + is-path-cwd "^1.0.0" + is-path-in-cwd "^1.0.0" + object-assign "^4.0.1" + pify "^2.0.0" + pinkie-promise "^2.0.0" + rimraf "^2.2.8" + + delayed-stream@~1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/delayed-stream/-/delayed-stream-1.0.0.tgz#df3ae199acadfb7d440aaae0b29e2272b24ec619" + + delegates@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/delegates/-/delegates-1.0.0.tgz#84c6e159b81904fdca59a0ef44cd870d31250f9a" + + des.js@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/des.js/-/des.js-1.0.0.tgz#c074d2e2aa6a8a9a07dbd61f9a15c2cd83ec8ecc" + dependencies: + inherits "^2.0.1" + minimalistic-assert "^1.0.0" + + detect-indent@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/detect-indent/-/detect-indent-4.0.0.tgz#f76d064352cdf43a1cb6ce619c4ee3a9475de208" + dependencies: + repeating "^2.0.0" + + detect-indent@^5.0.0: + version "5.0.0" + resolved "https://registry.yarnpkg.com/detect-indent/-/detect-indent-5.0.0.tgz#3871cc0a6a002e8c3e5b3cf7f336264675f06b9d" + + detect-libc@^1.0.2, detect-libc@^1.0.3: + version "1.0.3" + resolved "https://registry.yarnpkg.com/detect-libc/-/detect-libc-1.0.3.tgz#fa137c4bd698edf55cd5cd02ac559f91a4c4ba9b" + + dev-null@^0.1.1: + version "0.1.1" + resolved "https://registry.yarnpkg.com/dev-null/-/dev-null-0.1.1.tgz#5a205ce3c2b2ef77b6238d6ba179eb74c6a0e818" + + diffie-hellman@^5.0.0: + version "5.0.2" + resolved "https://registry.yarnpkg.com/diffie-hellman/-/diffie-hellman-5.0.2.tgz#b5835739270cfe26acf632099fded2a07f209e5e" + dependencies: + bn.js "^4.1.0" + miller-rabin "^4.0.0" + randombytes "^2.0.0" + + dir-glob@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/dir-glob/-/dir-glob-2.0.0.tgz#0b205d2b6aef98238ca286598a8204d29d0a0034" + dependencies: + arrify "^1.0.1" + path-type "^3.0.0" + + dmg-builder@4.1.2: + version "4.1.2" + resolved "https://registry.yarnpkg.com/dmg-builder/-/dmg-builder-4.1.2.tgz#b4d7245dc2e91812395b4268b12f888443ba5f30" + dependencies: + bluebird-lst "^1.0.5" + builder-util "^5.6.5" + electron-builder-lib "~20.5.0" + fs-extra-p "^4.5.2" + iconv-lite "^0.4.19" + js-yaml "^3.11.0" + parse-color "^1.0.0" + sanitize-filename "^1.6.1" + + doctrine@^2.0.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/doctrine/-/doctrine-2.1.0.tgz#5cd01fc101621b42c4cd7f5d1a66243716d3f39d" + dependencies: + esutils "^2.0.2" + + domain-browser@^1.1.1: + version "1.2.0" + resolved "https://registry.yarnpkg.com/domain-browser/-/domain-browser-1.2.0.tgz#3d31f50191a6749dd1375a7f522e823d42e54eda" + + dot-prop@^4.1.0: + version "4.2.0" + resolved "https://registry.yarnpkg.com/dot-prop/-/dot-prop-4.2.0.tgz#1f19e0c2e1aa0e32797c49799f2837ac6af69c57" + dependencies: + is-obj "^1.0.0" + + dotenv-expand@^4.0.1: + version "4.2.0" + resolved "https://registry.yarnpkg.com/dotenv-expand/-/dotenv-expand-4.2.0.tgz#def1f1ca5d6059d24a766e587942c21106ce1275" + + dotenv@^5.0.0: + version "5.0.1" + resolved "https://registry.yarnpkg.com/dotenv/-/dotenv-5.0.1.tgz#a5317459bd3d79ab88cff6e44057a6a3fbb1fcef" + + duplexer3@^0.1.4: + version "0.1.4" + resolved "https://registry.yarnpkg.com/duplexer3/-/duplexer3-0.1.4.tgz#ee01dd1cac0ed3cbc7fdbea37dc0a8f1ce002ce2" + + duplexify@^3.4.2, duplexify@^3.5.3: + version "3.5.3" + resolved "https://registry.yarnpkg.com/duplexify/-/duplexify-3.5.3.tgz#8b5818800df92fd0125b27ab896491912858243e" + dependencies: + end-of-stream "^1.0.0" + inherits "^2.0.1" + readable-stream "^2.0.0" + stream-shift "^1.0.0" + + ecc-jsbn@~0.1.1: + version "0.1.1" + resolved "https://registry.yarnpkg.com/ecc-jsbn/-/ecc-jsbn-0.1.1.tgz#0fc73a9ed5f0d53c38193398523ef7e543777505" + dependencies: + jsbn "~0.1.0" + + ejs@^2.5.7, ejs@~2.5.6: + version "2.5.7" + resolved "https://registry.yarnpkg.com/ejs/-/ejs-2.5.7.tgz#cc872c168880ae3c7189762fd5ffc00896c9518a" + + electron-builder-lib@20.5.1, electron-builder-lib@~20.5.0: + version "20.5.1" + resolved "https://registry.yarnpkg.com/electron-builder-lib/-/electron-builder-lib-20.5.1.tgz#c155345c58d25580d316f6437c251a57e8e92d62" + dependencies: + "7zip-bin" "~3.1.0" + app-builder-bin "1.7.2" + async-exit-hook "^2.0.1" + bluebird-lst "^1.0.5" + builder-util "5.6.5" + builder-util-runtime "4.0.5" + chromium-pickle-js "^0.2.0" + debug "^3.1.0" + ejs "^2.5.7" + electron-osx-sign "0.4.10" + electron-publish "20.5.0" + fs-extra-p "^4.5.2" + hosted-git-info "^2.6.0" + is-ci "^1.1.0" + isbinaryfile "^3.0.2" + js-yaml "^3.11.0" + lazy-val "^1.0.3" + minimatch "^3.0.4" + normalize-package-data "^2.4.0" + plist "^2.1.0" + read-config-file "3.0.0" + sanitize-filename "^1.6.1" + semver "^5.5.0" + temp-file "^3.1.1" + + electron-builder-squirrel-windows@20.5.0: + version "20.5.0" + resolved "https://registry.yarnpkg.com/electron-builder-squirrel-windows/-/electron-builder-squirrel-windows-20.5.0.tgz#652d0849887b76f4502955a45b214fb93d311634" + dependencies: + archiver "^2.1.1" + bluebird-lst "^1.0.5" + builder-util "^5.6.5" + fs-extra-p "^4.5.2" + sanitize-filename "^1.6.1" + optionalDependencies: + "7zip-bin" "~3.1.0" + + electron-builder@20.5.1: + version "20.5.1" + resolved "https://registry.yarnpkg.com/electron-builder/-/electron-builder-20.5.1.tgz#8e6fba76dcd65aeabab60f15bd46f294ee04dd11" + dependencies: + bluebird-lst "^1.0.5" + builder-util "5.6.5" + builder-util-runtime "4.0.5" + chalk "^2.3.2" + dmg-builder "4.1.2" + electron-builder-lib "20.5.1" + electron-download-tf "4.3.4" + fs-extra-p "^4.5.2" + is-ci "^1.1.0" + lazy-val "^1.0.3" + read-config-file "3.0.0" + sanitize-filename "^1.6.1" + update-notifier "^2.3.0" + yargs "^11.0.0" + + electron-chromedriver@~1.8.0: + version "1.8.0" + resolved "https://registry.yarnpkg.com/electron-chromedriver/-/electron-chromedriver-1.8.0.tgz#901714133cf6f6093d365e1f44a52d99624d8241" + dependencies: + electron-download "^4.1.0" + extract-zip "^1.6.5" + + electron-devtools-installer@2.2.3: + version "2.2.3" + resolved "https://registry.yarnpkg.com/electron-devtools-installer/-/electron-devtools-installer-2.2.3.tgz#58b9a4ec507377bc46e091cd43714188e0c369be" + dependencies: + "7zip" "0.0.6" + cross-unzip "0.0.2" + rimraf "^2.5.2" + semver "^5.3.0" + + electron-download-tf@4.3.4: + version "4.3.4" + resolved "https://registry.yarnpkg.com/electron-download-tf/-/electron-download-tf-4.3.4.tgz#b03740b2885aa2ad3f8784fae74df427f66d5165" + dependencies: + debug "^3.0.0" + env-paths "^1.0.0" + fs-extra "^4.0.1" + minimist "^1.2.0" + nugget "^2.0.1" + path-exists "^3.0.0" + rc "^1.2.1" + semver "^5.4.1" + sumchecker "^2.0.2" + + electron-download@^3.0.1: + version "3.3.0" + resolved "https://registry.yarnpkg.com/electron-download/-/electron-download-3.3.0.tgz#2cfd54d6966c019c4d49ad65fbe65cc9cdef68c8" + dependencies: + debug "^2.2.0" + fs-extra "^0.30.0" + home-path "^1.0.1" + minimist "^1.2.0" + nugget "^2.0.0" + path-exists "^2.1.0" + rc "^1.1.2" + semver "^5.3.0" + sumchecker "^1.2.0" + + electron-download@^4.1.0: + version "4.1.0" + resolved "https://registry.yarnpkg.com/electron-download/-/electron-download-4.1.0.tgz#bf932c746f2f87ffcc09d1dd472f2ff6b9187845" + dependencies: + debug "^2.2.0" + env-paths "^1.0.0" + fs-extra "^2.0.0" + minimist "^1.2.0" + nugget "^2.0.0" + path-exists "^3.0.0" + rc "^1.1.2" + semver "^5.3.0" + sumchecker "^2.0.1" + + electron-osx-sign@0.4.10: + version "0.4.10" + resolved "https://registry.yarnpkg.com/electron-osx-sign/-/electron-osx-sign-0.4.10.tgz#be4f3b89b2a75a1dc5f1e7249081ab2929ca3a26" + dependencies: + bluebird "^3.5.0" + compare-version "^0.1.2" + debug "^2.6.8" + isbinaryfile "^3.0.2" + minimist "^1.2.0" + plist "^2.1.0" + + electron-publish@20.5.0: + version "20.5.0" + resolved "https://registry.yarnpkg.com/electron-publish/-/electron-publish-20.5.0.tgz#bcef9949c63899d34680e89110e8d38d1016f1f6" + dependencies: + bluebird-lst "^1.0.5" + builder-util "^5.6.5" + builder-util-runtime "^4.0.5" + chalk "^2.3.2" + fs-extra-p "^4.5.2" + lazy-val "^1.0.3" + mime "^2.2.0" + + electron-rebuild@1.7.3: + version "1.7.3" + resolved "https://registry.yarnpkg.com/electron-rebuild/-/electron-rebuild-1.7.3.tgz#24ae06ad9dd61cb7e4d688961f49118c40a110eb" + dependencies: + colors "^1.1.2" + debug "^2.6.3" + detect-libc "^1.0.3" + fs-extra "^3.0.1" + node-abi "^2.0.0" + node-gyp "^3.6.0" + ora "^1.2.0" + rimraf "^2.6.1" + spawn-rx "^2.0.10" + yargs "^7.0.2" + + electron-to-chromium@^1.2.7: + version "1.3.33" + resolved "https://registry.yarnpkg.com/electron-to-chromium/-/electron-to-chromium-1.3.33.tgz#bf00703d62a7c65238136578c352d6c5c042a545" + + electron@1.8.4: + version "1.8.4" + resolved "https://registry.yarnpkg.com/electron/-/electron-1.8.4.tgz#cca8d0e6889f238f55b414ad224f03e03b226a38" + dependencies: + "@types/node" "^8.0.24" + electron-download "^3.0.1" + extract-zip "^1.0.3" + + elliptic@^6.0.0: + version "6.4.0" + resolved "https://registry.yarnpkg.com/elliptic/-/elliptic-6.4.0.tgz#cac9af8762c85836187003c8dfe193e5e2eae5df" + dependencies: + bn.js "^4.4.0" + brorand "^1.0.1" + hash.js "^1.0.0" + hmac-drbg "^1.0.0" + inherits "^2.0.1" + minimalistic-assert "^1.0.0" + minimalistic-crypto-utils "^1.0.0" + + emojis-list@^2.0.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/emojis-list/-/emojis-list-2.1.0.tgz#4daa4d9db00f9819880c79fa457ae5b09a1fd389" + + empower-core@^0.6.1: + version "0.6.2" + resolved "https://registry.yarnpkg.com/empower-core/-/empower-core-0.6.2.tgz#5adef566088e31fba80ba0a36df47d7094169144" + dependencies: + call-signature "0.0.2" + core-js "^2.0.0" + + encoding@^0.1.11: + version "0.1.12" + resolved "https://registry.yarnpkg.com/encoding/-/encoding-0.1.12.tgz#538b66f3ee62cd1ab51ec323829d1f9480c74beb" + dependencies: + iconv-lite "~0.4.13" + + end-of-stream@^1.0.0, end-of-stream@^1.1.0: + version "1.4.1" + resolved "https://registry.yarnpkg.com/end-of-stream/-/end-of-stream-1.4.1.tgz#ed29634d19baba463b6ce6b80a37213eab71ec43" + dependencies: + once "^1.4.0" + + enhanced-resolve@^3.4.0: + version "3.4.1" + resolved "https://registry.yarnpkg.com/enhanced-resolve/-/enhanced-resolve-3.4.1.tgz#0421e339fd71419b3da13d129b3979040230476e" + dependencies: + graceful-fs "^4.1.2" + memory-fs "^0.4.0" + object-assign "^4.0.1" + tapable "^0.2.7" + + env-paths@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/env-paths/-/env-paths-1.0.0.tgz#4168133b42bb05c38a35b1ae4397c8298ab369e0" + + equal-length@^1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/equal-length/-/equal-length-1.0.1.tgz#21ca112d48ab24b4e1e7ffc0e5339d31fdfc274c" + + errno@^0.1.3: + version "0.1.7" + resolved "https://registry.yarnpkg.com/errno/-/errno-0.1.7.tgz#4684d71779ad39af177e3f007996f7c67c852618" + dependencies: + prr "~1.0.1" + + error-ex@^1.2.0, error-ex@^1.3.1: + version "1.3.1" + resolved "https://registry.yarnpkg.com/error-ex/-/error-ex-1.3.1.tgz#f855a86ce61adc4e8621c3cda21e7a7612c3a8dc" + dependencies: + is-arrayish "^0.2.1" + + es-abstract@^1.7.0: + version "1.10.0" + resolved "https://registry.yarnpkg.com/es-abstract/-/es-abstract-1.10.0.tgz#1ecb36c197842a00d8ee4c2dfd8646bb97d60864" + dependencies: + es-to-primitive "^1.1.1" + function-bind "^1.1.1" + has "^1.0.1" + is-callable "^1.1.3" + is-regex "^1.0.4" + + es-to-primitive@^1.1.1: + version "1.1.1" + resolved "https://registry.yarnpkg.com/es-to-primitive/-/es-to-primitive-1.1.1.tgz#45355248a88979034b6792e19bb81f2b7975dd0d" + dependencies: + is-callable "^1.1.1" + is-date-object "^1.0.1" + is-symbol "^1.0.1" + + es5-ext@^0.10.14, es5-ext@^0.10.35, es5-ext@^0.10.9, es5-ext@~0.10.14: + version "0.10.39" + resolved "https://registry.yarnpkg.com/es5-ext/-/es5-ext-0.10.39.tgz#fca21b67559277ca4ac1a1ed7048b107b6f76d87" + dependencies: + es6-iterator "~2.0.3" + es6-symbol "~3.1.1" + + es6-error@^4.0.1, es6-error@^4.0.2: + version "4.1.1" + resolved "https://registry.yarnpkg.com/es6-error/-/es6-error-4.1.1.tgz#9e3af407459deed47e9a91f9b885a84eb05c561d" + + es6-iterator@^2.0.1, es6-iterator@~2.0.1, es6-iterator@~2.0.3: + version "2.0.3" + resolved "https://registry.yarnpkg.com/es6-iterator/-/es6-iterator-2.0.3.tgz#a7de889141a05a94b0854403b2d0a0fbfa98f3b7" + dependencies: + d "1" + es5-ext "^0.10.35" + es6-symbol "^3.1.1" + + es6-map@^0.1.3: + version "0.1.5" + resolved "https://registry.yarnpkg.com/es6-map/-/es6-map-0.1.5.tgz#9136e0503dcc06a301690f0bb14ff4e364e949f0" + dependencies: + d "1" + es5-ext "~0.10.14" + es6-iterator "~2.0.1" + es6-set "~0.1.5" + es6-symbol "~3.1.1" + event-emitter "~0.3.5" + + es6-promise@^4.0.5: + version "4.2.4" + resolved "https://registry.yarnpkg.com/es6-promise/-/es6-promise-4.2.4.tgz#dc4221c2b16518760bd8c39a52d8f356fc00ed29" + + es6-set@~0.1.5: + version "0.1.5" + resolved "https://registry.yarnpkg.com/es6-set/-/es6-set-0.1.5.tgz#d2b3ec5d4d800ced818db538d28974db0a73ccb1" + dependencies: + d "1" + es5-ext "~0.10.14" + es6-iterator "~2.0.1" + es6-symbol "3.1.1" + event-emitter "~0.3.5" + + es6-symbol@3.1.1, es6-symbol@^3.1.1, es6-symbol@~3.1.1: + version "3.1.1" + resolved "https://registry.yarnpkg.com/es6-symbol/-/es6-symbol-3.1.1.tgz#bf00ef4fdab6ba1b46ecb7b629b4c7ed5715cc77" + dependencies: + d "1" + es5-ext "~0.10.14" + + es6-weak-map@^2.0.1: + version "2.0.2" + resolved "https://registry.yarnpkg.com/es6-weak-map/-/es6-weak-map-2.0.2.tgz#5e3ab32251ffd1538a1f8e5ffa1357772f92d96f" + dependencies: + d "1" + es5-ext "^0.10.14" + es6-iterator "^2.0.1" + es6-symbol "^3.1.1" + + escape-string-regexp@^1.0.2, escape-string-regexp@^1.0.4, escape-string-regexp@^1.0.5: + version "1.0.5" + resolved "https://registry.yarnpkg.com/escape-string-regexp/-/escape-string-regexp-1.0.5.tgz#1b61c0562190a8dff6ae3bb2cf0200ca130b86d4" + + escope@^3.6.0: + version "3.6.0" + resolved "https://registry.yarnpkg.com/escope/-/escope-3.6.0.tgz#e01975e812781a163a6dadfdd80398dc64c889c3" + dependencies: + es6-map "^0.1.3" + es6-weak-map "^2.0.1" + esrecurse "^4.1.0" + estraverse "^4.1.1" + + eslint-config-prettier@2.6.0: + version "2.6.0" + resolved "https://registry.yarnpkg.com/eslint-config-prettier/-/eslint-config-prettier-2.6.0.tgz#f21db0ebb438ad678fb98946097c4bb198befccc" + dependencies: + get-stdin "^5.0.1" + + eslint-plugin-prettier@2.3.1: + version "2.3.1" + resolved "https://registry.yarnpkg.com/eslint-plugin-prettier/-/eslint-plugin-prettier-2.3.1.tgz#e7a746c67e716f335274b88295a9ead9f544e44d" + dependencies: + fast-diff "^1.1.1" + jest-docblock "^21.0.0" + + eslint-plugin-react@7.3.0: + version "7.3.0" + resolved "https://registry.yarnpkg.com/eslint-plugin-react/-/eslint-plugin-react-7.3.0.tgz#ca9368da36f733fbdc05718ae4e91f778f38e344" + dependencies: + doctrine "^2.0.0" + has "^1.0.1" + jsx-ast-utils "^2.0.0" + prop-types "^15.5.10" + + eslint-scope@^3.7.1: + version "3.7.1" + resolved "https://registry.yarnpkg.com/eslint-scope/-/eslint-scope-3.7.1.tgz#3d63c3edfda02e06e01a452ad88caacc7cdcb6e8" + dependencies: + esrecurse "^4.1.0" + estraverse "^4.1.1" + + eslint@4.7.2: + version "4.7.2" + resolved "https://registry.yarnpkg.com/eslint/-/eslint-4.7.2.tgz#ff6f5f5193848a27ee9b627be3e73fb9cb5e662e" + dependencies: + ajv "^5.2.0" + babel-code-frame "^6.22.0" + chalk "^2.1.0" + concat-stream "^1.6.0" + cross-spawn "^5.1.0" + debug "^3.0.1" + doctrine "^2.0.0" + eslint-scope "^3.7.1" + espree "^3.5.1" + esquery "^1.0.0" + estraverse "^4.2.0" + esutils "^2.0.2" + file-entry-cache "^2.0.0" + functional-red-black-tree "^1.0.1" + glob "^7.1.2" + globals "^9.17.0" + ignore "^3.3.3" + imurmurhash "^0.1.4" + inquirer "^3.0.6" + is-resolvable "^1.0.0" + js-yaml "^3.9.1" + json-stable-stringify "^1.0.1" + levn "^0.3.0" + lodash "^4.17.4" + minimatch "^3.0.2" + mkdirp "^0.5.1" + natural-compare "^1.4.0" + optionator "^0.8.2" + path-is-inside "^1.0.2" + pluralize "^7.0.0" + progress "^2.0.0" + require-uncached "^1.0.3" + semver "^5.3.0" + strip-ansi "^4.0.0" + strip-json-comments "~2.0.1" + table "^4.0.1" + text-table "~0.2.0" + + espower-location-detector@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/espower-location-detector/-/espower-location-detector-1.0.0.tgz#a17b7ecc59d30e179e2bef73fb4137704cb331b5" + dependencies: + is-url "^1.2.1" + path-is-absolute "^1.0.0" + source-map "^0.5.0" + xtend "^4.0.0" + + espree@^3.5.1: + version "3.5.4" + resolved "https://registry.yarnpkg.com/espree/-/espree-3.5.4.tgz#b0f447187c8a8bed944b815a660bddf5deb5d1a7" + dependencies: + acorn "^5.5.0" + acorn-jsx "^3.0.0" + + esprima@^2.6.0: + version "2.7.3" + resolved "https://registry.yarnpkg.com/esprima/-/esprima-2.7.3.tgz#96e3b70d5779f6ad49cd032673d1c312767ba581" + + esprima@^4.0.0, esprima@~4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/esprima/-/esprima-4.0.0.tgz#4499eddcd1110e0b218bacf2fa7f7f59f55ca804" + + espurify@^1.6.0: + version "1.7.0" + resolved "https://registry.yarnpkg.com/espurify/-/espurify-1.7.0.tgz#1c5cf6cbccc32e6f639380bd4f991fab9ba9d226" + dependencies: + core-js "^2.0.0" + + esquery@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/esquery/-/esquery-1.0.0.tgz#cfba8b57d7fba93f17298a8a006a04cda13d80fa" + dependencies: + estraverse "^4.0.0" + + esrecurse@^4.1.0: + version "4.2.0" + resolved "https://registry.yarnpkg.com/esrecurse/-/esrecurse-4.2.0.tgz#fa9568d98d3823f9a41d91e902dcab9ea6e5b163" + dependencies: + estraverse "^4.1.0" + object-assign "^4.0.1" + + estraverse@^4.0.0, estraverse@^4.1.0, estraverse@^4.1.1, estraverse@^4.2.0: + version "4.2.0" + resolved "https://registry.yarnpkg.com/estraverse/-/estraverse-4.2.0.tgz#0dee3fed31fcd469618ce7342099fc1afa0bdb13" + + esutils@^2.0.2: + version "2.0.2" + resolved "https://registry.yarnpkg.com/esutils/-/esutils-2.0.2.tgz#0abf4f1caa5bcb1f7a9d8acc6dea4faaa04bac9b" + + event-emitter@~0.3.5: + version "0.3.5" + resolved "https://registry.yarnpkg.com/event-emitter/-/event-emitter-0.3.5.tgz#df8c69eef1647923c7157b9ce83840610b02cc39" + dependencies: + d "1" + es5-ext "~0.10.14" + + events@^1.0.0: + version "1.1.1" + resolved "https://registry.yarnpkg.com/events/-/events-1.1.1.tgz#9ebdb7635ad099c70dcc4c2a1f5004288e8bd924" + + evp_bytestokey@^1.0.0, evp_bytestokey@^1.0.3: + version "1.0.3" + resolved "https://registry.yarnpkg.com/evp_bytestokey/-/evp_bytestokey-1.0.3.tgz#7fcbdb198dc71959432efe13842684e0525acb02" + dependencies: + md5.js "^1.3.4" + safe-buffer "^5.1.1" + + execa@^0.7.0: + version "0.7.0" + resolved "https://registry.yarnpkg.com/execa/-/execa-0.7.0.tgz#944becd34cc41ee32a63a9faf27ad5a65fc59777" + dependencies: + cross-spawn "^5.0.1" + get-stream "^3.0.0" + is-stream "^1.1.0" + npm-run-path "^2.0.0" + p-finally "^1.0.0" + signal-exit "^3.0.0" + strip-eof "^1.0.0" + + expand-brackets@^0.1.4: + version "0.1.5" + resolved "https://registry.yarnpkg.com/expand-brackets/-/expand-brackets-0.1.5.tgz#df07284e342a807cd733ac5af72411e581d1177b" + dependencies: + is-posix-bracket "^0.1.0" + + expand-range@^1.8.1: + version "1.8.2" + resolved "https://registry.yarnpkg.com/expand-range/-/expand-range-1.8.2.tgz#a299effd335fe2721ebae8e257ec79644fc85337" + dependencies: + fill-range "^2.1.0" + + extend@~3.0.0, extend@~3.0.1: + version "3.0.1" + resolved "https://registry.yarnpkg.com/extend/-/extend-3.0.1.tgz#a755ea7bc1adfcc5a31ce7e762dbaadc5e636444" + + external-editor@^2.0.4, external-editor@^2.1.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/external-editor/-/external-editor-2.1.0.tgz#3d026a21b7f95b5726387d4200ac160d372c3b48" + dependencies: + chardet "^0.4.0" + iconv-lite "^0.4.17" + tmp "^0.0.33" + + extglob@^0.3.1: + version "0.3.2" + resolved "https://registry.yarnpkg.com/extglob/-/extglob-0.3.2.tgz#2e18ff3d2f49ab2765cec9023f011daa8d8349a1" + dependencies: + is-extglob "^1.0.0" + + extract-zip@^1.0.3, extract-zip@^1.6.5: + version "1.6.6" + resolved "https://registry.yarnpkg.com/extract-zip/-/extract-zip-1.6.6.tgz#1290ede8d20d0872b429fd3f351ca128ec5ef85c" + dependencies: + concat-stream "1.6.0" + debug "2.6.9" + mkdirp "0.5.0" + yauzl "2.4.1" + + extsprintf@1.3.0: + version "1.3.0" + resolved "https://registry.yarnpkg.com/extsprintf/-/extsprintf-1.3.0.tgz#96918440e3041a7a414f8c52e3c574eb3c3e1e05" + + extsprintf@^1.2.0: + version "1.4.0" + resolved "https://registry.yarnpkg.com/extsprintf/-/extsprintf-1.4.0.tgz#e2689f8f356fad62cca65a3a91c5df5f9551692f" + + fast-deep-equal@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/fast-deep-equal/-/fast-deep-equal-1.0.0.tgz#96256a3bc975595eb36d82e9929d060d893439ff" + + fast-diff@^1.1.1: + version "1.1.2" + resolved "https://registry.yarnpkg.com/fast-diff/-/fast-diff-1.1.2.tgz#4b62c42b8e03de3f848460b639079920695d0154" + + fast-json-stable-stringify@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/fast-json-stable-stringify/-/fast-json-stable-stringify-2.0.0.tgz#d5142c0caee6b1189f87d3a76111064f86c8bbf2" + + fast-levenshtein@~2.0.4: + version "2.0.6" + resolved "https://registry.yarnpkg.com/fast-levenshtein/-/fast-levenshtein-2.0.6.tgz#3d8a5c66883a16a30ca8643e851f19baa7797917" + + fastparse@^1.1.1: + version "1.1.1" + resolved "https://registry.yarnpkg.com/fastparse/-/fastparse-1.1.1.tgz#d1e2643b38a94d7583b479060e6c4affc94071f8" + + fbjs@^0.8.16: + version "0.8.16" + resolved "https://registry.yarnpkg.com/fbjs/-/fbjs-0.8.16.tgz#5e67432f550dc41b572bf55847b8aca64e5337db" + dependencies: + core-js "^1.0.0" + isomorphic-fetch "^2.1.1" + loose-envify "^1.0.0" + object-assign "^4.1.0" + promise "^7.1.1" + setimmediate "^1.0.5" + ua-parser-js "^0.7.9" + + fd-slicer@~1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/fd-slicer/-/fd-slicer-1.0.1.tgz#8b5bcbd9ec327c5041bf9ab023fd6750f1177e65" + dependencies: + pend "~1.2.0" + + figures@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/figures/-/figures-2.0.0.tgz#3ab1a2d2a62c8bfb431a0c94cb797a2fce27c962" + dependencies: + escape-string-regexp "^1.0.5" + + file-entry-cache@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/file-entry-cache/-/file-entry-cache-2.0.0.tgz#c392990c3e684783d838b8c84a45d8a048458361" + dependencies: + flat-cache "^1.2.1" + object-assign "^4.0.1" + + filename-regex@^2.0.0: + version "2.0.1" + resolved "https://registry.yarnpkg.com/filename-regex/-/filename-regex-2.0.1.tgz#c1c4b9bee3e09725ddb106b75c1e301fe2f18b26" + + fill-keys@^1.0.2: + version "1.0.2" + resolved "https://registry.yarnpkg.com/fill-keys/-/fill-keys-1.0.2.tgz#9a8fa36f4e8ad634e3bf6b4f3c8882551452eb20" + dependencies: + is-object "~1.0.1" + merge-descriptors "~1.0.0" + + fill-range@^2.1.0: + version "2.2.3" + resolved "https://registry.yarnpkg.com/fill-range/-/fill-range-2.2.3.tgz#50b77dfd7e469bc7492470963699fe7a8485a723" + dependencies: + is-number "^2.1.0" + isobject "^2.0.0" + randomatic "^1.1.3" + repeat-element "^1.1.2" + repeat-string "^1.5.2" + + find-cache-dir@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/find-cache-dir/-/find-cache-dir-1.0.0.tgz#9288e3e9e3cc3748717d39eade17cf71fc30ee6f" + dependencies: + commondir "^1.0.1" + make-dir "^1.0.0" + pkg-dir "^2.0.0" + + find-up@^1.0.0: + version "1.1.2" + resolved "https://registry.yarnpkg.com/find-up/-/find-up-1.1.2.tgz#6b2e9822b1a2ce0a60ab64d610eccad53cb24d0f" + dependencies: + path-exists "^2.0.0" + pinkie-promise "^2.0.0" + + find-up@^2.0.0, find-up@^2.1.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/find-up/-/find-up-2.1.0.tgz#45d1b7e506c717ddd482775a2b77920a3c0c57a7" + dependencies: + locate-path "^2.0.0" + + flat-cache@^1.2.1: + version "1.3.0" + resolved "https://registry.yarnpkg.com/flat-cache/-/flat-cache-1.3.0.tgz#d3030b32b38154f4e3b7e9c709f490f7ef97c481" + dependencies: + circular-json "^0.3.1" + del "^2.0.2" + graceful-fs "^4.1.2" + write "^0.2.1" + + flatten@^1.0.2: + version "1.0.2" + resolved "https://registry.yarnpkg.com/flatten/-/flatten-1.0.2.tgz#dae46a9d78fbe25292258cc1e780a41d95c03782" + + flush-write-stream@^1.0.0: + version "1.0.2" + resolved "https://registry.yarnpkg.com/flush-write-stream/-/flush-write-stream-1.0.2.tgz#c81b90d8746766f1a609a46809946c45dd8ae417" + dependencies: + inherits "^2.0.1" + readable-stream "^2.0.4" + + fn-name@^2.0.0: + version "2.0.1" + resolved "https://registry.yarnpkg.com/fn-name/-/fn-name-2.0.1.tgz#5214d7537a4d06a4a301c0cc262feb84188002e7" + + for-in@^1.0.1: + version "1.0.2" + resolved "https://registry.yarnpkg.com/for-in/-/for-in-1.0.2.tgz#81068d295a8142ec0ac726c6e2200c30fb6d5e80" + + for-own@^0.1.4: + version "0.1.5" + resolved "https://registry.yarnpkg.com/for-own/-/for-own-0.1.5.tgz#5265c681a4f294dabbf17c9509b6763aa84510ce" + dependencies: + for-in "^1.0.1" + + foreach@^2.0.5: + version "2.0.5" + resolved "https://registry.yarnpkg.com/foreach/-/foreach-2.0.5.tgz#0bee005018aeb260d0a3af3ae658dd0136ec1b99" + + forever-agent@~0.6.1: + version "0.6.1" + resolved "https://registry.yarnpkg.com/forever-agent/-/forever-agent-0.6.1.tgz#fbc71f0c41adeb37f96c577ad1ed42d8fdacca91" + + form-data@~2.1.1: + version "2.1.4" + resolved "https://registry.yarnpkg.com/form-data/-/form-data-2.1.4.tgz#33c183acf193276ecaa98143a69e94bfee1750d1" + dependencies: + asynckit "^0.4.0" + combined-stream "^1.0.5" + mime-types "^2.1.12" + + form-data@~2.3.1: + version "2.3.2" + resolved "https://registry.yarnpkg.com/form-data/-/form-data-2.3.2.tgz#4970498be604c20c005d4f5c23aecd21d6b49099" + dependencies: + asynckit "^0.4.0" + combined-stream "1.0.6" + mime-types "^2.1.12" + + from2@^2.1.0: + version "2.3.0" + resolved "https://registry.yarnpkg.com/from2/-/from2-2.3.0.tgz#8bfb5502bde4a4d36cfdeea007fcca21d7e382af" + dependencies: + inherits "^2.0.1" + readable-stream "^2.0.0" + + fs-extra-p@^4.5.0, fs-extra-p@^4.5.2: + version "4.5.2" + resolved "https://registry.yarnpkg.com/fs-extra-p/-/fs-extra-p-4.5.2.tgz#0a22aba489284d17f375d5dc5139aa777fe2df51" + dependencies: + bluebird-lst "^1.0.5" + fs-extra "^5.0.0" + + fs-extra@^0.30.0: + version "0.30.0" + resolved "https://registry.yarnpkg.com/fs-extra/-/fs-extra-0.30.0.tgz#f233ffcc08d4da7d432daa449776989db1df93f0" + dependencies: + graceful-fs "^4.1.2" + jsonfile "^2.1.0" + klaw "^1.0.0" + path-is-absolute "^1.0.0" + rimraf "^2.2.8" + + fs-extra@^2.0.0: + version "2.1.2" + resolved "https://registry.yarnpkg.com/fs-extra/-/fs-extra-2.1.2.tgz#046c70163cef9aad46b0e4a7fa467fb22d71de35" + dependencies: + graceful-fs "^4.1.2" + jsonfile "^2.1.0" + + fs-extra@^3.0.1: + version "3.0.1" + resolved "https://registry.yarnpkg.com/fs-extra/-/fs-extra-3.0.1.tgz#3794f378c58b342ea7dbbb23095109c4b3b62291" + dependencies: + graceful-fs "^4.1.2" + jsonfile "^3.0.0" + universalify "^0.1.0" + + fs-extra@^4.0.1: + version "4.0.3" + resolved "https://registry.yarnpkg.com/fs-extra/-/fs-extra-4.0.3.tgz#0d852122e5bc5beb453fb028e9c0c9bf36340c94" + dependencies: + graceful-fs "^4.1.2" + jsonfile "^4.0.0" + universalify "^0.1.0" + + fs-extra@^5.0.0: + version "5.0.0" + resolved "https://registry.yarnpkg.com/fs-extra/-/fs-extra-5.0.0.tgz#414d0110cdd06705734d055652c5411260c31abd" + dependencies: + graceful-fs "^4.1.2" + jsonfile "^4.0.0" + universalify "^0.1.0" + + fs-readdir-recursive@^1.0.0: + version "1.1.0" + resolved "https://registry.yarnpkg.com/fs-readdir-recursive/-/fs-readdir-recursive-1.1.0.tgz#e32fc030a2ccee44a6b5371308da54be0b397d27" + + fs-write-stream-atomic@^1.0.8: + version "1.0.10" + resolved "https://registry.yarnpkg.com/fs-write-stream-atomic/-/fs-write-stream-atomic-1.0.10.tgz#b47df53493ef911df75731e70a9ded0189db40c9" + dependencies: + graceful-fs "^4.1.2" + iferr "^0.1.5" + imurmurhash "^0.1.4" + readable-stream "1 || 2" + + fs.realpath@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/fs.realpath/-/fs.realpath-1.0.0.tgz#1504ad2523158caa40db4a2787cb01411994ea4f" + + fsevents@^1.0.0: + version "1.1.3" + resolved "https://registry.yarnpkg.com/fsevents/-/fsevents-1.1.3.tgz#11f82318f5fe7bb2cd22965a108e9306208216d8" + dependencies: + nan "^2.3.0" + node-pre-gyp "^0.6.39" + + fstream-ignore@^1.0.5: + version "1.0.5" + resolved "https://registry.yarnpkg.com/fstream-ignore/-/fstream-ignore-1.0.5.tgz#9c31dae34767018fe1d249b24dada67d092da105" + dependencies: + fstream "^1.0.0" + inherits "2" + minimatch "^3.0.0" + + fstream@^1.0.0, fstream@^1.0.10, fstream@^1.0.2: + version "1.0.11" + resolved "https://registry.yarnpkg.com/fstream/-/fstream-1.0.11.tgz#5c1fb1f117477114f0632a0eb4b71b3cb0fd3171" + dependencies: + graceful-fs "^4.1.2" + inherits "~2.0.0" + mkdirp ">=0.5 0" + rimraf "2" + + function-bind@^1.0.2, function-bind@^1.1.1: + version "1.1.1" + resolved "https://registry.yarnpkg.com/function-bind/-/function-bind-1.1.1.tgz#a56899d3ea3c9bab874bb9773b7c5ede92f4895d" + + function-name-support@^0.2.0: + version "0.2.0" + resolved "https://registry.yarnpkg.com/function-name-support/-/function-name-support-0.2.0.tgz#55d3bfaa6eafd505a50f9bc81fdf57564a0bb071" + + functional-red-black-tree@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/functional-red-black-tree/-/functional-red-black-tree-1.0.1.tgz#1b0ab3bd553b2a0d6399d29c0e3ea0b252078327" + + gauge@~2.7.3: + version "2.7.4" + resolved "https://registry.yarnpkg.com/gauge/-/gauge-2.7.4.tgz#2c03405c7538c39d7eb37b317022e325fb018bf7" + dependencies: + aproba "^1.0.3" + console-control-strings "^1.0.0" + has-unicode "^2.0.0" + object-assign "^4.1.0" + signal-exit "^3.0.0" + string-width "^1.0.1" + strip-ansi "^3.0.1" + wide-align "^1.1.0" + + gaze@~1.1.2: + version "1.1.2" + resolved "https://registry.yarnpkg.com/gaze/-/gaze-1.1.2.tgz#847224677adb8870d679257ed3388fdb61e40105" + dependencies: + globule "^1.0.0" + + get-caller-file@^1.0.1: + version "1.0.2" + resolved "https://registry.yarnpkg.com/get-caller-file/-/get-caller-file-1.0.2.tgz#f702e63127e7e231c160a80c1554acb70d5047e5" + + get-port@^3.0.0: + version "3.2.0" + resolved "https://registry.yarnpkg.com/get-port/-/get-port-3.2.0.tgz#dd7ce7de187c06c8bf353796ac71e099f0980ebc" + + get-stdin@^4.0.1: + version "4.0.1" + resolved "https://registry.yarnpkg.com/get-stdin/-/get-stdin-4.0.1.tgz#b968c6b0a04384324902e8bf1a5df32579a450fe" + + get-stdin@^5.0.1: + version "5.0.1" + resolved "https://registry.yarnpkg.com/get-stdin/-/get-stdin-5.0.1.tgz#122e161591e21ff4c52530305693f20e6393a398" + + get-stream@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/get-stream/-/get-stream-3.0.0.tgz#8e943d1358dc37555054ecbe2edb05aa174ede14" + + getpass@^0.1.1: + version "0.1.7" + resolved "https://registry.yarnpkg.com/getpass/-/getpass-0.1.7.tgz#5eff8e3e684d569ae4cb2b1282604e8ba62149fa" + dependencies: + assert-plus "^1.0.0" + + glob-base@^0.3.0: + version "0.3.0" + resolved "https://registry.yarnpkg.com/glob-base/-/glob-base-0.3.0.tgz#dbb164f6221b1c0b1ccf82aea328b497df0ea3c4" + dependencies: + glob-parent "^2.0.0" + is-glob "^2.0.0" + + glob-parent@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/glob-parent/-/glob-parent-2.0.0.tgz#81383d72db054fcccf5336daa902f182f6edbb28" + dependencies: + is-glob "^2.0.0" + + glob@^7.0.0, glob@^7.0.3, glob@^7.0.5, glob@^7.1.2, glob@~7.1.1: + version "7.1.2" + resolved "https://registry.yarnpkg.com/glob/-/glob-7.1.2.tgz#c19c9df9a028702d678612384a6552404c636d15" + dependencies: + fs.realpath "^1.0.0" + inflight "^1.0.4" + inherits "2" + minimatch "^3.0.4" + once "^1.3.0" + path-is-absolute "^1.0.0" + + global-dirs@^0.1.0: + version "0.1.1" + resolved "https://registry.yarnpkg.com/global-dirs/-/global-dirs-0.1.1.tgz#b319c0dd4607f353f3be9cca4c72fc148c49f445" + dependencies: + ini "^1.3.4" + + globals@^9.17.0, globals@^9.18.0: + version "9.18.0" + resolved "https://registry.yarnpkg.com/globals/-/globals-9.18.0.tgz#aa3896b3e69b487f17e31ed2143d69a8e30c2d8a" + + globby@^5.0.0: + version "5.0.0" + resolved "https://registry.yarnpkg.com/globby/-/globby-5.0.0.tgz#ebd84667ca0dbb330b99bcfc68eac2bc54370e0d" + dependencies: + array-union "^1.0.1" + arrify "^1.0.0" + glob "^7.0.3" + object-assign "^4.0.1" + pify "^2.0.0" + pinkie-promise "^2.0.0" + + globby@^6.0.0: + version "6.1.0" + resolved "https://registry.yarnpkg.com/globby/-/globby-6.1.0.tgz#f5a6d70e8395e21c858fb0489d64df02424d506c" + dependencies: + array-union "^1.0.1" + glob "^7.0.3" + object-assign "^4.0.1" + pify "^2.0.0" + pinkie-promise "^2.0.0" + + globby@^7.1.1: + version "7.1.1" + resolved "https://registry.yarnpkg.com/globby/-/globby-7.1.1.tgz#fb2ccff9401f8600945dfada97440cca972b8680" + dependencies: + array-union "^1.0.1" + dir-glob "^2.0.0" + glob "^7.1.2" + ignore "^3.3.5" + pify "^3.0.0" + slash "^1.0.0" + + globule@^1.0.0: + version "1.2.0" + resolved "https://registry.yarnpkg.com/globule/-/globule-1.2.0.tgz#1dc49c6822dd9e8a2fa00ba2a295006e8664bd09" + dependencies: + glob "~7.1.1" + lodash "~4.17.4" + minimatch "~3.0.2" + + got@7.1.0: + version "7.1.0" + resolved "https://registry.yarnpkg.com/got/-/got-7.1.0.tgz#05450fd84094e6bbea56f451a43a9c289166385a" + dependencies: + decompress-response "^3.2.0" + duplexer3 "^0.1.4" + get-stream "^3.0.0" + is-plain-obj "^1.1.0" + is-retry-allowed "^1.0.0" + is-stream "^1.0.0" + isurl "^1.0.0-alpha5" + lowercase-keys "^1.0.0" + p-cancelable "^0.3.0" + p-timeout "^1.1.1" + safe-buffer "^5.0.1" + timed-out "^4.0.0" + url-parse-lax "^1.0.0" + url-to-options "^1.0.1" + + got@^6.7.1: + version "6.7.1" + resolved "https://registry.yarnpkg.com/got/-/got-6.7.1.tgz#240cd05785a9a18e561dc1b44b41c763ef1e8db0" + dependencies: + create-error-class "^3.0.0" + duplexer3 "^0.1.4" + get-stream "^3.0.0" + is-redirect "^1.0.0" + is-retry-allowed "^1.0.0" + is-stream "^1.0.0" + lowercase-keys "^1.0.0" + safe-buffer "^5.0.1" + timed-out "^4.0.0" + unzip-response "^2.0.1" + url-parse-lax "^1.0.0" + + graceful-fs@^4.1.0, graceful-fs@^4.1.11, graceful-fs@^4.1.2, graceful-fs@^4.1.4, graceful-fs@^4.1.6, graceful-fs@^4.1.9: + version "4.1.11" + resolved "https://registry.yarnpkg.com/graceful-fs/-/graceful-fs-4.1.11.tgz#0e8bdfe4d1ddb8854d64e04ea7c00e2a026e5658" + + har-schema@^1.0.5: + version "1.0.5" + resolved "https://registry.yarnpkg.com/har-schema/-/har-schema-1.0.5.tgz#d263135f43307c02c602afc8fe95970c0151369e" + + har-schema@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/har-schema/-/har-schema-2.0.0.tgz#a94c2224ebcac04782a0d9035521f24735b7ec92" + + har-validator@~4.2.1: + version "4.2.1" + resolved "https://registry.yarnpkg.com/har-validator/-/har-validator-4.2.1.tgz#33481d0f1bbff600dd203d75812a6a5fba002e2a" + dependencies: + ajv "^4.9.1" + har-schema "^1.0.5" + + har-validator@~5.0.3: + version "5.0.3" + resolved "https://registry.yarnpkg.com/har-validator/-/har-validator-5.0.3.tgz#ba402c266194f15956ef15e0fcf242993f6a7dfd" + dependencies: + ajv "^5.1.0" + har-schema "^2.0.0" + + has-ansi@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/has-ansi/-/has-ansi-2.0.0.tgz#34f5049ce1ecdf2b0649af3ef24e45ed35416d91" + dependencies: + ansi-regex "^2.0.0" + + has-color@~0.1.0: + version "0.1.7" + resolved "https://registry.yarnpkg.com/has-color/-/has-color-0.1.7.tgz#67144a5260c34fc3cca677d041daf52fe7b78b2f" + + has-flag@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/has-flag/-/has-flag-1.0.0.tgz#9d9e793165ce017a00f00418c43f942a7b1d11fa" + + has-flag@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/has-flag/-/has-flag-2.0.0.tgz#e8207af1cc7b30d446cc70b734b5e8be18f88d51" + + has-flag@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/has-flag/-/has-flag-3.0.0.tgz#b5d454dc2199ae225699f3467e5a07f3b955bafd" + + has-symbol-support-x@^1.4.1: + version "1.4.1" + resolved "https://registry.yarnpkg.com/has-symbol-support-x/-/has-symbol-support-x-1.4.1.tgz#66ec2e377e0c7d7ccedb07a3a84d77510ff1bc4c" + + has-to-string-tag-x@^1.2.0: + version "1.4.1" + resolved "https://registry.yarnpkg.com/has-to-string-tag-x/-/has-to-string-tag-x-1.4.1.tgz#a045ab383d7b4b2012a00148ab0aa5f290044d4d" + dependencies: + has-symbol-support-x "^1.4.1" + + has-unicode@^2.0.0: + version "2.0.1" + resolved "https://registry.yarnpkg.com/has-unicode/-/has-unicode-2.0.1.tgz#e0e6fe6a28cf51138855e086d1691e771de2a8b9" + + has-yarn@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/has-yarn/-/has-yarn-1.0.0.tgz#89e25db604b725c8f5976fff0addc921b828a5a7" + + has@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/has/-/has-1.0.1.tgz#8461733f538b0837c9361e39a9ab9e9704dc2f28" + dependencies: + function-bind "^1.0.2" + + hash-base@^2.0.0: + version "2.0.2" + resolved "https://registry.yarnpkg.com/hash-base/-/hash-base-2.0.2.tgz#66ea1d856db4e8a5470cadf6fce23ae5244ef2e1" + dependencies: + inherits "^2.0.1" + + hash-base@^3.0.0: + version "3.0.4" + resolved "https://registry.yarnpkg.com/hash-base/-/hash-base-3.0.4.tgz#5fc8686847ecd73499403319a6b0a3f3f6ae4918" + dependencies: + inherits "^2.0.1" + safe-buffer "^5.0.1" + + hash.js@^1.0.0, hash.js@^1.0.3: + version "1.1.3" + resolved "https://registry.yarnpkg.com/hash.js/-/hash.js-1.1.3.tgz#340dedbe6290187151c1ea1d777a3448935df846" + dependencies: + inherits "^2.0.3" + minimalistic-assert "^1.0.0" + + hawk@3.1.3, hawk@~3.1.3: + version "3.1.3" + resolved "https://registry.yarnpkg.com/hawk/-/hawk-3.1.3.tgz#078444bd7c1640b0fe540d2c9b73d59678e8e1c4" + dependencies: + boom "2.x.x" + cryptiles "2.x.x" + hoek "2.x.x" + sntp "1.x.x" + + hawk@~6.0.2: + version "6.0.2" + resolved "https://registry.yarnpkg.com/hawk/-/hawk-6.0.2.tgz#af4d914eb065f9b5ce4d9d11c1cb2126eecc3038" + dependencies: + boom "4.x.x" + cryptiles "3.x.x" + hoek "4.x.x" + sntp "2.x.x" + + hmac-drbg@^1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/hmac-drbg/-/hmac-drbg-1.0.1.tgz#d2745701025a6c775a6c545793ed502fc0c649a1" + dependencies: + hash.js "^1.0.3" + minimalistic-assert "^1.0.0" + minimalistic-crypto-utils "^1.0.1" + + hoek@2.x.x: + version "2.16.3" + resolved "https://registry.yarnpkg.com/hoek/-/hoek-2.16.3.tgz#20bb7403d3cea398e91dc4710a8ff1b8274a25ed" + + hoek@4.x.x: + version "4.2.1" + resolved "https://registry.yarnpkg.com/hoek/-/hoek-4.2.1.tgz#9634502aa12c445dd5a7c5734b572bb8738aacbb" + + hoist-non-react-statics@^2.5.0: + version "2.5.0" + resolved "https://registry.yarnpkg.com/hoist-non-react-statics/-/hoist-non-react-statics-2.5.0.tgz#d2ca2dfc19c5a91c5a6615ce8e564ef0347e2a40" + + home-or-tmp@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/home-or-tmp/-/home-or-tmp-2.0.0.tgz#e36c3f2d2cae7d746a857e38d18d5f32a7882db8" + dependencies: + os-homedir "^1.0.0" + os-tmpdir "^1.0.1" + + home-path@^1.0.1: + version "1.0.5" + resolved "https://registry.yarnpkg.com/home-path/-/home-path-1.0.5.tgz#788b29815b12d53bacf575648476e6f9041d133f" + + hosted-git-info@^2.1.4: + version "2.5.0" + resolved "https://registry.yarnpkg.com/hosted-git-info/-/hosted-git-info-2.5.0.tgz#6d60e34b3abbc8313062c3b798ef8d901a07af3c" + + hosted-git-info@^2.6.0: + version "2.6.0" + resolved "https://registry.yarnpkg.com/hosted-git-info/-/hosted-git-info-2.6.0.tgz#23235b29ab230c576aab0d4f13fc046b0b038222" + + html-comment-regex@^1.1.0: + version "1.1.1" + resolved "https://registry.yarnpkg.com/html-comment-regex/-/html-comment-regex-1.1.1.tgz#668b93776eaae55ebde8f3ad464b307a4963625e" + + http-signature@~1.1.0: + version "1.1.1" + resolved "https://registry.yarnpkg.com/http-signature/-/http-signature-1.1.1.tgz#df72e267066cd0ac67fb76adf8e134a8fbcf91bf" + dependencies: + assert-plus "^0.2.0" + jsprim "^1.2.2" + sshpk "^1.7.0" + + http-signature@~1.2.0: + version "1.2.0" + resolved "https://registry.yarnpkg.com/http-signature/-/http-signature-1.2.0.tgz#9aecd925114772f3d95b65a60abb8f7c18fbace1" + dependencies: + assert-plus "^1.0.0" + jsprim "^1.2.2" + sshpk "^1.7.0" + + https-browserify@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/https-browserify/-/https-browserify-1.0.0.tgz#ec06c10e0a34c0f2faf199f7fd7fc78fffd03c73" + + hullabaloo-config-manager@^1.1.0: + version "1.1.1" + resolved "https://registry.yarnpkg.com/hullabaloo-config-manager/-/hullabaloo-config-manager-1.1.1.tgz#1d9117813129ad035fd9e8477eaf066911269fe3" + dependencies: + dot-prop "^4.1.0" + es6-error "^4.0.2" + graceful-fs "^4.1.11" + indent-string "^3.1.0" + json5 "^0.5.1" + lodash.clonedeep "^4.5.0" + lodash.clonedeepwith "^4.5.0" + lodash.isequal "^4.5.0" + lodash.merge "^4.6.0" + md5-hex "^2.0.0" + package-hash "^2.0.0" + pkg-dir "^2.0.0" + resolve-from "^3.0.0" + safe-buffer "^5.0.1" + + husky@0.14.3: + version "0.14.3" + resolved "https://registry.yarnpkg.com/husky/-/husky-0.14.3.tgz#c69ed74e2d2779769a17ba8399b54ce0b63c12c3" + dependencies: + is-ci "^1.0.10" + normalize-path "^1.0.0" + strip-indent "^2.0.0" + + iconv-lite@^0.4.17, iconv-lite@^0.4.19, iconv-lite@~0.4.13: + version "0.4.19" + resolved "https://registry.yarnpkg.com/iconv-lite/-/iconv-lite-0.4.19.tgz#f7468f60135f5e5dad3399c0a81be9a1603a082b" + + icss-replace-symbols@^1.1.0: + version "1.1.0" + resolved "https://registry.yarnpkg.com/icss-replace-symbols/-/icss-replace-symbols-1.1.0.tgz#06ea6f83679a7749e386cfe1fe812ae5db223ded" + + icss-utils@^2.1.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/icss-utils/-/icss-utils-2.1.0.tgz#83f0a0ec378bf3246178b6c2ad9136f135b1c962" + dependencies: + postcss "^6.0.1" + + ieee754@^1.1.4: + version "1.1.8" + resolved "https://registry.yarnpkg.com/ieee754/-/ieee754-1.1.8.tgz#be33d40ac10ef1926701f6f08a2d86fbfd1ad3e4" + + iferr@^0.1.5: + version "0.1.5" + resolved "https://registry.yarnpkg.com/iferr/-/iferr-0.1.5.tgz#c60eed69e6d8fdb6b3104a1fcbca1c192dc5b501" + + ignore-by-default@^1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/ignore-by-default/-/ignore-by-default-1.0.1.tgz#48ca6d72f6c6a3af00a9ad4ae6876be3889e2b09" + + ignore@^3.3.3, ignore@^3.3.5: + version "3.3.7" + resolved "https://registry.yarnpkg.com/ignore/-/ignore-3.3.7.tgz#612289bfb3c220e186a58118618d5be8c1bab021" + + import-lazy@^2.1.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/import-lazy/-/import-lazy-2.1.0.tgz#05698e3d45c88e8d7e9d92cb0584e77f096f3e43" + + import-local@^0.1.1: + version "0.1.1" + resolved "https://registry.yarnpkg.com/import-local/-/import-local-0.1.1.tgz#b1179572aacdc11c6a91009fb430dbcab5f668a8" + dependencies: + pkg-dir "^2.0.0" + resolve-cwd "^2.0.0" + + imurmurhash@^0.1.4: + version "0.1.4" + resolved "https://registry.yarnpkg.com/imurmurhash/-/imurmurhash-0.1.4.tgz#9218b9b2b928a238b13dc4fb6b6d576f231453ea" + + indent-string@^2.1.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/indent-string/-/indent-string-2.1.0.tgz#8e2d48348742121b4a8218b7a137e9a52049dc80" + dependencies: + repeating "^2.0.0" + + indent-string@^3.0.0, indent-string@^3.1.0, indent-string@^3.2.0: + version "3.2.0" + resolved "https://registry.yarnpkg.com/indent-string/-/indent-string-3.2.0.tgz#4a5fd6d27cc332f37e5419a504dbb837105c9289" + + indexes-of@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/indexes-of/-/indexes-of-1.0.1.tgz#f30f716c8e2bd346c7b67d3df3915566a7c05607" + + indexof@0.0.1: + version "0.0.1" + resolved "https://registry.yarnpkg.com/indexof/-/indexof-0.0.1.tgz#82dc336d232b9062179d05ab3293a66059fd435d" + + inflight@^1.0.4: + version "1.0.6" + resolved "https://registry.yarnpkg.com/inflight/-/inflight-1.0.6.tgz#49bd6331d7d02d0c09bc910a1075ba8165b56df9" + dependencies: + once "^1.3.0" + wrappy "1" + + inherits@2, inherits@^2.0.1, inherits@^2.0.3, inherits@~2.0.0, inherits@~2.0.1, inherits@~2.0.3: + version "2.0.3" + resolved "https://registry.yarnpkg.com/inherits/-/inherits-2.0.3.tgz#633c2c83e3da42a502f52466022480f4208261de" + + inherits@2.0.1: + version "2.0.1" + resolved "https://registry.yarnpkg.com/inherits/-/inherits-2.0.1.tgz#b17d08d326b4423e568eff719f91b0b1cbdf69f1" + + ini@^1.3.4, ini@~1.3.0: + version "1.3.5" + resolved "https://registry.yarnpkg.com/ini/-/ini-1.3.5.tgz#eee25f56db1c9ec6085e0c22778083f596abf927" + + inquirer@5.1.0: + version "5.1.0" + resolved "https://registry.yarnpkg.com/inquirer/-/inquirer-5.1.0.tgz#19da508931892328abbbdd4c477f1efc65abfd67" + dependencies: + ansi-escapes "^3.0.0" + chalk "^2.0.0" + cli-cursor "^2.1.0" + cli-width "^2.0.0" + external-editor "^2.1.0" + figures "^2.0.0" + lodash "^4.3.0" + mute-stream "0.0.7" + run-async "^2.2.0" + rxjs "^5.5.2" + string-width "^2.1.0" + strip-ansi "^4.0.0" + through "^2.3.6" + + inquirer@^3.0.6, inquirer@~3.3.0: + version "3.3.0" + resolved "https://registry.yarnpkg.com/inquirer/-/inquirer-3.3.0.tgz#9dd2f2ad765dcab1ff0443b491442a20ba227dc9" + dependencies: + ansi-escapes "^3.0.0" + chalk "^2.0.0" + cli-cursor "^2.1.0" + cli-width "^2.0.0" + external-editor "^2.0.4" + figures "^2.0.0" + lodash "^4.3.0" + mute-stream "0.0.7" + run-async "^2.2.0" + rx-lite "^4.0.8" + rx-lite-aggregates "^4.0.8" + string-width "^2.1.0" + strip-ansi "^4.0.0" + through "^2.3.6" + + interpret@^1.0.0: + version "1.1.0" + resolved "https://registry.yarnpkg.com/interpret/-/interpret-1.1.0.tgz#7ed1b1410c6a0e0f78cf95d3b8440c63f78b8614" + + invariant@^2.0.0, invariant@^2.2.2: + version "2.2.3" + resolved "https://registry.yarnpkg.com/invariant/-/invariant-2.2.3.tgz#1a827dfde7dcbd7c323f0ca826be8fa7c5e9d688" + dependencies: + loose-envify "^1.0.0" + + invert-kv@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/invert-kv/-/invert-kv-1.0.0.tgz#104a8e4aaca6d3d8cd157a8ef8bfab2d7a3ffdb6" + + irregular-plurals@^1.0.0: + version "1.4.0" + resolved "https://registry.yarnpkg.com/irregular-plurals/-/irregular-plurals-1.4.0.tgz#2ca9b033651111855412f16be5d77c62a458a766" + + is-absolute-url@^2.0.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/is-absolute-url/-/is-absolute-url-2.1.0.tgz#50530dfb84fcc9aa7dbe7852e83a37b93b9f2aa6" + + is-arrayish@^0.2.1: + version "0.2.1" + resolved "https://registry.yarnpkg.com/is-arrayish/-/is-arrayish-0.2.1.tgz#77c99840527aa8ecb1a8ba697b80645a7a926a9d" + + is-arrayish@^0.3.1: + version "0.3.1" + resolved "https://registry.yarnpkg.com/is-arrayish/-/is-arrayish-0.3.1.tgz#c2dfc386abaa0c3e33c48db3fe87059e69065efd" + + is-binary-path@^1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/is-binary-path/-/is-binary-path-1.0.1.tgz#75f16642b480f187a711c814161fd3a4a7655898" + dependencies: + binary-extensions "^1.0.0" + + is-buffer@^1.1.5: + version "1.1.6" + resolved "https://registry.yarnpkg.com/is-buffer/-/is-buffer-1.1.6.tgz#efaa2ea9daa0d7ab2ea13a97b2b8ad51fefbe8be" + + is-builtin-module@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/is-builtin-module/-/is-builtin-module-1.0.0.tgz#540572d34f7ac3119f8f76c30cbc1b1e037affbe" + dependencies: + builtin-modules "^1.0.0" + + is-callable@^1.1.1, is-callable@^1.1.3: + version "1.1.3" + resolved "https://registry.yarnpkg.com/is-callable/-/is-callable-1.1.3.tgz#86eb75392805ddc33af71c92a0eedf74ee7604b2" + + is-ci@^1.0.10, is-ci@^1.0.7, is-ci@^1.1.0: + version "1.1.0" + resolved "https://registry.yarnpkg.com/is-ci/-/is-ci-1.1.0.tgz#247e4162e7860cebbdaf30b774d6b0ac7dcfe7a5" + dependencies: + ci-info "^1.0.0" + + is-date-object@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/is-date-object/-/is-date-object-1.0.1.tgz#9aa20eb6aeebbff77fbd33e74ca01b33581d3a16" + + is-dotfile@^1.0.0: + version "1.0.3" + resolved "https://registry.yarnpkg.com/is-dotfile/-/is-dotfile-1.0.3.tgz#a6a2f32ffd2dfb04f5ca25ecd0f6b83cf798a1e1" + + is-equal-shallow@^0.1.3: + version "0.1.3" + resolved "https://registry.yarnpkg.com/is-equal-shallow/-/is-equal-shallow-0.1.3.tgz#2238098fc221de0bcfa5d9eac4c45d638aa1c534" + dependencies: + is-primitive "^2.0.0" + + is-error@^2.2.0: + version "2.2.1" + resolved "https://registry.yarnpkg.com/is-error/-/is-error-2.2.1.tgz#684a96d84076577c98f4cdb40c6d26a5123bf19c" + + is-extendable@^0.1.1: + version "0.1.1" + resolved "https://registry.yarnpkg.com/is-extendable/-/is-extendable-0.1.1.tgz#62b110e289a471418e3ec36a617d472e301dfc89" + + is-extglob@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/is-extglob/-/is-extglob-1.0.0.tgz#ac468177c4943405a092fc8f29760c6ffc6206c0" + + is-extglob@^2.1.1: + version "2.1.1" + resolved "https://registry.yarnpkg.com/is-extglob/-/is-extglob-2.1.1.tgz#a88c02535791f02ed37c76a1b9ea9773c833f8c2" + + is-finite@^1.0.0: + version "1.0.2" + resolved "https://registry.yarnpkg.com/is-finite/-/is-finite-1.0.2.tgz#cc6677695602be550ef11e8b4aa6305342b6d0aa" + dependencies: + number-is-nan "^1.0.0" + + is-fullwidth-code-point@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/is-fullwidth-code-point/-/is-fullwidth-code-point-1.0.0.tgz#ef9e31386f031a7f0d643af82fde50c457ef00cb" + dependencies: + number-is-nan "^1.0.0" + + is-fullwidth-code-point@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/is-fullwidth-code-point/-/is-fullwidth-code-point-2.0.0.tgz#a3b30a5c4f199183167aaab93beefae3ddfb654f" + + is-generator-fn@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/is-generator-fn/-/is-generator-fn-1.0.0.tgz#969d49e1bb3329f6bb7f09089be26578b2ddd46a" + + is-glob@^2.0.0, is-glob@^2.0.1: + version "2.0.1" + resolved "https://registry.yarnpkg.com/is-glob/-/is-glob-2.0.1.tgz#d096f926a3ded5600f3fdfd91198cb0888c2d863" + dependencies: + is-extglob "^1.0.0" + + is-glob@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/is-glob/-/is-glob-4.0.0.tgz#9521c76845cc2610a85203ddf080a958c2ffabc0" + dependencies: + is-extglob "^2.1.1" + + is-installed-globally@^0.1.0: + version "0.1.0" + resolved "https://registry.yarnpkg.com/is-installed-globally/-/is-installed-globally-0.1.0.tgz#0dfd98f5a9111716dd535dda6492f67bf3d25a80" + dependencies: + global-dirs "^0.1.0" + is-path-inside "^1.0.0" + + is-npm@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/is-npm/-/is-npm-1.0.0.tgz#f2fb63a65e4905b406c86072765a1a4dc793b9f4" + + is-number@^2.1.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/is-number/-/is-number-2.1.0.tgz#01fcbbb393463a548f2f466cce16dece49db908f" + dependencies: + kind-of "^3.0.2" + + is-number@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/is-number/-/is-number-3.0.0.tgz#24fd6201a4782cf50561c810276afc7d12d71195" + dependencies: + kind-of "^3.0.2" + + is-obj@^1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/is-obj/-/is-obj-1.0.1.tgz#3e4729ac1f5fde025cd7d83a896dab9f4f67db0f" + + is-object@^1.0.1, is-object@~1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/is-object/-/is-object-1.0.1.tgz#8952688c5ec2ffd6b03ecc85e769e02903083470" + + is-observable@^0.2.0: + version "0.2.0" + resolved "https://registry.yarnpkg.com/is-observable/-/is-observable-0.2.0.tgz#b361311d83c6e5d726cabf5e250b0237106f5ae2" + dependencies: + symbol-observable "^0.2.2" + + is-observable@^1.0.0: + version "1.1.0" + resolved "https://registry.yarnpkg.com/is-observable/-/is-observable-1.1.0.tgz#b3e986c8f44de950867cab5403f5a3465005975e" + dependencies: + symbol-observable "^1.1.0" + + is-path-cwd@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/is-path-cwd/-/is-path-cwd-1.0.0.tgz#d225ec23132e89edd38fda767472e62e65f1106d" + + is-path-in-cwd@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/is-path-in-cwd/-/is-path-in-cwd-1.0.0.tgz#6477582b8214d602346094567003be8a9eac04dc" + dependencies: + is-path-inside "^1.0.0" + + is-path-inside@^1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/is-path-inside/-/is-path-inside-1.0.1.tgz#8ef5b7de50437a3fdca6b4e865ef7aa55cb48036" + dependencies: + path-is-inside "^1.0.1" + + is-plain-obj@^1.0.0, is-plain-obj@^1.1.0: + version "1.1.0" + resolved "https://registry.yarnpkg.com/is-plain-obj/-/is-plain-obj-1.1.0.tgz#71a50c8429dfca773c92a390a4a03b39fcd51d3e" + + is-posix-bracket@^0.1.0: + version "0.1.1" + resolved "https://registry.yarnpkg.com/is-posix-bracket/-/is-posix-bracket-0.1.1.tgz#3334dc79774368e92f016e6fbc0a88f5cd6e6bc4" + + is-primitive@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/is-primitive/-/is-primitive-2.0.0.tgz#207bab91638499c07b2adf240a41a87210034575" + + is-promise@^2.1.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/is-promise/-/is-promise-2.1.0.tgz#79a2a9ece7f096e80f36d2b2f3bc16c1ff4bf3fa" + + is-redirect@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/is-redirect/-/is-redirect-1.0.0.tgz#1d03dded53bd8db0f30c26e4f95d36fc7c87dc24" + + is-regex@^1.0.4: + version "1.0.4" + resolved "https://registry.yarnpkg.com/is-regex/-/is-regex-1.0.4.tgz#5517489b547091b0930e095654ced25ee97e9491" + dependencies: + has "^1.0.1" + + is-resolvable@^1.0.0: + version "1.1.0" + resolved "https://registry.yarnpkg.com/is-resolvable/-/is-resolvable-1.1.0.tgz#fb18f87ce1feb925169c9a407c19318a3206ed88" + + is-retry-allowed@^1.0.0: + version "1.1.0" + resolved "https://registry.yarnpkg.com/is-retry-allowed/-/is-retry-allowed-1.1.0.tgz#11a060568b67339444033d0125a61a20d564fb34" + + is-ssh@^1.3.0: + version "1.3.0" + resolved "https://registry.yarnpkg.com/is-ssh/-/is-ssh-1.3.0.tgz#ebea1169a2614da392a63740366c3ce049d8dff6" + dependencies: + protocols "^1.1.0" + + is-stream@^1.0.0, is-stream@^1.0.1, is-stream@^1.1.0: + version "1.1.0" + resolved "https://registry.yarnpkg.com/is-stream/-/is-stream-1.1.0.tgz#12d4a3dd4e68e0b79ceb8dbc84173ae80d91ca44" + + is-svg@^2.0.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/is-svg/-/is-svg-2.1.0.tgz#cf61090da0d9efbcab8722deba6f032208dbb0e9" + dependencies: + html-comment-regex "^1.1.0" + + is-symbol@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/is-symbol/-/is-symbol-1.0.1.tgz#3cc59f00025194b6ab2e38dbae6689256b660572" + + is-typedarray@~1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/is-typedarray/-/is-typedarray-1.0.0.tgz#e479c80858df0c1b11ddda6940f96011fcda4a9a" + + is-url@^1.2.1: + version "1.2.2" + resolved "https://registry.yarnpkg.com/is-url/-/is-url-1.2.2.tgz#498905a593bf47cc2d9e7f738372bbf7696c7f26" + + is-utf8@^0.2.0, is-utf8@^0.2.1: + version "0.2.1" + resolved "https://registry.yarnpkg.com/is-utf8/-/is-utf8-0.2.1.tgz#4b0da1442104d1b336340e80797e865cf39f7d72" + + is-windows@^1.0.0: + version "1.0.2" + resolved "https://registry.yarnpkg.com/is-windows/-/is-windows-1.0.2.tgz#d1850eb9791ecd18e6182ce12a30f396634bb19d" + + is-wsl@^1.1.0: + version "1.1.0" + resolved "https://registry.yarnpkg.com/is-wsl/-/is-wsl-1.1.0.tgz#1f16e4aa22b04d1336b66188a66af3c600c3a66d" + + isarray@0.0.1: + version "0.0.1" + resolved "https://registry.yarnpkg.com/isarray/-/isarray-0.0.1.tgz#8a18acfca9a8f4177e09abfc6038939b05d1eedf" + + isarray@1.0.0, isarray@^1.0.0, isarray@~1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/isarray/-/isarray-1.0.0.tgz#bb935d48582cba168c06834957a54a3e07124f11" + + isbinaryfile@^3.0.2: + version "3.0.2" + resolved "https://registry.yarnpkg.com/isbinaryfile/-/isbinaryfile-3.0.2.tgz#4a3e974ec0cba9004d3fc6cde7209ea69368a621" + + isexe@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/isexe/-/isexe-2.0.0.tgz#e8fbf374dc556ff8947a10dcb0572d633f2cfa10" + + isobject@^2.0.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/isobject/-/isobject-2.1.0.tgz#f065561096a3f1da2ef46272f815c840d87e0c89" + dependencies: + isarray "1.0.0" + + isomorphic-fetch@^2.1.1: + version "2.2.1" + resolved "https://registry.yarnpkg.com/isomorphic-fetch/-/isomorphic-fetch-2.2.1.tgz#611ae1acf14f5e81f729507472819fe9733558a9" + dependencies: + node-fetch "^1.0.1" + whatwg-fetch ">=0.10.0" + + isstream@~0.1.2: + version "0.1.2" + resolved "https://registry.yarnpkg.com/isstream/-/isstream-0.1.2.tgz#47e63f7af55afa6f92e1500e690eb8b8529c099a" + + isurl@^1.0.0-alpha5: + version "1.0.0" + resolved "https://registry.yarnpkg.com/isurl/-/isurl-1.0.0.tgz#b27f4f49f3cdaa3ea44a0a5b7f3462e6edc39d67" + dependencies: + has-to-string-tag-x "^1.2.0" + is-object "^1.0.1" + + jest-docblock@^21.0.0: + version "21.2.0" + resolved "https://registry.yarnpkg.com/jest-docblock/-/jest-docblock-21.2.0.tgz#51529c3b30d5fd159da60c27ceedc195faf8d414" + + js-base64@^2.1.9: + version "2.4.3" + resolved "https://registry.yarnpkg.com/js-base64/-/js-base64-2.4.3.tgz#2e545ec2b0f2957f41356510205214e98fad6582" + + js-string-escape@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/js-string-escape/-/js-string-escape-1.0.1.tgz#e2625badbc0d67c7533e9edc1068c587ae4137ef" + + js-tokens@^3.0.0, js-tokens@^3.0.2: + version "3.0.2" + resolved "https://registry.yarnpkg.com/js-tokens/-/js-tokens-3.0.2.tgz#9866df395102130e38f7f996bceb65443209c25b" + + js-yaml@^3.10.0, js-yaml@^3.9.1: + version "3.10.0" + resolved "https://registry.yarnpkg.com/js-yaml/-/js-yaml-3.10.0.tgz#2e78441646bd4682e963f22b6e92823c309c62dc" + dependencies: + argparse "^1.0.7" + esprima "^4.0.0" + + js-yaml@^3.11.0: + version "3.11.0" + resolved "https://registry.yarnpkg.com/js-yaml/-/js-yaml-3.11.0.tgz#597c1a8bd57152f26d622ce4117851a51f5ebaef" + dependencies: + argparse "^1.0.7" + esprima "^4.0.0" + + js-yaml@~3.7.0: + version "3.7.0" + resolved "https://registry.yarnpkg.com/js-yaml/-/js-yaml-3.7.0.tgz#5c967ddd837a9bfdca5f2de84253abe8a1c03b80" + dependencies: + argparse "^1.0.7" + esprima "^2.6.0" + + jsbn@~0.1.0: + version "0.1.1" + resolved "https://registry.yarnpkg.com/jsbn/-/jsbn-0.1.1.tgz#a5e654c2e5a2deb5f201d96cefbca80c0ef2f513" + + jsesc@^1.3.0: + version "1.3.0" + resolved "https://registry.yarnpkg.com/jsesc/-/jsesc-1.3.0.tgz#46c3fec8c1892b12b0833db9bc7622176dbab34b" + + jsesc@~0.5.0: + version "0.5.0" + resolved "https://registry.yarnpkg.com/jsesc/-/jsesc-0.5.0.tgz#e7dee66e35d6fc16f710fe91d5cf69f70f08911d" + + json-loader@0.5.7, json-loader@^0.5.4: + version "0.5.7" + resolved "https://registry.yarnpkg.com/json-loader/-/json-loader-0.5.7.tgz#dca14a70235ff82f0ac9a3abeb60d337a365185d" + + json-parse-better-errors@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/json-parse-better-errors/-/json-parse-better-errors-1.0.1.tgz#50183cd1b2d25275de069e9e71b467ac9eab973a" + + json-schema-traverse@^0.3.0: + version "0.3.1" + resolved "https://registry.yarnpkg.com/json-schema-traverse/-/json-schema-traverse-0.3.1.tgz#349a6d44c53a51de89b40805c5d5e59b417d3340" + + json-schema@0.2.3: + version "0.2.3" + resolved "https://registry.yarnpkg.com/json-schema/-/json-schema-0.2.3.tgz#b480c892e59a2f05954ce727bd3f2a4e882f9e13" + + json-stable-stringify@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/json-stable-stringify/-/json-stable-stringify-1.0.1.tgz#9a759d39c5f2ff503fd5300646ed445f88c4f9af" + dependencies: + jsonify "~0.0.0" + + json-stringify-safe@~5.0.1: + version "5.0.1" + resolved "https://registry.yarnpkg.com/json-stringify-safe/-/json-stringify-safe-5.0.1.tgz#1296a2d58fd45f19a0f6ce01d65701e2c735b6eb" + + json5@^0.5.0, json5@^0.5.1: + version "0.5.1" + resolved "https://registry.yarnpkg.com/json5/-/json5-0.5.1.tgz#1eade7acc012034ad84e2396767ead9fa5495821" + + jsonfile@^2.1.0: + version "2.4.0" + resolved "https://registry.yarnpkg.com/jsonfile/-/jsonfile-2.4.0.tgz#3736a2b428b87bbda0cc83b53fa3d633a35c2ae8" + optionalDependencies: + graceful-fs "^4.1.6" + + jsonfile@^3.0.0: + version "3.0.1" + resolved "https://registry.yarnpkg.com/jsonfile/-/jsonfile-3.0.1.tgz#a5ecc6f65f53f662c4415c7675a0331d0992ec66" + optionalDependencies: + graceful-fs "^4.1.6" + + jsonfile@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/jsonfile/-/jsonfile-4.0.0.tgz#8771aae0799b64076b76640fca058f9c10e33ecb" + optionalDependencies: + graceful-fs "^4.1.6" + + jsonify@~0.0.0: + version "0.0.0" + resolved "https://registry.yarnpkg.com/jsonify/-/jsonify-0.0.0.tgz#2c74b6ee41d93ca51b7b5aaee8f503631d252a73" + + jsprim@^1.2.2: + version "1.4.1" + resolved "https://registry.yarnpkg.com/jsprim/-/jsprim-1.4.1.tgz#313e66bc1e5cc06e438bc1b7499c2e5c56acb6a2" + dependencies: + assert-plus "1.0.0" + extsprintf "1.3.0" + json-schema "0.2.3" + verror "1.10.0" + + jsx-ast-utils@^2.0.0: + version "2.0.1" + resolved "https://registry.yarnpkg.com/jsx-ast-utils/-/jsx-ast-utils-2.0.1.tgz#e801b1b39985e20fffc87b40e3748080e2dcac7f" + dependencies: + array-includes "^3.0.3" + + kind-of@^3.0.2: + version "3.2.2" + resolved "https://registry.yarnpkg.com/kind-of/-/kind-of-3.2.2.tgz#31ea21a734bab9bbb0f32466d893aea51e4a3c64" + dependencies: + is-buffer "^1.1.5" + + kind-of@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/kind-of/-/kind-of-4.0.0.tgz#20813df3d712928b207378691a45066fae72dd57" + dependencies: + is-buffer "^1.1.5" + + klaw@^1.0.0: + version "1.3.1" + resolved "https://registry.yarnpkg.com/klaw/-/klaw-1.3.1.tgz#4088433b46b3b1ba259d78785d8e96f73ba02439" + optionalDependencies: + graceful-fs "^4.1.9" + + last-line-stream@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/last-line-stream/-/last-line-stream-1.0.0.tgz#d1b64d69f86ff24af2d04883a2ceee14520a5600" + dependencies: + through2 "^2.0.0" + + latest-version@^3.0.0: + version "3.1.0" + resolved "https://registry.yarnpkg.com/latest-version/-/latest-version-3.1.0.tgz#a205383fea322b33b5ae3b18abee0dc2f356ee15" + dependencies: + package-json "^4.0.0" + + lazy-cache@^1.0.3: + version "1.0.4" + resolved "https://registry.yarnpkg.com/lazy-cache/-/lazy-cache-1.0.4.tgz#a1d78fc3a50474cb80845d3b3b6e1da49a446e8e" + + lazy-val@^1.0.3: + version "1.0.3" + resolved "https://registry.yarnpkg.com/lazy-val/-/lazy-val-1.0.3.tgz#bb97b200ef00801d94c317e29dc6ed39e31c5edc" + + lazystream@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/lazystream/-/lazystream-1.0.0.tgz#f6995fe0f820392f61396be89462407bb77168e4" + dependencies: + readable-stream "^2.0.5" + + lcid@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/lcid/-/lcid-1.0.0.tgz#308accafa0bc483a3867b4b6f2b9506251d1b835" + dependencies: + invert-kv "^1.0.0" + + levn@^0.3.0, levn@~0.3.0: + version "0.3.0" + resolved "https://registry.yarnpkg.com/levn/-/levn-0.3.0.tgz#3b09924edf9f083c0490fdd4c0bc4421e04764ee" + dependencies: + prelude-ls "~1.1.2" + type-check "~0.3.2" + + load-json-file@^1.0.0: + version "1.1.0" + resolved "https://registry.yarnpkg.com/load-json-file/-/load-json-file-1.1.0.tgz#956905708d58b4bab4c2261b04f59f31c99374c0" + dependencies: + graceful-fs "^4.1.2" + parse-json "^2.2.0" + pify "^2.0.0" + pinkie-promise "^2.0.0" + strip-bom "^2.0.0" + + load-json-file@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/load-json-file/-/load-json-file-2.0.0.tgz#7947e42149af80d696cbf797bcaabcfe1fe29ca8" + dependencies: + graceful-fs "^4.1.2" + parse-json "^2.2.0" + pify "^2.0.0" + strip-bom "^3.0.0" + + load-json-file@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/load-json-file/-/load-json-file-4.0.0.tgz#2f5f45ab91e33216234fd53adab668eb4ec0993b" + dependencies: + graceful-fs "^4.1.2" + parse-json "^4.0.0" + pify "^3.0.0" + strip-bom "^3.0.0" + + loader-runner@^2.3.0: + version "2.3.0" + resolved "https://registry.yarnpkg.com/loader-runner/-/loader-runner-2.3.0.tgz#f482aea82d543e07921700d5a46ef26fdac6b8a2" + + loader-utils@^0.2.15: + version "0.2.17" + resolved "https://registry.yarnpkg.com/loader-utils/-/loader-utils-0.2.17.tgz#f86e6374d43205a6e6c60e9196f17c0299bfb348" + dependencies: + big.js "^3.1.3" + emojis-list "^2.0.0" + json5 "^0.5.0" + object-assign "^4.0.1" + + loader-utils@^1.0.2, loader-utils@^1.1.0: + version "1.1.0" + resolved "https://registry.yarnpkg.com/loader-utils/-/loader-utils-1.1.0.tgz#c98aef488bcceda2ffb5e2de646d6a754429f5cd" + dependencies: + big.js "^3.1.3" + emojis-list "^2.0.0" + json5 "^0.5.0" + + locate-path@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/locate-path/-/locate-path-2.0.0.tgz#2b568b265eec944c6d9c0de9c3dbbbca0354cd8e" + dependencies: + p-locate "^2.0.0" + path-exists "^3.0.0" + + lodash-es@^4.17.5: + version "4.17.7" + resolved "https://registry.yarnpkg.com/lodash-es/-/lodash-es-4.17.7.tgz#db240a3252c3dd8360201ac9feef91ac977ea856" + + lodash-es@^4.2.1: + version "4.17.5" + resolved "https://registry.yarnpkg.com/lodash-es/-/lodash-es-4.17.5.tgz#9fc6e737b1c4d151d8f9cae2247305d552ce748f" + + lodash.assign@^4.2.0: + version "4.2.0" + resolved "https://registry.yarnpkg.com/lodash.assign/-/lodash.assign-4.2.0.tgz#0d99f3ccd7a6d261d19bdaeb9245005d285808e7" + + lodash.camelcase@^4.3.0: + version "4.3.0" + resolved "https://registry.yarnpkg.com/lodash.camelcase/-/lodash.camelcase-4.3.0.tgz#b28aa6288a2b9fc651035c7711f65ab6190331a6" + + lodash.clonedeep@^4.5.0: + version "4.5.0" + resolved "https://registry.yarnpkg.com/lodash.clonedeep/-/lodash.clonedeep-4.5.0.tgz#e23f3f9c4f8fbdde872529c1071857a086e5ccef" + + lodash.clonedeepwith@^4.5.0: + version "4.5.0" + resolved "https://registry.yarnpkg.com/lodash.clonedeepwith/-/lodash.clonedeepwith-4.5.0.tgz#6ee30573a03a1a60d670a62ef33c10cf1afdbdd4" + + lodash.debounce@^4.0.3: + version "4.0.8" + resolved "https://registry.yarnpkg.com/lodash.debounce/-/lodash.debounce-4.0.8.tgz#82d79bff30a67c4005ffd5e2515300ad9ca4d7af" + + lodash.difference@^4.3.0: + version "4.5.0" + resolved "https://registry.yarnpkg.com/lodash.difference/-/lodash.difference-4.5.0.tgz#9ccb4e505d486b91651345772885a2df27fd017c" + + lodash.flatten@^4.2.0: + version "4.4.0" + resolved "https://registry.yarnpkg.com/lodash.flatten/-/lodash.flatten-4.4.0.tgz#f31c22225a9632d2bbf8e4addbef240aa765a61f" + + lodash.flattendeep@^4.4.0: + version "4.4.0" + resolved "https://registry.yarnpkg.com/lodash.flattendeep/-/lodash.flattendeep-4.4.0.tgz#fb030917f86a3134e5bc9bec0d69e0013ddfedb2" + + lodash.isequal@^4.5.0: + version "4.5.0" + resolved "https://registry.yarnpkg.com/lodash.isequal/-/lodash.isequal-4.5.0.tgz#415c4478f2bcc30120c22ce10ed3226f7d3e18e0" + + lodash.isplainobject@^4.0.6: + version "4.0.6" + resolved "https://registry.yarnpkg.com/lodash.isplainobject/-/lodash.isplainobject-4.0.6.tgz#7c526a52d89b45c45cc690b88163be0497f550cb" + + lodash.memoize@^4.1.2: + version "4.1.2" + resolved "https://registry.yarnpkg.com/lodash.memoize/-/lodash.memoize-4.1.2.tgz#bcc6c49a42a2840ed997f323eada5ecd182e0bfe" + + lodash.merge@^4.6.0: + version "4.6.1" + resolved "https://registry.yarnpkg.com/lodash.merge/-/lodash.merge-4.6.1.tgz#adc25d9cb99b9391c59624f379fbba60d7111d54" + + lodash.some@^4.6.0: + version "4.6.0" + resolved "https://registry.yarnpkg.com/lodash.some/-/lodash.some-4.6.0.tgz#1bb9f314ef6b8baded13b549169b2a945eb68e4d" + + lodash.uniq@^4.5.0: + version "4.5.0" + resolved "https://registry.yarnpkg.com/lodash.uniq/-/lodash.uniq-4.5.0.tgz#d0225373aeb652adc1bc82e4945339a842754773" + + lodash@^4.13.1, lodash@^4.14.0, lodash@^4.17.4, lodash@^4.17.5, lodash@^4.2.1, lodash@^4.3.0, lodash@^4.8.0, lodash@~4.17.4: + version "4.17.5" + resolved "https://registry.yarnpkg.com/lodash/-/lodash-4.17.5.tgz#99a92d65c0272debe8c96b6057bc8fbfa3bed511" + + log-symbols@^1.0.2: + version "1.0.2" + resolved "https://registry.yarnpkg.com/log-symbols/-/log-symbols-1.0.2.tgz#376ff7b58ea3086a0f09facc74617eca501e1a18" + dependencies: + chalk "^1.0.0" + + log-symbols@^2.1.0: + version "2.2.0" + resolved "https://registry.yarnpkg.com/log-symbols/-/log-symbols-2.2.0.tgz#5740e1c5d6f0dfda4ad9323b5332107ef6b4c40a" + dependencies: + chalk "^2.0.1" + + longest@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/longest/-/longest-1.0.1.tgz#30a0b2da38f73770e8294a0d22e6625ed77d0097" + + loose-envify@^1.0.0, loose-envify@^1.1.0, loose-envify@^1.3.1: + version "1.3.1" + resolved "https://registry.yarnpkg.com/loose-envify/-/loose-envify-1.3.1.tgz#d1a8ad33fa9ce0e713d65fdd0ac8b748d478c848" + dependencies: + js-tokens "^3.0.0" + + loud-rejection@^1.0.0, loud-rejection@^1.2.0: + version "1.6.0" + resolved "https://registry.yarnpkg.com/loud-rejection/-/loud-rejection-1.6.0.tgz#5b46f80147edee578870f086d04821cf998e551f" + dependencies: + currently-unhandled "^0.4.1" + signal-exit "^3.0.0" + + lowercase-keys@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/lowercase-keys/-/lowercase-keys-1.0.0.tgz#4e3366b39e7f5457e35f1324bdf6f88d0bfc7306" + + lru-cache@^4.0.1, lru-cache@^4.1.1: + version "4.1.1" + resolved "https://registry.yarnpkg.com/lru-cache/-/lru-cache-4.1.1.tgz#622e32e82488b49279114a4f9ecf45e7cd6bba55" + dependencies: + pseudomap "^1.0.2" + yallist "^2.1.2" + + macaddress@^0.2.8: + version "0.2.8" + resolved "https://registry.yarnpkg.com/macaddress/-/macaddress-0.2.8.tgz#5904dc537c39ec6dbefeae902327135fa8511f12" + + make-dir@^1.0.0: + version "1.2.0" + resolved "https://registry.yarnpkg.com/make-dir/-/make-dir-1.2.0.tgz#6d6a49eead4aae296c53bbf3a1a008bd6c89469b" + dependencies: + pify "^3.0.0" + + map-obj@^1.0.0, map-obj@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/map-obj/-/map-obj-1.0.1.tgz#d933ceb9205d82bdcf4886f6742bdc2b4dea146d" + + matcher@^1.0.0: + version "1.1.0" + resolved "https://registry.yarnpkg.com/matcher/-/matcher-1.1.0.tgz#4ad3a9cb6585186dc95cb8a08c7de936caed17ee" + dependencies: + escape-string-regexp "^1.0.4" + + math-expression-evaluator@^1.2.14: + version "1.2.17" + resolved "https://registry.yarnpkg.com/math-expression-evaluator/-/math-expression-evaluator-1.2.17.tgz#de819fdbcd84dccd8fae59c6aeb79615b9d266ac" + + md5-hex@^1.2.0, md5-hex@^1.3.0: + version "1.3.0" + resolved "https://registry.yarnpkg.com/md5-hex/-/md5-hex-1.3.0.tgz#d2c4afe983c4370662179b8cad145219135046c4" + dependencies: + md5-o-matic "^0.1.1" + + md5-hex@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/md5-hex/-/md5-hex-2.0.0.tgz#d0588e9f1c74954492ecd24ac0ac6ce997d92e33" + dependencies: + md5-o-matic "^0.1.1" + + md5-o-matic@^0.1.1: + version "0.1.1" + resolved "https://registry.yarnpkg.com/md5-o-matic/-/md5-o-matic-0.1.1.tgz#822bccd65e117c514fab176b25945d54100a03c3" + + md5.js@^1.3.4: + version "1.3.4" + resolved "https://registry.yarnpkg.com/md5.js/-/md5.js-1.3.4.tgz#e9bdbde94a20a5ac18b04340fc5764d5b09d901d" + dependencies: + hash-base "^3.0.0" + inherits "^2.0.1" + + mem@^1.1.0: + version "1.1.0" + resolved "https://registry.yarnpkg.com/mem/-/mem-1.1.0.tgz#5edd52b485ca1d900fe64895505399a0dfa45f76" + dependencies: + mimic-fn "^1.0.0" + + memory-fs@^0.4.0, memory-fs@~0.4.1: + version "0.4.1" + resolved "https://registry.yarnpkg.com/memory-fs/-/memory-fs-0.4.1.tgz#3a9a20b8462523e447cfbc7e8bb80ed667bfc552" + dependencies: + errno "^0.1.3" + readable-stream "^2.0.1" + + meow@^3.1.0, meow@^3.7.0: + version "3.7.0" + resolved "https://registry.yarnpkg.com/meow/-/meow-3.7.0.tgz#72cb668b425228290abbfa856892587308a801fb" + dependencies: + camelcase-keys "^2.0.0" + decamelize "^1.1.2" + loud-rejection "^1.0.0" + map-obj "^1.0.1" + minimist "^1.1.3" + normalize-package-data "^2.3.4" + object-assign "^4.0.1" + read-pkg-up "^1.0.1" + redent "^1.0.0" + trim-newlines "^1.0.0" + + merge-descriptors@~1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/merge-descriptors/-/merge-descriptors-1.0.1.tgz#b00aaa556dd8b44568150ec9d1b953f3f90cbb61" + + micromatch@^2.1.5: + version "2.3.11" + resolved "https://registry.yarnpkg.com/micromatch/-/micromatch-2.3.11.tgz#86677c97d1720b363431d04d0d15293bd38c1565" + dependencies: + arr-diff "^2.0.0" + array-unique "^0.2.1" + braces "^1.8.2" + expand-brackets "^0.1.4" + extglob "^0.3.1" + filename-regex "^2.0.0" + is-extglob "^1.0.0" + is-glob "^2.0.1" + kind-of "^3.0.2" + normalize-path "^2.0.1" + object.omit "^2.0.0" + parse-glob "^3.0.4" + regex-cache "^0.4.2" + + miller-rabin@^4.0.0: + version "4.0.1" + resolved "https://registry.yarnpkg.com/miller-rabin/-/miller-rabin-4.0.1.tgz#f080351c865b0dc562a8462966daa53543c78a4d" + dependencies: + bn.js "^4.0.0" + brorand "^1.0.1" + + mime-db@~1.33.0: + version "1.33.0" + resolved "https://registry.yarnpkg.com/mime-db/-/mime-db-1.33.0.tgz#a3492050a5cb9b63450541e39d9788d2272783db" + + mime-types@^2.1.12, mime-types@~2.1.17, mime-types@~2.1.7: + version "2.1.18" + resolved "https://registry.yarnpkg.com/mime-types/-/mime-types-2.1.18.tgz#6f323f60a83d11146f831ff11fd66e2fe5503bb8" + dependencies: + mime-db "~1.33.0" + + mime@^2.2.0: + version "2.2.0" + resolved "https://registry.yarnpkg.com/mime/-/mime-2.2.0.tgz#161e541965551d3b549fa1114391e3a3d55b923b" + + mimic-fn@^1.0.0: + version "1.2.0" + resolved "https://registry.yarnpkg.com/mimic-fn/-/mimic-fn-1.2.0.tgz#820c86a39334640e99516928bd03fca88057d022" + + mimic-response@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/mimic-response/-/mimic-response-1.0.0.tgz#df3d3652a73fded6b9b0b24146e6fd052353458e" + + minimalistic-assert@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/minimalistic-assert/-/minimalistic-assert-1.0.0.tgz#702be2dda6b37f4836bcb3f5db56641b64a1d3d3" + + minimalistic-crypto-utils@^1.0.0, minimalistic-crypto-utils@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/minimalistic-crypto-utils/-/minimalistic-crypto-utils-1.0.1.tgz#f6c00c1c0b082246e5c4d99dfb8c7c083b2b582a" + + minimatch@^3.0.0, minimatch@^3.0.2, minimatch@^3.0.4, minimatch@~3.0.2: + version "3.0.4" + resolved "https://registry.yarnpkg.com/minimatch/-/minimatch-3.0.4.tgz#5166e286457f03306064be5497e8dbb0c3d32083" + dependencies: + brace-expansion "^1.1.7" + + minimist@0.0.8: + version "0.0.8" + resolved "https://registry.yarnpkg.com/minimist/-/minimist-0.0.8.tgz#857fcabfc3397d2625b8228262e86aa7a011b05d" + + minimist@^1.1.0, minimist@^1.1.3, minimist@^1.2.0: + version "1.2.0" + resolved "https://registry.yarnpkg.com/minimist/-/minimist-1.2.0.tgz#a35008b20f41383eec1fb914f4cd5df79a264284" + + minimist@~0.0.1: + version "0.0.10" + resolved "https://registry.yarnpkg.com/minimist/-/minimist-0.0.10.tgz#de3f98543dbf96082be48ad1a0c7cda836301dcf" + + mississippi@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/mississippi/-/mississippi-2.0.0.tgz#3442a508fafc28500486feea99409676e4ee5a6f" + dependencies: + concat-stream "^1.5.0" + duplexify "^3.4.2" + end-of-stream "^1.1.0" + flush-write-stream "^1.0.0" + from2 "^2.1.0" + parallel-transform "^1.1.0" + pump "^2.0.1" + pumpify "^1.3.3" + stream-each "^1.1.0" + through2 "^2.0.0" + + mkdirp@0.5.0: + version "0.5.0" + resolved "https://registry.yarnpkg.com/mkdirp/-/mkdirp-0.5.0.tgz#1d73076a6df986cd9344e15e71fcc05a4c9abf12" + dependencies: + minimist "0.0.8" + + "mkdirp@>=0.5 0", mkdirp@^0.5.0, mkdirp@^0.5.1, mkdirp@~0.5.0, mkdirp@~0.5.1: + version "0.5.1" + resolved "https://registry.yarnpkg.com/mkdirp/-/mkdirp-0.5.1.tgz#30057438eac6cf7f8c4767f38648d6697d75c903" + dependencies: + minimist "0.0.8" + + module-not-found-error@^1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/module-not-found-error/-/module-not-found-error-1.0.1.tgz#cf8b4ff4f29640674d6cdd02b0e3bc523c2bbdc0" + + mousetrap@chabou/mousetrap#useCapture: + version "1.6.1" + resolved "https://codeload.github.com/chabou/mousetrap/tar.gz/c95eeeaafba1131dd8d35bc130d4a79b2ff9261a" + + move-concurrently@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/move-concurrently/-/move-concurrently-1.0.1.tgz#be2c005fda32e0b29af1f05d7c4b33214c701f92" + dependencies: + aproba "^1.1.1" + copy-concurrently "^1.0.0" + fs-write-stream-atomic "^1.0.8" + mkdirp "^0.5.1" + rimraf "^2.5.4" + run-queue "^1.0.3" + + mri@1.1.0: + version "1.1.0" + resolved "https://registry.yarnpkg.com/mri/-/mri-1.1.0.tgz#5c0a3f29c8ccffbbb1ec941dcec09d71fa32f36a" + + ms@2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/ms/-/ms-2.0.0.tgz#5608aeadfc00be6c2901df5f9861788de0d597c8" + + ms@2.1.1, ms@^2.0.0: + version "2.1.1" + resolved "https://registry.yarnpkg.com/ms/-/ms-2.1.1.tgz#30a5864eb3ebb0a66f2ebe6d727af06a09d86e0a" + + multimatch@^2.1.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/multimatch/-/multimatch-2.1.0.tgz#9c7906a22fb4c02919e2f5f75161b4cdbd4b2a2b" + dependencies: + array-differ "^1.0.0" + array-union "^1.0.1" + arrify "^1.0.0" + minimatch "^3.0.0" + + mute-stream@0.0.7: + version "0.0.7" + resolved "https://registry.yarnpkg.com/mute-stream/-/mute-stream-0.0.7.tgz#3075ce93bc21b8fab43e1bc4da7e8115ed1e7bab" + + nan@^2.3.0: + version "2.8.0" + resolved "https://registry.yarnpkg.com/nan/-/nan-2.8.0.tgz#ed715f3fe9de02b57a5e6252d90a96675e1f085a" + + natural-compare@^1.4.0: + version "1.4.0" + resolved "https://registry.yarnpkg.com/natural-compare/-/natural-compare-1.4.0.tgz#4abebfeed7541f2c27acfb29bdbbd15c8d5ba4f7" + + node-abi@^2.0.0: + version "2.2.0" + resolved "https://registry.yarnpkg.com/node-abi/-/node-abi-2.2.0.tgz#e802ac7a2408e2c0593fb3176ffdf8a99a9b4dec" + dependencies: + semver "^5.4.1" + + node-fetch@^1.0.1: + version "1.7.3" + resolved "https://registry.yarnpkg.com/node-fetch/-/node-fetch-1.7.3.tgz#980f6f72d85211a5347c6b2bc18c5b84c3eb47ef" + dependencies: + encoding "^0.1.11" + is-stream "^1.0.1" + + node-gyp@3.6.2, node-gyp@^3.6.0: + version "3.6.2" + resolved "https://registry.yarnpkg.com/node-gyp/-/node-gyp-3.6.2.tgz#9bfbe54562286284838e750eac05295853fa1c60" + dependencies: + fstream "^1.0.0" + glob "^7.0.3" + graceful-fs "^4.1.2" + minimatch "^3.0.2" + mkdirp "^0.5.0" + nopt "2 || 3" + npmlog "0 || 1 || 2 || 3 || 4" + osenv "0" + request "2" + rimraf "2" + semver "~5.3.0" + tar "^2.0.0" + which "1" + + node-libs-browser@^2.0.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/node-libs-browser/-/node-libs-browser-2.1.0.tgz#5f94263d404f6e44767d726901fff05478d600df" + dependencies: + assert "^1.1.1" + browserify-zlib "^0.2.0" + buffer "^4.3.0" + console-browserify "^1.1.0" + constants-browserify "^1.0.0" + crypto-browserify "^3.11.0" + domain-browser "^1.1.1" + events "^1.0.0" + https-browserify "^1.0.0" + os-browserify "^0.3.0" + path-browserify "0.0.0" + process "^0.11.10" + punycode "^1.2.4" + querystring-es3 "^0.2.0" + readable-stream "^2.3.3" + stream-browserify "^2.0.1" + stream-http "^2.7.2" + string_decoder "^1.0.0" + timers-browserify "^2.0.4" + tty-browserify "0.0.0" + url "^0.11.0" + util "^0.10.3" + vm-browserify "0.0.4" + + node-pre-gyp@^0.6.39: + version "0.6.39" + resolved "https://registry.yarnpkg.com/node-pre-gyp/-/node-pre-gyp-0.6.39.tgz#c00e96860b23c0e1420ac7befc5044e1d78d8649" + dependencies: + detect-libc "^1.0.2" + hawk "3.1.3" + mkdirp "^0.5.1" + nopt "^4.0.1" + npmlog "^4.0.2" + rc "^1.1.7" + request "2.81.0" + rimraf "^2.6.1" + semver "^5.3.0" + tar "^2.2.1" + tar-pack "^3.4.0" + + "nopt@2 || 3": + version "3.0.6" + resolved "https://registry.yarnpkg.com/nopt/-/nopt-3.0.6.tgz#c6465dbf08abcd4db359317f79ac68a646b28ff9" + dependencies: + abbrev "1" + + nopt@^4.0.1: + version "4.0.1" + resolved "https://registry.yarnpkg.com/nopt/-/nopt-4.0.1.tgz#d0d4685afd5415193c8c7505602d0d17cd64474d" + dependencies: + abbrev "1" + osenv "^0.1.4" + + normalize-package-data@^2.3.2, normalize-package-data@^2.3.4, normalize-package-data@^2.4.0: + version "2.4.0" + resolved "https://registry.yarnpkg.com/normalize-package-data/-/normalize-package-data-2.4.0.tgz#12f95a307d58352075a04907b84ac8be98ac012f" + dependencies: + hosted-git-info "^2.1.4" + is-builtin-module "^1.0.0" + semver "2 || 3 || 4 || 5" + validate-npm-package-license "^3.0.1" + + normalize-path@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/normalize-path/-/normalize-path-1.0.0.tgz#32d0e472f91ff345701c15a8311018d3b0a90379" + + normalize-path@^2.0.0, normalize-path@^2.0.1: + version "2.1.1" + resolved "https://registry.yarnpkg.com/normalize-path/-/normalize-path-2.1.1.tgz#1ab28b556e198363a8c1a6f7e6fa20137fe6aed9" + dependencies: + remove-trailing-separator "^1.0.1" + + normalize-range@^0.1.2: + version "0.1.2" + resolved "https://registry.yarnpkg.com/normalize-range/-/normalize-range-0.1.2.tgz#2d10c06bdfd312ea9777695a4d28439456b75942" + + normalize-url@^1.4.0, normalize-url@^1.9.1: + version "1.9.1" + resolved "https://registry.yarnpkg.com/normalize-url/-/normalize-url-1.9.1.tgz#2cc0d66b31ea23036458436e3620d85954c66c3c" + dependencies: + object-assign "^4.0.1" + prepend-http "^1.0.0" + query-string "^4.1.0" + sort-keys "^1.0.0" + + npm-install-package@~2.1.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/npm-install-package/-/npm-install-package-2.1.0.tgz#d7efe3cfcd7ab00614b896ea53119dc9ab259125" + + npm-run-path@^2.0.0: + version "2.0.2" + resolved "https://registry.yarnpkg.com/npm-run-path/-/npm-run-path-2.0.2.tgz#35a9232dfa35d7067b4cb2ddf2357b1871536c5f" + dependencies: + path-key "^2.0.0" + + "npmlog@0 || 1 || 2 || 3 || 4", npmlog@^4.0.2: + version "4.1.2" + resolved "https://registry.yarnpkg.com/npmlog/-/npmlog-4.1.2.tgz#08a7f2a8bf734604779a9efa4ad5cc717abb954b" + dependencies: + are-we-there-yet "~1.1.2" + console-control-strings "~1.1.0" + gauge "~2.7.3" + set-blocking "~2.0.0" + + nugget@^2.0.0, nugget@^2.0.1: + version "2.0.1" + resolved "https://registry.yarnpkg.com/nugget/-/nugget-2.0.1.tgz#201095a487e1ad36081b3432fa3cada4f8d071b0" + dependencies: + debug "^2.1.3" + minimist "^1.1.0" + pretty-bytes "^1.0.2" + progress-stream "^1.1.0" + request "^2.45.0" + single-line-log "^1.1.2" + throttleit "0.0.2" + + num2fraction@^1.2.2: + version "1.2.2" + resolved "https://registry.yarnpkg.com/num2fraction/-/num2fraction-1.2.2.tgz#6f682b6a027a4e9ddfa4564cd2589d1d4e669ede" + + number-is-nan@^1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/number-is-nan/-/number-is-nan-1.0.1.tgz#097b602b53422a522c1afb8790318336941a011d" + + oauth-sign@~0.8.1, oauth-sign@~0.8.2: + version "0.8.2" + resolved "https://registry.yarnpkg.com/oauth-sign/-/oauth-sign-0.8.2.tgz#46a6ab7f0aead8deae9ec0565780b7d4efeb9d43" + + object-assign@^4.0.1, object-assign@^4.1.0, object-assign@^4.1.1: + version "4.1.1" + resolved "https://registry.yarnpkg.com/object-assign/-/object-assign-4.1.1.tgz#2109adc7965887cfc05cbbd442cac8bfbb360863" + + object-keys@^1.0.8: + version "1.0.11" + resolved "https://registry.yarnpkg.com/object-keys/-/object-keys-1.0.11.tgz#c54601778ad560f1142ce0e01bcca8b56d13426d" + + object-keys@~0.4.0: + version "0.4.0" + resolved "https://registry.yarnpkg.com/object-keys/-/object-keys-0.4.0.tgz#28a6aae7428dd2c3a92f3d95f21335dd204e0336" + + object.omit@^2.0.0: + version "2.0.1" + resolved "https://registry.yarnpkg.com/object.omit/-/object.omit-2.0.1.tgz#1a9c744829f39dbb858c76ca3579ae2a54ebd1fa" + dependencies: + for-own "^0.1.4" + is-extendable "^0.1.1" + + observable-to-promise@^0.5.0: + version "0.5.0" + resolved "https://registry.yarnpkg.com/observable-to-promise/-/observable-to-promise-0.5.0.tgz#c828f0f0dc47e9f86af8a4977c5d55076ce7a91f" + dependencies: + is-observable "^0.2.0" + symbol-observable "^1.0.4" + + once@^1.3.0, once@^1.3.1, once@^1.3.3, once@^1.4.0: + version "1.4.0" + resolved "https://registry.yarnpkg.com/once/-/once-1.4.0.tgz#583b1aa775961d4b113ac17d9c50baef9dd76bd1" + dependencies: + wrappy "1" + + onetime@^2.0.0: + version "2.0.1" + resolved "https://registry.yarnpkg.com/onetime/-/onetime-2.0.1.tgz#067428230fd67443b2794b22bba528b6867962d4" + dependencies: + mimic-fn "^1.0.0" + + opn@5.3.0: + version "5.3.0" + resolved "https://registry.yarnpkg.com/opn/-/opn-5.3.0.tgz#64871565c863875f052cfdf53d3e3cb5adb53b1c" + dependencies: + is-wsl "^1.1.0" + + optimist@~0.6.1: + version "0.6.1" + resolved "https://registry.yarnpkg.com/optimist/-/optimist-0.6.1.tgz#da3ea74686fa21a19a111c326e90eb15a0196686" + dependencies: + minimist "~0.0.1" + wordwrap "~0.0.2" + + option-chain@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/option-chain/-/option-chain-1.0.0.tgz#938d73bd4e1783f948d34023644ada23669e30f2" + + optionator@^0.8.2: + version "0.8.2" + resolved "https://registry.yarnpkg.com/optionator/-/optionator-0.8.2.tgz#364c5e409d3f4d6301d6c0b4c05bba50180aeb64" + dependencies: + deep-is "~0.1.3" + fast-levenshtein "~2.0.4" + levn "~0.3.0" + prelude-ls "~1.1.2" + type-check "~0.3.2" + wordwrap "~1.0.0" + + ora@1.3.0: + version "1.3.0" + resolved "https://registry.yarnpkg.com/ora/-/ora-1.3.0.tgz#80078dd2b92a934af66a3ad72a5b910694ede51a" + dependencies: + chalk "^1.1.1" + cli-cursor "^2.1.0" + cli-spinners "^1.0.0" + log-symbols "^1.0.2" + + ora@^1.2.0: + version "1.4.0" + resolved "https://registry.yarnpkg.com/ora/-/ora-1.4.0.tgz#884458215b3a5d4097592285f93321bb7a79e2e5" + dependencies: + chalk "^2.1.0" + cli-cursor "^2.1.0" + cli-spinners "^1.0.1" + log-symbols "^2.1.0" + + os-browserify@^0.3.0: + version "0.3.0" + resolved "https://registry.yarnpkg.com/os-browserify/-/os-browserify-0.3.0.tgz#854373c7f5c2315914fc9bfc6bd8238fdda1ec27" + + os-homedir@^1.0.0: + version "1.0.2" + resolved "https://registry.yarnpkg.com/os-homedir/-/os-homedir-1.0.2.tgz#ffbc4988336e0e833de0c168c7ef152121aa7fb3" + + os-locale@^1.4.0: + version "1.4.0" + resolved "https://registry.yarnpkg.com/os-locale/-/os-locale-1.4.0.tgz#20f9f17ae29ed345e8bde583b13d2009803c14d9" + dependencies: + lcid "^1.0.0" + + os-locale@^2.0.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/os-locale/-/os-locale-2.1.0.tgz#42bc2900a6b5b8bd17376c8e882b65afccf24bf2" + dependencies: + execa "^0.7.0" + lcid "^1.0.0" + mem "^1.1.0" + + os-tmpdir@^1.0.0, os-tmpdir@^1.0.1, os-tmpdir@~1.0.2: + version "1.0.2" + resolved "https://registry.yarnpkg.com/os-tmpdir/-/os-tmpdir-1.0.2.tgz#bbe67406c79aa85c5cfec766fe5734555dfa1274" + + osenv@0, osenv@^0.1.4: + version "0.1.5" + resolved "https://registry.yarnpkg.com/osenv/-/osenv-0.1.5.tgz#85cdfafaeb28e8677f416e287592b5f3f49ea410" + dependencies: + os-homedir "^1.0.0" + os-tmpdir "^1.0.0" + + output-file-sync@^1.1.2: + version "1.1.2" + resolved "https://registry.yarnpkg.com/output-file-sync/-/output-file-sync-1.1.2.tgz#d0a33eefe61a205facb90092e826598d5245ce76" + dependencies: + graceful-fs "^4.1.4" + mkdirp "^0.5.1" + object-assign "^4.1.0" + + p-cancelable@^0.3.0: + version "0.3.0" + resolved "https://registry.yarnpkg.com/p-cancelable/-/p-cancelable-0.3.0.tgz#b9e123800bcebb7ac13a479be195b507b98d30fa" + + p-finally@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/p-finally/-/p-finally-1.0.0.tgz#3fbcfb15b899a44123b34b6dcc18b724336a2cae" + + p-limit@^1.0.0, p-limit@^1.1.0: + version "1.2.0" + resolved "https://registry.yarnpkg.com/p-limit/-/p-limit-1.2.0.tgz#0e92b6bedcb59f022c13d0f1949dc82d15909f1c" + dependencies: + p-try "^1.0.0" + + p-locate@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/p-locate/-/p-locate-2.0.0.tgz#20a0103b222a70c8fd39cc2e580680f3dde5ec43" + dependencies: + p-limit "^1.1.0" + + p-timeout@^1.1.1: + version "1.2.1" + resolved "https://registry.yarnpkg.com/p-timeout/-/p-timeout-1.2.1.tgz#5eb3b353b7fce99f101a1038880bb054ebbea386" + dependencies: + p-finally "^1.0.0" + + p-try@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/p-try/-/p-try-1.0.0.tgz#cbc79cdbaf8fd4228e13f621f2b1a237c1b207b3" + + package-hash@^1.2.0: + version "1.2.0" + resolved "https://registry.yarnpkg.com/package-hash/-/package-hash-1.2.0.tgz#003e56cd57b736a6ed6114cc2b81542672770e44" + dependencies: + md5-hex "^1.3.0" + + package-hash@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/package-hash/-/package-hash-2.0.0.tgz#78ae326c89e05a4d813b68601977af05c00d2a0d" + dependencies: + graceful-fs "^4.1.11" + lodash.flattendeep "^4.4.0" + md5-hex "^2.0.0" + release-zalgo "^1.0.0" + + package-json@^4.0.0: + version "4.0.1" + resolved "https://registry.yarnpkg.com/package-json/-/package-json-4.0.1.tgz#8869a0401253661c4c4ca3da6c2121ed555f5eed" + dependencies: + got "^6.7.1" + registry-auth-token "^3.0.1" + registry-url "^3.0.3" + semver "^5.1.0" + + pako@~1.0.5: + version "1.0.6" + resolved "https://registry.yarnpkg.com/pako/-/pako-1.0.6.tgz#0101211baa70c4bca4a0f63f2206e97b7dfaf258" + + parallel-transform@^1.1.0: + version "1.1.0" + resolved "https://registry.yarnpkg.com/parallel-transform/-/parallel-transform-1.1.0.tgz#d410f065b05da23081fcd10f28854c29bda33b06" + dependencies: + cyclist "~0.2.2" + inherits "^2.0.3" + readable-stream "^2.1.5" + + parse-asn1@^5.0.0: + version "5.1.0" + resolved "https://registry.yarnpkg.com/parse-asn1/-/parse-asn1-5.1.0.tgz#37c4f9b7ed3ab65c74817b5f2480937fbf97c712" + dependencies: + asn1.js "^4.0.0" + browserify-aes "^1.0.0" + create-hash "^1.1.0" + evp_bytestokey "^1.0.0" + pbkdf2 "^3.0.3" + + parse-color@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/parse-color/-/parse-color-1.0.0.tgz#7b748b95a83f03f16a94f535e52d7f3d94658619" + dependencies: + color-convert "~0.5.0" + + parse-glob@^3.0.4: + version "3.0.4" + resolved "https://registry.yarnpkg.com/parse-glob/-/parse-glob-3.0.4.tgz#b2c376cfb11f35513badd173ef0bb6e3a388391c" + dependencies: + glob-base "^0.3.0" + is-dotfile "^1.0.0" + is-extglob "^1.0.0" + is-glob "^2.0.0" + + parse-json@^2.2.0: + version "2.2.0" + resolved "https://registry.yarnpkg.com/parse-json/-/parse-json-2.2.0.tgz#f480f40434ef80741f8469099f8dea18f55a4dc9" + dependencies: + error-ex "^1.2.0" + + parse-json@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/parse-json/-/parse-json-4.0.0.tgz#be35f5425be1f7f6c747184f98a788cb99477ee0" + dependencies: + error-ex "^1.3.1" + json-parse-better-errors "^1.0.1" + + parse-ms@^0.1.0: + version "0.1.2" + resolved "https://registry.yarnpkg.com/parse-ms/-/parse-ms-0.1.2.tgz#dd3fa25ed6c2efc7bdde12ad9b46c163aa29224e" + + parse-ms@^1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/parse-ms/-/parse-ms-1.0.1.tgz#56346d4749d78f23430ca0c713850aef91aa361d" + + parse-path@^3.0.1: + version "3.0.2" + resolved "https://registry.yarnpkg.com/parse-path/-/parse-path-3.0.2.tgz#4686980f0b262ee2dbb9a64eef739c91edc85245" + dependencies: + is-ssh "^1.3.0" + protocols "^1.4.0" + + parse-url@3.0.2: + version "3.0.2" + resolved "https://registry.yarnpkg.com/parse-url/-/parse-url-3.0.2.tgz#602787a7063a795d72b8673197505e72f60610be" + dependencies: + is-ssh "^1.3.0" + normalize-url "^1.9.1" + parse-path "^3.0.1" + protocols "^1.4.0" + + path-browserify@0.0.0: + version "0.0.0" + resolved "https://registry.yarnpkg.com/path-browserify/-/path-browserify-0.0.0.tgz#a0b870729aae214005b7d5032ec2cbbb0fb4451a" + + path-exists@^2.0.0, path-exists@^2.1.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/path-exists/-/path-exists-2.1.0.tgz#0feb6c64f0fc518d9a754dd5efb62c7022761f4b" + dependencies: + pinkie-promise "^2.0.0" + + path-exists@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/path-exists/-/path-exists-3.0.0.tgz#ce0ebeaa5f78cb18925ea7d810d7b59b010fd515" + + path-is-absolute@^1.0.0, path-is-absolute@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/path-is-absolute/-/path-is-absolute-1.0.1.tgz#174b9268735534ffbc7ace6bf53a5a9e1b5c5f5f" + + path-is-inside@^1.0.1, path-is-inside@^1.0.2: + version "1.0.2" + resolved "https://registry.yarnpkg.com/path-is-inside/-/path-is-inside-1.0.2.tgz#365417dede44430d1c11af61027facf074bdfc53" + + path-key@^2.0.0: + version "2.0.1" + resolved "https://registry.yarnpkg.com/path-key/-/path-key-2.0.1.tgz#411cadb574c5a140d3a4b1910d40d80cc9f40b40" + + path-type@^1.0.0: + version "1.1.0" + resolved "https://registry.yarnpkg.com/path-type/-/path-type-1.1.0.tgz#59c44f7ee491da704da415da5a4070ba4f8fe441" + dependencies: + graceful-fs "^4.1.2" + pify "^2.0.0" + pinkie-promise "^2.0.0" + + path-type@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/path-type/-/path-type-2.0.0.tgz#f012ccb8415b7096fc2daa1054c3d72389594c73" + dependencies: + pify "^2.0.0" + + path-type@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/path-type/-/path-type-3.0.0.tgz#cef31dc8e0a1a3bb0d105c0cd97cf3bf47f4e36f" + dependencies: + pify "^3.0.0" + + pbkdf2@^3.0.3: + version "3.0.14" + resolved "https://registry.yarnpkg.com/pbkdf2/-/pbkdf2-3.0.14.tgz#a35e13c64799b06ce15320f459c230e68e73bade" + dependencies: + create-hash "^1.1.2" + create-hmac "^1.1.4" + ripemd160 "^2.0.1" + safe-buffer "^5.0.1" + sha.js "^2.4.8" + + pend@~1.2.0: + version "1.2.0" + resolved "https://registry.yarnpkg.com/pend/-/pend-1.2.0.tgz#7a57eb550a6783f9115331fcf4663d5c8e007a50" + + performance-now@^0.2.0: + version "0.2.0" + resolved "https://registry.yarnpkg.com/performance-now/-/performance-now-0.2.0.tgz#33ef30c5c77d4ea21c5a53869d91b56d8f2555e5" + + performance-now@^2.1.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/performance-now/-/performance-now-2.1.0.tgz#6309f4e0e5fa913ec1c69307ae364b4b377c9e7b" + + php-escape-shell@1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/php-escape-shell/-/php-escape-shell-1.0.0.tgz#7d589611f91c2ff6f3fe6591c91478c05c610879" + + pify@3.0.0, pify@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/pify/-/pify-3.0.0.tgz#e5a4acd2c101fdf3d9a4d07f0dbc4db49dd28176" + + pify@^2.0.0: + version "2.3.0" + resolved "https://registry.yarnpkg.com/pify/-/pify-2.3.0.tgz#ed141a6ac043a849ea588498e7dca8b15330e90c" + + pinkie-promise@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/pinkie-promise/-/pinkie-promise-1.0.0.tgz#d1da67f5482563bb7cf57f286ae2822ecfbf3670" + dependencies: + pinkie "^1.0.0" + + pinkie-promise@^2.0.0: + version "2.0.1" + resolved "https://registry.yarnpkg.com/pinkie-promise/-/pinkie-promise-2.0.1.tgz#2135d6dfa7a358c069ac9b178776288228450ffa" + dependencies: + pinkie "^2.0.0" + + pinkie@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/pinkie/-/pinkie-1.0.0.tgz#5a47f28ba1015d0201bda7bf0f358e47bec8c7e4" + + pinkie@^2.0.0: + version "2.0.4" + resolved "https://registry.yarnpkg.com/pinkie/-/pinkie-2.0.4.tgz#72556b80cfa0d48a974e80e77248e80ed4f7f870" + + pkg-conf@^2.0.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/pkg-conf/-/pkg-conf-2.1.0.tgz#2126514ca6f2abfebd168596df18ba57867f0058" + dependencies: + find-up "^2.0.0" + load-json-file "^4.0.0" + + pkg-dir@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/pkg-dir/-/pkg-dir-2.0.0.tgz#f6d5d1109e19d63edf428e0bd57e12777615334b" + dependencies: + find-up "^2.1.0" + + pkginfo@0.4.1: + version "0.4.1" + resolved "https://registry.yarnpkg.com/pkginfo/-/pkginfo-0.4.1.tgz#b5418ef0439de5425fc4995042dced14fb2a84ff" + + plist@^2.1.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/plist/-/plist-2.1.0.tgz#57ccdb7a0821df21831217a3cad54e3e146a1025" + dependencies: + base64-js "1.2.0" + xmlbuilder "8.2.2" + xmldom "0.1.x" + + plur@^2.0.0, plur@^2.1.2: + version "2.1.2" + resolved "https://registry.yarnpkg.com/plur/-/plur-2.1.2.tgz#7482452c1a0f508e3e344eaec312c91c29dc655a" + dependencies: + irregular-plurals "^1.0.0" + + pluralize@^7.0.0: + version "7.0.0" + resolved "https://registry.yarnpkg.com/pluralize/-/pluralize-7.0.0.tgz#298b89df8b93b0221dbf421ad2b1b1ea23fc6777" + + postcss-calc@^5.2.0: + version "5.3.1" + resolved "https://registry.yarnpkg.com/postcss-calc/-/postcss-calc-5.3.1.tgz#77bae7ca928ad85716e2fda42f261bf7c1d65b5e" + dependencies: + postcss "^5.0.2" + postcss-message-helpers "^2.0.0" + reduce-css-calc "^1.2.6" + + postcss-colormin@^2.1.8: + version "2.2.2" + resolved "https://registry.yarnpkg.com/postcss-colormin/-/postcss-colormin-2.2.2.tgz#6631417d5f0e909a3d7ec26b24c8a8d1e4f96e4b" + dependencies: + colormin "^1.0.5" + postcss "^5.0.13" + postcss-value-parser "^3.2.3" + + postcss-convert-values@^2.3.4: + version "2.6.1" + resolved "https://registry.yarnpkg.com/postcss-convert-values/-/postcss-convert-values-2.6.1.tgz#bbd8593c5c1fd2e3d1c322bb925dcae8dae4d62d" + dependencies: + postcss "^5.0.11" + postcss-value-parser "^3.1.2" + + postcss-discard-comments@^2.0.4: + version "2.0.4" + resolved "https://registry.yarnpkg.com/postcss-discard-comments/-/postcss-discard-comments-2.0.4.tgz#befe89fafd5b3dace5ccce51b76b81514be00e3d" + dependencies: + postcss "^5.0.14" + + postcss-discard-duplicates@^2.0.1: + version "2.1.0" + resolved "https://registry.yarnpkg.com/postcss-discard-duplicates/-/postcss-discard-duplicates-2.1.0.tgz#b9abf27b88ac188158a5eb12abcae20263b91932" + dependencies: + postcss "^5.0.4" + + postcss-discard-empty@^2.0.1: + version "2.1.0" + resolved "https://registry.yarnpkg.com/postcss-discard-empty/-/postcss-discard-empty-2.1.0.tgz#d2b4bd9d5ced5ebd8dcade7640c7d7cd7f4f92b5" + dependencies: + postcss "^5.0.14" + + postcss-discard-overridden@^0.1.1: + version "0.1.1" + resolved "https://registry.yarnpkg.com/postcss-discard-overridden/-/postcss-discard-overridden-0.1.1.tgz#8b1eaf554f686fb288cd874c55667b0aa3668d58" + dependencies: + postcss "^5.0.16" + + postcss-discard-unused@^2.2.1: + version "2.2.3" + resolved "https://registry.yarnpkg.com/postcss-discard-unused/-/postcss-discard-unused-2.2.3.tgz#bce30b2cc591ffc634322b5fb3464b6d934f4433" + dependencies: + postcss "^5.0.14" + uniqs "^2.0.0" + + postcss-filter-plugins@^2.0.0: + version "2.0.2" + resolved "https://registry.yarnpkg.com/postcss-filter-plugins/-/postcss-filter-plugins-2.0.2.tgz#6d85862534d735ac420e4a85806e1f5d4286d84c" + dependencies: + postcss "^5.0.4" + uniqid "^4.0.0" + + postcss-merge-idents@^2.1.5: + version "2.1.7" + resolved "https://registry.yarnpkg.com/postcss-merge-idents/-/postcss-merge-idents-2.1.7.tgz#4c5530313c08e1d5b3bbf3d2bbc747e278eea270" + dependencies: + has "^1.0.1" + postcss "^5.0.10" + postcss-value-parser "^3.1.1" + + postcss-merge-longhand@^2.0.1: + version "2.0.2" + resolved "https://registry.yarnpkg.com/postcss-merge-longhand/-/postcss-merge-longhand-2.0.2.tgz#23d90cd127b0a77994915332739034a1a4f3d658" + dependencies: + postcss "^5.0.4" + + postcss-merge-rules@^2.0.3: + version "2.1.2" + resolved "https://registry.yarnpkg.com/postcss-merge-rules/-/postcss-merge-rules-2.1.2.tgz#d1df5dfaa7b1acc3be553f0e9e10e87c61b5f721" + dependencies: + browserslist "^1.5.2" + caniuse-api "^1.5.2" + postcss "^5.0.4" + postcss-selector-parser "^2.2.2" + vendors "^1.0.0" + + postcss-message-helpers@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/postcss-message-helpers/-/postcss-message-helpers-2.0.0.tgz#a4f2f4fab6e4fe002f0aed000478cdf52f9ba60e" + + postcss-minify-font-values@^1.0.2: + version "1.0.5" + resolved "https://registry.yarnpkg.com/postcss-minify-font-values/-/postcss-minify-font-values-1.0.5.tgz#4b58edb56641eba7c8474ab3526cafd7bbdecb69" + dependencies: + object-assign "^4.0.1" + postcss "^5.0.4" + postcss-value-parser "^3.0.2" + + postcss-minify-gradients@^1.0.1: + version "1.0.5" + resolved "https://registry.yarnpkg.com/postcss-minify-gradients/-/postcss-minify-gradients-1.0.5.tgz#5dbda11373703f83cfb4a3ea3881d8d75ff5e6e1" + dependencies: + postcss "^5.0.12" + postcss-value-parser "^3.3.0" + + postcss-minify-params@^1.0.4: + version "1.2.2" + resolved "https://registry.yarnpkg.com/postcss-minify-params/-/postcss-minify-params-1.2.2.tgz#ad2ce071373b943b3d930a3fa59a358c28d6f1f3" + dependencies: + alphanum-sort "^1.0.1" + postcss "^5.0.2" + postcss-value-parser "^3.0.2" + uniqs "^2.0.0" + + postcss-minify-selectors@^2.0.4: + version "2.1.1" + resolved "https://registry.yarnpkg.com/postcss-minify-selectors/-/postcss-minify-selectors-2.1.1.tgz#b2c6a98c0072cf91b932d1a496508114311735bf" + dependencies: + alphanum-sort "^1.0.2" + has "^1.0.1" + postcss "^5.0.14" + postcss-selector-parser "^2.0.0" + + postcss-modules-extract-imports@^1.2.0: + version "1.2.0" + resolved "https://registry.yarnpkg.com/postcss-modules-extract-imports/-/postcss-modules-extract-imports-1.2.0.tgz#66140ecece38ef06bf0d3e355d69bf59d141ea85" + dependencies: + postcss "^6.0.1" + + postcss-modules-local-by-default@^1.2.0: + version "1.2.0" + resolved "https://registry.yarnpkg.com/postcss-modules-local-by-default/-/postcss-modules-local-by-default-1.2.0.tgz#f7d80c398c5a393fa7964466bd19500a7d61c069" + dependencies: + css-selector-tokenizer "^0.7.0" + postcss "^6.0.1" + + postcss-modules-scope@^1.1.0: + version "1.1.0" + resolved "https://registry.yarnpkg.com/postcss-modules-scope/-/postcss-modules-scope-1.1.0.tgz#d6ea64994c79f97b62a72b426fbe6056a194bb90" + dependencies: + css-selector-tokenizer "^0.7.0" + postcss "^6.0.1" + + postcss-modules-values@^1.3.0: + version "1.3.0" + resolved "https://registry.yarnpkg.com/postcss-modules-values/-/postcss-modules-values-1.3.0.tgz#ecffa9d7e192518389f42ad0e83f72aec456ea20" + dependencies: + icss-replace-symbols "^1.1.0" + postcss "^6.0.1" + + postcss-normalize-charset@^1.1.0: + version "1.1.1" + resolved "https://registry.yarnpkg.com/postcss-normalize-charset/-/postcss-normalize-charset-1.1.1.tgz#ef9ee71212d7fe759c78ed162f61ed62b5cb93f1" + dependencies: + postcss "^5.0.5" + + postcss-normalize-url@^3.0.7: + version "3.0.8" + resolved "https://registry.yarnpkg.com/postcss-normalize-url/-/postcss-normalize-url-3.0.8.tgz#108f74b3f2fcdaf891a2ffa3ea4592279fc78222" + dependencies: + is-absolute-url "^2.0.0" + normalize-url "^1.4.0" + postcss "^5.0.14" + postcss-value-parser "^3.2.3" + + postcss-ordered-values@^2.1.0: + version "2.2.3" + resolved "https://registry.yarnpkg.com/postcss-ordered-values/-/postcss-ordered-values-2.2.3.tgz#eec6c2a67b6c412a8db2042e77fe8da43f95c11d" + dependencies: + postcss "^5.0.4" + postcss-value-parser "^3.0.1" + + postcss-reduce-idents@^2.2.2: + version "2.4.0" + resolved "https://registry.yarnpkg.com/postcss-reduce-idents/-/postcss-reduce-idents-2.4.0.tgz#c2c6d20cc958284f6abfbe63f7609bf409059ad3" + dependencies: + postcss "^5.0.4" + postcss-value-parser "^3.0.2" + + postcss-reduce-initial@^1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/postcss-reduce-initial/-/postcss-reduce-initial-1.0.1.tgz#68f80695f045d08263a879ad240df8dd64f644ea" + dependencies: + postcss "^5.0.4" + + postcss-reduce-transforms@^1.0.3: + version "1.0.4" + resolved "https://registry.yarnpkg.com/postcss-reduce-transforms/-/postcss-reduce-transforms-1.0.4.tgz#ff76f4d8212437b31c298a42d2e1444025771ae1" + dependencies: + has "^1.0.1" + postcss "^5.0.8" + postcss-value-parser "^3.0.1" + + postcss-selector-parser@^2.0.0, postcss-selector-parser@^2.2.2: + version "2.2.3" + resolved "https://registry.yarnpkg.com/postcss-selector-parser/-/postcss-selector-parser-2.2.3.tgz#f9437788606c3c9acee16ffe8d8b16297f27bb90" + dependencies: + flatten "^1.0.2" + indexes-of "^1.0.1" + uniq "^1.0.1" + + postcss-svgo@^2.1.1: + version "2.1.6" + resolved "https://registry.yarnpkg.com/postcss-svgo/-/postcss-svgo-2.1.6.tgz#b6df18aa613b666e133f08adb5219c2684ac108d" + dependencies: + is-svg "^2.0.0" + postcss "^5.0.14" + postcss-value-parser "^3.2.3" + svgo "^0.7.0" + + postcss-unique-selectors@^2.0.2: + version "2.0.2" + resolved "https://registry.yarnpkg.com/postcss-unique-selectors/-/postcss-unique-selectors-2.0.2.tgz#981d57d29ddcb33e7b1dfe1fd43b8649f933ca1d" + dependencies: + alphanum-sort "^1.0.1" + postcss "^5.0.4" + uniqs "^2.0.0" + + postcss-value-parser@^3.0.1, postcss-value-parser@^3.0.2, postcss-value-parser@^3.1.1, postcss-value-parser@^3.1.2, postcss-value-parser@^3.2.3, postcss-value-parser@^3.3.0: + version "3.3.0" + resolved "https://registry.yarnpkg.com/postcss-value-parser/-/postcss-value-parser-3.3.0.tgz#87f38f9f18f774a4ab4c8a232f5c5ce8872a9d15" + + postcss-zindex@^2.0.1: + version "2.2.0" + resolved "https://registry.yarnpkg.com/postcss-zindex/-/postcss-zindex-2.2.0.tgz#d2109ddc055b91af67fc4cb3b025946639d2af22" + dependencies: + has "^1.0.1" + postcss "^5.0.4" + uniqs "^2.0.0" + + postcss@^5.0.10, postcss@^5.0.11, postcss@^5.0.12, postcss@^5.0.13, postcss@^5.0.14, postcss@^5.0.16, postcss@^5.0.2, postcss@^5.0.4, postcss@^5.0.5, postcss@^5.0.6, postcss@^5.0.8, postcss@^5.2.16: + version "5.2.18" + resolved "https://registry.yarnpkg.com/postcss/-/postcss-5.2.18.tgz#badfa1497d46244f6390f58b319830d9107853c5" + dependencies: + chalk "^1.1.3" + js-base64 "^2.1.9" + source-map "^0.5.6" + supports-color "^3.2.3" + + postcss@^6.0.1: + version "6.0.19" + resolved "https://registry.yarnpkg.com/postcss/-/postcss-6.0.19.tgz#76a78386f670b9d9494a655bf23ac012effd1555" + dependencies: + chalk "^2.3.1" + source-map "^0.6.1" + supports-color "^5.2.0" + + prelude-ls@~1.1.2: + version "1.1.2" + resolved "https://registry.yarnpkg.com/prelude-ls/-/prelude-ls-1.1.2.tgz#21932a549f5e52ffd9a827f570e04be62a97da54" + + prepend-http@^1.0.0, prepend-http@^1.0.1: + version "1.0.4" + resolved "https://registry.yarnpkg.com/prepend-http/-/prepend-http-1.0.4.tgz#d4f4562b0ce3696e41ac52d0e002e57a635dc6dc" + + preserve@^0.2.0: + version "0.2.0" + resolved "https://registry.yarnpkg.com/preserve/-/preserve-0.2.0.tgz#815ed1f6ebc65926f865b310c0713bcb3315ce4b" + + prettier@1.11.1: + version "1.11.1" + resolved "https://registry.yarnpkg.com/prettier/-/prettier-1.11.1.tgz#61e43fc4cd44e68f2b0dfc2c38cd4bb0fccdcc75" + + pretty-bytes@^1.0.2: + version "1.0.4" + resolved "https://registry.yarnpkg.com/pretty-bytes/-/pretty-bytes-1.0.4.tgz#0a22e8210609ad35542f8c8d5d2159aff0751c84" + dependencies: + get-stdin "^4.0.1" + meow "^3.1.0" + + pretty-ms@^0.2.1: + version "0.2.2" + resolved "https://registry.yarnpkg.com/pretty-ms/-/pretty-ms-0.2.2.tgz#da879a682ff33a37011046f13d627f67c73b84f6" + dependencies: + parse-ms "^0.1.0" + + pretty-ms@^3.0.0: + version "3.1.0" + resolved "https://registry.yarnpkg.com/pretty-ms/-/pretty-ms-3.1.0.tgz#e9cac9c76bf6ee52fe942dd9c6c4213153b12881" + dependencies: + parse-ms "^1.0.0" + plur "^2.1.2" + + private@^0.1.7, private@~0.1.5: + version "0.1.8" + resolved "https://registry.yarnpkg.com/private/-/private-0.1.8.tgz#2381edb3689f7a53d653190060fcf822d2f368ff" + + process-nextick-args@~2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/process-nextick-args/-/process-nextick-args-2.0.0.tgz#a37d732f4271b4ab1ad070d35508e8290788ffaa" + + process@^0.11.10: + version "0.11.10" + resolved "https://registry.yarnpkg.com/process/-/process-0.11.10.tgz#7332300e840161bda3e69a1d1d91a7d4bc16f182" + + progress-stream@^1.1.0: + version "1.2.0" + resolved "https://registry.yarnpkg.com/progress-stream/-/progress-stream-1.2.0.tgz#2cd3cfea33ba3a89c9c121ec3347abe9ab125f77" + dependencies: + speedometer "~0.1.2" + through2 "~0.2.3" + + progress@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/progress/-/progress-2.0.0.tgz#8a1be366bf8fc23db2bd23f10c6fe920b4389d1f" + + promise-inflight@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/promise-inflight/-/promise-inflight-1.0.1.tgz#98472870bf228132fcbdd868129bad12c3c029e3" + + promise@^7.1.1: + version "7.3.1" + resolved "https://registry.yarnpkg.com/promise/-/promise-7.3.1.tgz#064b72602b18f90f29192b8b1bc418ffd1ebd3bf" + dependencies: + asap "~2.0.3" + + prop-types@^15.5.10: + version "15.6.1" + resolved "https://registry.yarnpkg.com/prop-types/-/prop-types-15.6.1.tgz#36644453564255ddda391191fb3a125cbdf654ca" + dependencies: + fbjs "^0.8.16" + loose-envify "^1.3.1" + object-assign "^4.1.1" + + prop-types@^15.6.0: + version "15.6.0" + resolved "https://registry.yarnpkg.com/prop-types/-/prop-types-15.6.0.tgz#ceaf083022fc46b4a35f69e13ef75aed0d639856" + dependencies: + fbjs "^0.8.16" + loose-envify "^1.3.1" + object-assign "^4.1.1" + + protocols@^1.1.0, protocols@^1.4.0: + version "1.4.6" + resolved "https://registry.yarnpkg.com/protocols/-/protocols-1.4.6.tgz#f8bb263ea1b5fd7a7604d26b8be39bd77678bf8a" + + proxyquire@1.8.0: + version "1.8.0" + resolved "https://registry.yarnpkg.com/proxyquire/-/proxyquire-1.8.0.tgz#02d514a5bed986f04cbb2093af16741535f79edc" + dependencies: + fill-keys "^1.0.2" + module-not-found-error "^1.0.0" + resolve "~1.1.7" + + prr@~1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/prr/-/prr-1.0.1.tgz#d3fc114ba06995a45ec6893f484ceb1d78f5f476" + + pseudomap@^1.0.2: + version "1.0.2" + resolved "https://registry.yarnpkg.com/pseudomap/-/pseudomap-1.0.2.tgz#f052a28da70e618917ef0a8ac34c1ae5a68286b3" + + public-encrypt@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/public-encrypt/-/public-encrypt-4.0.0.tgz#39f699f3a46560dd5ebacbca693caf7c65c18cc6" + dependencies: + bn.js "^4.1.0" + browserify-rsa "^4.0.0" + create-hash "^1.1.0" + parse-asn1 "^5.0.0" + randombytes "^2.0.1" + + pump@^2.0.0, pump@^2.0.1: + version "2.0.1" + resolved "https://registry.yarnpkg.com/pump/-/pump-2.0.1.tgz#12399add6e4cf7526d973cbc8b5ce2e2908b3909" + dependencies: + end-of-stream "^1.1.0" + once "^1.3.1" + + pumpify@^1.3.3: + version "1.4.0" + resolved "https://registry.yarnpkg.com/pumpify/-/pumpify-1.4.0.tgz#80b7c5df7e24153d03f0e7ac8a05a5d068bd07fb" + dependencies: + duplexify "^3.5.3" + inherits "^2.0.3" + pump "^2.0.0" + + punycode@1.3.2: + version "1.3.2" + resolved "https://registry.yarnpkg.com/punycode/-/punycode-1.3.2.tgz#9653a036fb7c1ee42342f2325cceefea3926c48d" + + punycode@^1.2.4, punycode@^1.4.1: + version "1.4.1" + resolved "https://registry.yarnpkg.com/punycode/-/punycode-1.4.1.tgz#c0d5a63b2718800ad8e1eb0fa5269c84dd41845e" + + q@^1.1.2, q@~1.5.0: + version "1.5.1" + resolved "https://registry.yarnpkg.com/q/-/q-1.5.1.tgz#7e32f75b41381291d04611f1bf14109ac00651d7" + + qs@~6.4.0: + version "6.4.0" + resolved "https://registry.yarnpkg.com/qs/-/qs-6.4.0.tgz#13e26d28ad6b0ffaa91312cd3bf708ed351e7233" + + qs@~6.5.1: + version "6.5.1" + resolved "https://registry.yarnpkg.com/qs/-/qs-6.5.1.tgz#349cdf6eef89ec45c12d7d5eb3fc0c870343a6d8" + + query-string@^4.1.0: + version "4.3.4" + resolved "https://registry.yarnpkg.com/query-string/-/query-string-4.3.4.tgz#bbb693b9ca915c232515b228b1a02b609043dbeb" + dependencies: + object-assign "^4.1.0" + strict-uri-encode "^1.0.0" + + querystring-es3@^0.2.0: + version "0.2.1" + resolved "https://registry.yarnpkg.com/querystring-es3/-/querystring-es3-0.2.1.tgz#9ec61f79049875707d69414596fd907a4d711e73" + + querystring@0.2.0: + version "0.2.0" + resolved "https://registry.yarnpkg.com/querystring/-/querystring-0.2.0.tgz#b209849203bb25df820da756e747005878521620" + + randomatic@^1.1.3: + version "1.1.7" + resolved "https://registry.yarnpkg.com/randomatic/-/randomatic-1.1.7.tgz#c7abe9cc8b87c0baa876b19fde83fd464797e38c" + dependencies: + is-number "^3.0.0" + kind-of "^4.0.0" + + randombytes@^2.0.0, randombytes@^2.0.1, randombytes@^2.0.5: + version "2.0.6" + resolved "https://registry.yarnpkg.com/randombytes/-/randombytes-2.0.6.tgz#d302c522948588848a8d300c932b44c24231da80" + dependencies: + safe-buffer "^5.1.0" + + randomfill@^1.0.3: + version "1.0.4" + resolved "https://registry.yarnpkg.com/randomfill/-/randomfill-1.0.4.tgz#c92196fc86ab42be983f1bf31778224931d61458" + dependencies: + randombytes "^2.0.5" + safe-buffer "^5.1.0" + + rc@1.2.3, rc@^1.0.1, rc@^1.1.2, rc@^1.1.6, rc@^1.1.7, rc@^1.2.1: + version "1.2.3" + resolved "https://registry.yarnpkg.com/rc/-/rc-1.2.3.tgz#51575a900f8dd68381c710b4712c2154c3e2035b" + dependencies: + deep-extend "~0.4.0" + ini "~1.3.0" + minimist "^1.2.0" + strip-json-comments "~2.0.1" + + react-deep-force-update@2.1.1: + version "2.1.1" + resolved "https://registry.yarnpkg.com/react-deep-force-update/-/react-deep-force-update-2.1.1.tgz#8ea4263cd6455a050b37445b3f08fd839d86e909" + + react-dom@16.2.0: + version "16.2.0" + resolved "https://registry.yarnpkg.com/react-dom/-/react-dom-16.2.0.tgz#69003178601c0ca19b709b33a83369fe6124c044" + dependencies: + fbjs "^0.8.16" + loose-envify "^1.1.0" + object-assign "^4.1.1" + prop-types "^15.6.0" + + react-redux@5.0.7: + version "5.0.7" + resolved "https://registry.yarnpkg.com/react-redux/-/react-redux-5.0.7.tgz#0dc1076d9afb4670f993ffaef44b8f8c1155a4c8" + dependencies: + hoist-non-react-statics "^2.5.0" + invariant "^2.0.0" + lodash "^4.17.5" + lodash-es "^4.17.5" + loose-envify "^1.1.0" + prop-types "^15.6.0" + + react@16.2.0: + version "16.2.0" + resolved "https://registry.yarnpkg.com/react/-/react-16.2.0.tgz#a31bd2dab89bff65d42134fa187f24d054c273ba" + dependencies: + fbjs "^0.8.16" + loose-envify "^1.1.0" + object-assign "^4.1.1" + prop-types "^15.6.0" + + read-config-file@3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/read-config-file/-/read-config-file-3.0.0.tgz#771def5184a7f76abaf6b2c82f20cb983775b8ea" + dependencies: + ajv "^6.1.1" + ajv-keywords "^3.1.0" + bluebird-lst "^1.0.5" + dotenv "^5.0.0" + dotenv-expand "^4.0.1" + fs-extra-p "^4.5.0" + js-yaml "^3.10.0" + json5 "^0.5.1" + lazy-val "^1.0.3" + + read-pkg-up@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/read-pkg-up/-/read-pkg-up-1.0.1.tgz#9d63c13276c065918d57f002a57f40a1b643fb02" + dependencies: + find-up "^1.0.0" + read-pkg "^1.0.0" + + read-pkg-up@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/read-pkg-up/-/read-pkg-up-2.0.0.tgz#6b72a8048984e0c41e79510fd5e9fa99b3b549be" + dependencies: + find-up "^2.0.0" + read-pkg "^2.0.0" + + read-pkg@^1.0.0: + version "1.1.0" + resolved "https://registry.yarnpkg.com/read-pkg/-/read-pkg-1.1.0.tgz#f5ffaa5ecd29cb31c0474bca7d756b6bb29e3f28" + dependencies: + load-json-file "^1.0.0" + normalize-package-data "^2.3.2" + path-type "^1.0.0" + + read-pkg@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/read-pkg/-/read-pkg-2.0.0.tgz#8ef1c0623c6a6db0dc6713c4bfac46332b2368f8" + dependencies: + load-json-file "^2.0.0" + normalize-package-data "^2.3.2" + path-type "^2.0.0" + + "readable-stream@1 || 2", readable-stream@^2.0.0, readable-stream@^2.0.1, readable-stream@^2.0.2, readable-stream@^2.0.4, readable-stream@^2.0.5, readable-stream@^2.0.6, readable-stream@^2.1.4, readable-stream@^2.1.5, readable-stream@^2.2.2, readable-stream@^2.3.3: + version "2.3.4" + resolved "https://registry.yarnpkg.com/readable-stream/-/readable-stream-2.3.4.tgz#c946c3f47fa7d8eabc0b6150f4a12f69a4574071" + dependencies: + core-util-is "~1.0.0" + inherits "~2.0.3" + isarray "~1.0.0" + process-nextick-args "~2.0.0" + safe-buffer "~5.1.1" + string_decoder "~1.0.3" + util-deprecate "~1.0.1" + + readable-stream@~1.1.9: + version "1.1.14" + resolved "https://registry.yarnpkg.com/readable-stream/-/readable-stream-1.1.14.tgz#7cf4c54ef648e3813084c636dd2079e166c081d9" + dependencies: + core-util-is "~1.0.0" + inherits "~2.0.1" + isarray "0.0.1" + string_decoder "~0.10.x" + + readdirp@^2.0.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/readdirp/-/readdirp-2.1.0.tgz#4ed0ad060df3073300c48440373f72d1cc642d78" + dependencies: + graceful-fs "^4.1.2" + minimatch "^3.0.2" + readable-stream "^2.0.2" + set-immediate-shim "^1.0.1" + + recast@0.13.0: + version "0.13.0" + resolved "https://registry.yarnpkg.com/recast/-/recast-0.13.0.tgz#a343a394a37d24668d700f88ed04b8d2c314d40d" + dependencies: + ast-types "0.10.1" + esprima "~4.0.0" + private "~0.1.5" + source-map "~0.6.1" + + redent@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/redent/-/redent-1.0.0.tgz#cf916ab1fd5f1f16dfb20822dd6ec7f730c2afde" + dependencies: + indent-string "^2.1.0" + strip-indent "^1.0.1" + + reduce-css-calc@^1.2.6: + version "1.3.0" + resolved "https://registry.yarnpkg.com/reduce-css-calc/-/reduce-css-calc-1.3.0.tgz#747c914e049614a4c9cfbba629871ad1d2927716" + dependencies: + balanced-match "^0.4.2" + math-expression-evaluator "^1.2.14" + reduce-function-call "^1.0.1" + + reduce-function-call@^1.0.1: + version "1.0.2" + resolved "https://registry.yarnpkg.com/reduce-function-call/-/reduce-function-call-1.0.2.tgz#5a200bf92e0e37751752fe45b0ab330fd4b6be99" + dependencies: + balanced-match "^0.4.2" + + redux-thunk@2.2.0: + version "2.2.0" + resolved "https://registry.yarnpkg.com/redux-thunk/-/redux-thunk-2.2.0.tgz#e615a16e16b47a19a515766133d1e3e99b7852e5" + + redux@3.7.2: + version "3.7.2" + resolved "https://registry.yarnpkg.com/redux/-/redux-3.7.2.tgz#06b73123215901d25d065be342eb026bc1c8537b" + dependencies: + lodash "^4.2.1" + lodash-es "^4.2.1" + loose-envify "^1.1.0" + symbol-observable "^1.0.3" + + regenerate@^1.2.1: + version "1.3.3" + resolved "https://registry.yarnpkg.com/regenerate/-/regenerate-1.3.3.tgz#0c336d3980553d755c39b586ae3b20aa49c82b7f" + + regenerator-runtime@^0.10.5: + version "0.10.5" + resolved "https://registry.yarnpkg.com/regenerator-runtime/-/regenerator-runtime-0.10.5.tgz#336c3efc1220adcedda2c9fab67b5a7955a33658" + + regenerator-runtime@^0.11.0: + version "0.11.1" + resolved "https://registry.yarnpkg.com/regenerator-runtime/-/regenerator-runtime-0.11.1.tgz#be05ad7f9bf7d22e056f9726cee5017fbf19e2e9" + + regex-cache@^0.4.2: + version "0.4.4" + resolved "https://registry.yarnpkg.com/regex-cache/-/regex-cache-0.4.4.tgz#75bdc58a2a1496cec48a12835bc54c8d562336dd" + dependencies: + is-equal-shallow "^0.1.3" + + regexpu-core@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/regexpu-core/-/regexpu-core-1.0.0.tgz#86a763f58ee4d7c2f6b102e4764050de7ed90c6b" + dependencies: + regenerate "^1.2.1" + regjsgen "^0.2.0" + regjsparser "^0.1.4" + + regexpu-core@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/regexpu-core/-/regexpu-core-2.0.0.tgz#49d038837b8dcf8bfa5b9a42139938e6ea2ae240" + dependencies: + regenerate "^1.2.1" + regjsgen "^0.2.0" + regjsparser "^0.1.4" + + registry-auth-token@^3.0.1: + version "3.3.2" + resolved "https://registry.yarnpkg.com/registry-auth-token/-/registry-auth-token-3.3.2.tgz#851fd49038eecb586911115af845260eec983f20" + dependencies: + rc "^1.1.6" + safe-buffer "^5.0.1" + + registry-url@^3.0.3: + version "3.1.0" + resolved "https://registry.yarnpkg.com/registry-url/-/registry-url-3.1.0.tgz#3d4ef870f73dde1d77f0cf9a381432444e174942" + dependencies: + rc "^1.0.1" + + regjsgen@^0.2.0: + version "0.2.0" + resolved "https://registry.yarnpkg.com/regjsgen/-/regjsgen-0.2.0.tgz#6c016adeac554f75823fe37ac05b92d5a4edb1f7" + + regjsparser@^0.1.4: + version "0.1.5" + resolved "https://registry.yarnpkg.com/regjsparser/-/regjsparser-0.1.5.tgz#7ee8f84dc6fa792d3fd0ae228d24bd949ead205c" + dependencies: + jsesc "~0.5.0" + + release-zalgo@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/release-zalgo/-/release-zalgo-1.0.0.tgz#09700b7e5074329739330e535c5a90fb67851730" + dependencies: + es6-error "^4.0.1" + + remove-trailing-separator@^1.0.1: + version "1.1.0" + resolved "https://registry.yarnpkg.com/remove-trailing-separator/-/remove-trailing-separator-1.1.0.tgz#c24bce2a283adad5bc3f58e0d48249b92379d8ef" + + repeat-element@^1.1.2: + version "1.1.2" + resolved "https://registry.yarnpkg.com/repeat-element/-/repeat-element-1.1.2.tgz#ef089a178d1483baae4d93eb98b4f9e4e11d990a" + + repeat-string@^1.5.2: + version "1.6.1" + resolved "https://registry.yarnpkg.com/repeat-string/-/repeat-string-1.6.1.tgz#8dcae470e1c88abc2d600fff4a776286da75e637" + + repeating@^2.0.0: + version "2.0.1" + resolved "https://registry.yarnpkg.com/repeating/-/repeating-2.0.1.tgz#5214c53a926d3552707527fbab415dbc08d06dda" + dependencies: + is-finite "^1.0.0" + + request@2, request@^2.45.0, request@^2.81.0, request@~2.83.0: + version "2.83.0" + resolved "https://registry.yarnpkg.com/request/-/request-2.83.0.tgz#ca0b65da02ed62935887808e6f510381034e3356" + dependencies: + aws-sign2 "~0.7.0" + aws4 "^1.6.0" + caseless "~0.12.0" + combined-stream "~1.0.5" + extend "~3.0.1" + forever-agent "~0.6.1" + form-data "~2.3.1" + har-validator "~5.0.3" + hawk "~6.0.2" + http-signature "~1.2.0" + is-typedarray "~1.0.0" + isstream "~0.1.2" + json-stringify-safe "~5.0.1" + mime-types "~2.1.17" + oauth-sign "~0.8.2" + performance-now "^2.1.0" + qs "~6.5.1" + safe-buffer "^5.1.1" + stringstream "~0.0.5" + tough-cookie "~2.3.3" + tunnel-agent "^0.6.0" + uuid "^3.1.0" + + request@2.81.0: + version "2.81.0" + resolved "https://registry.yarnpkg.com/request/-/request-2.81.0.tgz#c6928946a0e06c5f8d6f8a9333469ffda46298a0" + dependencies: + aws-sign2 "~0.6.0" + aws4 "^1.2.1" + caseless "~0.12.0" + combined-stream "~1.0.5" + extend "~3.0.0" + forever-agent "~0.6.1" + form-data "~2.1.1" + har-validator "~4.2.1" + hawk "~3.1.3" + http-signature "~1.1.0" + is-typedarray "~1.0.0" + isstream "~0.1.2" + json-stringify-safe "~5.0.1" + mime-types "~2.1.7" + oauth-sign "~0.8.1" + performance-now "^0.2.0" + qs "~6.4.0" + safe-buffer "^5.0.1" + stringstream "~0.0.4" + tough-cookie "~2.3.0" + tunnel-agent "^0.6.0" + uuid "^3.0.0" + + require-directory@^2.1.1: + version "2.1.1" + resolved "https://registry.yarnpkg.com/require-directory/-/require-directory-2.1.1.tgz#8c64ad5fd30dab1c976e2344ffe7f792a6a6df42" + + require-main-filename@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/require-main-filename/-/require-main-filename-1.0.1.tgz#97f717b69d48784f5f526a6c5aa8ffdda055a4d1" + + require-precompiled@^0.1.0: + version "0.1.0" + resolved "https://registry.yarnpkg.com/require-precompiled/-/require-precompiled-0.1.0.tgz#5a1b52eb70ebed43eb982e974c85ab59571e56fa" + + require-uncached@^1.0.3: + version "1.0.3" + resolved "https://registry.yarnpkg.com/require-uncached/-/require-uncached-1.0.3.tgz#4e0d56d6c9662fd31e43011c4b95aa49955421d3" + dependencies: + caller-path "^0.1.0" + resolve-from "^1.0.0" + + reselect@3.0.1: + version "3.0.1" + resolved "https://registry.yarnpkg.com/reselect/-/reselect-3.0.1.tgz#efdaa98ea7451324d092b2b2163a6a1d7a9a2147" + + resolve-cwd@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/resolve-cwd/-/resolve-cwd-2.0.0.tgz#00a9f7387556e27038eae232caa372a6a59b665a" + dependencies: + resolve-from "^3.0.0" + + resolve-from@^1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/resolve-from/-/resolve-from-1.0.1.tgz#26cbfe935d1aeeeabb29bc3fe5aeb01e93d44226" + + resolve-from@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/resolve-from/-/resolve-from-3.0.0.tgz#b22c7af7d9d6881bc8b6e653335eebcb0a188748" + + resolve-url@~0.2.1: + version "0.2.1" + resolved "https://registry.yarnpkg.com/resolve-url/-/resolve-url-0.2.1.tgz#2c637fe77c893afd2a663fe21aa9080068e2052a" + + resolve@~1.1.7: + version "1.1.7" + resolved "https://registry.yarnpkg.com/resolve/-/resolve-1.1.7.tgz#203114d82ad2c5ed9e8e0411b3932875e889e97b" + + restore-cursor@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/restore-cursor/-/restore-cursor-2.0.0.tgz#9f7ee287f82fd326d4fd162923d62129eee0dfaf" + dependencies: + onetime "^2.0.0" + signal-exit "^3.0.2" + + rgb2hex@~0.1.0: + version "0.1.0" + resolved "https://registry.yarnpkg.com/rgb2hex/-/rgb2hex-0.1.0.tgz#ccd55f860ae0c5c4ea37504b958e442d8d12325b" + + right-align@^0.1.1: + version "0.1.3" + resolved "https://registry.yarnpkg.com/right-align/-/right-align-0.1.3.tgz#61339b722fe6a3515689210d24e14c96148613ef" + dependencies: + align-text "^0.1.1" + + rimraf@2, rimraf@^2.2.8, rimraf@^2.5.1, rimraf@^2.5.2, rimraf@^2.5.4, rimraf@^2.6.1, rimraf@^2.6.2: + version "2.6.2" + resolved "https://registry.yarnpkg.com/rimraf/-/rimraf-2.6.2.tgz#2ed8150d24a16ea8651e6d6ef0f47c4158ce7a36" + dependencies: + glob "^7.0.5" + + ripemd160@^2.0.0, ripemd160@^2.0.1: + version "2.0.1" + resolved "https://registry.yarnpkg.com/ripemd160/-/ripemd160-2.0.1.tgz#0f4584295c53a3628af7e6d79aca21ce57d1c6e7" + dependencies: + hash-base "^2.0.0" + inherits "^2.0.1" + + run-async@^2.2.0: + version "2.3.0" + resolved "https://registry.yarnpkg.com/run-async/-/run-async-2.3.0.tgz#0371ab4ae0bdd720d4166d7dfda64ff7a445a6c0" + dependencies: + is-promise "^2.1.0" + + run-queue@^1.0.0, run-queue@^1.0.3: + version "1.0.3" + resolved "https://registry.yarnpkg.com/run-queue/-/run-queue-1.0.3.tgz#e848396f057d223f24386924618e25694161ec47" + dependencies: + aproba "^1.1.1" + + rx-lite-aggregates@^4.0.8: + version "4.0.8" + resolved "https://registry.yarnpkg.com/rx-lite-aggregates/-/rx-lite-aggregates-4.0.8.tgz#753b87a89a11c95467c4ac1626c4efc4e05c67be" + dependencies: + rx-lite "*" + + rx-lite@*, rx-lite@^4.0.8: + version "4.0.8" + resolved "https://registry.yarnpkg.com/rx-lite/-/rx-lite-4.0.8.tgz#0b1e11af8bc44836f04a6407e92da42467b79444" + + rxjs@^5.1.1, rxjs@^5.5.2: + version "5.5.6" + resolved "https://registry.yarnpkg.com/rxjs/-/rxjs-5.5.6.tgz#e31fb96d6fd2ff1fd84bcea8ae9c02d007179c02" + dependencies: + symbol-observable "1.0.1" + + safe-buffer@^5.0.1, safe-buffer@^5.1.0, safe-buffer@^5.1.1, safe-buffer@~5.1.0, safe-buffer@~5.1.1: + version "5.1.1" + resolved "https://registry.yarnpkg.com/safe-buffer/-/safe-buffer-5.1.1.tgz#893312af69b2123def71f57889001671eeb2c853" + + sanitize-filename@^1.6.1: + version "1.6.1" + resolved "https://registry.yarnpkg.com/sanitize-filename/-/sanitize-filename-1.6.1.tgz#612da1c96473fa02dccda92dcd5b4ab164a6772a" + dependencies: + truncate-utf8-bytes "^1.0.0" + + sax@^1.2.4, sax@~1.2.1: + version "1.2.4" + resolved "https://registry.yarnpkg.com/sax/-/sax-1.2.4.tgz#2816234e2378bddc4e5354fab5caa895df7100d9" + + schema-utils@^0.3.0: + version "0.3.0" + resolved "https://registry.yarnpkg.com/schema-utils/-/schema-utils-0.3.0.tgz#f5877222ce3e931edae039f17eb3716e7137f8cf" + dependencies: + ajv "^5.0.0" + + seamless-immutable@7.1.3: + version "7.1.3" + resolved "https://registry.yarnpkg.com/seamless-immutable/-/seamless-immutable-7.1.3.tgz#d32a8a202a331dffa69e4069a367a2159252490e" + + semver-diff@^2.0.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/semver-diff/-/semver-diff-2.1.0.tgz#4bbb8437c8d37e4b0cf1a68fd726ec6d645d6d36" + dependencies: + semver "^5.0.3" + + "semver@2 || 3 || 4 || 5", semver@5.5.0, semver@^5.0.3, semver@^5.1.0, semver@^5.3.0, semver@^5.4.1, semver@^5.5.0: + version "5.5.0" + resolved "https://registry.yarnpkg.com/semver/-/semver-5.5.0.tgz#dc4bbc7a6ca9d916dee5d43516f0092b58f7b8ab" + + semver@~5.3.0: + version "5.3.0" + resolved "https://registry.yarnpkg.com/semver/-/semver-5.3.0.tgz#9b2ce5d3de02d17c6012ad326aa6b4d0cf54f94f" + + serialize-error@^2.1.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/serialize-error/-/serialize-error-2.1.0.tgz#50b679d5635cdf84667bdc8e59af4e5b81d5f60a" + + serialize-javascript@^1.4.0: + version "1.4.0" + resolved "https://registry.yarnpkg.com/serialize-javascript/-/serialize-javascript-1.4.0.tgz#7c958514db6ac2443a8abc062dc9f7886a7f6005" + + set-blocking@^2.0.0, set-blocking@~2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/set-blocking/-/set-blocking-2.0.0.tgz#045f9782d011ae9a6803ddd382b24392b3d890f7" + + set-immediate-shim@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/set-immediate-shim/-/set-immediate-shim-1.0.1.tgz#4b2b1b27eb808a9f8dcc481a58e5e56f599f3f61" + + setimmediate@^1.0.4, setimmediate@^1.0.5: + version "1.0.5" + resolved "https://registry.yarnpkg.com/setimmediate/-/setimmediate-1.0.5.tgz#290cbb232e306942d7d7ea9b83732ab7856f8285" + + sha.js@^2.4.0, sha.js@^2.4.8: + version "2.4.10" + resolved "https://registry.yarnpkg.com/sha.js/-/sha.js-2.4.10.tgz#b1fde5cd7d11a5626638a07c604ab909cfa31f9b" + dependencies: + inherits "^2.0.1" + safe-buffer "^5.0.1" + + shebang-command@^1.2.0: + version "1.2.0" + resolved "https://registry.yarnpkg.com/shebang-command/-/shebang-command-1.2.0.tgz#44aac65b695b03398968c39f363fee5deafdf1ea" + dependencies: + shebang-regex "^1.0.0" + + shebang-loader@0.0.1: + version "0.0.1" + resolved "https://registry.yarnpkg.com/shebang-loader/-/shebang-loader-0.0.1.tgz#a4000495d44cceefbec63435e7b1698569fa52ec" + + shebang-regex@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/shebang-regex/-/shebang-regex-1.0.0.tgz#da42f49740c0b42db2ca9728571cb190c98efea3" + + signal-exit@^3.0.0, signal-exit@^3.0.2: + version "3.0.2" + resolved "https://registry.yarnpkg.com/signal-exit/-/signal-exit-3.0.2.tgz#b5fdc08f1287ea1178628e415e25132b73646c6d" + + simple-swizzle@^0.2.2: + version "0.2.2" + resolved "https://registry.yarnpkg.com/simple-swizzle/-/simple-swizzle-0.2.2.tgz#a4da6b635ffcccca33f70d17cb92592de95e557a" + dependencies: + is-arrayish "^0.3.1" + + single-line-log@^1.1.2: + version "1.1.2" + resolved "https://registry.yarnpkg.com/single-line-log/-/single-line-log-1.1.2.tgz#c2f83f273a3e1a16edb0995661da0ed5ef033364" + dependencies: + string-width "^1.0.1" + + slash@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/slash/-/slash-1.0.0.tgz#c41f2f6c39fc16d1cd17ad4b5d896114ae470d55" + + slice-ansi@1.0.0, slice-ansi@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/slice-ansi/-/slice-ansi-1.0.0.tgz#044f1a49d8842ff307aad6b505ed178bd950134d" + dependencies: + is-fullwidth-code-point "^2.0.0" + + slide@^1.1.5: + version "1.1.6" + resolved "https://registry.yarnpkg.com/slide/-/slide-1.1.6.tgz#56eb027d65b4d2dce6cb2e2d32c4d4afc9e1d707" + + sntp@1.x.x: + version "1.0.9" + resolved "https://registry.yarnpkg.com/sntp/-/sntp-1.0.9.tgz#6541184cc90aeea6c6e7b35e2659082443c66198" + dependencies: + hoek "2.x.x" + + sntp@2.x.x: + version "2.1.0" + resolved "https://registry.yarnpkg.com/sntp/-/sntp-2.1.0.tgz#2c6cec14fedc2222739caf9b5c3d85d1cc5a2cc8" + dependencies: + hoek "4.x.x" + + sort-keys@^1.0.0: + version "1.1.2" + resolved "https://registry.yarnpkg.com/sort-keys/-/sort-keys-1.1.2.tgz#441b6d4d346798f1b4e49e8920adfba0e543f9ad" + dependencies: + is-plain-obj "^1.0.0" + + sort-keys@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/sort-keys/-/sort-keys-2.0.0.tgz#658535584861ec97d730d6cf41822e1f56684128" + dependencies: + is-plain-obj "^1.0.0" + + source-list-map@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/source-list-map/-/source-list-map-2.0.0.tgz#aaa47403f7b245a92fbc97ea08f250d6087ed085" + + source-map-resolve@^0.3.0: + version "0.3.1" + resolved "https://registry.yarnpkg.com/source-map-resolve/-/source-map-resolve-0.3.1.tgz#610f6122a445b8dd51535a2a71b783dfc1248761" + dependencies: + atob "~1.1.0" + resolve-url "~0.2.1" + source-map-url "~0.3.0" + urix "~0.1.0" + + source-map-support@^0.4.15: + version "0.4.18" + resolved "https://registry.yarnpkg.com/source-map-support/-/source-map-support-0.4.18.tgz#0286a6de8be42641338594e97ccea75f0a2c585f" + dependencies: + source-map "^0.5.6" + + source-map-support@^0.5.0, source-map-support@^0.5.3: + version "0.5.3" + resolved "https://registry.yarnpkg.com/source-map-support/-/source-map-support-0.5.3.tgz#2b3d5fff298cfa4d1afd7d4352d569e9a0158e76" + dependencies: + source-map "^0.6.0" + + source-map-url@~0.3.0: + version "0.3.0" + resolved "https://registry.yarnpkg.com/source-map-url/-/source-map-url-0.3.0.tgz#7ecaf13b57bcd09da8a40c5d269db33799d4aaf9" + + source-map@0.6.1, source-map@^0.6.0, source-map@^0.6.1, source-map@~0.6.1: + version "0.6.1" + resolved "https://registry.yarnpkg.com/source-map/-/source-map-0.6.1.tgz#74722af32e9614e9c287a8d0bbde48b5e2f1a263" + + source-map@^0.1.38: + version "0.1.43" + resolved "https://registry.yarnpkg.com/source-map/-/source-map-0.1.43.tgz#c24bc146ca517c1471f5dacbe2571b2b7f9e3346" + dependencies: + amdefine ">=0.0.4" + + source-map@^0.5.0, source-map@^0.5.3, source-map@^0.5.6, source-map@^0.5.7, source-map@~0.5.1: + version "0.5.7" + resolved "https://registry.yarnpkg.com/source-map/-/source-map-0.5.7.tgz#8a039d2d1021d22d1ea14c80d8ea468ba2ef3fcc" + + spawn-rx@^2.0.10: + version "2.0.12" + resolved "https://registry.yarnpkg.com/spawn-rx/-/spawn-rx-2.0.12.tgz#b6285294499426089beea0c3c1ec32d7fc57a376" + dependencies: + debug "^2.5.1" + lodash.assign "^4.2.0" + rxjs "^5.1.1" + + spdx-correct@~1.0.0: + version "1.0.2" + resolved "https://registry.yarnpkg.com/spdx-correct/-/spdx-correct-1.0.2.tgz#4b3073d933ff51f3912f03ac5519498a4150db40" + dependencies: + spdx-license-ids "^1.0.2" + + spdx-expression-parse@~1.0.0: + version "1.0.4" + resolved "https://registry.yarnpkg.com/spdx-expression-parse/-/spdx-expression-parse-1.0.4.tgz#9bdf2f20e1f40ed447fbe273266191fced51626c" + + spdx-license-ids@^1.0.2: + version "1.2.2" + resolved "https://registry.yarnpkg.com/spdx-license-ids/-/spdx-license-ids-1.2.2.tgz#c9df7a3424594ade6bd11900d596696dc06bac57" + + spectron@3.8.0: + version "3.8.0" + resolved "https://registry.yarnpkg.com/spectron/-/spectron-3.8.0.tgz#122c3562fd7e92b7cdf6f94094aa495b150dfa51" + dependencies: + dev-null "^0.1.1" + electron-chromedriver "~1.8.0" + request "^2.81.0" + split "^1.0.0" + webdriverio "^4.8.0" + + speedometer@~0.1.2: + version "0.1.4" + resolved "https://registry.yarnpkg.com/speedometer/-/speedometer-0.1.4.tgz#9876dbd2a169d3115402d48e6ea6329c8816a50d" + + split@^1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/split/-/split-1.0.1.tgz#605bd9be303aa59fb35f9229fbea0ddec9ea07d9" + dependencies: + through "2" + + sprintf-js@~1.0.2: + version "1.0.3" + resolved "https://registry.yarnpkg.com/sprintf-js/-/sprintf-js-1.0.3.tgz#04e6926f662895354f3dd015203633b857297e2c" + + sshpk@^1.7.0: + version "1.13.1" + resolved "https://registry.yarnpkg.com/sshpk/-/sshpk-1.13.1.tgz#512df6da6287144316dc4c18fe1cf1d940739be3" + dependencies: + asn1 "~0.2.3" + assert-plus "^1.0.0" + dashdash "^1.12.0" + getpass "^0.1.1" + optionalDependencies: + bcrypt-pbkdf "^1.0.0" + ecc-jsbn "~0.1.1" + jsbn "~0.1.0" + tweetnacl "~0.14.0" + + ssri@^5.2.4: + version "5.2.4" + resolved "https://registry.yarnpkg.com/ssri/-/ssri-5.2.4.tgz#9985e14041e65fc397af96542be35724ac11da52" + dependencies: + safe-buffer "^5.1.1" + + stack-utils@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/stack-utils/-/stack-utils-1.0.1.tgz#d4f33ab54e8e38778b0ca5cfd3b3afb12db68620" + + stat-mode@^0.2.2: + version "0.2.2" + resolved "https://registry.yarnpkg.com/stat-mode/-/stat-mode-0.2.2.tgz#e6c80b623123d7d80cf132ce538f346289072502" + + stream-browserify@^2.0.1: + version "2.0.1" + resolved "https://registry.yarnpkg.com/stream-browserify/-/stream-browserify-2.0.1.tgz#66266ee5f9bdb9940a4e4514cafb43bb71e5c9db" + dependencies: + inherits "~2.0.1" + readable-stream "^2.0.2" + + stream-each@^1.1.0: + version "1.2.2" + resolved "https://registry.yarnpkg.com/stream-each/-/stream-each-1.2.2.tgz#8e8c463f91da8991778765873fe4d960d8f616bd" + dependencies: + end-of-stream "^1.1.0" + stream-shift "^1.0.0" + + stream-http@^2.7.2: + version "2.8.0" + resolved "https://registry.yarnpkg.com/stream-http/-/stream-http-2.8.0.tgz#fd86546dac9b1c91aff8fc5d287b98fafb41bc10" + dependencies: + builtin-status-codes "^3.0.0" + inherits "^2.0.1" + readable-stream "^2.3.3" + to-arraybuffer "^1.0.0" + xtend "^4.0.0" + + stream-shift@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/stream-shift/-/stream-shift-1.0.0.tgz#d5c752825e5367e786f78e18e445ea223a155952" + + strict-uri-encode@^1.0.0: + version "1.1.0" + resolved "https://registry.yarnpkg.com/strict-uri-encode/-/strict-uri-encode-1.1.0.tgz#279b225df1d582b1f54e65addd4352e18faa0713" + + string-hash@1.1.3: + version "1.1.3" + resolved "https://registry.yarnpkg.com/string-hash/-/string-hash-1.1.3.tgz#e8aafc0ac1855b4666929ed7dd1275df5d6c811b" + + string-similarity@1.2.0: + version "1.2.0" + resolved "https://registry.yarnpkg.com/string-similarity/-/string-similarity-1.2.0.tgz#d75153cb383846318b7a39a8d9292bb4db4e9c30" + dependencies: + lodash "^4.13.1" + + string-width@^1.0.1, string-width@^1.0.2: + version "1.0.2" + resolved "https://registry.yarnpkg.com/string-width/-/string-width-1.0.2.tgz#118bdf5b8cdc51a2a7e70d211e07e2b0b9b107d3" + dependencies: + code-point-at "^1.0.0" + is-fullwidth-code-point "^1.0.0" + strip-ansi "^3.0.0" + + string-width@^2.0.0, string-width@^2.1.0, string-width@^2.1.1: + version "2.1.1" + resolved "https://registry.yarnpkg.com/string-width/-/string-width-2.1.1.tgz#ab93f27a8dc13d28cac815c462143a6d9012ae9e" + dependencies: + is-fullwidth-code-point "^2.0.0" + strip-ansi "^4.0.0" + + string_decoder@^1.0.0, string_decoder@~1.0.3: + version "1.0.3" + resolved "https://registry.yarnpkg.com/string_decoder/-/string_decoder-1.0.3.tgz#0fc67d7c141825de94282dd536bec6b9bce860ab" + dependencies: + safe-buffer "~5.1.0" + + string_decoder@~0.10.x: + version "0.10.31" + resolved "https://registry.yarnpkg.com/string_decoder/-/string_decoder-0.10.31.tgz#62e203bc41766c6c28c9fc84301dab1c5310fa94" + + stringstream@~0.0.4, stringstream@~0.0.5: + version "0.0.5" + resolved "https://registry.yarnpkg.com/stringstream/-/stringstream-0.0.5.tgz#4e484cd4de5a0bbbee18e46307710a8a81621878" + + strip-ansi@^3.0.0, strip-ansi@^3.0.1: + version "3.0.1" + resolved "https://registry.yarnpkg.com/strip-ansi/-/strip-ansi-3.0.1.tgz#6a385fb8853d952d5ff05d0e8aaf94278dc63dcf" + dependencies: + ansi-regex "^2.0.0" + + strip-ansi@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/strip-ansi/-/strip-ansi-4.0.0.tgz#a8479022eb1ac368a871389b635262c505ee368f" + dependencies: + ansi-regex "^3.0.0" + + strip-ansi@~0.1.0: + version "0.1.1" + resolved "https://registry.yarnpkg.com/strip-ansi/-/strip-ansi-0.1.1.tgz#39e8a98d044d150660abe4a6808acf70bb7bc991" + + strip-bom-buf@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/strip-bom-buf/-/strip-bom-buf-1.0.0.tgz#1cb45aaf57530f4caf86c7f75179d2c9a51dd572" + dependencies: + is-utf8 "^0.2.1" + + strip-bom@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/strip-bom/-/strip-bom-2.0.0.tgz#6219a85616520491f35788bdbf1447a99c7e6b0e" + dependencies: + is-utf8 "^0.2.0" + + strip-bom@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/strip-bom/-/strip-bom-3.0.0.tgz#2334c18e9c759f7bdd56fdef7e9ae3d588e68ed3" + + strip-eof@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/strip-eof/-/strip-eof-1.0.0.tgz#bb43ff5598a6eb05d89b59fcd129c983313606bf" + + strip-indent@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/strip-indent/-/strip-indent-1.0.1.tgz#0c7962a6adefa7bbd4ac366460a638552ae1a0a2" + dependencies: + get-stdin "^4.0.1" + + strip-indent@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/strip-indent/-/strip-indent-2.0.0.tgz#5ef8db295d01e6ed6cbf7aab96998d7822527b68" + + strip-json-comments@~2.0.1: + version "2.0.1" + resolved "https://registry.yarnpkg.com/strip-json-comments/-/strip-json-comments-2.0.1.tgz#3c531942e908c2697c0ec344858c286c7ca0a60a" + + style-loader@0.19.1: + version "0.19.1" + resolved "https://registry.yarnpkg.com/style-loader/-/style-loader-0.19.1.tgz#591ffc80bcefe268b77c5d9ebc0505d772619f85" + dependencies: + loader-utils "^1.0.2" + schema-utils "^0.3.0" + + styled-jsx@2.2.6: + version "2.2.6" + resolved "https://registry.yarnpkg.com/styled-jsx/-/styled-jsx-2.2.6.tgz#7e826279e1ef718213ef9cc42ac7370b5008449d" + dependencies: + babel-plugin-syntax-jsx "6.18.0" + babel-types "6.26.0" + convert-source-map "1.5.1" + source-map "0.6.1" + string-hash "1.1.3" + stylis "3.4.10" + stylis-rule-sheet "0.0.8" + + stylis-rule-sheet@0.0.8: + version "0.0.8" + resolved "https://registry.yarnpkg.com/stylis-rule-sheet/-/stylis-rule-sheet-0.0.8.tgz#b0d0a126c945b1f3047447a3aae0647013e8d166" + + stylis@3.4.10: + version "3.4.10" + resolved "https://registry.yarnpkg.com/stylis/-/stylis-3.4.10.tgz#a135cab4b9ff208e327fbb5a6fde3fa991c638ee" + + stylis@3.5.0: + version "3.5.0" + resolved "https://registry.yarnpkg.com/stylis/-/stylis-3.5.0.tgz#016fa239663d77f868fef5b67cf201c4b7c701e1" + + sumchecker@^1.2.0: + version "1.3.1" + resolved "https://registry.yarnpkg.com/sumchecker/-/sumchecker-1.3.1.tgz#79bb3b4456dd04f18ebdbc0d703a1d1daec5105d" + dependencies: + debug "^2.2.0" + es6-promise "^4.0.5" + + sumchecker@^2.0.1, sumchecker@^2.0.2: + version "2.0.2" + resolved "https://registry.yarnpkg.com/sumchecker/-/sumchecker-2.0.2.tgz#0f42c10e5d05da5d42eea3e56c3399a37d6c5b3e" + dependencies: + debug "^2.2.0" + + supertap@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/supertap/-/supertap-1.0.0.tgz#bd9751c7fafd68c68cf8222a29892206a119fa9e" + dependencies: + arrify "^1.0.1" + indent-string "^3.2.0" + js-yaml "^3.10.0" + serialize-error "^2.1.0" + strip-ansi "^4.0.0" + + supports-color@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-2.0.0.tgz#535d045ce6b6363fa40117084629995e9df324c7" + + supports-color@^3.2.3: + version "3.2.3" + resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-3.2.3.tgz#65ac0504b3954171d8a64946b2ae3cbb8a5f54f6" + dependencies: + has-flag "^1.0.0" + + supports-color@^4.0.0, supports-color@^4.2.1: + version "4.5.0" + resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-4.5.0.tgz#be7a0de484dec5c5cddf8b3d59125044912f635b" + dependencies: + has-flag "^2.0.0" + + supports-color@^5.0.0, supports-color@^5.2.0: + version "5.2.0" + resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-5.2.0.tgz#b0d5333b1184dd3666cbe5aa0b45c5ac7ac17a4a" + dependencies: + has-flag "^3.0.0" + + supports-color@^5.3.0: + version "5.3.0" + resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-5.3.0.tgz#5b24ac15db80fa927cf5227a4a33fd3c4c7676c0" + dependencies: + has-flag "^3.0.0" + + supports-color@~5.0.0: + version "5.0.1" + resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-5.0.1.tgz#1c5331f22250c84202805b2f17adf16699f3a39a" + dependencies: + has-flag "^2.0.0" + + svgo@^0.7.0: + version "0.7.2" + resolved "https://registry.yarnpkg.com/svgo/-/svgo-0.7.2.tgz#9f5772413952135c6fefbf40afe6a4faa88b4bb5" + dependencies: + coa "~1.0.1" + colors "~1.1.2" + csso "~2.3.1" + js-yaml "~3.7.0" + mkdirp "~0.5.1" + sax "~1.2.1" + whet.extend "~0.9.9" + + symbol-observable@1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/symbol-observable/-/symbol-observable-1.0.1.tgz#8340fc4702c3122df5d22288f88283f513d3fdd4" + + symbol-observable@^0.2.2: + version "0.2.4" + resolved "https://registry.yarnpkg.com/symbol-observable/-/symbol-observable-0.2.4.tgz#95a83db26186d6af7e7a18dbd9760a2f86d08f40" + + symbol-observable@^1.0.3, symbol-observable@^1.0.4, symbol-observable@^1.1.0: + version "1.2.0" + resolved "https://registry.yarnpkg.com/symbol-observable/-/symbol-observable-1.2.0.tgz#c22688aed4eab3cdc2dfeacbb561660560a00804" + + table@^4.0.1: + version "4.0.2" + resolved "https://registry.yarnpkg.com/table/-/table-4.0.2.tgz#a33447375391e766ad34d3486e6e2aedc84d2e36" + dependencies: + ajv "^5.2.3" + ajv-keywords "^2.1.0" + chalk "^2.1.0" + lodash "^4.17.4" + slice-ansi "1.0.0" + string-width "^2.1.1" + + tapable@^0.2.7: + version "0.2.8" + resolved "https://registry.yarnpkg.com/tapable/-/tapable-0.2.8.tgz#99372a5c999bf2df160afc0d74bed4f47948cd22" + + tar-pack@^3.4.0: + version "3.4.1" + resolved "https://registry.yarnpkg.com/tar-pack/-/tar-pack-3.4.1.tgz#e1dbc03a9b9d3ba07e896ad027317eb679a10a1f" + dependencies: + debug "^2.2.0" + fstream "^1.0.10" + fstream-ignore "^1.0.5" + once "^1.3.3" + readable-stream "^2.1.4" + rimraf "^2.5.1" + tar "^2.2.1" + uid-number "^0.0.6" + + tar-stream@^1.5.0: + version "1.5.5" + resolved "https://registry.yarnpkg.com/tar-stream/-/tar-stream-1.5.5.tgz#5cad84779f45c83b1f2508d96b09d88c7218af55" + dependencies: + bl "^1.0.0" + end-of-stream "^1.0.0" + readable-stream "^2.0.0" + xtend "^4.0.0" + + tar@^2.0.0, tar@^2.2.1: + version "2.2.1" + resolved "https://registry.yarnpkg.com/tar/-/tar-2.2.1.tgz#8e4d2a256c0e2185c6b18ad694aec968b83cb1d1" + dependencies: + block-stream "*" + fstream "^1.0.2" + inherits "2" + + temp-file@^3.1.1: + version "3.1.1" + resolved "https://registry.yarnpkg.com/temp-file/-/temp-file-3.1.1.tgz#8823649aa4e8a6e419eb71b601a2e4d472b0f24f" + dependencies: + async-exit-hook "^2.0.1" + bluebird-lst "^1.0.5" + fs-extra-p "^4.5.0" + lazy-val "^1.0.3" + + term-size@^1.2.0: + version "1.2.0" + resolved "https://registry.yarnpkg.com/term-size/-/term-size-1.2.0.tgz#458b83887f288fc56d6fffbfad262e26638efa69" + dependencies: + execa "^0.7.0" + + text-table@^0.2.0, text-table@~0.2.0: + version "0.2.0" + resolved "https://registry.yarnpkg.com/text-table/-/text-table-0.2.0.tgz#7f5ee823ae805207c00af2df4a84ec3fcfa570b4" + + throttleit@0.0.2: + version "0.0.2" + resolved "https://registry.yarnpkg.com/throttleit/-/throttleit-0.0.2.tgz#cfedf88e60c00dd9697b61fdd2a8343a9b680eaf" + + through2@^2.0.0: + version "2.0.3" + resolved "https://registry.yarnpkg.com/through2/-/through2-2.0.3.tgz#0004569b37c7c74ba39c43f3ced78d1ad94140be" + dependencies: + readable-stream "^2.1.5" + xtend "~4.0.1" + + through2@~0.2.3: + version "0.2.3" + resolved "https://registry.yarnpkg.com/through2/-/through2-0.2.3.tgz#eb3284da4ea311b6cc8ace3653748a52abf25a3f" + dependencies: + readable-stream "~1.1.9" + xtend "~2.1.1" + + through@2, through@^2.3.6: + version "2.3.8" + resolved "https://registry.yarnpkg.com/through/-/through-2.3.8.tgz#0dd4c9ffaabc357960b1b724115d7e0e86a2e1f5" + + time-zone@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/time-zone/-/time-zone-1.0.0.tgz#99c5bf55958966af6d06d83bdf3800dc82faec5d" + + timed-out@^4.0.0: + version "4.0.1" + resolved "https://registry.yarnpkg.com/timed-out/-/timed-out-4.0.1.tgz#f32eacac5a175bea25d7fab565ab3ed8741ef56f" + + timers-browserify@^2.0.4: + version "2.0.6" + resolved "https://registry.yarnpkg.com/timers-browserify/-/timers-browserify-2.0.6.tgz#241e76927d9ca05f4d959819022f5b3664b64bae" + dependencies: + setimmediate "^1.0.4" + + tmp@^0.0.33: + version "0.0.33" + resolved "https://registry.yarnpkg.com/tmp/-/tmp-0.0.33.tgz#6d34335889768d21b2bcda0aa277ced3b1bfadf9" + dependencies: + os-tmpdir "~1.0.2" + + to-arraybuffer@^1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/to-arraybuffer/-/to-arraybuffer-1.0.1.tgz#7d229b1fcc637e466ca081180836a7aabff83f43" + + to-fast-properties@^1.0.3: + version "1.0.3" + resolved "https://registry.yarnpkg.com/to-fast-properties/-/to-fast-properties-1.0.3.tgz#b83571fa4d8c25b82e231b06e3a3055de4ca1a47" + + tough-cookie@~2.3.0, tough-cookie@~2.3.3: + version "2.3.3" + resolved "https://registry.yarnpkg.com/tough-cookie/-/tough-cookie-2.3.3.tgz#0b618a5565b6dea90bf3425d04d55edc475a7561" + dependencies: + punycode "^1.4.1" + + trim-newlines@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/trim-newlines/-/trim-newlines-1.0.0.tgz#5887966bb582a4503a41eb524f7d35011815a613" + + trim-off-newlines@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/trim-off-newlines/-/trim-off-newlines-1.0.1.tgz#9f9ba9d9efa8764c387698bcbfeb2c848f11adb3" + + trim-right@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/trim-right/-/trim-right-1.0.1.tgz#cb2e1203067e0c8de1f614094b9fe45704ea6003" + + truncate-utf8-bytes@^1.0.0: + version "1.0.2" + resolved "https://registry.yarnpkg.com/truncate-utf8-bytes/-/truncate-utf8-bytes-1.0.2.tgz#405923909592d56f78a5818434b0b78489ca5f2b" + dependencies: + utf8-byte-length "^1.0.1" + + tty-browserify@0.0.0: + version "0.0.0" + resolved "https://registry.yarnpkg.com/tty-browserify/-/tty-browserify-0.0.0.tgz#a157ba402da24e9bf957f9aa69d524eed42901a6" + + tunnel-agent@^0.6.0: + version "0.6.0" + resolved "https://registry.yarnpkg.com/tunnel-agent/-/tunnel-agent-0.6.0.tgz#27a5dea06b36b04a0a9966774b290868f0fc40fd" + dependencies: + safe-buffer "^5.0.1" + + tweetnacl@^0.14.3, tweetnacl@~0.14.0: + version "0.14.5" + resolved "https://registry.yarnpkg.com/tweetnacl/-/tweetnacl-0.14.5.tgz#5ae68177f192d4456269d108afa93ff8743f4f64" + + type-check@~0.3.2: + version "0.3.2" + resolved "https://registry.yarnpkg.com/type-check/-/type-check-0.3.2.tgz#5884cab512cf1d355e3fb784f30804b2b520db72" + dependencies: + prelude-ls "~1.1.2" + + typedarray@^0.0.6: + version "0.0.6" + resolved "https://registry.yarnpkg.com/typedarray/-/typedarray-0.0.6.tgz#867ac74e3864187b1d3d47d996a78ec5c8830777" + + ua-parser-js@^0.7.9: + version "0.7.17" + resolved "https://registry.yarnpkg.com/ua-parser-js/-/ua-parser-js-0.7.17.tgz#e9ec5f9498b9ec910e7ae3ac626a805c4d09ecac" + + uglify-js@^2.8.29: + version "2.8.29" + resolved "https://registry.yarnpkg.com/uglify-js/-/uglify-js-2.8.29.tgz#29c5733148057bb4e1f75df35b7a9cb72e6a59dd" + dependencies: + source-map "~0.5.1" + yargs "~3.10.0" + optionalDependencies: + uglify-to-browserify "~1.0.0" + + uglify-to-browserify@~1.0.0: + version "1.0.2" + resolved "https://registry.yarnpkg.com/uglify-to-browserify/-/uglify-to-browserify-1.0.2.tgz#6e0924d6bda6b5afe349e39a6d632850a0f882b7" + + uglifyjs-webpack-plugin@^0.4.6: + version "0.4.6" + resolved "https://registry.yarnpkg.com/uglifyjs-webpack-plugin/-/uglifyjs-webpack-plugin-0.4.6.tgz#b951f4abb6bd617e66f63eb891498e391763e309" + dependencies: + source-map "^0.5.6" + uglify-js "^2.8.29" + webpack-sources "^1.0.1" + + uid-number@^0.0.6: + version "0.0.6" + resolved "https://registry.yarnpkg.com/uid-number/-/uid-number-0.0.6.tgz#0ea10e8035e8eb5b8e4449f06da1c730663baa81" + + uid2@0.0.3: + version "0.0.3" + resolved "https://registry.yarnpkg.com/uid2/-/uid2-0.0.3.tgz#483126e11774df2f71b8b639dcd799c376162b82" + + uniq@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/uniq/-/uniq-1.0.1.tgz#b31c5ae8254844a3a8281541ce2b04b865a734ff" + + uniqid@^4.0.0: + version "4.1.1" + resolved "https://registry.yarnpkg.com/uniqid/-/uniqid-4.1.1.tgz#89220ddf6b751ae52b5f72484863528596bb84c1" + dependencies: + macaddress "^0.2.8" + + uniqs@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/uniqs/-/uniqs-2.0.0.tgz#ffede4b36b25290696e6e165d4a59edb998e6b02" + + unique-filename@^1.1.0: + version "1.1.0" + resolved "https://registry.yarnpkg.com/unique-filename/-/unique-filename-1.1.0.tgz#d05f2fe4032560871f30e93cbe735eea201514f3" + dependencies: + unique-slug "^2.0.0" + + unique-slug@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/unique-slug/-/unique-slug-2.0.0.tgz#db6676e7c7cc0629878ff196097c78855ae9f4ab" + dependencies: + imurmurhash "^0.1.4" + + unique-string@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/unique-string/-/unique-string-1.0.0.tgz#9e1057cca851abb93398f8b33ae187b99caec11a" + dependencies: + crypto-random-string "^1.0.0" + + unique-temp-dir@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/unique-temp-dir/-/unique-temp-dir-1.0.0.tgz#6dce95b2681ca003eebfb304a415f9cbabcc5385" + dependencies: + mkdirp "^0.5.1" + os-tmpdir "^1.0.1" + uid2 "0.0.3" + + universalify@^0.1.0: + version "0.1.1" + resolved "https://registry.yarnpkg.com/universalify/-/universalify-0.1.1.tgz#fa71badd4437af4c148841e3b3b165f9e9e590b7" + + unzip-response@^2.0.1: + version "2.0.1" + resolved "https://registry.yarnpkg.com/unzip-response/-/unzip-response-2.0.1.tgz#d2f0f737d16b0615e72a6935ed04214572d56f97" + + update-notifier@^2.3.0: + version "2.3.0" + resolved "https://registry.yarnpkg.com/update-notifier/-/update-notifier-2.3.0.tgz#4e8827a6bb915140ab093559d7014e3ebb837451" + dependencies: + boxen "^1.2.1" + chalk "^2.0.1" + configstore "^3.0.0" + import-lazy "^2.1.0" + is-installed-globally "^0.1.0" + is-npm "^1.0.0" + latest-version "^3.0.0" + semver-diff "^2.0.0" + xdg-basedir "^3.0.0" + + urix@^0.1.0, urix@~0.1.0: + version "0.1.0" + resolved "https://registry.yarnpkg.com/urix/-/urix-0.1.0.tgz#da937f7a62e21fec1fd18d49b35c2935067a6c72" + + url-parse-lax@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/url-parse-lax/-/url-parse-lax-1.0.0.tgz#7af8f303645e9bd79a272e7a14ac68bc0609da73" + dependencies: + prepend-http "^1.0.1" + + url-to-options@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/url-to-options/-/url-to-options-1.0.1.tgz#1505a03a289a48cbd7a434efbaeec5055f5633a9" + + url@^0.11.0, url@~0.11.0: + version "0.11.0" + resolved "https://registry.yarnpkg.com/url/-/url-0.11.0.tgz#3838e97cfc60521eb73c525a8e55bfdd9e2e28f1" + dependencies: + punycode "1.3.2" + querystring "0.2.0" + + user-home@^1.1.1: + version "1.1.1" + resolved "https://registry.yarnpkg.com/user-home/-/user-home-1.1.1.tgz#2b5be23a32b63a7c9deb8d0f28d485724a3df190" + + utf8-byte-length@^1.0.1: + version "1.0.4" + resolved "https://registry.yarnpkg.com/utf8-byte-length/-/utf8-byte-length-1.0.4.tgz#f45f150c4c66eee968186505ab93fcbb8ad6bf61" + + util-deprecate@~1.0.1: + version "1.0.2" + resolved "https://registry.yarnpkg.com/util-deprecate/-/util-deprecate-1.0.2.tgz#450d4dc9fa70de732762fbd2d4a28981419a0ccf" + + util@0.10.3, util@^0.10.3: + version "0.10.3" + resolved "https://registry.yarnpkg.com/util/-/util-0.10.3.tgz#7afb1afe50805246489e3db7fe0ed379336ac0f9" + dependencies: + inherits "2.0.1" + + uuid@3.1.0: + version "3.1.0" + resolved "https://registry.yarnpkg.com/uuid/-/uuid-3.1.0.tgz#3dd3d3e790abc24d7b0d3a034ffababe28ebbc04" + + uuid@^3.0.0, uuid@^3.1.0: + version "3.2.1" + resolved "https://registry.yarnpkg.com/uuid/-/uuid-3.2.1.tgz#12c528bb9d58d0b9265d9a2f6f0fe8be17ff1f14" + + v8flags@^2.1.1: + version "2.1.1" + resolved "https://registry.yarnpkg.com/v8flags/-/v8flags-2.1.1.tgz#aab1a1fa30d45f88dd321148875ac02c0b55e5b4" + dependencies: + user-home "^1.1.1" + + validate-npm-package-license@^3.0.1: + version "3.0.1" + resolved "https://registry.yarnpkg.com/validate-npm-package-license/-/validate-npm-package-license-3.0.1.tgz#2804babe712ad3379459acfbe24746ab2c303fbc" + dependencies: + spdx-correct "~1.0.0" + spdx-expression-parse "~1.0.0" + + validator@~9.1.1: + version "9.1.2" + resolved "https://registry.yarnpkg.com/validator/-/validator-9.1.2.tgz#5711b6413f78bd9d56003130c81b47c39e86546c" + + vendors@^1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/vendors/-/vendors-1.0.1.tgz#37ad73c8ee417fb3d580e785312307d274847f22" + + verror@1.10.0: + version "1.10.0" + resolved "https://registry.yarnpkg.com/verror/-/verror-1.10.0.tgz#3a105ca17053af55d6e270c1f8288682e18da400" + dependencies: + assert-plus "^1.0.0" + core-util-is "1.0.2" + extsprintf "^1.2.0" + + vm-browserify@0.0.4: + version "0.0.4" + resolved "https://registry.yarnpkg.com/vm-browserify/-/vm-browserify-0.0.4.tgz#5d7ea45bbef9e4a6ff65f95438e0a87c357d5a73" + dependencies: + indexof "0.0.1" + + watchpack@^1.4.0: + version "1.4.0" + resolved "https://registry.yarnpkg.com/watchpack/-/watchpack-1.4.0.tgz#4a1472bcbb952bd0a9bb4036801f954dfb39faac" + dependencies: + async "^2.1.2" + chokidar "^1.7.0" + graceful-fs "^4.1.2" + + wcwidth@^1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/wcwidth/-/wcwidth-1.0.1.tgz#f0b0dcf915bc5ff1528afadb2c0e17b532da2fe8" + dependencies: + defaults "^1.0.3" + + wdio-dot-reporter@~0.0.8: + version "0.0.9" + resolved "https://registry.yarnpkg.com/wdio-dot-reporter/-/wdio-dot-reporter-0.0.9.tgz#929b2adafd49d6b0534fda068e87319b47e38fe5" + + webdriverio@^4.8.0: + version "4.10.2" + resolved "https://registry.yarnpkg.com/webdriverio/-/webdriverio-4.10.2.tgz#0d28622802c966015afe34b3ac566dc339f22e43" + dependencies: + archiver "~2.1.0" + babel-runtime "^6.26.0" + css-parse "~2.0.0" + css-value "~0.0.1" + deepmerge "~2.0.1" + ejs "~2.5.6" + gaze "~1.1.2" + glob "~7.1.1" + inquirer "~3.3.0" + json-stringify-safe "~5.0.1" + mkdirp "~0.5.1" + npm-install-package "~2.1.0" + optimist "~0.6.1" + q "~1.5.0" + request "~2.83.0" + rgb2hex "~0.1.0" + safe-buffer "~5.1.1" + supports-color "~5.0.0" + url "~0.11.0" + validator "~9.1.1" + wdio-dot-reporter "~0.0.8" + wgxpath "~1.0.0" + + webpack-sources@^1.0.1: + version "1.1.0" + resolved "https://registry.yarnpkg.com/webpack-sources/-/webpack-sources-1.1.0.tgz#a101ebae59d6507354d71d8013950a3a8b7a5a54" + dependencies: + source-list-map "^2.0.0" + source-map "~0.6.1" + + webpack@3.10.0: + version "3.10.0" + resolved "https://registry.yarnpkg.com/webpack/-/webpack-3.10.0.tgz#5291b875078cf2abf42bdd23afe3f8f96c17d725" + dependencies: + acorn "^5.0.0" + acorn-dynamic-import "^2.0.0" + ajv "^5.1.5" + ajv-keywords "^2.0.0" + async "^2.1.2" + enhanced-resolve "^3.4.0" + escope "^3.6.0" + interpret "^1.0.0" + json-loader "^0.5.4" + json5 "^0.5.1" + loader-runner "^2.3.0" + loader-utils "^1.1.0" + memory-fs "~0.4.1" + mkdirp "~0.5.0" + node-libs-browser "^2.0.0" + source-map "^0.5.3" + supports-color "^4.2.1" + tapable "^0.2.7" + uglifyjs-webpack-plugin "^0.4.6" + watchpack "^1.4.0" + webpack-sources "^1.0.1" + yargs "^8.0.2" + + well-known-symbols@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/well-known-symbols/-/well-known-symbols-1.0.0.tgz#73c78ae81a7726a8fa598e2880801c8b16225518" + + wgxpath@~1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/wgxpath/-/wgxpath-1.0.0.tgz#eef8a4b9d558cc495ad3a9a2b751597ecd9af690" + + whatwg-fetch@>=0.10.0: + version "2.0.3" + resolved "https://registry.yarnpkg.com/whatwg-fetch/-/whatwg-fetch-2.0.3.tgz#9c84ec2dcf68187ff00bc64e1274b442176e1c84" + + whet.extend@~0.9.9: + version "0.9.9" + resolved "https://registry.yarnpkg.com/whet.extend/-/whet.extend-0.9.9.tgz#f877d5bf648c97e5aa542fadc16d6a259b9c11a1" + + which-module@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/which-module/-/which-module-1.0.0.tgz#bba63ca861948994ff307736089e3b96026c2a4f" + + which-module@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/which-module/-/which-module-2.0.0.tgz#d9ef07dce77b9902b8a3a8fa4b31c3e3f7e6e87a" + + which@1, which@^1.2.9: + version "1.3.0" + resolved "https://registry.yarnpkg.com/which/-/which-1.3.0.tgz#ff04bdfc010ee547d780bec38e1ac1c2777d253a" + dependencies: + isexe "^2.0.0" + + wide-align@^1.1.0: + version "1.1.2" + resolved "https://registry.yarnpkg.com/wide-align/-/wide-align-1.1.2.tgz#571e0f1b0604636ebc0dfc21b0339bbe31341710" + dependencies: + string-width "^1.0.2" + + widest-line@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/widest-line/-/widest-line-2.0.0.tgz#0142a4e8a243f8882c0233aa0e0281aa76152273" + dependencies: + string-width "^2.1.1" + + window-size@0.1.0: + version "0.1.0" + resolved "https://registry.yarnpkg.com/window-size/-/window-size-0.1.0.tgz#5438cd2ea93b202efa3a19fe8887aee7c94f9c9d" + + wordwrap@0.0.2: + version "0.0.2" + resolved "https://registry.yarnpkg.com/wordwrap/-/wordwrap-0.0.2.tgz#b79669bb42ecb409f83d583cad52ca17eaa1643f" + + wordwrap@~0.0.2: + version "0.0.3" + resolved "https://registry.yarnpkg.com/wordwrap/-/wordwrap-0.0.3.tgz#a3d5da6cd5c0bc0008d37234bbaf1bed63059107" + + wordwrap@~1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/wordwrap/-/wordwrap-1.0.0.tgz#27584810891456a4171c8d0226441ade90cbcaeb" + + wrap-ansi@^2.0.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/wrap-ansi/-/wrap-ansi-2.1.0.tgz#d8fc3d284dd05794fe84973caecdd1cf824fdd85" + dependencies: + string-width "^1.0.1" + strip-ansi "^3.0.1" + + wrappy@1: + version "1.0.2" + resolved "https://registry.yarnpkg.com/wrappy/-/wrappy-1.0.2.tgz#b5243d8f3ec1aa35f1364605bc0d1036e30ab69f" + + write-file-atomic@^1.1.4: + version "1.3.4" + resolved "https://registry.yarnpkg.com/write-file-atomic/-/write-file-atomic-1.3.4.tgz#f807a4f0b1d9e913ae7a48112e6cc3af1991b45f" + dependencies: + graceful-fs "^4.1.11" + imurmurhash "^0.1.4" + slide "^1.1.5" + + write-file-atomic@^2.0.0: + version "2.3.0" + resolved "https://registry.yarnpkg.com/write-file-atomic/-/write-file-atomic-2.3.0.tgz#1ff61575c2e2a4e8e510d6fa4e243cce183999ab" + dependencies: + graceful-fs "^4.1.11" + imurmurhash "^0.1.4" + signal-exit "^3.0.2" + + write-json-file@^2.2.0: + version "2.3.0" + resolved "https://registry.yarnpkg.com/write-json-file/-/write-json-file-2.3.0.tgz#2b64c8a33004d54b8698c76d585a77ceb61da32f" + dependencies: + detect-indent "^5.0.0" + graceful-fs "^4.1.2" + make-dir "^1.0.0" + pify "^3.0.0" + sort-keys "^2.0.0" + write-file-atomic "^2.0.0" + + write-pkg@^3.1.0: + version "3.1.0" + resolved "https://registry.yarnpkg.com/write-pkg/-/write-pkg-3.1.0.tgz#030a9994cc9993d25b4e75a9f1a1923607291ce9" + dependencies: + sort-keys "^2.0.0" + write-json-file "^2.2.0" + + write@^0.2.1: + version "0.2.1" + resolved "https://registry.yarnpkg.com/write/-/write-0.2.1.tgz#5fc03828e264cea3fe91455476f7a3c566cb0757" + dependencies: + mkdirp "^0.5.1" + + xdg-basedir@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/xdg-basedir/-/xdg-basedir-3.0.0.tgz#496b2cc109eca8dbacfe2dc72b603c17c5870ad4" + + xmlbuilder@8.2.2: + version "8.2.2" + resolved "https://registry.yarnpkg.com/xmlbuilder/-/xmlbuilder-8.2.2.tgz#69248673410b4ba42e1a6136551d2922335aa773" + + xmldom@0.1.x: + version "0.1.27" + resolved "https://registry.yarnpkg.com/xmldom/-/xmldom-0.1.27.tgz#d501f97b3bdb403af8ef9ecc20573187aadac0e9" + + xtend@^4.0.0, xtend@~4.0.1: + version "4.0.1" + resolved "https://registry.yarnpkg.com/xtend/-/xtend-4.0.1.tgz#a5c6d532be656e23db820efb943a1f04998d63af" + + xtend@~2.1.1: + version "2.1.2" + resolved "https://registry.yarnpkg.com/xtend/-/xtend-2.1.2.tgz#6efecc2a4dad8e6962c4901b337ce7ba87b5d28b" + dependencies: + object-keys "~0.4.0" + + xterm@chabou/xterm.js#7cb4b8e: + version "3.2.0-hyper.2" + resolved "https://codeload.github.com/chabou/xterm.js/tar.gz/7cb4b8e0b1a76a5af947b7417e47917595afc6f9" + + y18n@^3.2.1: + version "3.2.1" + resolved "https://registry.yarnpkg.com/y18n/-/y18n-3.2.1.tgz#6d15fba884c08679c0d77e88e7759e811e07fa41" + + y18n@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/y18n/-/y18n-4.0.0.tgz#95ef94f85ecc81d007c264e190a120f0a3c8566b" + + yallist@^2.1.2: + version "2.1.2" + resolved "https://registry.yarnpkg.com/yallist/-/yallist-2.1.2.tgz#1c11f9218f076089a47dd512f93c6699a6a81d52" + + yargs-parser@^5.0.0: + version "5.0.0" + resolved "https://registry.yarnpkg.com/yargs-parser/-/yargs-parser-5.0.0.tgz#275ecf0d7ffe05c77e64e7c86e4cd94bf0e1228a" + dependencies: + camelcase "^3.0.0" + + yargs-parser@^7.0.0: + version "7.0.0" + resolved "https://registry.yarnpkg.com/yargs-parser/-/yargs-parser-7.0.0.tgz#8d0ac42f16ea55debd332caf4c4038b3e3f5dfd9" + dependencies: + camelcase "^4.1.0" + + yargs-parser@^9.0.2: + version "9.0.2" + resolved "https://registry.yarnpkg.com/yargs-parser/-/yargs-parser-9.0.2.tgz#9ccf6a43460fe4ed40a9bb68f48d43b8a68cc077" + dependencies: + camelcase "^4.1.0" + + yargs@^11.0.0: + version "11.0.0" + resolved "https://registry.yarnpkg.com/yargs/-/yargs-11.0.0.tgz#c052931006c5eee74610e5fc0354bedfd08a201b" + dependencies: + cliui "^4.0.0" + decamelize "^1.1.1" + find-up "^2.1.0" + get-caller-file "^1.0.1" + os-locale "^2.0.0" + require-directory "^2.1.1" + require-main-filename "^1.0.1" + set-blocking "^2.0.0" + string-width "^2.0.0" + which-module "^2.0.0" + y18n "^3.2.1" + yargs-parser "^9.0.2" + + yargs@^7.0.2: + version "7.1.0" + resolved "https://registry.yarnpkg.com/yargs/-/yargs-7.1.0.tgz#6ba318eb16961727f5d284f8ea003e8d6154d0c8" + dependencies: + camelcase "^3.0.0" + cliui "^3.2.0" + decamelize "^1.1.1" + get-caller-file "^1.0.1" + os-locale "^1.4.0" + read-pkg-up "^1.0.1" + require-directory "^2.1.1" + require-main-filename "^1.0.1" + set-blocking "^2.0.0" + string-width "^1.0.2" + which-module "^1.0.0" + y18n "^3.2.1" + yargs-parser "^5.0.0" + + yargs@^8.0.2: + version "8.0.2" + resolved "https://registry.yarnpkg.com/yargs/-/yargs-8.0.2.tgz#6299a9055b1cefc969ff7e79c1d918dceb22c360" + dependencies: + camelcase "^4.1.0" + cliui "^3.2.0" + decamelize "^1.1.1" + get-caller-file "^1.0.1" + os-locale "^2.0.0" + read-pkg-up "^2.0.0" + require-directory "^2.1.1" + require-main-filename "^1.0.1" + set-blocking "^2.0.0" + string-width "^2.0.0" + which-module "^2.0.0" + y18n "^3.2.1" + yargs-parser "^7.0.0" + + yargs@~3.10.0: + version "3.10.0" + resolved "https://registry.yarnpkg.com/yargs/-/yargs-3.10.0.tgz#f7ee7bd857dd7c1d2d38c0e74efbd681d1431fd1" + dependencies: + camelcase "^1.0.2" + cliui "^2.1.0" + decamelize "^1.0.0" + window-size "0.1.0" + + yauzl@2.4.1: + version "2.4.1" + resolved "https://registry.yarnpkg.com/yauzl/-/yauzl-2.4.1.tgz#9528f442dab1b2284e58b4379bb194e22e0c4005" + dependencies: + fd-slicer "~1.0.1" + + zip-stream@^1.2.0: + version "1.2.0" + resolved "https://registry.yarnpkg.com/zip-stream/-/zip-stream-1.2.0.tgz#a8bc45f4c1b49699c6b90198baacaacdbcd4ba04" + dependencies: + archiver-utils "^1.3.0" + compress-commons "^1.2.0" + lodash "^4.8.0" + readable-stream "^2.0.0" + +Trace: + Error: Command failed. + Exit code: 1 + Command: sh + Arguments: -c electron-builder install-app-deps && yarn run rebuild-node-pty && yarn --cwd node_modules/xterm + Directory: /Users/leo/projects/hyper + Output: + + at ProcessTermError.MessageError (/usr/local/Cellar/yarn/1.5.1_1/libexec/lib/cli.js:186:110) + at new ProcessTermError (/usr/local/Cellar/yarn/1.5.1_1/libexec/lib/cli.js:226:113) + at ChildProcess. (/usr/local/Cellar/yarn/1.5.1_1/libexec/lib/cli.js:30281:17) + at ChildProcess.emit (events.js:180:13) + at maybeClose (internal/child_process.js:936:16) + at Process.ChildProcess._handle.onexit (internal/child_process.js:220:5) diff --git a/yarn.lock b/yarn.lock index 0b123f811082..e7c759e0d6c9 100644 --- a/yarn.lock +++ b/yarn.lock @@ -2,25 +2,25 @@ # yarn lockfile v1 -"7zip-bin-linux@^1.1.0": - version "1.1.0" - resolved "https://registry.yarnpkg.com/7zip-bin-linux/-/7zip-bin-linux-1.1.0.tgz#2ca309fd6a2102e18bd81e3a5d91b39db9adab71" +"7zip-bin-linux@~1.3.1": + version "1.3.1" + resolved "https://registry.yarnpkg.com/7zip-bin-linux/-/7zip-bin-linux-1.3.1.tgz#4856db1ab1bf5b6ee8444f93f5a8ad71446d00d5" -"7zip-bin-mac@^1.0.1": +"7zip-bin-mac@~1.0.1": version "1.0.1" resolved "https://registry.yarnpkg.com/7zip-bin-mac/-/7zip-bin-mac-1.0.1.tgz#3e68778bbf0926adc68159427074505d47555c02" -"7zip-bin-win@^2.1.1": - version "2.1.1" - resolved "https://registry.yarnpkg.com/7zip-bin-win/-/7zip-bin-win-2.1.1.tgz#8acfc28bb34e53a9476b46ae85a97418e6035c20" +"7zip-bin-win@~2.2.0": + version "2.2.0" + resolved "https://registry.yarnpkg.com/7zip-bin-win/-/7zip-bin-win-2.2.0.tgz#0b81c43e911100f3ece2ebac4f414ca95a572d5b" -"7zip-bin@^2.2.3": - version "2.2.4" - resolved "https://registry.yarnpkg.com/7zip-bin/-/7zip-bin-2.2.4.tgz#5d0a7da759258b7fa59121fddcec7cb65938a85c" +"7zip-bin@~3.1.0": + version "3.1.0" + resolved "https://registry.yarnpkg.com/7zip-bin/-/7zip-bin-3.1.0.tgz#70814c6b6d44fef8b74be6fc64d3977a2eff59a5" optionalDependencies: - "7zip-bin-linux" "^1.1.0" - "7zip-bin-mac" "^1.0.1" - "7zip-bin-win" "^2.1.1" + "7zip-bin-linux" "~1.3.1" + "7zip-bin-mac" "~1.0.1" + "7zip-bin-win" "~2.2.0" "7zip@0.0.6": version "0.0.6" @@ -68,13 +68,22 @@ dependencies: arrify "^1.0.1" -"@types/node@^7.0.18": - version "7.0.43" - resolved "https://registry.yarnpkg.com/@types/node/-/node-7.0.43.tgz#a187e08495a075f200ca946079c914e1a5fe962c" +"@ladjs/time-require@^0.1.4": + version "0.1.4" + resolved "https://registry.yarnpkg.com/@ladjs/time-require/-/time-require-0.1.4.tgz#5c615d75fd647ddd5de9cf6922649558856b21a1" + dependencies: + chalk "^0.4.0" + date-time "^0.1.1" + pretty-ms "^0.2.1" + text-table "^0.2.0" + +"@types/node@^8.0.24": + version "8.9.4" + resolved "https://registry.yarnpkg.com/@types/node/-/node-8.9.4.tgz#dfd327582a06c114eb6e0441fa3d6fab35edad48" abbrev@1: - version "1.1.0" - resolved "https://registry.yarnpkg.com/abbrev/-/abbrev-1.1.0.tgz#d0554c2256636e2f56e7c2e5ad183f859428d81f" + version "1.1.1" + resolved "https://registry.yarnpkg.com/abbrev/-/abbrev-1.1.1.tgz#f8f2c887ad10bf67f634f005b6987fed3179aac8" acorn-dynamic-import@^2.0.0: version "2.0.2" @@ -96,33 +105,45 @@ acorn@^4.0.3: version "4.0.13" resolved "https://registry.yarnpkg.com/acorn/-/acorn-4.0.13.tgz#105495ae5361d697bd195c825192e1ad7f253787" -acorn@^5.0.0, acorn@^5.1.1: - version "5.1.2" - resolved "https://registry.yarnpkg.com/acorn/-/acorn-5.1.2.tgz#911cb53e036807cf0fa778dc5d370fbd864246d7" +acorn@^5.0.0: + version "5.4.1" + resolved "https://registry.yarnpkg.com/acorn/-/acorn-5.4.1.tgz#fdc58d9d17f4a4e98d102ded826a9b9759125102" -ajv-keywords@^1.0.0: - version "1.5.1" - resolved "https://registry.yarnpkg.com/ajv-keywords/-/ajv-keywords-1.5.1.tgz#314dd0a4b3368fad3dfcdc54ede6171b886daf3c" +acorn@^5.5.0: + version "5.5.3" + resolved "https://registry.yarnpkg.com/acorn/-/acorn-5.5.3.tgz#f473dd47e0277a08e28e9bec5aeeb04751f0b8c9" ajv-keywords@^2.0.0, ajv-keywords@^2.1.0: - version "2.1.0" - resolved "https://registry.yarnpkg.com/ajv-keywords/-/ajv-keywords-2.1.0.tgz#a296e17f7bfae7c1ce4f7e0de53d29cb32162df0" + version "2.1.1" + resolved "https://registry.yarnpkg.com/ajv-keywords/-/ajv-keywords-2.1.1.tgz#617997fc5f60576894c435f940d819e135b80762" + +ajv-keywords@^3.1.0: + version "3.1.0" + resolved "https://registry.yarnpkg.com/ajv-keywords/-/ajv-keywords-3.1.0.tgz#ac2b27939c543e95d2c06e7f7f5c27be4aa543be" -ajv@^4.7.0, ajv@^4.9.1: +ajv@^4.9.1: version "4.11.8" resolved "https://registry.yarnpkg.com/ajv/-/ajv-4.11.8.tgz#82ffb02b29e662ae53bdc20af15947706739c536" dependencies: co "^4.6.0" json-stable-stringify "^1.0.1" -ajv@^5.1.0, ajv@^5.1.5, ajv@^5.2.2: - version "5.2.3" - resolved "https://registry.yarnpkg.com/ajv/-/ajv-5.2.3.tgz#c06f598778c44c6b161abafe3466b81ad1814ed2" +ajv@^5.0.0, ajv@^5.1.0, ajv@^5.1.5, ajv@^5.2.0, ajv@^5.2.3: + version "5.5.2" + resolved "https://registry.yarnpkg.com/ajv/-/ajv-5.5.2.tgz#73b5eeca3fab653e3d3f9422b341ad42205dc965" dependencies: co "^4.6.0" fast-deep-equal "^1.0.0" + fast-json-stable-stringify "^2.0.0" + json-schema-traverse "^0.3.0" + +ajv@^6.1.1: + version "6.2.1" + resolved "https://registry.yarnpkg.com/ajv/-/ajv-6.2.1.tgz#28a6abc493a2abe0fb4c8507acaedb43fa550671" + dependencies: + fast-deep-equal "^1.0.0" + fast-json-stable-stringify "^2.0.0" json-schema-traverse "^0.3.0" - json-stable-stringify "^1.0.1" align-text@^0.1.1, align-text@^0.1.3: version "0.1.4" @@ -132,6 +153,10 @@ align-text@^0.1.1, align-text@^0.1.3: longest "^1.0.1" repeat-string "^1.5.2" +alphanum-sort@^1.0.1, alphanum-sort@^1.0.2: + version "1.0.2" + resolved "https://registry.yarnpkg.com/alphanum-sort/-/alphanum-sort-1.0.2.tgz#97a1119649b211ad33691d9f9f486a8ec9fbe0a3" + amdefine@>=0.0.4: version "1.0.1" resolved "https://registry.yarnpkg.com/amdefine/-/amdefine-1.0.1.tgz#4a5282ac164729e93619bcfd3ad151f817ce91f5" @@ -142,14 +167,6 @@ ansi-align@^2.0.0: dependencies: string-width "^2.0.0" -ansi-escapes@^1.1.0: - version "1.4.0" - resolved "https://registry.yarnpkg.com/ansi-escapes/-/ansi-escapes-1.4.0.tgz#d3a8a83b319aa67793662b13e761c7911422306e" - -ansi-escapes@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/ansi-escapes/-/ansi-escapes-2.0.0.tgz#5bae52be424878dd9783e8910e3fc2922e83c81b" - ansi-escapes@^3.0.0: version "3.0.0" resolved "https://registry.yarnpkg.com/ansi-escapes/-/ansi-escapes-3.0.0.tgz#ec3e8b4e9f8064fc02c3ac9b65f1c275bda8ef92" @@ -166,12 +183,18 @@ ansi-styles@^2.2.1: version "2.2.1" resolved "https://registry.yarnpkg.com/ansi-styles/-/ansi-styles-2.2.1.tgz#b432dd3358b634cf75e1e4664368240533c1ddbe" -ansi-styles@^3.1.0: +ansi-styles@^3.1.0, ansi-styles@^3.2.0: version "3.2.0" resolved "https://registry.yarnpkg.com/ansi-styles/-/ansi-styles-3.2.0.tgz#c159b8d5be0f9e5a6f346dab94f16ce022161b88" dependencies: color-convert "^1.9.0" +ansi-styles@^3.2.1: + version "3.2.1" + resolved "https://registry.yarnpkg.com/ansi-styles/-/ansi-styles-3.2.1.tgz#41fbb20243e50b12be0f04b8dedbf07520ce841d" + dependencies: + color-convert "^1.9.0" + ansi-styles@~1.0.0: version "1.0.0" resolved "https://registry.yarnpkg.com/ansi-styles/-/ansi-styles-1.0.0.tgz#cb102df1c56f5123eab8b67cd7b98027a0279178" @@ -183,14 +206,27 @@ anymatch@^1.3.0: micromatch "^2.1.5" normalize-path "^2.0.0" -aphrodite-simple@0.4.1: - version "0.4.1" - resolved "https://registry.yarnpkg.com/aphrodite-simple/-/aphrodite-simple-0.4.1.tgz#ceac064e5ecb2bca2b80a3bf84f172729bc926d8" - dependencies: - asap "^2.0.3" - inline-style-prefixer "^2.0.0" +app-builder-bin-linux@1.7.2: + version "1.7.2" + resolved "https://registry.yarnpkg.com/app-builder-bin-linux/-/app-builder-bin-linux-1.7.2.tgz#a764c8e52ecf1b5b068f32c820c6daf1ffed6a8f" + +app-builder-bin-mac@1.7.2: + version "1.7.2" + resolved "https://registry.yarnpkg.com/app-builder-bin-mac/-/app-builder-bin-mac-1.7.2.tgz#c4ee0d950666c97c12a45ac74ec6396be3357644" + +app-builder-bin-win@1.7.2: + version "1.7.2" + resolved "https://registry.yarnpkg.com/app-builder-bin-win/-/app-builder-bin-win-1.7.2.tgz#7acac890782f4118f09941b343ba06c56452a6f6" + +app-builder-bin@1.7.2: + version "1.7.2" + resolved "https://registry.yarnpkg.com/app-builder-bin/-/app-builder-bin-1.7.2.tgz#daf67060a6bad8f5f611a0d2876d9db897a83f06" + optionalDependencies: + app-builder-bin-linux "1.7.2" + app-builder-bin-mac "1.7.2" + app-builder-bin-win "1.7.2" -aproba@^1.0.3: +aproba@^1.0.3, aproba@^1.1.1: version "1.2.0" resolved "https://registry.yarnpkg.com/aproba/-/aproba-1.2.0.tgz#6802e6264efd18c790a1b0d517f0f2627bf2c94a" @@ -205,9 +241,9 @@ archiver-utils@^1.3.0: normalize-path "^2.0.0" readable-stream "^2.0.0" -archiver@^2.0.0: - version "2.0.3" - resolved "https://registry.yarnpkg.com/archiver/-/archiver-2.0.3.tgz#b4360bb584af1437991942716f21d7c523d1dbbd" +archiver@^2.1.1, archiver@~2.1.0: + version "2.1.1" + resolved "https://registry.yarnpkg.com/archiver/-/archiver-2.1.1.tgz#ff662b4a78201494a3ee544d3a33fe7496509ebc" dependencies: archiver-utils "^1.3.0" async "^2.0.0" @@ -216,23 +252,8 @@ archiver@^2.0.0: lodash "^4.8.0" readable-stream "^2.0.0" tar-stream "^1.5.0" - walkdir "^0.0.11" zip-stream "^1.2.0" -archiver@~1.3.0: - version "1.3.0" - resolved "https://registry.yarnpkg.com/archiver/-/archiver-1.3.0.tgz#4f2194d6d8f99df3f531e6881f14f15d55faaf22" - dependencies: - archiver-utils "^1.3.0" - async "^2.0.0" - buffer-crc32 "^0.2.1" - glob "^7.0.0" - lodash "^4.8.0" - readable-stream "^2.0.0" - tar-stream "^1.5.0" - walkdir "^0.0.11" - zip-stream "^1.1.0" - are-we-there-yet@~1.1.2: version "1.1.4" resolved "https://registry.yarnpkg.com/are-we-there-yet/-/are-we-there-yet-1.1.4.tgz#bb5dca382bb94f05e15194373d16fd3ba1ca110d" @@ -241,11 +262,21 @@ are-we-there-yet@~1.1.2: readable-stream "^2.0.6" argparse@^1.0.7: - version "1.0.9" - resolved "https://registry.yarnpkg.com/argparse/-/argparse-1.0.9.tgz#73d83bc263f86e97f8cc4f6bae1b0e90a7d22c86" + version "1.0.10" + resolved "https://registry.yarnpkg.com/argparse/-/argparse-1.0.10.tgz#bcd6791ea5ae09725e17e5ad988134cd40b3d911" dependencies: sprintf-js "~1.0.2" +args@3.0.8: + version "3.0.8" + resolved "https://registry.yarnpkg.com/args/-/args-3.0.8.tgz#2f425ab639c69d74ff728f3d7c6e93b97b91af7c" + dependencies: + camelcase "4.1.0" + chalk "2.1.0" + mri "1.1.0" + pkginfo "0.4.1" + string-similarity "1.2.0" + arr-diff@^2.0.0: version "2.0.0" resolved "https://registry.yarnpkg.com/arr-diff/-/arr-diff-2.0.0.tgz#8f3b827f955a8bd669697e4a4256ac3ceae356cf" @@ -293,20 +324,13 @@ arrify@^1.0.0, arrify@^1.0.1: version "1.0.1" resolved "https://registry.yarnpkg.com/arrify/-/arrify-1.0.1.tgz#898508da2226f380df904728456849c1501a4b0d" -asap@^2.0.3, asap@~2.0.3: +asap@~2.0.3: version "2.0.6" resolved "https://registry.yarnpkg.com/asap/-/asap-2.0.6.tgz#e50347611d7e690943208bbdafebcbc2fb866d46" -asar-integrity@0.1.2: - version "0.1.2" - resolved "https://registry.yarnpkg.com/asar-integrity/-/asar-integrity-0.1.2.tgz#461248c63c24b13d4a11a70c378f8f59dba2b4af" - dependencies: - bluebird-lst "^1.0.2" - fs-extra-p "^4.4.0" - asn1.js@^4.0.0: - version "4.9.1" - resolved "https://registry.yarnpkg.com/asn1.js/-/asn1.js-4.9.1.tgz#48ba240b45a9280e94748990ba597d216617fd40" + version "4.10.1" + resolved "https://registry.yarnpkg.com/asn1.js/-/asn1.js-4.10.1.tgz#b9c2bf5805f1e64aadeed6df3a2bfafb5a73f5a0" dependencies: bn.js "^4.0.0" inherits "^2.0.1" @@ -330,6 +354,10 @@ assert@^1.1.1: dependencies: util "0.10.3" +ast-types@0.10.1: + version "0.10.1" + resolved "https://registry.yarnpkg.com/ast-types/-/ast-types-0.10.1.tgz#f52fca9715579a14f841d67d7f8d25432ab6a3dd" + async-each@^1.0.0: version "1.0.1" resolved "https://registry.yarnpkg.com/async-each/-/async-each-1.0.1.tgz#19d386a1d9edc6e7c1c85d388aedbcc56d33602d" @@ -339,8 +367,8 @@ async-exit-hook@^2.0.1: resolved "https://registry.yarnpkg.com/async-exit-hook/-/async-exit-hook-2.0.1.tgz#8bd8b024b0ec9b1c01cccb9af9db29bd717dfaf3" async@^2.0.0, async@^2.1.2: - version "2.5.0" - resolved "https://registry.yarnpkg.com/async/-/async-2.5.0.tgz#843190fd6b7357a0b9e1c956edddd5ec8462b54d" + version "2.6.0" + resolved "https://registry.yarnpkg.com/async/-/async-2.6.0.tgz#61a29abb6fcc026fea77e56d1c6ec53a795951f4" dependencies: lodash "^4.14.0" @@ -353,8 +381,19 @@ atob@~1.1.0: resolved "https://registry.yarnpkg.com/atob/-/atob-1.1.3.tgz#95f13629b12c3a51a5d215abdce2aa9f32f80773" auto-bind@^1.1.0: - version "1.1.0" - resolved "https://registry.yarnpkg.com/auto-bind/-/auto-bind-1.1.0.tgz#93b864dc7ee01a326281775d5c75ca0a751e5961" + version "1.2.0" + resolved "https://registry.yarnpkg.com/auto-bind/-/auto-bind-1.2.0.tgz#8b7e318aad53d43ba8a8ecaf0066d85d5f798cd6" + +autoprefixer@^6.3.1: + version "6.7.7" + resolved "https://registry.yarnpkg.com/autoprefixer/-/autoprefixer-6.7.7.tgz#1dbd1c835658e35ce3f9984099db00585c782014" + dependencies: + browserslist "^1.7.6" + caniuse-db "^1.0.30000634" + normalize-range "^0.1.2" + num2fraction "^1.2.2" + postcss "^5.2.16" + postcss-value-parser "^3.2.3" ava-init@^0.2.0: version "0.2.1" @@ -366,15 +405,16 @@ ava-init@^0.2.0: read-pkg-up "^2.0.0" write-pkg "^3.1.0" -ava@0.22.0: - version "0.22.0" - resolved "https://registry.yarnpkg.com/ava/-/ava-0.22.0.tgz#4c28a1fdef7e749ba0c8131ac18a7ca489eef049" +ava@0.25.0: + version "0.25.0" + resolved "https://registry.yarnpkg.com/ava/-/ava-0.25.0.tgz#8ac87780514f96a6fd42e1306eaa0752ce3a407f" dependencies: "@ava/babel-preset-stage-4" "^1.1.0" "@ava/babel-preset-transform-test-files" "^3.0.0" "@ava/write-file-atomic" "^2.2.0" "@concordance/react" "^1.0.0" - ansi-escapes "^2.0.0" + "@ladjs/time-require" "^0.1.4" + ansi-escapes "^3.0.0" ansi-styles "^3.1.0" arr-flatten "^1.0.1" array-union "^1.0.1" @@ -383,6 +423,8 @@ ava@0.22.0: auto-bind "^1.1.0" ava-init "^0.2.0" babel-core "^6.17.0" + babel-generator "^6.26.0" + babel-plugin-syntax-object-rest-spread "^6.13.0" bluebird "^3.0.0" caching-transform "^1.0.0" chalk "^2.0.1" @@ -393,13 +435,13 @@ ava@0.22.0: cli-spinners "^1.0.0" cli-truncate "^1.0.0" co-with-promise "^4.6.0" - code-excerpt "^2.1.0" + code-excerpt "^2.1.1" common-path-prefix "^1.0.0" concordance "^3.0.0" - convert-source-map "^1.2.0" + convert-source-map "^1.5.1" core-assert "^0.2.0" currently-unhandled "^0.4.1" - debug "^2.2.0" + debug "^3.0.1" dot-prop "^4.1.0" empower-core "^0.6.1" equal-length "^1.0.0" @@ -416,9 +458,8 @@ ava@0.22.0: is-ci "^1.0.7" is-generator-fn "^1.0.0" is-obj "^1.0.0" - is-observable "^0.2.0" + is-observable "^1.0.0" is-promise "^2.1.0" - js-yaml "^3.8.2" last-line-stream "^1.0.0" lodash.clonedeepwith "^4.5.0" lodash.debounce "^4.0.3" @@ -436,20 +477,21 @@ ava@0.22.0: package-hash "^2.0.0" pkg-conf "^2.0.0" plur "^2.0.0" - pretty-ms "^2.0.0" + pretty-ms "^3.0.0" require-precompiled "^0.1.0" resolve-cwd "^2.0.0" safe-buffer "^5.1.1" + semver "^5.4.1" slash "^1.0.0" - source-map-support "^0.4.0" - stack-utils "^1.0.0" + source-map-support "^0.5.0" + stack-utils "^1.0.1" strip-ansi "^4.0.0" strip-bom-buf "^1.0.0" - supports-color "^4.0.0" - time-require "^0.1.2" + supertap "^1.0.0" + supports-color "^5.0.0" trim-off-newlines "^1.0.1" unique-temp-dir "^1.0.0" - update-notifier "^2.1.0" + update-notifier "^2.3.0" aws-sign2@~0.6.0: version "0.6.0" @@ -484,7 +526,7 @@ babel-cli@6.26.0: optionalDependencies: chokidar "^1.6.1" -babel-code-frame@^6.16.0, babel-code-frame@^6.26.0: +babel-code-frame@^6.22.0, babel-code-frame@^6.26.0: version "6.26.0" resolved "https://registry.yarnpkg.com/babel-code-frame/-/babel-code-frame-6.26.0.tgz#63fd43f7dc1e3bb7ce35947db8fe369a3f58c74b" dependencies: @@ -517,8 +559,8 @@ babel-core@6.26.0, babel-core@^6.17.0, babel-core@^6.26.0: source-map "^0.5.6" babel-generator@^6.1.0, babel-generator@^6.26.0: - version "6.26.0" - resolved "https://registry.yarnpkg.com/babel-generator/-/babel-generator-6.26.0.tgz#ac1ae20070b79f6e3ca1d3269613053774f20dc5" + version "6.26.1" + resolved "https://registry.yarnpkg.com/babel-generator/-/babel-generator-6.26.1.tgz#1844408d3b8f0d35a404ea7ac180f087a601bd90" dependencies: babel-messages "^6.23.0" babel-runtime "^6.26.0" @@ -526,7 +568,7 @@ babel-generator@^6.1.0, babel-generator@^6.26.0: detect-indent "^4.0.0" jsesc "^1.3.0" lodash "^4.17.4" - source-map "^0.5.6" + source-map "^0.5.7" trim-right "^1.0.1" babel-helper-builder-binary-assignment-operator-visitor@^6.24.1: @@ -660,8 +702,8 @@ babel-plugin-check-es2015-constants@^6.8.0: babel-runtime "^6.22.0" babel-plugin-espower@^2.3.2: - version "2.3.2" - resolved "https://registry.yarnpkg.com/babel-plugin-espower/-/babel-plugin-espower-2.3.2.tgz#5516b8fcdb26c9f0e1d8160749f6e4c65e71271e" + version "2.4.0" + resolved "https://registry.yarnpkg.com/babel-plugin-espower/-/babel-plugin-espower-2.4.0.tgz#9f92c080e9adfe73f69baed7ab3e24f649009373" dependencies: babel-generator "^6.1.0" babylon "^6.1.0" @@ -747,10 +789,14 @@ babel-plugin-syntax-flow@^6.18.0: version "6.18.0" resolved "https://registry.yarnpkg.com/babel-plugin-syntax-flow/-/babel-plugin-syntax-flow-6.18.0.tgz#4c3ab20a2af26aa20cd25995c398c4eb70310c8d" -babel-plugin-syntax-jsx@^6.3.13, babel-plugin-syntax-jsx@^6.8.0: +babel-plugin-syntax-jsx@6.18.0, babel-plugin-syntax-jsx@^6.3.13, babel-plugin-syntax-jsx@^6.8.0: version "6.18.0" resolved "https://registry.yarnpkg.com/babel-plugin-syntax-jsx/-/babel-plugin-syntax-jsx-6.18.0.tgz#0af32a9a6e13ca7a3fd5069e62d7b0f58d0d8946" +babel-plugin-syntax-object-rest-spread@^6.13.0: + version "6.13.0" + resolved "https://registry.yarnpkg.com/babel-plugin-syntax-object-rest-spread/-/babel-plugin-syntax-object-rest-spread-6.13.0.tgz#fd6536f2bce13836ffa3a5458c4903a597bb3bf5" + babel-plugin-syntax-trailing-function-commas@^6.20.0: version "6.22.0" resolved "https://registry.yarnpkg.com/babel-plugin-syntax-trailing-function-commas/-/babel-plugin-syntax-trailing-function-commas-6.22.0.tgz#ba0360937f8d06e40180a43fe0d5616fff532cf3" @@ -839,20 +885,20 @@ babel-plugin-transform-inline-consecutive-adds@^0.1.2: resolved "https://registry.yarnpkg.com/babel-plugin-transform-inline-consecutive-adds/-/babel-plugin-transform-inline-consecutive-adds-0.1.2.tgz#5442e9f1c19c78a7899f8a4dee6fd481f61001f5" babel-plugin-transform-member-expression-literals@^6.8.4: - version "6.8.5" - resolved "https://registry.yarnpkg.com/babel-plugin-transform-member-expression-literals/-/babel-plugin-transform-member-expression-literals-6.8.5.tgz#e06ae305cf48d819822e93a70d79269f04d89eec" + version "6.9.0" + resolved "https://registry.yarnpkg.com/babel-plugin-transform-member-expression-literals/-/babel-plugin-transform-member-expression-literals-6.9.0.tgz#ab07ad52a11ff7d2528c71388e8f901a4499c2b2" babel-plugin-transform-merge-sibling-variables@^6.8.5: - version "6.8.6" - resolved "https://registry.yarnpkg.com/babel-plugin-transform-merge-sibling-variables/-/babel-plugin-transform-merge-sibling-variables-6.8.6.tgz#6d21efa5ee4981f71657fae716f9594bb2622aef" + version "6.9.0" + resolved "https://registry.yarnpkg.com/babel-plugin-transform-merge-sibling-variables/-/babel-plugin-transform-merge-sibling-variables-6.9.0.tgz#140017e305f8eb4f60d2f2db61154fbd71a9fcdd" babel-plugin-transform-minify-booleans@^6.8.2: - version "6.8.3" - resolved "https://registry.yarnpkg.com/babel-plugin-transform-minify-booleans/-/babel-plugin-transform-minify-booleans-6.8.3.tgz#5906ed776d3718250519abf1bace44b0b613ddf9" + version "6.9.0" + resolved "https://registry.yarnpkg.com/babel-plugin-transform-minify-booleans/-/babel-plugin-transform-minify-booleans-6.9.0.tgz#e36ceaa49aadcae70ec98bd9dbccb660719a667a" babel-plugin-transform-property-literals@^6.8.4: - version "6.8.5" - resolved "https://registry.yarnpkg.com/babel-plugin-transform-property-literals/-/babel-plugin-transform-property-literals-6.8.5.tgz#67ed5930b34805443452c8b9690c7ebe1e206c40" + version "6.9.0" + resolved "https://registry.yarnpkg.com/babel-plugin-transform-property-literals/-/babel-plugin-transform-property-literals-6.9.0.tgz#4ddc12ada888927eacab4daff8a535ebc5de5a61" dependencies: esutils "^2.0.2" @@ -889,20 +935,20 @@ babel-plugin-transform-regexp-constructors@^0.1.1: resolved "https://registry.yarnpkg.com/babel-plugin-transform-regexp-constructors/-/babel-plugin-transform-regexp-constructors-0.1.1.tgz#312ab7487cc88a1c62ee25ea1b6087e89b87799c" babel-plugin-transform-remove-console@^6.8.4: - version "6.8.5" - resolved "https://registry.yarnpkg.com/babel-plugin-transform-remove-console/-/babel-plugin-transform-remove-console-6.8.5.tgz#fde9d2d3d725530b0fadd8d31078402410386810" + version "6.9.0" + resolved "https://registry.yarnpkg.com/babel-plugin-transform-remove-console/-/babel-plugin-transform-remove-console-6.9.0.tgz#a7b671aab050dd30ef7cf2142b61a7d10efb327f" babel-plugin-transform-remove-debugger@^6.8.4: - version "6.8.5" - resolved "https://registry.yarnpkg.com/babel-plugin-transform-remove-debugger/-/babel-plugin-transform-remove-debugger-6.8.5.tgz#809584d412bf918f071fdf41e1fdb15ea89cdcd5" + version "6.9.0" + resolved "https://registry.yarnpkg.com/babel-plugin-transform-remove-debugger/-/babel-plugin-transform-remove-debugger-6.9.0.tgz#b465e74b3fbe1970da561fb1331e30aefac3f1fe" babel-plugin-transform-remove-undefined@^0.1.2: version "0.1.2" resolved "https://registry.yarnpkg.com/babel-plugin-transform-remove-undefined/-/babel-plugin-transform-remove-undefined-0.1.2.tgz#e1ebf51110f6b1e0665f28382ef73f95e5023652" babel-plugin-transform-simplify-comparison-operators@^6.8.4: - version "6.8.5" - resolved "https://registry.yarnpkg.com/babel-plugin-transform-simplify-comparison-operators/-/babel-plugin-transform-simplify-comparison-operators-6.8.5.tgz#a838786baf40cc33a93b95ae09e05591227e43bf" + version "6.9.0" + resolved "https://registry.yarnpkg.com/babel-plugin-transform-simplify-comparison-operators/-/babel-plugin-transform-simplify-comparison-operators-6.9.0.tgz#586252fea023cb13f2400a09c0ab178dc0844f0a" babel-plugin-transform-strict-mode@^6.24.1: version "6.24.1" @@ -912,8 +958,8 @@ babel-plugin-transform-strict-mode@^6.24.1: babel-types "^6.24.1" babel-plugin-transform-undefined-to-void@^6.8.2: - version "6.8.3" - resolved "https://registry.yarnpkg.com/babel-plugin-transform-undefined-to-void/-/babel-plugin-transform-undefined-to-void-6.8.3.tgz#fc52707f6ee1ddc71bb91b0d314fbefdeef9beb4" + version "6.9.0" + resolved "https://registry.yarnpkg.com/babel-plugin-transform-undefined-to-void/-/babel-plugin-transform-undefined-to-void-6.9.0.tgz#eb5db0554caffe9ded0206468ec0c6c3b332b9d2" babel-polyfill@^6.26.0: version "6.26.0" @@ -987,13 +1033,6 @@ babel-runtime@^6.22.0, babel-runtime@^6.26.0: core-js "^2.4.0" regenerator-runtime "^0.11.0" -babel-runtime@~6.23.0: - version "6.23.0" - resolved "https://registry.yarnpkg.com/babel-runtime/-/babel-runtime-6.23.0.tgz#0a9489f144de70efb3ce4300accdb329e2fc543b" - dependencies: - core-js "^2.4.0" - regenerator-runtime "^0.10.0" - babel-template@^6.24.1, babel-template@^6.26.0: version "6.26.0" resolved "https://registry.yarnpkg.com/babel-template/-/babel-template-6.26.0.tgz#de03e2d16396b069f46dd9fff8521fb1a0e35e02" @@ -1018,7 +1057,7 @@ babel-traverse@^6.24.1, babel-traverse@^6.26.0: invariant "^2.2.2" lodash "^4.17.4" -babel-types@^6.24.1, babel-types@^6.26.0: +babel-types@6.26.0, babel-types@^6.24.1, babel-types@^6.26.0: version "6.26.0" resolved "https://registry.yarnpkg.com/babel-types/-/babel-types-6.26.0.tgz#a3b073f94ab49eb6fa55cd65227a334380632497" dependencies: @@ -1031,6 +1070,10 @@ babylon@^6.1.0, babylon@^6.18.0: version "6.18.0" resolved "https://registry.yarnpkg.com/babylon/-/babylon-6.18.0.tgz#af2f3b88fa6f5c1e4c634d1a0f8eac4f55b395e3" +balanced-match@^0.4.2: + version "0.4.2" + resolved "https://registry.yarnpkg.com/balanced-match/-/balanced-match-0.4.2.tgz#cb3f3e3c732dc0f01ee70b403f302e61d7709838" + balanced-match@^1.0.0: version "1.0.0" resolved "https://registry.yarnpkg.com/balanced-match/-/balanced-match-1.0.0.tgz#89b4d199ab2bee49de164ea02b89ce462d71b767" @@ -1040,8 +1083,8 @@ base64-js@1.2.0: resolved "https://registry.yarnpkg.com/base64-js/-/base64-js-1.2.0.tgz#a39992d723584811982be5e290bb6a53d86700f1" base64-js@^1.0.2: - version "1.2.1" - resolved "https://registry.yarnpkg.com/base64-js/-/base64-js-1.2.1.tgz#a91947da1f4a516ea38e5b4ec0ec3773675e0886" + version "1.2.3" + resolved "https://registry.yarnpkg.com/base64-js/-/base64-js-1.2.3.tgz#fb13668233d9614cf5fb4bce95a9ba4096cdf801" bcrypt-pbkdf@^1.0.0: version "1.0.1" @@ -1054,8 +1097,8 @@ big.js@^3.1.3: resolved "https://registry.yarnpkg.com/big.js/-/big.js-3.2.0.tgz#a5fc298b81b9e0dca2e458824784b65c52ba588e" binary-extensions@^1.0.0: - version "1.10.0" - resolved "https://registry.yarnpkg.com/binary-extensions/-/binary-extensions-1.10.0.tgz#9aeb9a6c5e88638aad171e167f5900abe24835d0" + version "1.11.0" + resolved "https://registry.yarnpkg.com/binary-extensions/-/binary-extensions-1.11.0.tgz#46aa1751fb6a2f93ee5e689bb1087d4b14c6c205" bl@^1.0.0: version "1.2.1" @@ -1069,19 +1112,15 @@ block-stream@*: dependencies: inherits "~2.0.0" -bluebird-lst@^1.0.2, bluebird-lst@^1.0.3: - version "1.0.3" - resolved "https://registry.yarnpkg.com/bluebird-lst/-/bluebird-lst-1.0.3.tgz#cc56c18660eff0a0b86e2c33d1659618f7005158" +bluebird-lst@^1.0.5: + version "1.0.5" + resolved "https://registry.yarnpkg.com/bluebird-lst/-/bluebird-lst-1.0.5.tgz#bebc83026b7e92a72871a3dc599e219cbfb002a9" dependencies: - bluebird "^3.5.0" - -bluebird@^2.10.2: - version "2.11.0" - resolved "https://registry.yarnpkg.com/bluebird/-/bluebird-2.11.0.tgz#534b9033c022c9579c56ba3b3e5a5caafbb650e1" + bluebird "^3.5.1" -bluebird@^3.0.0, bluebird@^3.5.0: - version "3.5.0" - resolved "https://registry.yarnpkg.com/bluebird/-/bluebird-3.5.0.tgz#791420d7f551eea2897453a8a77653f96606d67c" +bluebird@^3.0.0, bluebird@^3.5.0, bluebird@^3.5.1: + version "3.5.1" + resolved "https://registry.yarnpkg.com/bluebird/-/bluebird-3.5.1.tgz#d9551f9de98f1fcda1e683d17ee91a0602ee2eb9" bn.js@^4.0.0, bn.js@^4.1.0, bn.js@^4.1.1, bn.js@^4.4.0: version "4.11.8" @@ -1105,13 +1144,9 @@ boom@5.x.x: dependencies: hoek "4.x.x" -bowser@^1.0.0: - version "1.7.3" - resolved "https://registry.yarnpkg.com/bowser/-/bowser-1.7.3.tgz#504bdb43118ca8db9cbbadf28fd60f265af96e4f" - -boxen@^1.0.0: - version "1.2.1" - resolved "https://registry.yarnpkg.com/boxen/-/boxen-1.2.1.tgz#0f11e7fe344edb9397977fc13ede7f64d956481d" +boxen@^1.2.1: + version "1.3.0" + resolved "https://registry.yarnpkg.com/boxen/-/boxen-1.3.0.tgz#55c6c39a8ba58d9c61ad22cd877532deb665a20b" dependencies: ansi-align "^2.0.0" camelcase "^4.0.0" @@ -1119,11 +1154,11 @@ boxen@^1.0.0: cli-boxes "^1.0.0" string-width "^2.0.0" term-size "^1.2.0" - widest-line "^1.0.0" + widest-line "^2.0.0" brace-expansion@^1.1.7: - version "1.1.8" - resolved "https://registry.yarnpkg.com/brace-expansion/-/brace-expansion-1.1.8.tgz#c07b211c7c952ec1f8efd51a77ef0d1d3990a292" + version "1.1.11" + resolved "https://registry.yarnpkg.com/brace-expansion/-/brace-expansion-1.1.11.tgz#3c7fcbf529d87226f3d2f52b966ff5271eb441dd" dependencies: balanced-match "^1.0.0" concat-map "0.0.1" @@ -1141,8 +1176,8 @@ brorand@^1.0.1: resolved "https://registry.yarnpkg.com/brorand/-/brorand-1.1.0.tgz#12c25efe40a45e3c323eb8675a0a0ce57b22371f" browserify-aes@^1.0.0, browserify-aes@^1.0.4: - version "1.0.8" - resolved "https://registry.yarnpkg.com/browserify-aes/-/browserify-aes-1.0.8.tgz#c8fa3b1b7585bb7ba77c5560b60996ddec6d5309" + version "1.1.1" + resolved "https://registry.yarnpkg.com/browserify-aes/-/browserify-aes-1.1.1.tgz#38b7ab55edb806ff2dcda1a7f1620773a477c49f" dependencies: buffer-xor "^1.0.3" cipher-base "^1.0.0" @@ -1186,11 +1221,18 @@ browserify-sign@^4.0.0: inherits "^2.0.1" parse-asn1 "^5.0.0" -browserify-zlib@^0.1.4: - version "0.1.4" - resolved "https://registry.yarnpkg.com/browserify-zlib/-/browserify-zlib-0.1.4.tgz#bb35f8a519f600e0fa6b8485241c979d0141fb2d" +browserify-zlib@^0.2.0: + version "0.2.0" + resolved "https://registry.yarnpkg.com/browserify-zlib/-/browserify-zlib-0.2.0.tgz#2869459d9aa3be245fe8fe2ca1f46e2e7f54d73f" + dependencies: + pako "~1.0.5" + +browserslist@^1.3.6, browserslist@^1.5.2, browserslist@^1.7.6: + version "1.7.7" + resolved "https://registry.yarnpkg.com/browserslist/-/browserslist-1.7.7.tgz#0bd76704258be829b2398bb50e4b62d1a166b0b9" dependencies: - pako "~0.2.0" + caniuse-db "^1.0.30000639" + electron-to-chromium "^1.2.7" buf-compare@^1.0.0: version "1.0.1" @@ -1212,51 +1254,35 @@ buffer@^4.3.0: ieee754 "^1.1.4" isarray "^1.0.0" -builder-util@1.0.1: - version "1.0.1" - resolved "https://registry.yarnpkg.com/builder-util/-/builder-util-1.0.1.tgz#e47e82be0ab3ae5ebff4bb361b91b94e49e27a8b" - dependencies: - "7zip-bin" "^2.2.3" - bluebird-lst "^1.0.3" - chalk "^2.1.0" - debug "^3.0.1" - electron-builder-http "~19.23.0" - fcopy-pre-bundled "0.3.4" - fs-extra-p "^4.4.0" - ini "^1.3.4" - is-ci "^1.0.10" - js-yaml "^3.9.1" - lazy-val "^1.0.2" - node-emoji "^1.8.1" - semver "^5.4.1" - source-map-support "^0.4.16" - stat-mode "^0.2.2" - temp-file "^2.0.2" - tunnel-agent "^0.6.0" - -builder-util@^1.0.0, builder-util@^1.0.1: - version "1.0.2" - resolved "https://registry.yarnpkg.com/builder-util/-/builder-util-1.0.2.tgz#93a4aadd8adf67d663717629eb6cd4b0666bea32" - dependencies: - "7zip-bin" "^2.2.3" - bluebird-lst "^1.0.3" - chalk "^2.1.0" - debug "^3.0.1" - electron-builder-http "^19.27.4" - fcopy-pre-bundled "0.3.4" - fs-extra-p "^4.4.0" - ini "^1.3.4" - is-ci "^1.0.10" - js-yaml "^3.9.1" - lazy-val "^1.0.2" - node-emoji "^1.8.1" - semver "^5.4.1" - source-map-support "^0.4.16" +builder-util-runtime@4.0.5, builder-util-runtime@^4.0.5: + version "4.0.5" + resolved "https://registry.yarnpkg.com/builder-util-runtime/-/builder-util-runtime-4.0.5.tgz#5340cf9886b9283ea6e5b20dc09b5e3e461aef62" + dependencies: + bluebird-lst "^1.0.5" + debug "^3.1.0" + fs-extra-p "^4.5.0" + sax "^1.2.4" + +builder-util@5.6.5, builder-util@^5.6.5: + version "5.6.5" + resolved "https://registry.yarnpkg.com/builder-util/-/builder-util-5.6.5.tgz#f2d156541b8df9599456848e057566443dc04c82" + dependencies: + "7zip-bin" "~3.1.0" + app-builder-bin "1.7.2" + bluebird-lst "^1.0.5" + builder-util-runtime "^4.0.5" + chalk "^2.3.2" + debug "^3.1.0" + fs-extra-p "^4.5.2" + is-ci "^1.1.0" + js-yaml "^3.11.0" + lazy-val "^1.0.3" + semver "^5.5.0" + source-map-support "^0.5.3" stat-mode "^0.2.2" - temp-file "^2.0.3" - tunnel-agent "^0.6.0" + temp-file "^3.1.1" -builtin-modules@^1.0.0, builtin-modules@^1.1.1: +builtin-modules@^1.0.0: version "1.1.1" resolved "https://registry.yarnpkg.com/builtin-modules/-/builtin-modules-1.1.1.tgz#270f076c5a72c02f5b65a47df94c5fe3a278892f" @@ -1264,6 +1290,24 @@ builtin-status-codes@^3.0.0: version "3.0.0" resolved "https://registry.yarnpkg.com/builtin-status-codes/-/builtin-status-codes-3.0.0.tgz#85982878e21b98e1c66425e03d0174788f569ee8" +cacache@^10.0.1: + version "10.0.4" + resolved "https://registry.yarnpkg.com/cacache/-/cacache-10.0.4.tgz#6452367999eff9d4188aefd9a14e9d7c6a263460" + dependencies: + bluebird "^3.5.1" + chownr "^1.0.1" + glob "^7.1.2" + graceful-fs "^4.1.11" + lru-cache "^4.1.1" + mississippi "^2.0.0" + mkdirp "^0.5.1" + move-concurrently "^1.0.1" + promise-inflight "^1.0.1" + rimraf "^2.6.2" + ssri "^5.2.4" + unique-filename "^1.1.0" + y18n "^4.0.0" + caching-transform@^1.0.0: version "1.0.1" resolved "https://registry.yarnpkg.com/caching-transform/-/caching-transform-1.0.1.tgz#6dbdb2f20f8d8fbce79f3e94e9d1742dcdf5c0a1" @@ -1302,6 +1346,10 @@ camelcase-keys@^2.0.0: camelcase "^2.0.0" map-obj "^1.0.0" +camelcase@4.1.0, camelcase@^4.0.0, camelcase@^4.1.0: + version "4.1.0" + resolved "https://registry.yarnpkg.com/camelcase/-/camelcase-4.1.0.tgz#d545635be1e33c542649c69173e5de6acfae34dd" + camelcase@^1.0.2: version "1.2.1" resolved "https://registry.yarnpkg.com/camelcase/-/camelcase-1.2.1.tgz#9bb5304d2e0b56698b2c758b08a3eaa9daa58a39" @@ -1314,9 +1362,18 @@ camelcase@^3.0.0: version "3.0.0" resolved "https://registry.yarnpkg.com/camelcase/-/camelcase-3.0.0.tgz#32fc4b9fcdaf845fcdf7e73bb97cac2261f0ab0a" -camelcase@^4.0.0, camelcase@^4.1.0: - version "4.1.0" - resolved "https://registry.yarnpkg.com/camelcase/-/camelcase-4.1.0.tgz#d545635be1e33c542649c69173e5de6acfae34dd" +caniuse-api@^1.5.2: + version "1.6.1" + resolved "https://registry.yarnpkg.com/caniuse-api/-/caniuse-api-1.6.1.tgz#b534e7c734c4f81ec5fbe8aca2ad24354b962c6c" + dependencies: + browserslist "^1.3.6" + caniuse-db "^1.0.30000529" + lodash.memoize "^4.1.2" + lodash.uniq "^4.5.0" + +caniuse-db@^1.0.30000529, caniuse-db@^1.0.30000634, caniuse-db@^1.0.30000639: + version "1.0.30000810" + resolved "https://registry.yarnpkg.com/caniuse-db/-/caniuse-db-1.0.30000810.tgz#bd25830c41efab64339a2e381f49677343c84509" capture-stack-trace@^1.0.0: version "1.0.0" @@ -1333,6 +1390,22 @@ center-align@^0.1.1: align-text "^0.1.3" lazy-cache "^1.0.3" +chalk@2.1.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/chalk/-/chalk-2.1.0.tgz#ac5becf14fa21b99c6c92ca7a7d7cfd5b17e743e" + dependencies: + ansi-styles "^3.1.0" + escape-string-regexp "^1.0.5" + supports-color "^4.0.0" + +chalk@2.3.2, chalk@^2.3.2: + version "2.3.2" + resolved "https://registry.yarnpkg.com/chalk/-/chalk-2.3.2.tgz#250dc96b07491bfd601e648d66ddf5f60c7a5c65" + dependencies: + ansi-styles "^3.2.1" + escape-string-regexp "^1.0.5" + supports-color "^5.3.0" + chalk@^0.4.0: version "0.4.0" resolved "https://registry.yarnpkg.com/chalk/-/chalk-0.4.0.tgz#5199a3ddcd0c1efe23bc08c1b027b06176e0c64f" @@ -1351,13 +1424,17 @@ chalk@^1.0.0, chalk@^1.1.1, chalk@^1.1.3: strip-ansi "^3.0.0" supports-color "^2.0.0" -chalk@^2.0.0, chalk@^2.0.1, chalk@^2.1.0: - version "2.1.0" - resolved "https://registry.yarnpkg.com/chalk/-/chalk-2.1.0.tgz#ac5becf14fa21b99c6c92ca7a7d7cfd5b17e743e" +chalk@^2.0.0, chalk@^2.0.1, chalk@^2.1.0, chalk@^2.3.1: + version "2.3.1" + resolved "https://registry.yarnpkg.com/chalk/-/chalk-2.3.1.tgz#523fe2678aec7b04e8041909292fe8b17059b796" dependencies: - ansi-styles "^3.1.0" + ansi-styles "^3.2.0" escape-string-regexp "^1.0.5" - supports-color "^4.0.0" + supports-color "^5.2.0" + +chardet@^0.4.0: + version "0.4.2" + resolved "https://registry.yarnpkg.com/chardet/-/chardet-0.4.2.tgz#b5473b33dc97c424e5d98dc87d55d4d8a29c8bf2" chokidar@^1.4.2, chokidar@^1.6.1, chokidar@^1.7.0: version "1.7.0" @@ -1374,13 +1451,17 @@ chokidar@^1.4.2, chokidar@^1.6.1, chokidar@^1.7.0: optionalDependencies: fsevents "^1.0.0" +chownr@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/chownr/-/chownr-1.0.1.tgz#e2a75042a9551908bebd25b8523d5f9769d79181" + chromium-pickle-js@^0.2.0: version "0.2.0" resolved "https://registry.yarnpkg.com/chromium-pickle-js/-/chromium-pickle-js-0.2.0.tgz#04a106672c18b085ab774d983dfa3ea138f22205" ci-info@^1.0.0: - version "1.1.1" - resolved "https://registry.yarnpkg.com/ci-info/-/ci-info-1.1.1.tgz#47b44df118c48d2597b56d342e7e25791060171a" + version "1.1.2" + resolved "https://registry.yarnpkg.com/ci-info/-/ci-info-1.1.2.tgz#03561259db48d0474c8bdc90f5b47b068b6bbfb4" cipher-base@^1.0.0, cipher-base@^1.0.1, cipher-base@^1.0.3: version "1.0.4" @@ -1393,6 +1474,12 @@ circular-json@^0.3.1: version "0.3.3" resolved "https://registry.yarnpkg.com/circular-json/-/circular-json-0.3.3.tgz#815c99ea84f6809529d2f45791bdf82711352d66" +clap@^1.0.9: + version "1.2.3" + resolved "https://registry.yarnpkg.com/clap/-/clap-1.2.3.tgz#4f36745b32008492557f46412d66d50cb99bce51" + dependencies: + chalk "^1.1.3" + clean-stack@^1.1.1: version "1.3.0" resolved "https://registry.yarnpkg.com/clean-stack/-/clean-stack-1.3.0.tgz#9e821501ae979986c46b1d66d2d432db2fd4ae31" @@ -1405,21 +1492,15 @@ cli-boxes@^1.0.0: version "1.0.0" resolved "https://registry.yarnpkg.com/cli-boxes/-/cli-boxes-1.0.0.tgz#4fa917c3e59c94a004cd61f8ee509da651687143" -cli-cursor@^1.0.1: - version "1.0.2" - resolved "https://registry.yarnpkg.com/cli-cursor/-/cli-cursor-1.0.2.tgz#64da3f7d56a54412e59794bd62dc35295e8f2987" - dependencies: - restore-cursor "^1.0.1" - cli-cursor@^2.1.0: version "2.1.0" resolved "https://registry.yarnpkg.com/cli-cursor/-/cli-cursor-2.1.0.tgz#b35dac376479facc3e94747d41d0d0f5238ffcb5" dependencies: restore-cursor "^2.0.0" -cli-spinners@^1.0.0: - version "1.0.1" - resolved "https://registry.yarnpkg.com/cli-spinners/-/cli-spinners-1.0.1.tgz#2675321c100f195b02877ac499e9911fa34b9783" +cli-spinners@^1.0.0, cli-spinners@^1.0.1: + version "1.1.0" + resolved "https://registry.yarnpkg.com/cli-spinners/-/cli-spinners-1.1.0.tgz#f1847b168844d917a671eb9d147e3df497c90d06" cli-truncate@^1.0.0: version "1.1.0" @@ -1448,6 +1529,18 @@ cliui@^3.2.0: strip-ansi "^3.0.1" wrap-ansi "^2.0.0" +cliui@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/cliui/-/cliui-4.0.0.tgz#743d4650e05f36d1ed2575b59638d87322bfbbcc" + dependencies: + string-width "^2.1.1" + strip-ansi "^4.0.0" + wrap-ansi "^2.0.0" + +clone@^1.0.2: + version "1.0.3" + resolved "https://registry.yarnpkg.com/clone/-/clone-1.0.3.tgz#298d7e2231660f40c003c2ed3140decf3f53085f" + co-with-promise@^4.6.0: version "4.6.0" resolved "https://registry.yarnpkg.com/co-with-promise/-/co-with-promise-4.6.0.tgz#413e7db6f5893a60b942cf492c4bec93db415ab7" @@ -1458,9 +1551,15 @@ co@^4.6.0: version "4.6.0" resolved "https://registry.yarnpkg.com/co/-/co-4.6.0.tgz#6ea6bdf3d853ae54ccb8e47bfa0bf3f9031fb184" -code-excerpt@^2.1.0: - version "2.1.0" - resolved "https://registry.yarnpkg.com/code-excerpt/-/code-excerpt-2.1.0.tgz#5dcc081e88f4a7e3b554e9e35d7ef232d47f8147" +coa@~1.0.1: + version "1.0.4" + resolved "https://registry.yarnpkg.com/coa/-/coa-1.0.4.tgz#a9ef153660d6a86a8bdec0289a5c684d217432fd" + dependencies: + q "^1.1.2" + +code-excerpt@^2.1.1: + version "2.1.1" + resolved "https://registry.yarnpkg.com/code-excerpt/-/code-excerpt-2.1.1.tgz#5fe3057bfbb71a5f300f659ef2cc0a47651ba77c" dependencies: convert-to-spaces "^1.0.1" @@ -1468,9 +1567,9 @@ code-point-at@^1.0.0: version "1.1.0" resolved "https://registry.yarnpkg.com/code-point-at/-/code-point-at-1.1.0.tgz#0d070b4d043a5bea33a2f1a40e2edb3d9a4ccf77" -color-convert@^1.8.2, color-convert@^1.9.0: - version "1.9.0" - resolved "https://registry.yarnpkg.com/color-convert/-/color-convert-1.9.0.tgz#1accf97dd739b983bf994d56fec8f95853641b7a" +color-convert@^1.3.0, color-convert@^1.9.0, color-convert@^1.9.1: + version "1.9.1" + resolved "https://registry.yarnpkg.com/color-convert/-/color-convert-1.9.1.tgz#c1261107aeb2f294ebffec9ed9ecad529a6097ed" dependencies: color-name "^1.1.1" @@ -1482,33 +1581,62 @@ color-name@^1.0.0, color-name@^1.1.1: version "1.1.3" resolved "https://registry.yarnpkg.com/color-name/-/color-name-1.1.3.tgz#a7d0558bd89c42f795dd42328f740831ca53bc25" -color-string@^1.4.0: +color-string@^0.3.0: + version "0.3.0" + resolved "https://registry.yarnpkg.com/color-string/-/color-string-0.3.0.tgz#27d46fb67025c5c2fa25993bfbf579e47841b991" + dependencies: + color-name "^1.0.0" + +color-string@^1.5.2: version "1.5.2" resolved "https://registry.yarnpkg.com/color-string/-/color-string-1.5.2.tgz#26e45814bc3c9a7cbd6751648a41434514a773a9" dependencies: color-name "^1.0.0" simple-swizzle "^0.2.2" -color@2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/color/-/color-2.0.0.tgz#e0c9972d1e969857004b101eaa55ceab5961d67d" +color@2.0.1: + version "2.0.1" + resolved "https://registry.yarnpkg.com/color/-/color-2.0.1.tgz#e4ed78a3c4603d0891eba5430b04b86314f4c839" + dependencies: + color-convert "^1.9.1" + color-string "^1.5.2" + +color@^0.11.0: + version "0.11.4" + resolved "https://registry.yarnpkg.com/color/-/color-0.11.4.tgz#6d7b5c74fb65e841cd48792ad1ed5e07b904d764" + dependencies: + clone "^1.0.2" + color-convert "^1.3.0" + color-string "^0.3.0" + +colormin@^1.0.5: + version "1.1.2" + resolved "https://registry.yarnpkg.com/colormin/-/colormin-1.1.2.tgz#ea2f7420a72b96881a38aae59ec124a6f7298133" dependencies: - color-convert "^1.8.2" - color-string "^1.4.0" + color "^0.11.0" + css-color-names "0.0.4" + has "^1.0.1" -colors@^1.1.2: +colors@^1.1.2, colors@~1.1.2: version "1.1.2" resolved "https://registry.yarnpkg.com/colors/-/colors-1.1.2.tgz#168a4701756b6a7f51a12ce0c97bfa28c084ed63" -combined-stream@^1.0.5, combined-stream@~1.0.5: - version "1.0.5" - resolved "https://registry.yarnpkg.com/combined-stream/-/combined-stream-1.0.5.tgz#938370a57b4a51dea2c77c15d5c5fdf895164009" +columnify@1.5.4: + version "1.5.4" + resolved "https://registry.yarnpkg.com/columnify/-/columnify-1.5.4.tgz#4737ddf1c7b69a8a7c340570782e947eec8e78bb" + dependencies: + strip-ansi "^3.0.0" + wcwidth "^1.0.0" + +combined-stream@1.0.6, combined-stream@^1.0.5, combined-stream@~1.0.5: + version "1.0.6" + resolved "https://registry.yarnpkg.com/combined-stream/-/combined-stream-1.0.6.tgz#723e7df6e801ac5613113a7e445a9b69cb632818" dependencies: delayed-stream "~1.0.0" commander@^2.11.0: - version "2.11.0" - resolved "https://registry.yarnpkg.com/commander/-/commander-2.11.0.tgz#157152fd1e7a6c8d98a5b715cf376df928004563" + version "2.14.1" + resolved "https://registry.yarnpkg.com/commander/-/commander-2.14.1.tgz#2235123e37af8ca3c65df45b026dbd357b01b9aa" common-path-prefix@^1.0.0: version "1.0.0" @@ -1523,8 +1651,8 @@ compare-version@^0.1.2: resolved "https://registry.yarnpkg.com/compare-version/-/compare-version-0.1.2.tgz#0162ec2d9351f5ddd59a9202cba935366a725080" compress-commons@^1.2.0: - version "1.2.0" - resolved "https://registry.yarnpkg.com/compress-commons/-/compress-commons-1.2.0.tgz#58587092ef20d37cb58baf000112c9278ff73b9f" + version "1.2.2" + resolved "https://registry.yarnpkg.com/compress-commons/-/compress-commons-1.2.2.tgz#524a9f10903f3a813389b0225d27c48bb751890f" dependencies: buffer-crc32 "^0.2.1" crc32-stream "^2.0.0" @@ -1535,7 +1663,7 @@ concat-map@0.0.1: version "0.0.1" resolved "https://registry.yarnpkg.com/concat-map/-/concat-map-0.0.1.tgz#d8a96bd77fd68df7793a73036a3ba0d5405d477b" -concat-stream@1.6.0, concat-stream@^1.5.2: +concat-stream@1.6.0, concat-stream@^1.5.0, concat-stream@^1.6.0: version "1.6.0" resolved "https://registry.yarnpkg.com/concat-stream/-/concat-stream-1.6.0.tgz#0aac662fd52be78964d5532f694784e70110acf7" dependencies: @@ -1584,30 +1712,39 @@ constants-browserify@^1.0.0: version "1.0.0" resolved "https://registry.yarnpkg.com/constants-browserify/-/constants-browserify-1.0.0.tgz#c20b96d8c617748aaf1c16021760cd27fcb8cb75" -contains-path@^0.1.0: - version "0.1.0" - resolved "https://registry.yarnpkg.com/contains-path/-/contains-path-0.1.0.tgz#fe8cf184ff6670b6baef01a9d4861a5cbec4120a" - -convert-source-map@^1.2.0, convert-source-map@^1.5.0: - version "1.5.0" - resolved "https://registry.yarnpkg.com/convert-source-map/-/convert-source-map-1.5.0.tgz#9acd70851c6d5dfdd93d9282e5edf94a03ff46b5" +convert-source-map@1.5.1, convert-source-map@^1.5.0, convert-source-map@^1.5.1: + version "1.5.1" + resolved "https://registry.yarnpkg.com/convert-source-map/-/convert-source-map-1.5.1.tgz#b8278097b9bc229365de5c62cf5fcaed8b5599e5" convert-to-spaces@^1.0.1: version "1.0.2" resolved "https://registry.yarnpkg.com/convert-to-spaces/-/convert-to-spaces-1.0.2.tgz#7e3e48bbe6d997b1417ddca2868204b4d3d85715" -copy-webpack-plugin@4.0.1: - version "4.0.1" - resolved "https://registry.yarnpkg.com/copy-webpack-plugin/-/copy-webpack-plugin-4.0.1.tgz#9728e383b94316050d0c7463958f2b85c0aa8200" +copy-concurrently@^1.0.0: + version "1.0.5" + resolved "https://registry.yarnpkg.com/copy-concurrently/-/copy-concurrently-1.0.5.tgz#92297398cae34937fcafd6ec8139c18051f0b5e0" + dependencies: + aproba "^1.1.1" + fs-write-stream-atomic "^1.0.8" + iferr "^0.1.5" + mkdirp "^0.5.1" + rimraf "^2.5.4" + run-queue "^1.0.0" + +copy-webpack-plugin@4.3.1: + version "4.3.1" + resolved "https://registry.yarnpkg.com/copy-webpack-plugin/-/copy-webpack-plugin-4.3.1.tgz#19ba6370bf6f8e263cbd66185a2b79f2321a9302" dependencies: - bluebird "^2.10.2" - fs-extra "^0.26.4" - glob "^6.0.4" - is-glob "^3.1.0" + cacache "^10.0.1" + find-cache-dir "^1.0.0" + globby "^7.1.1" + is-glob "^4.0.0" loader-utils "^0.2.15" lodash "^4.3.0" - minimatch "^3.0.0" - node-dir "^0.1.10" + minimatch "^3.0.4" + p-limit "^1.0.0" + pify "^3.0.0" + serialize-javascript "^1.4.0" core-assert@^0.2.0: version "0.2.1" @@ -1621,8 +1758,8 @@ core-js@^1.0.0: resolved "https://registry.yarnpkg.com/core-js/-/core-js-1.2.7.tgz#652294c14651db28fa93bd2d5ff2983a4f08c636" core-js@^2.0.0, core-js@^2.4.0, core-js@^2.5.0: - version "2.5.1" - resolved "https://registry.yarnpkg.com/core-js/-/core-js-2.5.1.tgz#ae6874dc66937789b80754ff5428df66819ca50b" + version "2.5.3" + resolved "https://registry.yarnpkg.com/core-js/-/core-js-2.5.3.tgz#8acc38345824f16d8365b7c9b4259168e8ed603e" core-util-is@1.0.2, core-util-is@~1.0.0: version "1.0.2" @@ -1672,28 +1809,13 @@ create-hmac@^1.1.0, create-hmac@^1.1.2, create-hmac@^1.1.4: safe-buffer "^5.0.1" sha.js "^2.4.8" -create-react-class@^15.6.0: - version "15.6.2" - resolved "https://registry.yarnpkg.com/create-react-class/-/create-react-class-15.6.2.tgz#cf1ed15f12aad7f14ef5f2dfe05e6c42f91ef02a" - dependencies: - fbjs "^0.8.9" - loose-envify "^1.3.1" - object-assign "^4.1.1" - -cross-env@5.0.5: - version "5.0.5" - resolved "https://registry.yarnpkg.com/cross-env/-/cross-env-5.0.5.tgz#4383d364d9660873dd185b398af3bfef5efffef3" +cross-env@5.1.4: + version "5.1.4" + resolved "https://registry.yarnpkg.com/cross-env/-/cross-env-5.1.4.tgz#f61c14291f7cc653bb86457002ea80a04699d022" dependencies: cross-spawn "^5.1.0" is-windows "^1.0.0" -cross-spawn@^4.0.0: - version "4.0.2" - resolved "https://registry.yarnpkg.com/cross-spawn/-/cross-spawn-4.0.2.tgz#7b9247621c23adfdd3856004a823cbe397424d41" - dependencies: - lru-cache "^4.0.1" - which "^1.2.9" - cross-spawn@^5.0.1, cross-spawn@^5.1.0: version "5.1.0" resolved "https://registry.yarnpkg.com/cross-spawn/-/cross-spawn-5.1.0.tgz#e8bd0efee58fcff6f8f94510a0a554bbfa235449" @@ -1719,8 +1841,8 @@ cryptiles@3.x.x: boom "5.x.x" crypto-browserify@^3.11.0: - version "3.11.1" - resolved "https://registry.yarnpkg.com/crypto-browserify/-/crypto-browserify-3.11.1.tgz#948945efc6757a400d6e5e5af47194d10064279f" + version "3.12.0" + resolved "https://registry.yarnpkg.com/crypto-browserify/-/crypto-browserify-3.12.0.tgz#396cf9f3137f03e4b8e532c58f698254e00f80ec" dependencies: browserify-cipher "^1.0.0" browserify-sign "^4.0.0" @@ -1732,17 +1854,49 @@ crypto-browserify@^3.11.0: pbkdf2 "^3.0.3" public-encrypt "^4.0.0" randombytes "^2.0.0" + randomfill "^1.0.3" crypto-random-string@^1.0.0: version "1.0.0" resolved "https://registry.yarnpkg.com/crypto-random-string/-/crypto-random-string-1.0.0.tgz#a230f64f568310e1498009940790ec99545bca7e" +css-color-names@0.0.4: + version "0.0.4" + resolved "https://registry.yarnpkg.com/css-color-names/-/css-color-names-0.0.4.tgz#808adc2e79cf84738069b646cb20ec27beb629e0" + +css-loader@0.28.11: + version "0.28.11" + resolved "https://registry.yarnpkg.com/css-loader/-/css-loader-0.28.11.tgz#c3f9864a700be2711bb5a2462b2389b1a392dab7" + dependencies: + babel-code-frame "^6.26.0" + css-selector-tokenizer "^0.7.0" + cssnano "^3.10.0" + icss-utils "^2.1.0" + loader-utils "^1.0.2" + lodash.camelcase "^4.3.0" + object-assign "^4.1.1" + postcss "^5.0.6" + postcss-modules-extract-imports "^1.2.0" + postcss-modules-local-by-default "^1.2.0" + postcss-modules-scope "^1.1.0" + postcss-modules-values "^1.3.0" + postcss-value-parser "^3.3.0" + source-list-map "^2.0.0" + css-parse@~2.0.0: version "2.0.0" resolved "https://registry.yarnpkg.com/css-parse/-/css-parse-2.0.0.tgz#a468ee667c16d81ccf05c58c38d2a97c780dbfd4" dependencies: css "^2.0.0" +css-selector-tokenizer@^0.7.0: + version "0.7.0" + resolved "https://registry.yarnpkg.com/css-selector-tokenizer/-/css-selector-tokenizer-0.7.0.tgz#e6988474ae8c953477bf5e7efecfceccd9cf4c86" + dependencies: + cssesc "^0.1.0" + fastparse "^1.1.1" + regexpu-core "^1.0.0" + css-value@~0.0.1: version "0.0.1" resolved "https://registry.yarnpkg.com/css-value/-/css-value-0.0.1.tgz#5efd6c2eea5ea1fd6b6ac57ec0427b18452424ea" @@ -1756,9 +1910,53 @@ css@^2.0.0: source-map-resolve "^0.3.0" urix "^0.1.0" -cuint@^0.2.2: - version "0.2.2" - resolved "https://registry.yarnpkg.com/cuint/-/cuint-0.2.2.tgz#408086d409550c2631155619e9fa7bcadc3b991b" +cssesc@^0.1.0: + version "0.1.0" + resolved "https://registry.yarnpkg.com/cssesc/-/cssesc-0.1.0.tgz#c814903e45623371a0477b40109aaafbeeaddbb4" + +cssnano@^3.10.0: + version "3.10.0" + resolved "https://registry.yarnpkg.com/cssnano/-/cssnano-3.10.0.tgz#4f38f6cea2b9b17fa01490f23f1dc68ea65c1c38" + dependencies: + autoprefixer "^6.3.1" + decamelize "^1.1.2" + defined "^1.0.0" + has "^1.0.1" + object-assign "^4.0.1" + postcss "^5.0.14" + postcss-calc "^5.2.0" + postcss-colormin "^2.1.8" + postcss-convert-values "^2.3.4" + postcss-discard-comments "^2.0.4" + postcss-discard-duplicates "^2.0.1" + postcss-discard-empty "^2.0.1" + postcss-discard-overridden "^0.1.1" + postcss-discard-unused "^2.2.1" + postcss-filter-plugins "^2.0.0" + postcss-merge-idents "^2.1.5" + postcss-merge-longhand "^2.0.1" + postcss-merge-rules "^2.0.3" + postcss-minify-font-values "^1.0.2" + postcss-minify-gradients "^1.0.1" + postcss-minify-params "^1.0.4" + postcss-minify-selectors "^2.0.4" + postcss-normalize-charset "^1.1.0" + postcss-normalize-url "^3.0.7" + postcss-ordered-values "^2.1.0" + postcss-reduce-idents "^2.2.2" + postcss-reduce-initial "^1.0.0" + postcss-reduce-transforms "^1.0.3" + postcss-svgo "^2.1.1" + postcss-unique-selectors "^2.0.2" + postcss-value-parser "^3.2.3" + postcss-zindex "^2.0.1" + +csso@~2.3.1: + version "2.3.2" + resolved "https://registry.yarnpkg.com/csso/-/csso-2.3.2.tgz#ddd52c587033f49e94b71fc55569f252e8ff5f85" + dependencies: + clap "^1.0.9" + source-map "^0.5.3" currently-unhandled@^0.4.1: version "0.4.1" @@ -1766,6 +1964,10 @@ currently-unhandled@^0.4.1: dependencies: array-find-index "^1.0.1" +cyclist@~0.2.2: + version "0.2.2" + resolved "https://registry.yarnpkg.com/cyclist/-/cyclist-0.2.2.tgz#1b33792e11e914a2fd6d6ed6447464444e5fa640" + d@1: version "1.0.0" resolved "https://registry.yarnpkg.com/d/-/d-1.0.0.tgz#754bb5bfe55451da69a58b94d45f4c5b0462d58f" @@ -1792,21 +1994,15 @@ date-time@^2.1.0: dependencies: time-zone "^1.0.0" -debug@2.2.0: - version "2.2.0" - resolved "https://registry.yarnpkg.com/debug/-/debug-2.2.0.tgz#f87057e995b1a1f6ae6a4960664137bc56f039da" - dependencies: - ms "0.7.1" - -debug@^2.1.1, debug@^2.1.3, debug@^2.2.0, debug@^2.5.1, debug@^2.6.3, debug@^2.6.8: +debug@2.6.9, debug@^2.1.3, debug@^2.2.0, debug@^2.5.1, debug@^2.6.3, debug@^2.6.8: version "2.6.9" resolved "https://registry.yarnpkg.com/debug/-/debug-2.6.9.tgz#5d128515df134ff327e90a4c93f4e077a536341f" dependencies: ms "2.0.0" -debug@^3.0.0, debug@^3.0.1: - version "3.0.1" - resolved "https://registry.yarnpkg.com/debug/-/debug-3.0.1.tgz#0564c612b521dc92d9f2988f0549e34f9c98db64" +debug@^3.0.0, debug@^3.0.1, debug@^3.1.0: + version "3.1.0" + resolved "https://registry.yarnpkg.com/debug/-/debug-3.1.0.tgz#5bb5a0672628b64149566ba16819e61518c67261" dependencies: ms "2.0.0" @@ -1814,15 +2010,11 @@ decamelize@^1.0.0, decamelize@^1.1.1, decamelize@^1.1.2: version "1.2.0" resolved "https://registry.yarnpkg.com/decamelize/-/decamelize-1.2.0.tgz#f6534d15148269b20352e7bee26f501f9a191290" -deep-assign@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/deep-assign/-/deep-assign-1.0.0.tgz#b092743be8427dc621ea0067cdec7e70dd19f37b" +decompress-response@^3.2.0: + version "3.3.0" + resolved "https://registry.yarnpkg.com/decompress-response/-/decompress-response-3.3.0.tgz#80a4dd323748384bfa248083622aedec982adff3" dependencies: - is-obj "^1.0.0" - -deep-diff@^0.3.5: - version "0.3.8" - resolved "https://registry.yarnpkg.com/deep-diff/-/deep-diff-0.3.8.tgz#c01de63efb0eec9798801d40c7e0dae25b582c84" + mimic-response "^1.0.0" deep-equal@^1.0.0: version "1.0.1" @@ -1836,15 +2028,15 @@ deep-is@~0.1.3: version "0.1.3" resolved "https://registry.yarnpkg.com/deep-is/-/deep-is-0.1.3.tgz#b369d6fb5dbc13eecf524f91b070feedc357cf34" -deep-strict-equal@^0.2.0: - version "0.2.0" - resolved "https://registry.yarnpkg.com/deep-strict-equal/-/deep-strict-equal-0.2.0.tgz#4a078147a8ab57f6a0d4f5547243cd22f44eb4e4" - dependencies: - core-assert "^0.2.0" +deepmerge@~2.0.1: + version "2.0.1" + resolved "https://registry.yarnpkg.com/deepmerge/-/deepmerge-2.0.1.tgz#25c1c24f110fb914f80001b925264dd77f3f4312" -deepmerge@~1.3.2: - version "1.3.2" - resolved "https://registry.yarnpkg.com/deepmerge/-/deepmerge-1.3.2.tgz#1663691629d4dbfe364fa12a2a4f0aa86aa3a050" +defaults@^1.0.3: + version "1.0.3" + resolved "https://registry.yarnpkg.com/defaults/-/defaults-1.0.3.tgz#c656051e9817d9ff08ed881477f3fe4019f3ef7d" + dependencies: + clone "^1.0.2" define-properties@^1.1.2: version "1.1.2" @@ -1853,6 +2045,10 @@ define-properties@^1.1.2: foreach "^2.0.5" object-keys "^1.0.8" +defined@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/defined/-/defined-1.0.0.tgz#c98d9bcef75674188e110969151199e39b1fa693" + del@^2.0.2: version "2.2.2" resolved "https://registry.yarnpkg.com/del/-/del-2.2.2.tgz#c12c981d067846c84bcaf862cff930d907ffd1a8" @@ -1890,6 +2086,10 @@ detect-indent@^5.0.0: version "5.0.0" resolved "https://registry.yarnpkg.com/detect-indent/-/detect-indent-5.0.0.tgz#3871cc0a6a002e8c3e5b3cf7f336264675f06b9d" +detect-libc@^1.0.2, detect-libc@^1.0.3: + version "1.0.3" + resolved "https://registry.yarnpkg.com/detect-libc/-/detect-libc-1.0.3.tgz#fa137c4bd698edf55cd5cd02ac559f91a4c4ba9b" + dev-null@^0.1.1: version "0.1.1" resolved "https://registry.yarnpkg.com/dev-null/-/dev-null-0.1.1.tgz#5a205ce3c2b2ef77b6238d6ba179eb74c6a0e818" @@ -1902,32 +2102,35 @@ diffie-hellman@^5.0.0: miller-rabin "^4.0.0" randombytes "^2.0.0" -dmg-builder@1.0.2: - version "1.0.2" - resolved "https://registry.yarnpkg.com/dmg-builder/-/dmg-builder-1.0.2.tgz#00ba33567ecfa1271f5ea87c78bbb4c3541f707d" +dir-glob@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/dir-glob/-/dir-glob-2.0.0.tgz#0b205d2b6aef98238ca286598a8204d29d0a0034" dependencies: - bluebird-lst "^1.0.3" - builder-util "^1.0.1" - fs-extra-p "^4.4.0" - parse-color "^1.0.0" + arrify "^1.0.1" + path-type "^3.0.0" -doctrine@1.5.0: - version "1.5.0" - resolved "https://registry.yarnpkg.com/doctrine/-/doctrine-1.5.0.tgz#379dce730f6166f76cefa4e6707a159b02c5a6fa" - dependencies: - esutils "^2.0.2" - isarray "^1.0.0" +dmg-builder@4.1.2: + version "4.1.2" + resolved "https://registry.yarnpkg.com/dmg-builder/-/dmg-builder-4.1.2.tgz#b4d7245dc2e91812395b4268b12f888443ba5f30" + dependencies: + bluebird-lst "^1.0.5" + builder-util "^5.6.5" + electron-builder-lib "~20.5.0" + fs-extra-p "^4.5.2" + iconv-lite "^0.4.19" + js-yaml "^3.11.0" + parse-color "^1.0.0" + sanitize-filename "^1.6.1" doctrine@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/doctrine/-/doctrine-2.0.0.tgz#c73d8d2909d22291e1a007a395804da8b665fe63" + version "2.1.0" + resolved "https://registry.yarnpkg.com/doctrine/-/doctrine-2.1.0.tgz#5cd01fc101621b42c4cd7f5d1a66243716d3f39d" dependencies: esutils "^2.0.2" - isarray "^1.0.0" domain-browser@^1.1.1: - version "1.1.7" - resolved "https://registry.yarnpkg.com/domain-browser/-/domain-browser-1.1.7.tgz#867aa4b093faa05f1de08c06f4d7b21fdf8698bc" + version "1.2.0" + resolved "https://registry.yarnpkg.com/domain-browser/-/domain-browser-1.2.0.tgz#3d31f50191a6749dd1375a7f522e823d42e54eda" dot-prop@^4.1.0: version "4.2.0" @@ -1936,17 +2139,26 @@ dot-prop@^4.1.0: is-obj "^1.0.0" dotenv-expand@^4.0.1: - version "4.0.1" - resolved "https://registry.yarnpkg.com/dotenv-expand/-/dotenv-expand-4.0.1.tgz#68fddc1561814e0a10964111057ff138ced7d7a8" + version "4.2.0" + resolved "https://registry.yarnpkg.com/dotenv-expand/-/dotenv-expand-4.2.0.tgz#def1f1ca5d6059d24a766e587942c21106ce1275" -dotenv@^4.0.0: - version "4.0.0" - resolved "https://registry.yarnpkg.com/dotenv/-/dotenv-4.0.0.tgz#864ef1379aced55ce6f95debecdce179f7a0cd1d" +dotenv@^5.0.0: + version "5.0.1" + resolved "https://registry.yarnpkg.com/dotenv/-/dotenv-5.0.1.tgz#a5317459bd3d79ab88cff6e44057a6a3fbb1fcef" duplexer3@^0.1.4: version "0.1.4" resolved "https://registry.yarnpkg.com/duplexer3/-/duplexer3-0.1.4.tgz#ee01dd1cac0ed3cbc7fdbea37dc0a8f1ce002ce2" +duplexify@^3.4.2, duplexify@^3.5.3: + version "3.5.3" + resolved "https://registry.yarnpkg.com/duplexify/-/duplexify-3.5.3.tgz#8b5818800df92fd0125b27ab896491912858243e" + dependencies: + end-of-stream "^1.0.0" + inherits "^2.0.1" + readable-stream "^2.0.0" + stream-shift "^1.0.0" + ecc-jsbn@~0.1.1: version "0.1.1" resolved "https://registry.yarnpkg.com/ecc-jsbn/-/ecc-jsbn-0.1.1.tgz#0fc73a9ed5f0d53c38193398523ef7e543777505" @@ -1957,79 +2169,76 @@ ejs@^2.5.7, ejs@~2.5.6: version "2.5.7" resolved "https://registry.yarnpkg.com/ejs/-/ejs-2.5.7.tgz#cc872c168880ae3c7189762fd5ffc00896c9518a" -electron-builder-http@19.23.0, electron-builder-http@~19.23.0: - version "19.23.0" - resolved "https://registry.yarnpkg.com/electron-builder-http/-/electron-builder-http-19.23.0.tgz#a7ec01bd1ca97b9e3a00d4799faa9ff1d52a4893" +electron-builder-lib@20.5.1, electron-builder-lib@~20.5.0: + version "20.5.1" + resolved "https://registry.yarnpkg.com/electron-builder-lib/-/electron-builder-lib-20.5.1.tgz#c155345c58d25580d316f6437c251a57e8e92d62" dependencies: - bluebird-lst "^1.0.3" - debug "^3.0.0" - fs-extra-p "^4.4.0" - -electron-builder-http@^19.27.4: - version "19.27.5" - resolved "https://registry.yarnpkg.com/electron-builder-http/-/electron-builder-http-19.27.5.tgz#800865df2e618ffab9e5b3b895c15b4ce7fd7f17" - dependencies: - bluebird-lst "^1.0.3" - debug "^3.0.1" - fs-extra-p "^4.4.0" - -electron-builder-squirrel-windows@19.25.0: - version "19.25.0" - resolved "https://registry.yarnpkg.com/electron-builder-squirrel-windows/-/electron-builder-squirrel-windows-19.25.0.tgz#758e0187435e62a03e630ea77cdfcbcef26159f2" - dependencies: - archiver "^2.0.0" - bluebird-lst "^1.0.3" - builder-util "^1.0.0" - fs-extra-p "^4.4.0" - sanitize-filename "^1.6.1" - -electron-builder@19.27.2: - version "19.27.2" - resolved "https://registry.yarnpkg.com/electron-builder/-/electron-builder-19.27.2.tgz#d3b5c490bb17b477a5fa6db6d186c81f3b6cab5d" - dependencies: - "7zip-bin" "^2.2.3" - asar-integrity "0.1.2" - bluebird-lst "^1.0.3" - builder-util "1.0.1" - chalk "^2.1.0" + "7zip-bin" "~3.1.0" + app-builder-bin "1.7.2" + async-exit-hook "^2.0.1" + bluebird-lst "^1.0.5" + builder-util "5.6.5" + builder-util-runtime "4.0.5" chromium-pickle-js "^0.2.0" - cuint "^0.2.2" - debug "^3.0.1" - dmg-builder "1.0.2" - dotenv "^4.0.0" - dotenv-expand "^4.0.1" + debug "^3.1.0" ejs "^2.5.7" - electron-builder-http "19.23.0" - electron-download-tf "4.3.4" - electron-osx-sign "0.4.7" - electron-publish "19.25.0" - fs-extra-p "^4.4.0" - hosted-git-info "^2.5.0" - is-ci "^1.0.10" + electron-osx-sign "0.4.10" + electron-publish "20.5.0" + fs-extra-p "^4.5.2" + hosted-git-info "^2.6.0" + is-ci "^1.1.0" isbinaryfile "^3.0.2" - js-yaml "^3.9.1" - lazy-val "^1.0.2" + js-yaml "^3.11.0" + lazy-val "^1.0.3" minimatch "^3.0.4" normalize-package-data "^2.4.0" plist "^2.1.0" - read-config-file "1.1.0" + read-config-file "3.0.0" sanitize-filename "^1.6.1" - semver "^5.4.1" - temp-file "^2.0.3" - update-notifier "^2.2.0" - uuid-1345 "^0.99.6" - yargs "^8.0.2" + semver "^5.5.0" + temp-file "^3.1.1" + +electron-builder-squirrel-windows@20.5.0: + version "20.5.0" + resolved "https://registry.yarnpkg.com/electron-builder-squirrel-windows/-/electron-builder-squirrel-windows-20.5.0.tgz#652d0849887b76f4502955a45b214fb93d311634" + dependencies: + archiver "^2.1.1" + bluebird-lst "^1.0.5" + builder-util "^5.6.5" + fs-extra-p "^4.5.2" + sanitize-filename "^1.6.1" + optionalDependencies: + "7zip-bin" "~3.1.0" + +electron-builder@20.5.1: + version "20.5.1" + resolved "https://registry.yarnpkg.com/electron-builder/-/electron-builder-20.5.1.tgz#8e6fba76dcd65aeabab60f15bd46f294ee04dd11" + dependencies: + bluebird-lst "^1.0.5" + builder-util "5.6.5" + builder-util-runtime "4.0.5" + chalk "^2.3.2" + dmg-builder "4.1.2" + electron-builder-lib "20.5.1" + electron-download-tf "4.3.4" + fs-extra-p "^4.5.2" + is-ci "^1.1.0" + lazy-val "^1.0.3" + read-config-file "3.0.0" + sanitize-filename "^1.6.1" + update-notifier "^2.3.0" + yargs "^11.0.0" -electron-chromedriver@~1.7.1: - version "1.7.1" - resolved "https://registry.yarnpkg.com/electron-chromedriver/-/electron-chromedriver-1.7.1.tgz#008c97976007aa4eb18491ee095e94d17ee47610" +electron-chromedriver@~1.8.0: + version "1.8.0" + resolved "https://registry.yarnpkg.com/electron-chromedriver/-/electron-chromedriver-1.8.0.tgz#901714133cf6f6093d365e1f44a52d99624d8241" dependencies: electron-download "^4.1.0" extract-zip "^1.6.5" -electron-devtools-installer@2.2.0: - version "2.2.0" - resolved "https://registry.yarnpkg.com/electron-devtools-installer/-/electron-devtools-installer-2.2.0.tgz#9813e6811afcd69ddca3cae5416db72ea7ecfb6a" +electron-devtools-installer@2.2.3: + version "2.2.3" + resolved "https://registry.yarnpkg.com/electron-devtools-installer/-/electron-devtools-installer-2.2.3.tgz#58b9a4ec507377bc46e091cd43714188e0c369be" dependencies: "7zip" "0.0.6" cross-unzip "0.0.2" @@ -2078,9 +2287,9 @@ electron-download@^4.1.0: semver "^5.3.0" sumchecker "^2.0.1" -electron-osx-sign@0.4.7: - version "0.4.7" - resolved "https://registry.yarnpkg.com/electron-osx-sign/-/electron-osx-sign-0.4.7.tgz#1d75647a82748eacd48bea70616ec83ffade3ee5" +electron-osx-sign@0.4.10: + version "0.4.10" + resolved "https://registry.yarnpkg.com/electron-osx-sign/-/electron-osx-sign-0.4.10.tgz#be4f3b89b2a75a1dc5f1e7249081ab2929ca3a26" dependencies: bluebird "^3.5.0" compare-version "^0.1.2" @@ -2089,23 +2298,25 @@ electron-osx-sign@0.4.7: minimist "^1.2.0" plist "^2.1.0" -electron-publish@19.25.0: - version "19.25.0" - resolved "https://registry.yarnpkg.com/electron-publish/-/electron-publish-19.25.0.tgz#e8954fd64093ea9d8f287a0c34292d67de8f302e" +electron-publish@20.5.0: + version "20.5.0" + resolved "https://registry.yarnpkg.com/electron-publish/-/electron-publish-20.5.0.tgz#bcef9949c63899d34680e89110e8d38d1016f1f6" dependencies: - bluebird-lst "^1.0.3" - builder-util "^1.0.0" - chalk "^2.1.0" - electron-builder-http "~19.23.0" - fs-extra-p "^4.4.0" - mime "^1.3.6" + bluebird-lst "^1.0.5" + builder-util "^5.6.5" + builder-util-runtime "^4.0.5" + chalk "^2.3.2" + fs-extra-p "^4.5.2" + lazy-val "^1.0.3" + mime "^2.2.0" -electron-rebuild@1.6.0: - version "1.6.0" - resolved "https://registry.yarnpkg.com/electron-rebuild/-/electron-rebuild-1.6.0.tgz#e8d26f4d8e9fe5388df35864b3658e5cfd4dcb7e" +electron-rebuild@1.7.3: + version "1.7.3" + resolved "https://registry.yarnpkg.com/electron-rebuild/-/electron-rebuild-1.7.3.tgz#24ae06ad9dd61cb7e4d688961f49118c40a110eb" dependencies: colors "^1.1.2" debug "^2.6.3" + detect-libc "^1.0.3" fs-extra "^3.0.1" node-abi "^2.0.0" node-gyp "^3.6.0" @@ -2114,11 +2325,15 @@ electron-rebuild@1.6.0: spawn-rx "^2.0.10" yargs "^7.0.2" -electron@1.7.9: - version "1.7.9" - resolved "https://registry.yarnpkg.com/electron/-/electron-1.7.9.tgz#add54e9f8f83ed02f6519ec10135f698b19336cf" +electron-to-chromium@^1.2.7: + version "1.3.33" + resolved "https://registry.yarnpkg.com/electron-to-chromium/-/electron-to-chromium-1.3.33.tgz#bf00703d62a7c65238136578c352d6c5c042a545" + +electron@1.8.4: + version "1.8.4" + resolved "https://registry.yarnpkg.com/electron/-/electron-1.8.4.tgz#cca8d0e6889f238f55b414ad224f03e03b226a38" dependencies: - "@types/node" "^7.0.18" + "@types/node" "^8.0.24" electron-download "^3.0.1" extract-zip "^1.0.3" @@ -2151,18 +2366,12 @@ encoding@^0.1.11: dependencies: iconv-lite "~0.4.13" -end-of-stream@^1.0.0: - version "1.4.0" - resolved "https://registry.yarnpkg.com/end-of-stream/-/end-of-stream-1.4.0.tgz#7a90d833efda6cfa6eac0f4949dbb0fad3a63206" +end-of-stream@^1.0.0, end-of-stream@^1.1.0: + version "1.4.1" + resolved "https://registry.yarnpkg.com/end-of-stream/-/end-of-stream-1.4.1.tgz#ed29634d19baba463b6ce6b80a37213eab71ec43" dependencies: once "^1.4.0" -enhance-visitors@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/enhance-visitors/-/enhance-visitors-1.0.0.tgz#aa945d05da465672a1ebd38fee2ed3da8518e95a" - dependencies: - lodash "^4.13.1" - enhanced-resolve@^3.4.0: version "3.4.1" resolved "https://registry.yarnpkg.com/enhanced-resolve/-/enhanced-resolve-3.4.1.tgz#0421e339fd71419b3da13d129b3979040230476e" @@ -2181,20 +2390,20 @@ equal-length@^1.0.0: resolved "https://registry.yarnpkg.com/equal-length/-/equal-length-1.0.1.tgz#21ca112d48ab24b4e1e7ffc0e5339d31fdfc274c" errno@^0.1.3: - version "0.1.4" - resolved "https://registry.yarnpkg.com/errno/-/errno-0.1.4.tgz#b896e23a9e5e8ba33871fc996abd3635fc9a1c7d" + version "0.1.7" + resolved "https://registry.yarnpkg.com/errno/-/errno-0.1.7.tgz#4684d71779ad39af177e3f007996f7c67c852618" dependencies: - prr "~0.0.0" + prr "~1.0.1" -error-ex@^1.2.0: +error-ex@^1.2.0, error-ex@^1.3.1: version "1.3.1" resolved "https://registry.yarnpkg.com/error-ex/-/error-ex-1.3.1.tgz#f855a86ce61adc4e8621c3cda21e7a7612c3a8dc" dependencies: is-arrayish "^0.2.1" es-abstract@^1.7.0: - version "1.8.2" - resolved "https://registry.yarnpkg.com/es-abstract/-/es-abstract-1.8.2.tgz#25103263dc4decbda60e0c737ca32313518027ee" + version "1.10.0" + resolved "https://registry.yarnpkg.com/es-abstract/-/es-abstract-1.10.0.tgz#1ecb36c197842a00d8ee4c2dfd8646bb97d60864" dependencies: es-to-primitive "^1.1.1" function-bind "^1.1.1" @@ -2210,24 +2419,24 @@ es-to-primitive@^1.1.1: is-date-object "^1.0.1" is-symbol "^1.0.1" -es5-ext@^0.10.14, es5-ext@^0.10.9, es5-ext@~0.10.14: - version "0.10.30" - resolved "https://registry.yarnpkg.com/es5-ext/-/es5-ext-0.10.30.tgz#7141a16836697dbabfaaaeee41495ce29f52c939" +es5-ext@^0.10.14, es5-ext@^0.10.35, es5-ext@^0.10.9, es5-ext@~0.10.14: + version "0.10.39" + resolved "https://registry.yarnpkg.com/es5-ext/-/es5-ext-0.10.39.tgz#fca21b67559277ca4ac1a1ed7048b107b6f76d87" dependencies: - es6-iterator "2" - es6-symbol "~3.1" + es6-iterator "~2.0.3" + es6-symbol "~3.1.1" es6-error@^4.0.1, es6-error@^4.0.2: - version "4.0.2" - resolved "https://registry.yarnpkg.com/es6-error/-/es6-error-4.0.2.tgz#eec5c726eacef51b7f6b73c20db6e1b13b069c98" + version "4.1.1" + resolved "https://registry.yarnpkg.com/es6-error/-/es6-error-4.1.1.tgz#9e3af407459deed47e9a91f9b885a84eb05c561d" -es6-iterator@2, es6-iterator@^2.0.1, es6-iterator@~2.0.1: - version "2.0.1" - resolved "https://registry.yarnpkg.com/es6-iterator/-/es6-iterator-2.0.1.tgz#8e319c9f0453bf575d374940a655920e59ca5512" +es6-iterator@^2.0.1, es6-iterator@~2.0.1, es6-iterator@~2.0.3: + version "2.0.3" + resolved "https://registry.yarnpkg.com/es6-iterator/-/es6-iterator-2.0.3.tgz#a7de889141a05a94b0854403b2d0a0fbfa98f3b7" dependencies: d "1" - es5-ext "^0.10.14" - es6-symbol "^3.1" + es5-ext "^0.10.35" + es6-symbol "^3.1.1" es6-map@^0.1.3: version "0.1.5" @@ -2241,8 +2450,8 @@ es6-map@^0.1.3: event-emitter "~0.3.5" es6-promise@^4.0.5: - version "4.1.1" - resolved "https://registry.yarnpkg.com/es6-promise/-/es6-promise-4.1.1.tgz#8811e90915d9a0dba36274f0b242dbda78f9c92a" + version "4.2.4" + resolved "https://registry.yarnpkg.com/es6-promise/-/es6-promise-4.2.4.tgz#dc4221c2b16518760bd8c39a52d8f356fc00ed29" es6-set@~0.1.5: version "0.1.5" @@ -2254,7 +2463,7 @@ es6-set@~0.1.5: es6-symbol "3.1.1" event-emitter "~0.3.5" -es6-symbol@3.1.1, es6-symbol@^3.1, es6-symbol@^3.1.1, es6-symbol@~3.1, es6-symbol@~3.1.1: +es6-symbol@3.1.1, es6-symbol@^3.1.1, es6-symbol@~3.1.1: version "3.1.1" resolved "https://registry.yarnpkg.com/es6-symbol/-/es6-symbol-3.1.1.tgz#bf00ef4fdab6ba1b46ecb7b629b4c7ed5715cc77" dependencies: @@ -2283,78 +2492,18 @@ escope@^3.6.0: esrecurse "^4.1.0" estraverse "^4.1.1" -eslint-config-xo-react@0.13.0: - version "0.13.0" - resolved "https://registry.yarnpkg.com/eslint-config-xo-react/-/eslint-config-xo-react-0.13.0.tgz#63518dbd8a87f0700f0861fbb6ac0fb5efdf6039" - -eslint-config-xo@^0.18.0: - version "0.18.2" - resolved "https://registry.yarnpkg.com/eslint-config-xo/-/eslint-config-xo-0.18.2.tgz#0a157120875619929e735ffd6b185c41e8a187af" - -eslint-formatter-pretty@^1.0.0: - version "1.3.0" - resolved "https://registry.yarnpkg.com/eslint-formatter-pretty/-/eslint-formatter-pretty-1.3.0.tgz#985d9e41c1f8475f4a090c5dbd2dfcf2821d607e" - dependencies: - ansi-escapes "^2.0.0" - chalk "^2.1.0" - log-symbols "^2.0.0" - plur "^2.1.2" - string-width "^2.0.0" - -eslint-import-resolver-node@^0.3.1: - version "0.3.1" - resolved "https://registry.yarnpkg.com/eslint-import-resolver-node/-/eslint-import-resolver-node-0.3.1.tgz#4422574cde66a9a7b099938ee4d508a199e0e3cc" - dependencies: - debug "^2.6.8" - resolve "^1.2.0" - -eslint-module-utils@^2.1.1: - version "2.1.1" - resolved "https://registry.yarnpkg.com/eslint-module-utils/-/eslint-module-utils-2.1.1.tgz#abaec824177613b8a95b299639e1b6facf473449" - dependencies: - debug "^2.6.8" - pkg-dir "^1.0.0" - -eslint-plugin-ava@^4.2.0: - version "4.2.2" - resolved "https://registry.yarnpkg.com/eslint-plugin-ava/-/eslint-plugin-ava-4.2.2.tgz#0a20395ddf6d7452f4f9d6fd1a90f0bf4a5fc4d5" - dependencies: - arrify "^1.0.1" - deep-strict-equal "^0.2.0" - enhance-visitors "^1.0.0" - espree "^3.1.3" - espurify "^1.5.0" - import-modules "^1.1.0" - multimatch "^2.1.0" - pkg-up "^2.0.0" - -eslint-plugin-import@^2.0.0: - version "2.7.0" - resolved "https://registry.yarnpkg.com/eslint-plugin-import/-/eslint-plugin-import-2.7.0.tgz#21de33380b9efb55f5ef6d2e210ec0e07e7fa69f" +eslint-config-prettier@2.6.0: + version "2.6.0" + resolved "https://registry.yarnpkg.com/eslint-config-prettier/-/eslint-config-prettier-2.6.0.tgz#f21db0ebb438ad678fb98946097c4bb198befccc" dependencies: - builtin-modules "^1.1.1" - contains-path "^0.1.0" - debug "^2.6.8" - doctrine "1.5.0" - eslint-import-resolver-node "^0.3.1" - eslint-module-utils "^2.1.1" - has "^1.0.1" - lodash.cond "^4.3.0" - minimatch "^3.0.3" - read-pkg-up "^2.0.0" + get-stdin "^5.0.1" -eslint-plugin-no-use-extend-native@^0.3.2: - version "0.3.12" - resolved "https://registry.yarnpkg.com/eslint-plugin-no-use-extend-native/-/eslint-plugin-no-use-extend-native-0.3.12.tgz#3ad9a00c2df23b5d7f7f6be91550985a4ab701ea" +eslint-plugin-prettier@2.3.1: + version "2.3.1" + resolved "https://registry.yarnpkg.com/eslint-plugin-prettier/-/eslint-plugin-prettier-2.3.1.tgz#e7a746c67e716f335274b88295a9ead9f544e44d" dependencies: - is-get-set-prop "^1.0.0" - is-js-type "^2.0.0" - is-obj-prop "^1.0.0" - is-proto-prop "^1.0.0" - -eslint-plugin-promise@^3.4.0: - version "3.5.0" - resolved "https://registry.yarnpkg.com/eslint-plugin-promise/-/eslint-plugin-promise-3.5.0.tgz#78fbb6ffe047201627569e85a6c5373af2a68fca" + fast-diff "^1.1.1" + jest-docblock "^21.0.0" eslint-plugin-react@7.3.0: version "7.3.0" @@ -2365,55 +2514,54 @@ eslint-plugin-react@7.3.0: jsx-ast-utils "^2.0.0" prop-types "^15.5.10" -eslint-plugin-unicorn@^2.1.0: - version "2.1.2" - resolved "https://registry.yarnpkg.com/eslint-plugin-unicorn/-/eslint-plugin-unicorn-2.1.2.tgz#99dffe9f4773b04bc39356a7febd64dd700274bc" +eslint-scope@^3.7.1: + version "3.7.1" + resolved "https://registry.yarnpkg.com/eslint-scope/-/eslint-scope-3.7.1.tgz#3d63c3edfda02e06e01a452ad88caacc7cdcb6e8" dependencies: - import-modules "^1.1.0" - lodash.camelcase "^4.1.1" - lodash.kebabcase "^4.0.1" - lodash.snakecase "^4.0.1" - lodash.upperfirst "^4.2.0" + esrecurse "^4.1.0" + estraverse "^4.1.1" -eslint@^3.18.0: - version "3.19.0" - resolved "https://registry.yarnpkg.com/eslint/-/eslint-3.19.0.tgz#c8fc6201c7f40dd08941b87c085767386a679acc" +eslint@4.7.2: + version "4.7.2" + resolved "https://registry.yarnpkg.com/eslint/-/eslint-4.7.2.tgz#ff6f5f5193848a27ee9b627be3e73fb9cb5e662e" dependencies: - babel-code-frame "^6.16.0" - chalk "^1.1.3" - concat-stream "^1.5.2" - debug "^2.1.1" + ajv "^5.2.0" + babel-code-frame "^6.22.0" + chalk "^2.1.0" + concat-stream "^1.6.0" + cross-spawn "^5.1.0" + debug "^3.0.1" doctrine "^2.0.0" - escope "^3.6.0" - espree "^3.4.0" + eslint-scope "^3.7.1" + espree "^3.5.1" esquery "^1.0.0" estraverse "^4.2.0" esutils "^2.0.2" file-entry-cache "^2.0.0" - glob "^7.0.3" - globals "^9.14.0" - ignore "^3.2.0" + functional-red-black-tree "^1.0.1" + glob "^7.1.2" + globals "^9.17.0" + ignore "^3.3.3" imurmurhash "^0.1.4" - inquirer "^0.12.0" - is-my-json-valid "^2.10.0" + inquirer "^3.0.6" is-resolvable "^1.0.0" - js-yaml "^3.5.1" - json-stable-stringify "^1.0.0" + js-yaml "^3.9.1" + json-stable-stringify "^1.0.1" levn "^0.3.0" - lodash "^4.0.0" - mkdirp "^0.5.0" + lodash "^4.17.4" + minimatch "^3.0.2" + mkdirp "^0.5.1" natural-compare "^1.4.0" optionator "^0.8.2" - path-is-inside "^1.0.1" - pluralize "^1.2.1" - progress "^1.1.8" - require-uncached "^1.0.2" - shelljs "^0.7.5" - strip-bom "^3.0.0" + path-is-inside "^1.0.2" + pluralize "^7.0.0" + progress "^2.0.0" + require-uncached "^1.0.3" + semver "^5.3.0" + strip-ansi "^4.0.0" strip-json-comments "~2.0.1" - table "^3.7.8" + table "^4.0.1" text-table "~0.2.0" - user-home "^2.0.0" espower-location-detector@^1.0.0: version "1.0.0" @@ -2424,18 +2572,22 @@ espower-location-detector@^1.0.0: source-map "^0.5.0" xtend "^4.0.0" -espree@^3.1.3, espree@^3.4.0: - version "3.5.1" - resolved "https://registry.yarnpkg.com/espree/-/espree-3.5.1.tgz#0c988b8ab46db53100a1954ae4ba995ddd27d87e" +espree@^3.5.1: + version "3.5.4" + resolved "https://registry.yarnpkg.com/espree/-/espree-3.5.4.tgz#b0f447187c8a8bed944b815a660bddf5deb5d1a7" dependencies: - acorn "^5.1.1" + acorn "^5.5.0" acorn-jsx "^3.0.0" -esprima@^4.0.0: +esprima@^2.6.0: + version "2.7.3" + resolved "https://registry.yarnpkg.com/esprima/-/esprima-2.7.3.tgz#96e3b70d5779f6ad49cd032673d1c312767ba581" + +esprima@^4.0.0, esprima@~4.0.0: version "4.0.0" resolved "https://registry.yarnpkg.com/esprima/-/esprima-4.0.0.tgz#4499eddcd1110e0b218bacf2fa7f7f59f55ca804" -espurify@^1.5.0, espurify@^1.6.0: +espurify@^1.6.0: version "1.7.0" resolved "https://registry.yarnpkg.com/espurify/-/espurify-1.7.0.tgz#1c5cf6cbccc32e6f639380bd4f991fab9ba9d226" dependencies: @@ -2480,18 +2632,6 @@ evp_bytestokey@^1.0.0, evp_bytestokey@^1.0.3: md5.js "^1.3.4" safe-buffer "^5.1.1" -execa@^0.5.0: - version "0.5.1" - resolved "https://registry.yarnpkg.com/execa/-/execa-0.5.1.tgz#de3fb85cb8d6e91c85bcbceb164581785cb57b36" - dependencies: - cross-spawn "^4.0.0" - get-stream "^2.2.0" - is-stream "^1.1.0" - npm-run-path "^2.0.0" - p-finally "^1.0.0" - signal-exit "^3.0.0" - strip-eof "^1.0.0" - execa@^0.7.0: version "0.7.0" resolved "https://registry.yarnpkg.com/execa/-/execa-0.7.0.tgz#944becd34cc41ee32a63a9faf27ad5a65fc59777" @@ -2504,10 +2644,6 @@ execa@^0.7.0: signal-exit "^3.0.0" strip-eof "^1.0.0" -exit-hook@^1.0.0: - version "1.1.1" - resolved "https://registry.yarnpkg.com/exit-hook/-/exit-hook-1.1.1.tgz#f05ca233b48c05d54fff07765df8507e95c02ff8" - expand-brackets@^0.1.4: version "0.1.5" resolved "https://registry.yarnpkg.com/expand-brackets/-/expand-brackets-0.1.5.tgz#df07284e342a807cd733ac5af72411e581d1177b" @@ -2524,12 +2660,12 @@ extend@~3.0.0, extend@~3.0.1: version "3.0.1" resolved "https://registry.yarnpkg.com/extend/-/extend-3.0.1.tgz#a755ea7bc1adfcc5a31ce7e762dbaadc5e636444" -external-editor@^2.0.1, external-editor@^2.0.4: - version "2.0.5" - resolved "https://registry.yarnpkg.com/external-editor/-/external-editor-2.0.5.tgz#52c249a3981b9ba187c7cacf5beb50bf1d91a6bc" +external-editor@^2.0.4, external-editor@^2.1.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/external-editor/-/external-editor-2.1.0.tgz#3d026a21b7f95b5726387d4200ac160d372c3b48" dependencies: + chardet "^0.4.0" iconv-lite "^0.4.17" - jschardet "^1.4.2" tmp "^0.0.33" extglob@^0.3.1: @@ -2539,18 +2675,22 @@ extglob@^0.3.1: is-extglob "^1.0.0" extract-zip@^1.0.3, extract-zip@^1.6.5: - version "1.6.5" - resolved "https://registry.yarnpkg.com/extract-zip/-/extract-zip-1.6.5.tgz#99a06735b6ea20ea9b705d779acffcc87cff0440" + version "1.6.6" + resolved "https://registry.yarnpkg.com/extract-zip/-/extract-zip-1.6.6.tgz#1290ede8d20d0872b429fd3f351ca128ec5ef85c" dependencies: concat-stream "1.6.0" - debug "2.2.0" + debug "2.6.9" mkdirp "0.5.0" yauzl "2.4.1" -extsprintf@1.3.0, extsprintf@^1.2.0: +extsprintf@1.3.0: version "1.3.0" resolved "https://registry.yarnpkg.com/extsprintf/-/extsprintf-1.3.0.tgz#96918440e3041a7a414f8c52e3c574eb3c3e1e05" +extsprintf@^1.2.0: + version "1.4.0" + resolved "https://registry.yarnpkg.com/extsprintf/-/extsprintf-1.4.0.tgz#e2689f8f356fad62cca65a3a91c5df5f9551692f" + fast-deep-equal@^1.0.0: version "1.0.0" resolved "https://registry.yarnpkg.com/fast-deep-equal/-/fast-deep-equal-1.0.0.tgz#96256a3bc975595eb36d82e9929d060d893439ff" @@ -2559,11 +2699,19 @@ fast-diff@^1.1.1: version "1.1.2" resolved "https://registry.yarnpkg.com/fast-diff/-/fast-diff-1.1.2.tgz#4b62c42b8e03de3f848460b639079920695d0154" +fast-json-stable-stringify@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/fast-json-stable-stringify/-/fast-json-stable-stringify-2.0.0.tgz#d5142c0caee6b1189f87d3a76111064f86c8bbf2" + fast-levenshtein@~2.0.4: version "2.0.6" resolved "https://registry.yarnpkg.com/fast-levenshtein/-/fast-levenshtein-2.0.6.tgz#3d8a5c66883a16a30ca8643e851f19baa7797917" -fbjs@^0.8.16, fbjs@^0.8.9: +fastparse@^1.1.1: + version "1.1.1" + resolved "https://registry.yarnpkg.com/fastparse/-/fastparse-1.1.1.tgz#d1e2643b38a94d7583b479060e6c4affc94071f8" + +fbjs@^0.8.16: version "0.8.16" resolved "https://registry.yarnpkg.com/fbjs/-/fbjs-0.8.16.tgz#5e67432f550dc41b572bf55847b8aca64e5337db" dependencies: @@ -2575,23 +2723,12 @@ fbjs@^0.8.16, fbjs@^0.8.9: setimmediate "^1.0.5" ua-parser-js "^0.7.9" -fcopy-pre-bundled@0.3.4: - version "0.3.4" - resolved "https://registry.yarnpkg.com/fcopy-pre-bundled/-/fcopy-pre-bundled-0.3.4.tgz#7ff1a1c339e877baa86b0856bebb33621cd5620b" - fd-slicer@~1.0.1: version "1.0.1" resolved "https://registry.yarnpkg.com/fd-slicer/-/fd-slicer-1.0.1.tgz#8b5bcbd9ec327c5041bf9ab023fd6750f1177e65" dependencies: pend "~1.2.0" -figures@^1.3.5: - version "1.7.0" - resolved "https://registry.yarnpkg.com/figures/-/figures-1.7.0.tgz#cbe1e3affcf1cd44b80cadfed28dc793a9701d2e" - dependencies: - escape-string-regexp "^1.0.5" - object-assign "^4.1.0" - figures@^2.0.0: version "2.0.0" resolved "https://registry.yarnpkg.com/figures/-/figures-2.0.0.tgz#3ab1a2d2a62c8bfb431a0c94cb797a2fce27c962" @@ -2609,6 +2746,13 @@ filename-regex@^2.0.0: version "2.0.1" resolved "https://registry.yarnpkg.com/filename-regex/-/filename-regex-2.0.1.tgz#c1c4b9bee3e09725ddb106b75c1e301fe2f18b26" +fill-keys@^1.0.2: + version "1.0.2" + resolved "https://registry.yarnpkg.com/fill-keys/-/fill-keys-1.0.2.tgz#9a8fa36f4e8ad634e3bf6b4f3c8882551452eb20" + dependencies: + is-object "~1.0.1" + merge-descriptors "~1.0.0" + fill-range@^2.1.0: version "2.2.3" resolved "https://registry.yarnpkg.com/fill-range/-/fill-range-2.2.3.tgz#50b77dfd7e469bc7492470963699fe7a8485a723" @@ -2641,14 +2785,25 @@ find-up@^2.0.0, find-up@^2.1.0: locate-path "^2.0.0" flat-cache@^1.2.1: - version "1.2.2" - resolved "https://registry.yarnpkg.com/flat-cache/-/flat-cache-1.2.2.tgz#fa86714e72c21db88601761ecf2f555d1abc6b96" + version "1.3.0" + resolved "https://registry.yarnpkg.com/flat-cache/-/flat-cache-1.3.0.tgz#d3030b32b38154f4e3b7e9c709f490f7ef97c481" dependencies: circular-json "^0.3.1" del "^2.0.2" graceful-fs "^4.1.2" write "^0.2.1" +flatten@^1.0.2: + version "1.0.2" + resolved "https://registry.yarnpkg.com/flatten/-/flatten-1.0.2.tgz#dae46a9d78fbe25292258cc1e780a41d95c03782" + +flush-write-stream@^1.0.0: + version "1.0.2" + resolved "https://registry.yarnpkg.com/flush-write-stream/-/flush-write-stream-1.0.2.tgz#c81b90d8746766f1a609a46809946c45dd8ae417" + dependencies: + inherits "^2.0.1" + readable-stream "^2.0.4" + fn-name@^2.0.0: version "2.0.1" resolved "https://registry.yarnpkg.com/fn-name/-/fn-name-2.0.1.tgz#5214d7537a4d06a4a301c0cc262feb84188002e7" @@ -2680,29 +2835,26 @@ form-data@~2.1.1: mime-types "^2.1.12" form-data@~2.3.1: - version "2.3.1" - resolved "https://registry.yarnpkg.com/form-data/-/form-data-2.3.1.tgz#6fb94fbd71885306d73d15cc497fe4cc4ecd44bf" + version "2.3.2" + resolved "https://registry.yarnpkg.com/form-data/-/form-data-2.3.2.tgz#4970498be604c20c005d4f5c23aecd21d6b49099" dependencies: asynckit "^0.4.0" - combined-stream "^1.0.5" + combined-stream "1.0.6" mime-types "^2.1.12" -fs-extra-p@^4.4.0: - version "4.4.2" - resolved "https://registry.yarnpkg.com/fs-extra-p/-/fs-extra-p-4.4.2.tgz#b6abd882a9b89f41b977771d3da788ce38f085f3" +from2@^2.1.0: + version "2.3.0" + resolved "https://registry.yarnpkg.com/from2/-/from2-2.3.0.tgz#8bfb5502bde4a4d36cfdeea007fcca21d7e382af" dependencies: - bluebird-lst "^1.0.2" - fs-extra "^4.0.2" + inherits "^2.0.1" + readable-stream "^2.0.0" -fs-extra@^0.26.4: - version "0.26.7" - resolved "https://registry.yarnpkg.com/fs-extra/-/fs-extra-0.26.7.tgz#9ae1fdd94897798edab76d0918cf42d0c3184fa9" +fs-extra-p@^4.5.0, fs-extra-p@^4.5.2: + version "4.5.2" + resolved "https://registry.yarnpkg.com/fs-extra-p/-/fs-extra-p-4.5.2.tgz#0a22aba489284d17f375d5dc5139aa777fe2df51" dependencies: - graceful-fs "^4.1.2" - jsonfile "^2.1.0" - klaw "^1.0.0" - path-is-absolute "^1.0.0" - rimraf "^2.2.8" + bluebird-lst "^1.0.5" + fs-extra "^5.0.0" fs-extra@^0.30.0: version "0.30.0" @@ -2729,28 +2881,45 @@ fs-extra@^3.0.1: jsonfile "^3.0.0" universalify "^0.1.0" -fs-extra@^4.0.1, fs-extra@^4.0.2: - version "4.0.2" - resolved "https://registry.yarnpkg.com/fs-extra/-/fs-extra-4.0.2.tgz#f91704c53d1b461f893452b0c307d9997647ab6b" +fs-extra@^4.0.1: + version "4.0.3" + resolved "https://registry.yarnpkg.com/fs-extra/-/fs-extra-4.0.3.tgz#0d852122e5bc5beb453fb028e9c0c9bf36340c94" + dependencies: + graceful-fs "^4.1.2" + jsonfile "^4.0.0" + universalify "^0.1.0" + +fs-extra@^5.0.0: + version "5.0.0" + resolved "https://registry.yarnpkg.com/fs-extra/-/fs-extra-5.0.0.tgz#414d0110cdd06705734d055652c5411260c31abd" dependencies: graceful-fs "^4.1.2" jsonfile "^4.0.0" universalify "^0.1.0" fs-readdir-recursive@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/fs-readdir-recursive/-/fs-readdir-recursive-1.0.0.tgz#8cd1745c8b4f8a29c8caec392476921ba195f560" + version "1.1.0" + resolved "https://registry.yarnpkg.com/fs-readdir-recursive/-/fs-readdir-recursive-1.1.0.tgz#e32fc030a2ccee44a6b5371308da54be0b397d27" + +fs-write-stream-atomic@^1.0.8: + version "1.0.10" + resolved "https://registry.yarnpkg.com/fs-write-stream-atomic/-/fs-write-stream-atomic-1.0.10.tgz#b47df53493ef911df75731e70a9ded0189db40c9" + dependencies: + graceful-fs "^4.1.2" + iferr "^0.1.5" + imurmurhash "^0.1.4" + readable-stream "1 || 2" fs.realpath@^1.0.0: version "1.0.0" resolved "https://registry.yarnpkg.com/fs.realpath/-/fs.realpath-1.0.0.tgz#1504ad2523158caa40db4a2787cb01411994ea4f" fsevents@^1.0.0: - version "1.1.2" - resolved "https://registry.yarnpkg.com/fsevents/-/fsevents-1.1.2.tgz#3282b713fb3ad80ede0e9fcf4611b5aa6fc033f4" + version "1.1.3" + resolved "https://registry.yarnpkg.com/fsevents/-/fsevents-1.1.3.tgz#11f82318f5fe7bb2cd22965a108e9306208216d8" dependencies: nan "^2.3.0" - node-pre-gyp "^0.6.36" + node-pre-gyp "^0.6.39" fstream-ignore@^1.0.5: version "1.0.5" @@ -2777,6 +2946,10 @@ function-name-support@^0.2.0: version "0.2.0" resolved "https://registry.yarnpkg.com/function-name-support/-/function-name-support-0.2.0.tgz#55d3bfaa6eafd505a50f9bc81fdf57564a0bb071" +functional-red-black-tree@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/functional-red-black-tree/-/functional-red-black-tree-1.0.1.tgz#1b0ab3bd553b2a0d6399d29c0e3ea0b252078327" + gauge@~2.7.3: version "2.7.4" resolved "https://registry.yarnpkg.com/gauge/-/gauge-2.7.4.tgz#2c03405c7538c39d7eb37b317022e325fb018bf7" @@ -2796,16 +2969,6 @@ gaze@~1.1.2: dependencies: globule "^1.0.0" -generate-function@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/generate-function/-/generate-function-2.0.0.tgz#6858fe7c0969b7d4e9093337647ac79f60dfbe74" - -generate-object-property@^1.1.0: - version "1.2.0" - resolved "https://registry.yarnpkg.com/generate-object-property/-/generate-object-property-1.2.0.tgz#9c0e1c40308ce804f4783618b937fa88f99d50d0" - dependencies: - is-property "^1.0.0" - get-caller-file@^1.0.1: version "1.0.2" resolved "https://registry.yarnpkg.com/get-caller-file/-/get-caller-file-1.0.2.tgz#f702e63127e7e231c160a80c1554acb70d5047e5" @@ -2814,25 +2977,14 @@ get-port@^3.0.0: version "3.2.0" resolved "https://registry.yarnpkg.com/get-port/-/get-port-3.2.0.tgz#dd7ce7de187c06c8bf353796ac71e099f0980ebc" -get-set-props@^0.1.0: - version "0.1.0" - resolved "https://registry.yarnpkg.com/get-set-props/-/get-set-props-0.1.0.tgz#998475c178445686d0b32246da5df8dbcfbe8ea3" - get-stdin@^4.0.1: version "4.0.1" resolved "https://registry.yarnpkg.com/get-stdin/-/get-stdin-4.0.1.tgz#b968c6b0a04384324902e8bf1a5df32579a450fe" -get-stdin@^5.0.0: +get-stdin@^5.0.1: version "5.0.1" resolved "https://registry.yarnpkg.com/get-stdin/-/get-stdin-5.0.1.tgz#122e161591e21ff4c52530305693f20e6393a398" -get-stream@^2.2.0: - version "2.3.1" - resolved "https://registry.yarnpkg.com/get-stream/-/get-stream-2.3.1.tgz#5f38f93f346009666ee0150a054167f91bdd95de" - dependencies: - object-assign "^4.0.1" - pinkie-promise "^2.0.0" - get-stream@^3.0.0: version "3.0.0" resolved "https://registry.yarnpkg.com/get-stream/-/get-stream-3.0.0.tgz#8e943d1358dc37555054ecbe2edb05aa174ede14" @@ -2856,16 +3008,6 @@ glob-parent@^2.0.0: dependencies: is-glob "^2.0.0" -glob@^6.0.4: - version "6.0.4" - resolved "https://registry.yarnpkg.com/glob/-/glob-6.0.4.tgz#0f08860f6a155127b2fadd4f9ce24b1aab6e4d22" - dependencies: - inflight "^1.0.4" - inherits "2" - minimatch "2 || 3" - once "^1.3.0" - path-is-absolute "^1.0.0" - glob@^7.0.0, glob@^7.0.3, glob@^7.0.5, glob@^7.1.2, glob@~7.1.1: version "7.1.2" resolved "https://registry.yarnpkg.com/glob/-/glob-7.1.2.tgz#c19c9df9a028702d678612384a6552404c636d15" @@ -2877,7 +3019,13 @@ glob@^7.0.0, glob@^7.0.3, glob@^7.0.5, glob@^7.1.2, glob@~7.1.1: once "^1.3.0" path-is-absolute "^1.0.0" -globals@^9.14.0, globals@^9.18.0: +global-dirs@^0.1.0: + version "0.1.1" + resolved "https://registry.yarnpkg.com/global-dirs/-/global-dirs-0.1.1.tgz#b319c0dd4607f353f3be9cca4c72fc148c49f445" + dependencies: + ini "^1.3.4" + +globals@^9.17.0, globals@^9.18.0: version "9.18.0" resolved "https://registry.yarnpkg.com/globals/-/globals-9.18.0.tgz#aa3896b3e69b487f17e31ed2143d69a8e30c2d8a" @@ -2902,6 +3050,17 @@ globby@^6.0.0: pify "^2.0.0" pinkie-promise "^2.0.0" +globby@^7.1.1: + version "7.1.1" + resolved "https://registry.yarnpkg.com/globby/-/globby-7.1.1.tgz#fb2ccff9401f8600945dfada97440cca972b8680" + dependencies: + array-union "^1.0.1" + dir-glob "^2.0.0" + glob "^7.1.2" + ignore "^3.3.5" + pify "^3.0.0" + slash "^1.0.0" + globule@^1.0.0: version "1.2.0" resolved "https://registry.yarnpkg.com/globule/-/globule-1.2.0.tgz#1dc49c6822dd9e8a2fa00ba2a295006e8664bd09" @@ -2910,6 +3069,25 @@ globule@^1.0.0: lodash "~4.17.4" minimatch "~3.0.2" +got@7.1.0: + version "7.1.0" + resolved "https://registry.yarnpkg.com/got/-/got-7.1.0.tgz#05450fd84094e6bbea56f451a43a9c289166385a" + dependencies: + decompress-response "^3.2.0" + duplexer3 "^0.1.4" + get-stream "^3.0.0" + is-plain-obj "^1.1.0" + is-retry-allowed "^1.0.0" + is-stream "^1.0.0" + isurl "^1.0.0-alpha5" + lowercase-keys "^1.0.0" + p-cancelable "^0.3.0" + p-timeout "^1.1.1" + safe-buffer "^5.0.1" + timed-out "^4.0.0" + url-parse-lax "^1.0.0" + url-to-options "^1.0.1" + got@^6.7.1: version "6.7.1" resolved "https://registry.yarnpkg.com/got/-/got-6.7.1.tgz#240cd05785a9a18e561dc1b44b41c763ef1e8db0" @@ -2970,6 +3148,20 @@ has-flag@^2.0.0: version "2.0.0" resolved "https://registry.yarnpkg.com/has-flag/-/has-flag-2.0.0.tgz#e8207af1cc7b30d446cc70b734b5e8be18f88d51" +has-flag@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/has-flag/-/has-flag-3.0.0.tgz#b5d454dc2199ae225699f3467e5a07f3b955bafd" + +has-symbol-support-x@^1.4.1: + version "1.4.1" + resolved "https://registry.yarnpkg.com/has-symbol-support-x/-/has-symbol-support-x-1.4.1.tgz#66ec2e377e0c7d7ccedb07a3a84d77510ff1bc4c" + +has-to-string-tag-x@^1.2.0: + version "1.4.1" + resolved "https://registry.yarnpkg.com/has-to-string-tag-x/-/has-to-string-tag-x-1.4.1.tgz#a045ab383d7b4b2012a00148ab0aa5f290044d4d" + dependencies: + has-symbol-support-x "^1.4.1" + has-unicode@^2.0.0: version "2.0.1" resolved "https://registry.yarnpkg.com/has-unicode/-/has-unicode-2.0.1.tgz#e0e6fe6a28cf51138855e086d1691e771de2a8b9" @@ -3035,12 +3227,12 @@ hoek@2.x.x: resolved "https://registry.yarnpkg.com/hoek/-/hoek-2.16.3.tgz#20bb7403d3cea398e91dc4710a8ff1b8274a25ed" hoek@4.x.x: - version "4.2.0" - resolved "https://registry.yarnpkg.com/hoek/-/hoek-4.2.0.tgz#72d9d0754f7fe25ca2d01ad8f8f9a9449a89526d" + version "4.2.1" + resolved "https://registry.yarnpkg.com/hoek/-/hoek-4.2.1.tgz#9634502aa12c445dd5a7c5734b572bb8738aacbb" -hoist-non-react-statics@^2.2.1: - version "2.3.1" - resolved "https://registry.yarnpkg.com/hoist-non-react-statics/-/hoist-non-react-statics-2.3.1.tgz#343db84c6018c650778898240135a1420ee22ce0" +hoist-non-react-statics@^2.5.0: + version "2.5.0" + resolved "https://registry.yarnpkg.com/hoist-non-react-statics/-/hoist-non-react-statics-2.5.0.tgz#d2ca2dfc19c5a91c5a6615ce8e564ef0347e2a40" home-or-tmp@^2.0.0: version "2.0.0" @@ -3053,13 +3245,17 @@ home-path@^1.0.1: version "1.0.5" resolved "https://registry.yarnpkg.com/home-path/-/home-path-1.0.5.tgz#788b29815b12d53bacf575648476e6f9041d133f" -hosted-git-info@^2.1.4, hosted-git-info@^2.5.0: +hosted-git-info@^2.1.4: version "2.5.0" resolved "https://registry.yarnpkg.com/hosted-git-info/-/hosted-git-info-2.5.0.tgz#6d60e34b3abbc8313062c3b798ef8d901a07af3c" -hterm-umdjs@1.1.3: - version "1.1.3" - resolved "https://registry.yarnpkg.com/hterm-umdjs/-/hterm-umdjs-1.1.3.tgz#8b57bcaded5ba9541d6c8e32a82b34abb93e885e" +hosted-git-info@^2.6.0: + version "2.6.0" + resolved "https://registry.yarnpkg.com/hosted-git-info/-/hosted-git-info-2.6.0.tgz#23235b29ab230c576aab0d4f13fc046b0b038222" + +html-comment-regex@^1.1.0: + version "1.1.1" + resolved "https://registry.yarnpkg.com/html-comment-regex/-/html-comment-regex-1.1.1.tgz#668b93776eaae55ebde8f3ad464b307a4963625e" http-signature@~1.1.0: version "1.1.1" @@ -3077,9 +3273,9 @@ http-signature@~1.2.0: jsprim "^1.2.2" sshpk "^1.7.0" -https-browserify@0.0.1: - version "0.0.1" - resolved "https://registry.yarnpkg.com/https-browserify/-/https-browserify-0.0.1.tgz#3f91365cabe60b77ed0ebba24b454e3e09d95a82" +https-browserify@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/https-browserify/-/https-browserify-1.0.0.tgz#ec06c10e0a34c0f2faf199f7fd7fc78fffd03c73" hullabaloo-config-manager@^1.1.0: version "1.1.1" @@ -3108,25 +3304,35 @@ husky@0.14.3: normalize-path "^1.0.0" strip-indent "^2.0.0" -hyphenate-style-name@^1.0.1: - version "1.0.2" - resolved "https://registry.yarnpkg.com/hyphenate-style-name/-/hyphenate-style-name-1.0.2.tgz#31160a36930adaf1fc04c6074f7eb41465d4ec4b" - -iconv-lite@^0.4.17, iconv-lite@~0.4.13: +iconv-lite@^0.4.17, iconv-lite@^0.4.19, iconv-lite@~0.4.13: version "0.4.19" resolved "https://registry.yarnpkg.com/iconv-lite/-/iconv-lite-0.4.19.tgz#f7468f60135f5e5dad3399c0a81be9a1603a082b" +icss-replace-symbols@^1.1.0: + version "1.1.0" + resolved "https://registry.yarnpkg.com/icss-replace-symbols/-/icss-replace-symbols-1.1.0.tgz#06ea6f83679a7749e386cfe1fe812ae5db223ded" + +icss-utils@^2.1.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/icss-utils/-/icss-utils-2.1.0.tgz#83f0a0ec378bf3246178b6c2ad9136f135b1c962" + dependencies: + postcss "^6.0.1" + ieee754@^1.1.4: version "1.1.8" resolved "https://registry.yarnpkg.com/ieee754/-/ieee754-1.1.8.tgz#be33d40ac10ef1926701f6f08a2d86fbfd1ad3e4" +iferr@^0.1.5: + version "0.1.5" + resolved "https://registry.yarnpkg.com/iferr/-/iferr-0.1.5.tgz#c60eed69e6d8fdb6b3104a1fcbca1c192dc5b501" + ignore-by-default@^1.0.0: version "1.0.1" resolved "https://registry.yarnpkg.com/ignore-by-default/-/ignore-by-default-1.0.1.tgz#48ca6d72f6c6a3af00a9ad4ae6876be3889e2b09" -ignore@^3.2.0, ignore@^3.2.6: - version "3.3.5" - resolved "https://registry.yarnpkg.com/ignore/-/ignore-3.3.5.tgz#c4e715455f6073a8d7e5dae72d2fc9d71663dba6" +ignore@^3.3.3, ignore@^3.3.5: + version "3.3.7" + resolved "https://registry.yarnpkg.com/ignore/-/ignore-3.3.7.tgz#612289bfb3c220e186a58118618d5be8c1bab021" import-lazy@^2.1.0: version "2.1.0" @@ -3139,10 +3345,6 @@ import-local@^0.1.1: pkg-dir "^2.0.0" resolve-cwd "^2.0.0" -import-modules@^1.1.0: - version "1.1.0" - resolved "https://registry.yarnpkg.com/import-modules/-/import-modules-1.1.0.tgz#748db79c5cc42bb9701efab424f894e72600e9dc" - imurmurhash@^0.1.4: version "0.1.4" resolved "https://registry.yarnpkg.com/imurmurhash/-/imurmurhash-0.1.4.tgz#9218b9b2b928a238b13dc4fb6b6d576f231453ea" @@ -3153,10 +3355,14 @@ indent-string@^2.1.0: dependencies: repeating "^2.0.0" -indent-string@^3.0.0, indent-string@^3.1.0: +indent-string@^3.0.0, indent-string@^3.1.0, indent-string@^3.2.0: version "3.2.0" resolved "https://registry.yarnpkg.com/indent-string/-/indent-string-3.2.0.tgz#4a5fd6d27cc332f37e5419a504dbb837105c9289" +indexes-of@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/indexes-of/-/indexes-of-1.0.1.tgz#f30f716c8e2bd346c7b67d3df3915566a7c05607" + indexof@0.0.1: version "0.0.1" resolved "https://registry.yarnpkg.com/indexof/-/indexof-0.0.1.tgz#82dc336d232b9062179d05ab3293a66059fd435d" @@ -3177,78 +3383,53 @@ inherits@2.0.1: resolved "https://registry.yarnpkg.com/inherits/-/inherits-2.0.1.tgz#b17d08d326b4423e568eff719f91b0b1cbdf69f1" ini@^1.3.4, ini@~1.3.0: - version "1.3.4" - resolved "https://registry.yarnpkg.com/ini/-/ini-1.3.4.tgz#0537cb79daf59b59a1a517dff706c86ec039162e" + version "1.3.5" + resolved "https://registry.yarnpkg.com/ini/-/ini-1.3.5.tgz#eee25f56db1c9ec6085e0c22778083f596abf927" -inline-style-prefixer@^2.0.0: - version "2.0.5" - resolved "https://registry.yarnpkg.com/inline-style-prefixer/-/inline-style-prefixer-2.0.5.tgz#c153c7e88fd84fef5c602e95a8168b2770671fe7" - dependencies: - bowser "^1.0.0" - hyphenate-style-name "^1.0.1" - -inquirer@3.3.0: - version "3.3.0" - resolved "https://registry.yarnpkg.com/inquirer/-/inquirer-3.3.0.tgz#9dd2f2ad765dcab1ff0443b491442a20ba227dc9" +inquirer@5.1.0: + version "5.1.0" + resolved "https://registry.yarnpkg.com/inquirer/-/inquirer-5.1.0.tgz#19da508931892328abbbdd4c477f1efc65abfd67" dependencies: ansi-escapes "^3.0.0" chalk "^2.0.0" cli-cursor "^2.1.0" cli-width "^2.0.0" - external-editor "^2.0.4" + external-editor "^2.1.0" figures "^2.0.0" lodash "^4.3.0" mute-stream "0.0.7" run-async "^2.2.0" - rx-lite "^4.0.8" - rx-lite-aggregates "^4.0.8" + rxjs "^5.5.2" string-width "^2.1.0" strip-ansi "^4.0.0" through "^2.3.6" -inquirer@^0.12.0: - version "0.12.0" - resolved "https://registry.yarnpkg.com/inquirer/-/inquirer-0.12.0.tgz#1ef2bfd63504df0bc75785fff8c2c41df12f077e" - dependencies: - ansi-escapes "^1.1.0" - ansi-regex "^2.0.0" - chalk "^1.0.0" - cli-cursor "^1.0.1" - cli-width "^2.0.0" - figures "^1.3.5" - lodash "^4.3.0" - readline2 "^1.0.1" - run-async "^0.1.0" - rx-lite "^3.1.2" - string-width "^1.0.1" - strip-ansi "^3.0.0" - through "^2.3.6" - -inquirer@~3.0.6: - version "3.0.6" - resolved "https://registry.yarnpkg.com/inquirer/-/inquirer-3.0.6.tgz#e04aaa9d05b7a3cb9b0f407d04375f0447190347" +inquirer@^3.0.6, inquirer@~3.3.0: + version "3.3.0" + resolved "https://registry.yarnpkg.com/inquirer/-/inquirer-3.3.0.tgz#9dd2f2ad765dcab1ff0443b491442a20ba227dc9" dependencies: - ansi-escapes "^1.1.0" - chalk "^1.0.0" + ansi-escapes "^3.0.0" + chalk "^2.0.0" cli-cursor "^2.1.0" cli-width "^2.0.0" - external-editor "^2.0.1" + external-editor "^2.0.4" figures "^2.0.0" lodash "^4.3.0" mute-stream "0.0.7" run-async "^2.2.0" - rx "^4.1.0" - string-width "^2.0.0" - strip-ansi "^3.0.0" + rx-lite "^4.0.8" + rx-lite-aggregates "^4.0.8" + string-width "^2.1.0" + strip-ansi "^4.0.0" through "^2.3.6" interpret@^1.0.0: - version "1.0.4" - resolved "https://registry.yarnpkg.com/interpret/-/interpret-1.0.4.tgz#820cdd588b868ffb191a809506d6c9c8f212b1b0" + version "1.1.0" + resolved "https://registry.yarnpkg.com/interpret/-/interpret-1.1.0.tgz#7ed1b1410c6a0e0f78cf95d3b8440c63f78b8614" invariant@^2.0.0, invariant@^2.2.2: - version "2.2.2" - resolved "https://registry.yarnpkg.com/invariant/-/invariant-2.2.2.tgz#9e1f56ac0acdb6bf303306f338be3b204ae60360" + version "2.2.3" + resolved "https://registry.yarnpkg.com/invariant/-/invariant-2.2.3.tgz#1a827dfde7dcbd7c323f0ca826be8fa7c5e9d688" dependencies: loose-envify "^1.0.0" @@ -3257,8 +3438,12 @@ invert-kv@^1.0.0: resolved "https://registry.yarnpkg.com/invert-kv/-/invert-kv-1.0.0.tgz#104a8e4aaca6d3d8cd157a8ef8bfab2d7a3ffdb6" irregular-plurals@^1.0.0: - version "1.3.0" - resolved "https://registry.yarnpkg.com/irregular-plurals/-/irregular-plurals-1.3.0.tgz#7af06931bdf74be33dcf585a13e06fccc16caecf" + version "1.4.0" + resolved "https://registry.yarnpkg.com/irregular-plurals/-/irregular-plurals-1.4.0.tgz#2ca9b033651111855412f16be5d77c62a458a766" + +is-absolute-url@^2.0.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/is-absolute-url/-/is-absolute-url-2.1.0.tgz#50530dfb84fcc9aa7dbe7852e83a37b93b9f2aa6" is-arrayish@^0.2.1: version "0.2.1" @@ -3275,8 +3460,8 @@ is-binary-path@^1.0.0: binary-extensions "^1.0.0" is-buffer@^1.1.5: - version "1.1.5" - resolved "https://registry.yarnpkg.com/is-buffer/-/is-buffer-1.1.5.tgz#1f3b26ef613b214b88cbca23cc6c01d87961eecc" + version "1.1.6" + resolved "https://registry.yarnpkg.com/is-buffer/-/is-buffer-1.1.6.tgz#efaa2ea9daa0d7ab2ea13a97b2b8ad51fefbe8be" is-builtin-module@^1.0.0: version "1.0.0" @@ -3288,9 +3473,9 @@ is-callable@^1.1.1, is-callable@^1.1.3: version "1.1.3" resolved "https://registry.yarnpkg.com/is-callable/-/is-callable-1.1.3.tgz#86eb75392805ddc33af71c92a0eedf74ee7604b2" -is-ci@^1.0.10, is-ci@^1.0.7: - version "1.0.10" - resolved "https://registry.yarnpkg.com/is-ci/-/is-ci-1.0.10.tgz#f739336b2632365061a9d48270cd56ae3369318e" +is-ci@^1.0.10, is-ci@^1.0.7, is-ci@^1.1.0: + version "1.1.0" + resolved "https://registry.yarnpkg.com/is-ci/-/is-ci-1.1.0.tgz#247e4162e7860cebbdaf30b774d6b0ac7dcfe7a5" dependencies: ci-info "^1.0.0" @@ -3320,11 +3505,11 @@ is-extglob@^1.0.0: version "1.0.0" resolved "https://registry.yarnpkg.com/is-extglob/-/is-extglob-1.0.0.tgz#ac468177c4943405a092fc8f29760c6ffc6206c0" -is-extglob@^2.1.0: +is-extglob@^2.1.1: version "2.1.1" resolved "https://registry.yarnpkg.com/is-extglob/-/is-extglob-2.1.1.tgz#a88c02535791f02ed37c76a1b9ea9773c833f8c2" -is-finite@^1.0.0, is-finite@^1.0.1: +is-finite@^1.0.0: version "1.0.2" resolved "https://registry.yarnpkg.com/is-finite/-/is-finite-1.0.2.tgz#cc6677695602be550ef11e8b4aa6305342b6d0aa" dependencies: @@ -3344,39 +3529,24 @@ is-generator-fn@^1.0.0: version "1.0.0" resolved "https://registry.yarnpkg.com/is-generator-fn/-/is-generator-fn-1.0.0.tgz#969d49e1bb3329f6bb7f09089be26578b2ddd46a" -is-get-set-prop@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/is-get-set-prop/-/is-get-set-prop-1.0.0.tgz#2731877e4d78a6a69edcce6bb9d68b0779e76312" - dependencies: - get-set-props "^0.1.0" - lowercase-keys "^1.0.0" - is-glob@^2.0.0, is-glob@^2.0.1: version "2.0.1" resolved "https://registry.yarnpkg.com/is-glob/-/is-glob-2.0.1.tgz#d096f926a3ded5600f3fdfd91198cb0888c2d863" dependencies: is-extglob "^1.0.0" -is-glob@^3.1.0: - version "3.1.0" - resolved "https://registry.yarnpkg.com/is-glob/-/is-glob-3.1.0.tgz#7ba5ae24217804ac70707b96922567486cc3e84a" - dependencies: - is-extglob "^2.1.0" - -is-js-type@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/is-js-type/-/is-js-type-2.0.0.tgz#73617006d659b4eb4729bba747d28782df0f7e22" +is-glob@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/is-glob/-/is-glob-4.0.0.tgz#9521c76845cc2610a85203ddf080a958c2ffabc0" dependencies: - js-types "^1.0.0" + is-extglob "^2.1.1" -is-my-json-valid@^2.10.0: - version "2.16.1" - resolved "https://registry.yarnpkg.com/is-my-json-valid/-/is-my-json-valid-2.16.1.tgz#5a846777e2c2620d1e69104e5d3a03b1f6088f11" +is-installed-globally@^0.1.0: + version "0.1.0" + resolved "https://registry.yarnpkg.com/is-installed-globally/-/is-installed-globally-0.1.0.tgz#0dfd98f5a9111716dd535dda6492f67bf3d25a80" dependencies: - generate-function "^2.0.0" - generate-object-property "^1.1.0" - jsonpointer "^4.0.0" - xtend "^4.0.0" + global-dirs "^0.1.0" + is-path-inside "^1.0.0" is-npm@^1.0.0: version "1.0.0" @@ -3394,23 +3564,26 @@ is-number@^3.0.0: dependencies: kind-of "^3.0.2" -is-obj-prop@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/is-obj-prop/-/is-obj-prop-1.0.0.tgz#b34de79c450b8d7c73ab2cdf67dc875adb85f80e" - dependencies: - lowercase-keys "^1.0.0" - obj-props "^1.0.0" - is-obj@^1.0.0: version "1.0.1" resolved "https://registry.yarnpkg.com/is-obj/-/is-obj-1.0.1.tgz#3e4729ac1f5fde025cd7d83a896dab9f4f67db0f" +is-object@^1.0.1, is-object@~1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/is-object/-/is-object-1.0.1.tgz#8952688c5ec2ffd6b03ecc85e769e02903083470" + is-observable@^0.2.0: version "0.2.0" resolved "https://registry.yarnpkg.com/is-observable/-/is-observable-0.2.0.tgz#b361311d83c6e5d726cabf5e250b0237106f5ae2" dependencies: symbol-observable "^0.2.2" +is-observable@^1.0.0: + version "1.1.0" + resolved "https://registry.yarnpkg.com/is-observable/-/is-observable-1.1.0.tgz#b3e986c8f44de950867cab5403f5a3465005975e" + dependencies: + symbol-observable "^1.1.0" + is-path-cwd@^1.0.0: version "1.0.0" resolved "https://registry.yarnpkg.com/is-path-cwd/-/is-path-cwd-1.0.0.tgz#d225ec23132e89edd38fda767472e62e65f1106d" @@ -3422,12 +3595,12 @@ is-path-in-cwd@^1.0.0: is-path-inside "^1.0.0" is-path-inside@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/is-path-inside/-/is-path-inside-1.0.0.tgz#fc06e5a1683fbda13de667aff717bbc10a48f37f" + version "1.0.1" + resolved "https://registry.yarnpkg.com/is-path-inside/-/is-path-inside-1.0.1.tgz#8ef5b7de50437a3fdca6b4e865ef7aa55cb48036" dependencies: path-is-inside "^1.0.1" -is-plain-obj@^1.0.0: +is-plain-obj@^1.0.0, is-plain-obj@^1.1.0: version "1.1.0" resolved "https://registry.yarnpkg.com/is-plain-obj/-/is-plain-obj-1.1.0.tgz#71a50c8429dfca773c92a390a4a03b39fcd51d3e" @@ -3443,17 +3616,6 @@ is-promise@^2.1.0: version "2.1.0" resolved "https://registry.yarnpkg.com/is-promise/-/is-promise-2.1.0.tgz#79a2a9ece7f096e80f36d2b2f3bc16c1ff4bf3fa" -is-property@^1.0.0: - version "1.0.2" - resolved "https://registry.yarnpkg.com/is-property/-/is-property-1.0.2.tgz#57fe1c4e48474edd65b09911f26b1cd4095dda84" - -is-proto-prop@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/is-proto-prop/-/is-proto-prop-1.0.0.tgz#b3951f95c089924fb5d4fcda6542ab3e83e2b220" - dependencies: - lowercase-keys "^1.0.0" - proto-props "^0.2.0" - is-redirect@^1.0.0: version "1.0.0" resolved "https://registry.yarnpkg.com/is-redirect/-/is-redirect-1.0.0.tgz#1d03dded53bd8db0f30c26e4f95d36fc7c87dc24" @@ -3465,19 +3627,29 @@ is-regex@^1.0.4: has "^1.0.1" is-resolvable@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/is-resolvable/-/is-resolvable-1.0.0.tgz#8df57c61ea2e3c501408d100fb013cf8d6e0cc62" - dependencies: - tryit "^1.0.1" + version "1.1.0" + resolved "https://registry.yarnpkg.com/is-resolvable/-/is-resolvable-1.1.0.tgz#fb18f87ce1feb925169c9a407c19318a3206ed88" is-retry-allowed@^1.0.0: version "1.1.0" resolved "https://registry.yarnpkg.com/is-retry-allowed/-/is-retry-allowed-1.1.0.tgz#11a060568b67339444033d0125a61a20d564fb34" +is-ssh@^1.3.0: + version "1.3.0" + resolved "https://registry.yarnpkg.com/is-ssh/-/is-ssh-1.3.0.tgz#ebea1169a2614da392a63740366c3ce049d8dff6" + dependencies: + protocols "^1.1.0" + is-stream@^1.0.0, is-stream@^1.0.1, is-stream@^1.1.0: version "1.1.0" resolved "https://registry.yarnpkg.com/is-stream/-/is-stream-1.1.0.tgz#12d4a3dd4e68e0b79ceb8dbc84173ae80d91ca44" +is-svg@^2.0.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/is-svg/-/is-svg-2.1.0.tgz#cf61090da0d9efbcab8722deba6f032208dbb0e9" + dependencies: + html-comment-regex "^1.1.0" + is-symbol@^1.0.1: version "1.0.1" resolved "https://registry.yarnpkg.com/is-symbol/-/is-symbol-1.0.1.tgz#3cc59f00025194b6ab2e38dbae6689256b660572" @@ -3495,8 +3667,12 @@ is-utf8@^0.2.0, is-utf8@^0.2.1: resolved "https://registry.yarnpkg.com/is-utf8/-/is-utf8-0.2.1.tgz#4b0da1442104d1b336340e80797e865cf39f7d72" is-windows@^1.0.0: - version "1.0.1" - resolved "https://registry.yarnpkg.com/is-windows/-/is-windows-1.0.1.tgz#310db70f742d259a16a369202b51af84233310d9" + version "1.0.2" + resolved "https://registry.yarnpkg.com/is-windows/-/is-windows-1.0.2.tgz#d1850eb9791ecd18e6182ce12a30f396634bb19d" + +is-wsl@^1.1.0: + version "1.1.0" + resolved "https://registry.yarnpkg.com/is-wsl/-/is-wsl-1.1.0.tgz#1f16e4aa22b04d1336b66188a66af3c600c3a66d" isarray@0.0.1: version "0.0.1" @@ -3531,6 +3707,21 @@ isstream@~0.1.2: version "0.1.2" resolved "https://registry.yarnpkg.com/isstream/-/isstream-0.1.2.tgz#47e63f7af55afa6f92e1500e690eb8b8529c099a" +isurl@^1.0.0-alpha5: + version "1.0.0" + resolved "https://registry.yarnpkg.com/isurl/-/isurl-1.0.0.tgz#b27f4f49f3cdaa3ea44a0a5b7f3462e6edc39d67" + dependencies: + has-to-string-tag-x "^1.2.0" + is-object "^1.0.1" + +jest-docblock@^21.0.0: + version "21.2.0" + resolved "https://registry.yarnpkg.com/jest-docblock/-/jest-docblock-21.2.0.tgz#51529c3b30d5fd159da60c27ceedc195faf8d414" + +js-base64@^2.1.9: + version "2.4.3" + resolved "https://registry.yarnpkg.com/js-base64/-/js-base64-2.4.3.tgz#2e545ec2b0f2957f41356510205214e98fad6582" + js-string-escape@^1.0.1: version "1.0.1" resolved "https://registry.yarnpkg.com/js-string-escape/-/js-string-escape-1.0.1.tgz#e2625badbc0d67c7533e9edc1068c587ae4137ef" @@ -3539,25 +3730,31 @@ js-tokens@^3.0.0, js-tokens@^3.0.2: version "3.0.2" resolved "https://registry.yarnpkg.com/js-tokens/-/js-tokens-3.0.2.tgz#9866df395102130e38f7f996bceb65443209c25b" -js-types@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/js-types/-/js-types-1.0.0.tgz#d242e6494ed572ad3c92809fc8bed7f7687cbf03" - -js-yaml@^3.5.1, js-yaml@^3.8.2, js-yaml@^3.9.1: +js-yaml@^3.10.0, js-yaml@^3.9.1: version "3.10.0" resolved "https://registry.yarnpkg.com/js-yaml/-/js-yaml-3.10.0.tgz#2e78441646bd4682e963f22b6e92823c309c62dc" dependencies: argparse "^1.0.7" esprima "^4.0.0" +js-yaml@^3.11.0: + version "3.11.0" + resolved "https://registry.yarnpkg.com/js-yaml/-/js-yaml-3.11.0.tgz#597c1a8bd57152f26d622ce4117851a51f5ebaef" + dependencies: + argparse "^1.0.7" + esprima "^4.0.0" + +js-yaml@~3.7.0: + version "3.7.0" + resolved "https://registry.yarnpkg.com/js-yaml/-/js-yaml-3.7.0.tgz#5c967ddd837a9bfdca5f2de84253abe8a1c03b80" + dependencies: + argparse "^1.0.7" + esprima "^2.6.0" + jsbn@~0.1.0: version "0.1.1" resolved "https://registry.yarnpkg.com/jsbn/-/jsbn-0.1.1.tgz#a5e654c2e5a2deb5f201d96cefbca80c0ef2f513" -jschardet@^1.4.2: - version "1.5.1" - resolved "https://registry.yarnpkg.com/jschardet/-/jschardet-1.5.1.tgz#c519f629f86b3a5bedba58a88d311309eec097f9" - jsesc@^1.3.0: version "1.3.0" resolved "https://registry.yarnpkg.com/jsesc/-/jsesc-1.3.0.tgz#46c3fec8c1892b12b0833db9bc7622176dbab34b" @@ -3570,6 +3767,10 @@ json-loader@0.5.7, json-loader@^0.5.4: version "0.5.7" resolved "https://registry.yarnpkg.com/json-loader/-/json-loader-0.5.7.tgz#dca14a70235ff82f0ac9a3abeb60d337a365185d" +json-parse-better-errors@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/json-parse-better-errors/-/json-parse-better-errors-1.0.1.tgz#50183cd1b2d25275de069e9e71b467ac9eab973a" + json-schema-traverse@^0.3.0: version "0.3.1" resolved "https://registry.yarnpkg.com/json-schema-traverse/-/json-schema-traverse-0.3.1.tgz#349a6d44c53a51de89b40805c5d5e59b417d3340" @@ -3578,7 +3779,7 @@ json-schema@0.2.3: version "0.2.3" resolved "https://registry.yarnpkg.com/json-schema/-/json-schema-0.2.3.tgz#b480c892e59a2f05954ce727bd3f2a4e882f9e13" -json-stable-stringify@^1.0.0, json-stable-stringify@^1.0.1: +json-stable-stringify@^1.0.1: version "1.0.1" resolved "https://registry.yarnpkg.com/json-stable-stringify/-/json-stable-stringify-1.0.1.tgz#9a759d39c5f2ff503fd5300646ed445f88c4f9af" dependencies: @@ -3614,10 +3815,6 @@ jsonify@~0.0.0: version "0.0.0" resolved "https://registry.yarnpkg.com/jsonify/-/jsonify-0.0.0.tgz#2c74b6ee41d93ca51b7b5aaee8f503631d252a73" -jsonpointer@^4.0.0: - version "4.0.1" - resolved "https://registry.yarnpkg.com/jsonpointer/-/jsonpointer-4.0.1.tgz#4fd92cb34e0e9db3c89c8622ecf51f9b978c6cb9" - jsprim@^1.2.2: version "1.4.1" resolved "https://registry.yarnpkg.com/jsprim/-/jsprim-1.4.1.tgz#313e66bc1e5cc06e438bc1b7499c2e5c56acb6a2" @@ -3667,9 +3864,9 @@ lazy-cache@^1.0.3: version "1.0.4" resolved "https://registry.yarnpkg.com/lazy-cache/-/lazy-cache-1.0.4.tgz#a1d78fc3a50474cb80845d3b3b6e1da49a446e8e" -lazy-val@^1.0.2: - version "1.0.2" - resolved "https://registry.yarnpkg.com/lazy-val/-/lazy-val-1.0.2.tgz#d9b07fb1fce54cbc99b3c611de431b83249369b6" +lazy-val@^1.0.3: + version "1.0.3" + resolved "https://registry.yarnpkg.com/lazy-val/-/lazy-val-1.0.3.tgz#bb97b200ef00801d94c317e29dc6ed39e31c5edc" lazystream@^1.0.0: version "1.0.0" @@ -3709,6 +3906,15 @@ load-json-file@^2.0.0: pify "^2.0.0" strip-bom "^3.0.0" +load-json-file@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/load-json-file/-/load-json-file-4.0.0.tgz#2f5f45ab91e33216234fd53adab668eb4ec0993b" + dependencies: + graceful-fs "^4.1.2" + parse-json "^4.0.0" + pify "^3.0.0" + strip-bom "^3.0.0" + loader-runner@^2.3.0: version "2.3.0" resolved "https://registry.yarnpkg.com/loader-runner/-/loader-runner-2.3.0.tgz#f482aea82d543e07921700d5a46ef26fdac6b8a2" @@ -3737,15 +3943,19 @@ locate-path@^2.0.0: p-locate "^2.0.0" path-exists "^3.0.0" -lodash-es@^4.2.0, lodash-es@^4.2.1: - version "4.17.4" - resolved "https://registry.yarnpkg.com/lodash-es/-/lodash-es-4.17.4.tgz#dcc1d7552e150a0640073ba9cb31d70f032950e7" +lodash-es@^4.17.5: + version "4.17.7" + resolved "https://registry.yarnpkg.com/lodash-es/-/lodash-es-4.17.7.tgz#db240a3252c3dd8360201ac9feef91ac977ea856" + +lodash-es@^4.2.1: + version "4.17.5" + resolved "https://registry.yarnpkg.com/lodash-es/-/lodash-es-4.17.5.tgz#9fc6e737b1c4d151d8f9cae2247305d552ce748f" lodash.assign@^4.2.0: version "4.2.0" resolved "https://registry.yarnpkg.com/lodash.assign/-/lodash.assign-4.2.0.tgz#0d99f3ccd7a6d261d19bdaeb9245005d285808e7" -lodash.camelcase@^4.1.1: +lodash.camelcase@^4.3.0: version "4.3.0" resolved "https://registry.yarnpkg.com/lodash.camelcase/-/lodash.camelcase-4.3.0.tgz#b28aa6288a2b9fc651035c7711f65ab6190331a6" @@ -3757,10 +3967,6 @@ lodash.clonedeepwith@^4.5.0: version "4.5.0" resolved "https://registry.yarnpkg.com/lodash.clonedeepwith/-/lodash.clonedeepwith-4.5.0.tgz#6ee30573a03a1a60d670a62ef33c10cf1afdbdd4" -lodash.cond@^4.3.0: - version "4.5.2" - resolved "https://registry.yarnpkg.com/lodash.cond/-/lodash.cond-4.5.2.tgz#f471a1da486be60f6ab955d17115523dd1d255d5" - lodash.debounce@^4.0.3: version "4.0.8" resolved "https://registry.yarnpkg.com/lodash.debounce/-/lodash.debounce-4.0.8.tgz#82d79bff30a67c4005ffd5e2515300ad9ca4d7af" @@ -3777,7 +3983,7 @@ lodash.flattendeep@^4.4.0: version "4.4.0" resolved "https://registry.yarnpkg.com/lodash.flattendeep/-/lodash.flattendeep-4.4.0.tgz#fb030917f86a3134e5bc9bec0d69e0013ddfedb2" -lodash.isequal@^4.4.0, lodash.isequal@^4.5.0: +lodash.isequal@^4.5.0: version "4.5.0" resolved "https://registry.yarnpkg.com/lodash.isequal/-/lodash.isequal-4.5.0.tgz#415c4478f2bcc30120c22ce10ed3226f7d3e18e0" @@ -3785,33 +3991,25 @@ lodash.isplainobject@^4.0.6: version "4.0.6" resolved "https://registry.yarnpkg.com/lodash.isplainobject/-/lodash.isplainobject-4.0.6.tgz#7c526a52d89b45c45cc690b88163be0497f550cb" -lodash.kebabcase@^4.0.1: - version "4.1.1" - resolved "https://registry.yarnpkg.com/lodash.kebabcase/-/lodash.kebabcase-4.1.1.tgz#8489b1cb0d29ff88195cceca448ff6d6cc295c36" +lodash.memoize@^4.1.2: + version "4.1.2" + resolved "https://registry.yarnpkg.com/lodash.memoize/-/lodash.memoize-4.1.2.tgz#bcc6c49a42a2840ed997f323eada5ecd182e0bfe" lodash.merge@^4.6.0: - version "4.6.0" - resolved "https://registry.yarnpkg.com/lodash.merge/-/lodash.merge-4.6.0.tgz#69884ba144ac33fe699737a6086deffadd0f89c5" - -lodash.snakecase@^4.0.1: - version "4.1.1" - resolved "https://registry.yarnpkg.com/lodash.snakecase/-/lodash.snakecase-4.1.1.tgz#39d714a35357147837aefd64b5dcbb16becd8f8d" + version "4.6.1" + resolved "https://registry.yarnpkg.com/lodash.merge/-/lodash.merge-4.6.1.tgz#adc25d9cb99b9391c59624f379fbba60d7111d54" lodash.some@^4.6.0: version "4.6.0" resolved "https://registry.yarnpkg.com/lodash.some/-/lodash.some-4.6.0.tgz#1bb9f314ef6b8baded13b549169b2a945eb68e4d" -lodash.toarray@^4.4.0: - version "4.4.0" - resolved "https://registry.yarnpkg.com/lodash.toarray/-/lodash.toarray-4.4.0.tgz#24c4bfcd6b2fba38bfd0594db1179d8e9b656561" - -lodash.upperfirst@^4.2.0: - version "4.3.1" - resolved "https://registry.yarnpkg.com/lodash.upperfirst/-/lodash.upperfirst-4.3.1.tgz#1365edf431480481ef0d1c68957a5ed99d49f7ce" +lodash.uniq@^4.5.0: + version "4.5.0" + resolved "https://registry.yarnpkg.com/lodash.uniq/-/lodash.uniq-4.5.0.tgz#d0225373aeb652adc1bc82e4945339a842754773" -lodash@^4.0.0, lodash@^4.13.1, lodash@^4.14.0, lodash@^4.17.4, lodash@^4.2.0, lodash@^4.2.1, lodash@^4.3.0, lodash@^4.8.0, lodash@~4.17.4: - version "4.17.4" - resolved "https://registry.yarnpkg.com/lodash/-/lodash-4.17.4.tgz#78203a4d1c328ae1d86dca6460e369b57f4055ae" +lodash@^4.13.1, lodash@^4.14.0, lodash@^4.17.4, lodash@^4.17.5, lodash@^4.2.1, lodash@^4.3.0, lodash@^4.8.0, lodash@~4.17.4: + version "4.17.5" + resolved "https://registry.yarnpkg.com/lodash/-/lodash-4.17.5.tgz#99a92d65c0272debe8c96b6057bc8fbfa3bed511" log-symbols@^1.0.2: version "1.0.2" @@ -3819,9 +4017,9 @@ log-symbols@^1.0.2: dependencies: chalk "^1.0.0" -log-symbols@^2.0.0: - version "2.1.0" - resolved "https://registry.yarnpkg.com/log-symbols/-/log-symbols-2.1.0.tgz#f35fa60e278832b538dc4dddcbb478a45d3e3be6" +log-symbols@^2.1.0: + version "2.2.0" + resolved "https://registry.yarnpkg.com/log-symbols/-/log-symbols-2.2.0.tgz#5740e1c5d6f0dfda4ad9323b5332107ef6b4c40a" dependencies: chalk "^2.0.1" @@ -3846,33 +4044,37 @@ lowercase-keys@^1.0.0: version "1.0.0" resolved "https://registry.yarnpkg.com/lowercase-keys/-/lowercase-keys-1.0.0.tgz#4e3366b39e7f5457e35f1324bdf6f88d0bfc7306" -lru-cache@^4.0.1: +lru-cache@^4.0.1, lru-cache@^4.1.1: version "4.1.1" resolved "https://registry.yarnpkg.com/lru-cache/-/lru-cache-4.1.1.tgz#622e32e82488b49279114a4f9ecf45e7cd6bba55" dependencies: pseudomap "^1.0.2" yallist "^2.1.2" -macaddress@^0.2.7: +macaddress@^0.2.8: version "0.2.8" resolved "https://registry.yarnpkg.com/macaddress/-/macaddress-0.2.8.tgz#5904dc537c39ec6dbefeae902327135fa8511f12" make-dir@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/make-dir/-/make-dir-1.0.0.tgz#97a011751e91dd87cfadef58832ebb04936de978" + version "1.2.0" + resolved "https://registry.yarnpkg.com/make-dir/-/make-dir-1.2.0.tgz#6d6a49eead4aae296c53bbf3a1a008bd6c89469b" dependencies: - pify "^2.3.0" + pify "^3.0.0" map-obj@^1.0.0, map-obj@^1.0.1: version "1.0.1" resolved "https://registry.yarnpkg.com/map-obj/-/map-obj-1.0.1.tgz#d933ceb9205d82bdcf4886f6742bdc2b4dea146d" matcher@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/matcher/-/matcher-1.0.0.tgz#aaf0c4816eb69b92094674175625f3466b0e3e19" + version "1.1.0" + resolved "https://registry.yarnpkg.com/matcher/-/matcher-1.1.0.tgz#4ad3a9cb6585186dc95cb8a08c7de936caed17ee" dependencies: escape-string-regexp "^1.0.4" +math-expression-evaluator@^1.2.14: + version "1.2.17" + resolved "https://registry.yarnpkg.com/math-expression-evaluator/-/math-expression-evaluator-1.2.17.tgz#de819fdbcd84dccd8fae59c6aeb79615b9d266ac" + md5-hex@^1.2.0, md5-hex@^1.3.0: version "1.3.0" resolved "https://registry.yarnpkg.com/md5-hex/-/md5-hex-1.3.0.tgz#d2c4afe983c4370662179b8cad145219135046c4" @@ -3909,7 +4111,7 @@ memory-fs@^0.4.0, memory-fs@~0.4.1: errno "^0.1.3" readable-stream "^2.0.1" -meow@^3.1.0, meow@^3.4.2, meow@^3.7.0: +meow@^3.1.0, meow@^3.7.0: version "3.7.0" resolved "https://registry.yarnpkg.com/meow/-/meow-3.7.0.tgz#72cb668b425228290abbfa856892587308a801fb" dependencies: @@ -3924,6 +4126,10 @@ meow@^3.1.0, meow@^3.4.2, meow@^3.7.0: redent "^1.0.0" trim-newlines "^1.0.0" +merge-descriptors@~1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/merge-descriptors/-/merge-descriptors-1.0.1.tgz#b00aaa556dd8b44568150ec9d1b953f3f90cbb61" + micromatch@^2.1.5: version "2.3.11" resolved "https://registry.yarnpkg.com/micromatch/-/micromatch-2.3.11.tgz#86677c97d1720b363431d04d0d15293bd38c1565" @@ -3943,29 +4149,33 @@ micromatch@^2.1.5: regex-cache "^0.4.2" miller-rabin@^4.0.0: - version "4.0.0" - resolved "https://registry.yarnpkg.com/miller-rabin/-/miller-rabin-4.0.0.tgz#4a62fb1d42933c05583982f4c716f6fb9e6c6d3d" + version "4.0.1" + resolved "https://registry.yarnpkg.com/miller-rabin/-/miller-rabin-4.0.1.tgz#f080351c865b0dc562a8462966daa53543c78a4d" dependencies: bn.js "^4.0.0" brorand "^1.0.1" -mime-db@~1.30.0: - version "1.30.0" - resolved "https://registry.yarnpkg.com/mime-db/-/mime-db-1.30.0.tgz#74c643da2dd9d6a45399963465b26d5ca7d71f01" +mime-db@~1.33.0: + version "1.33.0" + resolved "https://registry.yarnpkg.com/mime-db/-/mime-db-1.33.0.tgz#a3492050a5cb9b63450541e39d9788d2272783db" mime-types@^2.1.12, mime-types@~2.1.17, mime-types@~2.1.7: - version "2.1.17" - resolved "https://registry.yarnpkg.com/mime-types/-/mime-types-2.1.17.tgz#09d7a393f03e995a79f8af857b70a9e0ab16557a" + version "2.1.18" + resolved "https://registry.yarnpkg.com/mime-types/-/mime-types-2.1.18.tgz#6f323f60a83d11146f831ff11fd66e2fe5503bb8" dependencies: - mime-db "~1.30.0" + mime-db "~1.33.0" -mime@^1.3.6: - version "1.4.1" - resolved "https://registry.yarnpkg.com/mime/-/mime-1.4.1.tgz#121f9ebc49e3766f311a76e1fa1c8003c4b03aa6" +mime@^2.2.0: + version "2.2.0" + resolved "https://registry.yarnpkg.com/mime/-/mime-2.2.0.tgz#161e541965551d3b549fa1114391e3a3d55b923b" mimic-fn@^1.0.0: - version "1.1.0" - resolved "https://registry.yarnpkg.com/mimic-fn/-/mimic-fn-1.1.0.tgz#e667783d92e89dbd342818b5230b9d62a672ad18" + version "1.2.0" + resolved "https://registry.yarnpkg.com/mimic-fn/-/mimic-fn-1.2.0.tgz#820c86a39334640e99516928bd03fca88057d022" + +mimic-response@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/mimic-response/-/mimic-response-1.0.0.tgz#df3d3652a73fded6b9b0b24146e6fd052353458e" minimalistic-assert@^1.0.0: version "1.0.0" @@ -3975,7 +4185,7 @@ minimalistic-crypto-utils@^1.0.0, minimalistic-crypto-utils@^1.0.1: version "1.0.1" resolved "https://registry.yarnpkg.com/minimalistic-crypto-utils/-/minimalistic-crypto-utils-1.0.1.tgz#f6c00c1c0b082246e5c4d99dfb8c7c083b2b582a" -"minimatch@2 || 3", minimatch@^3.0.0, minimatch@^3.0.2, minimatch@^3.0.3, minimatch@^3.0.4, minimatch@~3.0.2: +minimatch@^3.0.0, minimatch@^3.0.2, minimatch@^3.0.4, minimatch@~3.0.2: version "3.0.4" resolved "https://registry.yarnpkg.com/minimatch/-/minimatch-3.0.4.tgz#5166e286457f03306064be5497e8dbb0c3d32083" dependencies: @@ -3993,6 +4203,21 @@ minimist@~0.0.1: version "0.0.10" resolved "https://registry.yarnpkg.com/minimist/-/minimist-0.0.10.tgz#de3f98543dbf96082be48ad1a0c7cda836301dcf" +mississippi@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/mississippi/-/mississippi-2.0.0.tgz#3442a508fafc28500486feea99409676e4ee5a6f" + dependencies: + concat-stream "^1.5.0" + duplexify "^3.4.2" + end-of-stream "^1.1.0" + flush-write-stream "^1.0.0" + from2 "^2.1.0" + parallel-transform "^1.1.0" + pump "^2.0.1" + pumpify "^1.3.3" + stream-each "^1.1.0" + through2 "^2.0.0" + mkdirp@0.5.0: version "0.5.0" resolved "https://registry.yarnpkg.com/mkdirp/-/mkdirp-0.5.0.tgz#1d73076a6df986cd9344e15e71fcc05a4c9abf12" @@ -4005,18 +4230,37 @@ mkdirp@0.5.0: dependencies: minimist "0.0.8" -mousetrap@1.6.1: +module-not-found-error@^1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/module-not-found-error/-/module-not-found-error-1.0.1.tgz#cf8b4ff4f29640674d6cdd02b0e3bc523c2bbdc0" + +mousetrap@chabou/mousetrap#useCapture: version "1.6.1" - resolved "https://registry.yarnpkg.com/mousetrap/-/mousetrap-1.6.1.tgz#2a085f5c751294c75e7e81f6ec2545b29cbf42d9" + resolved "https://codeload.github.com/chabou/mousetrap/tar.gz/c95eeeaafba1131dd8d35bc130d4a79b2ff9261a" + +move-concurrently@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/move-concurrently/-/move-concurrently-1.0.1.tgz#be2c005fda32e0b29af1f05d7c4b33214c701f92" + dependencies: + aproba "^1.1.1" + copy-concurrently "^1.0.0" + fs-write-stream-atomic "^1.0.8" + mkdirp "^0.5.1" + rimraf "^2.5.4" + run-queue "^1.0.3" -ms@0.7.1: - version "0.7.1" - resolved "https://registry.yarnpkg.com/ms/-/ms-0.7.1.tgz#9cd13c03adbff25b65effde7ce864ee952017098" +mri@1.1.0: + version "1.1.0" + resolved "https://registry.yarnpkg.com/mri/-/mri-1.1.0.tgz#5c0a3f29c8ccffbbb1ec941dcec09d71fa32f36a" -ms@2.0.0, ms@^2.0.0: +ms@2.0.0: version "2.0.0" resolved "https://registry.yarnpkg.com/ms/-/ms-2.0.0.tgz#5608aeadfc00be6c2901df5f9861788de0d597c8" +ms@2.1.1, ms@^2.0.0: + version "2.1.1" + resolved "https://registry.yarnpkg.com/ms/-/ms-2.1.1.tgz#30a5864eb3ebb0a66f2ebe6d727af06a09d86e0a" + multimatch@^2.1.0: version "2.1.0" resolved "https://registry.yarnpkg.com/multimatch/-/multimatch-2.1.0.tgz#9c7906a22fb4c02919e2f5f75161b4cdbd4b2a2b" @@ -4026,37 +4270,23 @@ multimatch@^2.1.0: arrify "^1.0.0" minimatch "^3.0.0" -mute-stream@0.0.5: - version "0.0.5" - resolved "https://registry.yarnpkg.com/mute-stream/-/mute-stream-0.0.5.tgz#8fbfabb0a98a253d3184331f9e8deb7372fac6c0" - mute-stream@0.0.7: version "0.0.7" resolved "https://registry.yarnpkg.com/mute-stream/-/mute-stream-0.0.7.tgz#3075ce93bc21b8fab43e1bc4da7e8115ed1e7bab" nan@^2.3.0: - version "2.7.0" - resolved "https://registry.yarnpkg.com/nan/-/nan-2.7.0.tgz#d95bf721ec877e08db276ed3fc6eb78f9083ad46" + version "2.8.0" + resolved "https://registry.yarnpkg.com/nan/-/nan-2.8.0.tgz#ed715f3fe9de02b57a5e6252d90a96675e1f085a" natural-compare@^1.4.0: version "1.4.0" resolved "https://registry.yarnpkg.com/natural-compare/-/natural-compare-1.4.0.tgz#4abebfeed7541f2c27acfb29bdbbd15c8d5ba4f7" node-abi@^2.0.0: - version "2.1.1" - resolved "https://registry.yarnpkg.com/node-abi/-/node-abi-2.1.1.tgz#c9cda256ec8aa99bcab2f6446db38af143338b2a" - -node-dir@^0.1.10: - version "0.1.17" - resolved "https://registry.yarnpkg.com/node-dir/-/node-dir-0.1.17.tgz#5f5665d93351335caabef8f1c554516cf5f1e4e5" - dependencies: - minimatch "^3.0.2" - -node-emoji@^1.8.1: - version "1.8.1" - resolved "https://registry.yarnpkg.com/node-emoji/-/node-emoji-1.8.1.tgz#6eec6bfb07421e2148c75c6bba72421f8530a826" + version "2.2.0" + resolved "https://registry.yarnpkg.com/node-abi/-/node-abi-2.2.0.tgz#e802ac7a2408e2c0593fb3176ffdf8a99a9b4dec" dependencies: - lodash.toarray "^4.4.0" + semver "^5.4.1" node-fetch@^1.0.1: version "1.7.3" @@ -4084,37 +4314,38 @@ node-gyp@3.6.2, node-gyp@^3.6.0: which "1" node-libs-browser@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/node-libs-browser/-/node-libs-browser-2.0.0.tgz#a3a59ec97024985b46e958379646f96c4b616646" + version "2.1.0" + resolved "https://registry.yarnpkg.com/node-libs-browser/-/node-libs-browser-2.1.0.tgz#5f94263d404f6e44767d726901fff05478d600df" dependencies: assert "^1.1.1" - browserify-zlib "^0.1.4" + browserify-zlib "^0.2.0" buffer "^4.3.0" console-browserify "^1.1.0" constants-browserify "^1.0.0" crypto-browserify "^3.11.0" domain-browser "^1.1.1" events "^1.0.0" - https-browserify "0.0.1" - os-browserify "^0.2.0" + https-browserify "^1.0.0" + os-browserify "^0.3.0" path-browserify "0.0.0" - process "^0.11.0" + process "^0.11.10" punycode "^1.2.4" querystring-es3 "^0.2.0" - readable-stream "^2.0.5" + readable-stream "^2.3.3" stream-browserify "^2.0.1" - stream-http "^2.3.1" - string_decoder "^0.10.25" - timers-browserify "^2.0.2" + stream-http "^2.7.2" + string_decoder "^1.0.0" + timers-browserify "^2.0.4" tty-browserify "0.0.0" url "^0.11.0" util "^0.10.3" vm-browserify "0.0.4" -node-pre-gyp@^0.6.36: - version "0.6.38" - resolved "https://registry.yarnpkg.com/node-pre-gyp/-/node-pre-gyp-0.6.38.tgz#e92a20f83416415bb4086f6d1fb78b3da73d113d" +node-pre-gyp@^0.6.39: + version "0.6.39" + resolved "https://registry.yarnpkg.com/node-pre-gyp/-/node-pre-gyp-0.6.39.tgz#c00e96860b23c0e1420ac7befc5044e1d78d8649" dependencies: + detect-libc "^1.0.2" hawk "3.1.3" mkdirp "^0.5.1" nopt "^4.0.1" @@ -4158,6 +4389,19 @@ normalize-path@^2.0.0, normalize-path@^2.0.1: dependencies: remove-trailing-separator "^1.0.1" +normalize-range@^0.1.2: + version "0.1.2" + resolved "https://registry.yarnpkg.com/normalize-range/-/normalize-range-0.1.2.tgz#2d10c06bdfd312ea9777695a4d28439456b75942" + +normalize-url@^1.4.0, normalize-url@^1.9.1: + version "1.9.1" + resolved "https://registry.yarnpkg.com/normalize-url/-/normalize-url-1.9.1.tgz#2cc0d66b31ea23036458436e3620d85954c66c3c" + dependencies: + object-assign "^4.0.1" + prepend-http "^1.0.0" + query-string "^4.1.0" + sort-keys "^1.0.0" + npm-install-package@~2.1.0: version "2.1.0" resolved "https://registry.yarnpkg.com/npm-install-package/-/npm-install-package-2.1.0.tgz#d7efe3cfcd7ab00614b896ea53119dc9ab259125" @@ -4189,6 +4433,10 @@ nugget@^2.0.0, nugget@^2.0.1: single-line-log "^1.1.2" throttleit "0.0.2" +num2fraction@^1.2.2: + version "1.2.2" + resolved "https://registry.yarnpkg.com/num2fraction/-/num2fraction-1.2.2.tgz#6f682b6a027a4e9ddfa4564cd2589d1d4e669ede" + number-is-nan@^1.0.0: version "1.0.1" resolved "https://registry.yarnpkg.com/number-is-nan/-/number-is-nan-1.0.1.tgz#097b602b53422a522c1afb8790318336941a011d" @@ -4197,10 +4445,6 @@ oauth-sign@~0.8.1, oauth-sign@~0.8.2: version "0.8.2" resolved "https://registry.yarnpkg.com/oauth-sign/-/oauth-sign-0.8.2.tgz#46a6ab7f0aead8deae9ec0565780b7d4efeb9d43" -obj-props@^1.0.0: - version "1.1.0" - resolved "https://registry.yarnpkg.com/obj-props/-/obj-props-1.1.0.tgz#626313faa442befd4a44e9a02c3cb6bde937b511" - object-assign@^4.0.1, object-assign@^4.1.0, object-assign@^4.1.1: version "4.1.1" resolved "https://registry.yarnpkg.com/object-assign/-/object-assign-4.1.1.tgz#2109adc7965887cfc05cbbd442cac8bfbb360863" @@ -4227,22 +4471,24 @@ observable-to-promise@^0.5.0: is-observable "^0.2.0" symbol-observable "^1.0.4" -once@^1.3.0, once@^1.3.3, once@^1.4.0: +once@^1.3.0, once@^1.3.1, once@^1.3.3, once@^1.4.0: version "1.4.0" resolved "https://registry.yarnpkg.com/once/-/once-1.4.0.tgz#583b1aa775961d4b113ac17d9c50baef9dd76bd1" dependencies: wrappy "1" -onetime@^1.0.0: - version "1.1.0" - resolved "https://registry.yarnpkg.com/onetime/-/onetime-1.1.0.tgz#a1f7838f8314c516f05ecefcbc4ccfe04b4ed789" - onetime@^2.0.0: version "2.0.1" resolved "https://registry.yarnpkg.com/onetime/-/onetime-2.0.1.tgz#067428230fd67443b2794b22bba528b6867962d4" dependencies: mimic-fn "^1.0.0" +opn@5.3.0: + version "5.3.0" + resolved "https://registry.yarnpkg.com/opn/-/opn-5.3.0.tgz#64871565c863875f052cfdf53d3e3cb5adb53b1c" + dependencies: + is-wsl "^1.1.0" + optimist@~0.6.1: version "0.6.1" resolved "https://registry.yarnpkg.com/optimist/-/optimist-0.6.1.tgz#da3ea74686fa21a19a111c326e90eb15a0196686" @@ -4265,7 +4511,7 @@ optionator@^0.8.2: type-check "~0.3.2" wordwrap "~1.0.0" -ora@^1.2.0: +ora@1.3.0: version "1.3.0" resolved "https://registry.yarnpkg.com/ora/-/ora-1.3.0.tgz#80078dd2b92a934af66a3ad72a5b910694ede51a" dependencies: @@ -4274,9 +4520,18 @@ ora@^1.2.0: cli-spinners "^1.0.0" log-symbols "^1.0.2" -os-browserify@^0.2.0: - version "0.2.1" - resolved "https://registry.yarnpkg.com/os-browserify/-/os-browserify-0.2.1.tgz#63fc4ccee5d2d7763d26bbf8601078e6c2e0044f" +ora@^1.2.0: + version "1.4.0" + resolved "https://registry.yarnpkg.com/ora/-/ora-1.4.0.tgz#884458215b3a5d4097592285f93321bb7a79e2e5" + dependencies: + chalk "^2.1.0" + cli-cursor "^2.1.0" + cli-spinners "^1.0.1" + log-symbols "^2.1.0" + +os-browserify@^0.3.0: + version "0.3.0" + resolved "https://registry.yarnpkg.com/os-browserify/-/os-browserify-0.3.0.tgz#854373c7f5c2315914fc9bfc6bd8238fdda1ec27" os-homedir@^1.0.0: version "1.0.2" @@ -4301,8 +4556,8 @@ os-tmpdir@^1.0.0, os-tmpdir@^1.0.1, os-tmpdir@~1.0.2: resolved "https://registry.yarnpkg.com/os-tmpdir/-/os-tmpdir-1.0.2.tgz#bbe67406c79aa85c5cfec766fe5734555dfa1274" osenv@0, osenv@^0.1.4: - version "0.1.4" - resolved "https://registry.yarnpkg.com/osenv/-/osenv-0.1.4.tgz#42fe6d5953df06c8064be6f176c3d05aaaa34644" + version "0.1.5" + resolved "https://registry.yarnpkg.com/osenv/-/osenv-0.1.5.tgz#85cdfafaeb28e8677f416e287592b5f3f49ea410" dependencies: os-homedir "^1.0.0" os-tmpdir "^1.0.0" @@ -4315,13 +4570,19 @@ output-file-sync@^1.1.2: mkdirp "^0.5.1" object-assign "^4.1.0" +p-cancelable@^0.3.0: + version "0.3.0" + resolved "https://registry.yarnpkg.com/p-cancelable/-/p-cancelable-0.3.0.tgz#b9e123800bcebb7ac13a479be195b507b98d30fa" + p-finally@^1.0.0: version "1.0.0" resolved "https://registry.yarnpkg.com/p-finally/-/p-finally-1.0.0.tgz#3fbcfb15b899a44123b34b6dcc18b724336a2cae" -p-limit@^1.1.0: - version "1.1.0" - resolved "https://registry.yarnpkg.com/p-limit/-/p-limit-1.1.0.tgz#b07ff2d9a5d88bec806035895a2bab66a27988bc" +p-limit@^1.0.0, p-limit@^1.1.0: + version "1.2.0" + resolved "https://registry.yarnpkg.com/p-limit/-/p-limit-1.2.0.tgz#0e92b6bedcb59f022c13d0f1949dc82d15909f1c" + dependencies: + p-try "^1.0.0" p-locate@^2.0.0: version "2.0.0" @@ -4329,6 +4590,16 @@ p-locate@^2.0.0: dependencies: p-limit "^1.1.0" +p-timeout@^1.1.1: + version "1.2.1" + resolved "https://registry.yarnpkg.com/p-timeout/-/p-timeout-1.2.1.tgz#5eb3b353b7fce99f101a1038880bb054ebbea386" + dependencies: + p-finally "^1.0.0" + +p-try@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/p-try/-/p-try-1.0.0.tgz#cbc79cdbaf8fd4228e13f621f2b1a237c1b207b3" + package-hash@^1.2.0: version "1.2.0" resolved "https://registry.yarnpkg.com/package-hash/-/package-hash-1.2.0.tgz#003e56cd57b736a6ed6114cc2b81542672770e44" @@ -4353,9 +4624,17 @@ package-json@^4.0.0: registry-url "^3.0.3" semver "^5.1.0" -pako@~0.2.0: - version "0.2.9" - resolved "https://registry.yarnpkg.com/pako/-/pako-0.2.9.tgz#f3f7522f4ef782348da8161bad9ecfd51bf83a75" +pako@~1.0.5: + version "1.0.6" + resolved "https://registry.yarnpkg.com/pako/-/pako-1.0.6.tgz#0101211baa70c4bca4a0f63f2206e97b7dfaf258" + +parallel-transform@^1.1.0: + version "1.1.0" + resolved "https://registry.yarnpkg.com/parallel-transform/-/parallel-transform-1.1.0.tgz#d410f065b05da23081fcd10f28854c29bda33b06" + dependencies: + cyclist "~0.2.2" + inherits "^2.0.3" + readable-stream "^2.1.5" parse-asn1@^5.0.0: version "5.1.0" @@ -4388,6 +4667,13 @@ parse-json@^2.2.0: dependencies: error-ex "^1.2.0" +parse-json@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/parse-json/-/parse-json-4.0.0.tgz#be35f5425be1f7f6c747184f98a788cb99477ee0" + dependencies: + error-ex "^1.3.1" + json-parse-better-errors "^1.0.1" + parse-ms@^0.1.0: version "0.1.2" resolved "https://registry.yarnpkg.com/parse-ms/-/parse-ms-0.1.2.tgz#dd3fa25ed6c2efc7bdde12ad9b46c163aa29224e" @@ -4396,6 +4682,22 @@ parse-ms@^1.0.0: version "1.0.1" resolved "https://registry.yarnpkg.com/parse-ms/-/parse-ms-1.0.1.tgz#56346d4749d78f23430ca0c713850aef91aa361d" +parse-path@^3.0.1: + version "3.0.2" + resolved "https://registry.yarnpkg.com/parse-path/-/parse-path-3.0.2.tgz#4686980f0b262ee2dbb9a64eef739c91edc85245" + dependencies: + is-ssh "^1.3.0" + protocols "^1.4.0" + +parse-url@3.0.2: + version "3.0.2" + resolved "https://registry.yarnpkg.com/parse-url/-/parse-url-3.0.2.tgz#602787a7063a795d72b8673197505e72f60610be" + dependencies: + is-ssh "^1.3.0" + normalize-url "^1.9.1" + parse-path "^3.0.1" + protocols "^1.4.0" + path-browserify@0.0.0: version "0.0.0" resolved "https://registry.yarnpkg.com/path-browserify/-/path-browserify-0.0.0.tgz#a0b870729aae214005b7d5032ec2cbbb0fb4451a" @@ -4414,7 +4716,7 @@ path-is-absolute@^1.0.0, path-is-absolute@^1.0.1: version "1.0.1" resolved "https://registry.yarnpkg.com/path-is-absolute/-/path-is-absolute-1.0.1.tgz#174b9268735534ffbc7ace6bf53a5a9e1b5c5f5f" -path-is-inside@^1.0.1: +path-is-inside@^1.0.1, path-is-inside@^1.0.2: version "1.0.2" resolved "https://registry.yarnpkg.com/path-is-inside/-/path-is-inside-1.0.2.tgz#365417dede44430d1c11af61027facf074bdfc53" @@ -4422,10 +4724,6 @@ path-key@^2.0.0: version "2.0.1" resolved "https://registry.yarnpkg.com/path-key/-/path-key-2.0.1.tgz#411cadb574c5a140d3a4b1910d40d80cc9f40b40" -path-parse@^1.0.5: - version "1.0.5" - resolved "https://registry.yarnpkg.com/path-parse/-/path-parse-1.0.5.tgz#3c1adf871ea9cd6c9431b6ea2bd74a0ff055c4c1" - path-type@^1.0.0: version "1.1.0" resolved "https://registry.yarnpkg.com/path-type/-/path-type-1.1.0.tgz#59c44f7ee491da704da415da5a4070ba4f8fe441" @@ -4440,6 +4738,12 @@ path-type@^2.0.0: dependencies: pify "^2.0.0" +path-type@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/path-type/-/path-type-3.0.0.tgz#cef31dc8e0a1a3bb0d105c0cd97cf3bf47f4e36f" + dependencies: + pify "^3.0.0" + pbkdf2@^3.0.3: version "3.0.14" resolved "https://registry.yarnpkg.com/pbkdf2/-/pbkdf2-3.0.14.tgz#a35e13c64799b06ce15320f459c230e68e73bade" @@ -4466,7 +4770,11 @@ php-escape-shell@1.0.0: version "1.0.0" resolved "https://registry.yarnpkg.com/php-escape-shell/-/php-escape-shell-1.0.0.tgz#7d589611f91c2ff6f3fe6591c91478c05c610879" -pify@^2.0.0, pify@^2.3.0: +pify@3.0.0, pify@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/pify/-/pify-3.0.0.tgz#e5a4acd2c101fdf3d9a4d07f0dbc4db49dd28176" + +pify@^2.0.0: version "2.3.0" resolved "https://registry.yarnpkg.com/pify/-/pify-2.3.0.tgz#ed141a6ac043a849ea588498e7dca8b15330e90c" @@ -4491,17 +4799,11 @@ pinkie@^2.0.0: resolved "https://registry.yarnpkg.com/pinkie/-/pinkie-2.0.4.tgz#72556b80cfa0d48a974e80e77248e80ed4f7f870" pkg-conf@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/pkg-conf/-/pkg-conf-2.0.0.tgz#071c87650403bccfb9c627f58751bfe47c067279" + version "2.1.0" + resolved "https://registry.yarnpkg.com/pkg-conf/-/pkg-conf-2.1.0.tgz#2126514ca6f2abfebd168596df18ba57867f0058" dependencies: find-up "^2.0.0" - load-json-file "^2.0.0" - -pkg-dir@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/pkg-dir/-/pkg-dir-1.0.0.tgz#7a4b508a8d5bb2d629d447056ff4e9c9314cf3d4" - dependencies: - find-up "^1.0.0" + load-json-file "^4.0.0" pkg-dir@^2.0.0: version "2.0.0" @@ -4509,11 +4811,9 @@ pkg-dir@^2.0.0: dependencies: find-up "^2.1.0" -pkg-up@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/pkg-up/-/pkg-up-2.0.0.tgz#c819ac728059a461cab1c3889a2be3c49a004d7f" - dependencies: - find-up "^2.1.0" +pkginfo@0.4.1: + version "0.4.1" + resolved "https://registry.yarnpkg.com/pkginfo/-/pkginfo-0.4.1.tgz#b5418ef0439de5425fc4995042dced14fb2a84ff" plist@^2.1.0: version "2.1.0" @@ -4523,25 +4823,267 @@ plist@^2.1.0: xmlbuilder "8.2.2" xmldom "0.1.x" -plur@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/plur/-/plur-1.0.0.tgz#db85c6814f5e5e5a3b49efc28d604fec62975156" - plur@^2.0.0, plur@^2.1.2: version "2.1.2" resolved "https://registry.yarnpkg.com/plur/-/plur-2.1.2.tgz#7482452c1a0f508e3e344eaec312c91c29dc655a" dependencies: irregular-plurals "^1.0.0" -pluralize@^1.2.1: - version "1.2.1" - resolved "https://registry.yarnpkg.com/pluralize/-/pluralize-1.2.1.tgz#d1a21483fd22bb41e58a12fa3421823140897c45" +pluralize@^7.0.0: + version "7.0.0" + resolved "https://registry.yarnpkg.com/pluralize/-/pluralize-7.0.0.tgz#298b89df8b93b0221dbf421ad2b1b1ea23fc6777" + +postcss-calc@^5.2.0: + version "5.3.1" + resolved "https://registry.yarnpkg.com/postcss-calc/-/postcss-calc-5.3.1.tgz#77bae7ca928ad85716e2fda42f261bf7c1d65b5e" + dependencies: + postcss "^5.0.2" + postcss-message-helpers "^2.0.0" + reduce-css-calc "^1.2.6" + +postcss-colormin@^2.1.8: + version "2.2.2" + resolved "https://registry.yarnpkg.com/postcss-colormin/-/postcss-colormin-2.2.2.tgz#6631417d5f0e909a3d7ec26b24c8a8d1e4f96e4b" + dependencies: + colormin "^1.0.5" + postcss "^5.0.13" + postcss-value-parser "^3.2.3" + +postcss-convert-values@^2.3.4: + version "2.6.1" + resolved "https://registry.yarnpkg.com/postcss-convert-values/-/postcss-convert-values-2.6.1.tgz#bbd8593c5c1fd2e3d1c322bb925dcae8dae4d62d" + dependencies: + postcss "^5.0.11" + postcss-value-parser "^3.1.2" + +postcss-discard-comments@^2.0.4: + version "2.0.4" + resolved "https://registry.yarnpkg.com/postcss-discard-comments/-/postcss-discard-comments-2.0.4.tgz#befe89fafd5b3dace5ccce51b76b81514be00e3d" + dependencies: + postcss "^5.0.14" + +postcss-discard-duplicates@^2.0.1: + version "2.1.0" + resolved "https://registry.yarnpkg.com/postcss-discard-duplicates/-/postcss-discard-duplicates-2.1.0.tgz#b9abf27b88ac188158a5eb12abcae20263b91932" + dependencies: + postcss "^5.0.4" + +postcss-discard-empty@^2.0.1: + version "2.1.0" + resolved "https://registry.yarnpkg.com/postcss-discard-empty/-/postcss-discard-empty-2.1.0.tgz#d2b4bd9d5ced5ebd8dcade7640c7d7cd7f4f92b5" + dependencies: + postcss "^5.0.14" + +postcss-discard-overridden@^0.1.1: + version "0.1.1" + resolved "https://registry.yarnpkg.com/postcss-discard-overridden/-/postcss-discard-overridden-0.1.1.tgz#8b1eaf554f686fb288cd874c55667b0aa3668d58" + dependencies: + postcss "^5.0.16" + +postcss-discard-unused@^2.2.1: + version "2.2.3" + resolved "https://registry.yarnpkg.com/postcss-discard-unused/-/postcss-discard-unused-2.2.3.tgz#bce30b2cc591ffc634322b5fb3464b6d934f4433" + dependencies: + postcss "^5.0.14" + uniqs "^2.0.0" + +postcss-filter-plugins@^2.0.0: + version "2.0.2" + resolved "https://registry.yarnpkg.com/postcss-filter-plugins/-/postcss-filter-plugins-2.0.2.tgz#6d85862534d735ac420e4a85806e1f5d4286d84c" + dependencies: + postcss "^5.0.4" + uniqid "^4.0.0" + +postcss-merge-idents@^2.1.5: + version "2.1.7" + resolved "https://registry.yarnpkg.com/postcss-merge-idents/-/postcss-merge-idents-2.1.7.tgz#4c5530313c08e1d5b3bbf3d2bbc747e278eea270" + dependencies: + has "^1.0.1" + postcss "^5.0.10" + postcss-value-parser "^3.1.1" + +postcss-merge-longhand@^2.0.1: + version "2.0.2" + resolved "https://registry.yarnpkg.com/postcss-merge-longhand/-/postcss-merge-longhand-2.0.2.tgz#23d90cd127b0a77994915332739034a1a4f3d658" + dependencies: + postcss "^5.0.4" + +postcss-merge-rules@^2.0.3: + version "2.1.2" + resolved "https://registry.yarnpkg.com/postcss-merge-rules/-/postcss-merge-rules-2.1.2.tgz#d1df5dfaa7b1acc3be553f0e9e10e87c61b5f721" + dependencies: + browserslist "^1.5.2" + caniuse-api "^1.5.2" + postcss "^5.0.4" + postcss-selector-parser "^2.2.2" + vendors "^1.0.0" + +postcss-message-helpers@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/postcss-message-helpers/-/postcss-message-helpers-2.0.0.tgz#a4f2f4fab6e4fe002f0aed000478cdf52f9ba60e" + +postcss-minify-font-values@^1.0.2: + version "1.0.5" + resolved "https://registry.yarnpkg.com/postcss-minify-font-values/-/postcss-minify-font-values-1.0.5.tgz#4b58edb56641eba7c8474ab3526cafd7bbdecb69" + dependencies: + object-assign "^4.0.1" + postcss "^5.0.4" + postcss-value-parser "^3.0.2" + +postcss-minify-gradients@^1.0.1: + version "1.0.5" + resolved "https://registry.yarnpkg.com/postcss-minify-gradients/-/postcss-minify-gradients-1.0.5.tgz#5dbda11373703f83cfb4a3ea3881d8d75ff5e6e1" + dependencies: + postcss "^5.0.12" + postcss-value-parser "^3.3.0" + +postcss-minify-params@^1.0.4: + version "1.2.2" + resolved "https://registry.yarnpkg.com/postcss-minify-params/-/postcss-minify-params-1.2.2.tgz#ad2ce071373b943b3d930a3fa59a358c28d6f1f3" + dependencies: + alphanum-sort "^1.0.1" + postcss "^5.0.2" + postcss-value-parser "^3.0.2" + uniqs "^2.0.0" + +postcss-minify-selectors@^2.0.4: + version "2.1.1" + resolved "https://registry.yarnpkg.com/postcss-minify-selectors/-/postcss-minify-selectors-2.1.1.tgz#b2c6a98c0072cf91b932d1a496508114311735bf" + dependencies: + alphanum-sort "^1.0.2" + has "^1.0.1" + postcss "^5.0.14" + postcss-selector-parser "^2.0.0" + +postcss-modules-extract-imports@^1.2.0: + version "1.2.0" + resolved "https://registry.yarnpkg.com/postcss-modules-extract-imports/-/postcss-modules-extract-imports-1.2.0.tgz#66140ecece38ef06bf0d3e355d69bf59d141ea85" + dependencies: + postcss "^6.0.1" + +postcss-modules-local-by-default@^1.2.0: + version "1.2.0" + resolved "https://registry.yarnpkg.com/postcss-modules-local-by-default/-/postcss-modules-local-by-default-1.2.0.tgz#f7d80c398c5a393fa7964466bd19500a7d61c069" + dependencies: + css-selector-tokenizer "^0.7.0" + postcss "^6.0.1" + +postcss-modules-scope@^1.1.0: + version "1.1.0" + resolved "https://registry.yarnpkg.com/postcss-modules-scope/-/postcss-modules-scope-1.1.0.tgz#d6ea64994c79f97b62a72b426fbe6056a194bb90" + dependencies: + css-selector-tokenizer "^0.7.0" + postcss "^6.0.1" + +postcss-modules-values@^1.3.0: + version "1.3.0" + resolved "https://registry.yarnpkg.com/postcss-modules-values/-/postcss-modules-values-1.3.0.tgz#ecffa9d7e192518389f42ad0e83f72aec456ea20" + dependencies: + icss-replace-symbols "^1.1.0" + postcss "^6.0.1" + +postcss-normalize-charset@^1.1.0: + version "1.1.1" + resolved "https://registry.yarnpkg.com/postcss-normalize-charset/-/postcss-normalize-charset-1.1.1.tgz#ef9ee71212d7fe759c78ed162f61ed62b5cb93f1" + dependencies: + postcss "^5.0.5" + +postcss-normalize-url@^3.0.7: + version "3.0.8" + resolved "https://registry.yarnpkg.com/postcss-normalize-url/-/postcss-normalize-url-3.0.8.tgz#108f74b3f2fcdaf891a2ffa3ea4592279fc78222" + dependencies: + is-absolute-url "^2.0.0" + normalize-url "^1.4.0" + postcss "^5.0.14" + postcss-value-parser "^3.2.3" + +postcss-ordered-values@^2.1.0: + version "2.2.3" + resolved "https://registry.yarnpkg.com/postcss-ordered-values/-/postcss-ordered-values-2.2.3.tgz#eec6c2a67b6c412a8db2042e77fe8da43f95c11d" + dependencies: + postcss "^5.0.4" + postcss-value-parser "^3.0.1" + +postcss-reduce-idents@^2.2.2: + version "2.4.0" + resolved "https://registry.yarnpkg.com/postcss-reduce-idents/-/postcss-reduce-idents-2.4.0.tgz#c2c6d20cc958284f6abfbe63f7609bf409059ad3" + dependencies: + postcss "^5.0.4" + postcss-value-parser "^3.0.2" + +postcss-reduce-initial@^1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/postcss-reduce-initial/-/postcss-reduce-initial-1.0.1.tgz#68f80695f045d08263a879ad240df8dd64f644ea" + dependencies: + postcss "^5.0.4" + +postcss-reduce-transforms@^1.0.3: + version "1.0.4" + resolved "https://registry.yarnpkg.com/postcss-reduce-transforms/-/postcss-reduce-transforms-1.0.4.tgz#ff76f4d8212437b31c298a42d2e1444025771ae1" + dependencies: + has "^1.0.1" + postcss "^5.0.8" + postcss-value-parser "^3.0.1" + +postcss-selector-parser@^2.0.0, postcss-selector-parser@^2.2.2: + version "2.2.3" + resolved "https://registry.yarnpkg.com/postcss-selector-parser/-/postcss-selector-parser-2.2.3.tgz#f9437788606c3c9acee16ffe8d8b16297f27bb90" + dependencies: + flatten "^1.0.2" + indexes-of "^1.0.1" + uniq "^1.0.1" + +postcss-svgo@^2.1.1: + version "2.1.6" + resolved "https://registry.yarnpkg.com/postcss-svgo/-/postcss-svgo-2.1.6.tgz#b6df18aa613b666e133f08adb5219c2684ac108d" + dependencies: + is-svg "^2.0.0" + postcss "^5.0.14" + postcss-value-parser "^3.2.3" + svgo "^0.7.0" + +postcss-unique-selectors@^2.0.2: + version "2.0.2" + resolved "https://registry.yarnpkg.com/postcss-unique-selectors/-/postcss-unique-selectors-2.0.2.tgz#981d57d29ddcb33e7b1dfe1fd43b8649f933ca1d" + dependencies: + alphanum-sort "^1.0.1" + postcss "^5.0.4" + uniqs "^2.0.0" + +postcss-value-parser@^3.0.1, postcss-value-parser@^3.0.2, postcss-value-parser@^3.1.1, postcss-value-parser@^3.1.2, postcss-value-parser@^3.2.3, postcss-value-parser@^3.3.0: + version "3.3.0" + resolved "https://registry.yarnpkg.com/postcss-value-parser/-/postcss-value-parser-3.3.0.tgz#87f38f9f18f774a4ab4c8a232f5c5ce8872a9d15" + +postcss-zindex@^2.0.1: + version "2.2.0" + resolved "https://registry.yarnpkg.com/postcss-zindex/-/postcss-zindex-2.2.0.tgz#d2109ddc055b91af67fc4cb3b025946639d2af22" + dependencies: + has "^1.0.1" + postcss "^5.0.4" + uniqs "^2.0.0" + +postcss@^5.0.10, postcss@^5.0.11, postcss@^5.0.12, postcss@^5.0.13, postcss@^5.0.14, postcss@^5.0.16, postcss@^5.0.2, postcss@^5.0.4, postcss@^5.0.5, postcss@^5.0.6, postcss@^5.0.8, postcss@^5.2.16: + version "5.2.18" + resolved "https://registry.yarnpkg.com/postcss/-/postcss-5.2.18.tgz#badfa1497d46244f6390f58b319830d9107853c5" + dependencies: + chalk "^1.1.3" + js-base64 "^2.1.9" + source-map "^0.5.6" + supports-color "^3.2.3" + +postcss@^6.0.1: + version "6.0.19" + resolved "https://registry.yarnpkg.com/postcss/-/postcss-6.0.19.tgz#76a78386f670b9d9494a655bf23ac012effd1555" + dependencies: + chalk "^2.3.1" + source-map "^0.6.1" + supports-color "^5.2.0" prelude-ls@~1.1.2: version "1.1.2" resolved "https://registry.yarnpkg.com/prelude-ls/-/prelude-ls-1.1.2.tgz#21932a549f5e52ffd9a827f570e04be62a97da54" -prepend-http@^1.0.1: +prepend-http@^1.0.0, prepend-http@^1.0.1: version "1.0.4" resolved "https://registry.yarnpkg.com/prepend-http/-/prepend-http-1.0.4.tgz#d4f4562b0ce3696e41ac52d0e002e57a635dc6dc" @@ -4549,6 +5091,10 @@ preserve@^0.2.0: version "0.2.0" resolved "https://registry.yarnpkg.com/preserve/-/preserve-0.2.0.tgz#815ed1f6ebc65926f865b310c0713bcb3315ce4b" +prettier@1.11.1: + version "1.11.1" + resolved "https://registry.yarnpkg.com/prettier/-/prettier-1.11.1.tgz#61e43fc4cd44e68f2b0dfc2c38cd4bb0fccdcc75" + pretty-bytes@^1.0.2: version "1.0.4" resolved "https://registry.yarnpkg.com/pretty-bytes/-/pretty-bytes-1.0.4.tgz#0a22e8210609ad35542f8c8d5d2159aff0751c84" @@ -4562,23 +5108,22 @@ pretty-ms@^0.2.1: dependencies: parse-ms "^0.1.0" -pretty-ms@^2.0.0: - version "2.1.0" - resolved "https://registry.yarnpkg.com/pretty-ms/-/pretty-ms-2.1.0.tgz#4257c256df3fb0b451d6affaab021884126981dc" +pretty-ms@^3.0.0: + version "3.1.0" + resolved "https://registry.yarnpkg.com/pretty-ms/-/pretty-ms-3.1.0.tgz#e9cac9c76bf6ee52fe942dd9c6c4213153b12881" dependencies: - is-finite "^1.0.1" parse-ms "^1.0.0" - plur "^1.0.0" + plur "^2.1.2" -private@^0.1.7: - version "0.1.7" - resolved "https://registry.yarnpkg.com/private/-/private-0.1.7.tgz#68ce5e8a1ef0a23bb570cc28537b5332aba63ef1" +private@^0.1.7, private@~0.1.5: + version "0.1.8" + resolved "https://registry.yarnpkg.com/private/-/private-0.1.8.tgz#2381edb3689f7a53d653190060fcf822d2f368ff" -process-nextick-args@~1.0.6: - version "1.0.7" - resolved "https://registry.yarnpkg.com/process-nextick-args/-/process-nextick-args-1.0.7.tgz#150e20b756590ad3f91093f25a4f2ad8bff30ba3" +process-nextick-args@~2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/process-nextick-args/-/process-nextick-args-2.0.0.tgz#a37d732f4271b4ab1ad070d35508e8290788ffaa" -process@^0.11.0: +process@^0.11.10: version "0.11.10" resolved "https://registry.yarnpkg.com/process/-/process-0.11.10.tgz#7332300e840161bda3e69a1d1d91a7d4bc16f182" @@ -4589,9 +5134,13 @@ progress-stream@^1.1.0: speedometer "~0.1.2" through2 "~0.2.3" -progress@^1.1.8: - version "1.1.8" - resolved "https://registry.yarnpkg.com/progress/-/progress-1.1.8.tgz#e260c78f6161cdd9b0e56cc3e0a85de17c7a57be" +progress@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/progress/-/progress-2.0.0.tgz#8a1be366bf8fc23db2bd23f10c6fe920b4389d1f" + +promise-inflight@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/promise-inflight/-/promise-inflight-1.0.1.tgz#98472870bf228132fcbdd868129bad12c3c029e3" promise@^7.1.1: version "7.3.1" @@ -4600,6 +5149,14 @@ promise@^7.1.1: asap "~2.0.3" prop-types@^15.5.10: + version "15.6.1" + resolved "https://registry.yarnpkg.com/prop-types/-/prop-types-15.6.1.tgz#36644453564255ddda391191fb3a125cbdf654ca" + dependencies: + fbjs "^0.8.16" + loose-envify "^1.3.1" + object-assign "^4.1.1" + +prop-types@^15.6.0: version "15.6.0" resolved "https://registry.yarnpkg.com/prop-types/-/prop-types-15.6.0.tgz#ceaf083022fc46b4a35f69e13ef75aed0d639856" dependencies: @@ -4607,13 +5164,21 @@ prop-types@^15.5.10: loose-envify "^1.3.1" object-assign "^4.1.1" -proto-props@^0.2.0: - version "0.2.1" - resolved "https://registry.yarnpkg.com/proto-props/-/proto-props-0.2.1.tgz#5e01dc2675a0de9abfa76e799dfa334d6f483f4b" +protocols@^1.1.0, protocols@^1.4.0: + version "1.4.6" + resolved "https://registry.yarnpkg.com/protocols/-/protocols-1.4.6.tgz#f8bb263ea1b5fd7a7604d26b8be39bd77678bf8a" -prr@~0.0.0: - version "0.0.0" - resolved "https://registry.yarnpkg.com/prr/-/prr-0.0.0.tgz#1a84b85908325501411853d0081ee3fa86e2926a" +proxyquire@1.8.0: + version "1.8.0" + resolved "https://registry.yarnpkg.com/proxyquire/-/proxyquire-1.8.0.tgz#02d514a5bed986f04cbb2093af16741535f79edc" + dependencies: + fill-keys "^1.0.2" + module-not-found-error "^1.0.0" + resolve "~1.1.7" + +prr@~1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/prr/-/prr-1.0.1.tgz#d3fc114ba06995a45ec6893f484ceb1d78f5f476" pseudomap@^1.0.2: version "1.0.2" @@ -4629,6 +5194,21 @@ public-encrypt@^4.0.0: parse-asn1 "^5.0.0" randombytes "^2.0.1" +pump@^2.0.0, pump@^2.0.1: + version "2.0.1" + resolved "https://registry.yarnpkg.com/pump/-/pump-2.0.1.tgz#12399add6e4cf7526d973cbc8b5ce2e2908b3909" + dependencies: + end-of-stream "^1.1.0" + once "^1.3.1" + +pumpify@^1.3.3: + version "1.4.0" + resolved "https://registry.yarnpkg.com/pumpify/-/pumpify-1.4.0.tgz#80b7c5df7e24153d03f0e7ac8a05a5d068bd07fb" + dependencies: + duplexify "^3.5.3" + inherits "^2.0.3" + pump "^2.0.0" + punycode@1.3.2: version "1.3.2" resolved "https://registry.yarnpkg.com/punycode/-/punycode-1.3.2.tgz#9653a036fb7c1ee42342f2325cceefea3926c48d" @@ -4637,9 +5217,9 @@ punycode@^1.2.4, punycode@^1.4.1: version "1.4.1" resolved "https://registry.yarnpkg.com/punycode/-/punycode-1.4.1.tgz#c0d5a63b2718800ad8e1eb0fa5269c84dd41845e" -q@~1.5.0: - version "1.5.0" - resolved "https://registry.yarnpkg.com/q/-/q-1.5.0.tgz#dd01bac9d06d30e6f219aecb8253ee9ebdc308f1" +q@^1.1.2, q@~1.5.0: + version "1.5.1" + resolved "https://registry.yarnpkg.com/q/-/q-1.5.1.tgz#7e32f75b41381291d04611f1bf14109ac00651d7" qs@~6.4.0: version "6.4.0" @@ -4649,6 +5229,13 @@ qs@~6.5.1: version "6.5.1" resolved "https://registry.yarnpkg.com/qs/-/qs-6.5.1.tgz#349cdf6eef89ec45c12d7d5eb3fc0c870343a6d8" +query-string@^4.1.0: + version "4.3.4" + resolved "https://registry.yarnpkg.com/query-string/-/query-string-4.3.4.tgz#bbb693b9ca915c232515b228b1a02b609043dbeb" + dependencies: + object-assign "^4.1.0" + strict-uri-encode "^1.0.0" + querystring-es3@^0.2.0: version "0.2.1" resolved "https://registry.yarnpkg.com/querystring-es3/-/querystring-es3-0.2.1.tgz#9ec61f79049875707d69414596fd907a4d711e73" @@ -4664,66 +5251,74 @@ randomatic@^1.1.3: is-number "^3.0.0" kind-of "^4.0.0" -randombytes@^2.0.0, randombytes@^2.0.1: - version "2.0.5" - resolved "https://registry.yarnpkg.com/randombytes/-/randombytes-2.0.5.tgz#dc009a246b8d09a177b4b7a0ae77bc570f4b1b79" +randombytes@^2.0.0, randombytes@^2.0.1, randombytes@^2.0.5: + version "2.0.6" + resolved "https://registry.yarnpkg.com/randombytes/-/randombytes-2.0.6.tgz#d302c522948588848a8d300c932b44c24231da80" dependencies: safe-buffer "^5.1.0" -rc@^1.0.1, rc@^1.1.2, rc@^1.1.6, rc@^1.1.7, rc@^1.2.1: - version "1.2.1" - resolved "https://registry.yarnpkg.com/rc/-/rc-1.2.1.tgz#2e03e8e42ee450b8cb3dce65be1bf8974e1dfd95" +randomfill@^1.0.3: + version "1.0.4" + resolved "https://registry.yarnpkg.com/randomfill/-/randomfill-1.0.4.tgz#c92196fc86ab42be983f1bf31778224931d61458" + dependencies: + randombytes "^2.0.5" + safe-buffer "^5.1.0" + +rc@1.2.3, rc@^1.0.1, rc@^1.1.2, rc@^1.1.6, rc@^1.1.7, rc@^1.2.1: + version "1.2.3" + resolved "https://registry.yarnpkg.com/rc/-/rc-1.2.3.tgz#51575a900f8dd68381c710b4712c2154c3e2035b" dependencies: deep-extend "~0.4.0" ini "~1.3.0" minimist "^1.2.0" strip-json-comments "~2.0.1" -react-deep-force-update@2.0.1: - version "2.0.1" - resolved "https://registry.yarnpkg.com/react-deep-force-update/-/react-deep-force-update-2.0.1.tgz#4f7f6c12c3e7de42f345992a3c518236fa1ecad3" +react-deep-force-update@2.1.1: + version "2.1.1" + resolved "https://registry.yarnpkg.com/react-deep-force-update/-/react-deep-force-update-2.1.1.tgz#8ea4263cd6455a050b37445b3f08fd839d86e909" -react-dom@15.6.1: - version "15.6.1" - resolved "https://registry.yarnpkg.com/react-dom/-/react-dom-15.6.1.tgz#2cb0ed4191038e53c209eb3a79a23e2a4cf99470" +react-dom@16.2.0: + version "16.2.0" + resolved "https://registry.yarnpkg.com/react-dom/-/react-dom-16.2.0.tgz#69003178601c0ca19b709b33a83369fe6124c044" dependencies: - fbjs "^0.8.9" + fbjs "^0.8.16" loose-envify "^1.1.0" - object-assign "^4.1.0" - prop-types "^15.5.10" + object-assign "^4.1.1" + prop-types "^15.6.0" -react-redux@5.0.6: - version "5.0.6" - resolved "https://registry.yarnpkg.com/react-redux/-/react-redux-5.0.6.tgz#23ed3a4f986359d68b5212eaaa681e60d6574946" +react-redux@5.0.7: + version "5.0.7" + resolved "https://registry.yarnpkg.com/react-redux/-/react-redux-5.0.7.tgz#0dc1076d9afb4670f993ffaef44b8f8c1155a4c8" dependencies: - hoist-non-react-statics "^2.2.1" + hoist-non-react-statics "^2.5.0" invariant "^2.0.0" - lodash "^4.2.0" - lodash-es "^4.2.0" + lodash "^4.17.5" + lodash-es "^4.17.5" loose-envify "^1.1.0" - prop-types "^15.5.10" + prop-types "^15.6.0" -react@15.6.1: - version "15.6.1" - resolved "https://registry.yarnpkg.com/react/-/react-15.6.1.tgz#baa8434ec6780bde997cdc380b79cd33b96393df" +react@16.2.0: + version "16.2.0" + resolved "https://registry.yarnpkg.com/react/-/react-16.2.0.tgz#a31bd2dab89bff65d42134fa187f24d054c273ba" dependencies: - create-react-class "^15.6.0" - fbjs "^0.8.9" + fbjs "^0.8.16" loose-envify "^1.1.0" - object-assign "^4.1.0" - prop-types "^15.5.10" + object-assign "^4.1.1" + prop-types "^15.6.0" -read-config-file@1.1.0: - version "1.1.0" - resolved "https://registry.yarnpkg.com/read-config-file/-/read-config-file-1.1.0.tgz#c4abafc547571dfbaee0d0bf54ea174ffef8c3cf" +read-config-file@3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/read-config-file/-/read-config-file-3.0.0.tgz#771def5184a7f76abaf6b2c82f20cb983775b8ea" dependencies: - ajv "^5.2.2" - ajv-keywords "^2.1.0" - bluebird-lst "^1.0.3" - fs-extra-p "^4.4.0" - js-yaml "^3.9.1" + ajv "^6.1.1" + ajv-keywords "^3.1.0" + bluebird-lst "^1.0.5" + dotenv "^5.0.0" + dotenv-expand "^4.0.1" + fs-extra-p "^4.5.0" + js-yaml "^3.10.0" json5 "^0.5.1" - lazy-val "^1.0.2" + lazy-val "^1.0.3" read-pkg-up@^1.0.1: version "1.0.1" @@ -4755,14 +5350,14 @@ read-pkg@^2.0.0: normalize-package-data "^2.3.2" path-type "^2.0.0" -readable-stream@^2.0.0, readable-stream@^2.0.1, readable-stream@^2.0.2, readable-stream@^2.0.5, readable-stream@^2.0.6, readable-stream@^2.1.4, readable-stream@^2.1.5, readable-stream@^2.2.2, readable-stream@^2.2.6: - version "2.3.3" - resolved "https://registry.yarnpkg.com/readable-stream/-/readable-stream-2.3.3.tgz#368f2512d79f9d46fdfc71349ae7878bbc1eb95c" +"readable-stream@1 || 2", readable-stream@^2.0.0, readable-stream@^2.0.1, readable-stream@^2.0.2, readable-stream@^2.0.4, readable-stream@^2.0.5, readable-stream@^2.0.6, readable-stream@^2.1.4, readable-stream@^2.1.5, readable-stream@^2.2.2, readable-stream@^2.3.3: + version "2.3.4" + resolved "https://registry.yarnpkg.com/readable-stream/-/readable-stream-2.3.4.tgz#c946c3f47fa7d8eabc0b6150f4a12f69a4574071" dependencies: core-util-is "~1.0.0" inherits "~2.0.3" isarray "~1.0.0" - process-nextick-args "~1.0.6" + process-nextick-args "~2.0.0" safe-buffer "~5.1.1" string_decoder "~1.0.3" util-deprecate "~1.0.1" @@ -4785,19 +5380,14 @@ readdirp@^2.0.0: readable-stream "^2.0.2" set-immediate-shim "^1.0.1" -readline2@^1.0.1: - version "1.0.1" - resolved "https://registry.yarnpkg.com/readline2/-/readline2-1.0.1.tgz#41059608ffc154757b715d9989d199ffbf372e35" - dependencies: - code-point-at "^1.0.0" - is-fullwidth-code-point "^1.0.0" - mute-stream "0.0.5" - -rechoir@^0.6.2: - version "0.6.2" - resolved "https://registry.yarnpkg.com/rechoir/-/rechoir-0.6.2.tgz#85204b54dba82d5742e28c96756ef43af50e3384" +recast@0.13.0: + version "0.13.0" + resolved "https://registry.yarnpkg.com/recast/-/recast-0.13.0.tgz#a343a394a37d24668d700f88ed04b8d2c314d40d" dependencies: - resolve "^1.1.6" + ast-types "0.10.1" + esprima "~4.0.0" + private "~0.1.5" + source-map "~0.6.1" redent@^1.0.0: version "1.0.0" @@ -4806,11 +5396,19 @@ redent@^1.0.0: indent-string "^2.1.0" strip-indent "^1.0.1" -redux-logger@3.0.6: - version "3.0.6" - resolved "https://registry.yarnpkg.com/redux-logger/-/redux-logger-3.0.6.tgz#f7555966f3098f3c88604c449cf0baf5778274bf" +reduce-css-calc@^1.2.6: + version "1.3.0" + resolved "https://registry.yarnpkg.com/reduce-css-calc/-/reduce-css-calc-1.3.0.tgz#747c914e049614a4c9cfbba629871ad1d2927716" + dependencies: + balanced-match "^0.4.2" + math-expression-evaluator "^1.2.14" + reduce-function-call "^1.0.1" + +reduce-function-call@^1.0.1: + version "1.0.2" + resolved "https://registry.yarnpkg.com/reduce-function-call/-/reduce-function-call-1.0.2.tgz#5a200bf92e0e37751752fe45b0ab330fd4b6be99" dependencies: - deep-diff "^0.3.5" + balanced-match "^0.4.2" redux-thunk@2.2.0: version "2.2.0" @@ -4829,13 +5427,13 @@ regenerate@^1.2.1: version "1.3.3" resolved "https://registry.yarnpkg.com/regenerate/-/regenerate-1.3.3.tgz#0c336d3980553d755c39b586ae3b20aa49c82b7f" -regenerator-runtime@^0.10.0, regenerator-runtime@^0.10.5: +regenerator-runtime@^0.10.5: version "0.10.5" resolved "https://registry.yarnpkg.com/regenerator-runtime/-/regenerator-runtime-0.10.5.tgz#336c3efc1220adcedda2c9fab67b5a7955a33658" regenerator-runtime@^0.11.0: - version "0.11.0" - resolved "https://registry.yarnpkg.com/regenerator-runtime/-/regenerator-runtime-0.11.0.tgz#7e54fe5b5ccd5d6624ea6255c3473be090b802e1" + version "0.11.1" + resolved "https://registry.yarnpkg.com/regenerator-runtime/-/regenerator-runtime-0.11.1.tgz#be05ad7f9bf7d22e056f9726cee5017fbf19e2e9" regex-cache@^0.4.2: version "0.4.4" @@ -4843,6 +5441,14 @@ regex-cache@^0.4.2: dependencies: is-equal-shallow "^0.1.3" +regexpu-core@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/regexpu-core/-/regexpu-core-1.0.0.tgz#86a763f58ee4d7c2f6b102e4764050de7ed90c6b" + dependencies: + regenerate "^1.2.1" + regjsgen "^0.2.0" + regjsparser "^0.1.4" + regexpu-core@^2.0.0: version "2.0.0" resolved "https://registry.yarnpkg.com/regexpu-core/-/regexpu-core-2.0.0.tgz#49d038837b8dcf8bfa5b9a42139938e6ea2ae240" @@ -4852,8 +5458,8 @@ regexpu-core@^2.0.0: regjsparser "^0.1.4" registry-auth-token@^3.0.1: - version "3.3.1" - resolved "https://registry.yarnpkg.com/registry-auth-token/-/registry-auth-token-3.3.1.tgz#fb0d3289ee0d9ada2cbb52af5dfe66cb070d3006" + version "3.3.2" + resolved "https://registry.yarnpkg.com/registry-auth-token/-/registry-auth-token-3.3.2.tgz#851fd49038eecb586911115af845260eec983f20" dependencies: rc "^1.1.6" safe-buffer "^5.0.1" @@ -4898,9 +5504,9 @@ repeating@^2.0.0: dependencies: is-finite "^1.0.0" -request@2, request@^2.45.0, request@^2.81.0: - version "2.82.0" - resolved "https://registry.yarnpkg.com/request/-/request-2.82.0.tgz#2ba8a92cd7ac45660ea2b10a53ae67cd247516ea" +request@2, request@^2.45.0, request@^2.81.0, request@~2.83.0: + version "2.83.0" + resolved "https://registry.yarnpkg.com/request/-/request-2.83.0.tgz#ca0b65da02ed62935887808e6f510381034e3356" dependencies: aws-sign2 "~0.7.0" aws4 "^1.6.0" @@ -4921,11 +5527,11 @@ request@2, request@^2.45.0, request@^2.81.0: qs "~6.5.1" safe-buffer "^5.1.1" stringstream "~0.0.5" - tough-cookie "~2.3.2" + tough-cookie "~2.3.3" tunnel-agent "^0.6.0" uuid "^3.1.0" -request@2.81.0, request@~2.81.0: +request@2.81.0: version "2.81.0" resolved "https://registry.yarnpkg.com/request/-/request-2.81.0.tgz#c6928946a0e06c5f8d6f8a9333469ffda46298a0" dependencies: @@ -4964,7 +5570,7 @@ require-precompiled@^0.1.0: version "0.1.0" resolved "https://registry.yarnpkg.com/require-precompiled/-/require-precompiled-0.1.0.tgz#5a1b52eb70ebed43eb982e974c85ab59571e56fa" -require-uncached@^1.0.2: +require-uncached@^1.0.3: version "1.0.3" resolved "https://registry.yarnpkg.com/require-uncached/-/require-uncached-1.0.3.tgz#4e0d56d6c9662fd31e43011c4b95aa49955421d3" dependencies: @@ -4975,12 +5581,6 @@ reselect@3.0.1: version "3.0.1" resolved "https://registry.yarnpkg.com/reselect/-/reselect-3.0.1.tgz#efdaa98ea7451324d092b2b2163a6a1d7a9a2147" -resolve-cwd@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/resolve-cwd/-/resolve-cwd-1.0.0.tgz#4eaeea41ed040d1702457df64a42b2b07d246f9f" - dependencies: - resolve-from "^2.0.0" - resolve-cwd@^2.0.0: version "2.0.0" resolved "https://registry.yarnpkg.com/resolve-cwd/-/resolve-cwd-2.0.0.tgz#00a9f7387556e27038eae232caa372a6a59b665a" @@ -4991,10 +5591,6 @@ resolve-from@^1.0.0: version "1.0.1" resolved "https://registry.yarnpkg.com/resolve-from/-/resolve-from-1.0.1.tgz#26cbfe935d1aeeeabb29bc3fe5aeb01e93d44226" -resolve-from@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/resolve-from/-/resolve-from-2.0.0.tgz#9480ab20e94ffa1d9e80a804c7ea147611966b57" - resolve-from@^3.0.0: version "3.0.0" resolved "https://registry.yarnpkg.com/resolve-from/-/resolve-from-3.0.0.tgz#b22c7af7d9d6881bc8b6e653335eebcb0a188748" @@ -5003,18 +5599,9 @@ resolve-url@~0.2.1: version "0.2.1" resolved "https://registry.yarnpkg.com/resolve-url/-/resolve-url-0.2.1.tgz#2c637fe77c893afd2a663fe21aa9080068e2052a" -resolve@^1.1.6, resolve@^1.2.0: - version "1.4.0" - resolved "https://registry.yarnpkg.com/resolve/-/resolve-1.4.0.tgz#a75be01c53da25d934a98ebd0e4c4a7312f92a86" - dependencies: - path-parse "^1.0.5" - -restore-cursor@^1.0.1: - version "1.0.1" - resolved "https://registry.yarnpkg.com/restore-cursor/-/restore-cursor-1.0.1.tgz#34661f46886327fed2991479152252df92daa541" - dependencies: - exit-hook "^1.0.0" - onetime "^1.0.0" +resolve@~1.1.7: + version "1.1.7" + resolved "https://registry.yarnpkg.com/resolve/-/resolve-1.1.7.tgz#203114d82ad2c5ed9e8e0411b3932875e889e97b" restore-cursor@^2.0.0: version "2.0.0" @@ -5033,7 +5620,7 @@ right-align@^0.1.1: dependencies: align-text "^0.1.1" -rimraf@2, rimraf@^2.2.8, rimraf@^2.5.1, rimraf@^2.5.2, rimraf@^2.6.1: +rimraf@2, rimraf@^2.2.8, rimraf@^2.5.1, rimraf@^2.5.2, rimraf@^2.5.4, rimraf@^2.6.1, rimraf@^2.6.2: version "2.6.2" resolved "https://registry.yarnpkg.com/rimraf/-/rimraf-2.6.2.tgz#2ed8150d24a16ea8651e6d6ef0f47c4158ce7a36" dependencies: @@ -5046,21 +5633,17 @@ ripemd160@^2.0.0, ripemd160@^2.0.1: hash-base "^2.0.0" inherits "^2.0.1" -run-async@^0.1.0: - version "0.1.0" - resolved "https://registry.yarnpkg.com/run-async/-/run-async-0.1.0.tgz#c8ad4a5e110661e402a7d21b530e009f25f8e389" - dependencies: - once "^1.3.0" - run-async@^2.2.0: version "2.3.0" resolved "https://registry.yarnpkg.com/run-async/-/run-async-2.3.0.tgz#0371ab4ae0bdd720d4166d7dfda64ff7a445a6c0" dependencies: is-promise "^2.1.0" -runes@0.4.2: - version "0.4.2" - resolved "https://registry.yarnpkg.com/runes/-/runes-0.4.2.tgz#1ddc1ea41de769cb32fc068a64fbbc45cd21052e" +run-queue@^1.0.0, run-queue@^1.0.3: + version "1.0.3" + resolved "https://registry.yarnpkg.com/run-queue/-/run-queue-1.0.3.tgz#e848396f057d223f24386924618e25694161ec47" + dependencies: + aproba "^1.1.1" rx-lite-aggregates@^4.0.8: version "4.0.8" @@ -5072,37 +5655,35 @@ rx-lite@*, rx-lite@^4.0.8: version "4.0.8" resolved "https://registry.yarnpkg.com/rx-lite/-/rx-lite-4.0.8.tgz#0b1e11af8bc44836f04a6407e92da42467b79444" -rx-lite@^3.1.2: - version "3.1.2" - resolved "https://registry.yarnpkg.com/rx-lite/-/rx-lite-3.1.2.tgz#19ce502ca572665f3b647b10939f97fd1615f102" - -rx@^4.1.0: - version "4.1.0" - resolved "https://registry.yarnpkg.com/rx/-/rx-4.1.0.tgz#a5f13ff79ef3b740fe30aa803fb09f98805d4782" - -rxjs@^5.1.1: - version "5.4.3" - resolved "https://registry.yarnpkg.com/rxjs/-/rxjs-5.4.3.tgz#0758cddee6033d68e0fd53676f0f3596ce3d483f" +rxjs@^5.1.1, rxjs@^5.5.2: + version "5.5.6" + resolved "https://registry.yarnpkg.com/rxjs/-/rxjs-5.5.6.tgz#e31fb96d6fd2ff1fd84bcea8ae9c02d007179c02" dependencies: - symbol-observable "^1.0.1" + symbol-observable "1.0.1" safe-buffer@^5.0.1, safe-buffer@^5.1.0, safe-buffer@^5.1.1, safe-buffer@~5.1.0, safe-buffer@~5.1.1: version "5.1.1" resolved "https://registry.yarnpkg.com/safe-buffer/-/safe-buffer-5.1.1.tgz#893312af69b2123def71f57889001671eeb2c853" -safe-buffer@~5.0.1: - version "5.0.1" - resolved "https://registry.yarnpkg.com/safe-buffer/-/safe-buffer-5.0.1.tgz#d263ca54696cd8a306b5ca6551e92de57918fbe7" - sanitize-filename@^1.6.1: version "1.6.1" resolved "https://registry.yarnpkg.com/sanitize-filename/-/sanitize-filename-1.6.1.tgz#612da1c96473fa02dccda92dcd5b4ab164a6772a" dependencies: truncate-utf8-bytes "^1.0.0" -seamless-immutable@7.1.2: - version "7.1.2" - resolved "https://registry.yarnpkg.com/seamless-immutable/-/seamless-immutable-7.1.2.tgz#c87a1eba6767a32455311d76600ac5eddeafbb69" +sax@^1.2.4, sax@~1.2.1: + version "1.2.4" + resolved "https://registry.yarnpkg.com/sax/-/sax-1.2.4.tgz#2816234e2378bddc4e5354fab5caa895df7100d9" + +schema-utils@^0.3.0: + version "0.3.0" + resolved "https://registry.yarnpkg.com/schema-utils/-/schema-utils-0.3.0.tgz#f5877222ce3e931edae039f17eb3716e7137f8cf" + dependencies: + ajv "^5.0.0" + +seamless-immutable@7.1.3: + version "7.1.3" + resolved "https://registry.yarnpkg.com/seamless-immutable/-/seamless-immutable-7.1.3.tgz#d32a8a202a331dffa69e4069a367a2159252490e" semver-diff@^2.0.0: version "2.1.0" @@ -5110,14 +5691,22 @@ semver-diff@^2.0.0: dependencies: semver "^5.0.3" -"semver@2 || 3 || 4 || 5", semver@5.4.1, semver@^5.0.3, semver@^5.1.0, semver@^5.3.0, semver@^5.4.1: - version "5.4.1" - resolved "https://registry.yarnpkg.com/semver/-/semver-5.4.1.tgz#e059c09d8571f0540823733433505d3a2f00b18e" +"semver@2 || 3 || 4 || 5", semver@5.5.0, semver@^5.0.3, semver@^5.1.0, semver@^5.3.0, semver@^5.4.1, semver@^5.5.0: + version "5.5.0" + resolved "https://registry.yarnpkg.com/semver/-/semver-5.5.0.tgz#dc4bbc7a6ca9d916dee5d43516f0092b58f7b8ab" semver@~5.3.0: version "5.3.0" resolved "https://registry.yarnpkg.com/semver/-/semver-5.3.0.tgz#9b2ce5d3de02d17c6012ad326aa6b4d0cf54f94f" +serialize-error@^2.1.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/serialize-error/-/serialize-error-2.1.0.tgz#50b679d5635cdf84667bdc8e59af4e5b81d5f60a" + +serialize-javascript@^1.4.0: + version "1.4.0" + resolved "https://registry.yarnpkg.com/serialize-javascript/-/serialize-javascript-1.4.0.tgz#7c958514db6ac2443a8abc062dc9f7886a7f6005" + set-blocking@^2.0.0, set-blocking@~2.0.0: version "2.0.0" resolved "https://registry.yarnpkg.com/set-blocking/-/set-blocking-2.0.0.tgz#045f9782d011ae9a6803ddd382b24392b3d890f7" @@ -5131,8 +5720,8 @@ setimmediate@^1.0.4, setimmediate@^1.0.5: resolved "https://registry.yarnpkg.com/setimmediate/-/setimmediate-1.0.5.tgz#290cbb232e306942d7d7ea9b83732ab7856f8285" sha.js@^2.4.0, sha.js@^2.4.8: - version "2.4.9" - resolved "https://registry.yarnpkg.com/sha.js/-/sha.js-2.4.9.tgz#98f64880474b74f4a38b8da9d3c0f2d104633e7d" + version "2.4.10" + resolved "https://registry.yarnpkg.com/sha.js/-/sha.js-2.4.10.tgz#b1fde5cd7d11a5626638a07c604ab909cfa31f9b" dependencies: inherits "^2.0.1" safe-buffer "^5.0.1" @@ -5143,18 +5732,14 @@ shebang-command@^1.2.0: dependencies: shebang-regex "^1.0.0" +shebang-loader@0.0.1: + version "0.0.1" + resolved "https://registry.yarnpkg.com/shebang-loader/-/shebang-loader-0.0.1.tgz#a4000495d44cceefbec63435e7b1698569fa52ec" + shebang-regex@^1.0.0: version "1.0.0" resolved "https://registry.yarnpkg.com/shebang-regex/-/shebang-regex-1.0.0.tgz#da42f49740c0b42db2ca9728571cb190c98efea3" -shelljs@^0.7.5: - version "0.7.8" - resolved "https://registry.yarnpkg.com/shelljs/-/shelljs-0.7.8.tgz#decbcf874b0d1e5fb72e14b164a9683048e9acb3" - dependencies: - glob "^7.0.0" - interpret "^1.0.0" - rechoir "^0.6.2" - signal-exit@^3.0.0, signal-exit@^3.0.2: version "3.0.2" resolved "https://registry.yarnpkg.com/signal-exit/-/signal-exit-3.0.2.tgz#b5fdc08f1287ea1178628e415e25132b73646c6d" @@ -5175,11 +5760,7 @@ slash@^1.0.0: version "1.0.0" resolved "https://registry.yarnpkg.com/slash/-/slash-1.0.0.tgz#c41f2f6c39fc16d1cd17ad4b5d896114ae470d55" -slice-ansi@0.0.4: - version "0.0.4" - resolved "https://registry.yarnpkg.com/slice-ansi/-/slice-ansi-0.0.4.tgz#edbf8903f66f7ce2f8eafd6ceed65e264c831b35" - -slice-ansi@^1.0.0: +slice-ansi@1.0.0, slice-ansi@^1.0.0: version "1.0.0" resolved "https://registry.yarnpkg.com/slice-ansi/-/slice-ansi-1.0.0.tgz#044f1a49d8842ff307aad6b505ed178bd950134d" dependencies: @@ -5196,12 +5777,12 @@ sntp@1.x.x: hoek "2.x.x" sntp@2.x.x: - version "2.0.2" - resolved "https://registry.yarnpkg.com/sntp/-/sntp-2.0.2.tgz#5064110f0af85f7cfdb7d6b67a40028ce52b4b2b" + version "2.1.0" + resolved "https://registry.yarnpkg.com/sntp/-/sntp-2.1.0.tgz#2c6cec14fedc2222739caf9b5c3d85d1cc5a2cc8" dependencies: hoek "4.x.x" -sort-keys@^1.1.1, sort-keys@^1.1.2: +sort-keys@^1.0.0: version "1.1.2" resolved "https://registry.yarnpkg.com/sort-keys/-/sort-keys-1.1.2.tgz#441b6d4d346798f1b4e49e8920adfba0e543f9ad" dependencies: @@ -5226,29 +5807,39 @@ source-map-resolve@^0.3.0: source-map-url "~0.3.0" urix "~0.1.0" -source-map-support@^0.4.0, source-map-support@^0.4.15, source-map-support@^0.4.16: +source-map-support@^0.4.15: version "0.4.18" resolved "https://registry.yarnpkg.com/source-map-support/-/source-map-support-0.4.18.tgz#0286a6de8be42641338594e97ccea75f0a2c585f" dependencies: source-map "^0.5.6" +source-map-support@^0.5.0, source-map-support@^0.5.3: + version "0.5.3" + resolved "https://registry.yarnpkg.com/source-map-support/-/source-map-support-0.5.3.tgz#2b3d5fff298cfa4d1afd7d4352d569e9a0158e76" + dependencies: + source-map "^0.6.0" + source-map-url@~0.3.0: version "0.3.0" resolved "https://registry.yarnpkg.com/source-map-url/-/source-map-url-0.3.0.tgz#7ecaf13b57bcd09da8a40c5d269db33799d4aaf9" +source-map@0.6.1, source-map@^0.6.0, source-map@^0.6.1, source-map@~0.6.1: + version "0.6.1" + resolved "https://registry.yarnpkg.com/source-map/-/source-map-0.6.1.tgz#74722af32e9614e9c287a8d0bbde48b5e2f1a263" + source-map@^0.1.38: version "0.1.43" resolved "https://registry.yarnpkg.com/source-map/-/source-map-0.1.43.tgz#c24bc146ca517c1471f5dacbe2571b2b7f9e3346" dependencies: amdefine ">=0.0.4" -source-map@^0.5.0, source-map@^0.5.3, source-map@^0.5.6, source-map@~0.5.1, source-map@~0.5.3: +source-map@^0.5.0, source-map@^0.5.3, source-map@^0.5.6, source-map@^0.5.7, source-map@~0.5.1: version "0.5.7" resolved "https://registry.yarnpkg.com/source-map/-/source-map-0.5.7.tgz#8a039d2d1021d22d1ea14c80d8ea468ba2ef3fcc" spawn-rx@^2.0.10: - version "2.0.11" - resolved "https://registry.yarnpkg.com/spawn-rx/-/spawn-rx-2.0.11.tgz#65451ad65662801daea75549832a782de0048dbf" + version "2.0.12" + resolved "https://registry.yarnpkg.com/spawn-rx/-/spawn-rx-2.0.12.tgz#b6285294499426089beea0c3c1ec32d7fc57a376" dependencies: debug "^2.5.1" lodash.assign "^4.2.0" @@ -5268,12 +5859,12 @@ spdx-license-ids@^1.0.2: version "1.2.2" resolved "https://registry.yarnpkg.com/spdx-license-ids/-/spdx-license-ids-1.2.2.tgz#c9df7a3424594ade6bd11900d596696dc06bac57" -spectron@3.7.2: - version "3.7.2" - resolved "https://registry.yarnpkg.com/spectron/-/spectron-3.7.2.tgz#86f41306a9b70ed6ee1500f7f7d3adc389afb446" +spectron@3.8.0: + version "3.8.0" + resolved "https://registry.yarnpkg.com/spectron/-/spectron-3.8.0.tgz#122c3562fd7e92b7cdf6f94094aa495b150dfa51" dependencies: dev-null "^0.1.1" - electron-chromedriver "~1.7.1" + electron-chromedriver "~1.8.0" request "^2.81.0" split "^1.0.0" webdriverio "^4.8.0" @@ -5306,7 +5897,13 @@ sshpk@^1.7.0: jsbn "~0.1.0" tweetnacl "~0.14.0" -stack-utils@^1.0.0: +ssri@^5.2.4: + version "5.2.4" + resolved "https://registry.yarnpkg.com/ssri/-/ssri-5.2.4.tgz#9985e14041e65fc397af96542be35724ac11da52" + dependencies: + safe-buffer "^5.1.1" + +stack-utils@^1.0.1: version "1.0.1" resolved "https://registry.yarnpkg.com/stack-utils/-/stack-utils-1.0.1.tgz#d4f33ab54e8e38778b0ca5cfd3b3afb12db68620" @@ -5321,16 +5918,41 @@ stream-browserify@^2.0.1: inherits "~2.0.1" readable-stream "^2.0.2" -stream-http@^2.3.1: - version "2.7.2" - resolved "https://registry.yarnpkg.com/stream-http/-/stream-http-2.7.2.tgz#40a050ec8dc3b53b33d9909415c02c0bf1abfbad" +stream-each@^1.1.0: + version "1.2.2" + resolved "https://registry.yarnpkg.com/stream-each/-/stream-each-1.2.2.tgz#8e8c463f91da8991778765873fe4d960d8f616bd" + dependencies: + end-of-stream "^1.1.0" + stream-shift "^1.0.0" + +stream-http@^2.7.2: + version "2.8.0" + resolved "https://registry.yarnpkg.com/stream-http/-/stream-http-2.8.0.tgz#fd86546dac9b1c91aff8fc5d287b98fafb41bc10" dependencies: builtin-status-codes "^3.0.0" inherits "^2.0.1" - readable-stream "^2.2.6" + readable-stream "^2.3.3" to-arraybuffer "^1.0.0" xtend "^4.0.0" +stream-shift@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/stream-shift/-/stream-shift-1.0.0.tgz#d5c752825e5367e786f78e18e445ea223a155952" + +strict-uri-encode@^1.0.0: + version "1.1.0" + resolved "https://registry.yarnpkg.com/strict-uri-encode/-/strict-uri-encode-1.1.0.tgz#279b225df1d582b1f54e65addd4352e18faa0713" + +string-hash@1.1.3: + version "1.1.3" + resolved "https://registry.yarnpkg.com/string-hash/-/string-hash-1.1.3.tgz#e8aafc0ac1855b4666929ed7dd1275df5d6c811b" + +string-similarity@1.2.0: + version "1.2.0" + resolved "https://registry.yarnpkg.com/string-similarity/-/string-similarity-1.2.0.tgz#d75153cb383846318b7a39a8d9292bb4db4e9c30" + dependencies: + lodash "^4.13.1" + string-width@^1.0.1, string-width@^1.0.2: version "1.0.2" resolved "https://registry.yarnpkg.com/string-width/-/string-width-1.0.2.tgz#118bdf5b8cdc51a2a7e70d211e07e2b0b9b107d3" @@ -5339,23 +5961,23 @@ string-width@^1.0.1, string-width@^1.0.2: is-fullwidth-code-point "^1.0.0" strip-ansi "^3.0.0" -string-width@^2.0.0, string-width@^2.1.0: +string-width@^2.0.0, string-width@^2.1.0, string-width@^2.1.1: version "2.1.1" resolved "https://registry.yarnpkg.com/string-width/-/string-width-2.1.1.tgz#ab93f27a8dc13d28cac815c462143a6d9012ae9e" dependencies: is-fullwidth-code-point "^2.0.0" strip-ansi "^4.0.0" -string_decoder@^0.10.25, string_decoder@~0.10.x: - version "0.10.31" - resolved "https://registry.yarnpkg.com/string_decoder/-/string_decoder-0.10.31.tgz#62e203bc41766c6c28c9fc84301dab1c5310fa94" - -string_decoder@~1.0.3: +string_decoder@^1.0.0, string_decoder@~1.0.3: version "1.0.3" resolved "https://registry.yarnpkg.com/string_decoder/-/string_decoder-1.0.3.tgz#0fc67d7c141825de94282dd536bec6b9bce860ab" dependencies: safe-buffer "~5.1.0" +string_decoder@~0.10.x: + version "0.10.31" + resolved "https://registry.yarnpkg.com/string_decoder/-/string_decoder-0.10.31.tgz#62e203bc41766c6c28c9fc84301dab1c5310fa94" + stringstream@~0.0.4, stringstream@~0.0.5: version "0.0.5" resolved "https://registry.yarnpkg.com/stringstream/-/stringstream-0.0.5.tgz#4e484cd4de5a0bbbee18e46307710a8a81621878" @@ -5410,6 +6032,37 @@ strip-json-comments@~2.0.1: version "2.0.1" resolved "https://registry.yarnpkg.com/strip-json-comments/-/strip-json-comments-2.0.1.tgz#3c531942e908c2697c0ec344858c286c7ca0a60a" +style-loader@0.19.1: + version "0.19.1" + resolved "https://registry.yarnpkg.com/style-loader/-/style-loader-0.19.1.tgz#591ffc80bcefe268b77c5d9ebc0505d772619f85" + dependencies: + loader-utils "^1.0.2" + schema-utils "^0.3.0" + +styled-jsx@2.2.6: + version "2.2.6" + resolved "https://registry.yarnpkg.com/styled-jsx/-/styled-jsx-2.2.6.tgz#7e826279e1ef718213ef9cc42ac7370b5008449d" + dependencies: + babel-plugin-syntax-jsx "6.18.0" + babel-types "6.26.0" + convert-source-map "1.5.1" + source-map "0.6.1" + string-hash "1.1.3" + stylis "3.4.10" + stylis-rule-sheet "0.0.8" + +stylis-rule-sheet@0.0.8: + version "0.0.8" + resolved "https://registry.yarnpkg.com/stylis-rule-sheet/-/stylis-rule-sheet-0.0.8.tgz#b0d0a126c945b1f3047447a3aae0647013e8d166" + +stylis@3.4.10: + version "3.4.10" + resolved "https://registry.yarnpkg.com/stylis/-/stylis-3.4.10.tgz#a135cab4b9ff208e327fbb5a6fde3fa991c638ee" + +stylis@3.5.0: + version "3.5.0" + resolved "https://registry.yarnpkg.com/stylis/-/stylis-3.5.0.tgz#016fa239663d77f868fef5b67cf201c4b7c701e1" + sumchecker@^1.2.0: version "1.3.1" resolved "https://registry.yarnpkg.com/sumchecker/-/sumchecker-1.3.1.tgz#79bb3b4456dd04f18ebdbc0d703a1d1daec5105d" @@ -5423,48 +6076,92 @@ sumchecker@^2.0.1, sumchecker@^2.0.2: dependencies: debug "^2.2.0" +supertap@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/supertap/-/supertap-1.0.0.tgz#bd9751c7fafd68c68cf8222a29892206a119fa9e" + dependencies: + arrify "^1.0.1" + indent-string "^3.2.0" + js-yaml "^3.10.0" + serialize-error "^2.1.0" + strip-ansi "^4.0.0" + supports-color@^2.0.0: version "2.0.0" resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-2.0.0.tgz#535d045ce6b6363fa40117084629995e9df324c7" +supports-color@^3.2.3: + version "3.2.3" + resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-3.2.3.tgz#65ac0504b3954171d8a64946b2ae3cbb8a5f54f6" + dependencies: + has-flag "^1.0.0" + supports-color@^4.0.0, supports-color@^4.2.1: - version "4.4.0" - resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-4.4.0.tgz#883f7ddabc165142b2a61427f3352ded195d1a3e" + version "4.5.0" + resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-4.5.0.tgz#be7a0de484dec5c5cddf8b3d59125044912f635b" dependencies: has-flag "^2.0.0" -supports-color@~3.2.3: - version "3.2.3" - resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-3.2.3.tgz#65ac0504b3954171d8a64946b2ae3cbb8a5f54f6" +supports-color@^5.0.0, supports-color@^5.2.0: + version "5.2.0" + resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-5.2.0.tgz#b0d5333b1184dd3666cbe5aa0b45c5ac7ac17a4a" dependencies: - has-flag "^1.0.0" + has-flag "^3.0.0" + +supports-color@^5.3.0: + version "5.3.0" + resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-5.3.0.tgz#5b24ac15db80fa927cf5227a4a33fd3c4c7676c0" + dependencies: + has-flag "^3.0.0" + +supports-color@~5.0.0: + version "5.0.1" + resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-5.0.1.tgz#1c5331f22250c84202805b2f17adf16699f3a39a" + dependencies: + has-flag "^2.0.0" + +svgo@^0.7.0: + version "0.7.2" + resolved "https://registry.yarnpkg.com/svgo/-/svgo-0.7.2.tgz#9f5772413952135c6fefbf40afe6a4faa88b4bb5" + dependencies: + coa "~1.0.1" + colors "~1.1.2" + csso "~2.3.1" + js-yaml "~3.7.0" + mkdirp "~0.5.1" + sax "~1.2.1" + whet.extend "~0.9.9" + +symbol-observable@1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/symbol-observable/-/symbol-observable-1.0.1.tgz#8340fc4702c3122df5d22288f88283f513d3fdd4" symbol-observable@^0.2.2: version "0.2.4" resolved "https://registry.yarnpkg.com/symbol-observable/-/symbol-observable-0.2.4.tgz#95a83db26186d6af7e7a18dbd9760a2f86d08f40" -symbol-observable@^1.0.1, symbol-observable@^1.0.3, symbol-observable@^1.0.4: - version "1.0.4" - resolved "https://registry.yarnpkg.com/symbol-observable/-/symbol-observable-1.0.4.tgz#29bf615d4aa7121bdd898b22d4b3f9bc4e2aa03d" +symbol-observable@^1.0.3, symbol-observable@^1.0.4, symbol-observable@^1.1.0: + version "1.2.0" + resolved "https://registry.yarnpkg.com/symbol-observable/-/symbol-observable-1.2.0.tgz#c22688aed4eab3cdc2dfeacbb561660560a00804" -table@^3.7.8: - version "3.8.3" - resolved "https://registry.yarnpkg.com/table/-/table-3.8.3.tgz#2bbc542f0fda9861a755d3947fefd8b3f513855f" +table@^4.0.1: + version "4.0.2" + resolved "https://registry.yarnpkg.com/table/-/table-4.0.2.tgz#a33447375391e766ad34d3486e6e2aedc84d2e36" dependencies: - ajv "^4.7.0" - ajv-keywords "^1.0.0" - chalk "^1.1.1" - lodash "^4.0.0" - slice-ansi "0.0.4" - string-width "^2.0.0" + ajv "^5.2.3" + ajv-keywords "^2.1.0" + chalk "^2.1.0" + lodash "^4.17.4" + slice-ansi "1.0.0" + string-width "^2.1.1" tapable@^0.2.7: version "0.2.8" resolved "https://registry.yarnpkg.com/tapable/-/tapable-0.2.8.tgz#99372a5c999bf2df160afc0d74bed4f47948cd22" tar-pack@^3.4.0: - version "3.4.0" - resolved "https://registry.yarnpkg.com/tar-pack/-/tar-pack-3.4.0.tgz#23be2d7f671a8339376cbdb0b8fe3fdebf317984" + version "3.4.1" + resolved "https://registry.yarnpkg.com/tar-pack/-/tar-pack-3.4.1.tgz#e1dbc03a9b9d3ba07e896ad027317eb679a10a1f" dependencies: debug "^2.2.0" fstream "^1.0.10" @@ -5476,8 +6173,8 @@ tar-pack@^3.4.0: uid-number "^0.0.6" tar-stream@^1.5.0: - version "1.5.4" - resolved "https://registry.yarnpkg.com/tar-stream/-/tar-stream-1.5.4.tgz#36549cf04ed1aee9b2a30c0143252238daf94016" + version "1.5.5" + resolved "https://registry.yarnpkg.com/tar-stream/-/tar-stream-1.5.5.tgz#5cad84779f45c83b1f2508d96b09d88c7218af55" dependencies: bl "^1.0.0" end-of-stream "^1.0.0" @@ -5492,14 +6189,14 @@ tar@^2.0.0, tar@^2.2.1: fstream "^1.0.2" inherits "2" -temp-file@^2.0.2, temp-file@^2.0.3: - version "2.0.3" - resolved "https://registry.yarnpkg.com/temp-file/-/temp-file-2.0.3.tgz#0de2540629fc77a6406ca56f50214d1f224947ac" +temp-file@^3.1.1: + version "3.1.1" + resolved "https://registry.yarnpkg.com/temp-file/-/temp-file-3.1.1.tgz#8823649aa4e8a6e419eb71b601a2e4d472b0f24f" dependencies: async-exit-hook "^2.0.1" - bluebird-lst "^1.0.3" - fs-extra-p "^4.4.0" - lazy-val "^1.0.2" + bluebird-lst "^1.0.5" + fs-extra-p "^4.5.0" + lazy-val "^1.0.3" term-size@^1.2.0: version "1.2.0" @@ -5511,10 +6208,6 @@ text-table@^0.2.0, text-table@~0.2.0: version "0.2.0" resolved "https://registry.yarnpkg.com/text-table/-/text-table-0.2.0.tgz#7f5ee823ae805207c00af2df4a84ec3fcfa570b4" -the-argv@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/the-argv/-/the-argv-1.0.0.tgz#0084705005730dd84db755253c931ae398db9522" - throttleit@0.0.2: version "0.0.2" resolved "https://registry.yarnpkg.com/throttleit/-/throttleit-0.0.2.tgz#cfedf88e60c00dd9697b61fdd2a8343a9b680eaf" @@ -5537,15 +6230,6 @@ through@2, through@^2.3.6: version "2.3.8" resolved "https://registry.yarnpkg.com/through/-/through-2.3.8.tgz#0dd4c9ffaabc357960b1b724115d7e0e86a2e1f5" -time-require@^0.1.2: - version "0.1.2" - resolved "https://registry.yarnpkg.com/time-require/-/time-require-0.1.2.tgz#f9e12cb370fc2605e11404582ba54ef5ca2b2d98" - dependencies: - chalk "^0.4.0" - date-time "^0.1.1" - pretty-ms "^0.2.1" - text-table "^0.2.0" - time-zone@^1.0.0: version "1.0.0" resolved "https://registry.yarnpkg.com/time-zone/-/time-zone-1.0.0.tgz#99c5bf55958966af6d06d83bdf3800dc82faec5d" @@ -5554,9 +6238,9 @@ timed-out@^4.0.0: version "4.0.1" resolved "https://registry.yarnpkg.com/timed-out/-/timed-out-4.0.1.tgz#f32eacac5a175bea25d7fab565ab3ed8741ef56f" -timers-browserify@^2.0.2: - version "2.0.4" - resolved "https://registry.yarnpkg.com/timers-browserify/-/timers-browserify-2.0.4.tgz#96ca53f4b794a5e7c0e1bd7cc88a372298fa01e6" +timers-browserify@^2.0.4: + version "2.0.6" + resolved "https://registry.yarnpkg.com/timers-browserify/-/timers-browserify-2.0.6.tgz#241e76927d9ca05f4d959819022f5b3664b64bae" dependencies: setimmediate "^1.0.4" @@ -5574,7 +6258,7 @@ to-fast-properties@^1.0.3: version "1.0.3" resolved "https://registry.yarnpkg.com/to-fast-properties/-/to-fast-properties-1.0.3.tgz#b83571fa4d8c25b82e231b06e3a3055de4ca1a47" -tough-cookie@~2.3.0, tough-cookie@~2.3.2: +tough-cookie@~2.3.0, tough-cookie@~2.3.3: version "2.3.3" resolved "https://registry.yarnpkg.com/tough-cookie/-/tough-cookie-2.3.3.tgz#0b618a5565b6dea90bf3425d04d55edc475a7561" dependencies: @@ -5598,10 +6282,6 @@ truncate-utf8-bytes@^1.0.0: dependencies: utf8-byte-length "^1.0.1" -tryit@^1.0.1: - version "1.0.3" - resolved "https://registry.yarnpkg.com/tryit/-/tryit-1.0.3.tgz#393be730a9446fd1ead6da59a014308f36c289cb" - tty-browserify@0.0.0: version "0.0.0" resolved "https://registry.yarnpkg.com/tty-browserify/-/tty-browserify-0.0.0.tgz#a157ba402da24e9bf957f9aa69d524eed42901a6" @@ -5627,8 +6307,8 @@ typedarray@^0.0.6: resolved "https://registry.yarnpkg.com/typedarray/-/typedarray-0.0.6.tgz#867ac74e3864187b1d3d47d996a78ec5c8830777" ua-parser-js@^0.7.9: - version "0.7.14" - resolved "https://registry.yarnpkg.com/ua-parser-js/-/ua-parser-js-0.7.14.tgz#110d53fa4c3f326c121292bbeac904d2e03387ca" + version "0.7.17" + resolved "https://registry.yarnpkg.com/ua-parser-js/-/ua-parser-js-0.7.17.tgz#e9ec5f9498b9ec910e7ae3ac626a805c4d09ecac" uglify-js@^2.8.29: version "2.8.29" @@ -5659,6 +6339,32 @@ uid2@0.0.3: version "0.0.3" resolved "https://registry.yarnpkg.com/uid2/-/uid2-0.0.3.tgz#483126e11774df2f71b8b639dcd799c376162b82" +uniq@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/uniq/-/uniq-1.0.1.tgz#b31c5ae8254844a3a8281541ce2b04b865a734ff" + +uniqid@^4.0.0: + version "4.1.1" + resolved "https://registry.yarnpkg.com/uniqid/-/uniqid-4.1.1.tgz#89220ddf6b751ae52b5f72484863528596bb84c1" + dependencies: + macaddress "^0.2.8" + +uniqs@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/uniqs/-/uniqs-2.0.0.tgz#ffede4b36b25290696e6e165d4a59edb998e6b02" + +unique-filename@^1.1.0: + version "1.1.0" + resolved "https://registry.yarnpkg.com/unique-filename/-/unique-filename-1.1.0.tgz#d05f2fe4032560871f30e93cbe735eea201514f3" + dependencies: + unique-slug "^2.0.0" + +unique-slug@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/unique-slug/-/unique-slug-2.0.0.tgz#db6676e7c7cc0629878ff196097c78855ae9f4ab" + dependencies: + imurmurhash "^0.1.4" + unique-string@^1.0.0: version "1.0.0" resolved "https://registry.yarnpkg.com/unique-string/-/unique-string-1.0.0.tgz#9e1057cca851abb93398f8b33ae187b99caec11a" @@ -5681,14 +6387,15 @@ unzip-response@^2.0.1: version "2.0.1" resolved "https://registry.yarnpkg.com/unzip-response/-/unzip-response-2.0.1.tgz#d2f0f737d16b0615e72a6935ed04214572d56f97" -update-notifier@^2.1.0, update-notifier@^2.2.0: - version "2.2.0" - resolved "https://registry.yarnpkg.com/update-notifier/-/update-notifier-2.2.0.tgz#1b5837cf90c0736d88627732b661c138f86de72f" +update-notifier@^2.3.0: + version "2.3.0" + resolved "https://registry.yarnpkg.com/update-notifier/-/update-notifier-2.3.0.tgz#4e8827a6bb915140ab093559d7014e3ebb837451" dependencies: - boxen "^1.0.0" - chalk "^1.0.0" + boxen "^1.2.1" + chalk "^2.0.1" configstore "^3.0.0" import-lazy "^2.1.0" + is-installed-globally "^0.1.0" is-npm "^1.0.0" latest-version "^3.0.0" semver-diff "^2.0.0" @@ -5704,6 +6411,10 @@ url-parse-lax@^1.0.0: dependencies: prepend-http "^1.0.1" +url-to-options@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/url-to-options/-/url-to-options-1.0.1.tgz#1505a03a289a48cbd7a434efbaeec5055f5633a9" + url@^0.11.0, url@~0.11.0: version "0.11.0" resolved "https://registry.yarnpkg.com/url/-/url-0.11.0.tgz#3838e97cfc60521eb73c525a8e55bfdd9e2e28f1" @@ -5715,12 +6426,6 @@ user-home@^1.1.1: version "1.1.1" resolved "https://registry.yarnpkg.com/user-home/-/user-home-1.1.1.tgz#2b5be23a32b63a7c9deb8d0f28d485724a3df190" -user-home@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/user-home/-/user-home-2.0.0.tgz#9c70bfd8169bc1dcbf48604e0f04b8b49cde9e9f" - dependencies: - os-homedir "^1.0.0" - utf8-byte-length@^1.0.1: version "1.0.4" resolved "https://registry.yarnpkg.com/utf8-byte-length/-/utf8-byte-length-1.0.4.tgz#f45f150c4c66eee968186505ab93fcbb8ad6bf61" @@ -5735,16 +6440,14 @@ util@0.10.3, util@^0.10.3: dependencies: inherits "2.0.1" -uuid-1345@^0.99.6: - version "0.99.6" - resolved "https://registry.yarnpkg.com/uuid-1345/-/uuid-1345-0.99.6.tgz#b1270ae015a7721c7adec6c46ec169c6098aed40" - dependencies: - macaddress "^0.2.7" - -uuid@3.1.0, uuid@^3.0.0, uuid@^3.1.0: +uuid@3.1.0: version "3.1.0" resolved "https://registry.yarnpkg.com/uuid/-/uuid-3.1.0.tgz#3dd3d3e790abc24d7b0d3a034ffababe28ebbc04" +uuid@^3.0.0, uuid@^3.1.0: + version "3.2.1" + resolved "https://registry.yarnpkg.com/uuid/-/uuid-3.2.1.tgz#12c528bb9d58d0b9265d9a2f6f0fe8be17ff1f14" + v8flags@^2.1.1: version "2.1.1" resolved "https://registry.yarnpkg.com/v8flags/-/v8flags-2.1.1.tgz#aab1a1fa30d45f88dd321148875ac02c0b55e5b4" @@ -5758,9 +6461,13 @@ validate-npm-package-license@^3.0.1: spdx-correct "~1.0.0" spdx-expression-parse "~1.0.0" -validator@~7.0.0: - version "7.0.0" - resolved "https://registry.yarnpkg.com/validator/-/validator-7.0.0.tgz#c74deb8063512fac35547938e6f0b1504a282fd2" +validator@~9.1.1: + version "9.1.2" + resolved "https://registry.yarnpkg.com/validator/-/validator-9.1.2.tgz#5711b6413f78bd9d56003130c81b47c39e86546c" + +vendors@^1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/vendors/-/vendors-1.0.1.tgz#37ad73c8ee417fb3d580e785312307d274847f22" verror@1.10.0: version "1.10.0" @@ -5776,10 +6483,6 @@ vm-browserify@0.0.4: dependencies: indexof "0.0.1" -walkdir@^0.0.11: - version "0.0.11" - resolved "https://registry.yarnpkg.com/walkdir/-/walkdir-0.0.11.tgz#a16d025eb931bd03b52f308caed0f40fcebe9532" - watchpack@^1.4.0: version "1.4.0" resolved "https://registry.yarnpkg.com/watchpack/-/watchpack-1.4.0.tgz#4a1472bcbb952bd0a9bb4036801f954dfb39faac" @@ -5788,47 +6491,53 @@ watchpack@^1.4.0: chokidar "^1.7.0" graceful-fs "^4.1.2" +wcwidth@^1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/wcwidth/-/wcwidth-1.0.1.tgz#f0b0dcf915bc5ff1528afadb2c0e17b532da2fe8" + dependencies: + defaults "^1.0.3" + wdio-dot-reporter@~0.0.8: version "0.0.9" resolved "https://registry.yarnpkg.com/wdio-dot-reporter/-/wdio-dot-reporter-0.0.9.tgz#929b2adafd49d6b0534fda068e87319b47e38fe5" webdriverio@^4.8.0: - version "4.8.0" - resolved "https://registry.yarnpkg.com/webdriverio/-/webdriverio-4.8.0.tgz#d52929b749080f89967f6e1614051cbc8172d132" + version "4.10.2" + resolved "https://registry.yarnpkg.com/webdriverio/-/webdriverio-4.10.2.tgz#0d28622802c966015afe34b3ac566dc339f22e43" dependencies: - archiver "~1.3.0" - babel-runtime "~6.23.0" + archiver "~2.1.0" + babel-runtime "^6.26.0" css-parse "~2.0.0" css-value "~0.0.1" - deepmerge "~1.3.2" + deepmerge "~2.0.1" ejs "~2.5.6" gaze "~1.1.2" glob "~7.1.1" - inquirer "~3.0.6" + inquirer "~3.3.0" json-stringify-safe "~5.0.1" mkdirp "~0.5.1" npm-install-package "~2.1.0" optimist "~0.6.1" q "~1.5.0" - request "~2.81.0" + request "~2.83.0" rgb2hex "~0.1.0" - safe-buffer "~5.0.1" - supports-color "~3.2.3" + safe-buffer "~5.1.1" + supports-color "~5.0.0" url "~0.11.0" - validator "~7.0.0" + validator "~9.1.1" wdio-dot-reporter "~0.0.8" wgxpath "~1.0.0" webpack-sources@^1.0.1: - version "1.0.1" - resolved "https://registry.yarnpkg.com/webpack-sources/-/webpack-sources-1.0.1.tgz#c7356436a4d13123be2e2426a05d1dad9cbe65cf" + version "1.1.0" + resolved "https://registry.yarnpkg.com/webpack-sources/-/webpack-sources-1.1.0.tgz#a101ebae59d6507354d71d8013950a3a8b7a5a54" dependencies: source-list-map "^2.0.0" - source-map "~0.5.3" + source-map "~0.6.1" -webpack@3.5.5: - version "3.5.5" - resolved "https://registry.yarnpkg.com/webpack/-/webpack-3.5.5.tgz#3226f09fc8b3e435ff781e7af34f82b68b26996c" +webpack@3.10.0: + version "3.10.0" + resolved "https://registry.yarnpkg.com/webpack/-/webpack-3.10.0.tgz#5291b875078cf2abf42bdd23afe3f8f96c17d725" dependencies: acorn "^5.0.0" acorn-dynamic-import "^2.0.0" @@ -5865,6 +6574,10 @@ whatwg-fetch@>=0.10.0: version "2.0.3" resolved "https://registry.yarnpkg.com/whatwg-fetch/-/whatwg-fetch-2.0.3.tgz#9c84ec2dcf68187ff00bc64e1274b442176e1c84" +whet.extend@~0.9.9: + version "0.9.9" + resolved "https://registry.yarnpkg.com/whet.extend/-/whet.extend-0.9.9.tgz#f877d5bf648c97e5aa542fadc16d6a259b9c11a1" + which-module@^1.0.0: version "1.0.0" resolved "https://registry.yarnpkg.com/which-module/-/which-module-1.0.0.tgz#bba63ca861948994ff307736089e3b96026c2a4f" @@ -5885,11 +6598,11 @@ wide-align@^1.1.0: dependencies: string-width "^1.0.2" -widest-line@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/widest-line/-/widest-line-1.0.0.tgz#0c09c85c2a94683d0d7eaf8ee097d564bf0e105c" +widest-line@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/widest-line/-/widest-line-2.0.0.tgz#0142a4e8a243f8882c0233aa0e0281aa76152273" dependencies: - string-width "^1.0.1" + string-width "^2.1.1" window-size@0.1.0: version "0.1.0" @@ -5934,24 +6647,17 @@ write-file-atomic@^2.0.0: imurmurhash "^0.1.4" signal-exit "^3.0.2" -write-json-file@^2.0.0, write-json-file@^2.2.0: - version "2.2.0" - resolved "https://registry.yarnpkg.com/write-json-file/-/write-json-file-2.2.0.tgz#51862506bbb3b619eefab7859f1fd6c6d0530876" +write-json-file@^2.2.0: + version "2.3.0" + resolved "https://registry.yarnpkg.com/write-json-file/-/write-json-file-2.3.0.tgz#2b64c8a33004d54b8698c76d585a77ceb61da32f" dependencies: detect-indent "^5.0.0" graceful-fs "^4.1.2" make-dir "^1.0.0" - pify "^2.0.0" - sort-keys "^1.1.1" + pify "^3.0.0" + sort-keys "^2.0.0" write-file-atomic "^2.0.0" -write-pkg@^2.0.0: - version "2.1.0" - resolved "https://registry.yarnpkg.com/write-pkg/-/write-pkg-2.1.0.tgz#353aa44c39c48c21440f5c08ce6abd46141c9c08" - dependencies: - sort-keys "^1.1.2" - write-json-file "^2.0.0" - write-pkg@^3.1.0: version "3.1.0" resolved "https://registry.yarnpkg.com/write-pkg/-/write-pkg-3.1.0.tgz#030a9994cc9993d25b4e75a9f1a1923607291ce9" @@ -5977,48 +6683,6 @@ xmldom@0.1.x: version "0.1.27" resolved "https://registry.yarnpkg.com/xmldom/-/xmldom-0.1.27.tgz#d501f97b3bdb403af8ef9ecc20573187aadac0e9" -xo-init@^0.5.0: - version "0.5.0" - resolved "https://registry.yarnpkg.com/xo-init/-/xo-init-0.5.0.tgz#8e28dec79676cc5e042fde5fd8f710e2646b0e36" - dependencies: - arrify "^1.0.0" - execa "^0.5.0" - minimist "^1.1.3" - path-exists "^3.0.0" - read-pkg-up "^2.0.0" - the-argv "^1.0.0" - write-pkg "^2.0.0" - -xo@0.18.2: - version "0.18.2" - resolved "https://registry.yarnpkg.com/xo/-/xo-0.18.2.tgz#92a42eb02a4fb149dfea5518021914f5aac84ff0" - dependencies: - arrify "^1.0.0" - debug "^2.2.0" - deep-assign "^1.0.0" - eslint "^3.18.0" - eslint-config-xo "^0.18.0" - eslint-formatter-pretty "^1.0.0" - eslint-plugin-ava "^4.2.0" - eslint-plugin-import "^2.0.0" - eslint-plugin-no-use-extend-native "^0.3.2" - eslint-plugin-promise "^3.4.0" - eslint-plugin-unicorn "^2.1.0" - get-stdin "^5.0.0" - globby "^6.0.0" - has-flag "^2.0.0" - ignore "^3.2.6" - lodash.isequal "^4.4.0" - meow "^3.4.2" - multimatch "^2.1.0" - path-exists "^3.0.0" - pkg-conf "^2.0.0" - resolve-cwd "^1.0.0" - resolve-from "^2.0.0" - slash "^1.0.0" - update-notifier "^2.1.0" - xo-init "^0.5.0" - xtend@^4.0.0, xtend@~4.0.1: version "4.0.1" resolved "https://registry.yarnpkg.com/xtend/-/xtend-4.0.1.tgz#a5c6d532be656e23db820efb943a1f04998d63af" @@ -6029,10 +6693,18 @@ xtend@~2.1.1: dependencies: object-keys "~0.4.0" +xterm@chabou/xterm.js#7cb4b8e: + version "3.2.0-hyper.2" + resolved "https://codeload.github.com/chabou/xterm.js/tar.gz/7cb4b8e0b1a76a5af947b7417e47917595afc6f9" + y18n@^3.2.1: version "3.2.1" resolved "https://registry.yarnpkg.com/y18n/-/y18n-3.2.1.tgz#6d15fba884c08679c0d77e88e7759e811e07fa41" +y18n@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/y18n/-/y18n-4.0.0.tgz#95ef94f85ecc81d007c264e190a120f0a3c8566b" + yallist@^2.1.2: version "2.1.2" resolved "https://registry.yarnpkg.com/yallist/-/yallist-2.1.2.tgz#1c11f9218f076089a47dd512f93c6699a6a81d52" @@ -6049,6 +6721,29 @@ yargs-parser@^7.0.0: dependencies: camelcase "^4.1.0" +yargs-parser@^9.0.2: + version "9.0.2" + resolved "https://registry.yarnpkg.com/yargs-parser/-/yargs-parser-9.0.2.tgz#9ccf6a43460fe4ed40a9bb68f48d43b8a68cc077" + dependencies: + camelcase "^4.1.0" + +yargs@^11.0.0: + version "11.0.0" + resolved "https://registry.yarnpkg.com/yargs/-/yargs-11.0.0.tgz#c052931006c5eee74610e5fc0354bedfd08a201b" + dependencies: + cliui "^4.0.0" + decamelize "^1.1.1" + find-up "^2.1.0" + get-caller-file "^1.0.1" + os-locale "^2.0.0" + require-directory "^2.1.1" + require-main-filename "^1.0.1" + set-blocking "^2.0.0" + string-width "^2.0.0" + which-module "^2.0.0" + y18n "^3.2.1" + yargs-parser "^9.0.2" + yargs@^7.0.2: version "7.1.0" resolved "https://registry.yarnpkg.com/yargs/-/yargs-7.1.0.tgz#6ba318eb16961727f5d284f8ea003e8d6154d0c8" @@ -6100,7 +6795,7 @@ yauzl@2.4.1: dependencies: fd-slicer "~1.0.1" -zip-stream@^1.1.0, zip-stream@^1.2.0: +zip-stream@^1.2.0: version "1.2.0" resolved "https://registry.yarnpkg.com/zip-stream/-/zip-stream-1.2.0.tgz#a8bc45f4c1b49699c6b90198baacaacdbcd4ba04" dependencies: From fdf1b95553f32fa458b648ef215b854dcc676aaa Mon Sep 17 00:00:00 2001 From: Leo Lamprecht Date: Mon, 16 Apr 2018 07:18:10 -0700 Subject: [PATCH 07/15] Removed Yarn's error files --- app/yarn-error.log | 518 ---- yarn-error.log | 7075 -------------------------------------------- 2 files changed, 7593 deletions(-) delete mode 100644 app/yarn-error.log delete mode 100644 yarn-error.log diff --git a/app/yarn-error.log b/app/yarn-error.log deleted file mode 100644 index 942a595e7efa..000000000000 --- a/app/yarn-error.log +++ /dev/null @@ -1,518 +0,0 @@ -Arguments: - /usr/local/bin/node /usr/local/Cellar/yarn/1.5.1_1/libexec/bin/yarn.js install --production - -PATH: - /Users/leo/projects/hyper/node_modules/.bin:/Users/leo/.config/yarn/link/node_modules/.bin:/Users/leo/projects/hyper/node_modules/.bin:/Users/leo/.config/yarn/link/node_modules/.bin:/usr/local/libexec/lib/node_modules/npm/bin/node-gyp-bin:/usr/local/lib/node_modules/npm/bin/node-gyp-bin:/usr/local/bin/node_modules/npm/bin/node-gyp-bin:/usr/local/opt/openvpn/sbin:/Users/leo/google-cloud-sdk/bin:/usr/local/bin:/usr/bin:/bin:/usr/sbin:/sbin:/usr/local/go/bin:/opt/X11/bin - -Yarn version: - 1.5.1 - -Node version: - 9.10.1 - -Platform: - darwin x64 - -npm manifest: - { - "name": "hyper", - "productName": "Hyper", - "description": "A terminal built on web technologies", - "version": "2.0.0-canary.17", - "license": "MIT", - "author": { - "name": "ZEIT, Inc.", - "email": "team@zeit.co" - }, - "repository": "zeit/hyper", - "dependencies": { - "async-retry": "1.1.4", - "color": "2.0.1", - "convert-css-color-name-to-hex": "0.1.1", - "default-shell": "1.0.1", - "electron-config": "1.0.0", - "electron-is-dev": "0.3.0", - "electron-squirrel-startup": "1.0.0", - "file-uri-to-path": "1.0.0", - "git-describe": "4.0.2", - "lodash": "4.17.5", - "mkdirp": "0.5.1", - "ms": "2.1.1", - "node-fetch": "1.7.3", - "node-pty": "0.7.4", - "parse-url": "3.0.2", - "queue": "4.4.2", - "semver": "5.5.0", - "shell-env": "0.3.0", - "uuid": "3.2.1", - "winreg": "1.2.4" - } - } - -yarn manifest: - No manifest - -Lockfile: - # THIS IS AN AUTOGENERATED FILE. DO NOT EDIT THIS FILE DIRECTLY. - # yarn lockfile v1 - - - ansi-regex@^2.0.0: - version "2.1.1" - resolved "https://registry.yarnpkg.com/ansi-regex/-/ansi-regex-2.1.1.tgz#c3b33ab5ee360d86e0e628f0468ae7ef27d654df" - - async-retry@1.1.4: - version "1.1.4" - resolved "https://registry.yarnpkg.com/async-retry/-/async-retry-1.1.4.tgz#e0edb546600f19bf90f892e9494faa9e19baf190" - dependencies: - retry "0.10.1" - - color-convert@^1.9.1: - version "1.9.1" - resolved "https://registry.yarnpkg.com/color-convert/-/color-convert-1.9.1.tgz#c1261107aeb2f294ebffec9ed9ecad529a6097ed" - dependencies: - color-name "^1.1.1" - - color-name@^1.0.0, color-name@^1.1.1: - version "1.1.3" - resolved "https://registry.yarnpkg.com/color-name/-/color-name-1.1.3.tgz#a7d0558bd89c42f795dd42328f740831ca53bc25" - - color-string@^1.5.2: - version "1.5.2" - resolved "https://registry.yarnpkg.com/color-string/-/color-string-1.5.2.tgz#26e45814bc3c9a7cbd6751648a41434514a773a9" - dependencies: - color-name "^1.0.0" - simple-swizzle "^0.2.2" - - color@2.0.1: - version "2.0.1" - resolved "https://registry.yarnpkg.com/color/-/color-2.0.1.tgz#e4ed78a3c4603d0891eba5430b04b86314f4c839" - dependencies: - color-convert "^1.9.1" - color-string "^1.5.2" - - conf@^1.0.0: - version "1.2.0" - resolved "https://registry.yarnpkg.com/conf/-/conf-1.2.0.tgz#149af7408f0af6abd62c3e24cff747e41a0bc54f" - dependencies: - dot-prop "^4.1.0" - env-paths "^1.0.0" - make-dir "^1.0.0" - pkg-up "^2.0.0" - write-file-atomic "^2.3.0" - - convert-css-color-name-to-hex@0.1.1: - version "0.1.1" - resolved "https://registry.yarnpkg.com/convert-css-color-name-to-hex/-/convert-css-color-name-to-hex-0.1.1.tgz#38ac4d27ca470593fd663b18a072a308926a35a2" - dependencies: - css-color-names "0.0.3" - is-css-color-name "^0.1.1" - - cross-spawn@^4.0.0: - version "4.0.2" - resolved "https://registry.yarnpkg.com/cross-spawn/-/cross-spawn-4.0.2.tgz#7b9247621c23adfdd3856004a823cbe397424d41" - dependencies: - lru-cache "^4.0.1" - which "^1.2.9" - - css-color-names@0.0.2: - version "0.0.2" - resolved "https://registry.yarnpkg.com/css-color-names/-/css-color-names-0.0.2.tgz#fba18e8cff86579572d749c146c47ee83f0ea955" - - css-color-names@0.0.3: - version "0.0.3" - resolved "https://registry.yarnpkg.com/css-color-names/-/css-color-names-0.0.3.tgz#de0cef16f4d8aa8222a320d5b6d7e9bbada7b9f6" - - debug@^2.2.0: - version "2.6.8" - resolved "https://registry.yarnpkg.com/debug/-/debug-2.6.8.tgz#e731531ca2ede27d188222427da17821d68ff4fc" - dependencies: - ms "2.0.0" - - default-shell@1.0.1, default-shell@^1.0.0: - version "1.0.1" - resolved "https://registry.yarnpkg.com/default-shell/-/default-shell-1.0.1.tgz#752304bddc6174f49eb29cb988feea0b8813c8bc" - - dot-prop@^4.1.0: - version "4.2.0" - resolved "https://registry.yarnpkg.com/dot-prop/-/dot-prop-4.2.0.tgz#1f19e0c2e1aa0e32797c49799f2837ac6af69c57" - dependencies: - is-obj "^1.0.0" - - electron-config@1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/electron-config/-/electron-config-1.0.0.tgz#069d044cc794f04784ae72f12916725d3c8c39af" - dependencies: - conf "^1.0.0" - - electron-is-dev@0.3.0: - version "0.3.0" - resolved "https://registry.yarnpkg.com/electron-is-dev/-/electron-is-dev-0.3.0.tgz#14e6fda5c68e9e4ecbeff9ccf037cbd7c05c5afe" - - electron-squirrel-startup@1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/electron-squirrel-startup/-/electron-squirrel-startup-1.0.0.tgz#19b4e55933fa0ef8f556784b9c660f772546a0b8" - dependencies: - debug "^2.2.0" - - encoding@^0.1.11: - version "0.1.12" - resolved "https://registry.yarnpkg.com/encoding/-/encoding-0.1.12.tgz#538b66f3ee62cd1ab51ec323829d1f9480c74beb" - dependencies: - iconv-lite "~0.4.13" - - env-paths@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/env-paths/-/env-paths-1.0.0.tgz#4168133b42bb05c38a35b1ae4397c8298ab369e0" - - execa@^0.5.0: - version "0.5.1" - resolved "https://registry.yarnpkg.com/execa/-/execa-0.5.1.tgz#de3fb85cb8d6e91c85bcbceb164581785cb57b36" - dependencies: - cross-spawn "^4.0.0" - get-stream "^2.2.0" - is-stream "^1.1.0" - npm-run-path "^2.0.0" - p-finally "^1.0.0" - signal-exit "^3.0.0" - strip-eof "^1.0.0" - - file-uri-to-path@1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/file-uri-to-path/-/file-uri-to-path-1.0.0.tgz#553a7b8446ff6f684359c445f1e37a05dacc33dd" - - find-up@^2.1.0: - version "2.1.0" - resolved "https://registry.yarnpkg.com/find-up/-/find-up-2.1.0.tgz#45d1b7e506c717ddd482775a2b77920a3c0c57a7" - dependencies: - locate-path "^2.0.0" - - get-stream@^2.2.0: - version "2.3.1" - resolved "https://registry.yarnpkg.com/get-stream/-/get-stream-2.3.1.tgz#5f38f93f346009666ee0150a054167f91bdd95de" - dependencies: - object-assign "^4.0.1" - pinkie-promise "^2.0.0" - - git-describe@4.0.2: - version "4.0.2" - resolved "https://registry.yarnpkg.com/git-describe/-/git-describe-4.0.2.tgz#9ecc5e6df4658450c89ea35d10183c9f5f40dc73" - dependencies: - lodash "^4.16.6" - optionalDependencies: - semver "^5.3.0" - - graceful-fs@^4.1.11: - version "4.1.11" - resolved "https://registry.yarnpkg.com/graceful-fs/-/graceful-fs-4.1.11.tgz#0e8bdfe4d1ddb8854d64e04ea7c00e2a026e5658" - - iconv-lite@~0.4.13: - version "0.4.19" - resolved "https://registry.yarnpkg.com/iconv-lite/-/iconv-lite-0.4.19.tgz#f7468f60135f5e5dad3399c0a81be9a1603a082b" - - imurmurhash@^0.1.4: - version "0.1.4" - resolved "https://registry.yarnpkg.com/imurmurhash/-/imurmurhash-0.1.4.tgz#9218b9b2b928a238b13dc4fb6b6d576f231453ea" - - inherits@~2.0.0: - version "2.0.3" - resolved "https://registry.yarnpkg.com/inherits/-/inherits-2.0.3.tgz#633c2c83e3da42a502f52466022480f4208261de" - - is-arrayish@^0.3.1: - version "0.3.1" - resolved "https://registry.yarnpkg.com/is-arrayish/-/is-arrayish-0.3.1.tgz#c2dfc386abaa0c3e33c48db3fe87059e69065efd" - - is-css-color-name@^0.1.1: - version "0.1.3" - resolved "https://registry.yarnpkg.com/is-css-color-name/-/is-css-color-name-0.1.3.tgz#ea3b51bc901d8a243d32c9b7873d0680dbbef7f1" - dependencies: - css-color-names "0.0.2" - - is-obj@^1.0.0: - version "1.0.1" - resolved "https://registry.yarnpkg.com/is-obj/-/is-obj-1.0.1.tgz#3e4729ac1f5fde025cd7d83a896dab9f4f67db0f" - - is-plain-obj@^1.0.0: - version "1.1.0" - resolved "https://registry.yarnpkg.com/is-plain-obj/-/is-plain-obj-1.1.0.tgz#71a50c8429dfca773c92a390a4a03b39fcd51d3e" - - is-ssh@^1.3.0: - version "1.3.0" - resolved "https://registry.yarnpkg.com/is-ssh/-/is-ssh-1.3.0.tgz#ebea1169a2614da392a63740366c3ce049d8dff6" - dependencies: - protocols "^1.1.0" - - is-stream@^1.0.1, is-stream@^1.1.0: - version "1.1.0" - resolved "https://registry.yarnpkg.com/is-stream/-/is-stream-1.1.0.tgz#12d4a3dd4e68e0b79ceb8dbc84173ae80d91ca44" - - isexe@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/isexe/-/isexe-2.0.0.tgz#e8fbf374dc556ff8947a10dcb0572d633f2cfa10" - - locate-path@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/locate-path/-/locate-path-2.0.0.tgz#2b568b265eec944c6d9c0de9c3dbbbca0354cd8e" - dependencies: - p-locate "^2.0.0" - path-exists "^3.0.0" - - lodash@4.17.5: - version "4.17.5" - resolved "https://registry.yarnpkg.com/lodash/-/lodash-4.17.5.tgz#99a92d65c0272debe8c96b6057bc8fbfa3bed511" - - lodash@^4.16.6: - version "4.17.4" - resolved "https://registry.yarnpkg.com/lodash/-/lodash-4.17.4.tgz#78203a4d1c328ae1d86dca6460e369b57f4055ae" - - lru-cache@^4.0.1: - version "4.1.1" - resolved "https://registry.yarnpkg.com/lru-cache/-/lru-cache-4.1.1.tgz#622e32e82488b49279114a4f9ecf45e7cd6bba55" - dependencies: - pseudomap "^1.0.2" - yallist "^2.1.2" - - make-dir@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/make-dir/-/make-dir-1.0.0.tgz#97a011751e91dd87cfadef58832ebb04936de978" - dependencies: - pify "^2.3.0" - - minimist@0.0.8: - version "0.0.8" - resolved "https://registry.yarnpkg.com/minimist/-/minimist-0.0.8.tgz#857fcabfc3397d2625b8228262e86aa7a011b05d" - - mkdirp@0.5.1: - version "0.5.1" - resolved "https://registry.yarnpkg.com/mkdirp/-/mkdirp-0.5.1.tgz#30057438eac6cf7f8c4767f38648d6697d75c903" - dependencies: - minimist "0.0.8" - - ms@2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/ms/-/ms-2.0.0.tgz#5608aeadfc00be6c2901df5f9861788de0d597c8" - - ms@2.1.1: - version "2.1.1" - resolved "https://registry.yarnpkg.com/ms/-/ms-2.1.1.tgz#30a5864eb3ebb0a66f2ebe6d727af06a09d86e0a" - - nan@^2.6.2: - version "2.7.0" - resolved "https://registry.yarnpkg.com/nan/-/nan-2.7.0.tgz#d95bf721ec877e08db276ed3fc6eb78f9083ad46" - - node-fetch@1.7.3: - version "1.7.3" - resolved "https://registry.yarnpkg.com/node-fetch/-/node-fetch-1.7.3.tgz#980f6f72d85211a5347c6b2bc18c5b84c3eb47ef" - dependencies: - encoding "^0.1.11" - is-stream "^1.0.1" - - node-pty@0.7.4: - version "0.7.4" - resolved "https://registry.yarnpkg.com/node-pty/-/node-pty-0.7.4.tgz#07146b2b40b76e432e57ce6750bda40f0da5c99f" - dependencies: - nan "^2.6.2" - - normalize-url@^1.9.1: - version "1.9.1" - resolved "https://registry.yarnpkg.com/normalize-url/-/normalize-url-1.9.1.tgz#2cc0d66b31ea23036458436e3620d85954c66c3c" - dependencies: - object-assign "^4.0.1" - prepend-http "^1.0.0" - query-string "^4.1.0" - sort-keys "^1.0.0" - - npm-run-path@^2.0.0: - version "2.0.2" - resolved "https://registry.yarnpkg.com/npm-run-path/-/npm-run-path-2.0.2.tgz#35a9232dfa35d7067b4cb2ddf2357b1871536c5f" - dependencies: - path-key "^2.0.0" - - object-assign@^4.0.1, object-assign@^4.1.0: - version "4.1.1" - resolved "https://registry.yarnpkg.com/object-assign/-/object-assign-4.1.1.tgz#2109adc7965887cfc05cbbd442cac8bfbb360863" - - p-finally@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/p-finally/-/p-finally-1.0.0.tgz#3fbcfb15b899a44123b34b6dcc18b724336a2cae" - - p-limit@^1.1.0: - version "1.1.0" - resolved "https://registry.yarnpkg.com/p-limit/-/p-limit-1.1.0.tgz#b07ff2d9a5d88bec806035895a2bab66a27988bc" - - p-locate@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/p-locate/-/p-locate-2.0.0.tgz#20a0103b222a70c8fd39cc2e580680f3dde5ec43" - dependencies: - p-limit "^1.1.0" - - parse-path@^3.0.1: - version "3.0.2" - resolved "https://registry.yarnpkg.com/parse-path/-/parse-path-3.0.2.tgz#4686980f0b262ee2dbb9a64eef739c91edc85245" - dependencies: - is-ssh "^1.3.0" - protocols "^1.4.0" - - parse-url@3.0.2: - version "3.0.2" - resolved "https://registry.yarnpkg.com/parse-url/-/parse-url-3.0.2.tgz#602787a7063a795d72b8673197505e72f60610be" - dependencies: - is-ssh "^1.3.0" - normalize-url "^1.9.1" - parse-path "^3.0.1" - protocols "^1.4.0" - - path-exists@^3.0.0: - version "3.0.0" - resolved "https://registry.yarnpkg.com/path-exists/-/path-exists-3.0.0.tgz#ce0ebeaa5f78cb18925ea7d810d7b59b010fd515" - - path-key@^2.0.0: - version "2.0.1" - resolved "https://registry.yarnpkg.com/path-key/-/path-key-2.0.1.tgz#411cadb574c5a140d3a4b1910d40d80cc9f40b40" - - pify@^2.3.0: - version "2.3.0" - resolved "https://registry.yarnpkg.com/pify/-/pify-2.3.0.tgz#ed141a6ac043a849ea588498e7dca8b15330e90c" - - pinkie-promise@^2.0.0: - version "2.0.1" - resolved "https://registry.yarnpkg.com/pinkie-promise/-/pinkie-promise-2.0.1.tgz#2135d6dfa7a358c069ac9b178776288228450ffa" - dependencies: - pinkie "^2.0.0" - - pinkie@^2.0.0: - version "2.0.4" - resolved "https://registry.yarnpkg.com/pinkie/-/pinkie-2.0.4.tgz#72556b80cfa0d48a974e80e77248e80ed4f7f870" - - pkg-up@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/pkg-up/-/pkg-up-2.0.0.tgz#c819ac728059a461cab1c3889a2be3c49a004d7f" - dependencies: - find-up "^2.1.0" - - prepend-http@^1.0.0: - version "1.0.4" - resolved "https://registry.yarnpkg.com/prepend-http/-/prepend-http-1.0.4.tgz#d4f4562b0ce3696e41ac52d0e002e57a635dc6dc" - - protocols@^1.1.0, protocols@^1.4.0: - version "1.4.6" - resolved "https://registry.yarnpkg.com/protocols/-/protocols-1.4.6.tgz#f8bb263ea1b5fd7a7604d26b8be39bd77678bf8a" - - pseudomap@^1.0.2: - version "1.0.2" - resolved "https://registry.yarnpkg.com/pseudomap/-/pseudomap-1.0.2.tgz#f052a28da70e618917ef0a8ac34c1ae5a68286b3" - - query-string@^4.1.0: - version "4.3.4" - resolved "https://registry.yarnpkg.com/query-string/-/query-string-4.3.4.tgz#bbb693b9ca915c232515b228b1a02b609043dbeb" - dependencies: - object-assign "^4.1.0" - strict-uri-encode "^1.0.0" - - queue@4.4.2: - version "4.4.2" - resolved "https://registry.yarnpkg.com/queue/-/queue-4.4.2.tgz#5a9733d9a8b8bd1b36e934bc9c55ab89b28e29c7" - dependencies: - inherits "~2.0.0" - - retry@0.10.1: - version "0.10.1" - resolved "https://registry.yarnpkg.com/retry/-/retry-0.10.1.tgz#e76388d217992c252750241d3d3956fed98d8ff4" - - semver@5.5.0: - version "5.5.0" - resolved "https://registry.yarnpkg.com/semver/-/semver-5.5.0.tgz#dc4bbc7a6ca9d916dee5d43516f0092b58f7b8ab" - - semver@^5.3.0: - version "5.4.1" - resolved "https://registry.yarnpkg.com/semver/-/semver-5.4.1.tgz#e059c09d8571f0540823733433505d3a2f00b18e" - - shell-env@0.3.0: - version "0.3.0" - resolved "https://registry.yarnpkg.com/shell-env/-/shell-env-0.3.0.tgz#2250339022989165bda4eb7bf383afeaaa92dc34" - dependencies: - default-shell "^1.0.0" - execa "^0.5.0" - strip-ansi "^3.0.0" - - signal-exit@^3.0.0, signal-exit@^3.0.2: - version "3.0.2" - resolved "https://registry.yarnpkg.com/signal-exit/-/signal-exit-3.0.2.tgz#b5fdc08f1287ea1178628e415e25132b73646c6d" - - simple-swizzle@^0.2.2: - version "0.2.2" - resolved "https://registry.yarnpkg.com/simple-swizzle/-/simple-swizzle-0.2.2.tgz#a4da6b635ffcccca33f70d17cb92592de95e557a" - dependencies: - is-arrayish "^0.3.1" - - sort-keys@^1.0.0: - version "1.1.2" - resolved "https://registry.yarnpkg.com/sort-keys/-/sort-keys-1.1.2.tgz#441b6d4d346798f1b4e49e8920adfba0e543f9ad" - dependencies: - is-plain-obj "^1.0.0" - - strict-uri-encode@^1.0.0: - version "1.1.0" - resolved "https://registry.yarnpkg.com/strict-uri-encode/-/strict-uri-encode-1.1.0.tgz#279b225df1d582b1f54e65addd4352e18faa0713" - - strip-ansi@^3.0.0: - version "3.0.1" - resolved "https://registry.yarnpkg.com/strip-ansi/-/strip-ansi-3.0.1.tgz#6a385fb8853d952d5ff05d0e8aaf94278dc63dcf" - dependencies: - ansi-regex "^2.0.0" - - strip-eof@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/strip-eof/-/strip-eof-1.0.0.tgz#bb43ff5598a6eb05d89b59fcd129c983313606bf" - - uuid@3.2.1: - version "3.2.1" - resolved "https://registry.yarnpkg.com/uuid/-/uuid-3.2.1.tgz#12c528bb9d58d0b9265d9a2f6f0fe8be17ff1f14" - - which@^1.2.9: - version "1.3.0" - resolved "https://registry.yarnpkg.com/which/-/which-1.3.0.tgz#ff04bdfc010ee547d780bec38e1ac1c2777d253a" - dependencies: - isexe "^2.0.0" - - winreg@1.2.4: - version "1.2.4" - resolved "https://registry.yarnpkg.com/winreg/-/winreg-1.2.4.tgz#ba065629b7a925130e15779108cf540990e98d1b" - - write-file-atomic@^2.3.0: - version "2.3.0" - resolved "https://registry.yarnpkg.com/write-file-atomic/-/write-file-atomic-2.3.0.tgz#1ff61575c2e2a4e8e510d6fa4e243cce183999ab" - dependencies: - graceful-fs "^4.1.11" - imurmurhash "^0.1.4" - signal-exit "^3.0.2" - - yallist@^2.1.2: - version "2.1.2" - resolved "https://registry.yarnpkg.com/yallist/-/yallist-2.1.2.tgz#1c11f9218f076089a47dd512f93c6699a6a81d52" - -Trace: - Error: /Users/leo/projects/hyper/app/node_modules/node-pty: Command failed. - Exit code: 1 - Command: sh - Arguments: -c node scripts/install.js - Directory: /Users/leo/projects/hyper/app/node_modules/node-pty - Output: - module.js:545 - throw err; - ^ - - Error: Cannot find module '/usr/local/lib/node_modules/npm/node_modules/node-gyp/bin/node-gyp.js' - at Function.Module._resolveFilename (module.js:543:15) - at Function.Module._load (module.js:470:25) - at Function.Module.runMain (module.js:690:10) - at startup (bootstrap_node.js:194:16) - at bootstrap_node.js:666:3 - at ProcessTermError.MessageError (/usr/local/Cellar/yarn/1.5.1_1/libexec/lib/cli.js:186:110) - at new ProcessTermError (/usr/local/Cellar/yarn/1.5.1_1/libexec/lib/cli.js:226:113) - at ChildProcess. (/usr/local/Cellar/yarn/1.5.1_1/libexec/lib/cli.js:30281:17) - at ChildProcess.emit (events.js:180:13) - at maybeClose (internal/child_process.js:936:16) - at Socket.stream.socket.on (internal/child_process.js:353:11) - at Socket.emit (events.js:180:13) - at Pipe._handle.close [as _onclose] (net.js:541:12) diff --git a/yarn-error.log b/yarn-error.log deleted file mode 100644 index 56d20f25630a..000000000000 --- a/yarn-error.log +++ /dev/null @@ -1,7075 +0,0 @@ -Arguments: - /usr/local/bin/node /usr/local/Cellar/yarn/1.5.1_1/libexec/bin/yarn.js - -PATH: - /usr/local/opt/openvpn/sbin:/Users/leo/google-cloud-sdk/bin:/usr/local/bin:/usr/bin:/bin:/usr/sbin:/sbin:/usr/local/go/bin:/opt/X11/bin - -Yarn version: - 1.5.1 - -Node version: - 9.10.1 - -Platform: - darwin x64 - -npm manifest: - { - "repository": "zeit/hyper", - "scripts": { - "start": "echo 'please run `yarn run dev` in one tab and then `yarn run app` in another one'", - "app": "electron app", - "dev": "webpack -w", - "build": "cross-env NODE_ENV=production webpack", - "lint": "eslint .", - "test": "yarn run lint && yarn run test:unit", - "test:unit": "ava test/unit", - "test:unit:watch": "yarn run test:unit -- --watch", - "prepush": "yarn test", - "postinstall": "electron-builder install-app-deps && yarn run rebuild-node-pty && yarn --cwd node_modules/xterm", - "rebuild-node-pty": "electron-rebuild -f -w app/node_modules/node-pty -m app", - "dist": - "yarn run build && cross-env BABEL_ENV=production babel --out-file app/renderer/bundle.js --no-comments --minified app/renderer/bundle.js && build", - "clean": - "node ./bin/rimraf-standalone.js node_modules && node ./bin/rimraf-standalone.js ./app/node_modules && node ./bin/rimraf-standalone.js ./app/renderer" - }, - "eslintConfig": { - "plugins": ["react", "prettier"], - "extends": ["eslint:recommended", "plugin:react/recommended", "prettier"], - "parserOptions": { - "ecmaVersion": 8, - "sourceType": "module", - "ecmaFeatures": { - "jsx": true, - "impliedStrict": true, - "experimentalObjectRestSpread": true - }, - "allowImportExportEverywhere": true - }, - "env": { - "es6": true, - "browser": true, - "node": true - }, - "rules": { - "func-names": ["error", "as-needed"], - "no-shadow": "error", - "no-extra-semi": 0, - "react/prop-types": 0, - "react/react-in-jsx-scope": 0, - "react/no-unescaped-entities": 0, - "react/jsx-no-target-blank": 0, - "react/no-string-refs": 0, - "prettier/prettier": [ - "error", - { - "printWidth": 120, - "tabWidth": 2, - "singleQuote": true, - "trailingComma": "none", - "bracketSpacing": false, - "semi": true, - "useTabs": false, - "parser": "babylon", - "jsxBracketSameLine": false - } - ] - }, - "overrides": [ - { - "files": "app/config/config-default.js", - "rules": { - "prettier/prettier": [ - "error", - { - "printWidth": 120, - "tabWidth": 2, - "singleQuote": true, - "trailingComma": "es5", - "bracketSpacing": false, - "semi": true, - "useTabs": false, - "parser": "babylon", - "jsxBracketSameLine": false - } - ] - } - } - ] - }, - "babel": { - "presets": ["react"], - "plugins": [ - [ - "styled-jsx/babel", - { - "vendorPrefixes": false - } - ] - ], - "env": { - "production": { - "plugins": [ - "minify-constant-folding", - "minify-dead-code-elimination", - "minify-flip-comparisons", - "minify-guarded-expressions", - "minify-infinity", - [ - "minify-mangle-names", - { - "keepClassName": true, - "keepFnName": true - } - ], - "minify-replace", - "minify-simplify", - "minify-type-constructors", - "transform-member-expression-literals", - "transform-merge-sibling-variables", - "transform-minify-booleans", - "transform-property-literals", - "transform-simplify-comparison-operators", - "transform-undefined-to-void" - ] - } - } - }, - "build": { - "appId": "co.zeit.hyper", - "extraResources": [ - "./bin/yarn-standalone.js", - "./bin/cli.js", - { - "from": "./build/${os}/", - "to": "./bin/", - "filter": ["hyper*"] - } - ], - "linux": { - "category": "TerminalEmulator", - "target": [ - { - "target": "deb", - "arch": ["x64"] - }, - { - "target": "AppImage", - "arch": ["x64"] - }, - { - "target": "rpm", - "arch": ["x64"] - } - ] - }, - "win": { - "target": ["squirrel"] - }, - "mac": { - "category": "public.app-category.developer-tools", - "extendInfo": "build/Info.plist" - }, - "deb": { - "afterInstall": "./build/linux/after-install.tpl" - }, - "rpm": { - "afterInstall": "./build/linux/after-install.tpl" - }, - "protocols": { - "name": "ssh URL", - "schemes": ["ssh"] - } - }, - "license": "MIT", - "author": { - "name": "ZEIT, Inc.", - "email": "team@zeit.co" - }, - "dependencies": { - "args": "3.0.8", - "chalk": "2.3.2", - "color": "2.0.1", - "columnify": "1.5.4", - "css-loader": "0.28.11", - "got": "7.1.0", - "json-loader": "0.5.7", - "mousetrap": "chabou/mousetrap#useCapture", - "ms": "2.1.1", - "opn": "5.3.0", - "ora": "1.3.0", - "parse-url": "3.0.2", - "php-escape-shell": "1.0.0", - "pify": "3.0.0", - "react": "16.2.0", - "react-deep-force-update": "2.1.1", - "react-dom": "16.2.0", - "react-redux": "5.0.7", - "recast": "0.13.0", - "redux": "3.7.2", - "redux-thunk": "2.2.0", - "reselect": "3.0.1", - "seamless-immutable": "7.1.3", - "semver": "5.5.0", - "shebang-loader": "0.0.1", - "styled-jsx": "2.2.6", - "stylis": "3.5.0", - "uuid": "3.1.0", - "xterm": "chabou/xterm.js#7cb4b8e" - }, - "devDependencies": { - "ava": "0.25.0", - "babel-cli": "6.26.0", - "babel-core": "6.26.0", - "babel-loader": "7.1.2", - "babel-preset-babili": "0.1.4", - "babel-preset-react": "6.24.1", - "copy-webpack-plugin": "4.3.1", - "cross-env": "5.1.4", - "electron": "1.8.4", - "electron-builder": "20.5.1", - "electron-builder-squirrel-windows": "20.5.0", - "electron-devtools-installer": "2.2.3", - "electron-rebuild": "1.7.3", - "eslint": "4.7.2", - "eslint-config-prettier": "2.6.0", - "eslint-plugin-prettier": "2.3.1", - "eslint-plugin-react": "7.3.0", - "husky": "0.14.3", - "inquirer": "5.1.0", - "node-gyp": "3.6.2", - "prettier": "1.11.1", - "proxyquire": "1.8.0", - "spectron": "3.8.0", - "style-loader": "0.19.1", - "webpack": "3.10.0" - }, - "resolutions": { - "rc": "1.2.3" - } - } - -yarn manifest: - No manifest - -Lockfile: - # THIS IS AN AUTOGENERATED FILE. DO NOT EDIT THIS FILE DIRECTLY. - # yarn lockfile v1 - - - "7zip-bin-linux@~1.3.1": - version "1.3.1" - resolved "https://registry.yarnpkg.com/7zip-bin-linux/-/7zip-bin-linux-1.3.1.tgz#4856db1ab1bf5b6ee8444f93f5a8ad71446d00d5" - - "7zip-bin-mac@~1.0.1": - version "1.0.1" - resolved "https://registry.yarnpkg.com/7zip-bin-mac/-/7zip-bin-mac-1.0.1.tgz#3e68778bbf0926adc68159427074505d47555c02" - - "7zip-bin-win@~2.2.0": - version "2.2.0" - resolved "https://registry.yarnpkg.com/7zip-bin-win/-/7zip-bin-win-2.2.0.tgz#0b81c43e911100f3ece2ebac4f414ca95a572d5b" - - "7zip-bin@~3.1.0": - version "3.1.0" - resolved "https://registry.yarnpkg.com/7zip-bin/-/7zip-bin-3.1.0.tgz#70814c6b6d44fef8b74be6fc64d3977a2eff59a5" - optionalDependencies: - "7zip-bin-linux" "~1.3.1" - "7zip-bin-mac" "~1.0.1" - "7zip-bin-win" "~2.2.0" - - "7zip@0.0.6": - version "0.0.6" - resolved "https://registry.yarnpkg.com/7zip/-/7zip-0.0.6.tgz#9cafb171af82329490353b4816f03347aa150a30" - - "@ava/babel-plugin-throws-helper@^2.0.0": - version "2.0.0" - resolved "https://registry.yarnpkg.com/@ava/babel-plugin-throws-helper/-/babel-plugin-throws-helper-2.0.0.tgz#2fc1fe3c211a71071a4eca7b8f7af5842cd1ae7c" - - "@ava/babel-preset-stage-4@^1.1.0": - version "1.1.0" - resolved "https://registry.yarnpkg.com/@ava/babel-preset-stage-4/-/babel-preset-stage-4-1.1.0.tgz#ae60be881a0babf7d35f52aba770d1f6194f76bd" - dependencies: - babel-plugin-check-es2015-constants "^6.8.0" - babel-plugin-syntax-trailing-function-commas "^6.20.0" - babel-plugin-transform-async-to-generator "^6.16.0" - babel-plugin-transform-es2015-destructuring "^6.19.0" - babel-plugin-transform-es2015-function-name "^6.9.0" - babel-plugin-transform-es2015-modules-commonjs "^6.18.0" - babel-plugin-transform-es2015-parameters "^6.21.0" - babel-plugin-transform-es2015-spread "^6.8.0" - babel-plugin-transform-es2015-sticky-regex "^6.8.0" - babel-plugin-transform-es2015-unicode-regex "^6.11.0" - babel-plugin-transform-exponentiation-operator "^6.8.0" - package-hash "^1.2.0" - - "@ava/babel-preset-transform-test-files@^3.0.0": - version "3.0.0" - resolved "https://registry.yarnpkg.com/@ava/babel-preset-transform-test-files/-/babel-preset-transform-test-files-3.0.0.tgz#cded1196a8d8d9381a509240ab92e91a5ec069f7" - dependencies: - "@ava/babel-plugin-throws-helper" "^2.0.0" - babel-plugin-espower "^2.3.2" - - "@ava/write-file-atomic@^2.2.0": - version "2.2.0" - resolved "https://registry.yarnpkg.com/@ava/write-file-atomic/-/write-file-atomic-2.2.0.tgz#d625046f3495f1f5e372135f473909684b429247" - dependencies: - graceful-fs "^4.1.11" - imurmurhash "^0.1.4" - slide "^1.1.5" - - "@concordance/react@^1.0.0": - version "1.0.0" - resolved "https://registry.yarnpkg.com/@concordance/react/-/react-1.0.0.tgz#fcf3cad020e5121bfd1c61d05bc3516aac25f734" - dependencies: - arrify "^1.0.1" - - "@ladjs/time-require@^0.1.4": - version "0.1.4" - resolved "https://registry.yarnpkg.com/@ladjs/time-require/-/time-require-0.1.4.tgz#5c615d75fd647ddd5de9cf6922649558856b21a1" - dependencies: - chalk "^0.4.0" - date-time "^0.1.1" - pretty-ms "^0.2.1" - text-table "^0.2.0" - - "@types/node@^8.0.24": - version "8.9.4" - resolved "https://registry.yarnpkg.com/@types/node/-/node-8.9.4.tgz#dfd327582a06c114eb6e0441fa3d6fab35edad48" - - abbrev@1: - version "1.1.1" - resolved "https://registry.yarnpkg.com/abbrev/-/abbrev-1.1.1.tgz#f8f2c887ad10bf67f634f005b6987fed3179aac8" - - acorn-dynamic-import@^2.0.0: - version "2.0.2" - resolved "https://registry.yarnpkg.com/acorn-dynamic-import/-/acorn-dynamic-import-2.0.2.tgz#c752bd210bef679501b6c6cb7fc84f8f47158cc4" - dependencies: - acorn "^4.0.3" - - acorn-jsx@^3.0.0: - version "3.0.1" - resolved "https://registry.yarnpkg.com/acorn-jsx/-/acorn-jsx-3.0.1.tgz#afdf9488fb1ecefc8348f6fb22f464e32a58b36b" - dependencies: - acorn "^3.0.4" - - acorn@^3.0.4: - version "3.3.0" - resolved "https://registry.yarnpkg.com/acorn/-/acorn-3.3.0.tgz#45e37fb39e8da3f25baee3ff5369e2bb5f22017a" - - acorn@^4.0.3: - version "4.0.13" - resolved "https://registry.yarnpkg.com/acorn/-/acorn-4.0.13.tgz#105495ae5361d697bd195c825192e1ad7f253787" - - acorn@^5.0.0: - version "5.4.1" - resolved "https://registry.yarnpkg.com/acorn/-/acorn-5.4.1.tgz#fdc58d9d17f4a4e98d102ded826a9b9759125102" - - acorn@^5.5.0: - version "5.5.3" - resolved "https://registry.yarnpkg.com/acorn/-/acorn-5.5.3.tgz#f473dd47e0277a08e28e9bec5aeeb04751f0b8c9" - - ajv-keywords@^2.0.0, ajv-keywords@^2.1.0: - version "2.1.1" - resolved "https://registry.yarnpkg.com/ajv-keywords/-/ajv-keywords-2.1.1.tgz#617997fc5f60576894c435f940d819e135b80762" - - ajv-keywords@^3.1.0: - version "3.1.0" - resolved "https://registry.yarnpkg.com/ajv-keywords/-/ajv-keywords-3.1.0.tgz#ac2b27939c543e95d2c06e7f7f5c27be4aa543be" - - ajv@^4.9.1: - version "4.11.8" - resolved "https://registry.yarnpkg.com/ajv/-/ajv-4.11.8.tgz#82ffb02b29e662ae53bdc20af15947706739c536" - dependencies: - co "^4.6.0" - json-stable-stringify "^1.0.1" - - ajv@^5.0.0, ajv@^5.1.0, ajv@^5.1.5, ajv@^5.2.0, ajv@^5.2.3: - version "5.5.2" - resolved "https://registry.yarnpkg.com/ajv/-/ajv-5.5.2.tgz#73b5eeca3fab653e3d3f9422b341ad42205dc965" - dependencies: - co "^4.6.0" - fast-deep-equal "^1.0.0" - fast-json-stable-stringify "^2.0.0" - json-schema-traverse "^0.3.0" - - ajv@^6.1.1: - version "6.2.1" - resolved "https://registry.yarnpkg.com/ajv/-/ajv-6.2.1.tgz#28a6abc493a2abe0fb4c8507acaedb43fa550671" - dependencies: - fast-deep-equal "^1.0.0" - fast-json-stable-stringify "^2.0.0" - json-schema-traverse "^0.3.0" - - align-text@^0.1.1, align-text@^0.1.3: - version "0.1.4" - resolved "https://registry.yarnpkg.com/align-text/-/align-text-0.1.4.tgz#0cd90a561093f35d0a99256c22b7069433fad117" - dependencies: - kind-of "^3.0.2" - longest "^1.0.1" - repeat-string "^1.5.2" - - alphanum-sort@^1.0.1, alphanum-sort@^1.0.2: - version "1.0.2" - resolved "https://registry.yarnpkg.com/alphanum-sort/-/alphanum-sort-1.0.2.tgz#97a1119649b211ad33691d9f9f486a8ec9fbe0a3" - - amdefine@>=0.0.4: - version "1.0.1" - resolved "https://registry.yarnpkg.com/amdefine/-/amdefine-1.0.1.tgz#4a5282ac164729e93619bcfd3ad151f817ce91f5" - - ansi-align@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/ansi-align/-/ansi-align-2.0.0.tgz#c36aeccba563b89ceb556f3690f0b1d9e3547f7f" - dependencies: - string-width "^2.0.0" - - ansi-escapes@^3.0.0: - version "3.0.0" - resolved "https://registry.yarnpkg.com/ansi-escapes/-/ansi-escapes-3.0.0.tgz#ec3e8b4e9f8064fc02c3ac9b65f1c275bda8ef92" - - ansi-regex@^2.0.0: - version "2.1.1" - resolved "https://registry.yarnpkg.com/ansi-regex/-/ansi-regex-2.1.1.tgz#c3b33ab5ee360d86e0e628f0468ae7ef27d654df" - - ansi-regex@^3.0.0: - version "3.0.0" - resolved "https://registry.yarnpkg.com/ansi-regex/-/ansi-regex-3.0.0.tgz#ed0317c322064f79466c02966bddb605ab37d998" - - ansi-styles@^2.2.1: - version "2.2.1" - resolved "https://registry.yarnpkg.com/ansi-styles/-/ansi-styles-2.2.1.tgz#b432dd3358b634cf75e1e4664368240533c1ddbe" - - ansi-styles@^3.1.0, ansi-styles@^3.2.0: - version "3.2.0" - resolved "https://registry.yarnpkg.com/ansi-styles/-/ansi-styles-3.2.0.tgz#c159b8d5be0f9e5a6f346dab94f16ce022161b88" - dependencies: - color-convert "^1.9.0" - - ansi-styles@^3.2.1: - version "3.2.1" - resolved "https://registry.yarnpkg.com/ansi-styles/-/ansi-styles-3.2.1.tgz#41fbb20243e50b12be0f04b8dedbf07520ce841d" - dependencies: - color-convert "^1.9.0" - - ansi-styles@~1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/ansi-styles/-/ansi-styles-1.0.0.tgz#cb102df1c56f5123eab8b67cd7b98027a0279178" - - anymatch@^1.3.0: - version "1.3.2" - resolved "https://registry.yarnpkg.com/anymatch/-/anymatch-1.3.2.tgz#553dcb8f91e3c889845dfdba34c77721b90b9d7a" - dependencies: - micromatch "^2.1.5" - normalize-path "^2.0.0" - - app-builder-bin-linux@1.7.2: - version "1.7.2" - resolved "https://registry.yarnpkg.com/app-builder-bin-linux/-/app-builder-bin-linux-1.7.2.tgz#a764c8e52ecf1b5b068f32c820c6daf1ffed6a8f" - - app-builder-bin-mac@1.7.2: - version "1.7.2" - resolved "https://registry.yarnpkg.com/app-builder-bin-mac/-/app-builder-bin-mac-1.7.2.tgz#c4ee0d950666c97c12a45ac74ec6396be3357644" - - app-builder-bin-win@1.7.2: - version "1.7.2" - resolved "https://registry.yarnpkg.com/app-builder-bin-win/-/app-builder-bin-win-1.7.2.tgz#7acac890782f4118f09941b343ba06c56452a6f6" - - app-builder-bin@1.7.2: - version "1.7.2" - resolved "https://registry.yarnpkg.com/app-builder-bin/-/app-builder-bin-1.7.2.tgz#daf67060a6bad8f5f611a0d2876d9db897a83f06" - optionalDependencies: - app-builder-bin-linux "1.7.2" - app-builder-bin-mac "1.7.2" - app-builder-bin-win "1.7.2" - - aproba@^1.0.3, aproba@^1.1.1: - version "1.2.0" - resolved "https://registry.yarnpkg.com/aproba/-/aproba-1.2.0.tgz#6802e6264efd18c790a1b0d517f0f2627bf2c94a" - - archiver-utils@^1.3.0: - version "1.3.0" - resolved "https://registry.yarnpkg.com/archiver-utils/-/archiver-utils-1.3.0.tgz#e50b4c09c70bf3d680e32ff1b7994e9f9d895174" - dependencies: - glob "^7.0.0" - graceful-fs "^4.1.0" - lazystream "^1.0.0" - lodash "^4.8.0" - normalize-path "^2.0.0" - readable-stream "^2.0.0" - - archiver@^2.1.1, archiver@~2.1.0: - version "2.1.1" - resolved "https://registry.yarnpkg.com/archiver/-/archiver-2.1.1.tgz#ff662b4a78201494a3ee544d3a33fe7496509ebc" - dependencies: - archiver-utils "^1.3.0" - async "^2.0.0" - buffer-crc32 "^0.2.1" - glob "^7.0.0" - lodash "^4.8.0" - readable-stream "^2.0.0" - tar-stream "^1.5.0" - zip-stream "^1.2.0" - - are-we-there-yet@~1.1.2: - version "1.1.4" - resolved "https://registry.yarnpkg.com/are-we-there-yet/-/are-we-there-yet-1.1.4.tgz#bb5dca382bb94f05e15194373d16fd3ba1ca110d" - dependencies: - delegates "^1.0.0" - readable-stream "^2.0.6" - - argparse@^1.0.7: - version "1.0.10" - resolved "https://registry.yarnpkg.com/argparse/-/argparse-1.0.10.tgz#bcd6791ea5ae09725e17e5ad988134cd40b3d911" - dependencies: - sprintf-js "~1.0.2" - - args@3.0.8: - version "3.0.8" - resolved "https://registry.yarnpkg.com/args/-/args-3.0.8.tgz#2f425ab639c69d74ff728f3d7c6e93b97b91af7c" - dependencies: - camelcase "4.1.0" - chalk "2.1.0" - mri "1.1.0" - pkginfo "0.4.1" - string-similarity "1.2.0" - - arr-diff@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/arr-diff/-/arr-diff-2.0.0.tgz#8f3b827f955a8bd669697e4a4256ac3ceae356cf" - dependencies: - arr-flatten "^1.0.1" - - arr-exclude@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/arr-exclude/-/arr-exclude-1.0.0.tgz#dfc7c2e552a270723ccda04cf3128c8cbfe5c631" - - arr-flatten@^1.0.1: - version "1.1.0" - resolved "https://registry.yarnpkg.com/arr-flatten/-/arr-flatten-1.1.0.tgz#36048bbff4e7b47e136644316c99669ea5ae91f1" - - array-differ@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/array-differ/-/array-differ-1.0.0.tgz#eff52e3758249d33be402b8bb8e564bb2b5d4031" - - array-find-index@^1.0.1: - version "1.0.2" - resolved "https://registry.yarnpkg.com/array-find-index/-/array-find-index-1.0.2.tgz#df010aa1287e164bbda6f9723b0a96a1ec4187a1" - - array-includes@^3.0.3: - version "3.0.3" - resolved "https://registry.yarnpkg.com/array-includes/-/array-includes-3.0.3.tgz#184b48f62d92d7452bb31b323165c7f8bd02266d" - dependencies: - define-properties "^1.1.2" - es-abstract "^1.7.0" - - array-union@^1.0.1: - version "1.0.2" - resolved "https://registry.yarnpkg.com/array-union/-/array-union-1.0.2.tgz#9a34410e4f4e3da23dea375be5be70f24778ec39" - dependencies: - array-uniq "^1.0.1" - - array-uniq@^1.0.1, array-uniq@^1.0.2: - version "1.0.3" - resolved "https://registry.yarnpkg.com/array-uniq/-/array-uniq-1.0.3.tgz#af6ac877a25cc7f74e058894753858dfdb24fdb6" - - array-unique@^0.2.1: - version "0.2.1" - resolved "https://registry.yarnpkg.com/array-unique/-/array-unique-0.2.1.tgz#a1d97ccafcbc2625cc70fadceb36a50c58b01a53" - - arrify@^1.0.0, arrify@^1.0.1: - version "1.0.1" - resolved "https://registry.yarnpkg.com/arrify/-/arrify-1.0.1.tgz#898508da2226f380df904728456849c1501a4b0d" - - asap@~2.0.3: - version "2.0.6" - resolved "https://registry.yarnpkg.com/asap/-/asap-2.0.6.tgz#e50347611d7e690943208bbdafebcbc2fb866d46" - - asn1.js@^4.0.0: - version "4.10.1" - resolved "https://registry.yarnpkg.com/asn1.js/-/asn1.js-4.10.1.tgz#b9c2bf5805f1e64aadeed6df3a2bfafb5a73f5a0" - dependencies: - bn.js "^4.0.0" - inherits "^2.0.1" - minimalistic-assert "^1.0.0" - - asn1@~0.2.3: - version "0.2.3" - resolved "https://registry.yarnpkg.com/asn1/-/asn1-0.2.3.tgz#dac8787713c9966849fc8180777ebe9c1ddf3b86" - - assert-plus@1.0.0, assert-plus@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/assert-plus/-/assert-plus-1.0.0.tgz#f12e0f3c5d77b0b1cdd9146942e4e96c1e4dd525" - - assert-plus@^0.2.0: - version "0.2.0" - resolved "https://registry.yarnpkg.com/assert-plus/-/assert-plus-0.2.0.tgz#d74e1b87e7affc0db8aadb7021f3fe48101ab234" - - assert@^1.1.1: - version "1.4.1" - resolved "https://registry.yarnpkg.com/assert/-/assert-1.4.1.tgz#99912d591836b5a6f5b345c0f07eefc08fc65d91" - dependencies: - util "0.10.3" - - ast-types@0.10.1: - version "0.10.1" - resolved "https://registry.yarnpkg.com/ast-types/-/ast-types-0.10.1.tgz#f52fca9715579a14f841d67d7f8d25432ab6a3dd" - - async-each@^1.0.0: - version "1.0.1" - resolved "https://registry.yarnpkg.com/async-each/-/async-each-1.0.1.tgz#19d386a1d9edc6e7c1c85d388aedbcc56d33602d" - - async-exit-hook@^2.0.1: - version "2.0.1" - resolved "https://registry.yarnpkg.com/async-exit-hook/-/async-exit-hook-2.0.1.tgz#8bd8b024b0ec9b1c01cccb9af9db29bd717dfaf3" - - async@^2.0.0, async@^2.1.2: - version "2.6.0" - resolved "https://registry.yarnpkg.com/async/-/async-2.6.0.tgz#61a29abb6fcc026fea77e56d1c6ec53a795951f4" - dependencies: - lodash "^4.14.0" - - asynckit@^0.4.0: - version "0.4.0" - resolved "https://registry.yarnpkg.com/asynckit/-/asynckit-0.4.0.tgz#c79ed97f7f34cb8f2ba1bc9790bcc366474b4b79" - - atob@~1.1.0: - version "1.1.3" - resolved "https://registry.yarnpkg.com/atob/-/atob-1.1.3.tgz#95f13629b12c3a51a5d215abdce2aa9f32f80773" - - auto-bind@^1.1.0: - version "1.2.0" - resolved "https://registry.yarnpkg.com/auto-bind/-/auto-bind-1.2.0.tgz#8b7e318aad53d43ba8a8ecaf0066d85d5f798cd6" - - autoprefixer@^6.3.1: - version "6.7.7" - resolved "https://registry.yarnpkg.com/autoprefixer/-/autoprefixer-6.7.7.tgz#1dbd1c835658e35ce3f9984099db00585c782014" - dependencies: - browserslist "^1.7.6" - caniuse-db "^1.0.30000634" - normalize-range "^0.1.2" - num2fraction "^1.2.2" - postcss "^5.2.16" - postcss-value-parser "^3.2.3" - - ava-init@^0.2.0: - version "0.2.1" - resolved "https://registry.yarnpkg.com/ava-init/-/ava-init-0.2.1.tgz#75ac4c8553326290d2866e63b62fa7035684bd58" - dependencies: - arr-exclude "^1.0.0" - execa "^0.7.0" - has-yarn "^1.0.0" - read-pkg-up "^2.0.0" - write-pkg "^3.1.0" - - ava@0.25.0: - version "0.25.0" - resolved "https://registry.yarnpkg.com/ava/-/ava-0.25.0.tgz#8ac87780514f96a6fd42e1306eaa0752ce3a407f" - dependencies: - "@ava/babel-preset-stage-4" "^1.1.0" - "@ava/babel-preset-transform-test-files" "^3.0.0" - "@ava/write-file-atomic" "^2.2.0" - "@concordance/react" "^1.0.0" - "@ladjs/time-require" "^0.1.4" - ansi-escapes "^3.0.0" - ansi-styles "^3.1.0" - arr-flatten "^1.0.1" - array-union "^1.0.1" - array-uniq "^1.0.2" - arrify "^1.0.0" - auto-bind "^1.1.0" - ava-init "^0.2.0" - babel-core "^6.17.0" - babel-generator "^6.26.0" - babel-plugin-syntax-object-rest-spread "^6.13.0" - bluebird "^3.0.0" - caching-transform "^1.0.0" - chalk "^2.0.1" - chokidar "^1.4.2" - clean-stack "^1.1.1" - clean-yaml-object "^0.1.0" - cli-cursor "^2.1.0" - cli-spinners "^1.0.0" - cli-truncate "^1.0.0" - co-with-promise "^4.6.0" - code-excerpt "^2.1.1" - common-path-prefix "^1.0.0" - concordance "^3.0.0" - convert-source-map "^1.5.1" - core-assert "^0.2.0" - currently-unhandled "^0.4.1" - debug "^3.0.1" - dot-prop "^4.1.0" - empower-core "^0.6.1" - equal-length "^1.0.0" - figures "^2.0.0" - find-cache-dir "^1.0.0" - fn-name "^2.0.0" - get-port "^3.0.0" - globby "^6.0.0" - has-flag "^2.0.0" - hullabaloo-config-manager "^1.1.0" - ignore-by-default "^1.0.0" - import-local "^0.1.1" - indent-string "^3.0.0" - is-ci "^1.0.7" - is-generator-fn "^1.0.0" - is-obj "^1.0.0" - is-observable "^1.0.0" - is-promise "^2.1.0" - last-line-stream "^1.0.0" - lodash.clonedeepwith "^4.5.0" - lodash.debounce "^4.0.3" - lodash.difference "^4.3.0" - lodash.flatten "^4.2.0" - loud-rejection "^1.2.0" - make-dir "^1.0.0" - matcher "^1.0.0" - md5-hex "^2.0.0" - meow "^3.7.0" - ms "^2.0.0" - multimatch "^2.1.0" - observable-to-promise "^0.5.0" - option-chain "^1.0.0" - package-hash "^2.0.0" - pkg-conf "^2.0.0" - plur "^2.0.0" - pretty-ms "^3.0.0" - require-precompiled "^0.1.0" - resolve-cwd "^2.0.0" - safe-buffer "^5.1.1" - semver "^5.4.1" - slash "^1.0.0" - source-map-support "^0.5.0" - stack-utils "^1.0.1" - strip-ansi "^4.0.0" - strip-bom-buf "^1.0.0" - supertap "^1.0.0" - supports-color "^5.0.0" - trim-off-newlines "^1.0.1" - unique-temp-dir "^1.0.0" - update-notifier "^2.3.0" - - aws-sign2@~0.6.0: - version "0.6.0" - resolved "https://registry.yarnpkg.com/aws-sign2/-/aws-sign2-0.6.0.tgz#14342dd38dbcc94d0e5b87d763cd63612c0e794f" - - aws-sign2@~0.7.0: - version "0.7.0" - resolved "https://registry.yarnpkg.com/aws-sign2/-/aws-sign2-0.7.0.tgz#b46e890934a9591f2d2f6f86d7e6a9f1b3fe76a8" - - aws4@^1.2.1, aws4@^1.6.0: - version "1.6.0" - resolved "https://registry.yarnpkg.com/aws4/-/aws4-1.6.0.tgz#83ef5ca860b2b32e4a0deedee8c771b9db57471e" - - babel-cli@6.26.0: - version "6.26.0" - resolved "https://registry.yarnpkg.com/babel-cli/-/babel-cli-6.26.0.tgz#502ab54874d7db88ad00b887a06383ce03d002f1" - dependencies: - babel-core "^6.26.0" - babel-polyfill "^6.26.0" - babel-register "^6.26.0" - babel-runtime "^6.26.0" - commander "^2.11.0" - convert-source-map "^1.5.0" - fs-readdir-recursive "^1.0.0" - glob "^7.1.2" - lodash "^4.17.4" - output-file-sync "^1.1.2" - path-is-absolute "^1.0.1" - slash "^1.0.0" - source-map "^0.5.6" - v8flags "^2.1.1" - optionalDependencies: - chokidar "^1.6.1" - - babel-code-frame@^6.22.0, babel-code-frame@^6.26.0: - version "6.26.0" - resolved "https://registry.yarnpkg.com/babel-code-frame/-/babel-code-frame-6.26.0.tgz#63fd43f7dc1e3bb7ce35947db8fe369a3f58c74b" - dependencies: - chalk "^1.1.3" - esutils "^2.0.2" - js-tokens "^3.0.2" - - babel-core@6.26.0, babel-core@^6.17.0, babel-core@^6.26.0: - version "6.26.0" - resolved "https://registry.yarnpkg.com/babel-core/-/babel-core-6.26.0.tgz#af32f78b31a6fcef119c87b0fd8d9753f03a0bb8" - dependencies: - babel-code-frame "^6.26.0" - babel-generator "^6.26.0" - babel-helpers "^6.24.1" - babel-messages "^6.23.0" - babel-register "^6.26.0" - babel-runtime "^6.26.0" - babel-template "^6.26.0" - babel-traverse "^6.26.0" - babel-types "^6.26.0" - babylon "^6.18.0" - convert-source-map "^1.5.0" - debug "^2.6.8" - json5 "^0.5.1" - lodash "^4.17.4" - minimatch "^3.0.4" - path-is-absolute "^1.0.1" - private "^0.1.7" - slash "^1.0.0" - source-map "^0.5.6" - - babel-generator@^6.1.0, babel-generator@^6.26.0: - version "6.26.1" - resolved "https://registry.yarnpkg.com/babel-generator/-/babel-generator-6.26.1.tgz#1844408d3b8f0d35a404ea7ac180f087a601bd90" - dependencies: - babel-messages "^6.23.0" - babel-runtime "^6.26.0" - babel-types "^6.26.0" - detect-indent "^4.0.0" - jsesc "^1.3.0" - lodash "^4.17.4" - source-map "^0.5.7" - trim-right "^1.0.1" - - babel-helper-builder-binary-assignment-operator-visitor@^6.24.1: - version "6.24.1" - resolved "https://registry.yarnpkg.com/babel-helper-builder-binary-assignment-operator-visitor/-/babel-helper-builder-binary-assignment-operator-visitor-6.24.1.tgz#cce4517ada356f4220bcae8a02c2b346f9a56664" - dependencies: - babel-helper-explode-assignable-expression "^6.24.1" - babel-runtime "^6.22.0" - babel-types "^6.24.1" - - babel-helper-builder-react-jsx@^6.24.1: - version "6.26.0" - resolved "https://registry.yarnpkg.com/babel-helper-builder-react-jsx/-/babel-helper-builder-react-jsx-6.26.0.tgz#39ff8313b75c8b65dceff1f31d383e0ff2a408a0" - dependencies: - babel-runtime "^6.26.0" - babel-types "^6.26.0" - esutils "^2.0.2" - - babel-helper-call-delegate@^6.24.1: - version "6.24.1" - resolved "https://registry.yarnpkg.com/babel-helper-call-delegate/-/babel-helper-call-delegate-6.24.1.tgz#ece6aacddc76e41c3461f88bfc575bd0daa2df8d" - dependencies: - babel-helper-hoist-variables "^6.24.1" - babel-runtime "^6.22.0" - babel-traverse "^6.24.1" - babel-types "^6.24.1" - - babel-helper-evaluate-path@^0.1.0: - version "0.1.0" - resolved "https://registry.yarnpkg.com/babel-helper-evaluate-path/-/babel-helper-evaluate-path-0.1.0.tgz#95d98c4ea36150483db2e7d3ec9e1954a72629cb" - - babel-helper-explode-assignable-expression@^6.24.1: - version "6.24.1" - resolved "https://registry.yarnpkg.com/babel-helper-explode-assignable-expression/-/babel-helper-explode-assignable-expression-6.24.1.tgz#f25b82cf7dc10433c55f70592d5746400ac22caa" - dependencies: - babel-runtime "^6.22.0" - babel-traverse "^6.24.1" - babel-types "^6.24.1" - - babel-helper-flip-expressions@^0.1.2: - version "0.1.2" - resolved "https://registry.yarnpkg.com/babel-helper-flip-expressions/-/babel-helper-flip-expressions-0.1.2.tgz#77f6652f9de9c42401d827bd46ebd2109e3ef18a" - - babel-helper-function-name@^6.24.1: - version "6.24.1" - resolved "https://registry.yarnpkg.com/babel-helper-function-name/-/babel-helper-function-name-6.24.1.tgz#d3475b8c03ed98242a25b48351ab18399d3580a9" - dependencies: - babel-helper-get-function-arity "^6.24.1" - babel-runtime "^6.22.0" - babel-template "^6.24.1" - babel-traverse "^6.24.1" - babel-types "^6.24.1" - - babel-helper-get-function-arity@^6.24.1: - version "6.24.1" - resolved "https://registry.yarnpkg.com/babel-helper-get-function-arity/-/babel-helper-get-function-arity-6.24.1.tgz#8f7782aa93407c41d3aa50908f89b031b1b6853d" - dependencies: - babel-runtime "^6.22.0" - babel-types "^6.24.1" - - babel-helper-hoist-variables@^6.24.1: - version "6.24.1" - resolved "https://registry.yarnpkg.com/babel-helper-hoist-variables/-/babel-helper-hoist-variables-6.24.1.tgz#1ecb27689c9d25513eadbc9914a73f5408be7a76" - dependencies: - babel-runtime "^6.22.0" - babel-types "^6.24.1" - - babel-helper-is-nodes-equiv@^0.0.1: - version "0.0.1" - resolved "https://registry.yarnpkg.com/babel-helper-is-nodes-equiv/-/babel-helper-is-nodes-equiv-0.0.1.tgz#34e9b300b1479ddd98ec77ea0bbe9342dfe39684" - - babel-helper-is-void-0@^0.1.1: - version "0.1.1" - resolved "https://registry.yarnpkg.com/babel-helper-is-void-0/-/babel-helper-is-void-0-0.1.1.tgz#72f21a3abba0bef3837f9174fca731aed9a02888" - - babel-helper-mark-eval-scopes@^0.1.1: - version "0.1.1" - resolved "https://registry.yarnpkg.com/babel-helper-mark-eval-scopes/-/babel-helper-mark-eval-scopes-0.1.1.tgz#4554345edf9f2549427bd2098e530253f8af2992" - - babel-helper-regex@^6.24.1: - version "6.26.0" - resolved "https://registry.yarnpkg.com/babel-helper-regex/-/babel-helper-regex-6.26.0.tgz#325c59f902f82f24b74faceed0363954f6495e72" - dependencies: - babel-runtime "^6.26.0" - babel-types "^6.26.0" - lodash "^4.17.4" - - babel-helper-remap-async-to-generator@^6.24.1: - version "6.24.1" - resolved "https://registry.yarnpkg.com/babel-helper-remap-async-to-generator/-/babel-helper-remap-async-to-generator-6.24.1.tgz#5ec581827ad723fecdd381f1c928390676e4551b" - dependencies: - babel-helper-function-name "^6.24.1" - babel-runtime "^6.22.0" - babel-template "^6.24.1" - babel-traverse "^6.24.1" - babel-types "^6.24.1" - - babel-helper-remove-or-void@^0.1.1: - version "0.1.1" - resolved "https://registry.yarnpkg.com/babel-helper-remove-or-void/-/babel-helper-remove-or-void-0.1.1.tgz#9d7e1856dc6fafcb41b283a416730dc1844f66d7" - - babel-helper-to-multiple-sequence-expressions@^0.1.1: - version "0.1.1" - resolved "https://registry.yarnpkg.com/babel-helper-to-multiple-sequence-expressions/-/babel-helper-to-multiple-sequence-expressions-0.1.1.tgz#5f1b832b39e4acf954e9137f0251395c71196b35" - - babel-helpers@^6.24.1: - version "6.24.1" - resolved "https://registry.yarnpkg.com/babel-helpers/-/babel-helpers-6.24.1.tgz#3471de9caec388e5c850e597e58a26ddf37602b2" - dependencies: - babel-runtime "^6.22.0" - babel-template "^6.24.1" - - babel-loader@7.1.2: - version "7.1.2" - resolved "https://registry.yarnpkg.com/babel-loader/-/babel-loader-7.1.2.tgz#f6cbe122710f1aa2af4d881c6d5b54358ca24126" - dependencies: - find-cache-dir "^1.0.0" - loader-utils "^1.0.2" - mkdirp "^0.5.1" - - babel-messages@^6.23.0: - version "6.23.0" - resolved "https://registry.yarnpkg.com/babel-messages/-/babel-messages-6.23.0.tgz#f3cdf4703858035b2a2951c6ec5edf6c62f2630e" - dependencies: - babel-runtime "^6.22.0" - - babel-plugin-check-es2015-constants@^6.8.0: - version "6.22.0" - resolved "https://registry.yarnpkg.com/babel-plugin-check-es2015-constants/-/babel-plugin-check-es2015-constants-6.22.0.tgz#35157b101426fd2ffd3da3f75c7d1e91835bbf8a" - dependencies: - babel-runtime "^6.22.0" - - babel-plugin-espower@^2.3.2: - version "2.4.0" - resolved "https://registry.yarnpkg.com/babel-plugin-espower/-/babel-plugin-espower-2.4.0.tgz#9f92c080e9adfe73f69baed7ab3e24f649009373" - dependencies: - babel-generator "^6.1.0" - babylon "^6.1.0" - call-matcher "^1.0.0" - core-js "^2.0.0" - espower-location-detector "^1.0.0" - espurify "^1.6.0" - estraverse "^4.1.1" - - babel-plugin-minify-builtins@^0.1.3: - version "0.1.3" - resolved "https://registry.yarnpkg.com/babel-plugin-minify-builtins/-/babel-plugin-minify-builtins-0.1.3.tgz#4f21a7dcb51f91a04ea71d47ff0e8e3b05fec021" - dependencies: - babel-helper-evaluate-path "^0.1.0" - - babel-plugin-minify-constant-folding@^0.1.3: - version "0.1.3" - resolved "https://registry.yarnpkg.com/babel-plugin-minify-constant-folding/-/babel-plugin-minify-constant-folding-0.1.3.tgz#57bd172adf8b8d74ad7c99612eb950414ebea3ca" - dependencies: - babel-helper-evaluate-path "^0.1.0" - - babel-plugin-minify-dead-code-elimination@^0.1.7: - version "0.1.7" - resolved "https://registry.yarnpkg.com/babel-plugin-minify-dead-code-elimination/-/babel-plugin-minify-dead-code-elimination-0.1.7.tgz#774f536f347b98393a27baa717872968813c342c" - dependencies: - babel-helper-mark-eval-scopes "^0.1.1" - babel-helper-remove-or-void "^0.1.1" - lodash.some "^4.6.0" - - babel-plugin-minify-flip-comparisons@^0.1.2: - version "0.1.2" - resolved "https://registry.yarnpkg.com/babel-plugin-minify-flip-comparisons/-/babel-plugin-minify-flip-comparisons-0.1.2.tgz#e286b40b7599b18dfea195071e4279465cfc1884" - dependencies: - babel-helper-is-void-0 "^0.1.1" - - babel-plugin-minify-guarded-expressions@^0.1.2: - version "0.1.2" - resolved "https://registry.yarnpkg.com/babel-plugin-minify-guarded-expressions/-/babel-plugin-minify-guarded-expressions-0.1.2.tgz#dfc3d473b0362d9605d3ce0ac1e22328c60d1007" - dependencies: - babel-helper-flip-expressions "^0.1.2" - - babel-plugin-minify-infinity@^0.1.2: - version "0.1.2" - resolved "https://registry.yarnpkg.com/babel-plugin-minify-infinity/-/babel-plugin-minify-infinity-0.1.2.tgz#5f1cf67ddedcba13c8a00da832542df0091a1cd4" - - babel-plugin-minify-mangle-names@^0.1.3: - version "0.1.3" - resolved "https://registry.yarnpkg.com/babel-plugin-minify-mangle-names/-/babel-plugin-minify-mangle-names-0.1.3.tgz#bfa24661a6794fb03833587e55828b65449e06fe" - dependencies: - babel-helper-mark-eval-scopes "^0.1.1" - - babel-plugin-minify-numeric-literals@^0.1.1: - version "0.1.1" - resolved "https://registry.yarnpkg.com/babel-plugin-minify-numeric-literals/-/babel-plugin-minify-numeric-literals-0.1.1.tgz#d4b8b0c925f874714ee33ee4b26678583d7ce7fb" - - babel-plugin-minify-replace@^0.1.2: - version "0.1.2" - resolved "https://registry.yarnpkg.com/babel-plugin-minify-replace/-/babel-plugin-minify-replace-0.1.2.tgz#b90b9e71ab4d3b36325629a91beabe13b0b16ac1" - - babel-plugin-minify-simplify@^0.1.2: - version "0.1.2" - resolved "https://registry.yarnpkg.com/babel-plugin-minify-simplify/-/babel-plugin-minify-simplify-0.1.2.tgz#a968f1658fdeb2fc759e81fe331d89829df0f6b9" - dependencies: - babel-helper-flip-expressions "^0.1.2" - babel-helper-is-nodes-equiv "^0.0.1" - babel-helper-to-multiple-sequence-expressions "^0.1.1" - - babel-plugin-minify-type-constructors@^0.1.2: - version "0.1.2" - resolved "https://registry.yarnpkg.com/babel-plugin-minify-type-constructors/-/babel-plugin-minify-type-constructors-0.1.2.tgz#db53c5b76cb8e2fcd45d862f17104c78761337ee" - dependencies: - babel-helper-is-void-0 "^0.1.1" - - babel-plugin-syntax-async-functions@^6.8.0: - version "6.13.0" - resolved "https://registry.yarnpkg.com/babel-plugin-syntax-async-functions/-/babel-plugin-syntax-async-functions-6.13.0.tgz#cad9cad1191b5ad634bf30ae0872391e0647be95" - - babel-plugin-syntax-exponentiation-operator@^6.8.0: - version "6.13.0" - resolved "https://registry.yarnpkg.com/babel-plugin-syntax-exponentiation-operator/-/babel-plugin-syntax-exponentiation-operator-6.13.0.tgz#9ee7e8337290da95288201a6a57f4170317830de" - - babel-plugin-syntax-flow@^6.18.0: - version "6.18.0" - resolved "https://registry.yarnpkg.com/babel-plugin-syntax-flow/-/babel-plugin-syntax-flow-6.18.0.tgz#4c3ab20a2af26aa20cd25995c398c4eb70310c8d" - - babel-plugin-syntax-jsx@6.18.0, babel-plugin-syntax-jsx@^6.3.13, babel-plugin-syntax-jsx@^6.8.0: - version "6.18.0" - resolved "https://registry.yarnpkg.com/babel-plugin-syntax-jsx/-/babel-plugin-syntax-jsx-6.18.0.tgz#0af32a9a6e13ca7a3fd5069e62d7b0f58d0d8946" - - babel-plugin-syntax-object-rest-spread@^6.13.0: - version "6.13.0" - resolved "https://registry.yarnpkg.com/babel-plugin-syntax-object-rest-spread/-/babel-plugin-syntax-object-rest-spread-6.13.0.tgz#fd6536f2bce13836ffa3a5458c4903a597bb3bf5" - - babel-plugin-syntax-trailing-function-commas@^6.20.0: - version "6.22.0" - resolved "https://registry.yarnpkg.com/babel-plugin-syntax-trailing-function-commas/-/babel-plugin-syntax-trailing-function-commas-6.22.0.tgz#ba0360937f8d06e40180a43fe0d5616fff532cf3" - - babel-plugin-transform-async-to-generator@^6.16.0: - version "6.24.1" - resolved "https://registry.yarnpkg.com/babel-plugin-transform-async-to-generator/-/babel-plugin-transform-async-to-generator-6.24.1.tgz#6536e378aff6cb1d5517ac0e40eb3e9fc8d08761" - dependencies: - babel-helper-remap-async-to-generator "^6.24.1" - babel-plugin-syntax-async-functions "^6.8.0" - babel-runtime "^6.22.0" - - babel-plugin-transform-es2015-destructuring@^6.19.0: - version "6.23.0" - resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-destructuring/-/babel-plugin-transform-es2015-destructuring-6.23.0.tgz#997bb1f1ab967f682d2b0876fe358d60e765c56d" - dependencies: - babel-runtime "^6.22.0" - - babel-plugin-transform-es2015-function-name@^6.9.0: - version "6.24.1" - resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-function-name/-/babel-plugin-transform-es2015-function-name-6.24.1.tgz#834c89853bc36b1af0f3a4c5dbaa94fd8eacaa8b" - dependencies: - babel-helper-function-name "^6.24.1" - babel-runtime "^6.22.0" - babel-types "^6.24.1" - - babel-plugin-transform-es2015-modules-commonjs@^6.18.0: - version "6.26.0" - resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-modules-commonjs/-/babel-plugin-transform-es2015-modules-commonjs-6.26.0.tgz#0d8394029b7dc6abe1a97ef181e00758dd2e5d8a" - dependencies: - babel-plugin-transform-strict-mode "^6.24.1" - babel-runtime "^6.26.0" - babel-template "^6.26.0" - babel-types "^6.26.0" - - babel-plugin-transform-es2015-parameters@^6.21.0: - version "6.24.1" - resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-parameters/-/babel-plugin-transform-es2015-parameters-6.24.1.tgz#57ac351ab49caf14a97cd13b09f66fdf0a625f2b" - dependencies: - babel-helper-call-delegate "^6.24.1" - babel-helper-get-function-arity "^6.24.1" - babel-runtime "^6.22.0" - babel-template "^6.24.1" - babel-traverse "^6.24.1" - babel-types "^6.24.1" - - babel-plugin-transform-es2015-spread@^6.8.0: - version "6.22.0" - resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-spread/-/babel-plugin-transform-es2015-spread-6.22.0.tgz#d6d68a99f89aedc4536c81a542e8dd9f1746f8d1" - dependencies: - babel-runtime "^6.22.0" - - babel-plugin-transform-es2015-sticky-regex@^6.8.0: - version "6.24.1" - resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-sticky-regex/-/babel-plugin-transform-es2015-sticky-regex-6.24.1.tgz#00c1cdb1aca71112cdf0cf6126c2ed6b457ccdbc" - dependencies: - babel-helper-regex "^6.24.1" - babel-runtime "^6.22.0" - babel-types "^6.24.1" - - babel-plugin-transform-es2015-unicode-regex@^6.11.0: - version "6.24.1" - resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-unicode-regex/-/babel-plugin-transform-es2015-unicode-regex-6.24.1.tgz#d38b12f42ea7323f729387f18a7c5ae1faeb35e9" - dependencies: - babel-helper-regex "^6.24.1" - babel-runtime "^6.22.0" - regexpu-core "^2.0.0" - - babel-plugin-transform-exponentiation-operator@^6.8.0: - version "6.24.1" - resolved "https://registry.yarnpkg.com/babel-plugin-transform-exponentiation-operator/-/babel-plugin-transform-exponentiation-operator-6.24.1.tgz#2ab0c9c7f3098fa48907772bb813fe41e8de3a0e" - dependencies: - babel-helper-builder-binary-assignment-operator-visitor "^6.24.1" - babel-plugin-syntax-exponentiation-operator "^6.8.0" - babel-runtime "^6.22.0" - - babel-plugin-transform-flow-strip-types@^6.22.0: - version "6.22.0" - resolved "https://registry.yarnpkg.com/babel-plugin-transform-flow-strip-types/-/babel-plugin-transform-flow-strip-types-6.22.0.tgz#84cb672935d43714fdc32bce84568d87441cf7cf" - dependencies: - babel-plugin-syntax-flow "^6.18.0" - babel-runtime "^6.22.0" - - babel-plugin-transform-inline-consecutive-adds@^0.1.2: - version "0.1.2" - resolved "https://registry.yarnpkg.com/babel-plugin-transform-inline-consecutive-adds/-/babel-plugin-transform-inline-consecutive-adds-0.1.2.tgz#5442e9f1c19c78a7899f8a4dee6fd481f61001f5" - - babel-plugin-transform-member-expression-literals@^6.8.4: - version "6.9.0" - resolved "https://registry.yarnpkg.com/babel-plugin-transform-member-expression-literals/-/babel-plugin-transform-member-expression-literals-6.9.0.tgz#ab07ad52a11ff7d2528c71388e8f901a4499c2b2" - - babel-plugin-transform-merge-sibling-variables@^6.8.5: - version "6.9.0" - resolved "https://registry.yarnpkg.com/babel-plugin-transform-merge-sibling-variables/-/babel-plugin-transform-merge-sibling-variables-6.9.0.tgz#140017e305f8eb4f60d2f2db61154fbd71a9fcdd" - - babel-plugin-transform-minify-booleans@^6.8.2: - version "6.9.0" - resolved "https://registry.yarnpkg.com/babel-plugin-transform-minify-booleans/-/babel-plugin-transform-minify-booleans-6.9.0.tgz#e36ceaa49aadcae70ec98bd9dbccb660719a667a" - - babel-plugin-transform-property-literals@^6.8.4: - version "6.9.0" - resolved "https://registry.yarnpkg.com/babel-plugin-transform-property-literals/-/babel-plugin-transform-property-literals-6.9.0.tgz#4ddc12ada888927eacab4daff8a535ebc5de5a61" - dependencies: - esutils "^2.0.2" - - babel-plugin-transform-react-display-name@^6.23.0: - version "6.25.0" - resolved "https://registry.yarnpkg.com/babel-plugin-transform-react-display-name/-/babel-plugin-transform-react-display-name-6.25.0.tgz#67e2bf1f1e9c93ab08db96792e05392bf2cc28d1" - dependencies: - babel-runtime "^6.22.0" - - babel-plugin-transform-react-jsx-self@^6.22.0: - version "6.22.0" - resolved "https://registry.yarnpkg.com/babel-plugin-transform-react-jsx-self/-/babel-plugin-transform-react-jsx-self-6.22.0.tgz#df6d80a9da2612a121e6ddd7558bcbecf06e636e" - dependencies: - babel-plugin-syntax-jsx "^6.8.0" - babel-runtime "^6.22.0" - - babel-plugin-transform-react-jsx-source@^6.22.0: - version "6.22.0" - resolved "https://registry.yarnpkg.com/babel-plugin-transform-react-jsx-source/-/babel-plugin-transform-react-jsx-source-6.22.0.tgz#66ac12153f5cd2d17b3c19268f4bf0197f44ecd6" - dependencies: - babel-plugin-syntax-jsx "^6.8.0" - babel-runtime "^6.22.0" - - babel-plugin-transform-react-jsx@^6.24.1: - version "6.24.1" - resolved "https://registry.yarnpkg.com/babel-plugin-transform-react-jsx/-/babel-plugin-transform-react-jsx-6.24.1.tgz#840a028e7df460dfc3a2d29f0c0d91f6376e66a3" - dependencies: - babel-helper-builder-react-jsx "^6.24.1" - babel-plugin-syntax-jsx "^6.8.0" - babel-runtime "^6.22.0" - - babel-plugin-transform-regexp-constructors@^0.1.1: - version "0.1.1" - resolved "https://registry.yarnpkg.com/babel-plugin-transform-regexp-constructors/-/babel-plugin-transform-regexp-constructors-0.1.1.tgz#312ab7487cc88a1c62ee25ea1b6087e89b87799c" - - babel-plugin-transform-remove-console@^6.8.4: - version "6.9.0" - resolved "https://registry.yarnpkg.com/babel-plugin-transform-remove-console/-/babel-plugin-transform-remove-console-6.9.0.tgz#a7b671aab050dd30ef7cf2142b61a7d10efb327f" - - babel-plugin-transform-remove-debugger@^6.8.4: - version "6.9.0" - resolved "https://registry.yarnpkg.com/babel-plugin-transform-remove-debugger/-/babel-plugin-transform-remove-debugger-6.9.0.tgz#b465e74b3fbe1970da561fb1331e30aefac3f1fe" - - babel-plugin-transform-remove-undefined@^0.1.2: - version "0.1.2" - resolved "https://registry.yarnpkg.com/babel-plugin-transform-remove-undefined/-/babel-plugin-transform-remove-undefined-0.1.2.tgz#e1ebf51110f6b1e0665f28382ef73f95e5023652" - - babel-plugin-transform-simplify-comparison-operators@^6.8.4: - version "6.9.0" - resolved "https://registry.yarnpkg.com/babel-plugin-transform-simplify-comparison-operators/-/babel-plugin-transform-simplify-comparison-operators-6.9.0.tgz#586252fea023cb13f2400a09c0ab178dc0844f0a" - - babel-plugin-transform-strict-mode@^6.24.1: - version "6.24.1" - resolved "https://registry.yarnpkg.com/babel-plugin-transform-strict-mode/-/babel-plugin-transform-strict-mode-6.24.1.tgz#d5faf7aa578a65bbe591cf5edae04a0c67020758" - dependencies: - babel-runtime "^6.22.0" - babel-types "^6.24.1" - - babel-plugin-transform-undefined-to-void@^6.8.2: - version "6.9.0" - resolved "https://registry.yarnpkg.com/babel-plugin-transform-undefined-to-void/-/babel-plugin-transform-undefined-to-void-6.9.0.tgz#eb5db0554caffe9ded0206468ec0c6c3b332b9d2" - - babel-polyfill@^6.26.0: - version "6.26.0" - resolved "https://registry.yarnpkg.com/babel-polyfill/-/babel-polyfill-6.26.0.tgz#379937abc67d7895970adc621f284cd966cf2153" - dependencies: - babel-runtime "^6.26.0" - core-js "^2.5.0" - regenerator-runtime "^0.10.5" - - babel-preset-babili@0.1.4: - version "0.1.4" - resolved "https://registry.yarnpkg.com/babel-preset-babili/-/babel-preset-babili-0.1.4.tgz#ad9d6651002f5bc3f07cab300781167f54724bf2" - dependencies: - babel-plugin-minify-builtins "^0.1.3" - babel-plugin-minify-constant-folding "^0.1.3" - babel-plugin-minify-dead-code-elimination "^0.1.7" - babel-plugin-minify-flip-comparisons "^0.1.2" - babel-plugin-minify-guarded-expressions "^0.1.2" - babel-plugin-minify-infinity "^0.1.2" - babel-plugin-minify-mangle-names "^0.1.3" - babel-plugin-minify-numeric-literals "^0.1.1" - babel-plugin-minify-replace "^0.1.2" - babel-plugin-minify-simplify "^0.1.2" - babel-plugin-minify-type-constructors "^0.1.2" - babel-plugin-transform-inline-consecutive-adds "^0.1.2" - babel-plugin-transform-member-expression-literals "^6.8.4" - babel-plugin-transform-merge-sibling-variables "^6.8.5" - babel-plugin-transform-minify-booleans "^6.8.2" - babel-plugin-transform-property-literals "^6.8.4" - babel-plugin-transform-regexp-constructors "^0.1.1" - babel-plugin-transform-remove-console "^6.8.4" - babel-plugin-transform-remove-debugger "^6.8.4" - babel-plugin-transform-remove-undefined "^0.1.2" - babel-plugin-transform-simplify-comparison-operators "^6.8.4" - babel-plugin-transform-undefined-to-void "^6.8.2" - lodash.isplainobject "^4.0.6" - - babel-preset-flow@^6.23.0: - version "6.23.0" - resolved "https://registry.yarnpkg.com/babel-preset-flow/-/babel-preset-flow-6.23.0.tgz#e71218887085ae9a24b5be4169affb599816c49d" - dependencies: - babel-plugin-transform-flow-strip-types "^6.22.0" - - babel-preset-react@6.24.1: - version "6.24.1" - resolved "https://registry.yarnpkg.com/babel-preset-react/-/babel-preset-react-6.24.1.tgz#ba69dfaea45fc3ec639b6a4ecea6e17702c91380" - dependencies: - babel-plugin-syntax-jsx "^6.3.13" - babel-plugin-transform-react-display-name "^6.23.0" - babel-plugin-transform-react-jsx "^6.24.1" - babel-plugin-transform-react-jsx-self "^6.22.0" - babel-plugin-transform-react-jsx-source "^6.22.0" - babel-preset-flow "^6.23.0" - - babel-register@^6.26.0: - version "6.26.0" - resolved "https://registry.yarnpkg.com/babel-register/-/babel-register-6.26.0.tgz#6ed021173e2fcb486d7acb45c6009a856f647071" - dependencies: - babel-core "^6.26.0" - babel-runtime "^6.26.0" - core-js "^2.5.0" - home-or-tmp "^2.0.0" - lodash "^4.17.4" - mkdirp "^0.5.1" - source-map-support "^0.4.15" - - babel-runtime@^6.22.0, babel-runtime@^6.26.0: - version "6.26.0" - resolved "https://registry.yarnpkg.com/babel-runtime/-/babel-runtime-6.26.0.tgz#965c7058668e82b55d7bfe04ff2337bc8b5647fe" - dependencies: - core-js "^2.4.0" - regenerator-runtime "^0.11.0" - - babel-template@^6.24.1, babel-template@^6.26.0: - version "6.26.0" - resolved "https://registry.yarnpkg.com/babel-template/-/babel-template-6.26.0.tgz#de03e2d16396b069f46dd9fff8521fb1a0e35e02" - dependencies: - babel-runtime "^6.26.0" - babel-traverse "^6.26.0" - babel-types "^6.26.0" - babylon "^6.18.0" - lodash "^4.17.4" - - babel-traverse@^6.24.1, babel-traverse@^6.26.0: - version "6.26.0" - resolved "https://registry.yarnpkg.com/babel-traverse/-/babel-traverse-6.26.0.tgz#46a9cbd7edcc62c8e5c064e2d2d8d0f4035766ee" - dependencies: - babel-code-frame "^6.26.0" - babel-messages "^6.23.0" - babel-runtime "^6.26.0" - babel-types "^6.26.0" - babylon "^6.18.0" - debug "^2.6.8" - globals "^9.18.0" - invariant "^2.2.2" - lodash "^4.17.4" - - babel-types@6.26.0, babel-types@^6.24.1, babel-types@^6.26.0: - version "6.26.0" - resolved "https://registry.yarnpkg.com/babel-types/-/babel-types-6.26.0.tgz#a3b073f94ab49eb6fa55cd65227a334380632497" - dependencies: - babel-runtime "^6.26.0" - esutils "^2.0.2" - lodash "^4.17.4" - to-fast-properties "^1.0.3" - - babylon@^6.1.0, babylon@^6.18.0: - version "6.18.0" - resolved "https://registry.yarnpkg.com/babylon/-/babylon-6.18.0.tgz#af2f3b88fa6f5c1e4c634d1a0f8eac4f55b395e3" - - balanced-match@^0.4.2: - version "0.4.2" - resolved "https://registry.yarnpkg.com/balanced-match/-/balanced-match-0.4.2.tgz#cb3f3e3c732dc0f01ee70b403f302e61d7709838" - - balanced-match@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/balanced-match/-/balanced-match-1.0.0.tgz#89b4d199ab2bee49de164ea02b89ce462d71b767" - - base64-js@1.2.0: - version "1.2.0" - resolved "https://registry.yarnpkg.com/base64-js/-/base64-js-1.2.0.tgz#a39992d723584811982be5e290bb6a53d86700f1" - - base64-js@^1.0.2: - version "1.2.3" - resolved "https://registry.yarnpkg.com/base64-js/-/base64-js-1.2.3.tgz#fb13668233d9614cf5fb4bce95a9ba4096cdf801" - - bcrypt-pbkdf@^1.0.0: - version "1.0.1" - resolved "https://registry.yarnpkg.com/bcrypt-pbkdf/-/bcrypt-pbkdf-1.0.1.tgz#63bc5dcb61331b92bc05fd528953c33462a06f8d" - dependencies: - tweetnacl "^0.14.3" - - big.js@^3.1.3: - version "3.2.0" - resolved "https://registry.yarnpkg.com/big.js/-/big.js-3.2.0.tgz#a5fc298b81b9e0dca2e458824784b65c52ba588e" - - binary-extensions@^1.0.0: - version "1.11.0" - resolved "https://registry.yarnpkg.com/binary-extensions/-/binary-extensions-1.11.0.tgz#46aa1751fb6a2f93ee5e689bb1087d4b14c6c205" - - bl@^1.0.0: - version "1.2.1" - resolved "https://registry.yarnpkg.com/bl/-/bl-1.2.1.tgz#cac328f7bee45730d404b692203fcb590e172d5e" - dependencies: - readable-stream "^2.0.5" - - block-stream@*: - version "0.0.9" - resolved "https://registry.yarnpkg.com/block-stream/-/block-stream-0.0.9.tgz#13ebfe778a03205cfe03751481ebb4b3300c126a" - dependencies: - inherits "~2.0.0" - - bluebird-lst@^1.0.5: - version "1.0.5" - resolved "https://registry.yarnpkg.com/bluebird-lst/-/bluebird-lst-1.0.5.tgz#bebc83026b7e92a72871a3dc599e219cbfb002a9" - dependencies: - bluebird "^3.5.1" - - bluebird@^3.0.0, bluebird@^3.5.0, bluebird@^3.5.1: - version "3.5.1" - resolved "https://registry.yarnpkg.com/bluebird/-/bluebird-3.5.1.tgz#d9551f9de98f1fcda1e683d17ee91a0602ee2eb9" - - bn.js@^4.0.0, bn.js@^4.1.0, bn.js@^4.1.1, bn.js@^4.4.0: - version "4.11.8" - resolved "https://registry.yarnpkg.com/bn.js/-/bn.js-4.11.8.tgz#2cde09eb5ee341f484746bb0309b3253b1b1442f" - - boom@2.x.x: - version "2.10.1" - resolved "https://registry.yarnpkg.com/boom/-/boom-2.10.1.tgz#39c8918ceff5799f83f9492a848f625add0c766f" - dependencies: - hoek "2.x.x" - - boom@4.x.x: - version "4.3.1" - resolved "https://registry.yarnpkg.com/boom/-/boom-4.3.1.tgz#4f8a3005cb4a7e3889f749030fd25b96e01d2e31" - dependencies: - hoek "4.x.x" - - boom@5.x.x: - version "5.2.0" - resolved "https://registry.yarnpkg.com/boom/-/boom-5.2.0.tgz#5dd9da6ee3a5f302077436290cb717d3f4a54e02" - dependencies: - hoek "4.x.x" - - boxen@^1.2.1: - version "1.3.0" - resolved "https://registry.yarnpkg.com/boxen/-/boxen-1.3.0.tgz#55c6c39a8ba58d9c61ad22cd877532deb665a20b" - dependencies: - ansi-align "^2.0.0" - camelcase "^4.0.0" - chalk "^2.0.1" - cli-boxes "^1.0.0" - string-width "^2.0.0" - term-size "^1.2.0" - widest-line "^2.0.0" - - brace-expansion@^1.1.7: - version "1.1.11" - resolved "https://registry.yarnpkg.com/brace-expansion/-/brace-expansion-1.1.11.tgz#3c7fcbf529d87226f3d2f52b966ff5271eb441dd" - dependencies: - balanced-match "^1.0.0" - concat-map "0.0.1" - - braces@^1.8.2: - version "1.8.5" - resolved "https://registry.yarnpkg.com/braces/-/braces-1.8.5.tgz#ba77962e12dff969d6b76711e914b737857bf6a7" - dependencies: - expand-range "^1.8.1" - preserve "^0.2.0" - repeat-element "^1.1.2" - - brorand@^1.0.1: - version "1.1.0" - resolved "https://registry.yarnpkg.com/brorand/-/brorand-1.1.0.tgz#12c25efe40a45e3c323eb8675a0a0ce57b22371f" - - browserify-aes@^1.0.0, browserify-aes@^1.0.4: - version "1.1.1" - resolved "https://registry.yarnpkg.com/browserify-aes/-/browserify-aes-1.1.1.tgz#38b7ab55edb806ff2dcda1a7f1620773a477c49f" - dependencies: - buffer-xor "^1.0.3" - cipher-base "^1.0.0" - create-hash "^1.1.0" - evp_bytestokey "^1.0.3" - inherits "^2.0.1" - safe-buffer "^5.0.1" - - browserify-cipher@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/browserify-cipher/-/browserify-cipher-1.0.0.tgz#9988244874bf5ed4e28da95666dcd66ac8fc363a" - dependencies: - browserify-aes "^1.0.4" - browserify-des "^1.0.0" - evp_bytestokey "^1.0.0" - - browserify-des@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/browserify-des/-/browserify-des-1.0.0.tgz#daa277717470922ed2fe18594118a175439721dd" - dependencies: - cipher-base "^1.0.1" - des.js "^1.0.0" - inherits "^2.0.1" - - browserify-rsa@^4.0.0: - version "4.0.1" - resolved "https://registry.yarnpkg.com/browserify-rsa/-/browserify-rsa-4.0.1.tgz#21e0abfaf6f2029cf2fafb133567a701d4135524" - dependencies: - bn.js "^4.1.0" - randombytes "^2.0.1" - - browserify-sign@^4.0.0: - version "4.0.4" - resolved "https://registry.yarnpkg.com/browserify-sign/-/browserify-sign-4.0.4.tgz#aa4eb68e5d7b658baa6bf6a57e630cbd7a93d298" - dependencies: - bn.js "^4.1.1" - browserify-rsa "^4.0.0" - create-hash "^1.1.0" - create-hmac "^1.1.2" - elliptic "^6.0.0" - inherits "^2.0.1" - parse-asn1 "^5.0.0" - - browserify-zlib@^0.2.0: - version "0.2.0" - resolved "https://registry.yarnpkg.com/browserify-zlib/-/browserify-zlib-0.2.0.tgz#2869459d9aa3be245fe8fe2ca1f46e2e7f54d73f" - dependencies: - pako "~1.0.5" - - browserslist@^1.3.6, browserslist@^1.5.2, browserslist@^1.7.6: - version "1.7.7" - resolved "https://registry.yarnpkg.com/browserslist/-/browserslist-1.7.7.tgz#0bd76704258be829b2398bb50e4b62d1a166b0b9" - dependencies: - caniuse-db "^1.0.30000639" - electron-to-chromium "^1.2.7" - - buf-compare@^1.0.0: - version "1.0.1" - resolved "https://registry.yarnpkg.com/buf-compare/-/buf-compare-1.0.1.tgz#fef28da8b8113a0a0db4430b0b6467b69730b34a" - - buffer-crc32@^0.2.1: - version "0.2.13" - resolved "https://registry.yarnpkg.com/buffer-crc32/-/buffer-crc32-0.2.13.tgz#0d333e3f00eac50aa1454abd30ef8c2a5d9a7242" - - buffer-xor@^1.0.3: - version "1.0.3" - resolved "https://registry.yarnpkg.com/buffer-xor/-/buffer-xor-1.0.3.tgz#26e61ed1422fb70dd42e6e36729ed51d855fe8d9" - - buffer@^4.3.0: - version "4.9.1" - resolved "https://registry.yarnpkg.com/buffer/-/buffer-4.9.1.tgz#6d1bb601b07a4efced97094132093027c95bc298" - dependencies: - base64-js "^1.0.2" - ieee754 "^1.1.4" - isarray "^1.0.0" - - builder-util-runtime@4.0.5, builder-util-runtime@^4.0.5: - version "4.0.5" - resolved "https://registry.yarnpkg.com/builder-util-runtime/-/builder-util-runtime-4.0.5.tgz#5340cf9886b9283ea6e5b20dc09b5e3e461aef62" - dependencies: - bluebird-lst "^1.0.5" - debug "^3.1.0" - fs-extra-p "^4.5.0" - sax "^1.2.4" - - builder-util@5.6.5, builder-util@^5.6.5: - version "5.6.5" - resolved "https://registry.yarnpkg.com/builder-util/-/builder-util-5.6.5.tgz#f2d156541b8df9599456848e057566443dc04c82" - dependencies: - "7zip-bin" "~3.1.0" - app-builder-bin "1.7.2" - bluebird-lst "^1.0.5" - builder-util-runtime "^4.0.5" - chalk "^2.3.2" - debug "^3.1.0" - fs-extra-p "^4.5.2" - is-ci "^1.1.0" - js-yaml "^3.11.0" - lazy-val "^1.0.3" - semver "^5.5.0" - source-map-support "^0.5.3" - stat-mode "^0.2.2" - temp-file "^3.1.1" - - builtin-modules@^1.0.0: - version "1.1.1" - resolved "https://registry.yarnpkg.com/builtin-modules/-/builtin-modules-1.1.1.tgz#270f076c5a72c02f5b65a47df94c5fe3a278892f" - - builtin-status-codes@^3.0.0: - version "3.0.0" - resolved "https://registry.yarnpkg.com/builtin-status-codes/-/builtin-status-codes-3.0.0.tgz#85982878e21b98e1c66425e03d0174788f569ee8" - - cacache@^10.0.1: - version "10.0.4" - resolved "https://registry.yarnpkg.com/cacache/-/cacache-10.0.4.tgz#6452367999eff9d4188aefd9a14e9d7c6a263460" - dependencies: - bluebird "^3.5.1" - chownr "^1.0.1" - glob "^7.1.2" - graceful-fs "^4.1.11" - lru-cache "^4.1.1" - mississippi "^2.0.0" - mkdirp "^0.5.1" - move-concurrently "^1.0.1" - promise-inflight "^1.0.1" - rimraf "^2.6.2" - ssri "^5.2.4" - unique-filename "^1.1.0" - y18n "^4.0.0" - - caching-transform@^1.0.0: - version "1.0.1" - resolved "https://registry.yarnpkg.com/caching-transform/-/caching-transform-1.0.1.tgz#6dbdb2f20f8d8fbce79f3e94e9d1742dcdf5c0a1" - dependencies: - md5-hex "^1.2.0" - mkdirp "^0.5.1" - write-file-atomic "^1.1.4" - - call-matcher@^1.0.0: - version "1.0.1" - resolved "https://registry.yarnpkg.com/call-matcher/-/call-matcher-1.0.1.tgz#5134d077984f712a54dad3cbf62de28dce416ca8" - dependencies: - core-js "^2.0.0" - deep-equal "^1.0.0" - espurify "^1.6.0" - estraverse "^4.0.0" - - call-signature@0.0.2: - version "0.0.2" - resolved "https://registry.yarnpkg.com/call-signature/-/call-signature-0.0.2.tgz#a84abc825a55ef4cb2b028bd74e205a65b9a4996" - - caller-path@^0.1.0: - version "0.1.0" - resolved "https://registry.yarnpkg.com/caller-path/-/caller-path-0.1.0.tgz#94085ef63581ecd3daa92444a8fe94e82577751f" - dependencies: - callsites "^0.2.0" - - callsites@^0.2.0: - version "0.2.0" - resolved "https://registry.yarnpkg.com/callsites/-/callsites-0.2.0.tgz#afab96262910a7f33c19a5775825c69f34e350ca" - - camelcase-keys@^2.0.0: - version "2.1.0" - resolved "https://registry.yarnpkg.com/camelcase-keys/-/camelcase-keys-2.1.0.tgz#308beeaffdf28119051efa1d932213c91b8f92e7" - dependencies: - camelcase "^2.0.0" - map-obj "^1.0.0" - - camelcase@4.1.0, camelcase@^4.0.0, camelcase@^4.1.0: - version "4.1.0" - resolved "https://registry.yarnpkg.com/camelcase/-/camelcase-4.1.0.tgz#d545635be1e33c542649c69173e5de6acfae34dd" - - camelcase@^1.0.2: - version "1.2.1" - resolved "https://registry.yarnpkg.com/camelcase/-/camelcase-1.2.1.tgz#9bb5304d2e0b56698b2c758b08a3eaa9daa58a39" - - camelcase@^2.0.0: - version "2.1.1" - resolved "https://registry.yarnpkg.com/camelcase/-/camelcase-2.1.1.tgz#7c1d16d679a1bbe59ca02cacecfb011e201f5a1f" - - camelcase@^3.0.0: - version "3.0.0" - resolved "https://registry.yarnpkg.com/camelcase/-/camelcase-3.0.0.tgz#32fc4b9fcdaf845fcdf7e73bb97cac2261f0ab0a" - - caniuse-api@^1.5.2: - version "1.6.1" - resolved "https://registry.yarnpkg.com/caniuse-api/-/caniuse-api-1.6.1.tgz#b534e7c734c4f81ec5fbe8aca2ad24354b962c6c" - dependencies: - browserslist "^1.3.6" - caniuse-db "^1.0.30000529" - lodash.memoize "^4.1.2" - lodash.uniq "^4.5.0" - - caniuse-db@^1.0.30000529, caniuse-db@^1.0.30000634, caniuse-db@^1.0.30000639: - version "1.0.30000810" - resolved "https://registry.yarnpkg.com/caniuse-db/-/caniuse-db-1.0.30000810.tgz#bd25830c41efab64339a2e381f49677343c84509" - - capture-stack-trace@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/capture-stack-trace/-/capture-stack-trace-1.0.0.tgz#4a6fa07399c26bba47f0b2496b4d0fb408c5550d" - - caseless@~0.12.0: - version "0.12.0" - resolved "https://registry.yarnpkg.com/caseless/-/caseless-0.12.0.tgz#1b681c21ff84033c826543090689420d187151dc" - - center-align@^0.1.1: - version "0.1.3" - resolved "https://registry.yarnpkg.com/center-align/-/center-align-0.1.3.tgz#aa0d32629b6ee972200411cbd4461c907bc2b7ad" - dependencies: - align-text "^0.1.3" - lazy-cache "^1.0.3" - - chalk@2.1.0: - version "2.1.0" - resolved "https://registry.yarnpkg.com/chalk/-/chalk-2.1.0.tgz#ac5becf14fa21b99c6c92ca7a7d7cfd5b17e743e" - dependencies: - ansi-styles "^3.1.0" - escape-string-regexp "^1.0.5" - supports-color "^4.0.0" - - chalk@2.3.2, chalk@^2.3.2: - version "2.3.2" - resolved "https://registry.yarnpkg.com/chalk/-/chalk-2.3.2.tgz#250dc96b07491bfd601e648d66ddf5f60c7a5c65" - dependencies: - ansi-styles "^3.2.1" - escape-string-regexp "^1.0.5" - supports-color "^5.3.0" - - chalk@^0.4.0: - version "0.4.0" - resolved "https://registry.yarnpkg.com/chalk/-/chalk-0.4.0.tgz#5199a3ddcd0c1efe23bc08c1b027b06176e0c64f" - dependencies: - ansi-styles "~1.0.0" - has-color "~0.1.0" - strip-ansi "~0.1.0" - - chalk@^1.0.0, chalk@^1.1.1, chalk@^1.1.3: - version "1.1.3" - resolved "https://registry.yarnpkg.com/chalk/-/chalk-1.1.3.tgz#a8115c55e4a702fe4d150abd3872822a7e09fc98" - dependencies: - ansi-styles "^2.2.1" - escape-string-regexp "^1.0.2" - has-ansi "^2.0.0" - strip-ansi "^3.0.0" - supports-color "^2.0.0" - - chalk@^2.0.0, chalk@^2.0.1, chalk@^2.1.0, chalk@^2.3.1: - version "2.3.1" - resolved "https://registry.yarnpkg.com/chalk/-/chalk-2.3.1.tgz#523fe2678aec7b04e8041909292fe8b17059b796" - dependencies: - ansi-styles "^3.2.0" - escape-string-regexp "^1.0.5" - supports-color "^5.2.0" - - chardet@^0.4.0: - version "0.4.2" - resolved "https://registry.yarnpkg.com/chardet/-/chardet-0.4.2.tgz#b5473b33dc97c424e5d98dc87d55d4d8a29c8bf2" - - chokidar@^1.4.2, chokidar@^1.6.1, chokidar@^1.7.0: - version "1.7.0" - resolved "https://registry.yarnpkg.com/chokidar/-/chokidar-1.7.0.tgz#798e689778151c8076b4b360e5edd28cda2bb468" - dependencies: - anymatch "^1.3.0" - async-each "^1.0.0" - glob-parent "^2.0.0" - inherits "^2.0.1" - is-binary-path "^1.0.0" - is-glob "^2.0.0" - path-is-absolute "^1.0.0" - readdirp "^2.0.0" - optionalDependencies: - fsevents "^1.0.0" - - chownr@^1.0.1: - version "1.0.1" - resolved "https://registry.yarnpkg.com/chownr/-/chownr-1.0.1.tgz#e2a75042a9551908bebd25b8523d5f9769d79181" - - chromium-pickle-js@^0.2.0: - version "0.2.0" - resolved "https://registry.yarnpkg.com/chromium-pickle-js/-/chromium-pickle-js-0.2.0.tgz#04a106672c18b085ab774d983dfa3ea138f22205" - - ci-info@^1.0.0: - version "1.1.2" - resolved "https://registry.yarnpkg.com/ci-info/-/ci-info-1.1.2.tgz#03561259db48d0474c8bdc90f5b47b068b6bbfb4" - - cipher-base@^1.0.0, cipher-base@^1.0.1, cipher-base@^1.0.3: - version "1.0.4" - resolved "https://registry.yarnpkg.com/cipher-base/-/cipher-base-1.0.4.tgz#8760e4ecc272f4c363532f926d874aae2c1397de" - dependencies: - inherits "^2.0.1" - safe-buffer "^5.0.1" - - circular-json@^0.3.1: - version "0.3.3" - resolved "https://registry.yarnpkg.com/circular-json/-/circular-json-0.3.3.tgz#815c99ea84f6809529d2f45791bdf82711352d66" - - clap@^1.0.9: - version "1.2.3" - resolved "https://registry.yarnpkg.com/clap/-/clap-1.2.3.tgz#4f36745b32008492557f46412d66d50cb99bce51" - dependencies: - chalk "^1.1.3" - - clean-stack@^1.1.1: - version "1.3.0" - resolved "https://registry.yarnpkg.com/clean-stack/-/clean-stack-1.3.0.tgz#9e821501ae979986c46b1d66d2d432db2fd4ae31" - - clean-yaml-object@^0.1.0: - version "0.1.0" - resolved "https://registry.yarnpkg.com/clean-yaml-object/-/clean-yaml-object-0.1.0.tgz#63fb110dc2ce1a84dc21f6d9334876d010ae8b68" - - cli-boxes@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/cli-boxes/-/cli-boxes-1.0.0.tgz#4fa917c3e59c94a004cd61f8ee509da651687143" - - cli-cursor@^2.1.0: - version "2.1.0" - resolved "https://registry.yarnpkg.com/cli-cursor/-/cli-cursor-2.1.0.tgz#b35dac376479facc3e94747d41d0d0f5238ffcb5" - dependencies: - restore-cursor "^2.0.0" - - cli-spinners@^1.0.0, cli-spinners@^1.0.1: - version "1.1.0" - resolved "https://registry.yarnpkg.com/cli-spinners/-/cli-spinners-1.1.0.tgz#f1847b168844d917a671eb9d147e3df497c90d06" - - cli-truncate@^1.0.0: - version "1.1.0" - resolved "https://registry.yarnpkg.com/cli-truncate/-/cli-truncate-1.1.0.tgz#2b2dfd83c53cfd3572b87fc4d430a808afb04086" - dependencies: - slice-ansi "^1.0.0" - string-width "^2.0.0" - - cli-width@^2.0.0: - version "2.2.0" - resolved "https://registry.yarnpkg.com/cli-width/-/cli-width-2.2.0.tgz#ff19ede8a9a5e579324147b0c11f0fbcbabed639" - - cliui@^2.1.0: - version "2.1.0" - resolved "https://registry.yarnpkg.com/cliui/-/cliui-2.1.0.tgz#4b475760ff80264c762c3a1719032e91c7fea0d1" - dependencies: - center-align "^0.1.1" - right-align "^0.1.1" - wordwrap "0.0.2" - - cliui@^3.2.0: - version "3.2.0" - resolved "https://registry.yarnpkg.com/cliui/-/cliui-3.2.0.tgz#120601537a916d29940f934da3b48d585a39213d" - dependencies: - string-width "^1.0.1" - strip-ansi "^3.0.1" - wrap-ansi "^2.0.0" - - cliui@^4.0.0: - version "4.0.0" - resolved "https://registry.yarnpkg.com/cliui/-/cliui-4.0.0.tgz#743d4650e05f36d1ed2575b59638d87322bfbbcc" - dependencies: - string-width "^2.1.1" - strip-ansi "^4.0.0" - wrap-ansi "^2.0.0" - - clone@^1.0.2: - version "1.0.3" - resolved "https://registry.yarnpkg.com/clone/-/clone-1.0.3.tgz#298d7e2231660f40c003c2ed3140decf3f53085f" - - co-with-promise@^4.6.0: - version "4.6.0" - resolved "https://registry.yarnpkg.com/co-with-promise/-/co-with-promise-4.6.0.tgz#413e7db6f5893a60b942cf492c4bec93db415ab7" - dependencies: - pinkie-promise "^1.0.0" - - co@^4.6.0: - version "4.6.0" - resolved "https://registry.yarnpkg.com/co/-/co-4.6.0.tgz#6ea6bdf3d853ae54ccb8e47bfa0bf3f9031fb184" - - coa@~1.0.1: - version "1.0.4" - resolved "https://registry.yarnpkg.com/coa/-/coa-1.0.4.tgz#a9ef153660d6a86a8bdec0289a5c684d217432fd" - dependencies: - q "^1.1.2" - - code-excerpt@^2.1.1: - version "2.1.1" - resolved "https://registry.yarnpkg.com/code-excerpt/-/code-excerpt-2.1.1.tgz#5fe3057bfbb71a5f300f659ef2cc0a47651ba77c" - dependencies: - convert-to-spaces "^1.0.1" - - code-point-at@^1.0.0: - version "1.1.0" - resolved "https://registry.yarnpkg.com/code-point-at/-/code-point-at-1.1.0.tgz#0d070b4d043a5bea33a2f1a40e2edb3d9a4ccf77" - - color-convert@^1.3.0, color-convert@^1.9.0, color-convert@^1.9.1: - version "1.9.1" - resolved "https://registry.yarnpkg.com/color-convert/-/color-convert-1.9.1.tgz#c1261107aeb2f294ebffec9ed9ecad529a6097ed" - dependencies: - color-name "^1.1.1" - - color-convert@~0.5.0: - version "0.5.3" - resolved "https://registry.yarnpkg.com/color-convert/-/color-convert-0.5.3.tgz#bdb6c69ce660fadffe0b0007cc447e1b9f7282bd" - - color-name@^1.0.0, color-name@^1.1.1: - version "1.1.3" - resolved "https://registry.yarnpkg.com/color-name/-/color-name-1.1.3.tgz#a7d0558bd89c42f795dd42328f740831ca53bc25" - - color-string@^0.3.0: - version "0.3.0" - resolved "https://registry.yarnpkg.com/color-string/-/color-string-0.3.0.tgz#27d46fb67025c5c2fa25993bfbf579e47841b991" - dependencies: - color-name "^1.0.0" - - color-string@^1.5.2: - version "1.5.2" - resolved "https://registry.yarnpkg.com/color-string/-/color-string-1.5.2.tgz#26e45814bc3c9a7cbd6751648a41434514a773a9" - dependencies: - color-name "^1.0.0" - simple-swizzle "^0.2.2" - - color@2.0.1: - version "2.0.1" - resolved "https://registry.yarnpkg.com/color/-/color-2.0.1.tgz#e4ed78a3c4603d0891eba5430b04b86314f4c839" - dependencies: - color-convert "^1.9.1" - color-string "^1.5.2" - - color@^0.11.0: - version "0.11.4" - resolved "https://registry.yarnpkg.com/color/-/color-0.11.4.tgz#6d7b5c74fb65e841cd48792ad1ed5e07b904d764" - dependencies: - clone "^1.0.2" - color-convert "^1.3.0" - color-string "^0.3.0" - - colormin@^1.0.5: - version "1.1.2" - resolved "https://registry.yarnpkg.com/colormin/-/colormin-1.1.2.tgz#ea2f7420a72b96881a38aae59ec124a6f7298133" - dependencies: - color "^0.11.0" - css-color-names "0.0.4" - has "^1.0.1" - - colors@^1.1.2, colors@~1.1.2: - version "1.1.2" - resolved "https://registry.yarnpkg.com/colors/-/colors-1.1.2.tgz#168a4701756b6a7f51a12ce0c97bfa28c084ed63" - - columnify@1.5.4: - version "1.5.4" - resolved "https://registry.yarnpkg.com/columnify/-/columnify-1.5.4.tgz#4737ddf1c7b69a8a7c340570782e947eec8e78bb" - dependencies: - strip-ansi "^3.0.0" - wcwidth "^1.0.0" - - combined-stream@1.0.6, combined-stream@^1.0.5, combined-stream@~1.0.5: - version "1.0.6" - resolved "https://registry.yarnpkg.com/combined-stream/-/combined-stream-1.0.6.tgz#723e7df6e801ac5613113a7e445a9b69cb632818" - dependencies: - delayed-stream "~1.0.0" - - commander@^2.11.0: - version "2.14.1" - resolved "https://registry.yarnpkg.com/commander/-/commander-2.14.1.tgz#2235123e37af8ca3c65df45b026dbd357b01b9aa" - - common-path-prefix@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/common-path-prefix/-/common-path-prefix-1.0.0.tgz#cd52f6f0712e0baab97d6f9732874f22f47752c0" - - commondir@^1.0.1: - version "1.0.1" - resolved "https://registry.yarnpkg.com/commondir/-/commondir-1.0.1.tgz#ddd800da0c66127393cca5950ea968a3aaf1253b" - - compare-version@^0.1.2: - version "0.1.2" - resolved "https://registry.yarnpkg.com/compare-version/-/compare-version-0.1.2.tgz#0162ec2d9351f5ddd59a9202cba935366a725080" - - compress-commons@^1.2.0: - version "1.2.2" - resolved "https://registry.yarnpkg.com/compress-commons/-/compress-commons-1.2.2.tgz#524a9f10903f3a813389b0225d27c48bb751890f" - dependencies: - buffer-crc32 "^0.2.1" - crc32-stream "^2.0.0" - normalize-path "^2.0.0" - readable-stream "^2.0.0" - - concat-map@0.0.1: - version "0.0.1" - resolved "https://registry.yarnpkg.com/concat-map/-/concat-map-0.0.1.tgz#d8a96bd77fd68df7793a73036a3ba0d5405d477b" - - concat-stream@1.6.0, concat-stream@^1.5.0, concat-stream@^1.6.0: - version "1.6.0" - resolved "https://registry.yarnpkg.com/concat-stream/-/concat-stream-1.6.0.tgz#0aac662fd52be78964d5532f694784e70110acf7" - dependencies: - inherits "^2.0.3" - readable-stream "^2.2.2" - typedarray "^0.0.6" - - concordance@^3.0.0: - version "3.0.0" - resolved "https://registry.yarnpkg.com/concordance/-/concordance-3.0.0.tgz#b2286af54405fc995fc7345b0b106d8dd073cb29" - dependencies: - date-time "^2.1.0" - esutils "^2.0.2" - fast-diff "^1.1.1" - function-name-support "^0.2.0" - js-string-escape "^1.0.1" - lodash.clonedeep "^4.5.0" - lodash.flattendeep "^4.4.0" - lodash.merge "^4.6.0" - md5-hex "^2.0.0" - semver "^5.3.0" - well-known-symbols "^1.0.0" - - configstore@^3.0.0: - version "3.1.1" - resolved "https://registry.yarnpkg.com/configstore/-/configstore-3.1.1.tgz#094ee662ab83fad9917678de114faaea8fcdca90" - dependencies: - dot-prop "^4.1.0" - graceful-fs "^4.1.2" - make-dir "^1.0.0" - unique-string "^1.0.0" - write-file-atomic "^2.0.0" - xdg-basedir "^3.0.0" - - console-browserify@^1.1.0: - version "1.1.0" - resolved "https://registry.yarnpkg.com/console-browserify/-/console-browserify-1.1.0.tgz#f0241c45730a9fc6323b206dbf38edc741d0bb10" - dependencies: - date-now "^0.1.4" - - console-control-strings@^1.0.0, console-control-strings@~1.1.0: - version "1.1.0" - resolved "https://registry.yarnpkg.com/console-control-strings/-/console-control-strings-1.1.0.tgz#3d7cf4464db6446ea644bf4b39507f9851008e8e" - - constants-browserify@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/constants-browserify/-/constants-browserify-1.0.0.tgz#c20b96d8c617748aaf1c16021760cd27fcb8cb75" - - convert-source-map@1.5.1, convert-source-map@^1.5.0, convert-source-map@^1.5.1: - version "1.5.1" - resolved "https://registry.yarnpkg.com/convert-source-map/-/convert-source-map-1.5.1.tgz#b8278097b9bc229365de5c62cf5fcaed8b5599e5" - - convert-to-spaces@^1.0.1: - version "1.0.2" - resolved "https://registry.yarnpkg.com/convert-to-spaces/-/convert-to-spaces-1.0.2.tgz#7e3e48bbe6d997b1417ddca2868204b4d3d85715" - - copy-concurrently@^1.0.0: - version "1.0.5" - resolved "https://registry.yarnpkg.com/copy-concurrently/-/copy-concurrently-1.0.5.tgz#92297398cae34937fcafd6ec8139c18051f0b5e0" - dependencies: - aproba "^1.1.1" - fs-write-stream-atomic "^1.0.8" - iferr "^0.1.5" - mkdirp "^0.5.1" - rimraf "^2.5.4" - run-queue "^1.0.0" - - copy-webpack-plugin@4.3.1: - version "4.3.1" - resolved "https://registry.yarnpkg.com/copy-webpack-plugin/-/copy-webpack-plugin-4.3.1.tgz#19ba6370bf6f8e263cbd66185a2b79f2321a9302" - dependencies: - cacache "^10.0.1" - find-cache-dir "^1.0.0" - globby "^7.1.1" - is-glob "^4.0.0" - loader-utils "^0.2.15" - lodash "^4.3.0" - minimatch "^3.0.4" - p-limit "^1.0.0" - pify "^3.0.0" - serialize-javascript "^1.4.0" - - core-assert@^0.2.0: - version "0.2.1" - resolved "https://registry.yarnpkg.com/core-assert/-/core-assert-0.2.1.tgz#f85e2cf9bfed28f773cc8b3fa5c5b69bdc02fe3f" - dependencies: - buf-compare "^1.0.0" - is-error "^2.2.0" - - core-js@^1.0.0: - version "1.2.7" - resolved "https://registry.yarnpkg.com/core-js/-/core-js-1.2.7.tgz#652294c14651db28fa93bd2d5ff2983a4f08c636" - - core-js@^2.0.0, core-js@^2.4.0, core-js@^2.5.0: - version "2.5.3" - resolved "https://registry.yarnpkg.com/core-js/-/core-js-2.5.3.tgz#8acc38345824f16d8365b7c9b4259168e8ed603e" - - core-util-is@1.0.2, core-util-is@~1.0.0: - version "1.0.2" - resolved "https://registry.yarnpkg.com/core-util-is/-/core-util-is-1.0.2.tgz#b5fd54220aa2bc5ab57aab7140c940754503c1a7" - - crc32-stream@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/crc32-stream/-/crc32-stream-2.0.0.tgz#e3cdd3b4df3168dd74e3de3fbbcb7b297fe908f4" - dependencies: - crc "^3.4.4" - readable-stream "^2.0.0" - - crc@^3.4.4: - version "3.5.0" - resolved "https://registry.yarnpkg.com/crc/-/crc-3.5.0.tgz#98b8ba7d489665ba3979f59b21381374101a1964" - - create-ecdh@^4.0.0: - version "4.0.0" - resolved "https://registry.yarnpkg.com/create-ecdh/-/create-ecdh-4.0.0.tgz#888c723596cdf7612f6498233eebd7a35301737d" - dependencies: - bn.js "^4.1.0" - elliptic "^6.0.0" - - create-error-class@^3.0.0: - version "3.0.2" - resolved "https://registry.yarnpkg.com/create-error-class/-/create-error-class-3.0.2.tgz#06be7abef947a3f14a30fd610671d401bca8b7b6" - dependencies: - capture-stack-trace "^1.0.0" - - create-hash@^1.1.0, create-hash@^1.1.2: - version "1.1.3" - resolved "https://registry.yarnpkg.com/create-hash/-/create-hash-1.1.3.tgz#606042ac8b9262750f483caddab0f5819172d8fd" - dependencies: - cipher-base "^1.0.1" - inherits "^2.0.1" - ripemd160 "^2.0.0" - sha.js "^2.4.0" - - create-hmac@^1.1.0, create-hmac@^1.1.2, create-hmac@^1.1.4: - version "1.1.6" - resolved "https://registry.yarnpkg.com/create-hmac/-/create-hmac-1.1.6.tgz#acb9e221a4e17bdb076e90657c42b93e3726cf06" - dependencies: - cipher-base "^1.0.3" - create-hash "^1.1.0" - inherits "^2.0.1" - ripemd160 "^2.0.0" - safe-buffer "^5.0.1" - sha.js "^2.4.8" - - cross-env@5.1.4: - version "5.1.4" - resolved "https://registry.yarnpkg.com/cross-env/-/cross-env-5.1.4.tgz#f61c14291f7cc653bb86457002ea80a04699d022" - dependencies: - cross-spawn "^5.1.0" - is-windows "^1.0.0" - - cross-spawn@^5.0.1, cross-spawn@^5.1.0: - version "5.1.0" - resolved "https://registry.yarnpkg.com/cross-spawn/-/cross-spawn-5.1.0.tgz#e8bd0efee58fcff6f8f94510a0a554bbfa235449" - dependencies: - lru-cache "^4.0.1" - shebang-command "^1.2.0" - which "^1.2.9" - - cross-unzip@0.0.2: - version "0.0.2" - resolved "https://registry.yarnpkg.com/cross-unzip/-/cross-unzip-0.0.2.tgz#5183bc47a09559befcf98cc4657964999359372f" - - cryptiles@2.x.x: - version "2.0.5" - resolved "https://registry.yarnpkg.com/cryptiles/-/cryptiles-2.0.5.tgz#3bdfecdc608147c1c67202fa291e7dca59eaa3b8" - dependencies: - boom "2.x.x" - - cryptiles@3.x.x: - version "3.1.2" - resolved "https://registry.yarnpkg.com/cryptiles/-/cryptiles-3.1.2.tgz#a89fbb220f5ce25ec56e8c4aa8a4fd7b5b0d29fe" - dependencies: - boom "5.x.x" - - crypto-browserify@^3.11.0: - version "3.12.0" - resolved "https://registry.yarnpkg.com/crypto-browserify/-/crypto-browserify-3.12.0.tgz#396cf9f3137f03e4b8e532c58f698254e00f80ec" - dependencies: - browserify-cipher "^1.0.0" - browserify-sign "^4.0.0" - create-ecdh "^4.0.0" - create-hash "^1.1.0" - create-hmac "^1.1.0" - diffie-hellman "^5.0.0" - inherits "^2.0.1" - pbkdf2 "^3.0.3" - public-encrypt "^4.0.0" - randombytes "^2.0.0" - randomfill "^1.0.3" - - crypto-random-string@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/crypto-random-string/-/crypto-random-string-1.0.0.tgz#a230f64f568310e1498009940790ec99545bca7e" - - css-color-names@0.0.4: - version "0.0.4" - resolved "https://registry.yarnpkg.com/css-color-names/-/css-color-names-0.0.4.tgz#808adc2e79cf84738069b646cb20ec27beb629e0" - - css-loader@0.28.11: - version "0.28.11" - resolved "https://registry.yarnpkg.com/css-loader/-/css-loader-0.28.11.tgz#c3f9864a700be2711bb5a2462b2389b1a392dab7" - dependencies: - babel-code-frame "^6.26.0" - css-selector-tokenizer "^0.7.0" - cssnano "^3.10.0" - icss-utils "^2.1.0" - loader-utils "^1.0.2" - lodash.camelcase "^4.3.0" - object-assign "^4.1.1" - postcss "^5.0.6" - postcss-modules-extract-imports "^1.2.0" - postcss-modules-local-by-default "^1.2.0" - postcss-modules-scope "^1.1.0" - postcss-modules-values "^1.3.0" - postcss-value-parser "^3.3.0" - source-list-map "^2.0.0" - - css-parse@~2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/css-parse/-/css-parse-2.0.0.tgz#a468ee667c16d81ccf05c58c38d2a97c780dbfd4" - dependencies: - css "^2.0.0" - - css-selector-tokenizer@^0.7.0: - version "0.7.0" - resolved "https://registry.yarnpkg.com/css-selector-tokenizer/-/css-selector-tokenizer-0.7.0.tgz#e6988474ae8c953477bf5e7efecfceccd9cf4c86" - dependencies: - cssesc "^0.1.0" - fastparse "^1.1.1" - regexpu-core "^1.0.0" - - css-value@~0.0.1: - version "0.0.1" - resolved "https://registry.yarnpkg.com/css-value/-/css-value-0.0.1.tgz#5efd6c2eea5ea1fd6b6ac57ec0427b18452424ea" - - css@^2.0.0: - version "2.2.1" - resolved "https://registry.yarnpkg.com/css/-/css-2.2.1.tgz#73a4c81de85db664d4ee674f7d47085e3b2d55dc" - dependencies: - inherits "^2.0.1" - source-map "^0.1.38" - source-map-resolve "^0.3.0" - urix "^0.1.0" - - cssesc@^0.1.0: - version "0.1.0" - resolved "https://registry.yarnpkg.com/cssesc/-/cssesc-0.1.0.tgz#c814903e45623371a0477b40109aaafbeeaddbb4" - - cssnano@^3.10.0: - version "3.10.0" - resolved "https://registry.yarnpkg.com/cssnano/-/cssnano-3.10.0.tgz#4f38f6cea2b9b17fa01490f23f1dc68ea65c1c38" - dependencies: - autoprefixer "^6.3.1" - decamelize "^1.1.2" - defined "^1.0.0" - has "^1.0.1" - object-assign "^4.0.1" - postcss "^5.0.14" - postcss-calc "^5.2.0" - postcss-colormin "^2.1.8" - postcss-convert-values "^2.3.4" - postcss-discard-comments "^2.0.4" - postcss-discard-duplicates "^2.0.1" - postcss-discard-empty "^2.0.1" - postcss-discard-overridden "^0.1.1" - postcss-discard-unused "^2.2.1" - postcss-filter-plugins "^2.0.0" - postcss-merge-idents "^2.1.5" - postcss-merge-longhand "^2.0.1" - postcss-merge-rules "^2.0.3" - postcss-minify-font-values "^1.0.2" - postcss-minify-gradients "^1.0.1" - postcss-minify-params "^1.0.4" - postcss-minify-selectors "^2.0.4" - postcss-normalize-charset "^1.1.0" - postcss-normalize-url "^3.0.7" - postcss-ordered-values "^2.1.0" - postcss-reduce-idents "^2.2.2" - postcss-reduce-initial "^1.0.0" - postcss-reduce-transforms "^1.0.3" - postcss-svgo "^2.1.1" - postcss-unique-selectors "^2.0.2" - postcss-value-parser "^3.2.3" - postcss-zindex "^2.0.1" - - csso@~2.3.1: - version "2.3.2" - resolved "https://registry.yarnpkg.com/csso/-/csso-2.3.2.tgz#ddd52c587033f49e94b71fc55569f252e8ff5f85" - dependencies: - clap "^1.0.9" - source-map "^0.5.3" - - currently-unhandled@^0.4.1: - version "0.4.1" - resolved "https://registry.yarnpkg.com/currently-unhandled/-/currently-unhandled-0.4.1.tgz#988df33feab191ef799a61369dd76c17adf957ea" - dependencies: - array-find-index "^1.0.1" - - cyclist@~0.2.2: - version "0.2.2" - resolved "https://registry.yarnpkg.com/cyclist/-/cyclist-0.2.2.tgz#1b33792e11e914a2fd6d6ed6447464444e5fa640" - - d@1: - version "1.0.0" - resolved "https://registry.yarnpkg.com/d/-/d-1.0.0.tgz#754bb5bfe55451da69a58b94d45f4c5b0462d58f" - dependencies: - es5-ext "^0.10.9" - - dashdash@^1.12.0: - version "1.14.1" - resolved "https://registry.yarnpkg.com/dashdash/-/dashdash-1.14.1.tgz#853cfa0f7cbe2fed5de20326b8dd581035f6e2f0" - dependencies: - assert-plus "^1.0.0" - - date-now@^0.1.4: - version "0.1.4" - resolved "https://registry.yarnpkg.com/date-now/-/date-now-0.1.4.tgz#eaf439fd4d4848ad74e5cc7dbef200672b9e345b" - - date-time@^0.1.1: - version "0.1.1" - resolved "https://registry.yarnpkg.com/date-time/-/date-time-0.1.1.tgz#ed2f6d93d9790ce2fd66d5b5ff3edd5bbcbf3b07" - - date-time@^2.1.0: - version "2.1.0" - resolved "https://registry.yarnpkg.com/date-time/-/date-time-2.1.0.tgz#0286d1b4c769633b3ca13e1e62558d2dbdc2eba2" - dependencies: - time-zone "^1.0.0" - - debug@2.6.9, debug@^2.1.3, debug@^2.2.0, debug@^2.5.1, debug@^2.6.3, debug@^2.6.8: - version "2.6.9" - resolved "https://registry.yarnpkg.com/debug/-/debug-2.6.9.tgz#5d128515df134ff327e90a4c93f4e077a536341f" - dependencies: - ms "2.0.0" - - debug@^3.0.0, debug@^3.0.1, debug@^3.1.0: - version "3.1.0" - resolved "https://registry.yarnpkg.com/debug/-/debug-3.1.0.tgz#5bb5a0672628b64149566ba16819e61518c67261" - dependencies: - ms "2.0.0" - - decamelize@^1.0.0, decamelize@^1.1.1, decamelize@^1.1.2: - version "1.2.0" - resolved "https://registry.yarnpkg.com/decamelize/-/decamelize-1.2.0.tgz#f6534d15148269b20352e7bee26f501f9a191290" - - decompress-response@^3.2.0: - version "3.3.0" - resolved "https://registry.yarnpkg.com/decompress-response/-/decompress-response-3.3.0.tgz#80a4dd323748384bfa248083622aedec982adff3" - dependencies: - mimic-response "^1.0.0" - - deep-equal@^1.0.0: - version "1.0.1" - resolved "https://registry.yarnpkg.com/deep-equal/-/deep-equal-1.0.1.tgz#f5d260292b660e084eff4cdbc9f08ad3247448b5" - - deep-extend@~0.4.0: - version "0.4.2" - resolved "https://registry.yarnpkg.com/deep-extend/-/deep-extend-0.4.2.tgz#48b699c27e334bf89f10892be432f6e4c7d34a7f" - - deep-is@~0.1.3: - version "0.1.3" - resolved "https://registry.yarnpkg.com/deep-is/-/deep-is-0.1.3.tgz#b369d6fb5dbc13eecf524f91b070feedc357cf34" - - deepmerge@~2.0.1: - version "2.0.1" - resolved "https://registry.yarnpkg.com/deepmerge/-/deepmerge-2.0.1.tgz#25c1c24f110fb914f80001b925264dd77f3f4312" - - defaults@^1.0.3: - version "1.0.3" - resolved "https://registry.yarnpkg.com/defaults/-/defaults-1.0.3.tgz#c656051e9817d9ff08ed881477f3fe4019f3ef7d" - dependencies: - clone "^1.0.2" - - define-properties@^1.1.2: - version "1.1.2" - resolved "https://registry.yarnpkg.com/define-properties/-/define-properties-1.1.2.tgz#83a73f2fea569898fb737193c8f873caf6d45c94" - dependencies: - foreach "^2.0.5" - object-keys "^1.0.8" - - defined@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/defined/-/defined-1.0.0.tgz#c98d9bcef75674188e110969151199e39b1fa693" - - del@^2.0.2: - version "2.2.2" - resolved "https://registry.yarnpkg.com/del/-/del-2.2.2.tgz#c12c981d067846c84bcaf862cff930d907ffd1a8" - dependencies: - globby "^5.0.0" - is-path-cwd "^1.0.0" - is-path-in-cwd "^1.0.0" - object-assign "^4.0.1" - pify "^2.0.0" - pinkie-promise "^2.0.0" - rimraf "^2.2.8" - - delayed-stream@~1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/delayed-stream/-/delayed-stream-1.0.0.tgz#df3ae199acadfb7d440aaae0b29e2272b24ec619" - - delegates@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/delegates/-/delegates-1.0.0.tgz#84c6e159b81904fdca59a0ef44cd870d31250f9a" - - des.js@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/des.js/-/des.js-1.0.0.tgz#c074d2e2aa6a8a9a07dbd61f9a15c2cd83ec8ecc" - dependencies: - inherits "^2.0.1" - minimalistic-assert "^1.0.0" - - detect-indent@^4.0.0: - version "4.0.0" - resolved "https://registry.yarnpkg.com/detect-indent/-/detect-indent-4.0.0.tgz#f76d064352cdf43a1cb6ce619c4ee3a9475de208" - dependencies: - repeating "^2.0.0" - - detect-indent@^5.0.0: - version "5.0.0" - resolved "https://registry.yarnpkg.com/detect-indent/-/detect-indent-5.0.0.tgz#3871cc0a6a002e8c3e5b3cf7f336264675f06b9d" - - detect-libc@^1.0.2, detect-libc@^1.0.3: - version "1.0.3" - resolved "https://registry.yarnpkg.com/detect-libc/-/detect-libc-1.0.3.tgz#fa137c4bd698edf55cd5cd02ac559f91a4c4ba9b" - - dev-null@^0.1.1: - version "0.1.1" - resolved "https://registry.yarnpkg.com/dev-null/-/dev-null-0.1.1.tgz#5a205ce3c2b2ef77b6238d6ba179eb74c6a0e818" - - diffie-hellman@^5.0.0: - version "5.0.2" - resolved "https://registry.yarnpkg.com/diffie-hellman/-/diffie-hellman-5.0.2.tgz#b5835739270cfe26acf632099fded2a07f209e5e" - dependencies: - bn.js "^4.1.0" - miller-rabin "^4.0.0" - randombytes "^2.0.0" - - dir-glob@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/dir-glob/-/dir-glob-2.0.0.tgz#0b205d2b6aef98238ca286598a8204d29d0a0034" - dependencies: - arrify "^1.0.1" - path-type "^3.0.0" - - dmg-builder@4.1.2: - version "4.1.2" - resolved "https://registry.yarnpkg.com/dmg-builder/-/dmg-builder-4.1.2.tgz#b4d7245dc2e91812395b4268b12f888443ba5f30" - dependencies: - bluebird-lst "^1.0.5" - builder-util "^5.6.5" - electron-builder-lib "~20.5.0" - fs-extra-p "^4.5.2" - iconv-lite "^0.4.19" - js-yaml "^3.11.0" - parse-color "^1.0.0" - sanitize-filename "^1.6.1" - - doctrine@^2.0.0: - version "2.1.0" - resolved "https://registry.yarnpkg.com/doctrine/-/doctrine-2.1.0.tgz#5cd01fc101621b42c4cd7f5d1a66243716d3f39d" - dependencies: - esutils "^2.0.2" - - domain-browser@^1.1.1: - version "1.2.0" - resolved "https://registry.yarnpkg.com/domain-browser/-/domain-browser-1.2.0.tgz#3d31f50191a6749dd1375a7f522e823d42e54eda" - - dot-prop@^4.1.0: - version "4.2.0" - resolved "https://registry.yarnpkg.com/dot-prop/-/dot-prop-4.2.0.tgz#1f19e0c2e1aa0e32797c49799f2837ac6af69c57" - dependencies: - is-obj "^1.0.0" - - dotenv-expand@^4.0.1: - version "4.2.0" - resolved "https://registry.yarnpkg.com/dotenv-expand/-/dotenv-expand-4.2.0.tgz#def1f1ca5d6059d24a766e587942c21106ce1275" - - dotenv@^5.0.0: - version "5.0.1" - resolved "https://registry.yarnpkg.com/dotenv/-/dotenv-5.0.1.tgz#a5317459bd3d79ab88cff6e44057a6a3fbb1fcef" - - duplexer3@^0.1.4: - version "0.1.4" - resolved "https://registry.yarnpkg.com/duplexer3/-/duplexer3-0.1.4.tgz#ee01dd1cac0ed3cbc7fdbea37dc0a8f1ce002ce2" - - duplexify@^3.4.2, duplexify@^3.5.3: - version "3.5.3" - resolved "https://registry.yarnpkg.com/duplexify/-/duplexify-3.5.3.tgz#8b5818800df92fd0125b27ab896491912858243e" - dependencies: - end-of-stream "^1.0.0" - inherits "^2.0.1" - readable-stream "^2.0.0" - stream-shift "^1.0.0" - - ecc-jsbn@~0.1.1: - version "0.1.1" - resolved "https://registry.yarnpkg.com/ecc-jsbn/-/ecc-jsbn-0.1.1.tgz#0fc73a9ed5f0d53c38193398523ef7e543777505" - dependencies: - jsbn "~0.1.0" - - ejs@^2.5.7, ejs@~2.5.6: - version "2.5.7" - resolved "https://registry.yarnpkg.com/ejs/-/ejs-2.5.7.tgz#cc872c168880ae3c7189762fd5ffc00896c9518a" - - electron-builder-lib@20.5.1, electron-builder-lib@~20.5.0: - version "20.5.1" - resolved "https://registry.yarnpkg.com/electron-builder-lib/-/electron-builder-lib-20.5.1.tgz#c155345c58d25580d316f6437c251a57e8e92d62" - dependencies: - "7zip-bin" "~3.1.0" - app-builder-bin "1.7.2" - async-exit-hook "^2.0.1" - bluebird-lst "^1.0.5" - builder-util "5.6.5" - builder-util-runtime "4.0.5" - chromium-pickle-js "^0.2.0" - debug "^3.1.0" - ejs "^2.5.7" - electron-osx-sign "0.4.10" - electron-publish "20.5.0" - fs-extra-p "^4.5.2" - hosted-git-info "^2.6.0" - is-ci "^1.1.0" - isbinaryfile "^3.0.2" - js-yaml "^3.11.0" - lazy-val "^1.0.3" - minimatch "^3.0.4" - normalize-package-data "^2.4.0" - plist "^2.1.0" - read-config-file "3.0.0" - sanitize-filename "^1.6.1" - semver "^5.5.0" - temp-file "^3.1.1" - - electron-builder-squirrel-windows@20.5.0: - version "20.5.0" - resolved "https://registry.yarnpkg.com/electron-builder-squirrel-windows/-/electron-builder-squirrel-windows-20.5.0.tgz#652d0849887b76f4502955a45b214fb93d311634" - dependencies: - archiver "^2.1.1" - bluebird-lst "^1.0.5" - builder-util "^5.6.5" - fs-extra-p "^4.5.2" - sanitize-filename "^1.6.1" - optionalDependencies: - "7zip-bin" "~3.1.0" - - electron-builder@20.5.1: - version "20.5.1" - resolved "https://registry.yarnpkg.com/electron-builder/-/electron-builder-20.5.1.tgz#8e6fba76dcd65aeabab60f15bd46f294ee04dd11" - dependencies: - bluebird-lst "^1.0.5" - builder-util "5.6.5" - builder-util-runtime "4.0.5" - chalk "^2.3.2" - dmg-builder "4.1.2" - electron-builder-lib "20.5.1" - electron-download-tf "4.3.4" - fs-extra-p "^4.5.2" - is-ci "^1.1.0" - lazy-val "^1.0.3" - read-config-file "3.0.0" - sanitize-filename "^1.6.1" - update-notifier "^2.3.0" - yargs "^11.0.0" - - electron-chromedriver@~1.8.0: - version "1.8.0" - resolved "https://registry.yarnpkg.com/electron-chromedriver/-/electron-chromedriver-1.8.0.tgz#901714133cf6f6093d365e1f44a52d99624d8241" - dependencies: - electron-download "^4.1.0" - extract-zip "^1.6.5" - - electron-devtools-installer@2.2.3: - version "2.2.3" - resolved "https://registry.yarnpkg.com/electron-devtools-installer/-/electron-devtools-installer-2.2.3.tgz#58b9a4ec507377bc46e091cd43714188e0c369be" - dependencies: - "7zip" "0.0.6" - cross-unzip "0.0.2" - rimraf "^2.5.2" - semver "^5.3.0" - - electron-download-tf@4.3.4: - version "4.3.4" - resolved "https://registry.yarnpkg.com/electron-download-tf/-/electron-download-tf-4.3.4.tgz#b03740b2885aa2ad3f8784fae74df427f66d5165" - dependencies: - debug "^3.0.0" - env-paths "^1.0.0" - fs-extra "^4.0.1" - minimist "^1.2.0" - nugget "^2.0.1" - path-exists "^3.0.0" - rc "^1.2.1" - semver "^5.4.1" - sumchecker "^2.0.2" - - electron-download@^3.0.1: - version "3.3.0" - resolved "https://registry.yarnpkg.com/electron-download/-/electron-download-3.3.0.tgz#2cfd54d6966c019c4d49ad65fbe65cc9cdef68c8" - dependencies: - debug "^2.2.0" - fs-extra "^0.30.0" - home-path "^1.0.1" - minimist "^1.2.0" - nugget "^2.0.0" - path-exists "^2.1.0" - rc "^1.1.2" - semver "^5.3.0" - sumchecker "^1.2.0" - - electron-download@^4.1.0: - version "4.1.0" - resolved "https://registry.yarnpkg.com/electron-download/-/electron-download-4.1.0.tgz#bf932c746f2f87ffcc09d1dd472f2ff6b9187845" - dependencies: - debug "^2.2.0" - env-paths "^1.0.0" - fs-extra "^2.0.0" - minimist "^1.2.0" - nugget "^2.0.0" - path-exists "^3.0.0" - rc "^1.1.2" - semver "^5.3.0" - sumchecker "^2.0.1" - - electron-osx-sign@0.4.10: - version "0.4.10" - resolved "https://registry.yarnpkg.com/electron-osx-sign/-/electron-osx-sign-0.4.10.tgz#be4f3b89b2a75a1dc5f1e7249081ab2929ca3a26" - dependencies: - bluebird "^3.5.0" - compare-version "^0.1.2" - debug "^2.6.8" - isbinaryfile "^3.0.2" - minimist "^1.2.0" - plist "^2.1.0" - - electron-publish@20.5.0: - version "20.5.0" - resolved "https://registry.yarnpkg.com/electron-publish/-/electron-publish-20.5.0.tgz#bcef9949c63899d34680e89110e8d38d1016f1f6" - dependencies: - bluebird-lst "^1.0.5" - builder-util "^5.6.5" - builder-util-runtime "^4.0.5" - chalk "^2.3.2" - fs-extra-p "^4.5.2" - lazy-val "^1.0.3" - mime "^2.2.0" - - electron-rebuild@1.7.3: - version "1.7.3" - resolved "https://registry.yarnpkg.com/electron-rebuild/-/electron-rebuild-1.7.3.tgz#24ae06ad9dd61cb7e4d688961f49118c40a110eb" - dependencies: - colors "^1.1.2" - debug "^2.6.3" - detect-libc "^1.0.3" - fs-extra "^3.0.1" - node-abi "^2.0.0" - node-gyp "^3.6.0" - ora "^1.2.0" - rimraf "^2.6.1" - spawn-rx "^2.0.10" - yargs "^7.0.2" - - electron-to-chromium@^1.2.7: - version "1.3.33" - resolved "https://registry.yarnpkg.com/electron-to-chromium/-/electron-to-chromium-1.3.33.tgz#bf00703d62a7c65238136578c352d6c5c042a545" - - electron@1.8.4: - version "1.8.4" - resolved "https://registry.yarnpkg.com/electron/-/electron-1.8.4.tgz#cca8d0e6889f238f55b414ad224f03e03b226a38" - dependencies: - "@types/node" "^8.0.24" - electron-download "^3.0.1" - extract-zip "^1.0.3" - - elliptic@^6.0.0: - version "6.4.0" - resolved "https://registry.yarnpkg.com/elliptic/-/elliptic-6.4.0.tgz#cac9af8762c85836187003c8dfe193e5e2eae5df" - dependencies: - bn.js "^4.4.0" - brorand "^1.0.1" - hash.js "^1.0.0" - hmac-drbg "^1.0.0" - inherits "^2.0.1" - minimalistic-assert "^1.0.0" - minimalistic-crypto-utils "^1.0.0" - - emojis-list@^2.0.0: - version "2.1.0" - resolved "https://registry.yarnpkg.com/emojis-list/-/emojis-list-2.1.0.tgz#4daa4d9db00f9819880c79fa457ae5b09a1fd389" - - empower-core@^0.6.1: - version "0.6.2" - resolved "https://registry.yarnpkg.com/empower-core/-/empower-core-0.6.2.tgz#5adef566088e31fba80ba0a36df47d7094169144" - dependencies: - call-signature "0.0.2" - core-js "^2.0.0" - - encoding@^0.1.11: - version "0.1.12" - resolved "https://registry.yarnpkg.com/encoding/-/encoding-0.1.12.tgz#538b66f3ee62cd1ab51ec323829d1f9480c74beb" - dependencies: - iconv-lite "~0.4.13" - - end-of-stream@^1.0.0, end-of-stream@^1.1.0: - version "1.4.1" - resolved "https://registry.yarnpkg.com/end-of-stream/-/end-of-stream-1.4.1.tgz#ed29634d19baba463b6ce6b80a37213eab71ec43" - dependencies: - once "^1.4.0" - - enhanced-resolve@^3.4.0: - version "3.4.1" - resolved "https://registry.yarnpkg.com/enhanced-resolve/-/enhanced-resolve-3.4.1.tgz#0421e339fd71419b3da13d129b3979040230476e" - dependencies: - graceful-fs "^4.1.2" - memory-fs "^0.4.0" - object-assign "^4.0.1" - tapable "^0.2.7" - - env-paths@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/env-paths/-/env-paths-1.0.0.tgz#4168133b42bb05c38a35b1ae4397c8298ab369e0" - - equal-length@^1.0.0: - version "1.0.1" - resolved "https://registry.yarnpkg.com/equal-length/-/equal-length-1.0.1.tgz#21ca112d48ab24b4e1e7ffc0e5339d31fdfc274c" - - errno@^0.1.3: - version "0.1.7" - resolved "https://registry.yarnpkg.com/errno/-/errno-0.1.7.tgz#4684d71779ad39af177e3f007996f7c67c852618" - dependencies: - prr "~1.0.1" - - error-ex@^1.2.0, error-ex@^1.3.1: - version "1.3.1" - resolved "https://registry.yarnpkg.com/error-ex/-/error-ex-1.3.1.tgz#f855a86ce61adc4e8621c3cda21e7a7612c3a8dc" - dependencies: - is-arrayish "^0.2.1" - - es-abstract@^1.7.0: - version "1.10.0" - resolved "https://registry.yarnpkg.com/es-abstract/-/es-abstract-1.10.0.tgz#1ecb36c197842a00d8ee4c2dfd8646bb97d60864" - dependencies: - es-to-primitive "^1.1.1" - function-bind "^1.1.1" - has "^1.0.1" - is-callable "^1.1.3" - is-regex "^1.0.4" - - es-to-primitive@^1.1.1: - version "1.1.1" - resolved "https://registry.yarnpkg.com/es-to-primitive/-/es-to-primitive-1.1.1.tgz#45355248a88979034b6792e19bb81f2b7975dd0d" - dependencies: - is-callable "^1.1.1" - is-date-object "^1.0.1" - is-symbol "^1.0.1" - - es5-ext@^0.10.14, es5-ext@^0.10.35, es5-ext@^0.10.9, es5-ext@~0.10.14: - version "0.10.39" - resolved "https://registry.yarnpkg.com/es5-ext/-/es5-ext-0.10.39.tgz#fca21b67559277ca4ac1a1ed7048b107b6f76d87" - dependencies: - es6-iterator "~2.0.3" - es6-symbol "~3.1.1" - - es6-error@^4.0.1, es6-error@^4.0.2: - version "4.1.1" - resolved "https://registry.yarnpkg.com/es6-error/-/es6-error-4.1.1.tgz#9e3af407459deed47e9a91f9b885a84eb05c561d" - - es6-iterator@^2.0.1, es6-iterator@~2.0.1, es6-iterator@~2.0.3: - version "2.0.3" - resolved "https://registry.yarnpkg.com/es6-iterator/-/es6-iterator-2.0.3.tgz#a7de889141a05a94b0854403b2d0a0fbfa98f3b7" - dependencies: - d "1" - es5-ext "^0.10.35" - es6-symbol "^3.1.1" - - es6-map@^0.1.3: - version "0.1.5" - resolved "https://registry.yarnpkg.com/es6-map/-/es6-map-0.1.5.tgz#9136e0503dcc06a301690f0bb14ff4e364e949f0" - dependencies: - d "1" - es5-ext "~0.10.14" - es6-iterator "~2.0.1" - es6-set "~0.1.5" - es6-symbol "~3.1.1" - event-emitter "~0.3.5" - - es6-promise@^4.0.5: - version "4.2.4" - resolved "https://registry.yarnpkg.com/es6-promise/-/es6-promise-4.2.4.tgz#dc4221c2b16518760bd8c39a52d8f356fc00ed29" - - es6-set@~0.1.5: - version "0.1.5" - resolved "https://registry.yarnpkg.com/es6-set/-/es6-set-0.1.5.tgz#d2b3ec5d4d800ced818db538d28974db0a73ccb1" - dependencies: - d "1" - es5-ext "~0.10.14" - es6-iterator "~2.0.1" - es6-symbol "3.1.1" - event-emitter "~0.3.5" - - es6-symbol@3.1.1, es6-symbol@^3.1.1, es6-symbol@~3.1.1: - version "3.1.1" - resolved "https://registry.yarnpkg.com/es6-symbol/-/es6-symbol-3.1.1.tgz#bf00ef4fdab6ba1b46ecb7b629b4c7ed5715cc77" - dependencies: - d "1" - es5-ext "~0.10.14" - - es6-weak-map@^2.0.1: - version "2.0.2" - resolved "https://registry.yarnpkg.com/es6-weak-map/-/es6-weak-map-2.0.2.tgz#5e3ab32251ffd1538a1f8e5ffa1357772f92d96f" - dependencies: - d "1" - es5-ext "^0.10.14" - es6-iterator "^2.0.1" - es6-symbol "^3.1.1" - - escape-string-regexp@^1.0.2, escape-string-regexp@^1.0.4, escape-string-regexp@^1.0.5: - version "1.0.5" - resolved "https://registry.yarnpkg.com/escape-string-regexp/-/escape-string-regexp-1.0.5.tgz#1b61c0562190a8dff6ae3bb2cf0200ca130b86d4" - - escope@^3.6.0: - version "3.6.0" - resolved "https://registry.yarnpkg.com/escope/-/escope-3.6.0.tgz#e01975e812781a163a6dadfdd80398dc64c889c3" - dependencies: - es6-map "^0.1.3" - es6-weak-map "^2.0.1" - esrecurse "^4.1.0" - estraverse "^4.1.1" - - eslint-config-prettier@2.6.0: - version "2.6.0" - resolved "https://registry.yarnpkg.com/eslint-config-prettier/-/eslint-config-prettier-2.6.0.tgz#f21db0ebb438ad678fb98946097c4bb198befccc" - dependencies: - get-stdin "^5.0.1" - - eslint-plugin-prettier@2.3.1: - version "2.3.1" - resolved "https://registry.yarnpkg.com/eslint-plugin-prettier/-/eslint-plugin-prettier-2.3.1.tgz#e7a746c67e716f335274b88295a9ead9f544e44d" - dependencies: - fast-diff "^1.1.1" - jest-docblock "^21.0.0" - - eslint-plugin-react@7.3.0: - version "7.3.0" - resolved "https://registry.yarnpkg.com/eslint-plugin-react/-/eslint-plugin-react-7.3.0.tgz#ca9368da36f733fbdc05718ae4e91f778f38e344" - dependencies: - doctrine "^2.0.0" - has "^1.0.1" - jsx-ast-utils "^2.0.0" - prop-types "^15.5.10" - - eslint-scope@^3.7.1: - version "3.7.1" - resolved "https://registry.yarnpkg.com/eslint-scope/-/eslint-scope-3.7.1.tgz#3d63c3edfda02e06e01a452ad88caacc7cdcb6e8" - dependencies: - esrecurse "^4.1.0" - estraverse "^4.1.1" - - eslint@4.7.2: - version "4.7.2" - resolved "https://registry.yarnpkg.com/eslint/-/eslint-4.7.2.tgz#ff6f5f5193848a27ee9b627be3e73fb9cb5e662e" - dependencies: - ajv "^5.2.0" - babel-code-frame "^6.22.0" - chalk "^2.1.0" - concat-stream "^1.6.0" - cross-spawn "^5.1.0" - debug "^3.0.1" - doctrine "^2.0.0" - eslint-scope "^3.7.1" - espree "^3.5.1" - esquery "^1.0.0" - estraverse "^4.2.0" - esutils "^2.0.2" - file-entry-cache "^2.0.0" - functional-red-black-tree "^1.0.1" - glob "^7.1.2" - globals "^9.17.0" - ignore "^3.3.3" - imurmurhash "^0.1.4" - inquirer "^3.0.6" - is-resolvable "^1.0.0" - js-yaml "^3.9.1" - json-stable-stringify "^1.0.1" - levn "^0.3.0" - lodash "^4.17.4" - minimatch "^3.0.2" - mkdirp "^0.5.1" - natural-compare "^1.4.0" - optionator "^0.8.2" - path-is-inside "^1.0.2" - pluralize "^7.0.0" - progress "^2.0.0" - require-uncached "^1.0.3" - semver "^5.3.0" - strip-ansi "^4.0.0" - strip-json-comments "~2.0.1" - table "^4.0.1" - text-table "~0.2.0" - - espower-location-detector@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/espower-location-detector/-/espower-location-detector-1.0.0.tgz#a17b7ecc59d30e179e2bef73fb4137704cb331b5" - dependencies: - is-url "^1.2.1" - path-is-absolute "^1.0.0" - source-map "^0.5.0" - xtend "^4.0.0" - - espree@^3.5.1: - version "3.5.4" - resolved "https://registry.yarnpkg.com/espree/-/espree-3.5.4.tgz#b0f447187c8a8bed944b815a660bddf5deb5d1a7" - dependencies: - acorn "^5.5.0" - acorn-jsx "^3.0.0" - - esprima@^2.6.0: - version "2.7.3" - resolved "https://registry.yarnpkg.com/esprima/-/esprima-2.7.3.tgz#96e3b70d5779f6ad49cd032673d1c312767ba581" - - esprima@^4.0.0, esprima@~4.0.0: - version "4.0.0" - resolved "https://registry.yarnpkg.com/esprima/-/esprima-4.0.0.tgz#4499eddcd1110e0b218bacf2fa7f7f59f55ca804" - - espurify@^1.6.0: - version "1.7.0" - resolved "https://registry.yarnpkg.com/espurify/-/espurify-1.7.0.tgz#1c5cf6cbccc32e6f639380bd4f991fab9ba9d226" - dependencies: - core-js "^2.0.0" - - esquery@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/esquery/-/esquery-1.0.0.tgz#cfba8b57d7fba93f17298a8a006a04cda13d80fa" - dependencies: - estraverse "^4.0.0" - - esrecurse@^4.1.0: - version "4.2.0" - resolved "https://registry.yarnpkg.com/esrecurse/-/esrecurse-4.2.0.tgz#fa9568d98d3823f9a41d91e902dcab9ea6e5b163" - dependencies: - estraverse "^4.1.0" - object-assign "^4.0.1" - - estraverse@^4.0.0, estraverse@^4.1.0, estraverse@^4.1.1, estraverse@^4.2.0: - version "4.2.0" - resolved "https://registry.yarnpkg.com/estraverse/-/estraverse-4.2.0.tgz#0dee3fed31fcd469618ce7342099fc1afa0bdb13" - - esutils@^2.0.2: - version "2.0.2" - resolved "https://registry.yarnpkg.com/esutils/-/esutils-2.0.2.tgz#0abf4f1caa5bcb1f7a9d8acc6dea4faaa04bac9b" - - event-emitter@~0.3.5: - version "0.3.5" - resolved "https://registry.yarnpkg.com/event-emitter/-/event-emitter-0.3.5.tgz#df8c69eef1647923c7157b9ce83840610b02cc39" - dependencies: - d "1" - es5-ext "~0.10.14" - - events@^1.0.0: - version "1.1.1" - resolved "https://registry.yarnpkg.com/events/-/events-1.1.1.tgz#9ebdb7635ad099c70dcc4c2a1f5004288e8bd924" - - evp_bytestokey@^1.0.0, evp_bytestokey@^1.0.3: - version "1.0.3" - resolved "https://registry.yarnpkg.com/evp_bytestokey/-/evp_bytestokey-1.0.3.tgz#7fcbdb198dc71959432efe13842684e0525acb02" - dependencies: - md5.js "^1.3.4" - safe-buffer "^5.1.1" - - execa@^0.7.0: - version "0.7.0" - resolved "https://registry.yarnpkg.com/execa/-/execa-0.7.0.tgz#944becd34cc41ee32a63a9faf27ad5a65fc59777" - dependencies: - cross-spawn "^5.0.1" - get-stream "^3.0.0" - is-stream "^1.1.0" - npm-run-path "^2.0.0" - p-finally "^1.0.0" - signal-exit "^3.0.0" - strip-eof "^1.0.0" - - expand-brackets@^0.1.4: - version "0.1.5" - resolved "https://registry.yarnpkg.com/expand-brackets/-/expand-brackets-0.1.5.tgz#df07284e342a807cd733ac5af72411e581d1177b" - dependencies: - is-posix-bracket "^0.1.0" - - expand-range@^1.8.1: - version "1.8.2" - resolved "https://registry.yarnpkg.com/expand-range/-/expand-range-1.8.2.tgz#a299effd335fe2721ebae8e257ec79644fc85337" - dependencies: - fill-range "^2.1.0" - - extend@~3.0.0, extend@~3.0.1: - version "3.0.1" - resolved "https://registry.yarnpkg.com/extend/-/extend-3.0.1.tgz#a755ea7bc1adfcc5a31ce7e762dbaadc5e636444" - - external-editor@^2.0.4, external-editor@^2.1.0: - version "2.1.0" - resolved "https://registry.yarnpkg.com/external-editor/-/external-editor-2.1.0.tgz#3d026a21b7f95b5726387d4200ac160d372c3b48" - dependencies: - chardet "^0.4.0" - iconv-lite "^0.4.17" - tmp "^0.0.33" - - extglob@^0.3.1: - version "0.3.2" - resolved "https://registry.yarnpkg.com/extglob/-/extglob-0.3.2.tgz#2e18ff3d2f49ab2765cec9023f011daa8d8349a1" - dependencies: - is-extglob "^1.0.0" - - extract-zip@^1.0.3, extract-zip@^1.6.5: - version "1.6.6" - resolved "https://registry.yarnpkg.com/extract-zip/-/extract-zip-1.6.6.tgz#1290ede8d20d0872b429fd3f351ca128ec5ef85c" - dependencies: - concat-stream "1.6.0" - debug "2.6.9" - mkdirp "0.5.0" - yauzl "2.4.1" - - extsprintf@1.3.0: - version "1.3.0" - resolved "https://registry.yarnpkg.com/extsprintf/-/extsprintf-1.3.0.tgz#96918440e3041a7a414f8c52e3c574eb3c3e1e05" - - extsprintf@^1.2.0: - version "1.4.0" - resolved "https://registry.yarnpkg.com/extsprintf/-/extsprintf-1.4.0.tgz#e2689f8f356fad62cca65a3a91c5df5f9551692f" - - fast-deep-equal@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/fast-deep-equal/-/fast-deep-equal-1.0.0.tgz#96256a3bc975595eb36d82e9929d060d893439ff" - - fast-diff@^1.1.1: - version "1.1.2" - resolved "https://registry.yarnpkg.com/fast-diff/-/fast-diff-1.1.2.tgz#4b62c42b8e03de3f848460b639079920695d0154" - - fast-json-stable-stringify@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/fast-json-stable-stringify/-/fast-json-stable-stringify-2.0.0.tgz#d5142c0caee6b1189f87d3a76111064f86c8bbf2" - - fast-levenshtein@~2.0.4: - version "2.0.6" - resolved "https://registry.yarnpkg.com/fast-levenshtein/-/fast-levenshtein-2.0.6.tgz#3d8a5c66883a16a30ca8643e851f19baa7797917" - - fastparse@^1.1.1: - version "1.1.1" - resolved "https://registry.yarnpkg.com/fastparse/-/fastparse-1.1.1.tgz#d1e2643b38a94d7583b479060e6c4affc94071f8" - - fbjs@^0.8.16: - version "0.8.16" - resolved "https://registry.yarnpkg.com/fbjs/-/fbjs-0.8.16.tgz#5e67432f550dc41b572bf55847b8aca64e5337db" - dependencies: - core-js "^1.0.0" - isomorphic-fetch "^2.1.1" - loose-envify "^1.0.0" - object-assign "^4.1.0" - promise "^7.1.1" - setimmediate "^1.0.5" - ua-parser-js "^0.7.9" - - fd-slicer@~1.0.1: - version "1.0.1" - resolved "https://registry.yarnpkg.com/fd-slicer/-/fd-slicer-1.0.1.tgz#8b5bcbd9ec327c5041bf9ab023fd6750f1177e65" - dependencies: - pend "~1.2.0" - - figures@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/figures/-/figures-2.0.0.tgz#3ab1a2d2a62c8bfb431a0c94cb797a2fce27c962" - dependencies: - escape-string-regexp "^1.0.5" - - file-entry-cache@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/file-entry-cache/-/file-entry-cache-2.0.0.tgz#c392990c3e684783d838b8c84a45d8a048458361" - dependencies: - flat-cache "^1.2.1" - object-assign "^4.0.1" - - filename-regex@^2.0.0: - version "2.0.1" - resolved "https://registry.yarnpkg.com/filename-regex/-/filename-regex-2.0.1.tgz#c1c4b9bee3e09725ddb106b75c1e301fe2f18b26" - - fill-keys@^1.0.2: - version "1.0.2" - resolved "https://registry.yarnpkg.com/fill-keys/-/fill-keys-1.0.2.tgz#9a8fa36f4e8ad634e3bf6b4f3c8882551452eb20" - dependencies: - is-object "~1.0.1" - merge-descriptors "~1.0.0" - - fill-range@^2.1.0: - version "2.2.3" - resolved "https://registry.yarnpkg.com/fill-range/-/fill-range-2.2.3.tgz#50b77dfd7e469bc7492470963699fe7a8485a723" - dependencies: - is-number "^2.1.0" - isobject "^2.0.0" - randomatic "^1.1.3" - repeat-element "^1.1.2" - repeat-string "^1.5.2" - - find-cache-dir@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/find-cache-dir/-/find-cache-dir-1.0.0.tgz#9288e3e9e3cc3748717d39eade17cf71fc30ee6f" - dependencies: - commondir "^1.0.1" - make-dir "^1.0.0" - pkg-dir "^2.0.0" - - find-up@^1.0.0: - version "1.1.2" - resolved "https://registry.yarnpkg.com/find-up/-/find-up-1.1.2.tgz#6b2e9822b1a2ce0a60ab64d610eccad53cb24d0f" - dependencies: - path-exists "^2.0.0" - pinkie-promise "^2.0.0" - - find-up@^2.0.0, find-up@^2.1.0: - version "2.1.0" - resolved "https://registry.yarnpkg.com/find-up/-/find-up-2.1.0.tgz#45d1b7e506c717ddd482775a2b77920a3c0c57a7" - dependencies: - locate-path "^2.0.0" - - flat-cache@^1.2.1: - version "1.3.0" - resolved "https://registry.yarnpkg.com/flat-cache/-/flat-cache-1.3.0.tgz#d3030b32b38154f4e3b7e9c709f490f7ef97c481" - dependencies: - circular-json "^0.3.1" - del "^2.0.2" - graceful-fs "^4.1.2" - write "^0.2.1" - - flatten@^1.0.2: - version "1.0.2" - resolved "https://registry.yarnpkg.com/flatten/-/flatten-1.0.2.tgz#dae46a9d78fbe25292258cc1e780a41d95c03782" - - flush-write-stream@^1.0.0: - version "1.0.2" - resolved "https://registry.yarnpkg.com/flush-write-stream/-/flush-write-stream-1.0.2.tgz#c81b90d8746766f1a609a46809946c45dd8ae417" - dependencies: - inherits "^2.0.1" - readable-stream "^2.0.4" - - fn-name@^2.0.0: - version "2.0.1" - resolved "https://registry.yarnpkg.com/fn-name/-/fn-name-2.0.1.tgz#5214d7537a4d06a4a301c0cc262feb84188002e7" - - for-in@^1.0.1: - version "1.0.2" - resolved "https://registry.yarnpkg.com/for-in/-/for-in-1.0.2.tgz#81068d295a8142ec0ac726c6e2200c30fb6d5e80" - - for-own@^0.1.4: - version "0.1.5" - resolved "https://registry.yarnpkg.com/for-own/-/for-own-0.1.5.tgz#5265c681a4f294dabbf17c9509b6763aa84510ce" - dependencies: - for-in "^1.0.1" - - foreach@^2.0.5: - version "2.0.5" - resolved "https://registry.yarnpkg.com/foreach/-/foreach-2.0.5.tgz#0bee005018aeb260d0a3af3ae658dd0136ec1b99" - - forever-agent@~0.6.1: - version "0.6.1" - resolved "https://registry.yarnpkg.com/forever-agent/-/forever-agent-0.6.1.tgz#fbc71f0c41adeb37f96c577ad1ed42d8fdacca91" - - form-data@~2.1.1: - version "2.1.4" - resolved "https://registry.yarnpkg.com/form-data/-/form-data-2.1.4.tgz#33c183acf193276ecaa98143a69e94bfee1750d1" - dependencies: - asynckit "^0.4.0" - combined-stream "^1.0.5" - mime-types "^2.1.12" - - form-data@~2.3.1: - version "2.3.2" - resolved "https://registry.yarnpkg.com/form-data/-/form-data-2.3.2.tgz#4970498be604c20c005d4f5c23aecd21d6b49099" - dependencies: - asynckit "^0.4.0" - combined-stream "1.0.6" - mime-types "^2.1.12" - - from2@^2.1.0: - version "2.3.0" - resolved "https://registry.yarnpkg.com/from2/-/from2-2.3.0.tgz#8bfb5502bde4a4d36cfdeea007fcca21d7e382af" - dependencies: - inherits "^2.0.1" - readable-stream "^2.0.0" - - fs-extra-p@^4.5.0, fs-extra-p@^4.5.2: - version "4.5.2" - resolved "https://registry.yarnpkg.com/fs-extra-p/-/fs-extra-p-4.5.2.tgz#0a22aba489284d17f375d5dc5139aa777fe2df51" - dependencies: - bluebird-lst "^1.0.5" - fs-extra "^5.0.0" - - fs-extra@^0.30.0: - version "0.30.0" - resolved "https://registry.yarnpkg.com/fs-extra/-/fs-extra-0.30.0.tgz#f233ffcc08d4da7d432daa449776989db1df93f0" - dependencies: - graceful-fs "^4.1.2" - jsonfile "^2.1.0" - klaw "^1.0.0" - path-is-absolute "^1.0.0" - rimraf "^2.2.8" - - fs-extra@^2.0.0: - version "2.1.2" - resolved "https://registry.yarnpkg.com/fs-extra/-/fs-extra-2.1.2.tgz#046c70163cef9aad46b0e4a7fa467fb22d71de35" - dependencies: - graceful-fs "^4.1.2" - jsonfile "^2.1.0" - - fs-extra@^3.0.1: - version "3.0.1" - resolved "https://registry.yarnpkg.com/fs-extra/-/fs-extra-3.0.1.tgz#3794f378c58b342ea7dbbb23095109c4b3b62291" - dependencies: - graceful-fs "^4.1.2" - jsonfile "^3.0.0" - universalify "^0.1.0" - - fs-extra@^4.0.1: - version "4.0.3" - resolved "https://registry.yarnpkg.com/fs-extra/-/fs-extra-4.0.3.tgz#0d852122e5bc5beb453fb028e9c0c9bf36340c94" - dependencies: - graceful-fs "^4.1.2" - jsonfile "^4.0.0" - universalify "^0.1.0" - - fs-extra@^5.0.0: - version "5.0.0" - resolved "https://registry.yarnpkg.com/fs-extra/-/fs-extra-5.0.0.tgz#414d0110cdd06705734d055652c5411260c31abd" - dependencies: - graceful-fs "^4.1.2" - jsonfile "^4.0.0" - universalify "^0.1.0" - - fs-readdir-recursive@^1.0.0: - version "1.1.0" - resolved "https://registry.yarnpkg.com/fs-readdir-recursive/-/fs-readdir-recursive-1.1.0.tgz#e32fc030a2ccee44a6b5371308da54be0b397d27" - - fs-write-stream-atomic@^1.0.8: - version "1.0.10" - resolved "https://registry.yarnpkg.com/fs-write-stream-atomic/-/fs-write-stream-atomic-1.0.10.tgz#b47df53493ef911df75731e70a9ded0189db40c9" - dependencies: - graceful-fs "^4.1.2" - iferr "^0.1.5" - imurmurhash "^0.1.4" - readable-stream "1 || 2" - - fs.realpath@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/fs.realpath/-/fs.realpath-1.0.0.tgz#1504ad2523158caa40db4a2787cb01411994ea4f" - - fsevents@^1.0.0: - version "1.1.3" - resolved "https://registry.yarnpkg.com/fsevents/-/fsevents-1.1.3.tgz#11f82318f5fe7bb2cd22965a108e9306208216d8" - dependencies: - nan "^2.3.0" - node-pre-gyp "^0.6.39" - - fstream-ignore@^1.0.5: - version "1.0.5" - resolved "https://registry.yarnpkg.com/fstream-ignore/-/fstream-ignore-1.0.5.tgz#9c31dae34767018fe1d249b24dada67d092da105" - dependencies: - fstream "^1.0.0" - inherits "2" - minimatch "^3.0.0" - - fstream@^1.0.0, fstream@^1.0.10, fstream@^1.0.2: - version "1.0.11" - resolved "https://registry.yarnpkg.com/fstream/-/fstream-1.0.11.tgz#5c1fb1f117477114f0632a0eb4b71b3cb0fd3171" - dependencies: - graceful-fs "^4.1.2" - inherits "~2.0.0" - mkdirp ">=0.5 0" - rimraf "2" - - function-bind@^1.0.2, function-bind@^1.1.1: - version "1.1.1" - resolved "https://registry.yarnpkg.com/function-bind/-/function-bind-1.1.1.tgz#a56899d3ea3c9bab874bb9773b7c5ede92f4895d" - - function-name-support@^0.2.0: - version "0.2.0" - resolved "https://registry.yarnpkg.com/function-name-support/-/function-name-support-0.2.0.tgz#55d3bfaa6eafd505a50f9bc81fdf57564a0bb071" - - functional-red-black-tree@^1.0.1: - version "1.0.1" - resolved "https://registry.yarnpkg.com/functional-red-black-tree/-/functional-red-black-tree-1.0.1.tgz#1b0ab3bd553b2a0d6399d29c0e3ea0b252078327" - - gauge@~2.7.3: - version "2.7.4" - resolved "https://registry.yarnpkg.com/gauge/-/gauge-2.7.4.tgz#2c03405c7538c39d7eb37b317022e325fb018bf7" - dependencies: - aproba "^1.0.3" - console-control-strings "^1.0.0" - has-unicode "^2.0.0" - object-assign "^4.1.0" - signal-exit "^3.0.0" - string-width "^1.0.1" - strip-ansi "^3.0.1" - wide-align "^1.1.0" - - gaze@~1.1.2: - version "1.1.2" - resolved "https://registry.yarnpkg.com/gaze/-/gaze-1.1.2.tgz#847224677adb8870d679257ed3388fdb61e40105" - dependencies: - globule "^1.0.0" - - get-caller-file@^1.0.1: - version "1.0.2" - resolved "https://registry.yarnpkg.com/get-caller-file/-/get-caller-file-1.0.2.tgz#f702e63127e7e231c160a80c1554acb70d5047e5" - - get-port@^3.0.0: - version "3.2.0" - resolved "https://registry.yarnpkg.com/get-port/-/get-port-3.2.0.tgz#dd7ce7de187c06c8bf353796ac71e099f0980ebc" - - get-stdin@^4.0.1: - version "4.0.1" - resolved "https://registry.yarnpkg.com/get-stdin/-/get-stdin-4.0.1.tgz#b968c6b0a04384324902e8bf1a5df32579a450fe" - - get-stdin@^5.0.1: - version "5.0.1" - resolved "https://registry.yarnpkg.com/get-stdin/-/get-stdin-5.0.1.tgz#122e161591e21ff4c52530305693f20e6393a398" - - get-stream@^3.0.0: - version "3.0.0" - resolved "https://registry.yarnpkg.com/get-stream/-/get-stream-3.0.0.tgz#8e943d1358dc37555054ecbe2edb05aa174ede14" - - getpass@^0.1.1: - version "0.1.7" - resolved "https://registry.yarnpkg.com/getpass/-/getpass-0.1.7.tgz#5eff8e3e684d569ae4cb2b1282604e8ba62149fa" - dependencies: - assert-plus "^1.0.0" - - glob-base@^0.3.0: - version "0.3.0" - resolved "https://registry.yarnpkg.com/glob-base/-/glob-base-0.3.0.tgz#dbb164f6221b1c0b1ccf82aea328b497df0ea3c4" - dependencies: - glob-parent "^2.0.0" - is-glob "^2.0.0" - - glob-parent@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/glob-parent/-/glob-parent-2.0.0.tgz#81383d72db054fcccf5336daa902f182f6edbb28" - dependencies: - is-glob "^2.0.0" - - glob@^7.0.0, glob@^7.0.3, glob@^7.0.5, glob@^7.1.2, glob@~7.1.1: - version "7.1.2" - resolved "https://registry.yarnpkg.com/glob/-/glob-7.1.2.tgz#c19c9df9a028702d678612384a6552404c636d15" - dependencies: - fs.realpath "^1.0.0" - inflight "^1.0.4" - inherits "2" - minimatch "^3.0.4" - once "^1.3.0" - path-is-absolute "^1.0.0" - - global-dirs@^0.1.0: - version "0.1.1" - resolved "https://registry.yarnpkg.com/global-dirs/-/global-dirs-0.1.1.tgz#b319c0dd4607f353f3be9cca4c72fc148c49f445" - dependencies: - ini "^1.3.4" - - globals@^9.17.0, globals@^9.18.0: - version "9.18.0" - resolved "https://registry.yarnpkg.com/globals/-/globals-9.18.0.tgz#aa3896b3e69b487f17e31ed2143d69a8e30c2d8a" - - globby@^5.0.0: - version "5.0.0" - resolved "https://registry.yarnpkg.com/globby/-/globby-5.0.0.tgz#ebd84667ca0dbb330b99bcfc68eac2bc54370e0d" - dependencies: - array-union "^1.0.1" - arrify "^1.0.0" - glob "^7.0.3" - object-assign "^4.0.1" - pify "^2.0.0" - pinkie-promise "^2.0.0" - - globby@^6.0.0: - version "6.1.0" - resolved "https://registry.yarnpkg.com/globby/-/globby-6.1.0.tgz#f5a6d70e8395e21c858fb0489d64df02424d506c" - dependencies: - array-union "^1.0.1" - glob "^7.0.3" - object-assign "^4.0.1" - pify "^2.0.0" - pinkie-promise "^2.0.0" - - globby@^7.1.1: - version "7.1.1" - resolved "https://registry.yarnpkg.com/globby/-/globby-7.1.1.tgz#fb2ccff9401f8600945dfada97440cca972b8680" - dependencies: - array-union "^1.0.1" - dir-glob "^2.0.0" - glob "^7.1.2" - ignore "^3.3.5" - pify "^3.0.0" - slash "^1.0.0" - - globule@^1.0.0: - version "1.2.0" - resolved "https://registry.yarnpkg.com/globule/-/globule-1.2.0.tgz#1dc49c6822dd9e8a2fa00ba2a295006e8664bd09" - dependencies: - glob "~7.1.1" - lodash "~4.17.4" - minimatch "~3.0.2" - - got@7.1.0: - version "7.1.0" - resolved "https://registry.yarnpkg.com/got/-/got-7.1.0.tgz#05450fd84094e6bbea56f451a43a9c289166385a" - dependencies: - decompress-response "^3.2.0" - duplexer3 "^0.1.4" - get-stream "^3.0.0" - is-plain-obj "^1.1.0" - is-retry-allowed "^1.0.0" - is-stream "^1.0.0" - isurl "^1.0.0-alpha5" - lowercase-keys "^1.0.0" - p-cancelable "^0.3.0" - p-timeout "^1.1.1" - safe-buffer "^5.0.1" - timed-out "^4.0.0" - url-parse-lax "^1.0.0" - url-to-options "^1.0.1" - - got@^6.7.1: - version "6.7.1" - resolved "https://registry.yarnpkg.com/got/-/got-6.7.1.tgz#240cd05785a9a18e561dc1b44b41c763ef1e8db0" - dependencies: - create-error-class "^3.0.0" - duplexer3 "^0.1.4" - get-stream "^3.0.0" - is-redirect "^1.0.0" - is-retry-allowed "^1.0.0" - is-stream "^1.0.0" - lowercase-keys "^1.0.0" - safe-buffer "^5.0.1" - timed-out "^4.0.0" - unzip-response "^2.0.1" - url-parse-lax "^1.0.0" - - graceful-fs@^4.1.0, graceful-fs@^4.1.11, graceful-fs@^4.1.2, graceful-fs@^4.1.4, graceful-fs@^4.1.6, graceful-fs@^4.1.9: - version "4.1.11" - resolved "https://registry.yarnpkg.com/graceful-fs/-/graceful-fs-4.1.11.tgz#0e8bdfe4d1ddb8854d64e04ea7c00e2a026e5658" - - har-schema@^1.0.5: - version "1.0.5" - resolved "https://registry.yarnpkg.com/har-schema/-/har-schema-1.0.5.tgz#d263135f43307c02c602afc8fe95970c0151369e" - - har-schema@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/har-schema/-/har-schema-2.0.0.tgz#a94c2224ebcac04782a0d9035521f24735b7ec92" - - har-validator@~4.2.1: - version "4.2.1" - resolved "https://registry.yarnpkg.com/har-validator/-/har-validator-4.2.1.tgz#33481d0f1bbff600dd203d75812a6a5fba002e2a" - dependencies: - ajv "^4.9.1" - har-schema "^1.0.5" - - har-validator@~5.0.3: - version "5.0.3" - resolved "https://registry.yarnpkg.com/har-validator/-/har-validator-5.0.3.tgz#ba402c266194f15956ef15e0fcf242993f6a7dfd" - dependencies: - ajv "^5.1.0" - har-schema "^2.0.0" - - has-ansi@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/has-ansi/-/has-ansi-2.0.0.tgz#34f5049ce1ecdf2b0649af3ef24e45ed35416d91" - dependencies: - ansi-regex "^2.0.0" - - has-color@~0.1.0: - version "0.1.7" - resolved "https://registry.yarnpkg.com/has-color/-/has-color-0.1.7.tgz#67144a5260c34fc3cca677d041daf52fe7b78b2f" - - has-flag@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/has-flag/-/has-flag-1.0.0.tgz#9d9e793165ce017a00f00418c43f942a7b1d11fa" - - has-flag@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/has-flag/-/has-flag-2.0.0.tgz#e8207af1cc7b30d446cc70b734b5e8be18f88d51" - - has-flag@^3.0.0: - version "3.0.0" - resolved "https://registry.yarnpkg.com/has-flag/-/has-flag-3.0.0.tgz#b5d454dc2199ae225699f3467e5a07f3b955bafd" - - has-symbol-support-x@^1.4.1: - version "1.4.1" - resolved "https://registry.yarnpkg.com/has-symbol-support-x/-/has-symbol-support-x-1.4.1.tgz#66ec2e377e0c7d7ccedb07a3a84d77510ff1bc4c" - - has-to-string-tag-x@^1.2.0: - version "1.4.1" - resolved "https://registry.yarnpkg.com/has-to-string-tag-x/-/has-to-string-tag-x-1.4.1.tgz#a045ab383d7b4b2012a00148ab0aa5f290044d4d" - dependencies: - has-symbol-support-x "^1.4.1" - - has-unicode@^2.0.0: - version "2.0.1" - resolved "https://registry.yarnpkg.com/has-unicode/-/has-unicode-2.0.1.tgz#e0e6fe6a28cf51138855e086d1691e771de2a8b9" - - has-yarn@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/has-yarn/-/has-yarn-1.0.0.tgz#89e25db604b725c8f5976fff0addc921b828a5a7" - - has@^1.0.1: - version "1.0.1" - resolved "https://registry.yarnpkg.com/has/-/has-1.0.1.tgz#8461733f538b0837c9361e39a9ab9e9704dc2f28" - dependencies: - function-bind "^1.0.2" - - hash-base@^2.0.0: - version "2.0.2" - resolved "https://registry.yarnpkg.com/hash-base/-/hash-base-2.0.2.tgz#66ea1d856db4e8a5470cadf6fce23ae5244ef2e1" - dependencies: - inherits "^2.0.1" - - hash-base@^3.0.0: - version "3.0.4" - resolved "https://registry.yarnpkg.com/hash-base/-/hash-base-3.0.4.tgz#5fc8686847ecd73499403319a6b0a3f3f6ae4918" - dependencies: - inherits "^2.0.1" - safe-buffer "^5.0.1" - - hash.js@^1.0.0, hash.js@^1.0.3: - version "1.1.3" - resolved "https://registry.yarnpkg.com/hash.js/-/hash.js-1.1.3.tgz#340dedbe6290187151c1ea1d777a3448935df846" - dependencies: - inherits "^2.0.3" - minimalistic-assert "^1.0.0" - - hawk@3.1.3, hawk@~3.1.3: - version "3.1.3" - resolved "https://registry.yarnpkg.com/hawk/-/hawk-3.1.3.tgz#078444bd7c1640b0fe540d2c9b73d59678e8e1c4" - dependencies: - boom "2.x.x" - cryptiles "2.x.x" - hoek "2.x.x" - sntp "1.x.x" - - hawk@~6.0.2: - version "6.0.2" - resolved "https://registry.yarnpkg.com/hawk/-/hawk-6.0.2.tgz#af4d914eb065f9b5ce4d9d11c1cb2126eecc3038" - dependencies: - boom "4.x.x" - cryptiles "3.x.x" - hoek "4.x.x" - sntp "2.x.x" - - hmac-drbg@^1.0.0: - version "1.0.1" - resolved "https://registry.yarnpkg.com/hmac-drbg/-/hmac-drbg-1.0.1.tgz#d2745701025a6c775a6c545793ed502fc0c649a1" - dependencies: - hash.js "^1.0.3" - minimalistic-assert "^1.0.0" - minimalistic-crypto-utils "^1.0.1" - - hoek@2.x.x: - version "2.16.3" - resolved "https://registry.yarnpkg.com/hoek/-/hoek-2.16.3.tgz#20bb7403d3cea398e91dc4710a8ff1b8274a25ed" - - hoek@4.x.x: - version "4.2.1" - resolved "https://registry.yarnpkg.com/hoek/-/hoek-4.2.1.tgz#9634502aa12c445dd5a7c5734b572bb8738aacbb" - - hoist-non-react-statics@^2.5.0: - version "2.5.0" - resolved "https://registry.yarnpkg.com/hoist-non-react-statics/-/hoist-non-react-statics-2.5.0.tgz#d2ca2dfc19c5a91c5a6615ce8e564ef0347e2a40" - - home-or-tmp@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/home-or-tmp/-/home-or-tmp-2.0.0.tgz#e36c3f2d2cae7d746a857e38d18d5f32a7882db8" - dependencies: - os-homedir "^1.0.0" - os-tmpdir "^1.0.1" - - home-path@^1.0.1: - version "1.0.5" - resolved "https://registry.yarnpkg.com/home-path/-/home-path-1.0.5.tgz#788b29815b12d53bacf575648476e6f9041d133f" - - hosted-git-info@^2.1.4: - version "2.5.0" - resolved "https://registry.yarnpkg.com/hosted-git-info/-/hosted-git-info-2.5.0.tgz#6d60e34b3abbc8313062c3b798ef8d901a07af3c" - - hosted-git-info@^2.6.0: - version "2.6.0" - resolved "https://registry.yarnpkg.com/hosted-git-info/-/hosted-git-info-2.6.0.tgz#23235b29ab230c576aab0d4f13fc046b0b038222" - - html-comment-regex@^1.1.0: - version "1.1.1" - resolved "https://registry.yarnpkg.com/html-comment-regex/-/html-comment-regex-1.1.1.tgz#668b93776eaae55ebde8f3ad464b307a4963625e" - - http-signature@~1.1.0: - version "1.1.1" - resolved "https://registry.yarnpkg.com/http-signature/-/http-signature-1.1.1.tgz#df72e267066cd0ac67fb76adf8e134a8fbcf91bf" - dependencies: - assert-plus "^0.2.0" - jsprim "^1.2.2" - sshpk "^1.7.0" - - http-signature@~1.2.0: - version "1.2.0" - resolved "https://registry.yarnpkg.com/http-signature/-/http-signature-1.2.0.tgz#9aecd925114772f3d95b65a60abb8f7c18fbace1" - dependencies: - assert-plus "^1.0.0" - jsprim "^1.2.2" - sshpk "^1.7.0" - - https-browserify@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/https-browserify/-/https-browserify-1.0.0.tgz#ec06c10e0a34c0f2faf199f7fd7fc78fffd03c73" - - hullabaloo-config-manager@^1.1.0: - version "1.1.1" - resolved "https://registry.yarnpkg.com/hullabaloo-config-manager/-/hullabaloo-config-manager-1.1.1.tgz#1d9117813129ad035fd9e8477eaf066911269fe3" - dependencies: - dot-prop "^4.1.0" - es6-error "^4.0.2" - graceful-fs "^4.1.11" - indent-string "^3.1.0" - json5 "^0.5.1" - lodash.clonedeep "^4.5.0" - lodash.clonedeepwith "^4.5.0" - lodash.isequal "^4.5.0" - lodash.merge "^4.6.0" - md5-hex "^2.0.0" - package-hash "^2.0.0" - pkg-dir "^2.0.0" - resolve-from "^3.0.0" - safe-buffer "^5.0.1" - - husky@0.14.3: - version "0.14.3" - resolved "https://registry.yarnpkg.com/husky/-/husky-0.14.3.tgz#c69ed74e2d2779769a17ba8399b54ce0b63c12c3" - dependencies: - is-ci "^1.0.10" - normalize-path "^1.0.0" - strip-indent "^2.0.0" - - iconv-lite@^0.4.17, iconv-lite@^0.4.19, iconv-lite@~0.4.13: - version "0.4.19" - resolved "https://registry.yarnpkg.com/iconv-lite/-/iconv-lite-0.4.19.tgz#f7468f60135f5e5dad3399c0a81be9a1603a082b" - - icss-replace-symbols@^1.1.0: - version "1.1.0" - resolved "https://registry.yarnpkg.com/icss-replace-symbols/-/icss-replace-symbols-1.1.0.tgz#06ea6f83679a7749e386cfe1fe812ae5db223ded" - - icss-utils@^2.1.0: - version "2.1.0" - resolved "https://registry.yarnpkg.com/icss-utils/-/icss-utils-2.1.0.tgz#83f0a0ec378bf3246178b6c2ad9136f135b1c962" - dependencies: - postcss "^6.0.1" - - ieee754@^1.1.4: - version "1.1.8" - resolved "https://registry.yarnpkg.com/ieee754/-/ieee754-1.1.8.tgz#be33d40ac10ef1926701f6f08a2d86fbfd1ad3e4" - - iferr@^0.1.5: - version "0.1.5" - resolved "https://registry.yarnpkg.com/iferr/-/iferr-0.1.5.tgz#c60eed69e6d8fdb6b3104a1fcbca1c192dc5b501" - - ignore-by-default@^1.0.0: - version "1.0.1" - resolved "https://registry.yarnpkg.com/ignore-by-default/-/ignore-by-default-1.0.1.tgz#48ca6d72f6c6a3af00a9ad4ae6876be3889e2b09" - - ignore@^3.3.3, ignore@^3.3.5: - version "3.3.7" - resolved "https://registry.yarnpkg.com/ignore/-/ignore-3.3.7.tgz#612289bfb3c220e186a58118618d5be8c1bab021" - - import-lazy@^2.1.0: - version "2.1.0" - resolved "https://registry.yarnpkg.com/import-lazy/-/import-lazy-2.1.0.tgz#05698e3d45c88e8d7e9d92cb0584e77f096f3e43" - - import-local@^0.1.1: - version "0.1.1" - resolved "https://registry.yarnpkg.com/import-local/-/import-local-0.1.1.tgz#b1179572aacdc11c6a91009fb430dbcab5f668a8" - dependencies: - pkg-dir "^2.0.0" - resolve-cwd "^2.0.0" - - imurmurhash@^0.1.4: - version "0.1.4" - resolved "https://registry.yarnpkg.com/imurmurhash/-/imurmurhash-0.1.4.tgz#9218b9b2b928a238b13dc4fb6b6d576f231453ea" - - indent-string@^2.1.0: - version "2.1.0" - resolved "https://registry.yarnpkg.com/indent-string/-/indent-string-2.1.0.tgz#8e2d48348742121b4a8218b7a137e9a52049dc80" - dependencies: - repeating "^2.0.0" - - indent-string@^3.0.0, indent-string@^3.1.0, indent-string@^3.2.0: - version "3.2.0" - resolved "https://registry.yarnpkg.com/indent-string/-/indent-string-3.2.0.tgz#4a5fd6d27cc332f37e5419a504dbb837105c9289" - - indexes-of@^1.0.1: - version "1.0.1" - resolved "https://registry.yarnpkg.com/indexes-of/-/indexes-of-1.0.1.tgz#f30f716c8e2bd346c7b67d3df3915566a7c05607" - - indexof@0.0.1: - version "0.0.1" - resolved "https://registry.yarnpkg.com/indexof/-/indexof-0.0.1.tgz#82dc336d232b9062179d05ab3293a66059fd435d" - - inflight@^1.0.4: - version "1.0.6" - resolved "https://registry.yarnpkg.com/inflight/-/inflight-1.0.6.tgz#49bd6331d7d02d0c09bc910a1075ba8165b56df9" - dependencies: - once "^1.3.0" - wrappy "1" - - inherits@2, inherits@^2.0.1, inherits@^2.0.3, inherits@~2.0.0, inherits@~2.0.1, inherits@~2.0.3: - version "2.0.3" - resolved "https://registry.yarnpkg.com/inherits/-/inherits-2.0.3.tgz#633c2c83e3da42a502f52466022480f4208261de" - - inherits@2.0.1: - version "2.0.1" - resolved "https://registry.yarnpkg.com/inherits/-/inherits-2.0.1.tgz#b17d08d326b4423e568eff719f91b0b1cbdf69f1" - - ini@^1.3.4, ini@~1.3.0: - version "1.3.5" - resolved "https://registry.yarnpkg.com/ini/-/ini-1.3.5.tgz#eee25f56db1c9ec6085e0c22778083f596abf927" - - inquirer@5.1.0: - version "5.1.0" - resolved "https://registry.yarnpkg.com/inquirer/-/inquirer-5.1.0.tgz#19da508931892328abbbdd4c477f1efc65abfd67" - dependencies: - ansi-escapes "^3.0.0" - chalk "^2.0.0" - cli-cursor "^2.1.0" - cli-width "^2.0.0" - external-editor "^2.1.0" - figures "^2.0.0" - lodash "^4.3.0" - mute-stream "0.0.7" - run-async "^2.2.0" - rxjs "^5.5.2" - string-width "^2.1.0" - strip-ansi "^4.0.0" - through "^2.3.6" - - inquirer@^3.0.6, inquirer@~3.3.0: - version "3.3.0" - resolved "https://registry.yarnpkg.com/inquirer/-/inquirer-3.3.0.tgz#9dd2f2ad765dcab1ff0443b491442a20ba227dc9" - dependencies: - ansi-escapes "^3.0.0" - chalk "^2.0.0" - cli-cursor "^2.1.0" - cli-width "^2.0.0" - external-editor "^2.0.4" - figures "^2.0.0" - lodash "^4.3.0" - mute-stream "0.0.7" - run-async "^2.2.0" - rx-lite "^4.0.8" - rx-lite-aggregates "^4.0.8" - string-width "^2.1.0" - strip-ansi "^4.0.0" - through "^2.3.6" - - interpret@^1.0.0: - version "1.1.0" - resolved "https://registry.yarnpkg.com/interpret/-/interpret-1.1.0.tgz#7ed1b1410c6a0e0f78cf95d3b8440c63f78b8614" - - invariant@^2.0.0, invariant@^2.2.2: - version "2.2.3" - resolved "https://registry.yarnpkg.com/invariant/-/invariant-2.2.3.tgz#1a827dfde7dcbd7c323f0ca826be8fa7c5e9d688" - dependencies: - loose-envify "^1.0.0" - - invert-kv@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/invert-kv/-/invert-kv-1.0.0.tgz#104a8e4aaca6d3d8cd157a8ef8bfab2d7a3ffdb6" - - irregular-plurals@^1.0.0: - version "1.4.0" - resolved "https://registry.yarnpkg.com/irregular-plurals/-/irregular-plurals-1.4.0.tgz#2ca9b033651111855412f16be5d77c62a458a766" - - is-absolute-url@^2.0.0: - version "2.1.0" - resolved "https://registry.yarnpkg.com/is-absolute-url/-/is-absolute-url-2.1.0.tgz#50530dfb84fcc9aa7dbe7852e83a37b93b9f2aa6" - - is-arrayish@^0.2.1: - version "0.2.1" - resolved "https://registry.yarnpkg.com/is-arrayish/-/is-arrayish-0.2.1.tgz#77c99840527aa8ecb1a8ba697b80645a7a926a9d" - - is-arrayish@^0.3.1: - version "0.3.1" - resolved "https://registry.yarnpkg.com/is-arrayish/-/is-arrayish-0.3.1.tgz#c2dfc386abaa0c3e33c48db3fe87059e69065efd" - - is-binary-path@^1.0.0: - version "1.0.1" - resolved "https://registry.yarnpkg.com/is-binary-path/-/is-binary-path-1.0.1.tgz#75f16642b480f187a711c814161fd3a4a7655898" - dependencies: - binary-extensions "^1.0.0" - - is-buffer@^1.1.5: - version "1.1.6" - resolved "https://registry.yarnpkg.com/is-buffer/-/is-buffer-1.1.6.tgz#efaa2ea9daa0d7ab2ea13a97b2b8ad51fefbe8be" - - is-builtin-module@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/is-builtin-module/-/is-builtin-module-1.0.0.tgz#540572d34f7ac3119f8f76c30cbc1b1e037affbe" - dependencies: - builtin-modules "^1.0.0" - - is-callable@^1.1.1, is-callable@^1.1.3: - version "1.1.3" - resolved "https://registry.yarnpkg.com/is-callable/-/is-callable-1.1.3.tgz#86eb75392805ddc33af71c92a0eedf74ee7604b2" - - is-ci@^1.0.10, is-ci@^1.0.7, is-ci@^1.1.0: - version "1.1.0" - resolved "https://registry.yarnpkg.com/is-ci/-/is-ci-1.1.0.tgz#247e4162e7860cebbdaf30b774d6b0ac7dcfe7a5" - dependencies: - ci-info "^1.0.0" - - is-date-object@^1.0.1: - version "1.0.1" - resolved "https://registry.yarnpkg.com/is-date-object/-/is-date-object-1.0.1.tgz#9aa20eb6aeebbff77fbd33e74ca01b33581d3a16" - - is-dotfile@^1.0.0: - version "1.0.3" - resolved "https://registry.yarnpkg.com/is-dotfile/-/is-dotfile-1.0.3.tgz#a6a2f32ffd2dfb04f5ca25ecd0f6b83cf798a1e1" - - is-equal-shallow@^0.1.3: - version "0.1.3" - resolved "https://registry.yarnpkg.com/is-equal-shallow/-/is-equal-shallow-0.1.3.tgz#2238098fc221de0bcfa5d9eac4c45d638aa1c534" - dependencies: - is-primitive "^2.0.0" - - is-error@^2.2.0: - version "2.2.1" - resolved "https://registry.yarnpkg.com/is-error/-/is-error-2.2.1.tgz#684a96d84076577c98f4cdb40c6d26a5123bf19c" - - is-extendable@^0.1.1: - version "0.1.1" - resolved "https://registry.yarnpkg.com/is-extendable/-/is-extendable-0.1.1.tgz#62b110e289a471418e3ec36a617d472e301dfc89" - - is-extglob@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/is-extglob/-/is-extglob-1.0.0.tgz#ac468177c4943405a092fc8f29760c6ffc6206c0" - - is-extglob@^2.1.1: - version "2.1.1" - resolved "https://registry.yarnpkg.com/is-extglob/-/is-extglob-2.1.1.tgz#a88c02535791f02ed37c76a1b9ea9773c833f8c2" - - is-finite@^1.0.0: - version "1.0.2" - resolved "https://registry.yarnpkg.com/is-finite/-/is-finite-1.0.2.tgz#cc6677695602be550ef11e8b4aa6305342b6d0aa" - dependencies: - number-is-nan "^1.0.0" - - is-fullwidth-code-point@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/is-fullwidth-code-point/-/is-fullwidth-code-point-1.0.0.tgz#ef9e31386f031a7f0d643af82fde50c457ef00cb" - dependencies: - number-is-nan "^1.0.0" - - is-fullwidth-code-point@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/is-fullwidth-code-point/-/is-fullwidth-code-point-2.0.0.tgz#a3b30a5c4f199183167aaab93beefae3ddfb654f" - - is-generator-fn@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/is-generator-fn/-/is-generator-fn-1.0.0.tgz#969d49e1bb3329f6bb7f09089be26578b2ddd46a" - - is-glob@^2.0.0, is-glob@^2.0.1: - version "2.0.1" - resolved "https://registry.yarnpkg.com/is-glob/-/is-glob-2.0.1.tgz#d096f926a3ded5600f3fdfd91198cb0888c2d863" - dependencies: - is-extglob "^1.0.0" - - is-glob@^4.0.0: - version "4.0.0" - resolved "https://registry.yarnpkg.com/is-glob/-/is-glob-4.0.0.tgz#9521c76845cc2610a85203ddf080a958c2ffabc0" - dependencies: - is-extglob "^2.1.1" - - is-installed-globally@^0.1.0: - version "0.1.0" - resolved "https://registry.yarnpkg.com/is-installed-globally/-/is-installed-globally-0.1.0.tgz#0dfd98f5a9111716dd535dda6492f67bf3d25a80" - dependencies: - global-dirs "^0.1.0" - is-path-inside "^1.0.0" - - is-npm@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/is-npm/-/is-npm-1.0.0.tgz#f2fb63a65e4905b406c86072765a1a4dc793b9f4" - - is-number@^2.1.0: - version "2.1.0" - resolved "https://registry.yarnpkg.com/is-number/-/is-number-2.1.0.tgz#01fcbbb393463a548f2f466cce16dece49db908f" - dependencies: - kind-of "^3.0.2" - - is-number@^3.0.0: - version "3.0.0" - resolved "https://registry.yarnpkg.com/is-number/-/is-number-3.0.0.tgz#24fd6201a4782cf50561c810276afc7d12d71195" - dependencies: - kind-of "^3.0.2" - - is-obj@^1.0.0: - version "1.0.1" - resolved "https://registry.yarnpkg.com/is-obj/-/is-obj-1.0.1.tgz#3e4729ac1f5fde025cd7d83a896dab9f4f67db0f" - - is-object@^1.0.1, is-object@~1.0.1: - version "1.0.1" - resolved "https://registry.yarnpkg.com/is-object/-/is-object-1.0.1.tgz#8952688c5ec2ffd6b03ecc85e769e02903083470" - - is-observable@^0.2.0: - version "0.2.0" - resolved "https://registry.yarnpkg.com/is-observable/-/is-observable-0.2.0.tgz#b361311d83c6e5d726cabf5e250b0237106f5ae2" - dependencies: - symbol-observable "^0.2.2" - - is-observable@^1.0.0: - version "1.1.0" - resolved "https://registry.yarnpkg.com/is-observable/-/is-observable-1.1.0.tgz#b3e986c8f44de950867cab5403f5a3465005975e" - dependencies: - symbol-observable "^1.1.0" - - is-path-cwd@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/is-path-cwd/-/is-path-cwd-1.0.0.tgz#d225ec23132e89edd38fda767472e62e65f1106d" - - is-path-in-cwd@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/is-path-in-cwd/-/is-path-in-cwd-1.0.0.tgz#6477582b8214d602346094567003be8a9eac04dc" - dependencies: - is-path-inside "^1.0.0" - - is-path-inside@^1.0.0: - version "1.0.1" - resolved "https://registry.yarnpkg.com/is-path-inside/-/is-path-inside-1.0.1.tgz#8ef5b7de50437a3fdca6b4e865ef7aa55cb48036" - dependencies: - path-is-inside "^1.0.1" - - is-plain-obj@^1.0.0, is-plain-obj@^1.1.0: - version "1.1.0" - resolved "https://registry.yarnpkg.com/is-plain-obj/-/is-plain-obj-1.1.0.tgz#71a50c8429dfca773c92a390a4a03b39fcd51d3e" - - is-posix-bracket@^0.1.0: - version "0.1.1" - resolved "https://registry.yarnpkg.com/is-posix-bracket/-/is-posix-bracket-0.1.1.tgz#3334dc79774368e92f016e6fbc0a88f5cd6e6bc4" - - is-primitive@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/is-primitive/-/is-primitive-2.0.0.tgz#207bab91638499c07b2adf240a41a87210034575" - - is-promise@^2.1.0: - version "2.1.0" - resolved "https://registry.yarnpkg.com/is-promise/-/is-promise-2.1.0.tgz#79a2a9ece7f096e80f36d2b2f3bc16c1ff4bf3fa" - - is-redirect@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/is-redirect/-/is-redirect-1.0.0.tgz#1d03dded53bd8db0f30c26e4f95d36fc7c87dc24" - - is-regex@^1.0.4: - version "1.0.4" - resolved "https://registry.yarnpkg.com/is-regex/-/is-regex-1.0.4.tgz#5517489b547091b0930e095654ced25ee97e9491" - dependencies: - has "^1.0.1" - - is-resolvable@^1.0.0: - version "1.1.0" - resolved "https://registry.yarnpkg.com/is-resolvable/-/is-resolvable-1.1.0.tgz#fb18f87ce1feb925169c9a407c19318a3206ed88" - - is-retry-allowed@^1.0.0: - version "1.1.0" - resolved "https://registry.yarnpkg.com/is-retry-allowed/-/is-retry-allowed-1.1.0.tgz#11a060568b67339444033d0125a61a20d564fb34" - - is-ssh@^1.3.0: - version "1.3.0" - resolved "https://registry.yarnpkg.com/is-ssh/-/is-ssh-1.3.0.tgz#ebea1169a2614da392a63740366c3ce049d8dff6" - dependencies: - protocols "^1.1.0" - - is-stream@^1.0.0, is-stream@^1.0.1, is-stream@^1.1.0: - version "1.1.0" - resolved "https://registry.yarnpkg.com/is-stream/-/is-stream-1.1.0.tgz#12d4a3dd4e68e0b79ceb8dbc84173ae80d91ca44" - - is-svg@^2.0.0: - version "2.1.0" - resolved "https://registry.yarnpkg.com/is-svg/-/is-svg-2.1.0.tgz#cf61090da0d9efbcab8722deba6f032208dbb0e9" - dependencies: - html-comment-regex "^1.1.0" - - is-symbol@^1.0.1: - version "1.0.1" - resolved "https://registry.yarnpkg.com/is-symbol/-/is-symbol-1.0.1.tgz#3cc59f00025194b6ab2e38dbae6689256b660572" - - is-typedarray@~1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/is-typedarray/-/is-typedarray-1.0.0.tgz#e479c80858df0c1b11ddda6940f96011fcda4a9a" - - is-url@^1.2.1: - version "1.2.2" - resolved "https://registry.yarnpkg.com/is-url/-/is-url-1.2.2.tgz#498905a593bf47cc2d9e7f738372bbf7696c7f26" - - is-utf8@^0.2.0, is-utf8@^0.2.1: - version "0.2.1" - resolved "https://registry.yarnpkg.com/is-utf8/-/is-utf8-0.2.1.tgz#4b0da1442104d1b336340e80797e865cf39f7d72" - - is-windows@^1.0.0: - version "1.0.2" - resolved "https://registry.yarnpkg.com/is-windows/-/is-windows-1.0.2.tgz#d1850eb9791ecd18e6182ce12a30f396634bb19d" - - is-wsl@^1.1.0: - version "1.1.0" - resolved "https://registry.yarnpkg.com/is-wsl/-/is-wsl-1.1.0.tgz#1f16e4aa22b04d1336b66188a66af3c600c3a66d" - - isarray@0.0.1: - version "0.0.1" - resolved "https://registry.yarnpkg.com/isarray/-/isarray-0.0.1.tgz#8a18acfca9a8f4177e09abfc6038939b05d1eedf" - - isarray@1.0.0, isarray@^1.0.0, isarray@~1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/isarray/-/isarray-1.0.0.tgz#bb935d48582cba168c06834957a54a3e07124f11" - - isbinaryfile@^3.0.2: - version "3.0.2" - resolved "https://registry.yarnpkg.com/isbinaryfile/-/isbinaryfile-3.0.2.tgz#4a3e974ec0cba9004d3fc6cde7209ea69368a621" - - isexe@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/isexe/-/isexe-2.0.0.tgz#e8fbf374dc556ff8947a10dcb0572d633f2cfa10" - - isobject@^2.0.0: - version "2.1.0" - resolved "https://registry.yarnpkg.com/isobject/-/isobject-2.1.0.tgz#f065561096a3f1da2ef46272f815c840d87e0c89" - dependencies: - isarray "1.0.0" - - isomorphic-fetch@^2.1.1: - version "2.2.1" - resolved "https://registry.yarnpkg.com/isomorphic-fetch/-/isomorphic-fetch-2.2.1.tgz#611ae1acf14f5e81f729507472819fe9733558a9" - dependencies: - node-fetch "^1.0.1" - whatwg-fetch ">=0.10.0" - - isstream@~0.1.2: - version "0.1.2" - resolved "https://registry.yarnpkg.com/isstream/-/isstream-0.1.2.tgz#47e63f7af55afa6f92e1500e690eb8b8529c099a" - - isurl@^1.0.0-alpha5: - version "1.0.0" - resolved "https://registry.yarnpkg.com/isurl/-/isurl-1.0.0.tgz#b27f4f49f3cdaa3ea44a0a5b7f3462e6edc39d67" - dependencies: - has-to-string-tag-x "^1.2.0" - is-object "^1.0.1" - - jest-docblock@^21.0.0: - version "21.2.0" - resolved "https://registry.yarnpkg.com/jest-docblock/-/jest-docblock-21.2.0.tgz#51529c3b30d5fd159da60c27ceedc195faf8d414" - - js-base64@^2.1.9: - version "2.4.3" - resolved "https://registry.yarnpkg.com/js-base64/-/js-base64-2.4.3.tgz#2e545ec2b0f2957f41356510205214e98fad6582" - - js-string-escape@^1.0.1: - version "1.0.1" - resolved "https://registry.yarnpkg.com/js-string-escape/-/js-string-escape-1.0.1.tgz#e2625badbc0d67c7533e9edc1068c587ae4137ef" - - js-tokens@^3.0.0, js-tokens@^3.0.2: - version "3.0.2" - resolved "https://registry.yarnpkg.com/js-tokens/-/js-tokens-3.0.2.tgz#9866df395102130e38f7f996bceb65443209c25b" - - js-yaml@^3.10.0, js-yaml@^3.9.1: - version "3.10.0" - resolved "https://registry.yarnpkg.com/js-yaml/-/js-yaml-3.10.0.tgz#2e78441646bd4682e963f22b6e92823c309c62dc" - dependencies: - argparse "^1.0.7" - esprima "^4.0.0" - - js-yaml@^3.11.0: - version "3.11.0" - resolved "https://registry.yarnpkg.com/js-yaml/-/js-yaml-3.11.0.tgz#597c1a8bd57152f26d622ce4117851a51f5ebaef" - dependencies: - argparse "^1.0.7" - esprima "^4.0.0" - - js-yaml@~3.7.0: - version "3.7.0" - resolved "https://registry.yarnpkg.com/js-yaml/-/js-yaml-3.7.0.tgz#5c967ddd837a9bfdca5f2de84253abe8a1c03b80" - dependencies: - argparse "^1.0.7" - esprima "^2.6.0" - - jsbn@~0.1.0: - version "0.1.1" - resolved "https://registry.yarnpkg.com/jsbn/-/jsbn-0.1.1.tgz#a5e654c2e5a2deb5f201d96cefbca80c0ef2f513" - - jsesc@^1.3.0: - version "1.3.0" - resolved "https://registry.yarnpkg.com/jsesc/-/jsesc-1.3.0.tgz#46c3fec8c1892b12b0833db9bc7622176dbab34b" - - jsesc@~0.5.0: - version "0.5.0" - resolved "https://registry.yarnpkg.com/jsesc/-/jsesc-0.5.0.tgz#e7dee66e35d6fc16f710fe91d5cf69f70f08911d" - - json-loader@0.5.7, json-loader@^0.5.4: - version "0.5.7" - resolved "https://registry.yarnpkg.com/json-loader/-/json-loader-0.5.7.tgz#dca14a70235ff82f0ac9a3abeb60d337a365185d" - - json-parse-better-errors@^1.0.1: - version "1.0.1" - resolved "https://registry.yarnpkg.com/json-parse-better-errors/-/json-parse-better-errors-1.0.1.tgz#50183cd1b2d25275de069e9e71b467ac9eab973a" - - json-schema-traverse@^0.3.0: - version "0.3.1" - resolved "https://registry.yarnpkg.com/json-schema-traverse/-/json-schema-traverse-0.3.1.tgz#349a6d44c53a51de89b40805c5d5e59b417d3340" - - json-schema@0.2.3: - version "0.2.3" - resolved "https://registry.yarnpkg.com/json-schema/-/json-schema-0.2.3.tgz#b480c892e59a2f05954ce727bd3f2a4e882f9e13" - - json-stable-stringify@^1.0.1: - version "1.0.1" - resolved "https://registry.yarnpkg.com/json-stable-stringify/-/json-stable-stringify-1.0.1.tgz#9a759d39c5f2ff503fd5300646ed445f88c4f9af" - dependencies: - jsonify "~0.0.0" - - json-stringify-safe@~5.0.1: - version "5.0.1" - resolved "https://registry.yarnpkg.com/json-stringify-safe/-/json-stringify-safe-5.0.1.tgz#1296a2d58fd45f19a0f6ce01d65701e2c735b6eb" - - json5@^0.5.0, json5@^0.5.1: - version "0.5.1" - resolved "https://registry.yarnpkg.com/json5/-/json5-0.5.1.tgz#1eade7acc012034ad84e2396767ead9fa5495821" - - jsonfile@^2.1.0: - version "2.4.0" - resolved "https://registry.yarnpkg.com/jsonfile/-/jsonfile-2.4.0.tgz#3736a2b428b87bbda0cc83b53fa3d633a35c2ae8" - optionalDependencies: - graceful-fs "^4.1.6" - - jsonfile@^3.0.0: - version "3.0.1" - resolved "https://registry.yarnpkg.com/jsonfile/-/jsonfile-3.0.1.tgz#a5ecc6f65f53f662c4415c7675a0331d0992ec66" - optionalDependencies: - graceful-fs "^4.1.6" - - jsonfile@^4.0.0: - version "4.0.0" - resolved "https://registry.yarnpkg.com/jsonfile/-/jsonfile-4.0.0.tgz#8771aae0799b64076b76640fca058f9c10e33ecb" - optionalDependencies: - graceful-fs "^4.1.6" - - jsonify@~0.0.0: - version "0.0.0" - resolved "https://registry.yarnpkg.com/jsonify/-/jsonify-0.0.0.tgz#2c74b6ee41d93ca51b7b5aaee8f503631d252a73" - - jsprim@^1.2.2: - version "1.4.1" - resolved "https://registry.yarnpkg.com/jsprim/-/jsprim-1.4.1.tgz#313e66bc1e5cc06e438bc1b7499c2e5c56acb6a2" - dependencies: - assert-plus "1.0.0" - extsprintf "1.3.0" - json-schema "0.2.3" - verror "1.10.0" - - jsx-ast-utils@^2.0.0: - version "2.0.1" - resolved "https://registry.yarnpkg.com/jsx-ast-utils/-/jsx-ast-utils-2.0.1.tgz#e801b1b39985e20fffc87b40e3748080e2dcac7f" - dependencies: - array-includes "^3.0.3" - - kind-of@^3.0.2: - version "3.2.2" - resolved "https://registry.yarnpkg.com/kind-of/-/kind-of-3.2.2.tgz#31ea21a734bab9bbb0f32466d893aea51e4a3c64" - dependencies: - is-buffer "^1.1.5" - - kind-of@^4.0.0: - version "4.0.0" - resolved "https://registry.yarnpkg.com/kind-of/-/kind-of-4.0.0.tgz#20813df3d712928b207378691a45066fae72dd57" - dependencies: - is-buffer "^1.1.5" - - klaw@^1.0.0: - version "1.3.1" - resolved "https://registry.yarnpkg.com/klaw/-/klaw-1.3.1.tgz#4088433b46b3b1ba259d78785d8e96f73ba02439" - optionalDependencies: - graceful-fs "^4.1.9" - - last-line-stream@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/last-line-stream/-/last-line-stream-1.0.0.tgz#d1b64d69f86ff24af2d04883a2ceee14520a5600" - dependencies: - through2 "^2.0.0" - - latest-version@^3.0.0: - version "3.1.0" - resolved "https://registry.yarnpkg.com/latest-version/-/latest-version-3.1.0.tgz#a205383fea322b33b5ae3b18abee0dc2f356ee15" - dependencies: - package-json "^4.0.0" - - lazy-cache@^1.0.3: - version "1.0.4" - resolved "https://registry.yarnpkg.com/lazy-cache/-/lazy-cache-1.0.4.tgz#a1d78fc3a50474cb80845d3b3b6e1da49a446e8e" - - lazy-val@^1.0.3: - version "1.0.3" - resolved "https://registry.yarnpkg.com/lazy-val/-/lazy-val-1.0.3.tgz#bb97b200ef00801d94c317e29dc6ed39e31c5edc" - - lazystream@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/lazystream/-/lazystream-1.0.0.tgz#f6995fe0f820392f61396be89462407bb77168e4" - dependencies: - readable-stream "^2.0.5" - - lcid@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/lcid/-/lcid-1.0.0.tgz#308accafa0bc483a3867b4b6f2b9506251d1b835" - dependencies: - invert-kv "^1.0.0" - - levn@^0.3.0, levn@~0.3.0: - version "0.3.0" - resolved "https://registry.yarnpkg.com/levn/-/levn-0.3.0.tgz#3b09924edf9f083c0490fdd4c0bc4421e04764ee" - dependencies: - prelude-ls "~1.1.2" - type-check "~0.3.2" - - load-json-file@^1.0.0: - version "1.1.0" - resolved "https://registry.yarnpkg.com/load-json-file/-/load-json-file-1.1.0.tgz#956905708d58b4bab4c2261b04f59f31c99374c0" - dependencies: - graceful-fs "^4.1.2" - parse-json "^2.2.0" - pify "^2.0.0" - pinkie-promise "^2.0.0" - strip-bom "^2.0.0" - - load-json-file@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/load-json-file/-/load-json-file-2.0.0.tgz#7947e42149af80d696cbf797bcaabcfe1fe29ca8" - dependencies: - graceful-fs "^4.1.2" - parse-json "^2.2.0" - pify "^2.0.0" - strip-bom "^3.0.0" - - load-json-file@^4.0.0: - version "4.0.0" - resolved "https://registry.yarnpkg.com/load-json-file/-/load-json-file-4.0.0.tgz#2f5f45ab91e33216234fd53adab668eb4ec0993b" - dependencies: - graceful-fs "^4.1.2" - parse-json "^4.0.0" - pify "^3.0.0" - strip-bom "^3.0.0" - - loader-runner@^2.3.0: - version "2.3.0" - resolved "https://registry.yarnpkg.com/loader-runner/-/loader-runner-2.3.0.tgz#f482aea82d543e07921700d5a46ef26fdac6b8a2" - - loader-utils@^0.2.15: - version "0.2.17" - resolved "https://registry.yarnpkg.com/loader-utils/-/loader-utils-0.2.17.tgz#f86e6374d43205a6e6c60e9196f17c0299bfb348" - dependencies: - big.js "^3.1.3" - emojis-list "^2.0.0" - json5 "^0.5.0" - object-assign "^4.0.1" - - loader-utils@^1.0.2, loader-utils@^1.1.0: - version "1.1.0" - resolved "https://registry.yarnpkg.com/loader-utils/-/loader-utils-1.1.0.tgz#c98aef488bcceda2ffb5e2de646d6a754429f5cd" - dependencies: - big.js "^3.1.3" - emojis-list "^2.0.0" - json5 "^0.5.0" - - locate-path@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/locate-path/-/locate-path-2.0.0.tgz#2b568b265eec944c6d9c0de9c3dbbbca0354cd8e" - dependencies: - p-locate "^2.0.0" - path-exists "^3.0.0" - - lodash-es@^4.17.5: - version "4.17.7" - resolved "https://registry.yarnpkg.com/lodash-es/-/lodash-es-4.17.7.tgz#db240a3252c3dd8360201ac9feef91ac977ea856" - - lodash-es@^4.2.1: - version "4.17.5" - resolved "https://registry.yarnpkg.com/lodash-es/-/lodash-es-4.17.5.tgz#9fc6e737b1c4d151d8f9cae2247305d552ce748f" - - lodash.assign@^4.2.0: - version "4.2.0" - resolved "https://registry.yarnpkg.com/lodash.assign/-/lodash.assign-4.2.0.tgz#0d99f3ccd7a6d261d19bdaeb9245005d285808e7" - - lodash.camelcase@^4.3.0: - version "4.3.0" - resolved "https://registry.yarnpkg.com/lodash.camelcase/-/lodash.camelcase-4.3.0.tgz#b28aa6288a2b9fc651035c7711f65ab6190331a6" - - lodash.clonedeep@^4.5.0: - version "4.5.0" - resolved "https://registry.yarnpkg.com/lodash.clonedeep/-/lodash.clonedeep-4.5.0.tgz#e23f3f9c4f8fbdde872529c1071857a086e5ccef" - - lodash.clonedeepwith@^4.5.0: - version "4.5.0" - resolved "https://registry.yarnpkg.com/lodash.clonedeepwith/-/lodash.clonedeepwith-4.5.0.tgz#6ee30573a03a1a60d670a62ef33c10cf1afdbdd4" - - lodash.debounce@^4.0.3: - version "4.0.8" - resolved "https://registry.yarnpkg.com/lodash.debounce/-/lodash.debounce-4.0.8.tgz#82d79bff30a67c4005ffd5e2515300ad9ca4d7af" - - lodash.difference@^4.3.0: - version "4.5.0" - resolved "https://registry.yarnpkg.com/lodash.difference/-/lodash.difference-4.5.0.tgz#9ccb4e505d486b91651345772885a2df27fd017c" - - lodash.flatten@^4.2.0: - version "4.4.0" - resolved "https://registry.yarnpkg.com/lodash.flatten/-/lodash.flatten-4.4.0.tgz#f31c22225a9632d2bbf8e4addbef240aa765a61f" - - lodash.flattendeep@^4.4.0: - version "4.4.0" - resolved "https://registry.yarnpkg.com/lodash.flattendeep/-/lodash.flattendeep-4.4.0.tgz#fb030917f86a3134e5bc9bec0d69e0013ddfedb2" - - lodash.isequal@^4.5.0: - version "4.5.0" - resolved "https://registry.yarnpkg.com/lodash.isequal/-/lodash.isequal-4.5.0.tgz#415c4478f2bcc30120c22ce10ed3226f7d3e18e0" - - lodash.isplainobject@^4.0.6: - version "4.0.6" - resolved "https://registry.yarnpkg.com/lodash.isplainobject/-/lodash.isplainobject-4.0.6.tgz#7c526a52d89b45c45cc690b88163be0497f550cb" - - lodash.memoize@^4.1.2: - version "4.1.2" - resolved "https://registry.yarnpkg.com/lodash.memoize/-/lodash.memoize-4.1.2.tgz#bcc6c49a42a2840ed997f323eada5ecd182e0bfe" - - lodash.merge@^4.6.0: - version "4.6.1" - resolved "https://registry.yarnpkg.com/lodash.merge/-/lodash.merge-4.6.1.tgz#adc25d9cb99b9391c59624f379fbba60d7111d54" - - lodash.some@^4.6.0: - version "4.6.0" - resolved "https://registry.yarnpkg.com/lodash.some/-/lodash.some-4.6.0.tgz#1bb9f314ef6b8baded13b549169b2a945eb68e4d" - - lodash.uniq@^4.5.0: - version "4.5.0" - resolved "https://registry.yarnpkg.com/lodash.uniq/-/lodash.uniq-4.5.0.tgz#d0225373aeb652adc1bc82e4945339a842754773" - - lodash@^4.13.1, lodash@^4.14.0, lodash@^4.17.4, lodash@^4.17.5, lodash@^4.2.1, lodash@^4.3.0, lodash@^4.8.0, lodash@~4.17.4: - version "4.17.5" - resolved "https://registry.yarnpkg.com/lodash/-/lodash-4.17.5.tgz#99a92d65c0272debe8c96b6057bc8fbfa3bed511" - - log-symbols@^1.0.2: - version "1.0.2" - resolved "https://registry.yarnpkg.com/log-symbols/-/log-symbols-1.0.2.tgz#376ff7b58ea3086a0f09facc74617eca501e1a18" - dependencies: - chalk "^1.0.0" - - log-symbols@^2.1.0: - version "2.2.0" - resolved "https://registry.yarnpkg.com/log-symbols/-/log-symbols-2.2.0.tgz#5740e1c5d6f0dfda4ad9323b5332107ef6b4c40a" - dependencies: - chalk "^2.0.1" - - longest@^1.0.1: - version "1.0.1" - resolved "https://registry.yarnpkg.com/longest/-/longest-1.0.1.tgz#30a0b2da38f73770e8294a0d22e6625ed77d0097" - - loose-envify@^1.0.0, loose-envify@^1.1.0, loose-envify@^1.3.1: - version "1.3.1" - resolved "https://registry.yarnpkg.com/loose-envify/-/loose-envify-1.3.1.tgz#d1a8ad33fa9ce0e713d65fdd0ac8b748d478c848" - dependencies: - js-tokens "^3.0.0" - - loud-rejection@^1.0.0, loud-rejection@^1.2.0: - version "1.6.0" - resolved "https://registry.yarnpkg.com/loud-rejection/-/loud-rejection-1.6.0.tgz#5b46f80147edee578870f086d04821cf998e551f" - dependencies: - currently-unhandled "^0.4.1" - signal-exit "^3.0.0" - - lowercase-keys@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/lowercase-keys/-/lowercase-keys-1.0.0.tgz#4e3366b39e7f5457e35f1324bdf6f88d0bfc7306" - - lru-cache@^4.0.1, lru-cache@^4.1.1: - version "4.1.1" - resolved "https://registry.yarnpkg.com/lru-cache/-/lru-cache-4.1.1.tgz#622e32e82488b49279114a4f9ecf45e7cd6bba55" - dependencies: - pseudomap "^1.0.2" - yallist "^2.1.2" - - macaddress@^0.2.8: - version "0.2.8" - resolved "https://registry.yarnpkg.com/macaddress/-/macaddress-0.2.8.tgz#5904dc537c39ec6dbefeae902327135fa8511f12" - - make-dir@^1.0.0: - version "1.2.0" - resolved "https://registry.yarnpkg.com/make-dir/-/make-dir-1.2.0.tgz#6d6a49eead4aae296c53bbf3a1a008bd6c89469b" - dependencies: - pify "^3.0.0" - - map-obj@^1.0.0, map-obj@^1.0.1: - version "1.0.1" - resolved "https://registry.yarnpkg.com/map-obj/-/map-obj-1.0.1.tgz#d933ceb9205d82bdcf4886f6742bdc2b4dea146d" - - matcher@^1.0.0: - version "1.1.0" - resolved "https://registry.yarnpkg.com/matcher/-/matcher-1.1.0.tgz#4ad3a9cb6585186dc95cb8a08c7de936caed17ee" - dependencies: - escape-string-regexp "^1.0.4" - - math-expression-evaluator@^1.2.14: - version "1.2.17" - resolved "https://registry.yarnpkg.com/math-expression-evaluator/-/math-expression-evaluator-1.2.17.tgz#de819fdbcd84dccd8fae59c6aeb79615b9d266ac" - - md5-hex@^1.2.0, md5-hex@^1.3.0: - version "1.3.0" - resolved "https://registry.yarnpkg.com/md5-hex/-/md5-hex-1.3.0.tgz#d2c4afe983c4370662179b8cad145219135046c4" - dependencies: - md5-o-matic "^0.1.1" - - md5-hex@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/md5-hex/-/md5-hex-2.0.0.tgz#d0588e9f1c74954492ecd24ac0ac6ce997d92e33" - dependencies: - md5-o-matic "^0.1.1" - - md5-o-matic@^0.1.1: - version "0.1.1" - resolved "https://registry.yarnpkg.com/md5-o-matic/-/md5-o-matic-0.1.1.tgz#822bccd65e117c514fab176b25945d54100a03c3" - - md5.js@^1.3.4: - version "1.3.4" - resolved "https://registry.yarnpkg.com/md5.js/-/md5.js-1.3.4.tgz#e9bdbde94a20a5ac18b04340fc5764d5b09d901d" - dependencies: - hash-base "^3.0.0" - inherits "^2.0.1" - - mem@^1.1.0: - version "1.1.0" - resolved "https://registry.yarnpkg.com/mem/-/mem-1.1.0.tgz#5edd52b485ca1d900fe64895505399a0dfa45f76" - dependencies: - mimic-fn "^1.0.0" - - memory-fs@^0.4.0, memory-fs@~0.4.1: - version "0.4.1" - resolved "https://registry.yarnpkg.com/memory-fs/-/memory-fs-0.4.1.tgz#3a9a20b8462523e447cfbc7e8bb80ed667bfc552" - dependencies: - errno "^0.1.3" - readable-stream "^2.0.1" - - meow@^3.1.0, meow@^3.7.0: - version "3.7.0" - resolved "https://registry.yarnpkg.com/meow/-/meow-3.7.0.tgz#72cb668b425228290abbfa856892587308a801fb" - dependencies: - camelcase-keys "^2.0.0" - decamelize "^1.1.2" - loud-rejection "^1.0.0" - map-obj "^1.0.1" - minimist "^1.1.3" - normalize-package-data "^2.3.4" - object-assign "^4.0.1" - read-pkg-up "^1.0.1" - redent "^1.0.0" - trim-newlines "^1.0.0" - - merge-descriptors@~1.0.0: - version "1.0.1" - resolved "https://registry.yarnpkg.com/merge-descriptors/-/merge-descriptors-1.0.1.tgz#b00aaa556dd8b44568150ec9d1b953f3f90cbb61" - - micromatch@^2.1.5: - version "2.3.11" - resolved "https://registry.yarnpkg.com/micromatch/-/micromatch-2.3.11.tgz#86677c97d1720b363431d04d0d15293bd38c1565" - dependencies: - arr-diff "^2.0.0" - array-unique "^0.2.1" - braces "^1.8.2" - expand-brackets "^0.1.4" - extglob "^0.3.1" - filename-regex "^2.0.0" - is-extglob "^1.0.0" - is-glob "^2.0.1" - kind-of "^3.0.2" - normalize-path "^2.0.1" - object.omit "^2.0.0" - parse-glob "^3.0.4" - regex-cache "^0.4.2" - - miller-rabin@^4.0.0: - version "4.0.1" - resolved "https://registry.yarnpkg.com/miller-rabin/-/miller-rabin-4.0.1.tgz#f080351c865b0dc562a8462966daa53543c78a4d" - dependencies: - bn.js "^4.0.0" - brorand "^1.0.1" - - mime-db@~1.33.0: - version "1.33.0" - resolved "https://registry.yarnpkg.com/mime-db/-/mime-db-1.33.0.tgz#a3492050a5cb9b63450541e39d9788d2272783db" - - mime-types@^2.1.12, mime-types@~2.1.17, mime-types@~2.1.7: - version "2.1.18" - resolved "https://registry.yarnpkg.com/mime-types/-/mime-types-2.1.18.tgz#6f323f60a83d11146f831ff11fd66e2fe5503bb8" - dependencies: - mime-db "~1.33.0" - - mime@^2.2.0: - version "2.2.0" - resolved "https://registry.yarnpkg.com/mime/-/mime-2.2.0.tgz#161e541965551d3b549fa1114391e3a3d55b923b" - - mimic-fn@^1.0.0: - version "1.2.0" - resolved "https://registry.yarnpkg.com/mimic-fn/-/mimic-fn-1.2.0.tgz#820c86a39334640e99516928bd03fca88057d022" - - mimic-response@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/mimic-response/-/mimic-response-1.0.0.tgz#df3d3652a73fded6b9b0b24146e6fd052353458e" - - minimalistic-assert@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/minimalistic-assert/-/minimalistic-assert-1.0.0.tgz#702be2dda6b37f4836bcb3f5db56641b64a1d3d3" - - minimalistic-crypto-utils@^1.0.0, minimalistic-crypto-utils@^1.0.1: - version "1.0.1" - resolved "https://registry.yarnpkg.com/minimalistic-crypto-utils/-/minimalistic-crypto-utils-1.0.1.tgz#f6c00c1c0b082246e5c4d99dfb8c7c083b2b582a" - - minimatch@^3.0.0, minimatch@^3.0.2, minimatch@^3.0.4, minimatch@~3.0.2: - version "3.0.4" - resolved "https://registry.yarnpkg.com/minimatch/-/minimatch-3.0.4.tgz#5166e286457f03306064be5497e8dbb0c3d32083" - dependencies: - brace-expansion "^1.1.7" - - minimist@0.0.8: - version "0.0.8" - resolved "https://registry.yarnpkg.com/minimist/-/minimist-0.0.8.tgz#857fcabfc3397d2625b8228262e86aa7a011b05d" - - minimist@^1.1.0, minimist@^1.1.3, minimist@^1.2.0: - version "1.2.0" - resolved "https://registry.yarnpkg.com/minimist/-/minimist-1.2.0.tgz#a35008b20f41383eec1fb914f4cd5df79a264284" - - minimist@~0.0.1: - version "0.0.10" - resolved "https://registry.yarnpkg.com/minimist/-/minimist-0.0.10.tgz#de3f98543dbf96082be48ad1a0c7cda836301dcf" - - mississippi@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/mississippi/-/mississippi-2.0.0.tgz#3442a508fafc28500486feea99409676e4ee5a6f" - dependencies: - concat-stream "^1.5.0" - duplexify "^3.4.2" - end-of-stream "^1.1.0" - flush-write-stream "^1.0.0" - from2 "^2.1.0" - parallel-transform "^1.1.0" - pump "^2.0.1" - pumpify "^1.3.3" - stream-each "^1.1.0" - through2 "^2.0.0" - - mkdirp@0.5.0: - version "0.5.0" - resolved "https://registry.yarnpkg.com/mkdirp/-/mkdirp-0.5.0.tgz#1d73076a6df986cd9344e15e71fcc05a4c9abf12" - dependencies: - minimist "0.0.8" - - "mkdirp@>=0.5 0", mkdirp@^0.5.0, mkdirp@^0.5.1, mkdirp@~0.5.0, mkdirp@~0.5.1: - version "0.5.1" - resolved "https://registry.yarnpkg.com/mkdirp/-/mkdirp-0.5.1.tgz#30057438eac6cf7f8c4767f38648d6697d75c903" - dependencies: - minimist "0.0.8" - - module-not-found-error@^1.0.0: - version "1.0.1" - resolved "https://registry.yarnpkg.com/module-not-found-error/-/module-not-found-error-1.0.1.tgz#cf8b4ff4f29640674d6cdd02b0e3bc523c2bbdc0" - - mousetrap@chabou/mousetrap#useCapture: - version "1.6.1" - resolved "https://codeload.github.com/chabou/mousetrap/tar.gz/c95eeeaafba1131dd8d35bc130d4a79b2ff9261a" - - move-concurrently@^1.0.1: - version "1.0.1" - resolved "https://registry.yarnpkg.com/move-concurrently/-/move-concurrently-1.0.1.tgz#be2c005fda32e0b29af1f05d7c4b33214c701f92" - dependencies: - aproba "^1.1.1" - copy-concurrently "^1.0.0" - fs-write-stream-atomic "^1.0.8" - mkdirp "^0.5.1" - rimraf "^2.5.4" - run-queue "^1.0.3" - - mri@1.1.0: - version "1.1.0" - resolved "https://registry.yarnpkg.com/mri/-/mri-1.1.0.tgz#5c0a3f29c8ccffbbb1ec941dcec09d71fa32f36a" - - ms@2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/ms/-/ms-2.0.0.tgz#5608aeadfc00be6c2901df5f9861788de0d597c8" - - ms@2.1.1, ms@^2.0.0: - version "2.1.1" - resolved "https://registry.yarnpkg.com/ms/-/ms-2.1.1.tgz#30a5864eb3ebb0a66f2ebe6d727af06a09d86e0a" - - multimatch@^2.1.0: - version "2.1.0" - resolved "https://registry.yarnpkg.com/multimatch/-/multimatch-2.1.0.tgz#9c7906a22fb4c02919e2f5f75161b4cdbd4b2a2b" - dependencies: - array-differ "^1.0.0" - array-union "^1.0.1" - arrify "^1.0.0" - minimatch "^3.0.0" - - mute-stream@0.0.7: - version "0.0.7" - resolved "https://registry.yarnpkg.com/mute-stream/-/mute-stream-0.0.7.tgz#3075ce93bc21b8fab43e1bc4da7e8115ed1e7bab" - - nan@^2.3.0: - version "2.8.0" - resolved "https://registry.yarnpkg.com/nan/-/nan-2.8.0.tgz#ed715f3fe9de02b57a5e6252d90a96675e1f085a" - - natural-compare@^1.4.0: - version "1.4.0" - resolved "https://registry.yarnpkg.com/natural-compare/-/natural-compare-1.4.0.tgz#4abebfeed7541f2c27acfb29bdbbd15c8d5ba4f7" - - node-abi@^2.0.0: - version "2.2.0" - resolved "https://registry.yarnpkg.com/node-abi/-/node-abi-2.2.0.tgz#e802ac7a2408e2c0593fb3176ffdf8a99a9b4dec" - dependencies: - semver "^5.4.1" - - node-fetch@^1.0.1: - version "1.7.3" - resolved "https://registry.yarnpkg.com/node-fetch/-/node-fetch-1.7.3.tgz#980f6f72d85211a5347c6b2bc18c5b84c3eb47ef" - dependencies: - encoding "^0.1.11" - is-stream "^1.0.1" - - node-gyp@3.6.2, node-gyp@^3.6.0: - version "3.6.2" - resolved "https://registry.yarnpkg.com/node-gyp/-/node-gyp-3.6.2.tgz#9bfbe54562286284838e750eac05295853fa1c60" - dependencies: - fstream "^1.0.0" - glob "^7.0.3" - graceful-fs "^4.1.2" - minimatch "^3.0.2" - mkdirp "^0.5.0" - nopt "2 || 3" - npmlog "0 || 1 || 2 || 3 || 4" - osenv "0" - request "2" - rimraf "2" - semver "~5.3.0" - tar "^2.0.0" - which "1" - - node-libs-browser@^2.0.0: - version "2.1.0" - resolved "https://registry.yarnpkg.com/node-libs-browser/-/node-libs-browser-2.1.0.tgz#5f94263d404f6e44767d726901fff05478d600df" - dependencies: - assert "^1.1.1" - browserify-zlib "^0.2.0" - buffer "^4.3.0" - console-browserify "^1.1.0" - constants-browserify "^1.0.0" - crypto-browserify "^3.11.0" - domain-browser "^1.1.1" - events "^1.0.0" - https-browserify "^1.0.0" - os-browserify "^0.3.0" - path-browserify "0.0.0" - process "^0.11.10" - punycode "^1.2.4" - querystring-es3 "^0.2.0" - readable-stream "^2.3.3" - stream-browserify "^2.0.1" - stream-http "^2.7.2" - string_decoder "^1.0.0" - timers-browserify "^2.0.4" - tty-browserify "0.0.0" - url "^0.11.0" - util "^0.10.3" - vm-browserify "0.0.4" - - node-pre-gyp@^0.6.39: - version "0.6.39" - resolved "https://registry.yarnpkg.com/node-pre-gyp/-/node-pre-gyp-0.6.39.tgz#c00e96860b23c0e1420ac7befc5044e1d78d8649" - dependencies: - detect-libc "^1.0.2" - hawk "3.1.3" - mkdirp "^0.5.1" - nopt "^4.0.1" - npmlog "^4.0.2" - rc "^1.1.7" - request "2.81.0" - rimraf "^2.6.1" - semver "^5.3.0" - tar "^2.2.1" - tar-pack "^3.4.0" - - "nopt@2 || 3": - version "3.0.6" - resolved "https://registry.yarnpkg.com/nopt/-/nopt-3.0.6.tgz#c6465dbf08abcd4db359317f79ac68a646b28ff9" - dependencies: - abbrev "1" - - nopt@^4.0.1: - version "4.0.1" - resolved "https://registry.yarnpkg.com/nopt/-/nopt-4.0.1.tgz#d0d4685afd5415193c8c7505602d0d17cd64474d" - dependencies: - abbrev "1" - osenv "^0.1.4" - - normalize-package-data@^2.3.2, normalize-package-data@^2.3.4, normalize-package-data@^2.4.0: - version "2.4.0" - resolved "https://registry.yarnpkg.com/normalize-package-data/-/normalize-package-data-2.4.0.tgz#12f95a307d58352075a04907b84ac8be98ac012f" - dependencies: - hosted-git-info "^2.1.4" - is-builtin-module "^1.0.0" - semver "2 || 3 || 4 || 5" - validate-npm-package-license "^3.0.1" - - normalize-path@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/normalize-path/-/normalize-path-1.0.0.tgz#32d0e472f91ff345701c15a8311018d3b0a90379" - - normalize-path@^2.0.0, normalize-path@^2.0.1: - version "2.1.1" - resolved "https://registry.yarnpkg.com/normalize-path/-/normalize-path-2.1.1.tgz#1ab28b556e198363a8c1a6f7e6fa20137fe6aed9" - dependencies: - remove-trailing-separator "^1.0.1" - - normalize-range@^0.1.2: - version "0.1.2" - resolved "https://registry.yarnpkg.com/normalize-range/-/normalize-range-0.1.2.tgz#2d10c06bdfd312ea9777695a4d28439456b75942" - - normalize-url@^1.4.0, normalize-url@^1.9.1: - version "1.9.1" - resolved "https://registry.yarnpkg.com/normalize-url/-/normalize-url-1.9.1.tgz#2cc0d66b31ea23036458436e3620d85954c66c3c" - dependencies: - object-assign "^4.0.1" - prepend-http "^1.0.0" - query-string "^4.1.0" - sort-keys "^1.0.0" - - npm-install-package@~2.1.0: - version "2.1.0" - resolved "https://registry.yarnpkg.com/npm-install-package/-/npm-install-package-2.1.0.tgz#d7efe3cfcd7ab00614b896ea53119dc9ab259125" - - npm-run-path@^2.0.0: - version "2.0.2" - resolved "https://registry.yarnpkg.com/npm-run-path/-/npm-run-path-2.0.2.tgz#35a9232dfa35d7067b4cb2ddf2357b1871536c5f" - dependencies: - path-key "^2.0.0" - - "npmlog@0 || 1 || 2 || 3 || 4", npmlog@^4.0.2: - version "4.1.2" - resolved "https://registry.yarnpkg.com/npmlog/-/npmlog-4.1.2.tgz#08a7f2a8bf734604779a9efa4ad5cc717abb954b" - dependencies: - are-we-there-yet "~1.1.2" - console-control-strings "~1.1.0" - gauge "~2.7.3" - set-blocking "~2.0.0" - - nugget@^2.0.0, nugget@^2.0.1: - version "2.0.1" - resolved "https://registry.yarnpkg.com/nugget/-/nugget-2.0.1.tgz#201095a487e1ad36081b3432fa3cada4f8d071b0" - dependencies: - debug "^2.1.3" - minimist "^1.1.0" - pretty-bytes "^1.0.2" - progress-stream "^1.1.0" - request "^2.45.0" - single-line-log "^1.1.2" - throttleit "0.0.2" - - num2fraction@^1.2.2: - version "1.2.2" - resolved "https://registry.yarnpkg.com/num2fraction/-/num2fraction-1.2.2.tgz#6f682b6a027a4e9ddfa4564cd2589d1d4e669ede" - - number-is-nan@^1.0.0: - version "1.0.1" - resolved "https://registry.yarnpkg.com/number-is-nan/-/number-is-nan-1.0.1.tgz#097b602b53422a522c1afb8790318336941a011d" - - oauth-sign@~0.8.1, oauth-sign@~0.8.2: - version "0.8.2" - resolved "https://registry.yarnpkg.com/oauth-sign/-/oauth-sign-0.8.2.tgz#46a6ab7f0aead8deae9ec0565780b7d4efeb9d43" - - object-assign@^4.0.1, object-assign@^4.1.0, object-assign@^4.1.1: - version "4.1.1" - resolved "https://registry.yarnpkg.com/object-assign/-/object-assign-4.1.1.tgz#2109adc7965887cfc05cbbd442cac8bfbb360863" - - object-keys@^1.0.8: - version "1.0.11" - resolved "https://registry.yarnpkg.com/object-keys/-/object-keys-1.0.11.tgz#c54601778ad560f1142ce0e01bcca8b56d13426d" - - object-keys@~0.4.0: - version "0.4.0" - resolved "https://registry.yarnpkg.com/object-keys/-/object-keys-0.4.0.tgz#28a6aae7428dd2c3a92f3d95f21335dd204e0336" - - object.omit@^2.0.0: - version "2.0.1" - resolved "https://registry.yarnpkg.com/object.omit/-/object.omit-2.0.1.tgz#1a9c744829f39dbb858c76ca3579ae2a54ebd1fa" - dependencies: - for-own "^0.1.4" - is-extendable "^0.1.1" - - observable-to-promise@^0.5.0: - version "0.5.0" - resolved "https://registry.yarnpkg.com/observable-to-promise/-/observable-to-promise-0.5.0.tgz#c828f0f0dc47e9f86af8a4977c5d55076ce7a91f" - dependencies: - is-observable "^0.2.0" - symbol-observable "^1.0.4" - - once@^1.3.0, once@^1.3.1, once@^1.3.3, once@^1.4.0: - version "1.4.0" - resolved "https://registry.yarnpkg.com/once/-/once-1.4.0.tgz#583b1aa775961d4b113ac17d9c50baef9dd76bd1" - dependencies: - wrappy "1" - - onetime@^2.0.0: - version "2.0.1" - resolved "https://registry.yarnpkg.com/onetime/-/onetime-2.0.1.tgz#067428230fd67443b2794b22bba528b6867962d4" - dependencies: - mimic-fn "^1.0.0" - - opn@5.3.0: - version "5.3.0" - resolved "https://registry.yarnpkg.com/opn/-/opn-5.3.0.tgz#64871565c863875f052cfdf53d3e3cb5adb53b1c" - dependencies: - is-wsl "^1.1.0" - - optimist@~0.6.1: - version "0.6.1" - resolved "https://registry.yarnpkg.com/optimist/-/optimist-0.6.1.tgz#da3ea74686fa21a19a111c326e90eb15a0196686" - dependencies: - minimist "~0.0.1" - wordwrap "~0.0.2" - - option-chain@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/option-chain/-/option-chain-1.0.0.tgz#938d73bd4e1783f948d34023644ada23669e30f2" - - optionator@^0.8.2: - version "0.8.2" - resolved "https://registry.yarnpkg.com/optionator/-/optionator-0.8.2.tgz#364c5e409d3f4d6301d6c0b4c05bba50180aeb64" - dependencies: - deep-is "~0.1.3" - fast-levenshtein "~2.0.4" - levn "~0.3.0" - prelude-ls "~1.1.2" - type-check "~0.3.2" - wordwrap "~1.0.0" - - ora@1.3.0: - version "1.3.0" - resolved "https://registry.yarnpkg.com/ora/-/ora-1.3.0.tgz#80078dd2b92a934af66a3ad72a5b910694ede51a" - dependencies: - chalk "^1.1.1" - cli-cursor "^2.1.0" - cli-spinners "^1.0.0" - log-symbols "^1.0.2" - - ora@^1.2.0: - version "1.4.0" - resolved "https://registry.yarnpkg.com/ora/-/ora-1.4.0.tgz#884458215b3a5d4097592285f93321bb7a79e2e5" - dependencies: - chalk "^2.1.0" - cli-cursor "^2.1.0" - cli-spinners "^1.0.1" - log-symbols "^2.1.0" - - os-browserify@^0.3.0: - version "0.3.0" - resolved "https://registry.yarnpkg.com/os-browserify/-/os-browserify-0.3.0.tgz#854373c7f5c2315914fc9bfc6bd8238fdda1ec27" - - os-homedir@^1.0.0: - version "1.0.2" - resolved "https://registry.yarnpkg.com/os-homedir/-/os-homedir-1.0.2.tgz#ffbc4988336e0e833de0c168c7ef152121aa7fb3" - - os-locale@^1.4.0: - version "1.4.0" - resolved "https://registry.yarnpkg.com/os-locale/-/os-locale-1.4.0.tgz#20f9f17ae29ed345e8bde583b13d2009803c14d9" - dependencies: - lcid "^1.0.0" - - os-locale@^2.0.0: - version "2.1.0" - resolved "https://registry.yarnpkg.com/os-locale/-/os-locale-2.1.0.tgz#42bc2900a6b5b8bd17376c8e882b65afccf24bf2" - dependencies: - execa "^0.7.0" - lcid "^1.0.0" - mem "^1.1.0" - - os-tmpdir@^1.0.0, os-tmpdir@^1.0.1, os-tmpdir@~1.0.2: - version "1.0.2" - resolved "https://registry.yarnpkg.com/os-tmpdir/-/os-tmpdir-1.0.2.tgz#bbe67406c79aa85c5cfec766fe5734555dfa1274" - - osenv@0, osenv@^0.1.4: - version "0.1.5" - resolved "https://registry.yarnpkg.com/osenv/-/osenv-0.1.5.tgz#85cdfafaeb28e8677f416e287592b5f3f49ea410" - dependencies: - os-homedir "^1.0.0" - os-tmpdir "^1.0.0" - - output-file-sync@^1.1.2: - version "1.1.2" - resolved "https://registry.yarnpkg.com/output-file-sync/-/output-file-sync-1.1.2.tgz#d0a33eefe61a205facb90092e826598d5245ce76" - dependencies: - graceful-fs "^4.1.4" - mkdirp "^0.5.1" - object-assign "^4.1.0" - - p-cancelable@^0.3.0: - version "0.3.0" - resolved "https://registry.yarnpkg.com/p-cancelable/-/p-cancelable-0.3.0.tgz#b9e123800bcebb7ac13a479be195b507b98d30fa" - - p-finally@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/p-finally/-/p-finally-1.0.0.tgz#3fbcfb15b899a44123b34b6dcc18b724336a2cae" - - p-limit@^1.0.0, p-limit@^1.1.0: - version "1.2.0" - resolved "https://registry.yarnpkg.com/p-limit/-/p-limit-1.2.0.tgz#0e92b6bedcb59f022c13d0f1949dc82d15909f1c" - dependencies: - p-try "^1.0.0" - - p-locate@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/p-locate/-/p-locate-2.0.0.tgz#20a0103b222a70c8fd39cc2e580680f3dde5ec43" - dependencies: - p-limit "^1.1.0" - - p-timeout@^1.1.1: - version "1.2.1" - resolved "https://registry.yarnpkg.com/p-timeout/-/p-timeout-1.2.1.tgz#5eb3b353b7fce99f101a1038880bb054ebbea386" - dependencies: - p-finally "^1.0.0" - - p-try@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/p-try/-/p-try-1.0.0.tgz#cbc79cdbaf8fd4228e13f621f2b1a237c1b207b3" - - package-hash@^1.2.0: - version "1.2.0" - resolved "https://registry.yarnpkg.com/package-hash/-/package-hash-1.2.0.tgz#003e56cd57b736a6ed6114cc2b81542672770e44" - dependencies: - md5-hex "^1.3.0" - - package-hash@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/package-hash/-/package-hash-2.0.0.tgz#78ae326c89e05a4d813b68601977af05c00d2a0d" - dependencies: - graceful-fs "^4.1.11" - lodash.flattendeep "^4.4.0" - md5-hex "^2.0.0" - release-zalgo "^1.0.0" - - package-json@^4.0.0: - version "4.0.1" - resolved "https://registry.yarnpkg.com/package-json/-/package-json-4.0.1.tgz#8869a0401253661c4c4ca3da6c2121ed555f5eed" - dependencies: - got "^6.7.1" - registry-auth-token "^3.0.1" - registry-url "^3.0.3" - semver "^5.1.0" - - pako@~1.0.5: - version "1.0.6" - resolved "https://registry.yarnpkg.com/pako/-/pako-1.0.6.tgz#0101211baa70c4bca4a0f63f2206e97b7dfaf258" - - parallel-transform@^1.1.0: - version "1.1.0" - resolved "https://registry.yarnpkg.com/parallel-transform/-/parallel-transform-1.1.0.tgz#d410f065b05da23081fcd10f28854c29bda33b06" - dependencies: - cyclist "~0.2.2" - inherits "^2.0.3" - readable-stream "^2.1.5" - - parse-asn1@^5.0.0: - version "5.1.0" - resolved "https://registry.yarnpkg.com/parse-asn1/-/parse-asn1-5.1.0.tgz#37c4f9b7ed3ab65c74817b5f2480937fbf97c712" - dependencies: - asn1.js "^4.0.0" - browserify-aes "^1.0.0" - create-hash "^1.1.0" - evp_bytestokey "^1.0.0" - pbkdf2 "^3.0.3" - - parse-color@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/parse-color/-/parse-color-1.0.0.tgz#7b748b95a83f03f16a94f535e52d7f3d94658619" - dependencies: - color-convert "~0.5.0" - - parse-glob@^3.0.4: - version "3.0.4" - resolved "https://registry.yarnpkg.com/parse-glob/-/parse-glob-3.0.4.tgz#b2c376cfb11f35513badd173ef0bb6e3a388391c" - dependencies: - glob-base "^0.3.0" - is-dotfile "^1.0.0" - is-extglob "^1.0.0" - is-glob "^2.0.0" - - parse-json@^2.2.0: - version "2.2.0" - resolved "https://registry.yarnpkg.com/parse-json/-/parse-json-2.2.0.tgz#f480f40434ef80741f8469099f8dea18f55a4dc9" - dependencies: - error-ex "^1.2.0" - - parse-json@^4.0.0: - version "4.0.0" - resolved "https://registry.yarnpkg.com/parse-json/-/parse-json-4.0.0.tgz#be35f5425be1f7f6c747184f98a788cb99477ee0" - dependencies: - error-ex "^1.3.1" - json-parse-better-errors "^1.0.1" - - parse-ms@^0.1.0: - version "0.1.2" - resolved "https://registry.yarnpkg.com/parse-ms/-/parse-ms-0.1.2.tgz#dd3fa25ed6c2efc7bdde12ad9b46c163aa29224e" - - parse-ms@^1.0.0: - version "1.0.1" - resolved "https://registry.yarnpkg.com/parse-ms/-/parse-ms-1.0.1.tgz#56346d4749d78f23430ca0c713850aef91aa361d" - - parse-path@^3.0.1: - version "3.0.2" - resolved "https://registry.yarnpkg.com/parse-path/-/parse-path-3.0.2.tgz#4686980f0b262ee2dbb9a64eef739c91edc85245" - dependencies: - is-ssh "^1.3.0" - protocols "^1.4.0" - - parse-url@3.0.2: - version "3.0.2" - resolved "https://registry.yarnpkg.com/parse-url/-/parse-url-3.0.2.tgz#602787a7063a795d72b8673197505e72f60610be" - dependencies: - is-ssh "^1.3.0" - normalize-url "^1.9.1" - parse-path "^3.0.1" - protocols "^1.4.0" - - path-browserify@0.0.0: - version "0.0.0" - resolved "https://registry.yarnpkg.com/path-browserify/-/path-browserify-0.0.0.tgz#a0b870729aae214005b7d5032ec2cbbb0fb4451a" - - path-exists@^2.0.0, path-exists@^2.1.0: - version "2.1.0" - resolved "https://registry.yarnpkg.com/path-exists/-/path-exists-2.1.0.tgz#0feb6c64f0fc518d9a754dd5efb62c7022761f4b" - dependencies: - pinkie-promise "^2.0.0" - - path-exists@^3.0.0: - version "3.0.0" - resolved "https://registry.yarnpkg.com/path-exists/-/path-exists-3.0.0.tgz#ce0ebeaa5f78cb18925ea7d810d7b59b010fd515" - - path-is-absolute@^1.0.0, path-is-absolute@^1.0.1: - version "1.0.1" - resolved "https://registry.yarnpkg.com/path-is-absolute/-/path-is-absolute-1.0.1.tgz#174b9268735534ffbc7ace6bf53a5a9e1b5c5f5f" - - path-is-inside@^1.0.1, path-is-inside@^1.0.2: - version "1.0.2" - resolved "https://registry.yarnpkg.com/path-is-inside/-/path-is-inside-1.0.2.tgz#365417dede44430d1c11af61027facf074bdfc53" - - path-key@^2.0.0: - version "2.0.1" - resolved "https://registry.yarnpkg.com/path-key/-/path-key-2.0.1.tgz#411cadb574c5a140d3a4b1910d40d80cc9f40b40" - - path-type@^1.0.0: - version "1.1.0" - resolved "https://registry.yarnpkg.com/path-type/-/path-type-1.1.0.tgz#59c44f7ee491da704da415da5a4070ba4f8fe441" - dependencies: - graceful-fs "^4.1.2" - pify "^2.0.0" - pinkie-promise "^2.0.0" - - path-type@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/path-type/-/path-type-2.0.0.tgz#f012ccb8415b7096fc2daa1054c3d72389594c73" - dependencies: - pify "^2.0.0" - - path-type@^3.0.0: - version "3.0.0" - resolved "https://registry.yarnpkg.com/path-type/-/path-type-3.0.0.tgz#cef31dc8e0a1a3bb0d105c0cd97cf3bf47f4e36f" - dependencies: - pify "^3.0.0" - - pbkdf2@^3.0.3: - version "3.0.14" - resolved "https://registry.yarnpkg.com/pbkdf2/-/pbkdf2-3.0.14.tgz#a35e13c64799b06ce15320f459c230e68e73bade" - dependencies: - create-hash "^1.1.2" - create-hmac "^1.1.4" - ripemd160 "^2.0.1" - safe-buffer "^5.0.1" - sha.js "^2.4.8" - - pend@~1.2.0: - version "1.2.0" - resolved "https://registry.yarnpkg.com/pend/-/pend-1.2.0.tgz#7a57eb550a6783f9115331fcf4663d5c8e007a50" - - performance-now@^0.2.0: - version "0.2.0" - resolved "https://registry.yarnpkg.com/performance-now/-/performance-now-0.2.0.tgz#33ef30c5c77d4ea21c5a53869d91b56d8f2555e5" - - performance-now@^2.1.0: - version "2.1.0" - resolved "https://registry.yarnpkg.com/performance-now/-/performance-now-2.1.0.tgz#6309f4e0e5fa913ec1c69307ae364b4b377c9e7b" - - php-escape-shell@1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/php-escape-shell/-/php-escape-shell-1.0.0.tgz#7d589611f91c2ff6f3fe6591c91478c05c610879" - - pify@3.0.0, pify@^3.0.0: - version "3.0.0" - resolved "https://registry.yarnpkg.com/pify/-/pify-3.0.0.tgz#e5a4acd2c101fdf3d9a4d07f0dbc4db49dd28176" - - pify@^2.0.0: - version "2.3.0" - resolved "https://registry.yarnpkg.com/pify/-/pify-2.3.0.tgz#ed141a6ac043a849ea588498e7dca8b15330e90c" - - pinkie-promise@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/pinkie-promise/-/pinkie-promise-1.0.0.tgz#d1da67f5482563bb7cf57f286ae2822ecfbf3670" - dependencies: - pinkie "^1.0.0" - - pinkie-promise@^2.0.0: - version "2.0.1" - resolved "https://registry.yarnpkg.com/pinkie-promise/-/pinkie-promise-2.0.1.tgz#2135d6dfa7a358c069ac9b178776288228450ffa" - dependencies: - pinkie "^2.0.0" - - pinkie@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/pinkie/-/pinkie-1.0.0.tgz#5a47f28ba1015d0201bda7bf0f358e47bec8c7e4" - - pinkie@^2.0.0: - version "2.0.4" - resolved "https://registry.yarnpkg.com/pinkie/-/pinkie-2.0.4.tgz#72556b80cfa0d48a974e80e77248e80ed4f7f870" - - pkg-conf@^2.0.0: - version "2.1.0" - resolved "https://registry.yarnpkg.com/pkg-conf/-/pkg-conf-2.1.0.tgz#2126514ca6f2abfebd168596df18ba57867f0058" - dependencies: - find-up "^2.0.0" - load-json-file "^4.0.0" - - pkg-dir@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/pkg-dir/-/pkg-dir-2.0.0.tgz#f6d5d1109e19d63edf428e0bd57e12777615334b" - dependencies: - find-up "^2.1.0" - - pkginfo@0.4.1: - version "0.4.1" - resolved "https://registry.yarnpkg.com/pkginfo/-/pkginfo-0.4.1.tgz#b5418ef0439de5425fc4995042dced14fb2a84ff" - - plist@^2.1.0: - version "2.1.0" - resolved "https://registry.yarnpkg.com/plist/-/plist-2.1.0.tgz#57ccdb7a0821df21831217a3cad54e3e146a1025" - dependencies: - base64-js "1.2.0" - xmlbuilder "8.2.2" - xmldom "0.1.x" - - plur@^2.0.0, plur@^2.1.2: - version "2.1.2" - resolved "https://registry.yarnpkg.com/plur/-/plur-2.1.2.tgz#7482452c1a0f508e3e344eaec312c91c29dc655a" - dependencies: - irregular-plurals "^1.0.0" - - pluralize@^7.0.0: - version "7.0.0" - resolved "https://registry.yarnpkg.com/pluralize/-/pluralize-7.0.0.tgz#298b89df8b93b0221dbf421ad2b1b1ea23fc6777" - - postcss-calc@^5.2.0: - version "5.3.1" - resolved "https://registry.yarnpkg.com/postcss-calc/-/postcss-calc-5.3.1.tgz#77bae7ca928ad85716e2fda42f261bf7c1d65b5e" - dependencies: - postcss "^5.0.2" - postcss-message-helpers "^2.0.0" - reduce-css-calc "^1.2.6" - - postcss-colormin@^2.1.8: - version "2.2.2" - resolved "https://registry.yarnpkg.com/postcss-colormin/-/postcss-colormin-2.2.2.tgz#6631417d5f0e909a3d7ec26b24c8a8d1e4f96e4b" - dependencies: - colormin "^1.0.5" - postcss "^5.0.13" - postcss-value-parser "^3.2.3" - - postcss-convert-values@^2.3.4: - version "2.6.1" - resolved "https://registry.yarnpkg.com/postcss-convert-values/-/postcss-convert-values-2.6.1.tgz#bbd8593c5c1fd2e3d1c322bb925dcae8dae4d62d" - dependencies: - postcss "^5.0.11" - postcss-value-parser "^3.1.2" - - postcss-discard-comments@^2.0.4: - version "2.0.4" - resolved "https://registry.yarnpkg.com/postcss-discard-comments/-/postcss-discard-comments-2.0.4.tgz#befe89fafd5b3dace5ccce51b76b81514be00e3d" - dependencies: - postcss "^5.0.14" - - postcss-discard-duplicates@^2.0.1: - version "2.1.0" - resolved "https://registry.yarnpkg.com/postcss-discard-duplicates/-/postcss-discard-duplicates-2.1.0.tgz#b9abf27b88ac188158a5eb12abcae20263b91932" - dependencies: - postcss "^5.0.4" - - postcss-discard-empty@^2.0.1: - version "2.1.0" - resolved "https://registry.yarnpkg.com/postcss-discard-empty/-/postcss-discard-empty-2.1.0.tgz#d2b4bd9d5ced5ebd8dcade7640c7d7cd7f4f92b5" - dependencies: - postcss "^5.0.14" - - postcss-discard-overridden@^0.1.1: - version "0.1.1" - resolved "https://registry.yarnpkg.com/postcss-discard-overridden/-/postcss-discard-overridden-0.1.1.tgz#8b1eaf554f686fb288cd874c55667b0aa3668d58" - dependencies: - postcss "^5.0.16" - - postcss-discard-unused@^2.2.1: - version "2.2.3" - resolved "https://registry.yarnpkg.com/postcss-discard-unused/-/postcss-discard-unused-2.2.3.tgz#bce30b2cc591ffc634322b5fb3464b6d934f4433" - dependencies: - postcss "^5.0.14" - uniqs "^2.0.0" - - postcss-filter-plugins@^2.0.0: - version "2.0.2" - resolved "https://registry.yarnpkg.com/postcss-filter-plugins/-/postcss-filter-plugins-2.0.2.tgz#6d85862534d735ac420e4a85806e1f5d4286d84c" - dependencies: - postcss "^5.0.4" - uniqid "^4.0.0" - - postcss-merge-idents@^2.1.5: - version "2.1.7" - resolved "https://registry.yarnpkg.com/postcss-merge-idents/-/postcss-merge-idents-2.1.7.tgz#4c5530313c08e1d5b3bbf3d2bbc747e278eea270" - dependencies: - has "^1.0.1" - postcss "^5.0.10" - postcss-value-parser "^3.1.1" - - postcss-merge-longhand@^2.0.1: - version "2.0.2" - resolved "https://registry.yarnpkg.com/postcss-merge-longhand/-/postcss-merge-longhand-2.0.2.tgz#23d90cd127b0a77994915332739034a1a4f3d658" - dependencies: - postcss "^5.0.4" - - postcss-merge-rules@^2.0.3: - version "2.1.2" - resolved "https://registry.yarnpkg.com/postcss-merge-rules/-/postcss-merge-rules-2.1.2.tgz#d1df5dfaa7b1acc3be553f0e9e10e87c61b5f721" - dependencies: - browserslist "^1.5.2" - caniuse-api "^1.5.2" - postcss "^5.0.4" - postcss-selector-parser "^2.2.2" - vendors "^1.0.0" - - postcss-message-helpers@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/postcss-message-helpers/-/postcss-message-helpers-2.0.0.tgz#a4f2f4fab6e4fe002f0aed000478cdf52f9ba60e" - - postcss-minify-font-values@^1.0.2: - version "1.0.5" - resolved "https://registry.yarnpkg.com/postcss-minify-font-values/-/postcss-minify-font-values-1.0.5.tgz#4b58edb56641eba7c8474ab3526cafd7bbdecb69" - dependencies: - object-assign "^4.0.1" - postcss "^5.0.4" - postcss-value-parser "^3.0.2" - - postcss-minify-gradients@^1.0.1: - version "1.0.5" - resolved "https://registry.yarnpkg.com/postcss-minify-gradients/-/postcss-minify-gradients-1.0.5.tgz#5dbda11373703f83cfb4a3ea3881d8d75ff5e6e1" - dependencies: - postcss "^5.0.12" - postcss-value-parser "^3.3.0" - - postcss-minify-params@^1.0.4: - version "1.2.2" - resolved "https://registry.yarnpkg.com/postcss-minify-params/-/postcss-minify-params-1.2.2.tgz#ad2ce071373b943b3d930a3fa59a358c28d6f1f3" - dependencies: - alphanum-sort "^1.0.1" - postcss "^5.0.2" - postcss-value-parser "^3.0.2" - uniqs "^2.0.0" - - postcss-minify-selectors@^2.0.4: - version "2.1.1" - resolved "https://registry.yarnpkg.com/postcss-minify-selectors/-/postcss-minify-selectors-2.1.1.tgz#b2c6a98c0072cf91b932d1a496508114311735bf" - dependencies: - alphanum-sort "^1.0.2" - has "^1.0.1" - postcss "^5.0.14" - postcss-selector-parser "^2.0.0" - - postcss-modules-extract-imports@^1.2.0: - version "1.2.0" - resolved "https://registry.yarnpkg.com/postcss-modules-extract-imports/-/postcss-modules-extract-imports-1.2.0.tgz#66140ecece38ef06bf0d3e355d69bf59d141ea85" - dependencies: - postcss "^6.0.1" - - postcss-modules-local-by-default@^1.2.0: - version "1.2.0" - resolved "https://registry.yarnpkg.com/postcss-modules-local-by-default/-/postcss-modules-local-by-default-1.2.0.tgz#f7d80c398c5a393fa7964466bd19500a7d61c069" - dependencies: - css-selector-tokenizer "^0.7.0" - postcss "^6.0.1" - - postcss-modules-scope@^1.1.0: - version "1.1.0" - resolved "https://registry.yarnpkg.com/postcss-modules-scope/-/postcss-modules-scope-1.1.0.tgz#d6ea64994c79f97b62a72b426fbe6056a194bb90" - dependencies: - css-selector-tokenizer "^0.7.0" - postcss "^6.0.1" - - postcss-modules-values@^1.3.0: - version "1.3.0" - resolved "https://registry.yarnpkg.com/postcss-modules-values/-/postcss-modules-values-1.3.0.tgz#ecffa9d7e192518389f42ad0e83f72aec456ea20" - dependencies: - icss-replace-symbols "^1.1.0" - postcss "^6.0.1" - - postcss-normalize-charset@^1.1.0: - version "1.1.1" - resolved "https://registry.yarnpkg.com/postcss-normalize-charset/-/postcss-normalize-charset-1.1.1.tgz#ef9ee71212d7fe759c78ed162f61ed62b5cb93f1" - dependencies: - postcss "^5.0.5" - - postcss-normalize-url@^3.0.7: - version "3.0.8" - resolved "https://registry.yarnpkg.com/postcss-normalize-url/-/postcss-normalize-url-3.0.8.tgz#108f74b3f2fcdaf891a2ffa3ea4592279fc78222" - dependencies: - is-absolute-url "^2.0.0" - normalize-url "^1.4.0" - postcss "^5.0.14" - postcss-value-parser "^3.2.3" - - postcss-ordered-values@^2.1.0: - version "2.2.3" - resolved "https://registry.yarnpkg.com/postcss-ordered-values/-/postcss-ordered-values-2.2.3.tgz#eec6c2a67b6c412a8db2042e77fe8da43f95c11d" - dependencies: - postcss "^5.0.4" - postcss-value-parser "^3.0.1" - - postcss-reduce-idents@^2.2.2: - version "2.4.0" - resolved "https://registry.yarnpkg.com/postcss-reduce-idents/-/postcss-reduce-idents-2.4.0.tgz#c2c6d20cc958284f6abfbe63f7609bf409059ad3" - dependencies: - postcss "^5.0.4" - postcss-value-parser "^3.0.2" - - postcss-reduce-initial@^1.0.0: - version "1.0.1" - resolved "https://registry.yarnpkg.com/postcss-reduce-initial/-/postcss-reduce-initial-1.0.1.tgz#68f80695f045d08263a879ad240df8dd64f644ea" - dependencies: - postcss "^5.0.4" - - postcss-reduce-transforms@^1.0.3: - version "1.0.4" - resolved "https://registry.yarnpkg.com/postcss-reduce-transforms/-/postcss-reduce-transforms-1.0.4.tgz#ff76f4d8212437b31c298a42d2e1444025771ae1" - dependencies: - has "^1.0.1" - postcss "^5.0.8" - postcss-value-parser "^3.0.1" - - postcss-selector-parser@^2.0.0, postcss-selector-parser@^2.2.2: - version "2.2.3" - resolved "https://registry.yarnpkg.com/postcss-selector-parser/-/postcss-selector-parser-2.2.3.tgz#f9437788606c3c9acee16ffe8d8b16297f27bb90" - dependencies: - flatten "^1.0.2" - indexes-of "^1.0.1" - uniq "^1.0.1" - - postcss-svgo@^2.1.1: - version "2.1.6" - resolved "https://registry.yarnpkg.com/postcss-svgo/-/postcss-svgo-2.1.6.tgz#b6df18aa613b666e133f08adb5219c2684ac108d" - dependencies: - is-svg "^2.0.0" - postcss "^5.0.14" - postcss-value-parser "^3.2.3" - svgo "^0.7.0" - - postcss-unique-selectors@^2.0.2: - version "2.0.2" - resolved "https://registry.yarnpkg.com/postcss-unique-selectors/-/postcss-unique-selectors-2.0.2.tgz#981d57d29ddcb33e7b1dfe1fd43b8649f933ca1d" - dependencies: - alphanum-sort "^1.0.1" - postcss "^5.0.4" - uniqs "^2.0.0" - - postcss-value-parser@^3.0.1, postcss-value-parser@^3.0.2, postcss-value-parser@^3.1.1, postcss-value-parser@^3.1.2, postcss-value-parser@^3.2.3, postcss-value-parser@^3.3.0: - version "3.3.0" - resolved "https://registry.yarnpkg.com/postcss-value-parser/-/postcss-value-parser-3.3.0.tgz#87f38f9f18f774a4ab4c8a232f5c5ce8872a9d15" - - postcss-zindex@^2.0.1: - version "2.2.0" - resolved "https://registry.yarnpkg.com/postcss-zindex/-/postcss-zindex-2.2.0.tgz#d2109ddc055b91af67fc4cb3b025946639d2af22" - dependencies: - has "^1.0.1" - postcss "^5.0.4" - uniqs "^2.0.0" - - postcss@^5.0.10, postcss@^5.0.11, postcss@^5.0.12, postcss@^5.0.13, postcss@^5.0.14, postcss@^5.0.16, postcss@^5.0.2, postcss@^5.0.4, postcss@^5.0.5, postcss@^5.0.6, postcss@^5.0.8, postcss@^5.2.16: - version "5.2.18" - resolved "https://registry.yarnpkg.com/postcss/-/postcss-5.2.18.tgz#badfa1497d46244f6390f58b319830d9107853c5" - dependencies: - chalk "^1.1.3" - js-base64 "^2.1.9" - source-map "^0.5.6" - supports-color "^3.2.3" - - postcss@^6.0.1: - version "6.0.19" - resolved "https://registry.yarnpkg.com/postcss/-/postcss-6.0.19.tgz#76a78386f670b9d9494a655bf23ac012effd1555" - dependencies: - chalk "^2.3.1" - source-map "^0.6.1" - supports-color "^5.2.0" - - prelude-ls@~1.1.2: - version "1.1.2" - resolved "https://registry.yarnpkg.com/prelude-ls/-/prelude-ls-1.1.2.tgz#21932a549f5e52ffd9a827f570e04be62a97da54" - - prepend-http@^1.0.0, prepend-http@^1.0.1: - version "1.0.4" - resolved "https://registry.yarnpkg.com/prepend-http/-/prepend-http-1.0.4.tgz#d4f4562b0ce3696e41ac52d0e002e57a635dc6dc" - - preserve@^0.2.0: - version "0.2.0" - resolved "https://registry.yarnpkg.com/preserve/-/preserve-0.2.0.tgz#815ed1f6ebc65926f865b310c0713bcb3315ce4b" - - prettier@1.11.1: - version "1.11.1" - resolved "https://registry.yarnpkg.com/prettier/-/prettier-1.11.1.tgz#61e43fc4cd44e68f2b0dfc2c38cd4bb0fccdcc75" - - pretty-bytes@^1.0.2: - version "1.0.4" - resolved "https://registry.yarnpkg.com/pretty-bytes/-/pretty-bytes-1.0.4.tgz#0a22e8210609ad35542f8c8d5d2159aff0751c84" - dependencies: - get-stdin "^4.0.1" - meow "^3.1.0" - - pretty-ms@^0.2.1: - version "0.2.2" - resolved "https://registry.yarnpkg.com/pretty-ms/-/pretty-ms-0.2.2.tgz#da879a682ff33a37011046f13d627f67c73b84f6" - dependencies: - parse-ms "^0.1.0" - - pretty-ms@^3.0.0: - version "3.1.0" - resolved "https://registry.yarnpkg.com/pretty-ms/-/pretty-ms-3.1.0.tgz#e9cac9c76bf6ee52fe942dd9c6c4213153b12881" - dependencies: - parse-ms "^1.0.0" - plur "^2.1.2" - - private@^0.1.7, private@~0.1.5: - version "0.1.8" - resolved "https://registry.yarnpkg.com/private/-/private-0.1.8.tgz#2381edb3689f7a53d653190060fcf822d2f368ff" - - process-nextick-args@~2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/process-nextick-args/-/process-nextick-args-2.0.0.tgz#a37d732f4271b4ab1ad070d35508e8290788ffaa" - - process@^0.11.10: - version "0.11.10" - resolved "https://registry.yarnpkg.com/process/-/process-0.11.10.tgz#7332300e840161bda3e69a1d1d91a7d4bc16f182" - - progress-stream@^1.1.0: - version "1.2.0" - resolved "https://registry.yarnpkg.com/progress-stream/-/progress-stream-1.2.0.tgz#2cd3cfea33ba3a89c9c121ec3347abe9ab125f77" - dependencies: - speedometer "~0.1.2" - through2 "~0.2.3" - - progress@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/progress/-/progress-2.0.0.tgz#8a1be366bf8fc23db2bd23f10c6fe920b4389d1f" - - promise-inflight@^1.0.1: - version "1.0.1" - resolved "https://registry.yarnpkg.com/promise-inflight/-/promise-inflight-1.0.1.tgz#98472870bf228132fcbdd868129bad12c3c029e3" - - promise@^7.1.1: - version "7.3.1" - resolved "https://registry.yarnpkg.com/promise/-/promise-7.3.1.tgz#064b72602b18f90f29192b8b1bc418ffd1ebd3bf" - dependencies: - asap "~2.0.3" - - prop-types@^15.5.10: - version "15.6.1" - resolved "https://registry.yarnpkg.com/prop-types/-/prop-types-15.6.1.tgz#36644453564255ddda391191fb3a125cbdf654ca" - dependencies: - fbjs "^0.8.16" - loose-envify "^1.3.1" - object-assign "^4.1.1" - - prop-types@^15.6.0: - version "15.6.0" - resolved "https://registry.yarnpkg.com/prop-types/-/prop-types-15.6.0.tgz#ceaf083022fc46b4a35f69e13ef75aed0d639856" - dependencies: - fbjs "^0.8.16" - loose-envify "^1.3.1" - object-assign "^4.1.1" - - protocols@^1.1.0, protocols@^1.4.0: - version "1.4.6" - resolved "https://registry.yarnpkg.com/protocols/-/protocols-1.4.6.tgz#f8bb263ea1b5fd7a7604d26b8be39bd77678bf8a" - - proxyquire@1.8.0: - version "1.8.0" - resolved "https://registry.yarnpkg.com/proxyquire/-/proxyquire-1.8.0.tgz#02d514a5bed986f04cbb2093af16741535f79edc" - dependencies: - fill-keys "^1.0.2" - module-not-found-error "^1.0.0" - resolve "~1.1.7" - - prr@~1.0.1: - version "1.0.1" - resolved "https://registry.yarnpkg.com/prr/-/prr-1.0.1.tgz#d3fc114ba06995a45ec6893f484ceb1d78f5f476" - - pseudomap@^1.0.2: - version "1.0.2" - resolved "https://registry.yarnpkg.com/pseudomap/-/pseudomap-1.0.2.tgz#f052a28da70e618917ef0a8ac34c1ae5a68286b3" - - public-encrypt@^4.0.0: - version "4.0.0" - resolved "https://registry.yarnpkg.com/public-encrypt/-/public-encrypt-4.0.0.tgz#39f699f3a46560dd5ebacbca693caf7c65c18cc6" - dependencies: - bn.js "^4.1.0" - browserify-rsa "^4.0.0" - create-hash "^1.1.0" - parse-asn1 "^5.0.0" - randombytes "^2.0.1" - - pump@^2.0.0, pump@^2.0.1: - version "2.0.1" - resolved "https://registry.yarnpkg.com/pump/-/pump-2.0.1.tgz#12399add6e4cf7526d973cbc8b5ce2e2908b3909" - dependencies: - end-of-stream "^1.1.0" - once "^1.3.1" - - pumpify@^1.3.3: - version "1.4.0" - resolved "https://registry.yarnpkg.com/pumpify/-/pumpify-1.4.0.tgz#80b7c5df7e24153d03f0e7ac8a05a5d068bd07fb" - dependencies: - duplexify "^3.5.3" - inherits "^2.0.3" - pump "^2.0.0" - - punycode@1.3.2: - version "1.3.2" - resolved "https://registry.yarnpkg.com/punycode/-/punycode-1.3.2.tgz#9653a036fb7c1ee42342f2325cceefea3926c48d" - - punycode@^1.2.4, punycode@^1.4.1: - version "1.4.1" - resolved "https://registry.yarnpkg.com/punycode/-/punycode-1.4.1.tgz#c0d5a63b2718800ad8e1eb0fa5269c84dd41845e" - - q@^1.1.2, q@~1.5.0: - version "1.5.1" - resolved "https://registry.yarnpkg.com/q/-/q-1.5.1.tgz#7e32f75b41381291d04611f1bf14109ac00651d7" - - qs@~6.4.0: - version "6.4.0" - resolved "https://registry.yarnpkg.com/qs/-/qs-6.4.0.tgz#13e26d28ad6b0ffaa91312cd3bf708ed351e7233" - - qs@~6.5.1: - version "6.5.1" - resolved "https://registry.yarnpkg.com/qs/-/qs-6.5.1.tgz#349cdf6eef89ec45c12d7d5eb3fc0c870343a6d8" - - query-string@^4.1.0: - version "4.3.4" - resolved "https://registry.yarnpkg.com/query-string/-/query-string-4.3.4.tgz#bbb693b9ca915c232515b228b1a02b609043dbeb" - dependencies: - object-assign "^4.1.0" - strict-uri-encode "^1.0.0" - - querystring-es3@^0.2.0: - version "0.2.1" - resolved "https://registry.yarnpkg.com/querystring-es3/-/querystring-es3-0.2.1.tgz#9ec61f79049875707d69414596fd907a4d711e73" - - querystring@0.2.0: - version "0.2.0" - resolved "https://registry.yarnpkg.com/querystring/-/querystring-0.2.0.tgz#b209849203bb25df820da756e747005878521620" - - randomatic@^1.1.3: - version "1.1.7" - resolved "https://registry.yarnpkg.com/randomatic/-/randomatic-1.1.7.tgz#c7abe9cc8b87c0baa876b19fde83fd464797e38c" - dependencies: - is-number "^3.0.0" - kind-of "^4.0.0" - - randombytes@^2.0.0, randombytes@^2.0.1, randombytes@^2.0.5: - version "2.0.6" - resolved "https://registry.yarnpkg.com/randombytes/-/randombytes-2.0.6.tgz#d302c522948588848a8d300c932b44c24231da80" - dependencies: - safe-buffer "^5.1.0" - - randomfill@^1.0.3: - version "1.0.4" - resolved "https://registry.yarnpkg.com/randomfill/-/randomfill-1.0.4.tgz#c92196fc86ab42be983f1bf31778224931d61458" - dependencies: - randombytes "^2.0.5" - safe-buffer "^5.1.0" - - rc@1.2.3, rc@^1.0.1, rc@^1.1.2, rc@^1.1.6, rc@^1.1.7, rc@^1.2.1: - version "1.2.3" - resolved "https://registry.yarnpkg.com/rc/-/rc-1.2.3.tgz#51575a900f8dd68381c710b4712c2154c3e2035b" - dependencies: - deep-extend "~0.4.0" - ini "~1.3.0" - minimist "^1.2.0" - strip-json-comments "~2.0.1" - - react-deep-force-update@2.1.1: - version "2.1.1" - resolved "https://registry.yarnpkg.com/react-deep-force-update/-/react-deep-force-update-2.1.1.tgz#8ea4263cd6455a050b37445b3f08fd839d86e909" - - react-dom@16.2.0: - version "16.2.0" - resolved "https://registry.yarnpkg.com/react-dom/-/react-dom-16.2.0.tgz#69003178601c0ca19b709b33a83369fe6124c044" - dependencies: - fbjs "^0.8.16" - loose-envify "^1.1.0" - object-assign "^4.1.1" - prop-types "^15.6.0" - - react-redux@5.0.7: - version "5.0.7" - resolved "https://registry.yarnpkg.com/react-redux/-/react-redux-5.0.7.tgz#0dc1076d9afb4670f993ffaef44b8f8c1155a4c8" - dependencies: - hoist-non-react-statics "^2.5.0" - invariant "^2.0.0" - lodash "^4.17.5" - lodash-es "^4.17.5" - loose-envify "^1.1.0" - prop-types "^15.6.0" - - react@16.2.0: - version "16.2.0" - resolved "https://registry.yarnpkg.com/react/-/react-16.2.0.tgz#a31bd2dab89bff65d42134fa187f24d054c273ba" - dependencies: - fbjs "^0.8.16" - loose-envify "^1.1.0" - object-assign "^4.1.1" - prop-types "^15.6.0" - - read-config-file@3.0.0: - version "3.0.0" - resolved "https://registry.yarnpkg.com/read-config-file/-/read-config-file-3.0.0.tgz#771def5184a7f76abaf6b2c82f20cb983775b8ea" - dependencies: - ajv "^6.1.1" - ajv-keywords "^3.1.0" - bluebird-lst "^1.0.5" - dotenv "^5.0.0" - dotenv-expand "^4.0.1" - fs-extra-p "^4.5.0" - js-yaml "^3.10.0" - json5 "^0.5.1" - lazy-val "^1.0.3" - - read-pkg-up@^1.0.1: - version "1.0.1" - resolved "https://registry.yarnpkg.com/read-pkg-up/-/read-pkg-up-1.0.1.tgz#9d63c13276c065918d57f002a57f40a1b643fb02" - dependencies: - find-up "^1.0.0" - read-pkg "^1.0.0" - - read-pkg-up@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/read-pkg-up/-/read-pkg-up-2.0.0.tgz#6b72a8048984e0c41e79510fd5e9fa99b3b549be" - dependencies: - find-up "^2.0.0" - read-pkg "^2.0.0" - - read-pkg@^1.0.0: - version "1.1.0" - resolved "https://registry.yarnpkg.com/read-pkg/-/read-pkg-1.1.0.tgz#f5ffaa5ecd29cb31c0474bca7d756b6bb29e3f28" - dependencies: - load-json-file "^1.0.0" - normalize-package-data "^2.3.2" - path-type "^1.0.0" - - read-pkg@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/read-pkg/-/read-pkg-2.0.0.tgz#8ef1c0623c6a6db0dc6713c4bfac46332b2368f8" - dependencies: - load-json-file "^2.0.0" - normalize-package-data "^2.3.2" - path-type "^2.0.0" - - "readable-stream@1 || 2", readable-stream@^2.0.0, readable-stream@^2.0.1, readable-stream@^2.0.2, readable-stream@^2.0.4, readable-stream@^2.0.5, readable-stream@^2.0.6, readable-stream@^2.1.4, readable-stream@^2.1.5, readable-stream@^2.2.2, readable-stream@^2.3.3: - version "2.3.4" - resolved "https://registry.yarnpkg.com/readable-stream/-/readable-stream-2.3.4.tgz#c946c3f47fa7d8eabc0b6150f4a12f69a4574071" - dependencies: - core-util-is "~1.0.0" - inherits "~2.0.3" - isarray "~1.0.0" - process-nextick-args "~2.0.0" - safe-buffer "~5.1.1" - string_decoder "~1.0.3" - util-deprecate "~1.0.1" - - readable-stream@~1.1.9: - version "1.1.14" - resolved "https://registry.yarnpkg.com/readable-stream/-/readable-stream-1.1.14.tgz#7cf4c54ef648e3813084c636dd2079e166c081d9" - dependencies: - core-util-is "~1.0.0" - inherits "~2.0.1" - isarray "0.0.1" - string_decoder "~0.10.x" - - readdirp@^2.0.0: - version "2.1.0" - resolved "https://registry.yarnpkg.com/readdirp/-/readdirp-2.1.0.tgz#4ed0ad060df3073300c48440373f72d1cc642d78" - dependencies: - graceful-fs "^4.1.2" - minimatch "^3.0.2" - readable-stream "^2.0.2" - set-immediate-shim "^1.0.1" - - recast@0.13.0: - version "0.13.0" - resolved "https://registry.yarnpkg.com/recast/-/recast-0.13.0.tgz#a343a394a37d24668d700f88ed04b8d2c314d40d" - dependencies: - ast-types "0.10.1" - esprima "~4.0.0" - private "~0.1.5" - source-map "~0.6.1" - - redent@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/redent/-/redent-1.0.0.tgz#cf916ab1fd5f1f16dfb20822dd6ec7f730c2afde" - dependencies: - indent-string "^2.1.0" - strip-indent "^1.0.1" - - reduce-css-calc@^1.2.6: - version "1.3.0" - resolved "https://registry.yarnpkg.com/reduce-css-calc/-/reduce-css-calc-1.3.0.tgz#747c914e049614a4c9cfbba629871ad1d2927716" - dependencies: - balanced-match "^0.4.2" - math-expression-evaluator "^1.2.14" - reduce-function-call "^1.0.1" - - reduce-function-call@^1.0.1: - version "1.0.2" - resolved "https://registry.yarnpkg.com/reduce-function-call/-/reduce-function-call-1.0.2.tgz#5a200bf92e0e37751752fe45b0ab330fd4b6be99" - dependencies: - balanced-match "^0.4.2" - - redux-thunk@2.2.0: - version "2.2.0" - resolved "https://registry.yarnpkg.com/redux-thunk/-/redux-thunk-2.2.0.tgz#e615a16e16b47a19a515766133d1e3e99b7852e5" - - redux@3.7.2: - version "3.7.2" - resolved "https://registry.yarnpkg.com/redux/-/redux-3.7.2.tgz#06b73123215901d25d065be342eb026bc1c8537b" - dependencies: - lodash "^4.2.1" - lodash-es "^4.2.1" - loose-envify "^1.1.0" - symbol-observable "^1.0.3" - - regenerate@^1.2.1: - version "1.3.3" - resolved "https://registry.yarnpkg.com/regenerate/-/regenerate-1.3.3.tgz#0c336d3980553d755c39b586ae3b20aa49c82b7f" - - regenerator-runtime@^0.10.5: - version "0.10.5" - resolved "https://registry.yarnpkg.com/regenerator-runtime/-/regenerator-runtime-0.10.5.tgz#336c3efc1220adcedda2c9fab67b5a7955a33658" - - regenerator-runtime@^0.11.0: - version "0.11.1" - resolved "https://registry.yarnpkg.com/regenerator-runtime/-/regenerator-runtime-0.11.1.tgz#be05ad7f9bf7d22e056f9726cee5017fbf19e2e9" - - regex-cache@^0.4.2: - version "0.4.4" - resolved "https://registry.yarnpkg.com/regex-cache/-/regex-cache-0.4.4.tgz#75bdc58a2a1496cec48a12835bc54c8d562336dd" - dependencies: - is-equal-shallow "^0.1.3" - - regexpu-core@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/regexpu-core/-/regexpu-core-1.0.0.tgz#86a763f58ee4d7c2f6b102e4764050de7ed90c6b" - dependencies: - regenerate "^1.2.1" - regjsgen "^0.2.0" - regjsparser "^0.1.4" - - regexpu-core@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/regexpu-core/-/regexpu-core-2.0.0.tgz#49d038837b8dcf8bfa5b9a42139938e6ea2ae240" - dependencies: - regenerate "^1.2.1" - regjsgen "^0.2.0" - regjsparser "^0.1.4" - - registry-auth-token@^3.0.1: - version "3.3.2" - resolved "https://registry.yarnpkg.com/registry-auth-token/-/registry-auth-token-3.3.2.tgz#851fd49038eecb586911115af845260eec983f20" - dependencies: - rc "^1.1.6" - safe-buffer "^5.0.1" - - registry-url@^3.0.3: - version "3.1.0" - resolved "https://registry.yarnpkg.com/registry-url/-/registry-url-3.1.0.tgz#3d4ef870f73dde1d77f0cf9a381432444e174942" - dependencies: - rc "^1.0.1" - - regjsgen@^0.2.0: - version "0.2.0" - resolved "https://registry.yarnpkg.com/regjsgen/-/regjsgen-0.2.0.tgz#6c016adeac554f75823fe37ac05b92d5a4edb1f7" - - regjsparser@^0.1.4: - version "0.1.5" - resolved "https://registry.yarnpkg.com/regjsparser/-/regjsparser-0.1.5.tgz#7ee8f84dc6fa792d3fd0ae228d24bd949ead205c" - dependencies: - jsesc "~0.5.0" - - release-zalgo@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/release-zalgo/-/release-zalgo-1.0.0.tgz#09700b7e5074329739330e535c5a90fb67851730" - dependencies: - es6-error "^4.0.1" - - remove-trailing-separator@^1.0.1: - version "1.1.0" - resolved "https://registry.yarnpkg.com/remove-trailing-separator/-/remove-trailing-separator-1.1.0.tgz#c24bce2a283adad5bc3f58e0d48249b92379d8ef" - - repeat-element@^1.1.2: - version "1.1.2" - resolved "https://registry.yarnpkg.com/repeat-element/-/repeat-element-1.1.2.tgz#ef089a178d1483baae4d93eb98b4f9e4e11d990a" - - repeat-string@^1.5.2: - version "1.6.1" - resolved "https://registry.yarnpkg.com/repeat-string/-/repeat-string-1.6.1.tgz#8dcae470e1c88abc2d600fff4a776286da75e637" - - repeating@^2.0.0: - version "2.0.1" - resolved "https://registry.yarnpkg.com/repeating/-/repeating-2.0.1.tgz#5214c53a926d3552707527fbab415dbc08d06dda" - dependencies: - is-finite "^1.0.0" - - request@2, request@^2.45.0, request@^2.81.0, request@~2.83.0: - version "2.83.0" - resolved "https://registry.yarnpkg.com/request/-/request-2.83.0.tgz#ca0b65da02ed62935887808e6f510381034e3356" - dependencies: - aws-sign2 "~0.7.0" - aws4 "^1.6.0" - caseless "~0.12.0" - combined-stream "~1.0.5" - extend "~3.0.1" - forever-agent "~0.6.1" - form-data "~2.3.1" - har-validator "~5.0.3" - hawk "~6.0.2" - http-signature "~1.2.0" - is-typedarray "~1.0.0" - isstream "~0.1.2" - json-stringify-safe "~5.0.1" - mime-types "~2.1.17" - oauth-sign "~0.8.2" - performance-now "^2.1.0" - qs "~6.5.1" - safe-buffer "^5.1.1" - stringstream "~0.0.5" - tough-cookie "~2.3.3" - tunnel-agent "^0.6.0" - uuid "^3.1.0" - - request@2.81.0: - version "2.81.0" - resolved "https://registry.yarnpkg.com/request/-/request-2.81.0.tgz#c6928946a0e06c5f8d6f8a9333469ffda46298a0" - dependencies: - aws-sign2 "~0.6.0" - aws4 "^1.2.1" - caseless "~0.12.0" - combined-stream "~1.0.5" - extend "~3.0.0" - forever-agent "~0.6.1" - form-data "~2.1.1" - har-validator "~4.2.1" - hawk "~3.1.3" - http-signature "~1.1.0" - is-typedarray "~1.0.0" - isstream "~0.1.2" - json-stringify-safe "~5.0.1" - mime-types "~2.1.7" - oauth-sign "~0.8.1" - performance-now "^0.2.0" - qs "~6.4.0" - safe-buffer "^5.0.1" - stringstream "~0.0.4" - tough-cookie "~2.3.0" - tunnel-agent "^0.6.0" - uuid "^3.0.0" - - require-directory@^2.1.1: - version "2.1.1" - resolved "https://registry.yarnpkg.com/require-directory/-/require-directory-2.1.1.tgz#8c64ad5fd30dab1c976e2344ffe7f792a6a6df42" - - require-main-filename@^1.0.1: - version "1.0.1" - resolved "https://registry.yarnpkg.com/require-main-filename/-/require-main-filename-1.0.1.tgz#97f717b69d48784f5f526a6c5aa8ffdda055a4d1" - - require-precompiled@^0.1.0: - version "0.1.0" - resolved "https://registry.yarnpkg.com/require-precompiled/-/require-precompiled-0.1.0.tgz#5a1b52eb70ebed43eb982e974c85ab59571e56fa" - - require-uncached@^1.0.3: - version "1.0.3" - resolved "https://registry.yarnpkg.com/require-uncached/-/require-uncached-1.0.3.tgz#4e0d56d6c9662fd31e43011c4b95aa49955421d3" - dependencies: - caller-path "^0.1.0" - resolve-from "^1.0.0" - - reselect@3.0.1: - version "3.0.1" - resolved "https://registry.yarnpkg.com/reselect/-/reselect-3.0.1.tgz#efdaa98ea7451324d092b2b2163a6a1d7a9a2147" - - resolve-cwd@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/resolve-cwd/-/resolve-cwd-2.0.0.tgz#00a9f7387556e27038eae232caa372a6a59b665a" - dependencies: - resolve-from "^3.0.0" - - resolve-from@^1.0.0: - version "1.0.1" - resolved "https://registry.yarnpkg.com/resolve-from/-/resolve-from-1.0.1.tgz#26cbfe935d1aeeeabb29bc3fe5aeb01e93d44226" - - resolve-from@^3.0.0: - version "3.0.0" - resolved "https://registry.yarnpkg.com/resolve-from/-/resolve-from-3.0.0.tgz#b22c7af7d9d6881bc8b6e653335eebcb0a188748" - - resolve-url@~0.2.1: - version "0.2.1" - resolved "https://registry.yarnpkg.com/resolve-url/-/resolve-url-0.2.1.tgz#2c637fe77c893afd2a663fe21aa9080068e2052a" - - resolve@~1.1.7: - version "1.1.7" - resolved "https://registry.yarnpkg.com/resolve/-/resolve-1.1.7.tgz#203114d82ad2c5ed9e8e0411b3932875e889e97b" - - restore-cursor@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/restore-cursor/-/restore-cursor-2.0.0.tgz#9f7ee287f82fd326d4fd162923d62129eee0dfaf" - dependencies: - onetime "^2.0.0" - signal-exit "^3.0.2" - - rgb2hex@~0.1.0: - version "0.1.0" - resolved "https://registry.yarnpkg.com/rgb2hex/-/rgb2hex-0.1.0.tgz#ccd55f860ae0c5c4ea37504b958e442d8d12325b" - - right-align@^0.1.1: - version "0.1.3" - resolved "https://registry.yarnpkg.com/right-align/-/right-align-0.1.3.tgz#61339b722fe6a3515689210d24e14c96148613ef" - dependencies: - align-text "^0.1.1" - - rimraf@2, rimraf@^2.2.8, rimraf@^2.5.1, rimraf@^2.5.2, rimraf@^2.5.4, rimraf@^2.6.1, rimraf@^2.6.2: - version "2.6.2" - resolved "https://registry.yarnpkg.com/rimraf/-/rimraf-2.6.2.tgz#2ed8150d24a16ea8651e6d6ef0f47c4158ce7a36" - dependencies: - glob "^7.0.5" - - ripemd160@^2.0.0, ripemd160@^2.0.1: - version "2.0.1" - resolved "https://registry.yarnpkg.com/ripemd160/-/ripemd160-2.0.1.tgz#0f4584295c53a3628af7e6d79aca21ce57d1c6e7" - dependencies: - hash-base "^2.0.0" - inherits "^2.0.1" - - run-async@^2.2.0: - version "2.3.0" - resolved "https://registry.yarnpkg.com/run-async/-/run-async-2.3.0.tgz#0371ab4ae0bdd720d4166d7dfda64ff7a445a6c0" - dependencies: - is-promise "^2.1.0" - - run-queue@^1.0.0, run-queue@^1.0.3: - version "1.0.3" - resolved "https://registry.yarnpkg.com/run-queue/-/run-queue-1.0.3.tgz#e848396f057d223f24386924618e25694161ec47" - dependencies: - aproba "^1.1.1" - - rx-lite-aggregates@^4.0.8: - version "4.0.8" - resolved "https://registry.yarnpkg.com/rx-lite-aggregates/-/rx-lite-aggregates-4.0.8.tgz#753b87a89a11c95467c4ac1626c4efc4e05c67be" - dependencies: - rx-lite "*" - - rx-lite@*, rx-lite@^4.0.8: - version "4.0.8" - resolved "https://registry.yarnpkg.com/rx-lite/-/rx-lite-4.0.8.tgz#0b1e11af8bc44836f04a6407e92da42467b79444" - - rxjs@^5.1.1, rxjs@^5.5.2: - version "5.5.6" - resolved "https://registry.yarnpkg.com/rxjs/-/rxjs-5.5.6.tgz#e31fb96d6fd2ff1fd84bcea8ae9c02d007179c02" - dependencies: - symbol-observable "1.0.1" - - safe-buffer@^5.0.1, safe-buffer@^5.1.0, safe-buffer@^5.1.1, safe-buffer@~5.1.0, safe-buffer@~5.1.1: - version "5.1.1" - resolved "https://registry.yarnpkg.com/safe-buffer/-/safe-buffer-5.1.1.tgz#893312af69b2123def71f57889001671eeb2c853" - - sanitize-filename@^1.6.1: - version "1.6.1" - resolved "https://registry.yarnpkg.com/sanitize-filename/-/sanitize-filename-1.6.1.tgz#612da1c96473fa02dccda92dcd5b4ab164a6772a" - dependencies: - truncate-utf8-bytes "^1.0.0" - - sax@^1.2.4, sax@~1.2.1: - version "1.2.4" - resolved "https://registry.yarnpkg.com/sax/-/sax-1.2.4.tgz#2816234e2378bddc4e5354fab5caa895df7100d9" - - schema-utils@^0.3.0: - version "0.3.0" - resolved "https://registry.yarnpkg.com/schema-utils/-/schema-utils-0.3.0.tgz#f5877222ce3e931edae039f17eb3716e7137f8cf" - dependencies: - ajv "^5.0.0" - - seamless-immutable@7.1.3: - version "7.1.3" - resolved "https://registry.yarnpkg.com/seamless-immutable/-/seamless-immutable-7.1.3.tgz#d32a8a202a331dffa69e4069a367a2159252490e" - - semver-diff@^2.0.0: - version "2.1.0" - resolved "https://registry.yarnpkg.com/semver-diff/-/semver-diff-2.1.0.tgz#4bbb8437c8d37e4b0cf1a68fd726ec6d645d6d36" - dependencies: - semver "^5.0.3" - - "semver@2 || 3 || 4 || 5", semver@5.5.0, semver@^5.0.3, semver@^5.1.0, semver@^5.3.0, semver@^5.4.1, semver@^5.5.0: - version "5.5.0" - resolved "https://registry.yarnpkg.com/semver/-/semver-5.5.0.tgz#dc4bbc7a6ca9d916dee5d43516f0092b58f7b8ab" - - semver@~5.3.0: - version "5.3.0" - resolved "https://registry.yarnpkg.com/semver/-/semver-5.3.0.tgz#9b2ce5d3de02d17c6012ad326aa6b4d0cf54f94f" - - serialize-error@^2.1.0: - version "2.1.0" - resolved "https://registry.yarnpkg.com/serialize-error/-/serialize-error-2.1.0.tgz#50b679d5635cdf84667bdc8e59af4e5b81d5f60a" - - serialize-javascript@^1.4.0: - version "1.4.0" - resolved "https://registry.yarnpkg.com/serialize-javascript/-/serialize-javascript-1.4.0.tgz#7c958514db6ac2443a8abc062dc9f7886a7f6005" - - set-blocking@^2.0.0, set-blocking@~2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/set-blocking/-/set-blocking-2.0.0.tgz#045f9782d011ae9a6803ddd382b24392b3d890f7" - - set-immediate-shim@^1.0.1: - version "1.0.1" - resolved "https://registry.yarnpkg.com/set-immediate-shim/-/set-immediate-shim-1.0.1.tgz#4b2b1b27eb808a9f8dcc481a58e5e56f599f3f61" - - setimmediate@^1.0.4, setimmediate@^1.0.5: - version "1.0.5" - resolved "https://registry.yarnpkg.com/setimmediate/-/setimmediate-1.0.5.tgz#290cbb232e306942d7d7ea9b83732ab7856f8285" - - sha.js@^2.4.0, sha.js@^2.4.8: - version "2.4.10" - resolved "https://registry.yarnpkg.com/sha.js/-/sha.js-2.4.10.tgz#b1fde5cd7d11a5626638a07c604ab909cfa31f9b" - dependencies: - inherits "^2.0.1" - safe-buffer "^5.0.1" - - shebang-command@^1.2.0: - version "1.2.0" - resolved "https://registry.yarnpkg.com/shebang-command/-/shebang-command-1.2.0.tgz#44aac65b695b03398968c39f363fee5deafdf1ea" - dependencies: - shebang-regex "^1.0.0" - - shebang-loader@0.0.1: - version "0.0.1" - resolved "https://registry.yarnpkg.com/shebang-loader/-/shebang-loader-0.0.1.tgz#a4000495d44cceefbec63435e7b1698569fa52ec" - - shebang-regex@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/shebang-regex/-/shebang-regex-1.0.0.tgz#da42f49740c0b42db2ca9728571cb190c98efea3" - - signal-exit@^3.0.0, signal-exit@^3.0.2: - version "3.0.2" - resolved "https://registry.yarnpkg.com/signal-exit/-/signal-exit-3.0.2.tgz#b5fdc08f1287ea1178628e415e25132b73646c6d" - - simple-swizzle@^0.2.2: - version "0.2.2" - resolved "https://registry.yarnpkg.com/simple-swizzle/-/simple-swizzle-0.2.2.tgz#a4da6b635ffcccca33f70d17cb92592de95e557a" - dependencies: - is-arrayish "^0.3.1" - - single-line-log@^1.1.2: - version "1.1.2" - resolved "https://registry.yarnpkg.com/single-line-log/-/single-line-log-1.1.2.tgz#c2f83f273a3e1a16edb0995661da0ed5ef033364" - dependencies: - string-width "^1.0.1" - - slash@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/slash/-/slash-1.0.0.tgz#c41f2f6c39fc16d1cd17ad4b5d896114ae470d55" - - slice-ansi@1.0.0, slice-ansi@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/slice-ansi/-/slice-ansi-1.0.0.tgz#044f1a49d8842ff307aad6b505ed178bd950134d" - dependencies: - is-fullwidth-code-point "^2.0.0" - - slide@^1.1.5: - version "1.1.6" - resolved "https://registry.yarnpkg.com/slide/-/slide-1.1.6.tgz#56eb027d65b4d2dce6cb2e2d32c4d4afc9e1d707" - - sntp@1.x.x: - version "1.0.9" - resolved "https://registry.yarnpkg.com/sntp/-/sntp-1.0.9.tgz#6541184cc90aeea6c6e7b35e2659082443c66198" - dependencies: - hoek "2.x.x" - - sntp@2.x.x: - version "2.1.0" - resolved "https://registry.yarnpkg.com/sntp/-/sntp-2.1.0.tgz#2c6cec14fedc2222739caf9b5c3d85d1cc5a2cc8" - dependencies: - hoek "4.x.x" - - sort-keys@^1.0.0: - version "1.1.2" - resolved "https://registry.yarnpkg.com/sort-keys/-/sort-keys-1.1.2.tgz#441b6d4d346798f1b4e49e8920adfba0e543f9ad" - dependencies: - is-plain-obj "^1.0.0" - - sort-keys@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/sort-keys/-/sort-keys-2.0.0.tgz#658535584861ec97d730d6cf41822e1f56684128" - dependencies: - is-plain-obj "^1.0.0" - - source-list-map@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/source-list-map/-/source-list-map-2.0.0.tgz#aaa47403f7b245a92fbc97ea08f250d6087ed085" - - source-map-resolve@^0.3.0: - version "0.3.1" - resolved "https://registry.yarnpkg.com/source-map-resolve/-/source-map-resolve-0.3.1.tgz#610f6122a445b8dd51535a2a71b783dfc1248761" - dependencies: - atob "~1.1.0" - resolve-url "~0.2.1" - source-map-url "~0.3.0" - urix "~0.1.0" - - source-map-support@^0.4.15: - version "0.4.18" - resolved "https://registry.yarnpkg.com/source-map-support/-/source-map-support-0.4.18.tgz#0286a6de8be42641338594e97ccea75f0a2c585f" - dependencies: - source-map "^0.5.6" - - source-map-support@^0.5.0, source-map-support@^0.5.3: - version "0.5.3" - resolved "https://registry.yarnpkg.com/source-map-support/-/source-map-support-0.5.3.tgz#2b3d5fff298cfa4d1afd7d4352d569e9a0158e76" - dependencies: - source-map "^0.6.0" - - source-map-url@~0.3.0: - version "0.3.0" - resolved "https://registry.yarnpkg.com/source-map-url/-/source-map-url-0.3.0.tgz#7ecaf13b57bcd09da8a40c5d269db33799d4aaf9" - - source-map@0.6.1, source-map@^0.6.0, source-map@^0.6.1, source-map@~0.6.1: - version "0.6.1" - resolved "https://registry.yarnpkg.com/source-map/-/source-map-0.6.1.tgz#74722af32e9614e9c287a8d0bbde48b5e2f1a263" - - source-map@^0.1.38: - version "0.1.43" - resolved "https://registry.yarnpkg.com/source-map/-/source-map-0.1.43.tgz#c24bc146ca517c1471f5dacbe2571b2b7f9e3346" - dependencies: - amdefine ">=0.0.4" - - source-map@^0.5.0, source-map@^0.5.3, source-map@^0.5.6, source-map@^0.5.7, source-map@~0.5.1: - version "0.5.7" - resolved "https://registry.yarnpkg.com/source-map/-/source-map-0.5.7.tgz#8a039d2d1021d22d1ea14c80d8ea468ba2ef3fcc" - - spawn-rx@^2.0.10: - version "2.0.12" - resolved "https://registry.yarnpkg.com/spawn-rx/-/spawn-rx-2.0.12.tgz#b6285294499426089beea0c3c1ec32d7fc57a376" - dependencies: - debug "^2.5.1" - lodash.assign "^4.2.0" - rxjs "^5.1.1" - - spdx-correct@~1.0.0: - version "1.0.2" - resolved "https://registry.yarnpkg.com/spdx-correct/-/spdx-correct-1.0.2.tgz#4b3073d933ff51f3912f03ac5519498a4150db40" - dependencies: - spdx-license-ids "^1.0.2" - - spdx-expression-parse@~1.0.0: - version "1.0.4" - resolved "https://registry.yarnpkg.com/spdx-expression-parse/-/spdx-expression-parse-1.0.4.tgz#9bdf2f20e1f40ed447fbe273266191fced51626c" - - spdx-license-ids@^1.0.2: - version "1.2.2" - resolved "https://registry.yarnpkg.com/spdx-license-ids/-/spdx-license-ids-1.2.2.tgz#c9df7a3424594ade6bd11900d596696dc06bac57" - - spectron@3.8.0: - version "3.8.0" - resolved "https://registry.yarnpkg.com/spectron/-/spectron-3.8.0.tgz#122c3562fd7e92b7cdf6f94094aa495b150dfa51" - dependencies: - dev-null "^0.1.1" - electron-chromedriver "~1.8.0" - request "^2.81.0" - split "^1.0.0" - webdriverio "^4.8.0" - - speedometer@~0.1.2: - version "0.1.4" - resolved "https://registry.yarnpkg.com/speedometer/-/speedometer-0.1.4.tgz#9876dbd2a169d3115402d48e6ea6329c8816a50d" - - split@^1.0.0: - version "1.0.1" - resolved "https://registry.yarnpkg.com/split/-/split-1.0.1.tgz#605bd9be303aa59fb35f9229fbea0ddec9ea07d9" - dependencies: - through "2" - - sprintf-js@~1.0.2: - version "1.0.3" - resolved "https://registry.yarnpkg.com/sprintf-js/-/sprintf-js-1.0.3.tgz#04e6926f662895354f3dd015203633b857297e2c" - - sshpk@^1.7.0: - version "1.13.1" - resolved "https://registry.yarnpkg.com/sshpk/-/sshpk-1.13.1.tgz#512df6da6287144316dc4c18fe1cf1d940739be3" - dependencies: - asn1 "~0.2.3" - assert-plus "^1.0.0" - dashdash "^1.12.0" - getpass "^0.1.1" - optionalDependencies: - bcrypt-pbkdf "^1.0.0" - ecc-jsbn "~0.1.1" - jsbn "~0.1.0" - tweetnacl "~0.14.0" - - ssri@^5.2.4: - version "5.2.4" - resolved "https://registry.yarnpkg.com/ssri/-/ssri-5.2.4.tgz#9985e14041e65fc397af96542be35724ac11da52" - dependencies: - safe-buffer "^5.1.1" - - stack-utils@^1.0.1: - version "1.0.1" - resolved "https://registry.yarnpkg.com/stack-utils/-/stack-utils-1.0.1.tgz#d4f33ab54e8e38778b0ca5cfd3b3afb12db68620" - - stat-mode@^0.2.2: - version "0.2.2" - resolved "https://registry.yarnpkg.com/stat-mode/-/stat-mode-0.2.2.tgz#e6c80b623123d7d80cf132ce538f346289072502" - - stream-browserify@^2.0.1: - version "2.0.1" - resolved "https://registry.yarnpkg.com/stream-browserify/-/stream-browserify-2.0.1.tgz#66266ee5f9bdb9940a4e4514cafb43bb71e5c9db" - dependencies: - inherits "~2.0.1" - readable-stream "^2.0.2" - - stream-each@^1.1.0: - version "1.2.2" - resolved "https://registry.yarnpkg.com/stream-each/-/stream-each-1.2.2.tgz#8e8c463f91da8991778765873fe4d960d8f616bd" - dependencies: - end-of-stream "^1.1.0" - stream-shift "^1.0.0" - - stream-http@^2.7.2: - version "2.8.0" - resolved "https://registry.yarnpkg.com/stream-http/-/stream-http-2.8.0.tgz#fd86546dac9b1c91aff8fc5d287b98fafb41bc10" - dependencies: - builtin-status-codes "^3.0.0" - inherits "^2.0.1" - readable-stream "^2.3.3" - to-arraybuffer "^1.0.0" - xtend "^4.0.0" - - stream-shift@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/stream-shift/-/stream-shift-1.0.0.tgz#d5c752825e5367e786f78e18e445ea223a155952" - - strict-uri-encode@^1.0.0: - version "1.1.0" - resolved "https://registry.yarnpkg.com/strict-uri-encode/-/strict-uri-encode-1.1.0.tgz#279b225df1d582b1f54e65addd4352e18faa0713" - - string-hash@1.1.3: - version "1.1.3" - resolved "https://registry.yarnpkg.com/string-hash/-/string-hash-1.1.3.tgz#e8aafc0ac1855b4666929ed7dd1275df5d6c811b" - - string-similarity@1.2.0: - version "1.2.0" - resolved "https://registry.yarnpkg.com/string-similarity/-/string-similarity-1.2.0.tgz#d75153cb383846318b7a39a8d9292bb4db4e9c30" - dependencies: - lodash "^4.13.1" - - string-width@^1.0.1, string-width@^1.0.2: - version "1.0.2" - resolved "https://registry.yarnpkg.com/string-width/-/string-width-1.0.2.tgz#118bdf5b8cdc51a2a7e70d211e07e2b0b9b107d3" - dependencies: - code-point-at "^1.0.0" - is-fullwidth-code-point "^1.0.0" - strip-ansi "^3.0.0" - - string-width@^2.0.0, string-width@^2.1.0, string-width@^2.1.1: - version "2.1.1" - resolved "https://registry.yarnpkg.com/string-width/-/string-width-2.1.1.tgz#ab93f27a8dc13d28cac815c462143a6d9012ae9e" - dependencies: - is-fullwidth-code-point "^2.0.0" - strip-ansi "^4.0.0" - - string_decoder@^1.0.0, string_decoder@~1.0.3: - version "1.0.3" - resolved "https://registry.yarnpkg.com/string_decoder/-/string_decoder-1.0.3.tgz#0fc67d7c141825de94282dd536bec6b9bce860ab" - dependencies: - safe-buffer "~5.1.0" - - string_decoder@~0.10.x: - version "0.10.31" - resolved "https://registry.yarnpkg.com/string_decoder/-/string_decoder-0.10.31.tgz#62e203bc41766c6c28c9fc84301dab1c5310fa94" - - stringstream@~0.0.4, stringstream@~0.0.5: - version "0.0.5" - resolved "https://registry.yarnpkg.com/stringstream/-/stringstream-0.0.5.tgz#4e484cd4de5a0bbbee18e46307710a8a81621878" - - strip-ansi@^3.0.0, strip-ansi@^3.0.1: - version "3.0.1" - resolved "https://registry.yarnpkg.com/strip-ansi/-/strip-ansi-3.0.1.tgz#6a385fb8853d952d5ff05d0e8aaf94278dc63dcf" - dependencies: - ansi-regex "^2.0.0" - - strip-ansi@^4.0.0: - version "4.0.0" - resolved "https://registry.yarnpkg.com/strip-ansi/-/strip-ansi-4.0.0.tgz#a8479022eb1ac368a871389b635262c505ee368f" - dependencies: - ansi-regex "^3.0.0" - - strip-ansi@~0.1.0: - version "0.1.1" - resolved "https://registry.yarnpkg.com/strip-ansi/-/strip-ansi-0.1.1.tgz#39e8a98d044d150660abe4a6808acf70bb7bc991" - - strip-bom-buf@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/strip-bom-buf/-/strip-bom-buf-1.0.0.tgz#1cb45aaf57530f4caf86c7f75179d2c9a51dd572" - dependencies: - is-utf8 "^0.2.1" - - strip-bom@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/strip-bom/-/strip-bom-2.0.0.tgz#6219a85616520491f35788bdbf1447a99c7e6b0e" - dependencies: - is-utf8 "^0.2.0" - - strip-bom@^3.0.0: - version "3.0.0" - resolved "https://registry.yarnpkg.com/strip-bom/-/strip-bom-3.0.0.tgz#2334c18e9c759f7bdd56fdef7e9ae3d588e68ed3" - - strip-eof@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/strip-eof/-/strip-eof-1.0.0.tgz#bb43ff5598a6eb05d89b59fcd129c983313606bf" - - strip-indent@^1.0.1: - version "1.0.1" - resolved "https://registry.yarnpkg.com/strip-indent/-/strip-indent-1.0.1.tgz#0c7962a6adefa7bbd4ac366460a638552ae1a0a2" - dependencies: - get-stdin "^4.0.1" - - strip-indent@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/strip-indent/-/strip-indent-2.0.0.tgz#5ef8db295d01e6ed6cbf7aab96998d7822527b68" - - strip-json-comments@~2.0.1: - version "2.0.1" - resolved "https://registry.yarnpkg.com/strip-json-comments/-/strip-json-comments-2.0.1.tgz#3c531942e908c2697c0ec344858c286c7ca0a60a" - - style-loader@0.19.1: - version "0.19.1" - resolved "https://registry.yarnpkg.com/style-loader/-/style-loader-0.19.1.tgz#591ffc80bcefe268b77c5d9ebc0505d772619f85" - dependencies: - loader-utils "^1.0.2" - schema-utils "^0.3.0" - - styled-jsx@2.2.6: - version "2.2.6" - resolved "https://registry.yarnpkg.com/styled-jsx/-/styled-jsx-2.2.6.tgz#7e826279e1ef718213ef9cc42ac7370b5008449d" - dependencies: - babel-plugin-syntax-jsx "6.18.0" - babel-types "6.26.0" - convert-source-map "1.5.1" - source-map "0.6.1" - string-hash "1.1.3" - stylis "3.4.10" - stylis-rule-sheet "0.0.8" - - stylis-rule-sheet@0.0.8: - version "0.0.8" - resolved "https://registry.yarnpkg.com/stylis-rule-sheet/-/stylis-rule-sheet-0.0.8.tgz#b0d0a126c945b1f3047447a3aae0647013e8d166" - - stylis@3.4.10: - version "3.4.10" - resolved "https://registry.yarnpkg.com/stylis/-/stylis-3.4.10.tgz#a135cab4b9ff208e327fbb5a6fde3fa991c638ee" - - stylis@3.5.0: - version "3.5.0" - resolved "https://registry.yarnpkg.com/stylis/-/stylis-3.5.0.tgz#016fa239663d77f868fef5b67cf201c4b7c701e1" - - sumchecker@^1.2.0: - version "1.3.1" - resolved "https://registry.yarnpkg.com/sumchecker/-/sumchecker-1.3.1.tgz#79bb3b4456dd04f18ebdbc0d703a1d1daec5105d" - dependencies: - debug "^2.2.0" - es6-promise "^4.0.5" - - sumchecker@^2.0.1, sumchecker@^2.0.2: - version "2.0.2" - resolved "https://registry.yarnpkg.com/sumchecker/-/sumchecker-2.0.2.tgz#0f42c10e5d05da5d42eea3e56c3399a37d6c5b3e" - dependencies: - debug "^2.2.0" - - supertap@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/supertap/-/supertap-1.0.0.tgz#bd9751c7fafd68c68cf8222a29892206a119fa9e" - dependencies: - arrify "^1.0.1" - indent-string "^3.2.0" - js-yaml "^3.10.0" - serialize-error "^2.1.0" - strip-ansi "^4.0.0" - - supports-color@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-2.0.0.tgz#535d045ce6b6363fa40117084629995e9df324c7" - - supports-color@^3.2.3: - version "3.2.3" - resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-3.2.3.tgz#65ac0504b3954171d8a64946b2ae3cbb8a5f54f6" - dependencies: - has-flag "^1.0.0" - - supports-color@^4.0.0, supports-color@^4.2.1: - version "4.5.0" - resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-4.5.0.tgz#be7a0de484dec5c5cddf8b3d59125044912f635b" - dependencies: - has-flag "^2.0.0" - - supports-color@^5.0.0, supports-color@^5.2.0: - version "5.2.0" - resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-5.2.0.tgz#b0d5333b1184dd3666cbe5aa0b45c5ac7ac17a4a" - dependencies: - has-flag "^3.0.0" - - supports-color@^5.3.0: - version "5.3.0" - resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-5.3.0.tgz#5b24ac15db80fa927cf5227a4a33fd3c4c7676c0" - dependencies: - has-flag "^3.0.0" - - supports-color@~5.0.0: - version "5.0.1" - resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-5.0.1.tgz#1c5331f22250c84202805b2f17adf16699f3a39a" - dependencies: - has-flag "^2.0.0" - - svgo@^0.7.0: - version "0.7.2" - resolved "https://registry.yarnpkg.com/svgo/-/svgo-0.7.2.tgz#9f5772413952135c6fefbf40afe6a4faa88b4bb5" - dependencies: - coa "~1.0.1" - colors "~1.1.2" - csso "~2.3.1" - js-yaml "~3.7.0" - mkdirp "~0.5.1" - sax "~1.2.1" - whet.extend "~0.9.9" - - symbol-observable@1.0.1: - version "1.0.1" - resolved "https://registry.yarnpkg.com/symbol-observable/-/symbol-observable-1.0.1.tgz#8340fc4702c3122df5d22288f88283f513d3fdd4" - - symbol-observable@^0.2.2: - version "0.2.4" - resolved "https://registry.yarnpkg.com/symbol-observable/-/symbol-observable-0.2.4.tgz#95a83db26186d6af7e7a18dbd9760a2f86d08f40" - - symbol-observable@^1.0.3, symbol-observable@^1.0.4, symbol-observable@^1.1.0: - version "1.2.0" - resolved "https://registry.yarnpkg.com/symbol-observable/-/symbol-observable-1.2.0.tgz#c22688aed4eab3cdc2dfeacbb561660560a00804" - - table@^4.0.1: - version "4.0.2" - resolved "https://registry.yarnpkg.com/table/-/table-4.0.2.tgz#a33447375391e766ad34d3486e6e2aedc84d2e36" - dependencies: - ajv "^5.2.3" - ajv-keywords "^2.1.0" - chalk "^2.1.0" - lodash "^4.17.4" - slice-ansi "1.0.0" - string-width "^2.1.1" - - tapable@^0.2.7: - version "0.2.8" - resolved "https://registry.yarnpkg.com/tapable/-/tapable-0.2.8.tgz#99372a5c999bf2df160afc0d74bed4f47948cd22" - - tar-pack@^3.4.0: - version "3.4.1" - resolved "https://registry.yarnpkg.com/tar-pack/-/tar-pack-3.4.1.tgz#e1dbc03a9b9d3ba07e896ad027317eb679a10a1f" - dependencies: - debug "^2.2.0" - fstream "^1.0.10" - fstream-ignore "^1.0.5" - once "^1.3.3" - readable-stream "^2.1.4" - rimraf "^2.5.1" - tar "^2.2.1" - uid-number "^0.0.6" - - tar-stream@^1.5.0: - version "1.5.5" - resolved "https://registry.yarnpkg.com/tar-stream/-/tar-stream-1.5.5.tgz#5cad84779f45c83b1f2508d96b09d88c7218af55" - dependencies: - bl "^1.0.0" - end-of-stream "^1.0.0" - readable-stream "^2.0.0" - xtend "^4.0.0" - - tar@^2.0.0, tar@^2.2.1: - version "2.2.1" - resolved "https://registry.yarnpkg.com/tar/-/tar-2.2.1.tgz#8e4d2a256c0e2185c6b18ad694aec968b83cb1d1" - dependencies: - block-stream "*" - fstream "^1.0.2" - inherits "2" - - temp-file@^3.1.1: - version "3.1.1" - resolved "https://registry.yarnpkg.com/temp-file/-/temp-file-3.1.1.tgz#8823649aa4e8a6e419eb71b601a2e4d472b0f24f" - dependencies: - async-exit-hook "^2.0.1" - bluebird-lst "^1.0.5" - fs-extra-p "^4.5.0" - lazy-val "^1.0.3" - - term-size@^1.2.0: - version "1.2.0" - resolved "https://registry.yarnpkg.com/term-size/-/term-size-1.2.0.tgz#458b83887f288fc56d6fffbfad262e26638efa69" - dependencies: - execa "^0.7.0" - - text-table@^0.2.0, text-table@~0.2.0: - version "0.2.0" - resolved "https://registry.yarnpkg.com/text-table/-/text-table-0.2.0.tgz#7f5ee823ae805207c00af2df4a84ec3fcfa570b4" - - throttleit@0.0.2: - version "0.0.2" - resolved "https://registry.yarnpkg.com/throttleit/-/throttleit-0.0.2.tgz#cfedf88e60c00dd9697b61fdd2a8343a9b680eaf" - - through2@^2.0.0: - version "2.0.3" - resolved "https://registry.yarnpkg.com/through2/-/through2-2.0.3.tgz#0004569b37c7c74ba39c43f3ced78d1ad94140be" - dependencies: - readable-stream "^2.1.5" - xtend "~4.0.1" - - through2@~0.2.3: - version "0.2.3" - resolved "https://registry.yarnpkg.com/through2/-/through2-0.2.3.tgz#eb3284da4ea311b6cc8ace3653748a52abf25a3f" - dependencies: - readable-stream "~1.1.9" - xtend "~2.1.1" - - through@2, through@^2.3.6: - version "2.3.8" - resolved "https://registry.yarnpkg.com/through/-/through-2.3.8.tgz#0dd4c9ffaabc357960b1b724115d7e0e86a2e1f5" - - time-zone@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/time-zone/-/time-zone-1.0.0.tgz#99c5bf55958966af6d06d83bdf3800dc82faec5d" - - timed-out@^4.0.0: - version "4.0.1" - resolved "https://registry.yarnpkg.com/timed-out/-/timed-out-4.0.1.tgz#f32eacac5a175bea25d7fab565ab3ed8741ef56f" - - timers-browserify@^2.0.4: - version "2.0.6" - resolved "https://registry.yarnpkg.com/timers-browserify/-/timers-browserify-2.0.6.tgz#241e76927d9ca05f4d959819022f5b3664b64bae" - dependencies: - setimmediate "^1.0.4" - - tmp@^0.0.33: - version "0.0.33" - resolved "https://registry.yarnpkg.com/tmp/-/tmp-0.0.33.tgz#6d34335889768d21b2bcda0aa277ced3b1bfadf9" - dependencies: - os-tmpdir "~1.0.2" - - to-arraybuffer@^1.0.0: - version "1.0.1" - resolved "https://registry.yarnpkg.com/to-arraybuffer/-/to-arraybuffer-1.0.1.tgz#7d229b1fcc637e466ca081180836a7aabff83f43" - - to-fast-properties@^1.0.3: - version "1.0.3" - resolved "https://registry.yarnpkg.com/to-fast-properties/-/to-fast-properties-1.0.3.tgz#b83571fa4d8c25b82e231b06e3a3055de4ca1a47" - - tough-cookie@~2.3.0, tough-cookie@~2.3.3: - version "2.3.3" - resolved "https://registry.yarnpkg.com/tough-cookie/-/tough-cookie-2.3.3.tgz#0b618a5565b6dea90bf3425d04d55edc475a7561" - dependencies: - punycode "^1.4.1" - - trim-newlines@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/trim-newlines/-/trim-newlines-1.0.0.tgz#5887966bb582a4503a41eb524f7d35011815a613" - - trim-off-newlines@^1.0.1: - version "1.0.1" - resolved "https://registry.yarnpkg.com/trim-off-newlines/-/trim-off-newlines-1.0.1.tgz#9f9ba9d9efa8764c387698bcbfeb2c848f11adb3" - - trim-right@^1.0.1: - version "1.0.1" - resolved "https://registry.yarnpkg.com/trim-right/-/trim-right-1.0.1.tgz#cb2e1203067e0c8de1f614094b9fe45704ea6003" - - truncate-utf8-bytes@^1.0.0: - version "1.0.2" - resolved "https://registry.yarnpkg.com/truncate-utf8-bytes/-/truncate-utf8-bytes-1.0.2.tgz#405923909592d56f78a5818434b0b78489ca5f2b" - dependencies: - utf8-byte-length "^1.0.1" - - tty-browserify@0.0.0: - version "0.0.0" - resolved "https://registry.yarnpkg.com/tty-browserify/-/tty-browserify-0.0.0.tgz#a157ba402da24e9bf957f9aa69d524eed42901a6" - - tunnel-agent@^0.6.0: - version "0.6.0" - resolved "https://registry.yarnpkg.com/tunnel-agent/-/tunnel-agent-0.6.0.tgz#27a5dea06b36b04a0a9966774b290868f0fc40fd" - dependencies: - safe-buffer "^5.0.1" - - tweetnacl@^0.14.3, tweetnacl@~0.14.0: - version "0.14.5" - resolved "https://registry.yarnpkg.com/tweetnacl/-/tweetnacl-0.14.5.tgz#5ae68177f192d4456269d108afa93ff8743f4f64" - - type-check@~0.3.2: - version "0.3.2" - resolved "https://registry.yarnpkg.com/type-check/-/type-check-0.3.2.tgz#5884cab512cf1d355e3fb784f30804b2b520db72" - dependencies: - prelude-ls "~1.1.2" - - typedarray@^0.0.6: - version "0.0.6" - resolved "https://registry.yarnpkg.com/typedarray/-/typedarray-0.0.6.tgz#867ac74e3864187b1d3d47d996a78ec5c8830777" - - ua-parser-js@^0.7.9: - version "0.7.17" - resolved "https://registry.yarnpkg.com/ua-parser-js/-/ua-parser-js-0.7.17.tgz#e9ec5f9498b9ec910e7ae3ac626a805c4d09ecac" - - uglify-js@^2.8.29: - version "2.8.29" - resolved "https://registry.yarnpkg.com/uglify-js/-/uglify-js-2.8.29.tgz#29c5733148057bb4e1f75df35b7a9cb72e6a59dd" - dependencies: - source-map "~0.5.1" - yargs "~3.10.0" - optionalDependencies: - uglify-to-browserify "~1.0.0" - - uglify-to-browserify@~1.0.0: - version "1.0.2" - resolved "https://registry.yarnpkg.com/uglify-to-browserify/-/uglify-to-browserify-1.0.2.tgz#6e0924d6bda6b5afe349e39a6d632850a0f882b7" - - uglifyjs-webpack-plugin@^0.4.6: - version "0.4.6" - resolved "https://registry.yarnpkg.com/uglifyjs-webpack-plugin/-/uglifyjs-webpack-plugin-0.4.6.tgz#b951f4abb6bd617e66f63eb891498e391763e309" - dependencies: - source-map "^0.5.6" - uglify-js "^2.8.29" - webpack-sources "^1.0.1" - - uid-number@^0.0.6: - version "0.0.6" - resolved "https://registry.yarnpkg.com/uid-number/-/uid-number-0.0.6.tgz#0ea10e8035e8eb5b8e4449f06da1c730663baa81" - - uid2@0.0.3: - version "0.0.3" - resolved "https://registry.yarnpkg.com/uid2/-/uid2-0.0.3.tgz#483126e11774df2f71b8b639dcd799c376162b82" - - uniq@^1.0.1: - version "1.0.1" - resolved "https://registry.yarnpkg.com/uniq/-/uniq-1.0.1.tgz#b31c5ae8254844a3a8281541ce2b04b865a734ff" - - uniqid@^4.0.0: - version "4.1.1" - resolved "https://registry.yarnpkg.com/uniqid/-/uniqid-4.1.1.tgz#89220ddf6b751ae52b5f72484863528596bb84c1" - dependencies: - macaddress "^0.2.8" - - uniqs@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/uniqs/-/uniqs-2.0.0.tgz#ffede4b36b25290696e6e165d4a59edb998e6b02" - - unique-filename@^1.1.0: - version "1.1.0" - resolved "https://registry.yarnpkg.com/unique-filename/-/unique-filename-1.1.0.tgz#d05f2fe4032560871f30e93cbe735eea201514f3" - dependencies: - unique-slug "^2.0.0" - - unique-slug@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/unique-slug/-/unique-slug-2.0.0.tgz#db6676e7c7cc0629878ff196097c78855ae9f4ab" - dependencies: - imurmurhash "^0.1.4" - - unique-string@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/unique-string/-/unique-string-1.0.0.tgz#9e1057cca851abb93398f8b33ae187b99caec11a" - dependencies: - crypto-random-string "^1.0.0" - - unique-temp-dir@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/unique-temp-dir/-/unique-temp-dir-1.0.0.tgz#6dce95b2681ca003eebfb304a415f9cbabcc5385" - dependencies: - mkdirp "^0.5.1" - os-tmpdir "^1.0.1" - uid2 "0.0.3" - - universalify@^0.1.0: - version "0.1.1" - resolved "https://registry.yarnpkg.com/universalify/-/universalify-0.1.1.tgz#fa71badd4437af4c148841e3b3b165f9e9e590b7" - - unzip-response@^2.0.1: - version "2.0.1" - resolved "https://registry.yarnpkg.com/unzip-response/-/unzip-response-2.0.1.tgz#d2f0f737d16b0615e72a6935ed04214572d56f97" - - update-notifier@^2.3.0: - version "2.3.0" - resolved "https://registry.yarnpkg.com/update-notifier/-/update-notifier-2.3.0.tgz#4e8827a6bb915140ab093559d7014e3ebb837451" - dependencies: - boxen "^1.2.1" - chalk "^2.0.1" - configstore "^3.0.0" - import-lazy "^2.1.0" - is-installed-globally "^0.1.0" - is-npm "^1.0.0" - latest-version "^3.0.0" - semver-diff "^2.0.0" - xdg-basedir "^3.0.0" - - urix@^0.1.0, urix@~0.1.0: - version "0.1.0" - resolved "https://registry.yarnpkg.com/urix/-/urix-0.1.0.tgz#da937f7a62e21fec1fd18d49b35c2935067a6c72" - - url-parse-lax@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/url-parse-lax/-/url-parse-lax-1.0.0.tgz#7af8f303645e9bd79a272e7a14ac68bc0609da73" - dependencies: - prepend-http "^1.0.1" - - url-to-options@^1.0.1: - version "1.0.1" - resolved "https://registry.yarnpkg.com/url-to-options/-/url-to-options-1.0.1.tgz#1505a03a289a48cbd7a434efbaeec5055f5633a9" - - url@^0.11.0, url@~0.11.0: - version "0.11.0" - resolved "https://registry.yarnpkg.com/url/-/url-0.11.0.tgz#3838e97cfc60521eb73c525a8e55bfdd9e2e28f1" - dependencies: - punycode "1.3.2" - querystring "0.2.0" - - user-home@^1.1.1: - version "1.1.1" - resolved "https://registry.yarnpkg.com/user-home/-/user-home-1.1.1.tgz#2b5be23a32b63a7c9deb8d0f28d485724a3df190" - - utf8-byte-length@^1.0.1: - version "1.0.4" - resolved "https://registry.yarnpkg.com/utf8-byte-length/-/utf8-byte-length-1.0.4.tgz#f45f150c4c66eee968186505ab93fcbb8ad6bf61" - - util-deprecate@~1.0.1: - version "1.0.2" - resolved "https://registry.yarnpkg.com/util-deprecate/-/util-deprecate-1.0.2.tgz#450d4dc9fa70de732762fbd2d4a28981419a0ccf" - - util@0.10.3, util@^0.10.3: - version "0.10.3" - resolved "https://registry.yarnpkg.com/util/-/util-0.10.3.tgz#7afb1afe50805246489e3db7fe0ed379336ac0f9" - dependencies: - inherits "2.0.1" - - uuid@3.1.0: - version "3.1.0" - resolved "https://registry.yarnpkg.com/uuid/-/uuid-3.1.0.tgz#3dd3d3e790abc24d7b0d3a034ffababe28ebbc04" - - uuid@^3.0.0, uuid@^3.1.0: - version "3.2.1" - resolved "https://registry.yarnpkg.com/uuid/-/uuid-3.2.1.tgz#12c528bb9d58d0b9265d9a2f6f0fe8be17ff1f14" - - v8flags@^2.1.1: - version "2.1.1" - resolved "https://registry.yarnpkg.com/v8flags/-/v8flags-2.1.1.tgz#aab1a1fa30d45f88dd321148875ac02c0b55e5b4" - dependencies: - user-home "^1.1.1" - - validate-npm-package-license@^3.0.1: - version "3.0.1" - resolved "https://registry.yarnpkg.com/validate-npm-package-license/-/validate-npm-package-license-3.0.1.tgz#2804babe712ad3379459acfbe24746ab2c303fbc" - dependencies: - spdx-correct "~1.0.0" - spdx-expression-parse "~1.0.0" - - validator@~9.1.1: - version "9.1.2" - resolved "https://registry.yarnpkg.com/validator/-/validator-9.1.2.tgz#5711b6413f78bd9d56003130c81b47c39e86546c" - - vendors@^1.0.0: - version "1.0.1" - resolved "https://registry.yarnpkg.com/vendors/-/vendors-1.0.1.tgz#37ad73c8ee417fb3d580e785312307d274847f22" - - verror@1.10.0: - version "1.10.0" - resolved "https://registry.yarnpkg.com/verror/-/verror-1.10.0.tgz#3a105ca17053af55d6e270c1f8288682e18da400" - dependencies: - assert-plus "^1.0.0" - core-util-is "1.0.2" - extsprintf "^1.2.0" - - vm-browserify@0.0.4: - version "0.0.4" - resolved "https://registry.yarnpkg.com/vm-browserify/-/vm-browserify-0.0.4.tgz#5d7ea45bbef9e4a6ff65f95438e0a87c357d5a73" - dependencies: - indexof "0.0.1" - - watchpack@^1.4.0: - version "1.4.0" - resolved "https://registry.yarnpkg.com/watchpack/-/watchpack-1.4.0.tgz#4a1472bcbb952bd0a9bb4036801f954dfb39faac" - dependencies: - async "^2.1.2" - chokidar "^1.7.0" - graceful-fs "^4.1.2" - - wcwidth@^1.0.0: - version "1.0.1" - resolved "https://registry.yarnpkg.com/wcwidth/-/wcwidth-1.0.1.tgz#f0b0dcf915bc5ff1528afadb2c0e17b532da2fe8" - dependencies: - defaults "^1.0.3" - - wdio-dot-reporter@~0.0.8: - version "0.0.9" - resolved "https://registry.yarnpkg.com/wdio-dot-reporter/-/wdio-dot-reporter-0.0.9.tgz#929b2adafd49d6b0534fda068e87319b47e38fe5" - - webdriverio@^4.8.0: - version "4.10.2" - resolved "https://registry.yarnpkg.com/webdriverio/-/webdriverio-4.10.2.tgz#0d28622802c966015afe34b3ac566dc339f22e43" - dependencies: - archiver "~2.1.0" - babel-runtime "^6.26.0" - css-parse "~2.0.0" - css-value "~0.0.1" - deepmerge "~2.0.1" - ejs "~2.5.6" - gaze "~1.1.2" - glob "~7.1.1" - inquirer "~3.3.0" - json-stringify-safe "~5.0.1" - mkdirp "~0.5.1" - npm-install-package "~2.1.0" - optimist "~0.6.1" - q "~1.5.0" - request "~2.83.0" - rgb2hex "~0.1.0" - safe-buffer "~5.1.1" - supports-color "~5.0.0" - url "~0.11.0" - validator "~9.1.1" - wdio-dot-reporter "~0.0.8" - wgxpath "~1.0.0" - - webpack-sources@^1.0.1: - version "1.1.0" - resolved "https://registry.yarnpkg.com/webpack-sources/-/webpack-sources-1.1.0.tgz#a101ebae59d6507354d71d8013950a3a8b7a5a54" - dependencies: - source-list-map "^2.0.0" - source-map "~0.6.1" - - webpack@3.10.0: - version "3.10.0" - resolved "https://registry.yarnpkg.com/webpack/-/webpack-3.10.0.tgz#5291b875078cf2abf42bdd23afe3f8f96c17d725" - dependencies: - acorn "^5.0.0" - acorn-dynamic-import "^2.0.0" - ajv "^5.1.5" - ajv-keywords "^2.0.0" - async "^2.1.2" - enhanced-resolve "^3.4.0" - escope "^3.6.0" - interpret "^1.0.0" - json-loader "^0.5.4" - json5 "^0.5.1" - loader-runner "^2.3.0" - loader-utils "^1.1.0" - memory-fs "~0.4.1" - mkdirp "~0.5.0" - node-libs-browser "^2.0.0" - source-map "^0.5.3" - supports-color "^4.2.1" - tapable "^0.2.7" - uglifyjs-webpack-plugin "^0.4.6" - watchpack "^1.4.0" - webpack-sources "^1.0.1" - yargs "^8.0.2" - - well-known-symbols@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/well-known-symbols/-/well-known-symbols-1.0.0.tgz#73c78ae81a7726a8fa598e2880801c8b16225518" - - wgxpath@~1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/wgxpath/-/wgxpath-1.0.0.tgz#eef8a4b9d558cc495ad3a9a2b751597ecd9af690" - - whatwg-fetch@>=0.10.0: - version "2.0.3" - resolved "https://registry.yarnpkg.com/whatwg-fetch/-/whatwg-fetch-2.0.3.tgz#9c84ec2dcf68187ff00bc64e1274b442176e1c84" - - whet.extend@~0.9.9: - version "0.9.9" - resolved "https://registry.yarnpkg.com/whet.extend/-/whet.extend-0.9.9.tgz#f877d5bf648c97e5aa542fadc16d6a259b9c11a1" - - which-module@^1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/which-module/-/which-module-1.0.0.tgz#bba63ca861948994ff307736089e3b96026c2a4f" - - which-module@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/which-module/-/which-module-2.0.0.tgz#d9ef07dce77b9902b8a3a8fa4b31c3e3f7e6e87a" - - which@1, which@^1.2.9: - version "1.3.0" - resolved "https://registry.yarnpkg.com/which/-/which-1.3.0.tgz#ff04bdfc010ee547d780bec38e1ac1c2777d253a" - dependencies: - isexe "^2.0.0" - - wide-align@^1.1.0: - version "1.1.2" - resolved "https://registry.yarnpkg.com/wide-align/-/wide-align-1.1.2.tgz#571e0f1b0604636ebc0dfc21b0339bbe31341710" - dependencies: - string-width "^1.0.2" - - widest-line@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/widest-line/-/widest-line-2.0.0.tgz#0142a4e8a243f8882c0233aa0e0281aa76152273" - dependencies: - string-width "^2.1.1" - - window-size@0.1.0: - version "0.1.0" - resolved "https://registry.yarnpkg.com/window-size/-/window-size-0.1.0.tgz#5438cd2ea93b202efa3a19fe8887aee7c94f9c9d" - - wordwrap@0.0.2: - version "0.0.2" - resolved "https://registry.yarnpkg.com/wordwrap/-/wordwrap-0.0.2.tgz#b79669bb42ecb409f83d583cad52ca17eaa1643f" - - wordwrap@~0.0.2: - version "0.0.3" - resolved "https://registry.yarnpkg.com/wordwrap/-/wordwrap-0.0.3.tgz#a3d5da6cd5c0bc0008d37234bbaf1bed63059107" - - wordwrap@~1.0.0: - version "1.0.0" - resolved "https://registry.yarnpkg.com/wordwrap/-/wordwrap-1.0.0.tgz#27584810891456a4171c8d0226441ade90cbcaeb" - - wrap-ansi@^2.0.0: - version "2.1.0" - resolved "https://registry.yarnpkg.com/wrap-ansi/-/wrap-ansi-2.1.0.tgz#d8fc3d284dd05794fe84973caecdd1cf824fdd85" - dependencies: - string-width "^1.0.1" - strip-ansi "^3.0.1" - - wrappy@1: - version "1.0.2" - resolved "https://registry.yarnpkg.com/wrappy/-/wrappy-1.0.2.tgz#b5243d8f3ec1aa35f1364605bc0d1036e30ab69f" - - write-file-atomic@^1.1.4: - version "1.3.4" - resolved "https://registry.yarnpkg.com/write-file-atomic/-/write-file-atomic-1.3.4.tgz#f807a4f0b1d9e913ae7a48112e6cc3af1991b45f" - dependencies: - graceful-fs "^4.1.11" - imurmurhash "^0.1.4" - slide "^1.1.5" - - write-file-atomic@^2.0.0: - version "2.3.0" - resolved "https://registry.yarnpkg.com/write-file-atomic/-/write-file-atomic-2.3.0.tgz#1ff61575c2e2a4e8e510d6fa4e243cce183999ab" - dependencies: - graceful-fs "^4.1.11" - imurmurhash "^0.1.4" - signal-exit "^3.0.2" - - write-json-file@^2.2.0: - version "2.3.0" - resolved "https://registry.yarnpkg.com/write-json-file/-/write-json-file-2.3.0.tgz#2b64c8a33004d54b8698c76d585a77ceb61da32f" - dependencies: - detect-indent "^5.0.0" - graceful-fs "^4.1.2" - make-dir "^1.0.0" - pify "^3.0.0" - sort-keys "^2.0.0" - write-file-atomic "^2.0.0" - - write-pkg@^3.1.0: - version "3.1.0" - resolved "https://registry.yarnpkg.com/write-pkg/-/write-pkg-3.1.0.tgz#030a9994cc9993d25b4e75a9f1a1923607291ce9" - dependencies: - sort-keys "^2.0.0" - write-json-file "^2.2.0" - - write@^0.2.1: - version "0.2.1" - resolved "https://registry.yarnpkg.com/write/-/write-0.2.1.tgz#5fc03828e264cea3fe91455476f7a3c566cb0757" - dependencies: - mkdirp "^0.5.1" - - xdg-basedir@^3.0.0: - version "3.0.0" - resolved "https://registry.yarnpkg.com/xdg-basedir/-/xdg-basedir-3.0.0.tgz#496b2cc109eca8dbacfe2dc72b603c17c5870ad4" - - xmlbuilder@8.2.2: - version "8.2.2" - resolved "https://registry.yarnpkg.com/xmlbuilder/-/xmlbuilder-8.2.2.tgz#69248673410b4ba42e1a6136551d2922335aa773" - - xmldom@0.1.x: - version "0.1.27" - resolved "https://registry.yarnpkg.com/xmldom/-/xmldom-0.1.27.tgz#d501f97b3bdb403af8ef9ecc20573187aadac0e9" - - xtend@^4.0.0, xtend@~4.0.1: - version "4.0.1" - resolved "https://registry.yarnpkg.com/xtend/-/xtend-4.0.1.tgz#a5c6d532be656e23db820efb943a1f04998d63af" - - xtend@~2.1.1: - version "2.1.2" - resolved "https://registry.yarnpkg.com/xtend/-/xtend-2.1.2.tgz#6efecc2a4dad8e6962c4901b337ce7ba87b5d28b" - dependencies: - object-keys "~0.4.0" - - xterm@chabou/xterm.js#7cb4b8e: - version "3.2.0-hyper.2" - resolved "https://codeload.github.com/chabou/xterm.js/tar.gz/7cb4b8e0b1a76a5af947b7417e47917595afc6f9" - - y18n@^3.2.1: - version "3.2.1" - resolved "https://registry.yarnpkg.com/y18n/-/y18n-3.2.1.tgz#6d15fba884c08679c0d77e88e7759e811e07fa41" - - y18n@^4.0.0: - version "4.0.0" - resolved "https://registry.yarnpkg.com/y18n/-/y18n-4.0.0.tgz#95ef94f85ecc81d007c264e190a120f0a3c8566b" - - yallist@^2.1.2: - version "2.1.2" - resolved "https://registry.yarnpkg.com/yallist/-/yallist-2.1.2.tgz#1c11f9218f076089a47dd512f93c6699a6a81d52" - - yargs-parser@^5.0.0: - version "5.0.0" - resolved "https://registry.yarnpkg.com/yargs-parser/-/yargs-parser-5.0.0.tgz#275ecf0d7ffe05c77e64e7c86e4cd94bf0e1228a" - dependencies: - camelcase "^3.0.0" - - yargs-parser@^7.0.0: - version "7.0.0" - resolved "https://registry.yarnpkg.com/yargs-parser/-/yargs-parser-7.0.0.tgz#8d0ac42f16ea55debd332caf4c4038b3e3f5dfd9" - dependencies: - camelcase "^4.1.0" - - yargs-parser@^9.0.2: - version "9.0.2" - resolved "https://registry.yarnpkg.com/yargs-parser/-/yargs-parser-9.0.2.tgz#9ccf6a43460fe4ed40a9bb68f48d43b8a68cc077" - dependencies: - camelcase "^4.1.0" - - yargs@^11.0.0: - version "11.0.0" - resolved "https://registry.yarnpkg.com/yargs/-/yargs-11.0.0.tgz#c052931006c5eee74610e5fc0354bedfd08a201b" - dependencies: - cliui "^4.0.0" - decamelize "^1.1.1" - find-up "^2.1.0" - get-caller-file "^1.0.1" - os-locale "^2.0.0" - require-directory "^2.1.1" - require-main-filename "^1.0.1" - set-blocking "^2.0.0" - string-width "^2.0.0" - which-module "^2.0.0" - y18n "^3.2.1" - yargs-parser "^9.0.2" - - yargs@^7.0.2: - version "7.1.0" - resolved "https://registry.yarnpkg.com/yargs/-/yargs-7.1.0.tgz#6ba318eb16961727f5d284f8ea003e8d6154d0c8" - dependencies: - camelcase "^3.0.0" - cliui "^3.2.0" - decamelize "^1.1.1" - get-caller-file "^1.0.1" - os-locale "^1.4.0" - read-pkg-up "^1.0.1" - require-directory "^2.1.1" - require-main-filename "^1.0.1" - set-blocking "^2.0.0" - string-width "^1.0.2" - which-module "^1.0.0" - y18n "^3.2.1" - yargs-parser "^5.0.0" - - yargs@^8.0.2: - version "8.0.2" - resolved "https://registry.yarnpkg.com/yargs/-/yargs-8.0.2.tgz#6299a9055b1cefc969ff7e79c1d918dceb22c360" - dependencies: - camelcase "^4.1.0" - cliui "^3.2.0" - decamelize "^1.1.1" - get-caller-file "^1.0.1" - os-locale "^2.0.0" - read-pkg-up "^2.0.0" - require-directory "^2.1.1" - require-main-filename "^1.0.1" - set-blocking "^2.0.0" - string-width "^2.0.0" - which-module "^2.0.0" - y18n "^3.2.1" - yargs-parser "^7.0.0" - - yargs@~3.10.0: - version "3.10.0" - resolved "https://registry.yarnpkg.com/yargs/-/yargs-3.10.0.tgz#f7ee7bd857dd7c1d2d38c0e74efbd681d1431fd1" - dependencies: - camelcase "^1.0.2" - cliui "^2.1.0" - decamelize "^1.0.0" - window-size "0.1.0" - - yauzl@2.4.1: - version "2.4.1" - resolved "https://registry.yarnpkg.com/yauzl/-/yauzl-2.4.1.tgz#9528f442dab1b2284e58b4379bb194e22e0c4005" - dependencies: - fd-slicer "~1.0.1" - - zip-stream@^1.2.0: - version "1.2.0" - resolved "https://registry.yarnpkg.com/zip-stream/-/zip-stream-1.2.0.tgz#a8bc45f4c1b49699c6b90198baacaacdbcd4ba04" - dependencies: - archiver-utils "^1.3.0" - compress-commons "^1.2.0" - lodash "^4.8.0" - readable-stream "^2.0.0" - -Trace: - Error: Command failed. - Exit code: 1 - Command: sh - Arguments: -c electron-builder install-app-deps && yarn run rebuild-node-pty && yarn --cwd node_modules/xterm - Directory: /Users/leo/projects/hyper - Output: - - at ProcessTermError.MessageError (/usr/local/Cellar/yarn/1.5.1_1/libexec/lib/cli.js:186:110) - at new ProcessTermError (/usr/local/Cellar/yarn/1.5.1_1/libexec/lib/cli.js:226:113) - at ChildProcess. (/usr/local/Cellar/yarn/1.5.1_1/libexec/lib/cli.js:30281:17) - at ChildProcess.emit (events.js:180:13) - at maybeClose (internal/child_process.js:936:16) - at Process.ChildProcess._handle.onexit (internal/child_process.js:220:5) From 7dd6045a1db3e6159f4debb2baf1e1e9483e4f45 Mon Sep 17 00:00:00 2001 From: Leo Lamprecht Date: Mon, 16 Apr 2018 07:22:03 -0700 Subject: [PATCH 08/15] Ensured dependencies match between channels --- package.json | 8 ++--- yarn.lock | 89 ++++++++++++++++++++++++++-------------------------- 2 files changed, 49 insertions(+), 48 deletions(-) diff --git a/package.json b/package.json index c635202de01e..8f11d9131217 100644 --- a/package.json +++ b/package.json @@ -215,10 +215,10 @@ "electron-builder-squirrel-windows": "20.5.0", "electron-devtools-installer": "2.2.3", "electron-rebuild": "1.7.3", - "eslint": "4.7.2", - "eslint-config-prettier": "2.6.0", - "eslint-plugin-prettier": "2.3.1", - "eslint-plugin-react": "7.3.0", + "eslint": "^4.7.2", + "eslint-config-prettier": "^2.6.0", + "eslint-plugin-prettier": "^2.3.1", + "eslint-plugin-react": "^7.3.0", "husky": "0.14.3", "inquirer": "5.1.0", "node-gyp": "3.6.2", diff --git a/yarn.lock b/yarn.lock index e7c759e0d6c9..82449ce3d5e6 100644 --- a/yarn.lock +++ b/yarn.lock @@ -105,14 +105,10 @@ acorn@^4.0.3: version "4.0.13" resolved "https://registry.yarnpkg.com/acorn/-/acorn-4.0.13.tgz#105495ae5361d697bd195c825192e1ad7f253787" -acorn@^5.0.0: +acorn@^5.0.0, acorn@^5.4.0: version "5.4.1" resolved "https://registry.yarnpkg.com/acorn/-/acorn-5.4.1.tgz#fdc58d9d17f4a4e98d102ded826a9b9759125102" -acorn@^5.5.0: - version "5.5.3" - resolved "https://registry.yarnpkg.com/acorn/-/acorn-5.5.3.tgz#f473dd47e0277a08e28e9bec5aeeb04751f0b8c9" - ajv-keywords@^2.0.0, ajv-keywords@^2.1.0: version "2.1.1" resolved "https://registry.yarnpkg.com/ajv-keywords/-/ajv-keywords-2.1.1.tgz#617997fc5f60576894c435f940d819e135b80762" @@ -128,7 +124,7 @@ ajv@^4.9.1: co "^4.6.0" json-stable-stringify "^1.0.1" -ajv@^5.0.0, ajv@^5.1.0, ajv@^5.1.5, ajv@^5.2.0, ajv@^5.2.3: +ajv@^5.0.0, ajv@^5.1.0, ajv@^5.1.5, ajv@^5.2.3, ajv@^5.3.0: version "5.5.2" resolved "https://registry.yarnpkg.com/ajv/-/ajv-5.5.2.tgz#73b5eeca3fab653e3d3f9422b341ad42205dc965" dependencies: @@ -2122,7 +2118,7 @@ dmg-builder@4.1.2: parse-color "^1.0.0" sanitize-filename "^1.6.1" -doctrine@^2.0.0: +doctrine@^2.0.2, doctrine@^2.1.0: version "2.1.0" resolved "https://registry.yarnpkg.com/doctrine/-/doctrine-2.1.0.tgz#5cd01fc101621b42c4cd7f5d1a66243716d3f39d" dependencies: @@ -2492,27 +2488,27 @@ escope@^3.6.0: esrecurse "^4.1.0" estraverse "^4.1.1" -eslint-config-prettier@2.6.0: - version "2.6.0" - resolved "https://registry.yarnpkg.com/eslint-config-prettier/-/eslint-config-prettier-2.6.0.tgz#f21db0ebb438ad678fb98946097c4bb198befccc" +eslint-config-prettier@^2.6.0: + version "2.9.0" + resolved "https://registry.yarnpkg.com/eslint-config-prettier/-/eslint-config-prettier-2.9.0.tgz#5ecd65174d486c22dff389fe036febf502d468a3" dependencies: get-stdin "^5.0.1" -eslint-plugin-prettier@2.3.1: - version "2.3.1" - resolved "https://registry.yarnpkg.com/eslint-plugin-prettier/-/eslint-plugin-prettier-2.3.1.tgz#e7a746c67e716f335274b88295a9ead9f544e44d" +eslint-plugin-prettier@^2.3.1: + version "2.6.0" + resolved "https://registry.yarnpkg.com/eslint-plugin-prettier/-/eslint-plugin-prettier-2.6.0.tgz#33e4e228bdb06142d03c560ce04ec23f6c767dd7" dependencies: fast-diff "^1.1.1" jest-docblock "^21.0.0" -eslint-plugin-react@7.3.0: - version "7.3.0" - resolved "https://registry.yarnpkg.com/eslint-plugin-react/-/eslint-plugin-react-7.3.0.tgz#ca9368da36f733fbdc05718ae4e91f778f38e344" +eslint-plugin-react@^7.3.0: + version "7.6.1" + resolved "https://registry.yarnpkg.com/eslint-plugin-react/-/eslint-plugin-react-7.6.1.tgz#5d0e908be599f0c02fbf4eef0c7ed6f29dff7633" dependencies: - doctrine "^2.0.0" + doctrine "^2.0.2" has "^1.0.1" - jsx-ast-utils "^2.0.0" - prop-types "^15.5.10" + jsx-ast-utils "^2.0.1" + prop-types "^15.6.0" eslint-scope@^3.7.1: version "3.7.1" @@ -2521,32 +2517,36 @@ eslint-scope@^3.7.1: esrecurse "^4.1.0" estraverse "^4.1.1" -eslint@4.7.2: - version "4.7.2" - resolved "https://registry.yarnpkg.com/eslint/-/eslint-4.7.2.tgz#ff6f5f5193848a27ee9b627be3e73fb9cb5e662e" +eslint-visitor-keys@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/eslint-visitor-keys/-/eslint-visitor-keys-1.0.0.tgz#3f3180fb2e291017716acb4c9d6d5b5c34a6a81d" + +eslint@^4.7.2: + version "4.18.0" + resolved "https://registry.yarnpkg.com/eslint/-/eslint-4.18.0.tgz#ebd0ba795af6dc59aa5cee17938160af5950e051" dependencies: - ajv "^5.2.0" + ajv "^5.3.0" babel-code-frame "^6.22.0" chalk "^2.1.0" concat-stream "^1.6.0" cross-spawn "^5.1.0" - debug "^3.0.1" - doctrine "^2.0.0" + debug "^3.1.0" + doctrine "^2.1.0" eslint-scope "^3.7.1" - espree "^3.5.1" + eslint-visitor-keys "^1.0.0" + espree "^3.5.2" esquery "^1.0.0" - estraverse "^4.2.0" esutils "^2.0.2" file-entry-cache "^2.0.0" functional-red-black-tree "^1.0.1" glob "^7.1.2" - globals "^9.17.0" + globals "^11.0.1" ignore "^3.3.3" imurmurhash "^0.1.4" inquirer "^3.0.6" is-resolvable "^1.0.0" js-yaml "^3.9.1" - json-stable-stringify "^1.0.1" + json-stable-stringify-without-jsonify "^1.0.1" levn "^0.3.0" lodash "^4.17.4" minimatch "^3.0.2" @@ -2572,11 +2572,11 @@ espower-location-detector@^1.0.0: source-map "^0.5.0" xtend "^4.0.0" -espree@^3.5.1: - version "3.5.4" - resolved "https://registry.yarnpkg.com/espree/-/espree-3.5.4.tgz#b0f447187c8a8bed944b815a660bddf5deb5d1a7" +espree@^3.5.2: + version "3.5.3" + resolved "https://registry.yarnpkg.com/espree/-/espree-3.5.3.tgz#931e0af64e7fbbed26b050a29daad1fc64799fa6" dependencies: - acorn "^5.5.0" + acorn "^5.4.0" acorn-jsx "^3.0.0" esprima@^2.6.0: @@ -2606,7 +2606,7 @@ esrecurse@^4.1.0: estraverse "^4.1.0" object-assign "^4.0.1" -estraverse@^4.0.0, estraverse@^4.1.0, estraverse@^4.1.1, estraverse@^4.2.0: +estraverse@^4.0.0, estraverse@^4.1.0, estraverse@^4.1.1: version "4.2.0" resolved "https://registry.yarnpkg.com/estraverse/-/estraverse-4.2.0.tgz#0dee3fed31fcd469618ce7342099fc1afa0bdb13" @@ -3025,7 +3025,11 @@ global-dirs@^0.1.0: dependencies: ini "^1.3.4" -globals@^9.17.0, globals@^9.18.0: +globals@^11.0.1: + version "11.3.0" + resolved "https://registry.yarnpkg.com/globals/-/globals-11.3.0.tgz#e04fdb7b9796d8adac9c8f64c14837b2313378b0" + +globals@^9.18.0: version "9.18.0" resolved "https://registry.yarnpkg.com/globals/-/globals-9.18.0.tgz#aa3896b3e69b487f17e31ed2143d69a8e30c2d8a" @@ -3779,6 +3783,10 @@ json-schema@0.2.3: version "0.2.3" resolved "https://registry.yarnpkg.com/json-schema/-/json-schema-0.2.3.tgz#b480c892e59a2f05954ce727bd3f2a4e882f9e13" +json-stable-stringify-without-jsonify@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/json-stable-stringify-without-jsonify/-/json-stable-stringify-without-jsonify-1.0.1.tgz#9db7b59496ad3f3cfef30a75142d2d930ad72651" + json-stable-stringify@^1.0.1: version "1.0.1" resolved "https://registry.yarnpkg.com/json-stable-stringify/-/json-stable-stringify-1.0.1.tgz#9a759d39c5f2ff503fd5300646ed445f88c4f9af" @@ -3824,7 +3832,7 @@ jsprim@^1.2.2: json-schema "0.2.3" verror "1.10.0" -jsx-ast-utils@^2.0.0: +jsx-ast-utils@^2.0.1: version "2.0.1" resolved "https://registry.yarnpkg.com/jsx-ast-utils/-/jsx-ast-utils-2.0.1.tgz#e801b1b39985e20fffc87b40e3748080e2dcac7f" dependencies: @@ -5148,14 +5156,6 @@ promise@^7.1.1: dependencies: asap "~2.0.3" -prop-types@^15.5.10: - version "15.6.1" - resolved "https://registry.yarnpkg.com/prop-types/-/prop-types-15.6.1.tgz#36644453564255ddda391191fb3a125cbdf654ca" - dependencies: - fbjs "^0.8.16" - loose-envify "^1.3.1" - object-assign "^4.1.1" - prop-types@^15.6.0: version "15.6.0" resolved "https://registry.yarnpkg.com/prop-types/-/prop-types-15.6.0.tgz#ceaf083022fc46b4a35f69e13ef75aed0d639856" @@ -6803,3 +6803,4 @@ zip-stream@^1.2.0: compress-commons "^1.2.0" lodash "^4.8.0" readable-stream "^2.0.0" + From b2dd9a5e018e3602adaaf60cfdbdbfe17722e589 Mon Sep 17 00:00:00 2001 From: Leo Lamprecht Date: Mon, 16 Apr 2018 07:23:37 -0700 Subject: [PATCH 09/15] Ensured they match exactly --- yarn.lock | 1 - 1 file changed, 1 deletion(-) diff --git a/yarn.lock b/yarn.lock index 82449ce3d5e6..b28c9b000ba0 100644 --- a/yarn.lock +++ b/yarn.lock @@ -6803,4 +6803,3 @@ zip-stream@^1.2.0: compress-commons "^1.2.0" lodash "^4.8.0" readable-stream "^2.0.0" - From f8a961eef6da40f4ec5282fec2c3bb3dc5a3b82b Mon Sep 17 00:00:00 2001 From: Leo Lamprecht Date: Mon, 16 Apr 2018 07:24:09 -0700 Subject: [PATCH 10/15] Reverted package version --- app/package.json | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/app/package.json b/app/package.json index 2b493555392d..92f26aa667b8 100644 --- a/app/package.json +++ b/app/package.json @@ -2,7 +2,7 @@ "name": "hyper", "productName": "Hyper", "description": "A terminal built on web technologies", - "version": "2.0.0-canary.17", + "version": "1.4.8", "license": "MIT", "author": { "name": "ZEIT, Inc.", From 4bff846ec0c1b5b2e3d8c6a14f411c785aa20b7c Mon Sep 17 00:00:00 2001 From: Leo Lamprecht Date: Mon, 16 Apr 2018 08:34:39 -0700 Subject: [PATCH 11/15] New timestamp server (#2825) * Replaced timestamp server * Added different server --- package.json | 3 ++- 1 file changed, 2 insertions(+), 1 deletion(-) diff --git a/package.json b/package.json index 8f11d9131217..dd367eb2f4d1 100644 --- a/package.json +++ b/package.json @@ -148,7 +148,8 @@ ] }, "win": { - "target": ["squirrel"] + "target": ["squirrel"], + "rfc3161TimeStampServer": "http://tsa.startssl.com/rfc3161" }, "mac": { "category": "public.app-category.developer-tools", From a4669beef6cad051f37a5a1f6b396112803c1266 Mon Sep 17 00:00:00 2001 From: Leo Lamprecht Date: Mon, 16 Apr 2018 08:36:26 -0700 Subject: [PATCH 12/15] 2.0.0 --- app/package.json | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/app/package.json b/app/package.json index 92f26aa667b8..318e69c280cb 100644 --- a/app/package.json +++ b/app/package.json @@ -2,7 +2,7 @@ "name": "hyper", "productName": "Hyper", "description": "A terminal built on web technologies", - "version": "1.4.8", + "version": "2.0.0", "license": "MIT", "author": { "name": "ZEIT, Inc.", From 204e23d79e6d89b23a82f6fe527a55866586d5c6 Mon Sep 17 00:00:00 2001 From: Timo Welde Date: Wed, 18 Apr 2018 12:28:02 +0200 Subject: [PATCH 13/15] Modules also need to be hijacked on the main process, so that plugins can load. --- app/plugins.js | 30 ++++++++++++++++++++++++++++++ 1 file changed, 30 insertions(+) diff --git a/app/plugins.js b/app/plugins.js index 0be9d458ebe6..c260b1c9930e 100644 --- a/app/plugins.js +++ b/app/plugins.js @@ -17,6 +17,8 @@ const cache = new Config(); const path = plugs.base; const localPath = plugs.local; +patchModuleLoad(); + // caches let plugins = config.getPlugins(); let paths = getPaths(); @@ -43,6 +45,34 @@ config.subscribe(() => { } }); +// patching Module._load +// so plugins can `require` them without needing their own version +// https://github.com/zeit/hyper/issues/619 +function patchModuleLoad() { + const React = require('react'); + const PureComponent = React.PureComponent; + const ReactDOM = require('react-dom'); + + const Module = require('module'); + const originalLoad = Module._load; + Module._load = function _load(modulePath) { + switch (modulePath) { + case 'react': + return React; + case 'react-dom': + return ReactDOM; + case 'hyper/component': + return PureComponent; + case 'hyper/Notification': + case 'hyper/notify': + case 'hyper/decorate': + return Object; + default: + return originalLoad.apply(this, arguments); + } + }; +} + function checkDeprecatedExtendKeymaps() { modules.forEach(plugin => { if (plugin.extendKeymaps) { From 0948c08cb57f08b1a13ad6b96230d8d6f83276e9 Mon Sep 17 00:00:00 2001 From: Timo Welde Date: Thu, 3 May 2018 12:27:22 +0200 Subject: [PATCH 14/15] Added comments for developer orientation --- app/plugins.js | 2 ++ lib/utils/plugins.js | 2 ++ 2 files changed, 4 insertions(+) diff --git a/app/plugins.js b/app/plugins.js index 813789e5b373..163fd1734184 100644 --- a/app/plugins.js +++ b/app/plugins.js @@ -56,6 +56,8 @@ function patchModuleLoad() { const Module = require('module'); const originalLoad = Module._load; Module._load = function _load(modulePath) { + // PLEASE NOTE: Code changes here, also need to be changed in + // lib/utils/plugins.js switch (modulePath) { case 'react': return React; diff --git a/lib/utils/plugins.js b/lib/utils/plugins.js index 71700f0e7f1e..8400db11c49e 100644 --- a/lib/utils/plugins.js +++ b/lib/utils/plugins.js @@ -14,6 +14,8 @@ import notify from './notify'; const Module = require('module'); const originalLoad = Module._load; Module._load = function _load(path) { + // PLEASE NOTE: Code changes here, also need to be changed in + // app/plugins.js switch (path) { case 'react': return React; From 35d50eb52376a4f63c2d43b1afeff34169edbf2f Mon Sep 17 00:00:00 2001 From: Timo Welde Date: Thu, 3 May 2018 12:29:21 +0200 Subject: [PATCH 15/15] Added another comment --- app/plugins.js | 2 ++ 1 file changed, 2 insertions(+) diff --git a/app/plugins.js b/app/plugins.js index 163fd1734184..c3f5c42148cf 100644 --- a/app/plugins.js +++ b/app/plugins.js @@ -65,6 +65,8 @@ function patchModuleLoad() { return ReactDOM; case 'hyper/component': return PureComponent; + // These return Object, since they work differently on the backend, than on the frontend. + // Still needs to be here, to prevent errors, while loading plugins. case 'hyper/Notification': case 'hyper/notify': case 'hyper/decorate':